Wikipedia
scowiki
https://sco.wikipedia.org/wiki/Main_Page
MediaWiki 1.44.0-wmf.8
first-letter
Media
Special
Collogue
Uiser
Uiser collogue
Wikipedia
Wikipedia collogue
File
File collogue
MediaWiki
MediaWiki collogue
Template
Template collogue
Help
Help collogue
Category
Category collogue
Portal
Portal talk
Define
Define talk
TimedText
TimedText talk
Module
Module talk
Karl Marx
0
1704
901713
901620
2025-01-04T11:22:22Z
RabbieBurnsGhost
114955
Chynged spellins of London to Lunnon
901713
wikitext
text/x-wiki
{{Short description| German Philosopher}}
{{Infobox person
| name = Karl Marx
| honorific_suffix = {{postnominals|country=GBR|size=100%|FRSA}}<ref>{{Cite web |title=Letter from Karl Marx accepting membership of the Society 1862 |url=http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |url-status=live |archive-url=https://web.archive.org/web/20180416202116/http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |archive-date=16 April 2018 |access-date=19 August 2022 |website=[[Royal Society of Arts]]}}</ref>
| image = Karl Marx 001 (rotated).jpg
| alt =
| caption = Marx in 1875
| birth_name = Karl Marx{{efn|name=name|His name was spelled ''Carl Marx'' in the birth register of [[Trier]] and he occasionally used this spelling in official contexts up to the 1840s. His full name is sometimes given as ''Karl Heinrich Marx'', but he never officially had a middle name, using the forms ''Karl Heinrich'' or ''Carl Heinrich'' (with his father's first name added after his own) only several times as a student.{{sfn|Heinrich|2019|pp=34–35}}}}
| birth_date = {{Birth date|df=y|1818|5|5}}
| birth_place = [[Trier]], [[Kinrick o Proushie]], [[German Confederation]]
| death_date = {{Death date and age|df=y|1883|3|14|1818|5|5}}
| death_place = Lunnon, England
| burial_place = [[Tomb of Karl Marx]]
| nationality = {{Plainlist|
* [[Prussia|Prussian]] (1818–1845)
* [[Statelessness|Stateless]] (after 1845)
}}
| education = {{Plainlist|
* [[Varsity of Bonn]]
* [[Varsity of Berlin]]
* [[Varsity of Jena]] (PhD, 1841)
}}
| spouse = {{Marriage|[[Jenny von Westphalen]]|19 June 1843|2 December 1881|end=died}}
| children = At least 7,<ref name=PadoverXXV>{{cite book |editor-first=Saul |editor-last=Padover |editor-link=Saul K. Padover |chapter=Introduction: Marx, the Human Side |title=Karl Marx on Education, Women, and Children |location=New York |publisher=[[McGraw Hill]] |date=1975 |page=xxv}}</ref> including [[Jenny Longuet|Jenny]], [[Laura Marx|Laura]] and [[Eleanor Marx|Eleanor]]
| father = [[Heinrich Marx]]
| mother = [[Henriette Pressburg]]
| relatives = {{Plainlist|
* [[Louise Juta]] (sister)
* [[Edgar Longuet]] (grandson)
* [[Jean Longuet]] (grandson)
* [[Henry Juta]] (nephew)
* [[Frederik Philips]] (cousin)
}}
| module = {{Infobox philosopher|embed=yes
| era = [[19t-century philosophy]]
| region = [[Westren philosophy]]
| school_tradition = {{hlist|[[Continental philosophy]]|[[Marxism]]}}
| thesis_title = [[The Difference Between the Democritean and Epicurean Philosophy of Nature]]
| thesis_year = 1841
| doctoral_advisor = [[Bruno Bauer]]
| main_interests = {{hlist|Philosophy|economics|history|politics}}
| notable_ideas = {{Plainlist|
* [[:Template:Marxism|Marxist terminology]]
* [[Value form]]
* Contributions to [[Dialectical materialism|dialectics]] and the [[Marxian critique of political economy]]
* [[Class conflict]]
* [[Marx's theory of alienation|Alienation]] and [[Exploitation of labour|exploitation]] of the worker
* [[historical materialism|Materialist conception of history]]
}}
}}
| signature = Karl Marx Signature.svg
| signature_alt =
}}
'''Karl Marx''' ([[5 Mey|5t Mey]] [[1818]] in [[Trier]], [[Germany]] – [[14 Mairch|14t Mairch]] [[1883]] in [[Lunnon]], [[UK]]) wis a [[Germany|German]] [[Philosophie|philosopher]] and poleitical thinker that wrat aboot [[economics]] an [[politics]]. Ane o his first beuks wis the ''[[Communist Manifesto]]'', written thegither wi [[Friedrich Engels]] in [[1848]]. In this beuk thay set oot the ideas an ettles o the [[Communism|Communist]] muvement for the first time. His theories wis gien the name [[Marxism]] efterhaund, baith bi thaim that gree'd wi him an thaim that criticeesed him.
His maist important contreibution is thocht tae be his beuk ''[[Das Kapital]]'' that wis written ower monie decades; in it he analeesed and criticeesed the system of [[Caipitalism]]. For the maist pairt it disagreed wi [[leiberal]] economic views an haes led tae gran debates atween its supporters an detractors. Juist the ae volume haed been feenisht bi the time Marx dee'd; Engels teuk his jots an completit twa mair volumes.
Born in [[Trier]] in the [[Kinrick o Proushie]], Marx started his studies at the universities o Bonn, Berlin, an Jena, gettin his doctorate in philosophy frae Jena in 1841. He was a Young Hegelian, influencet by the works o [[Georg Wilhelm Friedrich Hegel]], an in his ain works, like ''The German Ideology'' an the ''Grundrisse'', he both critiqued an developed Hegel’s ideas. While in Paris in 1844, Marx wrote his ''Economic and Philosophic Manuscripts'' an met Engels, wha became his closest friend an collaborator. After muivin tae Brussels in 1845, the pair were active in the Communist League, an by 1848, they wrote ''The Communist Manifesto'', a pamphlet layin oot Marx's thoughts an a plan for revolution. After bein expelled from Belgium an Germany, Marx made his way tae [[Lunnon]] in 1849, whaur he penned ''The Eighteenth Brumaire of Louis Bonaparte'' an ''Das Kapital''. In 1864, Marx got involved in the International Workingmen's Association (First International), where he took on the [[Anarchism|anarchists]] led by Mikhail Bakunin. In his ''Critique of the Gotha Programme'' (1875), he laid doon his thoughts on revolution, the state, an the road tae communism. Marx passed away stateless in 1883 an was buried in Highgate Cemetery.
{{Commons|Karl Marx}}
{{Commonscat}}
{{DEFAULTSORT:Marx, Karl}}
[[Category:Karl Marx| ]]
[[Category:1818 births]]
[[Category:1883 daiths]]
[[Category:19t-century philosophers]]
[[Category:19t-century Proushie fowk]]
[[Category:19t-century jurnalists]]
[[Category:19t-century economists]]
[[Category:19t-century German writers]]
[[Category:Victorian writers]]
[[Category:Ashkenazi Jews]]
[[Category:Atheist filosofers]]
[[Category:Buirials at Highgate Seemetry]]
[[Category:Creetics o releegions]]
[[Category:Economic historians]]
[[Category:Umwhile Lutherans]]
[[Category:German atheists]]
[[Category:German communists]]
[[Category:German economists]]
[[Category:German emigrants tae the Unitit Kinrick]]
[[Category:German historians]]
[[Category:German Jews]]
[[Category:German philosophers]]
[[Category:German revolutionaries]]
[[Category:German socialists]]
[[Category:German sociologists]]
[[Category:German tax resisters]]
[[Category:Historians o economic thocht]]
[[Category:Jewish atheists]]
[[Category:Marxian economists|*]]
[[Category:Marxist historians|*]]
[[Category:Marxist jurnalists|*]]
[[Category:Marxist theorists| ]]
[[Category:Marxists| ]]
[[Category:Materialists]]
[[Category:Members o the Internaitional Workingmen's Association]]
[[Category:Fowk frae the Rhine Province]]
[[Category:Fowk frae Trier]]
[[Category:Fowk associatit wi the Ryal Society o Airts]]
[[Category:Poleetical economy]]
[[Category:Poleetical filosofers]]
[[Category:Social philosophers]]
[[Category:Stateless fowk]]
[[Category:Writers aboot globalisation]]
[[Category:Varsity o Bonn alumni]]
[[Category:Humboldt Varsity o Berlin alumni]]
[[Category:Varsity o Jena alumni]]
{{Stub/Germany}}
<references />
os4kzsnhy8yzmvnsj10j9p11v3jpb1g
901714
901713
2025-01-04T11:26:30Z
RabbieBurnsGhost
114955
901714
wikitext
text/x-wiki
{{Short description| German Philosopher}}
{{Infobox person
| name = Karl Marx
| honorific_suffix = {{postnominals|country=GBR|size=100%|FRSA}}
| image = Karl Marx 001 (rotated).jpg
| alt =
| caption = Marx in 1875
| birth_name = Karl Marx{{efn|name=name|His name was spelled ''Carl Marx'' in the birth register of [[Trier]] and he occasionally used this spelling in official contexts up to the 1840s. His full name is sometimes given as ''Karl Heinrich Marx'', but he never officially had a middle name, using the forms ''Karl Heinrich'' or ''Carl Heinrich'' (with his father's first name added after his own) only several times as a student.{{sfn|Heinrich|2019|pp=34–35}}}}
| birth_date = {{Birth date|df=y|1818|5|5}}
| birth_place = [[Trier]], [[Kinrick o Proushie]], [[German Confederation]]
| death_date = {{Death date and age|df=y|1883|3|14|1818|5|5}}
| death_place = Lunnon, England
| burial_place = [[Tomb of Karl Marx]]
| nationality = {{Plainlist|
* [[Prussia|Prussian]] (1818–1845)
* [[Statelessness|Stateless]] (after 1845)
}}
| education = {{Plainlist|
* [[Varsity of Bonn]]
* [[Varsity of Berlin]]
* [[Varsity of Jena]] (PhD, 1841)
}}
| spouse = {{Marriage|[[Jenny von Westphalen]]|19 June 1843|2 December 1881|end=died}}
| children = At least 7,<ref name=PadoverXXV>{{cite book |editor-first=Saul |editor-last=Padover |editor-link=Saul K. Padover |chapter=Introduction: Marx, the Human Side |title=Karl Marx on Education, Women, and Children |location=New York |publisher=[[McGraw Hill]] |date=1975 |page=xxv}}</ref> including [[Jenny Longuet|Jenny]], [[Laura Marx|Laura]] and [[Eleanor Marx|Eleanor]]
| father = [[Heinrich Marx]]
| mother = [[Henriette Pressburg]]
| relatives = {{Plainlist|
* [[Louise Juta]] (sister)
* [[Edgar Longuet]] (grandson)
* [[Jean Longuet]] (grandson)
* [[Henry Juta]] (nephew)
* [[Frederik Philips]] (cousin)
}}
| module = {{Infobox philosopher|embed=yes
| era = [[19t-century philosophy]]
| region = [[Westren philosophy]]
| school_tradition = {{hlist|[[Continental philosophy]]|[[Marxism]]}}
| thesis_title = [[The Difference Between the Democritean and Epicurean Philosophy of Nature]]
| thesis_year = 1841
| doctoral_advisor = [[Bruno Bauer]]
| main_interests = {{hlist|Philosophy|economics|history|politics}}
| notable_ideas = {{Plainlist|
* [[:Template:Marxism|Marxist terminology]]
* [[Value form]]
* Contributions to [[Dialectical materialism|dialectics]] and the [[Marxian critique of political economy]]
* [[Class conflict]]
* [[Marx's theory of alienation|Alienation]] and [[Exploitation of labour|exploitation]] of the worker
* [[historical materialism|Materialist conception of history]]
}}
}}
| signature = Karl Marx Signature.svg
| signature_alt =
}}
'''Karl Marx''' ([[5 Mey|5t Mey]] [[1818]] in [[Trier]], [[Germany]] – [[14 Mairch|14t Mairch]] [[1883]] in [[Lunnon]], [[UK]]) wis a [[Germany|German]] [[Philosophie|philosopher]] and poleitical thinker that wrat aboot [[economics]] an [[politics]]. Ane o his first beuks wis the ''[[Communist Manifesto]]'', written thegither wi [[Friedrich Engels]] in [[1848]]. In this beuk thay set oot the ideas an ettles o the [[Communism|Communist]] muvement for the first time. His theories wis gien the name [[Marxism]] efterhaund, baith bi thaim that gree'd wi him an thaim that criticeesed him.
His maist important contreibution is thocht tae be his beuk ''[[Das Kapital]]'' that wis written ower monie decades; in it he analeesed and criticeesed the system of [[Caipitalism]]. For the maist pairt it disagreed wi [[leiberal]] economic views an haes led tae gran debates atween its supporters an detractors. Juist the ae volume haed been feenisht bi the time Marx dee'd; Engels teuk his jots an completit twa mair volumes.
Born in [[Trier]] in the [[Kinrick o Proushie]], Marx started his studies at the universities o Bonn, Berlin, an Jena, gettin his doctorate in philosophy frae Jena in 1841. He was a Young Hegelian, influencet by the works o [[Georg Wilhelm Friedrich Hegel]], an in his ain works, like ''The German Ideology'' an the ''Grundrisse'', he both critiqued an developed Hegel’s ideas. While in Paris in 1844, Marx wrote his ''Economic and Philosophic Manuscripts'' an met Engels, wha became his closest friend an collaborator. After muivin tae Brussels in 1845, the pair were active in the Communist League, an by 1848, they wrote ''The Communist Manifesto'', a pamphlet layin oot Marx's thoughts an a plan for revolution. After bein expelled from Belgium an Germany, Marx made his way tae [[Lunnon]] in 1849, whaur he penned ''The Eighteenth Brumaire of Louis Bonaparte'' an ''Das Kapital''. In 1864, Marx got involved in the International Workingmen's Association (First International), where he took on the [[Anarchism|anarchists]] led by Mikhail Bakunin. In his ''Critique of the Gotha Programme'' (1875), he laid doon his thoughts on revolution, the state, an the road tae communism. Marx passed away stateless in 1883 an was buried in Highgate Cemetery.
{{Commons|Karl Marx}}
{{Commonscat}}
{{DEFAULTSORT:Marx, Karl}}
[[Category:Karl Marx| ]]
[[Category:1818 births]]
[[Category:1883 daiths]]
[[Category:19t-century philosophers]]
[[Category:19t-century Proushie fowk]]
[[Category:19t-century jurnalists]]
[[Category:19t-century economists]]
[[Category:19t-century German writers]]
[[Category:Victorian writers]]
[[Category:Ashkenazi Jews]]
[[Category:Atheist filosofers]]
[[Category:Buirials at Highgate Seemetry]]
[[Category:Creetics o releegions]]
[[Category:Economic historians]]
[[Category:Umwhile Lutherans]]
[[Category:German atheists]]
[[Category:German communists]]
[[Category:German economists]]
[[Category:German emigrants tae the Unitit Kinrick]]
[[Category:German historians]]
[[Category:German Jews]]
[[Category:German philosophers]]
[[Category:German revolutionaries]]
[[Category:German socialists]]
[[Category:German sociologists]]
[[Category:German tax resisters]]
[[Category:Historians o economic thocht]]
[[Category:Jewish atheists]]
[[Category:Marxian economists|*]]
[[Category:Marxist historians|*]]
[[Category:Marxist jurnalists|*]]
[[Category:Marxist theorists| ]]
[[Category:Marxists| ]]
[[Category:Materialists]]
[[Category:Members o the Internaitional Workingmen's Association]]
[[Category:Fowk frae the Rhine Province]]
[[Category:Fowk frae Trier]]
[[Category:Fowk associatit wi the Ryal Society o Airts]]
[[Category:Poleetical economy]]
[[Category:Poleetical filosofers]]
[[Category:Social philosophers]]
[[Category:Stateless fowk]]
[[Category:Writers aboot globalisation]]
[[Category:Varsity o Bonn alumni]]
[[Category:Humboldt Varsity o Berlin alumni]]
[[Category:Varsity o Jena alumni]]
{{Stub/Germany}}
<references />
cee511fvhlb005wntbpgtspmybea4ly
901715
901714
2025-01-04T11:28:35Z
RabbieBurnsGhost
114955
Took oot the href error. will fix in time
901715
wikitext
text/x-wiki
{{Short description| German Philosopher}}
{{Infobox person
| name = Karl Marx
| honorific_suffix = {{postnominals|country=GBR|size=100%|FRSA}}<ref>{{Cite web |title=Letter from Karl Marx accepting membership of the Society 1862 |url=http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |url-status=live |archive-url=https://web.archive.org/web/20180416202116/http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |archive-date=16 April 2018 |access-date=19 August 2022 |website=[[Royal Society of Arts]]}}</ref>
| image = Karl Marx 001 (rotated).jpg
| alt =
| caption = Marx in 1875
| birth_name = Karl Marx
| birth_date = {{Birth date|df=y|1818|5|5}}
| birth_place = [[Trier]], [[Kinrick o Proushie]], [[German Confederation]]
| death_date = {{Death date and age|df=y|1883|3|14|1818|5|5}}
| death_place = Lunnon, England
| burial_place = [[Tomb of Karl Marx]]
| nationality = {{Plainlist|
* [[Prussia|Prussian]] (1818–1845)
* [[Statelessness|Stateless]] (after 1845)
}}
| education = {{Plainlist|
* [[Varsity of Bonn]]
* [[Varsity of Berlin]]
* [[Varsity of Jena]] (PhD, 1841)
}}
| spouse = {{Marriage|[[Jenny von Westphalen]]|19 June 1843|2 December 1881|end=died}}
| children = At least 7,<ref name=PadoverXXV>{{cite book |editor-first=Saul |editor-last=Padover |editor-link=Saul K. Padover |chapter=Introduction: Marx, the Human Side |title=Karl Marx on Education, Women, and Children |location=New York |publisher=[[McGraw Hill]] |date=1975 |page=xxv}}</ref> including [[Jenny Longuet|Jenny]], [[Laura Marx|Laura]] and [[Eleanor Marx|Eleanor]]
| father = [[Heinrich Marx]]
| mother = [[Henriette Pressburg]]
| relatives = {{Plainlist|
* [[Louise Juta]] (sister)
* [[Edgar Longuet]] (grandson)
* [[Jean Longuet]] (grandson)
* [[Henry Juta]] (nephew)
* [[Frederik Philips]] (cousin)
}}
| module = {{Infobox philosopher|embed=yes
| era = [[19t-century philosophy]]
| region = [[Westren philosophy]]
| school_tradition = {{hlist|[[Continental philosophy]]|[[Marxism]]}}
| thesis_title = [[The Difference Between the Democritean and Epicurean Philosophy of Nature]]
| thesis_year = 1841
| doctoral_advisor = [[Bruno Bauer]]
| main_interests = {{hlist|Philosophy|economics|history|politics}}
| notable_ideas = {{Plainlist|
* [[:Template:Marxism|Marxist terminology]]
* [[Value form]]
* Contributions to [[Dialectical materialism|dialectics]] and the [[Marxian critique of political economy]]
* [[Class conflict]]
* [[Marx's theory of alienation|Alienation]] and [[Exploitation of labour|exploitation]] of the worker
* [[historical materialism|Materialist conception of history]]
}}
}}
| signature = Karl Marx Signature.svg
| signature_alt =
}}
'''Karl Marx''' ([[5 Mey|5t Mey]] [[1818]] in [[Trier]], [[Germany]] – [[14 Mairch|14t Mairch]] [[1883]] in [[Lunnon]], [[UK]]) wis a [[Germany|German]] [[Philosophie|philosopher]] and poleitical thinker that wrat aboot [[economics]] an [[politics]]. Ane o his first beuks wis the ''[[Communist Manifesto]]'', written thegither wi [[Friedrich Engels]] in [[1848]]. In this beuk thay set oot the ideas an ettles o the [[Communism|Communist]] muvement for the first time. His theories wis gien the name [[Marxism]] efterhaund, baith bi thaim that gree'd wi him an thaim that criticeesed him.
His maist important contreibution is thocht tae be his beuk ''[[Das Kapital]]'' that wis written ower monie decades; in it he analeesed and criticeesed the system of [[Caipitalism]]. For the maist pairt it disagreed wi [[leiberal]] economic views an haes led tae gran debates atween its supporters an detractors. Juist the ae volume haed been feenisht bi the time Marx dee'd; Engels teuk his jots an completit twa mair volumes.
Born in [[Trier]] in the [[Kinrick o Proushie]], Marx started his studies at the universities o Bonn, Berlin, an Jena, gettin his doctorate in philosophy frae Jena in 1841. He was a Young Hegelian, influencet by the works o [[Georg Wilhelm Friedrich Hegel]], an in his ain works, like ''The German Ideology'' an the ''Grundrisse'', he both critiqued an developed Hegel’s ideas. While in Paris in 1844, Marx wrote his ''Economic and Philosophic Manuscripts'' an met Engels, wha became his closest friend an collaborator. After muivin tae Brussels in 1845, the pair were active in the Communist League, an by 1848, they wrote ''The Communist Manifesto'', a pamphlet layin oot Marx's thoughts an a plan for revolution. After bein expelled from Belgium an Germany, Marx made his way tae [[Lunnon]] in 1849, whaur he penned ''The Eighteenth Brumaire of Louis Bonaparte'' an ''Das Kapital''. In 1864, Marx got involved in the International Workingmen's Association (First International), where he took on the [[Anarchism|anarchists]] led by Mikhail Bakunin. In his ''Critique of the Gotha Programme'' (1875), he laid doon his thoughts on revolution, the state, an the road tae communism. Marx passed away stateless in 1883 an was buried in Highgate Cemetery.
{{Commons|Karl Marx}}
{{Commonscat}}
{{DEFAULTSORT:Marx, Karl}}
[[Category:Karl Marx| ]]
[[Category:1818 births]]
[[Category:1883 daiths]]
[[Category:19t-century philosophers]]
[[Category:19t-century Proushie fowk]]
[[Category:19t-century jurnalists]]
[[Category:19t-century economists]]
[[Category:19t-century German writers]]
[[Category:Victorian writers]]
[[Category:Ashkenazi Jews]]
[[Category:Atheist filosofers]]
[[Category:Buirials at Highgate Seemetry]]
[[Category:Creetics o releegions]]
[[Category:Economic historians]]
[[Category:Umwhile Lutherans]]
[[Category:German atheists]]
[[Category:German communists]]
[[Category:German economists]]
[[Category:German emigrants tae the Unitit Kinrick]]
[[Category:German historians]]
[[Category:German Jews]]
[[Category:German philosophers]]
[[Category:German revolutionaries]]
[[Category:German socialists]]
[[Category:German sociologists]]
[[Category:German tax resisters]]
[[Category:Historians o economic thocht]]
[[Category:Jewish atheists]]
[[Category:Marxian economists|*]]
[[Category:Marxist historians|*]]
[[Category:Marxist jurnalists|*]]
[[Category:Marxist theorists| ]]
[[Category:Marxists| ]]
[[Category:Materialists]]
[[Category:Members o the Internaitional Workingmen's Association]]
[[Category:Fowk frae the Rhine Province]]
[[Category:Fowk frae Trier]]
[[Category:Fowk associatit wi the Ryal Society o Airts]]
[[Category:Poleetical economy]]
[[Category:Poleetical filosofers]]
[[Category:Social philosophers]]
[[Category:Stateless fowk]]
[[Category:Writers aboot globalisation]]
[[Category:Varsity o Bonn alumni]]
[[Category:Humboldt Varsity o Berlin alumni]]
[[Category:Varsity o Jena alumni]]
{{Stub/Germany}}
<references />
iemd0u2v4oytxf5i2j1tnyedtci63bt
901716
901715
2025-01-04T11:48:19Z
RabbieBurnsGhost
114955
901716
wikitext
text/x-wiki
{{Short description| German Philosopher}}
{{Infobox person
| name = Karl Marx
| honorific_suffix = {{postnominals|country=GBR|size=100%|FRSA}}<ref>{{Cite web |title=Letter from Karl Marx accepting membership of the Society 1862 |url=http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |url-status=live |archive-url=https://web.archive.org/web/20180416202116/http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |archive-date=16 April 2018 |access-date=19 August 2022 |website=[[Royal Society of Arts]]}}</ref>
| image = Karl Marx 001 (rotated).jpg
| alt =
| caption = Marx in 1875
| birth_name = Karl Marx{{efn|name=name|His name was spelled ''Carl Marx'' in the birth register of [[Trier]] and he occasionally used this spelling in official contexts up to the 1840s. His full name is sometimes given as ''Karl Heinrich Marx'', but he never officially had a middle name, using the forms ''Karl Heinrich'' or ''Carl Heinrich'' (with his father's first name added after his own) only several times as a student.}}
| birth_date = {{Birth date|df=y|1818|5|5}}
| birth_place = [[Trier]], [[Kinrick o Proushie]], [[German Confederation]]
| death_date = {{Death date and age|df=y|1883|3|14|1818|5|5}}
| death_place = Lunnon, England
| burial_place = [[Tomb of Karl Marx]]
| nationality = {{Plainlist|
* [[Prussia|Prussian]] (1818–1845)
* [[Statelessness|Stateless]] (after 1845)
}}
| education = {{Plainlist|
* [[Varsity of Bonn]]
* [[Varsity of Berlin]]
* [[Varsity of Jena]] (PhD, 1841)
}}
| spouse = {{Marriage|[[Jenny von Westphalen]]|19 June 1843|2 December 1881|end=died}}
| children = At least 7,<ref name=PadoverXXV>{{cite book |editor-first=Saul |editor-last=Padover |editor-link=Saul K. Padover |chapter=Introduction: Marx, the Human Side |title=Karl Marx on Education, Women, and Children |location=New York |publisher=[[McGraw Hill]] |date=1975 |page=xxv}}</ref> including [[Jenny Longuet|Jenny]], [[Laura Marx|Laura]] and [[Eleanor Marx|Eleanor]]
| father = [[Heinrich Marx]]
| mother = [[Henriette Pressburg]]
| relatives = {{Plainlist|
* [[Louise Juta]] (sister)
* [[Edgar Longuet]] (grandson)
* [[Jean Longuet]] (grandson)
* [[Henry Juta]] (nephew)
* [[Frederik Philips]] (cousin)
}}
| module = {{Infobox philosopher|embed=yes
| era = [[19t-century philosophy]]
| region = [[Westren philosophy]]
| school_tradition = {{hlist|[[Continental philosophy]]|[[Marxism]]}}
| thesis_title = [[The Difference Between the Democritean and Epicurean Philosophy of Nature]]
| thesis_year = 1841
| doctoral_advisor = [[Bruno Bauer]]
| main_interests = {{hlist|Philosophy|economics|history|politics}}
| notable_ideas = {{Plainlist|
* [[:Template:Marxism|Marxist terminology]]
* [[Value form]]
* Contributions to [[Dialectical materialism|dialectics]] and the [[Marxian critique of political economy]]
* [[Class conflict]]
* [[Marx's theory of alienation|Alienation]] and [[Exploitation of labour|exploitation]] of the worker
* [[historical materialism|Materialist conception of history]]
}}
}}
| signature = Karl Marx Signature.svg
| signature_alt =
}}
'''Karl Marx''' ([[5 Mey|5t Mey]] [[1818]] in [[Trier]], [[Germany]] – [[14 Mairch|14t Mairch]] [[1883]] in [[Lunnon]], [[UK]]) wis a [[Germany|German]] [[Philosophie|philosopher]] and poleitical thinker that wrat aboot [[economics]] an [[politics]]. Ane o his first beuks wis the ''[[Communist Manifesto]]'', written thegither wi [[Friedrich Engels]] in [[1848]]. In this beuk thay set oot the ideas an ettles o the [[Communism|Communist]] muvement for the first time. His theories wis gien the name [[Marxism]] efterhaund, baith bi thaim that gree'd wi him an thaim that criticeesed him.
His maist important contreibution is thocht tae be his beuk ''[[Das Kapital]]'' that wis written ower monie decades; in it he analeesed and criticeesed the system of [[Caipitalism]]. For the maist pairt it disagreed wi [[leiberal]] economic views an haes led tae gran debates atween its supporters an detractors. Juist the ae volume haed been feenisht bi the time Marx dee'd; Engels teuk his jots an completit twa mair volumes.
Born in [[Trier]] in the [[Kinrick o Proushie]], Marx started his studies at the universities o Bonn, Berlin, an Jena, gettin his doctorate in philosophy frae Jena in 1841. He was a Young Hegelian, influencet by the works o [[Georg Wilhelm Friedrich Hegel]], an in his ain works, like ''The German Ideology'' an the ''Grundrisse'', he both critiqued an developed Hegel’s ideas. While in Paris in 1844, Marx wrote his ''Economic and Philosophic Manuscripts'' an met Engels, wha became his closest friend an collaborator. After muivin tae Brussels in 1845, the pair were active in the Communist League, an by 1848, they wrote ''The Communist Manifesto'', a pamphlet layin oot Marx's thoughts an a plan for revolution. After bein expelled from Belgium an Germany, Marx made his way tae [[Lunnon]] in 1849, whaur he penned ''The Eighteenth Brumaire of Louis Bonaparte'' an ''Das Kapital''. In 1864, Marx got involved in the International Workingmen's Association (First International), where he took on the [[Anarchism|anarchists]] led by Mikhail Bakunin. In his ''Critique of the Gotha Programme'' (1875), he laid doon his thoughts on revolution, the state, an the road tae communism. Marx passed away stateless in 1883 an was buried in Highgate Cemetery.
{{Commons|Karl Marx}}
{{Commonscat}}
{{DEFAULTSORT:Marx, Karl}}
[[Category:Karl Marx| ]]
[[Category:1818 births]]
[[Category:1883 daiths]]
[[Category:19t-century philosophers]]
[[Category:19t-century Proushie fowk]]
[[Category:19t-century jurnalists]]
[[Category:19t-century economists]]
[[Category:19t-century German writers]]
[[Category:Victorian writers]]
[[Category:Ashkenazi Jews]]
[[Category:Atheist filosofers]]
[[Category:Buirials at Highgate Seemetry]]
[[Category:Creetics o releegions]]
[[Category:Economic historians]]
[[Category:Umwhile Lutherans]]
[[Category:German atheists]]
[[Category:German communists]]
[[Category:German economists]]
[[Category:German emigrants tae the Unitit Kinrick]]
[[Category:German historians]]
[[Category:German Jews]]
[[Category:German philosophers]]
[[Category:German revolutionaries]]
[[Category:German socialists]]
[[Category:German sociologists]]
[[Category:German tax resisters]]
[[Category:Historians o economic thocht]]
[[Category:Jewish atheists]]
[[Category:Marxian economists|*]]
[[Category:Marxist historians|*]]
[[Category:Marxist jurnalists|*]]
[[Category:Marxist theorists| ]]
[[Category:Marxists| ]]
[[Category:Materialists]]
[[Category:Members o the Internaitional Workingmen's Association]]
[[Category:Fowk frae the Rhine Province]]
[[Category:Fowk frae Trier]]
[[Category:Fowk associatit wi the Ryal Society o Airts]]
[[Category:Poleetical economy]]
[[Category:Poleetical filosofers]]
[[Category:Social philosophers]]
[[Category:Stateless fowk]]
[[Category:Writers aboot globalisation]]
[[Category:Varsity o Bonn alumni]]
[[Category:Humboldt Varsity o Berlin alumni]]
[[Category:Varsity o Jena alumni]]
{{Stub/Germany}}
<references />
m77ioniz7g2xfzelrua8o2mzml1gd6j
901717
901716
2025-01-04T11:58:26Z
RabbieBurnsGhost
114955
Fixed the Footnote
901717
wikitext
text/x-wiki
{{Short description| German Philosopher}}
{{Infobox person
| name = Karl Marx
| honorific_suffix = {{postnominals|country=GBR|size=100%|FRSA}}<ref>{{Cite web |title=Letter from Karl Marx accepting membership of the Society 1862 |url=http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |url-status=live |archive-url=https://web.archive.org/web/20180416202116/http://www.calmview2.eu/RSA/CalmViewA/Record.aspx?src=CalmView.Catalog&id=RSA%2fSC%2fIM%2f701%2fS1000&pos=9 |archive-date=16 April 2018 |access-date=19 August 2022 |website=[[Royal Society of Arts]]}}</ref>
| image = Karl Marx 001 (rotated).jpg
| alt =
| caption = Marx in 1875
| birth_name = Karl Marx{{efn|name=name|His name was spelled ''Carl Marx'' in the birth register of [[Trier]] and he occasionally used this spelling in official contexts up to the 1840s. His full name is sometimes given as ''Karl Heinrich Marx'', but he never officially had a middle name, using the forms ''Karl Heinrich'' or ''Carl Heinrich'' (with his father's first name added after his own) only several times as a student.}}
| birth_date = {{Birth date|df=y|1818|5|5}}
| birth_place = [[Trier]], [[Kinrick o Proushie]], [[German Confederation]]
| death_date = {{Death date and age|df=y|1883|3|14|1818|5|5}}
| death_place = Lunnon, England
| burial_place = [[Tomb of Karl Marx]]
| nationality = {{Plainlist|
* [[Prussia|Prussian]] (1818–1845)
* [[Statelessness|Stateless]] (after 1845)
}}
| education = {{Plainlist|
* [[Varsity of Bonn]]
* [[Varsity of Berlin]]
* [[Varsity of Jena]] (PhD, 1841)
}}
| spouse = {{Marriage|[[Jenny von Westphalen]]|19 June 1843|2 December 1881|end=died}}
| children = At least 7,<ref name=PadoverXXV>{{cite book |editor-first=Saul |editor-last=Padover |editor-link=Saul K. Padover |chapter=Introduction: Marx, the Human Side |title=Karl Marx on Education, Women, and Children |location=New York |publisher=[[McGraw Hill]] |date=1975 |page=xxv}}</ref> including [[Jenny Longuet|Jenny]], [[Laura Marx|Laura]] and [[Eleanor Marx|Eleanor]]
| father = [[Heinrich Marx]]
| mother = [[Henriette Pressburg]]
| relatives = {{Plainlist|
* [[Louise Juta]] (sister)
* [[Edgar Longuet]] (grandson)
* [[Jean Longuet]] (grandson)
* [[Henry Juta]] (nephew)
* [[Frederik Philips]] (cousin)
}}
| module = {{Infobox philosopher|embed=yes
| era = [[19t-century philosophy]]
| region = [[Westren philosophy]]
| school_tradition = {{hlist|[[Continental philosophy]]|[[Marxism]]}}
| thesis_title = [[The Difference Between the Democritean and Epicurean Philosophy of Nature]]
| thesis_year = 1841
| doctoral_advisor = [[Bruno Bauer]]
| main_interests = {{hlist|Philosophy|economics|history|politics}}
| notable_ideas = {{Plainlist|
* [[:Template:Marxism|Marxist terminology]]
* [[Value form]]
* Contributions to [[Dialectical materialism|dialectics]] and the [[Marxian critique of political economy]]
* [[Class conflict]]
* [[Marx's theory of alienation|Alienation]] and [[Exploitation of labour|exploitation]] of the worker
* [[historical materialism|Materialist conception of history]]
}}
}}
| signature = Karl Marx Signature.svg
| signature_alt =
}}
'''Karl Marx''' ([[5 Mey|5t Mey]] [[1818]] in [[Trier]], [[Germany]] – [[14 Mairch|14t Mairch]] [[1883]] in [[Lunnon]], [[UK]]) wis a [[Germany|German]] [[Philosophie|philosopher]] and poleitical thinker that wrat aboot [[economics]] an [[politics]]. Ane o his first beuks wis the ''[[Communist Manifesto]]'', written thegither wi [[Friedrich Engels]] in [[1848]]. In this beuk thay set oot the ideas an ettles o the [[Communism|Communist]] muvement for the first time. His theories wis gien the name [[Marxism]] efterhaund, baith bi thaim that gree'd wi him an thaim that criticeesed him.
His maist important contreibution is thocht tae be his beuk ''[[Das Kapital]]'' that wis written ower monie decades; in it he analeesed and criticeesed the system of [[Caipitalism]]. For the maist pairt it disagreed wi [[leiberal]] economic views an haes led tae gran debates atween its supporters an detractors. Juist the ae volume haed been feenisht bi the time Marx dee'd; Engels teuk his jots an completit twa mair volumes.
Born in [[Trier]] in the [[Kinrick o Proushie]], Marx started his studies at the universities o Bonn, Berlin, an Jena, gettin his doctorate in philosophy frae Jena in 1841. He was a Young Hegelian, influencet by the works o [[Georg Wilhelm Friedrich Hegel]], an in his ain works, like ''The German Ideology'' an the ''Grundrisse'', he both critiqued an developed Hegel’s ideas. While in Paris in 1844, Marx wrote his ''Economic and Philosophic Manuscripts'' an met Engels, wha became his closest friend an collaborator. After muivin tae Brussels in 1845, the pair were active in the Communist League, an by 1848, they wrote ''The Communist Manifesto'', a pamphlet layin oot Marx's thoughts an a plan for revolution. After bein expelled from Belgium an Germany, Marx made his way tae [[Lunnon]] in 1849, whaur he penned ''The Eighteenth Brumaire of Louis Bonaparte'' an ''Das Kapital''. In 1864, Marx got involved in the International Workingmen's Association (First International), where he took on the [[Anarchism|anarchists]] led by Mikhail Bakunin. In his ''Critique of the Gotha Programme'' (1875), he laid doon his thoughts on revolution, the state, an the road tae communism. Marx passed away stateless in 1883 an was buried in Highgate Cemetery.
==Notes==
{{Noteslist}}
{{Commons|Karl Marx}}
{{Commonscat}}
{{DEFAULTSORT:Marx, Karl}}
[[Category:Karl Marx| ]]
[[Category:1818 births]]
[[Category:1883 daiths]]
[[Category:19t-century philosophers]]
[[Category:19t-century Proushie fowk]]
[[Category:19t-century jurnalists]]
[[Category:19t-century economists]]
[[Category:19t-century German writers]]
[[Category:Victorian writers]]
[[Category:Ashkenazi Jews]]
[[Category:Atheist filosofers]]
[[Category:Buirials at Highgate Seemetry]]
[[Category:Creetics o releegions]]
[[Category:Economic historians]]
[[Category:Umwhile Lutherans]]
[[Category:German atheists]]
[[Category:German communists]]
[[Category:German economists]]
[[Category:German emigrants tae the Unitit Kinrick]]
[[Category:German historians]]
[[Category:German Jews]]
[[Category:German philosophers]]
[[Category:German revolutionaries]]
[[Category:German socialists]]
[[Category:German sociologists]]
[[Category:German tax resisters]]
[[Category:Historians o economic thocht]]
[[Category:Jewish atheists]]
[[Category:Marxian economists|*]]
[[Category:Marxist historians|*]]
[[Category:Marxist jurnalists|*]]
[[Category:Marxist theorists| ]]
[[Category:Marxists| ]]
[[Category:Materialists]]
[[Category:Members o the Internaitional Workingmen's Association]]
[[Category:Fowk frae the Rhine Province]]
[[Category:Fowk frae Trier]]
[[Category:Fowk associatit wi the Ryal Society o Airts]]
[[Category:Poleetical economy]]
[[Category:Poleetical filosofers]]
[[Category:Social philosophers]]
[[Category:Stateless fowk]]
[[Category:Writers aboot globalisation]]
[[Category:Varsity o Bonn alumni]]
[[Category:Humboldt Varsity o Berlin alumni]]
[[Category:Varsity o Jena alumni]]
{{Stub/Germany}}
<references />
q9o1bzylhnxr7ha8tndj0h2sajd99ss
Moldovae
0
4974
901703
876246
2025-01-04T00:58:53Z
InternetArchiveBot
79721
Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5
901703
wikitext
text/x-wiki
{{Coord|47|N|29|E|type:country|display=title}}
{{Infobox country
|conventional_long_name = Republic o Moldovae
|common_name = Moldovae
|native_name = {{native name|ro|Republica Moldova}}
|image_flag = Flag of Moldova.svg
|image_coat = Coat of arms of Moldova.svg
|national_anthem =
<br />''[[Limba Noastră]]'' <br />{{small|"Our Leid"}}<br /><center>[[File : Imnul Republicii Moldova versiune coral.ogg]]</center>
|image_map = Location Moldova Europe.png
|map_caption = {{nowrap|Location o '''Moldova''' (green) an <br />[[Transnistrie]] (licht green) in Europe.}}
|capital = [[Chișinău]]
|coordinates = {{Coord|47|0|N|28|55|E|type:city}}
|largest_city = capital
|official_languages = [[Romanie leid|Romanie]] <sup>a</sup><ref name="CCDecision2013" /><ref name="congress">{{cite web| url=https://www.loc.gov/law/foreign-news/article/moldova-romanian-recognized-as-the-official-language/| title=Moldova: Romanian Recognized as the Official Language| publisher=[[Law Library of Congress]]| date=23 December 2013| accessdate=13 June 2014| last=Roudik| first=Peter}}</ref><ref name="MCC">{{cite web| url=http://constcourt.md/libview.php?l=en&idc=7&id=512&t=/Overview/Press-Service/News/The-text-of-the-Declaration-of-Independence-prevails-over-the-text-of-the-Constitution| title=The text of the Declaration of Independence prevails over the text of the Constitution| publisher=Constitutional Court of Moldova| date=5 December 2013| accessdate=13 June 2014}}</ref>
|regional_languages = {{hlist | [[Gagauz leid|Gagauz]] | [[Ukrainian leid|Ukrainian]]}}
|languages_type = Inter-ethnic leids
|languages = [[Roushie leid|Roushie]]<ref name="deschide">{{cite web|title=Игорь Додон // Русский язык должен вернуться в Молдову|url=https://deschide.md/ru/russian_news/social_ru/9330/%D0%98%D0%B3%D0%BE%D1%80%D1%8C-%D0%94%D0%BE%D0%B4%D0%BE%D0%BD--%D0%A0%D1%83%D1%81%D1%81%D0%BA%D0%B8%D0%B9-%D1%8F%D0%B7%D1%8B%D0%BA-%D0%B4%D0%BE%D0%BB%D0%B6%D0%B5%D0%BD-%D0%B2%D0%B5%D1%80%D0%BD%D1%83%D1%82%D1%8C%D1%81%D1%8F-%D0%B2-%D0%9C%D0%BE%D0%BB%D0%B4%D0%BE%D0%B2%D1%83.htm|website=Deschide|publisher=Deschide|accessdate=18 August 2017}}</ref><ref name="Rosbalt">{{cite web|title=Додон готов изменить статус русского языка в Молдавии в случае воссоединения с Приднестровьем|url=http://m.rosbalt.ru/world/2017/07/26/1633629.html|website=Rosbalt|publisher=Rosbalt|accessdate=18 August 2017|archive-date=2017-08-18|archive-url=https://web.archive.org/web/20170818173711/http://m.rosbalt.ru/world/2017/07/26/1633629.html|url-status=dead}}</ref><ref name="Rusojuz">{{cite web|title=Русский союз Латвии будет сотрудничать с партией Социалистов Молдовы|url=http://www.rusojuz.lv/ru/ourevents/26083-russkij-sojuz-latvii-budet-sotrudnichat-s-partiej-socialistov--moldovi/|website=Rusojuz.lv|publisher=[[Latvian Russian Union]]|accessdate=18 August 2017|archive-date=2017-08-18|archive-url=https://web.archive.org/web/20170818173702/http://www.rusojuz.lv/ru/ourevents/26083-russkij-sojuz-latvii-budet-sotrudnichat-s-partiej-socialistov--moldovi/|url-status=dead}}</ref>
|ethnic_groups =
|ethnic_groups_year =
|demonym = [[Moldovans|Moldovan]]
|government_type = [[Unitar state|Unitar]] [[Pairlamentar seestem|pairlamentar]] [[constitutional republic]]
|leader_title1 = [[Preses o Moldova|Preses]]
|leader_name1 = [[Maia Sandu]]
|leader_title2 = [[Prime Meenister o Moldovae|Prime Meenister]]
|leader_name2 = [[Natalia Gavrilița]]
| leader_name3 = [[Zinaida Greceanîi]]
|leader_title3 = [[Preses o the Moldovan Pairlament|Preses o the Pairlament]]
|leader_name3 = [[Igor Grosu]]
|legislature = [[Pairlament o the Republic o Moldovae|Pairlament]]
|sovereignty_type = [[History o Moldovae|Unthirldom]] frae the [[Soviet Union|USSR]]
|established_event1 = [[Unthirldom o Moldovae|Sovereignty declared]]
|established_date1 = 23 Juin 1990
|established_event2 = {{nowrap|[[Moldovan Declaration o Unthirldom|Unthirldom declared]]}}
|established_date2 = 27 August 1991<sup>b</sup>
|established_event3 = [[Alma-Ata Protocol|Joined the CIS]]
|established_date3 = 21 December 1991
|established_event4 = [[Dissolution o the Soviet Union|Recognised]]
|established_date4 = 25 December 1991
|established_event5 = [[Unitit Nations]] [[Unitit Naitions Security Cooncil Resolution 739|membership]]
|established_date5 = 2 Mairch 1992
|established_event6 = [[Constitution o Moldovae|Constitution]] adopted
|established_date6 = 29 Julie 1994
|area_label = Includin Transnistrie
|area_km2 = 33,846
|area_rank = 135th <!-- Area rank should match [[List of countries and dependencies by area]] -->
|area_sq_mi = 13,067 <!-- Do not remove per [[WP:MOSNUM]] -->
|area_label2 = Excluding Transnistrie
|area_data2 = {{convert|29683|km2|abbr=on}}
|percent_water = 1.4 {{small|(includin Transnistrie)}}
|population_census = 2,998,235<ref name="2014census">{{cite press release |url=http://www.statistica.md/newsview.php?l=ro&idc=30&id=5582|title=Populația Republicii Moldova la momentul Recensământului|publisher=National Bureau of Statistics of Moldova |date=31 March 2017}}</ref><br />{{small|(excluding [[Transnistria]])}}
|population_census_year = 2014
|population_estimate_rank = 133rd
|population_density_km2 = 105
|population_density_sq_mi = 272 <!-- Do not remove per [[WP:MOSNUM]] -->
|population_density_rank = 101st
|GDP_PPP = $20 billion<ref name=imf2>{{cite web |url=http://www.imf.org/external/pubs/ft/weo/2017/02/weodata/weorept.aspx?sy=2017&ey=2017&scsm=1&ssd=1&sort=country&ds=.&br=1&pr1.x=64&pr1.y=8&c=921&s=NGDPD%2CPPPGDP%2CNGDPDPC%2CPPPPC&grp=0&a=|title=World Economic Outlook Database, October 2017|publisher=[[International Monetary Fund]] |date=April 2016 |accessdate=14 April 2017}}</ref>
|GDP_PPP_year = 2017
|GDP_PPP_rank =
|GDP_PPP_per_capita = $5,657 <ref name=imf2/>
|GDP_PPP_per_capita_rank =
|GDP_nominal = $8 billion<ref name=imf2/>
|GDP_nominal_year = 2017
|GDP_nominal_rank =
|GDP_nominal_per_capita = $2,240<ref name=imf2/>
|GDP_nominal_per_capita_rank =
|Gini = 26.8 <!-- number only -->
|Gini_year = 2014
|Gini_change = decrease <!-- increase/decrease/steady -->
|Gini_ref =<ref name="GINI">{{cite web |url=http://data.worldbank.org/indicator/SI.POV.GINI?locations=MD |title=GINI index (World Bank estimate) |publisher=The World Bank |accessdate=9 November 2016}}</ref>
|Gini_rank =
|HDI = 0.699 <!-- number only -->
|HDI_year = 2015<!-- Please use the year to which the data refers, not the publication year -->
|HDI_change = decrease <!-- increase/decrease/steady -->
|HDI_ref =<ref name="HDI">{{cite web |url=http://hdr.undp.org/sites/default/files/2016_human_development_report.pdf |title=2016 Human Development Report |date=2016 |accessdate=24 March 2017 |publisher=United Nations Development Programme}}</ref>
|HDI_rank = 107t
|currency = [[Moldovan leu|Leu]]
|currency_code = MDL
|time_zone = [[Eastren European Time|EET]]
|utc_offset = +2
|utc_offset_DST = +3
|time_zone_DST = [[Eastren European Simmer Time|EEST]]
|drives_on = richt
|calling_code = [[Telephone nummers in Moldovae|+373]]
|patron_saint =
|cctld = [[.md]]
|official_website = {{Official website}}
|footnote_a = As determined bi the [[Moldovan Declaration o Unthirldom]], that the Constitutional coort o Moldova foond tae tak precedence ower Airticle 13 o the [[Constitution o Moldova (1994)|Constitution]], that uises the name "[[Moldovan leid|Moldovan]]".<ref name="CCDecision2013">{{cite news |url=http://www.rferl.org/content/moldova-romanian-official-language/25191455.html |title=Chișinău Recognizes Romanian As Official Language |agency=[[Associated Press]] |date=5 December 2013 |publisher=[[Radio Free Europe/Radio Liberty]] |accessdate=6 December 2013}}</ref>
|footnote_b = Date o proclamation. Unthirldom subsequently finalised wi the [[Dissolution o the Soviet Union|dissolution o the USSR]] in December 1991.
|area_magnitude = 1 E10
}}
[[File:Moldadm.png|thumb|Territorial organization]]
'''Moldovae''' ([[Romanie leid|Romanie]]: ''Moldova'') kent offeecially as the '''Republic o Moldovae''' ([[Romanie leid|Romanie]]: ''Republica Moldova'') is a wee laundlockit kintra in Eastren [[Europe]] atween the [[Ukraine]] tae the Sooth-East an [[Romanie]] tae the Wast. Historically it wis pairt o the '''Preencipality o Moldovae''' fae the 1300's, annexed bi the [[Roushie Empire]] in 1812 bi' the Ottoman Empire (Tae wheech Moldovae wis a vassal state) an becum kent as Bessarabia. in 1856 soothren Bessarabia wis returned tae Moldovae an three yeirs latter it unitit wi the ither [[Romanie]] laund o' [[Wallachie]] in 1918. Efter chyngin hauns durin [[WWII]] it becam pairt o the [[Soviet Union]] an frae 1945 tae 1991 it wis cried '''Moldovae SSR'''. It feenally becam independant in August 1991.
==References==
{{reflist}}
{{Commonscat|Moldova}}
{{Authority control}}
[[Category:Moldovae| ]]
[[Category:Laundlockit kintras]]
[[Category:Member states o the Commonweel o Independent States]]
[[Category:Member states o the Cooncil o Europe]]
[[Category:Member states o the Organisation internationale de la Francophonie]]
[[Category:Member states o the Unitit Naitions]]
[[Category:Republics]]
[[Category:Sootheastren European kintras]]
[[Category:States an territories established in 1991]]
[[Category:1991 establishments in Europe]]
[[Category:Kintras in Europe]]
[[Category:Eastren European kintras]]
ruk74lujzo6y553jo4n2nvcn06vq4cv
Wikipedia:Votes for deletion
4
5564
901696
900925
2025-01-03T21:50:02Z
CiphriusKane
74958
/* Leetins */
901696
wikitext
text/x-wiki
This page haes an archive [[Wikipedia:Votes for deletion/Archive/2014|here]]. Ye can tag for speedy deletion a page by adding '''{{tl|delete}}''' tae the tap. Tae add a page here, tag it wi '''<nowiki>{{subst:</nowiki>[[Template:Airticle for deletion|Airticle for deletion]]<nowiki>}}</nowiki>''', then create [[Wikipedia:Votes for deletion/AIRTICLE TITLE]] wi <nowiki>{{subst:afd2|pg={{subst:SUBPAGENAME}}|cat=U|text=Reason}} ~~~~</nowiki>, finally add <nowiki>{{Wikipedia:Votes for deletion/AIRTICLE TITLE}}</nowiki> unner the "Leetins" section o this page.
== Archives ==
{{Special:PrefixIndex/Wikipedia:Votes for deletion/Archive/}}
== Leetins ==
<!--Place VfD leetin ablo this line-->
{{Wikipedia:Votes for deletion/Template:Belgian Professional Fitbawer o the Year}}
{{Wikipedia:Votes for deletion/Template:Belgian Young Professional Fitbawer o the Year}}
{{Wikipedia:Votes for deletion/Template:Eredivisie Coach o the Year}}
{{Wikipedia:Votes for deletion/Leet o Cheenese leid schuils in Taiwan for furrin students}}
{{Wikipedia:Votes for deletion/Abortion in Azerbaijan}}
{{Wikipedia:Votes for deletion/Extreme pynts o Azerbaijan}}
{{Wikipedia:Votes for deletion/Ferrari FX}}
{{Wikipedia:Votes for deletion/Dragon Tosha}}
{{Wikipedia:Votes for deletion/Save Our Souls}}
{{Wikipedia:Votes for deletion/Leet o neo-Nazi organisations}}
<!--{{Wikipedia:Votes for deletion/X}}-->
<!--Place VfD leetin abuin this line-->
[[Category:Wikipaedia]]
1139drhdey7kwpowe1rti23vxyskasv
Tallinn
0
11023
901698
897691
2025-01-03T22:22:18Z
VulpesVulpes42
30016
PNG→SVG
901698
wikitext
text/x-wiki
{{Infobox settlement
|official_name = Tallinn
|native_name =
|image_skyline =
|imagesize = 290
|image_caption = Frae tap: Auld Toun, [[KUMU (museum)|KUMU]], [[Tallinn Sang Festival Grunds]], [[Kadriorg Palace]], [[Waws o Tallinn|Viru Gate]], Ceety Centre
|image_flag = Flag of Tallinn.svg
|image_shield = Coat of arms of Tallinn (greater).svg
|pushpin_map = Estonia
|subdivision_type = [[Leet o kintras|Kintra]]
|subdivision_name = {{flag|Estonie}}
|subdivision_type1 = [[Coonties o Estonie|Coonty]]
|subdivision_name1 = [[File:Flag of et-Harju maakond.svg|25px]] [[Harju Coonty]]
|leader_party = [[Estonie Centre Pairty|Centre Pairty]]
|leader_title = [[Mayor]]
|leader_name = [[{{#property:P6}}]]
|established_title = <!-- First settled -->
|established_date =
|established_title1 = First appeared on map
|established_date1 = 1154
|established_title2 = Toun richts
|established_date2 = 1248
|area_total_km2 = 159.2
|area_total_sq_mi = 61.5
|population_as_of = 1 Aprile 2017<ref name="registered_population">{{cite web|url=http://www.tallinn.ee/Tallinna-elanike-arv|title=Tallinna elanike arv|trans-title=Number of Tallinn residents|publisher=Tallinn city government|date=1 June 2016|accessdate=14 June 2016|language=Estonian}}</ref>
|population_total = 444591
|population_rank = [[Leet o ceeties an touns in Estonie|1st]] ([[Lairgest ceeties o the European Union bi population within ceety limits|67t]] in EU)
|population_density_km2 = auto
|population_density_sq_mi =auto
|population_metro = 542983<ref name="urban audit">{{cite web|url=http://epp.eurostat.ec.europa.eu/tgm/table.do?tab=table&init=1&language=en&pcode=tgs00080&plugin=1 |title=Total population in Urban Audit cities |publisher=European Commission |date=14 June 2013 |accessdate=29 September 2013}}</ref>
|timezone = [[Eastren European Time|EET]]
|utc_offset = +2
|timezone_DST = [[Eastren European Simmer Time|EEST]]
|utc_offset_DST = +3
|coordinates = {{coord|59|26|14|N|24|44|43|E|region:EE|display=inline,title}}
|website = [http://www.tallinn.ee/eng www.tallinn.ee]
|footnotes =
}}
'''Tallinn''' is the caipital an the lairgest ceety in [[Estonie]]. It is situatit on the northren coast o the kintra, on the banks o the [[Gulf o Finland]], 80 km (50 mi) sooth o [[Helsinki]], wast o [[Saunt Petersburg]].
== Toponymie ==
=== Historical names ===
In 1154 a toun cried ''Qlwn''<ref>Fasman, The Geographer's Library, pp.17</ref> or ''Qalaven'' (possible derivations of ''Kalevan'' or ''Kolyvan'')<ref name="TUE"/><ref>{{cite book |title=Birnbaum's Eastern Europe |last=Birnbaum |first=Stephen |authorlink= |year=1992 |publisher=Harper Perennial |location= |isbn=9780062780195 |pages= |url=http://books.google.com/books?source=ig&hl=en&rlz=&=&q=%22who%20called%20the%20settlement%20Kolyvan%22&um=1&ie=UTF-8&sa=N&tab=wp }}</ref> wis put on the warld cairt o the [[Almoravid]] bi cartographer [[Muhammad al-Idrisi]] who describit it as ''a sma toun like a lairge castle'' amang the touns o ''Astlanda''. It haes been suggestit that the ''Quwri in Astlanda'' mey hae denotit the predecessor toun o the day's Tallinn.<ref>{{cite book |title=The Geographer's Library |last=Fasman |first=Jon |authorlink= |year=2006 |publisher=Penguin |location= |isbn=9780143036623 |page=17 |url=http://books.google.com/books?id=bE2oerrW_IkC&pg=PA17&dq }}</ref><ref>"A glance at the history and geology of Tallinn" by Jaak Nõlvak. In [http://www.gi.ee/WOGOGOB/wogogob_web.pdf Wogogob 2004: Conference Materials] {{Webarchive|url=https://web.archive.org/web/20110720125323/http://www.gi.ee/WOGOGOB/wogogob_web.pdf |date=2011-07-20 }}</ref>
The earliest names o Tallinn include ''Kolyvan'' ({{Lang-ru|Колывань}}) kent frae East Slavic chronicles, the name possibly derivin frae the Estonian mythical hero ''[[Kalev (mythology)|Kalev]]''.<ref>{{cite book |title=Handbook of Russian Literature |last=Terras |first=Victor |authorlink= |year=1990 |publisher=Yale University Press |location= |isbn=9780300048681 |page=68 |url=http://books.google.com/books?id=VjKh2gkCudAC&pg=PA68&dq }}</ref><ref>{{cite book |title=The Esthonian Review |last= |first= |authorlink= |year= |publisher=University of California |location= |isbn= |pages= |url=http://books.google.com/books?id=-D9DAAAAIAAJ&q=%22the+old+Russian+name+for+Reval+has+been+retained+(Kolyvan+from+Kalev)%22&dq=%22the+old+Russian+name+for+Reval+has+been+retained+(Kolyvan+from+Kalev)%22}}</ref>
Up tae the 13t century the Scandinavians an [[Henry o Livonie]] in his chronicle cried the toun Lindanisa: ''Lyndanisse'' in [[Dens leid|Dens]],<ref>{{dk icon}} In 1219 [[Valdemar II o Denmark]], leadin the Dens Fleet in connection wi the [[Livonian Crusade]], landit in an Estonian toun o Lindanisse</ref><ref>[https://runeberg.org/salmonsen/2/7/0518.html SALMONSENS KONVERSATIONS LEKSIKON]</ref><ref>{{de icon}} Reval's ältester Estnischer Name Lindanisse, Verhandlungen der gelehrten estnischen Gesellschaft zu Dorpat. Band 3, Heft 1. Dorpat 1854, p. 46–47</ref> ''Lindanäs'' in Swadish, an aa mentioned as ''Ledenets'' in [[Auld East Slavic leid|Auld East Slavic]]. Accordin tae some theories the name derived frae meethical Linda, the wife o Kalev an the mither o [[Kalevipoeg]].<ref>{{cite book |title=The Modern Encyclopedia of Russian and Soviet History |last=Wieczynski |first=Joseph |authorlink= |year=1976 |publisher=Academic International Press |location= |isbn=9780875690643 |page=230 }}</ref> who in an Estonian legend carried rocks tae her husband's grave that formed the [[Toompea]] hill.<ref>{{cite book |title="Racundra's" First Cruise |last=Ransome |first=Arthur |authorlink= |year=1923 |publisher=B.W. Huebsc |location= |isbn= |pages= |url=http://books.google.com/books?q=%22The+old+giant+Kalev+died+here+at+Reval%2C+and+Linda+heaped+stone+after+stone+upon+his+grave+and+so+made+that+proud+hill%22&btnG=Search+Books }}</ref><br />
It haes been an aa suggestit that in the context the meanin o ''linda'' in the airchaic Estonian leid, that is seemilar tae ''lidna'' in [[Votic leid|Votic]], haed the same meanin as ''linna'' or ''linn'' later on meanin a castle or toun in Inglis. Accordin tae the suggestion ''nisa'' wad hae haed the same meanin as ''niemi'' (meanin [[peninsula]] in Inglis) in an auld Finnish form o the name ''Kesoniemi''.<ref>{{cite book |title=ITÄMEREN SUOMALAISET SAKSALAISEN VALLOITUKSEN AIKANA |last=VIRKKUNEN |first=A. H. |language=[[Finnish leid|Finnish]]|authorlink= |year=1907 |publisher=Suomen Muinaismuistoyhdistys |location= |isbn= |page=91 |url=http://books.google.com/books?id=OK4MAAAAYAAJ&pg=PA91 }}</ref>
Ither than ''Kesoniemi'' kent auncient historical names o Tallinn in [[Finnish leid|Finnish]] include ''Rääveli''. The Icelandic ''[[Njal's Saga]]'' mentions Tallinn an caws it Rafala, which is a variant o the name Raphael.
Efter the Dens conquest in 1219 the toun became kent in the [[German leid|German]], [[Swadish leid|Swadish]] an [[Dens leid|Dens]] leids as Reval ({{lang-la|Revalia}}, {{lang-sco|Reffel}}<ref>{{cite news |last1=Leask |first1=David |title=How the unassuming housing area of Burdiehouse has been revealed as ground zero for a rediscovery of Scots ‘exonyms’ |url=https://www.heraldscotland.com/news/19224853.unassuming-housing-area-burdiehouse-revealed-ground-zero-rediscovery-scots-exonyms/ |access-date=4 August 2024 |work=The Herald |date=11 April 2021 |language=en}}</ref>). The name oreeginatit frae (Laitin) ''Revelia'' (Estonian) ''[[Revala]]'' or ''Rävala'', the adjacent auncient name o the surroonding Estonian coonty.
=== Modren name ===
[[File:Old town of Tallinn 06-03-2012.jpg|thumb|left|200px|The auld toun]]
The oreegin o the name "Tallinn(a)" is certaint tae be [[Estonian leid|Estonian]], awtho the oreeginal meanin o the name is debatit. It is uisually thocht tae be derived frae "''Taani-linn(a)''" (meanin "[[Denmark|Dens]]-castle/toun"; [[Laitin]]: [[Castrum Danorum]]) efter the Danes biggit the castle in place o the Estonian stranghauld at Lindanisse. Housomeivver, it coud an aa hae come frae "''tali-linna''" ("winter-castle/toun"), or "''talu-linna''" ("hoose/farmstead-castle/toun"). The element ''-linna'', lik [[Germanic leids|Germanic]] ''-[[burg]]'' an [[Slavic leids|Slavic]] ''-[[grad (geography)|grad]]'' / ''-[[gorod]]'', oreeginally meant "fortress" but is uised as a suffix in the formation o toun names.
The previously uised offeecial German name {{Audio|Reval.ogg|'''Reval'''}} ({{lang-ru|Ревель}}) wis replaced efter Estonie became independent in 1918–1920. At first baith forms ''Tallinna'' an ''Tallinn'' wur uised.<ref>{{cite book |title=Tallinn In Your Pocket |last=Singer |first=Nat A. |authorlink= Steve Roman |year=2008 |publisher=In Your Pocket |location= |isbn=0014062690 |page=11 |pages= |url=http://books.google.com/books?id=PZdt1EnuafsC&pg=PA13&dq |accessdate= }}</ref> The [[United States Board on Geographic Names]] adoptit the form ''Tallinn'' atween Juin 1923 an Juin 1927.<ref>{{cite book |title=Decisions of the United States Geographic Board |author=United States Geographic Board |authorlink= |year= 1908|publisher=The Board. |location= |isbn= |page= |pages= |url=http://books.google.com/books?id=F40tAAAAMAAJ&pg=RA8-PA39&dq}}</ref> The form ''Tallinna'' appearin in modren times in [[Estonian leid|Estonian]] denotes the [[genitive case]] o the name, as in ''Tallinna Reisisadam'' (''Port o Tallinn'').
Ither variations o modren spellins include '''Tallinna''' in [[Finnish leid|Finnish]] an '''Таллин''' in [[Roushie leid|Roushie]].
A form '''Tallin''' derivin frae the [[Romanization o Roushie]] spellin o the name ''Таллин'' <ref>{{cite book |title=Russian at Your Fingertips |last=Young |first=Jekaterina |authorlink= |year=1990 |publisher=Routledge |location= |isbn=0415029309 |page=100 |pages= |url=http://books.google.com/books?id=rve6qRtMPYUC&pg=RA1-PA100&dq}}</ref> wis uised internaitionally an aw durin the era Estonie wis annexed bi the Soviet Union.
== History ==
{{see an aw|Timeline o Tallinn history}}
{{Infobox World Heritage Site
| WHS = Historic Centre (Auld Toun) o Tallinn
| Image = [[File:Reval-8371.jpg|250px|The historical Auld Toun]]
| State Party = Estonia
| Type = Cultural
| Criteria = ii, iv
| ID = 822bis
| Region = [[:en:List of World Heritage Sites in Europe|Europe and North America]]
| Year = 1997
| Session = 21st
| Link = http://whc.unesco.org/en/list/822
}}
[[File:VanaToomas1530.jpg|thumb|right|150px|The oreeginal [[Auld Thomas]] (1530)]]
The first traces o human dounset foond in Tallinn's ceety centre bi [[aircheologist]]s are aboot 5000 year auld. The [[:en:Comb Ceramic culture|comb ceramic pottery]] foond on the steid dates tae aboot 3000 BC an [[:en:Corded Ware culture|corded ware pottery]] c. 2500 BC.<ref>{{cite news |first=Askur |last=Alas |language=[[Estonian language|Estonian]] |title=The mystery of Tallinn's Central Square |url=http://www.ekspress.ee/2008/10/29/eesti-uudised/5040-vabaduse-platsi-mysteerium-kuhu-kadus-kaks-sajandit-ajalugu |publisher=EE |accessdate=29 October 2008 |archive-date=2008-11-05 |archive-url=https://web.archive.org/web/20081105044712/http://www.ekspress.ee/2008/10/29/eesti-uudised/5040-vabaduse-platsi-mysteerium-kuhu-kadus-kaks-sajandit-ajalugu |url-status=dead }}</ref>
In 1050 the first fortress wis biggit on Tallinn [[Toompea]].<ref name="TUE">{{cite book |title=Toward an Understanding of Europe |last=Ertl |first=Alan |year=2008 |publisher=Universal-Publishers |isbn=978-1-59942-983-0 |page=381 |url=http://books.google.com/books?id=X9PGRaZt-zcC&pg=PA381 }}</ref>
As an important port for tred atween Roushie an Scandinavie, it became a target for the expansion o the [[Teutonic Knichts]] an the Kinrick o Denmark durin the period o [[Northren Crusades]] in the beginnin o the 13t century whan [[Roman Catholic Kirk|Christianity]] wis forcibly imposed on the local population. Dens rule o Tallinn an Northren Estonie stairtit in 1219.
In 1285 the ceety, then kent as Reval, became the northmaist member o the [[Hanseatic League]] – a mercantile an militar alliance o [[Germans|German]]-dominatit ceeties in Northren Europe. The Danes sauld Reval alang wi thair ither laund possessions in northren Estonie tae the [[Teutonic Knichts]] in 1346. Medieval Reval enjoyed a strategic poseetion at the crossroads o tred atween Wastren an Northren Europe an Roushie. The ceety, wi a population o 8,000, wis vera well fortifee'd wi [[:en:Tallinn City Walls|ceety waws an 66 defence touers]].
A [[wather vane]], the figur o a auld warrior cried [[Auld Thomas]], wis put on tap o the spire o the [[Tallinn Toun Haw]] in 1530 that became the seembol for the ceety.
Wi the stairt o the [[Protestant Reformation]] the [[Germans|German]] influence became even stranger as the ceety wis convertit tae [[Lutheranism]]. In 1561 Reval poleetically became a [[Dominions o Swaden|dominion]] o Swaden.
Durin the [[Great Northren War]], [[:en:The plague during the Great Northern War#Lithuania.2C Livonia.2C Estonia|plague stricken Tallinn]] [[:en:Capitulation of Estonia and Livonia|alang wi Swadish Estonie an Livonie capitulatit]] tae [[Roushie Empire|Imperial Roushie]] in 1710, but the local sel-govrenment institutions (Magistracy o Reval an Chivalry o Estonie) retained thair cultural an economical autonomy athin Imperial Roushie as the [[Duchy o Estonie]]. The Magistracy o Reval wis abolisht in 1889. The 19t century brocht industrialization o the ceety an the port kept its importance. Durin the last decades o the century [[Roushification]] measurs became stranger.
The auldest fitbaa club in Estonie, [[:en:FC Meteor Tallinn|Meteor Tallinn]] wis foondit in 1908 in the destrict Lasnamäe.
On 24 Februar 1918, the [[:en:Estonian Declaration of Independence|Independence Manifesto]] wis proclaimed in Reval, suin tae be Tallinn, follaeed bi [[German Empire|Imperial German]] occupation an a [[:en:Estonian Liberation War|war o unthirldom]] wi Roushie. On 2 Februar 1920, the [[Treaty o Tartu (Roushie–Estonian)|Tartu Peace Treaty]] wis signed wi Soviet Roushie, whaurin Roushie acknawledgit the unthirldom o the Estonie Republic. Tallinn became the caipital o a unthirlt Estonie. Efter Warld War II stairtit, Estonie wis annexed bi the Soviet Union (USSR) in 1940, an later occupee'd bi [[Nazi Germany]] frae 1941 tae 1944. Efter the Nazi retreat in 1944, it wis again annexed bi the USSR. Efter [[:en:Occupation of Baltic Republics|annexation]] intae the Soviet Union, Tallinn became the caipital o the [[Estonie Soviet Socialist Republic|Estonie SSR]].
Durin the [[1980 Simmer Olympics]], the [[:en:Sailing at the 1980 Summer Olympics|sailin (then kent as yachtin)]] events wur held at [[Pirita (subdestrict)|Pirita]], north-east o central Tallinn. Mony biggins, sic as the "Olümpia" hotel, the new Main Post Office biggin, an the Regatta Center, wur biggit for the Olympics.
In August 1991 an independent democratic Estonian state wis re-established and a period of quick development tae a modren European caipital ensued. Tallinn became the caipital o a de facto independent kintra ance again on 20 August 1991.
Tallinn haes historically consistit o three pairts:
* The [[Toompea]] (''Domberg'') or "Cathedral Hill", which wis the seat o the central authority: first the Dens captains, then the [[komtur]]s o the Teutonic Order, an Swadish an Roushie govrenors. It wis till 1877 a separate toun (''Dom zu Reval''), the residence o the aristocracy; it is the day the seat o the [[Riigikogu|Estonie pairlament]], [[Govrenment o Estonie|govrenment]] an some embassies an residencies.
* The Auld Toun, which is the auld [[Hanseatic League|Hanseatic]] toun, the "ceety o the ceetizens", wis no admeenistratively unitit wi Cathedral Hill till the late 19t century. It wis the centre o the medieval tred on which it grew prosperous.
* The Estonie toun forms a crescent tae the sooth o the Auld Toun, whaur the [[Estonies]] came tae settle. It wis no till the mid-19t century that ethnic Estonies replacit the local [[Baltic Germans]] as the majority amang the residents o Tallinn.
The ceety o Tallinn haes niver been razit an pillagit; that wis the fate o Tartu, the varsity toun {{convert|200|km|0|abbr=on}} sooth, which wis pillagit in 1397 bi the Teutonic Order. Aroond 1524 Catholic kirks in mony touns in Estonie, includin Tallinn, war pillaged as pairt o the Reformational fervor: this occurred throuoot Europe. Awtho extensively [[:en:Bombing of Tallinn in World War II|bombed bi Soviet air forces]] durin the later stages o Warld War II, hintle o the medieval Auld Toun still retains its chairm. The Tallinn Auld Toun (includin ''Toompea'') became a [[UNESCO]] [[Warld Heritage Steid|Warld Cultural Heritage]] steid in 1997.
At the end o the 15t century a new {{convert|159|m|2|abbr=on}} heich [[Gothic airchitectur|Gothic]] spire wis biggit for [[St. Olaf's Kirk, Tallinn|St. Olaf's Kirk]]. atween 1549 an 1625 it wis the [[:en:List of tallest churches|tawest biggin in the warld]]. Efter several fires an follaein rebiggin, its owerall hicht is nou {{convert|123|m|2|abbr=on}}.
{{Wide image|Raekoja plats (Tallinn).jpg|500px|Panorama o the central [[:en:Town Hall Square, Tallinn|Toun Haw Square]] (Raekoja plats)}}
{{Wide image|Tallinn-panorama.jpg|500px|Auld Toun o Tallinn}}
== Admeenistrative destricts ==
[[File:Districts of Tallinn.jpg|thumb|right|Destricts o Tallinn]]
{| style="float:right; margin-left:5px; margin-right:0;"
|-
!Destrict
!Aurie
!Population
|-
| 1. [[Haabersti]] || align=right | 18.6 km² || align=right | 42,839
|-
| 2. [[Kesklinn, Tallinn|Kesklinn]] (centre) || align=right | 28.0 km² || align=right | 52,820
|-
| 3. [[Kristiine]] || align=right | 9.4 km² || align=right | 30,274
|-
| 4. [[Lasnamäe]] || align=right | 30.0 km² || align=right | 116,490
|-
| 5. [[Mustamäe]] || align=right | 8.0 km² || align=right | 64,425
|-
| 6. [[Nõmme]] || align=right | 28.0 km² || align=right | 39,049
|-
| 7. [[Pirita]] || align=right | 18.7 km² || align=right | 17,019
|-
| 8. [[Põhja-Tallinn]] || align=right | 17.3 km² || align=right | 56,914
|}
For local govrenment purposes, Tallinn is subdividit intae 8 admeenistrative destricts ({{lang-et|linnaosad}}, singular ''linnaosa''). The destrict governments are ceety institutions that fulfill, in the territory o thair destrict, the functions assigned tae thaiem biy Tallinn legislation an [[statute]]s.
Each destrict govrenment is managit bi an Elder ({{lang-et|linnaosavanem}}). He or she is appointit bi the Ceety Govrenment on the nomination o the Mayor an efter haein heard the opinion o the Admeenistrative Cooncils. The function o the Admeenistrative Cooncils is tae recommend, tae the Ceety Govrenment an Commissions o the Ceety Cooncil, hou the destricts shoud be admeenistered.
{{-}}
== Internaitional relations ==
=== Twin touns – sister ceeties ===
Tallinn participates in internaitional [[Twin touns an sister ceeties|toun twinnin]] schemes tae foster guid internaitional relations. Pairtners include:
{| cellpadding="10"
|- style="vertical-align:top;"
|
* {{flagicon|United States}} [[Annapolis, Maryland|Annapolis]], Unitit States
* {{flagicon|Poland}} [[Białystok]], Poland
* {{flagicon|United Kingdom}} [[Dartford]], Unitit Kinrick
* {{flagicon|Poland}} [[Gdańsk]], Poland
* {{flagicon|Poland}} [[Gdynia]], Poland
||
* {{flagicon|Belgium}} [[Ghent]], Belgium
* {{flagicon|Sweden}} [[Gothenburg]], Swaden
* {{flagicon|Netherlands}} [[Groningen]], Netherlands<ref name="Graz">{{cite web |url=http://www.graz.at/cms/beitrag/10045157/606819/ |title=Twin Towns - Graz Online - English Version |publisher=www.graz.at |accessdate=2010-01-05 |archive-date=2010-01-31 |archive-url=https://web.archive.org/web/20100131044827/http://www.graz.at/cms/beitrag/10045157/606819 |url-status=dead }}</ref><ref name="Groningen">{{cite web|url=http://www.groningen.nl/functies/pagfunctie.cfm?parameter=1285|title=''Groningen - Partner Cities''|publisher=[[copyright|©]] 2008 Gemeente Groningen, Kreupelstraat 1,9712 HW Groningen|accessdate=2008-12-08|archive-date=2007-09-26|archive-url=https://web.archive.org/web/20070926211207/http://www.groningen.nl/functies/pagfunctie.cfm?parameter=1285|url-status=dead}}</ref>
* {{flagicon|Germany}} [[Kiel]], Germany
* {{flagicon|Finland}} [[Kotka]], Finland (1955)
||
* {{flagicon|Poland}} [[Łomża]], Poland
* {{flagicon|USA}} [[Los Gatos, Californie|Los Gatos]], Unitit States
* {{flagicon|Sweden}} [[Malmö]], Swaden<ref name="Malmö twinning">{{cite web|url=http://www.malmo.se/faktaommalmopolitik/internationelltsamarbete/vanortssamarbetet.4.33aee30d103b8f15916800032874.html|title=Malmö stads vänortssamarbete|publisher=© 2004–2009 Malmö stad, 205 80 Malmö, Organisationsnummer: 212000-1124|language=Swadish|accessdate=2009-06-27|archive-date=2007-09-28|archive-url=https://web.archive.org/web/20070928003810/http://www.malmo.se/faktaommalmopolitik/internationelltsamarbete/vanortssamarbetet.4.33aee30d103b8f15916800032874.html|url-status=dead}}</ref>
* {{flagicon|USA}} [[Portland, Oregon|Portland]], [[Oregon]], United States
* {{flagicon|Latvia}} [[Riga]], Latvie<ref>{{cite web |url=http://www.riga.lv/EN/Channels/Riga_Municipality/Twin_cities_of_Riga/default.htm |title=Twin cities of Riga |publisher=[[Riga City Council]] |accessdate=2009-07-27 |archive-date=2008-12-04 |archive-url=https://web.archive.org/web/20081204021323/http://www.riga.lv/EN/Channels/Riga_Municipality/Twin_cities_of_Riga/default.htm |url-status=dead }}</ref>
||
* {{flagicon|Russia}} [[Moscow]], Roushie
* {{flagicon|Russia}} [[Saunt Petersburg]], Roushie
* {{flagicon|Germany}} [[Schwerin]], Germany
* {{flagicon|Italy}} [[Venice]], Italy
* {{flagicon|Lithuania}} [[Vilnius]], Lithuanie<ref name="Vilnius twinning">{{cite web|url=http://www.tallinn.ee/est/g1471s41613|title=Vilniuse sõpruslinnad|publisher=© 2002–2009 Tallinn|language=Estonian|accessdate=2009-09-12|archive-date=2011-09-27|archive-url=https://web.archive.org/web/20110927103248/http://www.tallinn.ee/est/g1471s41613|url-status=dead}}</ref>
|}
== References ==
{{reflist}}
{{Commonscat}}
[[Category:Tallinn| ]]
[[Category:Ceeties an touns in Estonie]]
[[Category:Caipitals in Europe]]
{{Stub/Balt}}
{{Stub/Ceety}}
8z4yuvpm111pkqpmye3usxpjr1ijqxh
Turku
0
12213
901699
896690
2025-01-03T22:22:51Z
VulpesVulpes42
30016
PNG→SVG
901699
wikitext
text/x-wiki
{{Infobox Finnish municipality
|name = Turku
|official_name = {{lang|fi|Turun kaupunki}}<br />{{lang|sv|Åbo stad}}
|native_name = {{lang|fi|Turku}} – {{lang|sv|Åbo}}
|nickname =
|settlement_type = Ceety
|motto =
|image_skyline = Turku postcard 2009.jpg
|imagesize = 250 px
|image_caption = Tap:Aerial view o Turku frae Turku Cathedral, 2nt left:Statue o Per Brahe, 2nt middle:Turku Castle, 2nt richt:Turku Cathedral, 3rd left:Turku Medieval Mercat, 3rd middle:The Christmas Peace Balcony o Turku, 3rd richt:Twilicht in Aura River, Bottom left:Simmer in Aura River, Bottom richt:View o Yliopistonkatu pedestrian aurie
|image_flag = Flag of turku Finland-.svg
|flag_size =
|image_seal =
|seal_size =
|image_shield = Turku.vaakuna.svg
|shield_size =
|image_blank_emblem =
|blank_emblem_type =
|blank_emblem_size =
|image_map =Turku sijainti Suomi.svg
|mapsize =
|map_caption =
|pushpin_map = <!-- name of a location map as per Template:Location_map -->
|pushpin_label_position = <!-- position of the pushpin label: left, right, top, bottom, none -->
|pushpin_map_caption =
|pushpin_mapsize =
|region = [[Finland Proper]]
|subregion = [[Turku sub-region]]
|leader_title = Mayor
|leader_name = [[{{#property:P6}}]]
|leader_title1 =
|leader_name1 =
|leader_title2 =
|leader_name2 =
|leader_title3 =
|leader_name3 =
|established_title =
|established_date =
|established_title2 =
|established_date2 =
|established_title3 =
|established_date3 =
|extinct_title =
|extinct_date =
|area_urban_km2 = 252.65
|area_metro_km2 = 2331.1
|population_metro = 303,492
|population_blank1_title =
|population_blank1 =
|population_density_metro_km2 =
|population_urban = 252,468<ref name="taajamat">{{cite web |url= http://pxweb2.stat.fi/Dialog/varval.asp?ma=160_vaerak_tau_340_fi&ti=Taajamat+v%E4kiluvun+ja+v%E4est%F6ntiheyden+mukaan+31.12.2011&path=..%2FDatabase%2FStatFin%2Fvrm%2Fvaerak%2F&lang=3&multilang=fi |title= Taajamat väkiluvun ja väestöntiheyden mukaan 31.12.2011 |date= 2011-12-31 |work= Tiedote |publisher= Statistics Finland (Tilastokeskus) |language= Finnish |accessdate= 28 March 2013 |archive-date= 2013-04-12 |archive-url= https://archive.today/20130412162104/http://pxweb2.stat.fi/Dialog/varval.asp?ma=160_vaerak_tau_340_fi&ti=Taajamat+v%E4kiluvun+ja+v%E4est%F6ntiheyden+mukaan+31.12.2011&path=../Database/StatFin/vrm/vaerak/&lang=3&multilang=fi |url-status= dead }}</ref>
|population_density_urban_km2 = 999,3
|population_note =
|finnish_official =
|swedish_official = 1
|sami_official =
|urbanisation =
|unemployment =
|blank1_name =
|blank1_info =
|blank2_name =
|blank2_info =
|blank3_name =
|blank3_info =
|blank4_name =
|blank4_info =
|coordinates_type =
|coordinates = {{coord|60|27|N|022|16|E|display=inline,title}}
|latNS=N
|longEW=E
|elevation_m =
|postal_code = 20000–20960
|website = [http://www.turku.fi/ www.turku.fi]
|footnotes =
}}
'''Turku''' ({{IPA-fi|ˈturku|-|Fi-Turku.ogg}}; {{lang-sv|Åbo|italic=yes}} {{IPA-sv|ˈoːbʊ||sv-Åbo.ogg}}) is a [[Leet o touns in Finland|ceety]] on the soothwast coast o [[Finland]] at the mooth o the [[Aura River (Finland)|Aura River]],<ref name="turku_stats"/><ref>'Aluetietopankki' at the Kuntaliitto website</ref> in the region o [[Finland Proper]]. Turku, as a toun, wis settled durin the 13t century an foondit maist likely at the end o the 13t century, makin hit the auldest ceety in Finland. hit quickly became the maist important ceety in Finland, a status hit retained fir hunders o years. Efter Finland became pairt o the [[Roushie Empire]] (1809) an the caipital o the [[Grand Duchy o Finland]] wis moved til [[Helsinki]] (1812), Turku continued tae be the maist populous ceety in Finland until the end o the 1840s, an hit remains a regional caipital an an important business an cultural centre.
Acause o hits lang history, hit haes been the steid o mony important events an haes extensively influenced [[History o Finland|Finnish history]]. Alang wi [[Tallinn]], the caipital ceety o [[Estonie]], Turku wis designatit the [[European Caipital o Cultur]] fir 2011. In 1996 hit wis declared the offeecial Christmas Ceety o Finland.<ref>{{cite web |url=http://www.turku.fi/public/default.aspx?nodeid=9289&culture=en-US&contentlan=2 |title=Christmas City » Turku, the Finnish Christmas City |publisher=www.turku.fi |accessdate=2009-05-06 |archive-date=2011-07-16 |archive-url=https://web.archive.org/web/20110716095158/https://www.turku.fi/public/default.aspx?nodeid=9289&culture=en-US&contentlan=2 |url-status=dead }}</ref>
Due tae hits location, Turku is a notable commercial an passenger [[seaport]] wi ower three million passengers travellin throu the [[Port o Turku]] each year tae [[Stockholm]] an [[Mariehamn]].<ref name="turku_stats">{{cite web | title = Statistical yearbook of Turku | url = http://www.turku.fi/Public/default.aspx?nodeid=3981&culture=en-US&contentlan=2 | date = 2008-07-17 | language = Finnish | access-date = 2015-06-01 | archive-date = 2007-09-27 | archive-url = https://web.archive.org/web/20070927175319/https://www.turku.fi/Public/default.aspx?nodeid=3981&culture=en-US&contentlan=2 | url-status = dead }}</ref>
As o 30 September 2014, the population o Turku wis 183,811,<ref>http://vrk.fi/default.aspx?docid=8639&site=3&id=0 {{Webarchive|url=https://web.archive.org/web/20141029190516/http://vrk.fi/default.aspx?docid=8639&site=3&id=0 |date=2014-10-29 }}</ref> makin hit the saxt lairgest ceety in Finland.<ref name="population_count"/> As o 31 August 2008 thare war 303,492 indwallers livin in the [[Turku sub-region]], rankin hit as the [[Leet o urban auries in Finland bi population|third lairgest]] urban aurie in Finland efter the [[Greater Helsinki]] aurie an [[Tampere]] sub-region. The ceety is offeecially [[bilingual]] as {{Formatnum: {{#expr: (({{Infobox Finnish Municipality/native language Swedish|Turku}}/{{Infobox Finnish Municipality/native language total|Turku}}) * 100) round 1}}}} percent o hits population identify Swadish as a [[mother-tongue|mither-tongue]].<ref name="population_by_language"/>
==History==
Turku haes a lang history as [[Finland]]'s lairgest ceety an occasionally as the admeenistrative centre o the kintra, but fir the last twa hunder years haes been surpassed bi [[Helsinki]]. The ceety's identity stems frae hits status as the auldest ceety in Finland<ref>{{cite web|url=http://www.visitfinland.com/W5/index.nsf/(pages)/Destinations |title=Destinations in Finland - Official Travel and Tourism Guide |publisher=Visitfinland.com |accessdate=2009-05-06}}</ref> an the kintra's first caipital. Oreeginally, the wird "Finland" referred anly tae the aurie aroond Turku (hence the title, "[[Finland Proper]]" fir the region).
[[File:Cathedral of Turku 1814.jpg|thumb|left|Cathedral o Turku, 1814.]]
Awtho airchaeological findins in the aurie date back tae the [[Stane Age]], the toun o Turku wis foondit in late 13t century.<ref>{{cite web|url= http://www.utu.fi/media/ajankohtaista/argumentit/AkiPihlman.html|title= Varhainen Turku rakennettiin pellolle|accessdate= 2008-05-06|author= Aki Pihlman|date= 2006-09-13|language= Finnish|archive-date= 2009-01-13|archive-url= https://web.archive.org/web/20090113003534/https://www.utu.fi/media/ajankohtaista/argumentit/AkiPihlman.html|url-status= dead}}</ref> The [[Cathedral o Turku]] wis [[consecration|consecratit]] in 1300.<ref name="Spicer2012">{{cite book|author=Andrew Spicer|title=Lutheran Churches in Early Modern Europe|url=http://books.google.com/books?id=GyErqszUsFYC&pg=PA314|year=2012|publisher=Ashgate Publishing, Ltd.|isbn=978-0-7546-6583-0|page=314}}</ref>
During the [[Middle Ages]], Turku wis the seat o the Bishop o Turku (a title later upgraded tae [[Airchdiocese o Turku|Airchbishop o Turku]]), coverin the then eastren hauf o the Kinrick o Swaden (maist o the present-day Finland) until the 17t century. Even gif Turku haed no offeecial caipital status, baith the short-lived institutions o [[Duke o Finland|Dukes]] an [[Govrenor-General in the Swadish Realm|Govrenors-General o Finland]] uisually haed thair Finnish residences thare. In the eftermath o the [[War against Sigismund]], the toun wis the steid o the [[Åbo bloodbath]]. In 1640, the first [[varsity]] in Finland, [[The Ryal Academy o Turku]], wis foondit in Turku. Turku wis an aa the meetin place fir the [[States o Finland]] in 1676.
[[File:Turku panorama late 19th century.jpg|thumb|right|450px|Panorama o Turku, late o 19t century]]
Efter the [[Finnish War]], which ended whan [[Swaden]] ceded Finland tae [[Roushien Empire|Imperial Roushie]] at the [[Treaty o Fredrikshamn]] in 1809, Turku acame briefly the offeecial caipital, but suin lost the status tae Helsinki, as [[Emperor]] [[Alexander I o Roushie|Alexander I]] felt that Turku wis too far frae Roushie an too aligned wi Swaden tae serve as the caipital o the [[Grand Duchy o Finland]]. {{Citation needed|date=June 2008}} The chynge offeecially teuk place in 1812. The govrenment offices that remained in Turku war finally moved tae the new caipital efter the [[Great Fire o Turku]], which awmaist completely destroyed the ceety in 1827. {{Citation needed|date=September 2008}} Efter the fire, a new an safer ceety plan wis drawn up bi [[Germany|German]] [[architect]] [[Carl Ludvig Engel]], who haed an aa designed the new caipital, Helsinki. Turku remained the lairgest ceety in Finland fir anither twinty years.
[[File:Aurakatu 1910's.jpg|thumb|right|Aurakatu aurie in 1910s]]
In 1918, a new varsity, the [[Åbo Akademi]] – the anly [[Swadish leid]] varsity in Finland – wis foondit in Turku. Twa years later, the [[Finnish leid]] [[Varsity o Turku]] wis foondit alangside hit. Thir twa varsities are the seicont an third tae be foondit in Finland, baith bi private donations.
In the 20t century Turku wis cried "Finland's gateway to the West" bi historians sic as Jarmo Virmavirta. The ceety enjoyed guid connections wi ither [[Western Europe]]an countries an ceeties, especially syne the 1940s wi [[Stockholm]] across the [[Gulf o Bothnie]]. In the 1960s, Turku became the first Wastren ceety tae sign a [[toun twinnin|twinnin]] agreement wi [[Saint Petersburg|Leningrad]] in the [[Soviet Union]], leadin tae greater inter-cultural exchange an providin a new meanin tae the ceety's 'gateway' function. Efter the faw o [[Communism]] in [[Roushie]], mony prominent Soviets came tae Turku tae study Western business practices {{Citation needed|date=June 2008}}, amang them [[Vladimir Putin]], then Leningrad's deputy [[mayor]].<ref>Virmavirta</ref>
As fir airchitectur in the ceety, baith the body o airchitectural styles as well as the prevalent wey o livin hae experienced significant changes in the 20t century. While haein survived relatively intact throughout the years o war 1939–1945, the ceety faced increasin changes in the 1950s an 1960s due tae risin demands fir apartments, the eagerness tae rebuild an maist o aw the new development o infrastructure (especially increased automobile traffeck). The widden ane- tae twa-story hooses that war the dominant mode o biggin in the ceety wur maistly demolished in the 1950s an 1960s tae baith enable mair efficient biggin an tae ease car traffeck. This resultit in the destruction o biggins that wis in later decades seen as beautiful an worth savin. Some individual biggins remain controversial tae this day whan hit comes tae thair demolition in the decades efter the war. fir example, the biggin o Hotel Phoenix that stood on corner o [[Mercat Squerr, Turku|Kauppatori]] wis torn down tae mak wey fir a lairge, multistory apartment biggin in 1959. The biggin wis significant baith fir hits location an history: havin stood on ane o the maist valuable lots in the ceety centre syne 1878 the biggin haed fir example served as the first main biggin o the Varsity o Turku. Ither biggins whose demolition wis seen as scandalous aither already at the time o action or proved tae be sae in later years include The Nobel Hoose (subject tae the very first photograph ever taken in Finland) an the biggin o Old Hotel Börs which wis biggit in jugendstil in 1909 bi Frithiof Strandel.
==Name==
The Finnish name ''Turku'' oreeginates frae an [[Old East Slavic]] wird, ''tǔrgǔ'', meanin "[[market place]]".<ref>{{cite web|url=http://www.katajala.net/keskiaika/suomi/kaupungit.html |title=Keskiaika - Suomen kaupungit keskiajalla |publisher=Katajala.net |date= |accessdate=2011-09-16}}</ref> The wird ''turku'' still means "market place" in some idioms in Finnish. The Swedish wird fir "market place" is ''torg'', an wis probably borrowed frae Old East Slavic, an wis present already in [[Old Swedish]].<ref>''[[Svenska Akademiens ordbok]]'', "torg", column T2031 [http://g3.spraakdata.gu.se/saob/show.phtml?filenr=2/52/241.html] {{Webarchive|url=https://web.archive.org/web/20150209001917/http://g3.spraakdata.gu.se/saob/show.phtml?filenr=2/52/241.html |date=2015-02-09 }}</ref>
The Swedish name ''Åbo'' mey be a semple combination o ''å'' ("river; creek; large stream") an ''bo'' ("dwellin"). As this pattern daes nae appear in ony ither Swedish place names in Finland, etymologists believe thare coud be a different explanation. Ane theory is that hit comes frae "Aabo", the Finnish rendition o the Roushie "Avram" ([[Abraham]]), which coud an aa be the origin o the name o the river [[Aura (Finland)|Aura]].<ref>[[YLE]], ''1000 km ortnamn'', 2003, http://vetamix.net/video/ortnamnet-%C3%A5bo_2273. Retrieved 2015-</ref> Thare is houiver an auld legal term cried "[[:sv:åborätt|åborätt]]" (meanin roughly "right to live at"), which gae ceetizens (cried "åbo") the inheritable right tae live at land ained bi the croun.<ref>[[:sv:Åborätt]]</ref>
In [[Finnish language|Finnish]], the [[Finnish noun cases|genitive]] o ''Turku'' is '''''Turun''''', meanin "o Turku". The Finnish names o organisations an institutes o Turku eften begin wi this wird, as in ''Turun yliopisto'' fir the [[Varsity o Turku]].
==Geografie==
[[File:Aura River Turku.jpg|thumb|right|[[Aura River (Finland)|Aura River]] seen further frae central Turku.]]
Locatit at the mooth o the [[Aura River (Finland)|Aura river]] in the soothwastren corner o Finland, Turku covers an aurie o {{convert|245|km2}} o land, spread ower baith banks o the river. The eastren side, whaur the Cathedral o Turku is locatit, is popularly referred tae as ''täl pual jokke'' ("this side o the river"), while the wastren side is referred tae as ''tois pual jokke'' ("the ither side o the river"). The ceety centre is locatit close tae the river mooth, on baith sides o the river, tho development haes recently been expandin wastward. {{Citation needed|date=January 2009}}
Thare are ten brigs ower the Aura river in Turku. The auldest o the current brigs is ''Auransilta'', which wis constructit in 1904. The newest brig is ''Kirjastosilta'' ('leebrar brig'), a pedestrian-anly brig biggit in 2013.<ref>{{cite web |url=http://www.turku.fi/public/?contentid=480599&nodeid=23 |title=Kirjastosilta avattiin tulen ja valon juhlassa |publisher=www.turku.fi |accessdate=2014-01-10 |archive-date=2014-01-14 |archive-url=https://web.archive.org/web/20140114100705/https://www.turku.fi/public/?contentid=480599&nodeid=23 |url-status=dead }}</ref> The ''Föri'', a smaw [[ferry]] that transports pedestrians an [[bicycle]]s across the river wioot payment, is a weel kent featur o the ceety.
Wi a population o approximately 300,000 {{Citation needed|date=September 2008}}, the [[Turku sub-region|Turku Region]] ([[Local admeenistrative unit|LAU]] 1) is the third lairgest urban region in Finland, efter [[Greater Helsinki]] an the aurie aroond [[Tampere]]. The region includes, in addition tae the ceety itsel the follaein municipalities: [[Askainen]], [[Kaarina]], [[Lemu]], [[Lieto]], [[Masku]], [[Merimasku]], [[Mynämäki]], [[Naantali]], [[Nousiainen]], [[Paimio]], [[Piikkiö]], [[Raisio]], [[Rusko]], [[Rymättylä]], [[Sauvo]], [[Vahto]] an [[Velkua]].
A mair exclusive definition fir the urban aurie is the [[Turku sub-region|ceety region o Turku]] wi a population aroond 235,000 consistin o fower major municipalities Kaarina, Raisio, Naantali an Turku.
==Admeenistrative subdiveesions==
{{Main|Subdiveesions o Turku}}
[[File:Stålarminkatu-Mestarinkatu.jpg|thumb|right|[[IV Destrict, Turku|IV Destrict]] or Martti is ane o the smawest but maist densely populatit destricts o Turku.]]
The ceety is dividit intae 78 destricts an nine [[Ward (kintra subdiveesion)|wards]] that dae nae function as local govrenment units. Thare are, houiver, some projects that are based on the destrict diveesions, pairteecularly in the eastren pairt o the ceety, whaur unemployment is heich in certaint auries. The lairgest populatit destricts are Varissuo an Runosmäki. Bi aurie, houever, [[Kakskerta]] an [[Paattinen]], formed frae umwhile municipalities that war annexed tae the ceety proper in the mid-20t century, constitute the lairgest districts. {{citation needed|date=April 2012}}
As mony o the smaa neighbourin [[municipalities o Finland|municipalities]] frae the north an sooth o the ceety wur annexed durin the mid-20t century, Turku is the day shaped lik an elongatit [[peir]]. The ceety centre an maist o the suburban auries lie in the middle, separatit frae the less densely populatit northren rural auries bi the Turku [[Bypass (road)|bypass]], that forms pairt o [[European route E18]]. Islands sic as [[Ruissalo]], [[Hirvensalo]] an [[Kakskerta]], formin the soothren pairt o the ceety, are an aa sparsely populat itan maistly contain simmer residences, wi the exception o some destricts in Hirvensalo which are currently growin intae [[upper middle class|upper-middle-class]] [[suburb]]s.
==Climate==
[[File:Autumn in Turku.jpg|thumb|Aurie o [[Turku cathedral]] in hairst.]]
Situatit bi the [[Baltic Sea]] an sheltered bi the islands o the [[Archipelago Sea]], Turku haes a [[humid continental]] climate. Lik much o soothren Finland, the ceety experiences warm simmers, wi [[temperatur]]s rangin up tae 30 °C (86 °F), an relatively cauld winters wi frequent [[snaw]]faw. The warmest month o the year is Julie, wi an average temperatur o {{convert|17.5|°C|0|abbr=on}}, whauras the cauldest month is Februar. The average year-roond temperatur is {{convert|5.5|°C|0|abbr=on}}. Winter uisually staorts in early December, an ware in late Mairch.
[[Precipitation (meteorology)|Preceepitation]] in Turku averages {{convert|720|mm|1|abbr=on}} a year. The rainiest month o the year is August, whan the ceety receives on average {{convert|80|mm|1|abbr=on}} o rainfaw. In Aprile, the driest month o the year, the figur is anly {{convert|32|mm|1|abbr=on}}. The average [[air pressur]] at sea level is {{convert|101.2|kPa|inHg}}, wi little variance throughoot the year.
Operational syne 1955, the ceety's [[wather station]] is locatit at an altitude o 47 metres (154 ft) at [[Turku Airport]].<ref>'Turku' at EuroWeather</ref>
{{Weather box
|location = Turku
|metric first = Y
|single line = Y
|Jan record high C = 8.5
|Feb record high C = 10.2
|Mar record high C = 15.8
|Apr record high C = 24.5
|May record high C = 30.0
|Jun record high C = 32.0
|Jul record high C = 35.9
|Aug record high C = 32.6
|Sep record high C = 27.8
|Oct record high C = 18.9
|Nov record high C = 11.2
|Dec record high C = 10.0
|Year record high C = 35.9
|Jan high C = -1.7
|Feb high C = -2.1
|Mar high C = 2.0
|Apr high C = 8.8
|May high C = 15.5
|Jun high C = 19.5
|Jul high C = 22.3
|Aug high C = 20.5
|Sep high C = 14.9
|Oct high C = 8.8
|Nov high C = 3.0
|Dec high C = -0.1
|Year high C = 9.3
|Jan mean C = -4.4
|Feb mean C = -5.2
|Mar mean C = -1.6
|Apr mean C = 4.0
|May mean C = 10.2
|Jun mean C = 14.4
|Jul mean C = 17.5
|Aug mean C = 16.0
|Sep mean C = 11.0
|Oct mean C = 5.9
|Nov mean C = 0.8
|Dec mean C = -2.6
|Year mean C = 9.3
|Jan low C = -7.3
|Feb low C = -8.3
|Mar low C = -4.9
|Apr low C = -0.2
|May low C = 4.8
|Jun low C = 9.3
|Jul low C = 12.6
|Aug low C = 11.6
|Sep low C = 7.2
|Oct low C = 3.2
|Nov low C = -1.6
|Dec low C = -5.6
|Year low C = 1.8
|Jan record low C = -35.5
|Feb record low C = -35.2
|Mar record low C = -32.8
|Apr record low C = -21.0
|May record low C = -6.6
|Jun record low C = -2.2
|Jul record low C = 1.8
|Aug record low C = 0.2
|Sep record low C = -6.9
|Oct record low C = -15.0
|Nov record low C = -22.3
|Dec record low C = -33.8
|Year record low C = -35.5
|precipitation colour = green
|Jan precipitation mm = 61
|Feb precipitation mm = 42
|Mar precipitation mm = 43
|Apr precipitation mm = 32
|May precipitation mm = 39
|Jun precipitation mm = 59
|Jul precipitation mm = 79
|Aug precipitation mm = 80
|Sep precipitation mm = 64
|Oct precipitation mm = 78
|Nov precipitation mm = 76
|Dec precipitation mm = 70
|Jan precipitation days = 11
|Feb precipitation days = 8
|Mar precipitation days = 9
|Apr precipitation days = 7
|May precipitation days = 7
|Jun precipitation days = 8
|Jul precipitation days = 9
|Aug precipitation days = 11
|Sep precipitation days = 9
|Oct precipitation days = 12
|Nov precipitation days = 13
|Dec precipitation days = 12
|Jan sun = 40
|Feb sun = 75
|Mar sun = 134
|Apr sun = 204
|May sun = 284
|Jun sun = 276
|Jul sun = 287
|Aug sun = 230
|Sep sun = 155
|Oct sun = 89
|Nov sun = 38
|Dec sun = 27
|year sun =
|source 1 = Climatological statistics for the normal period 1981–2010 <ref name="fmi.fi">{{cite web|url=http://en.ilmatieteenlaitos.fi/normal-period-1981-2010 |title=Normal period 1981-2010 |accessdate=12 October 2012}}</ref>
|date=February 2011
}}
==Govrenment an politics==
[[File:Turun hovioikeus.jpg|thumb|The Coort o Appeal an Academy Hoose o Turku.]]
Bein baith a [[regions o Finland|regional]] an [[provinces o Finland|provincial]] caipital, Turku is an important admeenistrative centre, hostin the seat o the [[Airchdiocese o Turku|Airchbishop o Finland]] an a [[Appellate coort|Coort o Appeal]]. [[Aleksi Randell]] haes been the mayor o Turku syne 2010.
The [[ceety cooncil]] an ceety buird hae lang been dominatit bi the [[Social Democratic Pairty o Finland|Social Democratic Pairty]] (SDP) an the [[Naitional Coaleetion Pairty (Finland)|Naitional Coaleetion Pairty]] (''Kokoomus/Samlingspartiet''), wi approximately equal representation. Currently, the cooncil haes 67 members, wi 19 frae ''Kokoomus'' an 14 frae SDP. The ither major pairties in the cooncil are the [[Green League]] (10 seats), the [[Left Alliance (Finland)|Left Alliance]] (9 seats) an The Finns (6 seats). The current chair o the ceety buird is [[Minna Arve]] frae ''Kokoomus''.
Results o the [[Finnish parliamentary election, 2011]] in Turku:
*[[Naitional Coalition Pairty]] 23.7%
*[[Social Democratic Pairty o Finland|Social Democratic Pairty]] 19.4%
*[[True Finns]] 15.8%
*[[Left Alliance (Finland)|Left Alliance]] 12.7%
*[[Green League]] 11.4%
*[[Swedish People's Party]] 5.8%
*[[Centre Party (Finland)|Centre Party]] 4.7%
*[[Christian Democrats (Finland)|Christian Democrats]] 3.1%
==Transport==
{{See also|Turku tram}}
[[File:Electric locomotives at Turku railway station..jpg|200px|thumb|left|[[Locomotive]]s at [[Turku Central railway station]].]]
[[File:Turku Postcard landscape.jpg|thumb|200px|left|[[Viking Line]]'s [[MS Isabella]] on her wey in the Turku Archipelago.]]
fir a ceety o hits size, Turku haes a moderate [[public transport]] network o [[bus]] routes, which is comparable tae bus network o seemilar-sized [[Tampere]]. The bus network is managed an supervised bi the ''Ceety o Turku Public Transport Office'' ({{lang-fi|Turun joukkoliikennetoimisto}}, {{lang-sv|Åbo kollektivtrafikkontor}}), an is operatit mainly bi private companies. {{Citation needed|date=June 2008}} Regional buses are operatit bi private companies, maist importantly [[TLO]], wi very frequent services especially tae the neighbourin ceeties o Naantali, Raisio, an Kaarina.
Rail traffeck tae an frae Turku is handled bi the Finnish naitional carrier, [[VR (Finnish railway company)|VR]]. The nummer o services haes fallen an anly the railways towards Tampere an Helsinki are nou in uise. The railway stations currently uised fir passenger traffeck are the [[Turku Central railway station]] in [[Pohjola, Turku|Pohjola]], an twa smawer stations in [[Kupittaa]] an the [[Port o Turku]].
Thare is no local rail traffeck at the moment, as the ceety's popular [[tram]] services war discontinued in 1972, an the various local railway lines tae neighbourin towns an municipalities war aw abolished during the late 20t century. {{Citation needed|date=October 2008}} Houever, thare are plans fir a [[licht rail]] seestem in the Turku region in the near future. This seestem wad mair ably serve major suburbs o the ceety sic as Varissuo an Runosmäki, as well as the neighbourin ceeties.<ref>{{cite web |url=http://www.raitio.org/historia/pika/pika.htm |title=Raitiovaunulla Naantaliin, Kaarinaan, Runosmäkeen, Varissuolle? |accessdate=2008-07-11 |last=Laaksonen |first=Mikko |work=raitio.org |publisher=Finnish Tramways Society |language=Finnish |archive-date=2016-10-07 |archive-url=https://web.archive.org/web/20161007180424/http://www.raitio.org/historia/pika/pika.htm |url-status=dead }}</ref>
The State o Finland haes annoonced plans tae support [[Espoo]] wi 30% o full expenses on a new metro rail, the Regional Cooncil o Soothwast Finland is gangin tae uise this as a test case fir a new licht rail network in Turku.:<ref>{{cite web |url=http://www.turunsanomat.fi/kotimaa/?ts=1,3:1002:0:0,4:2:0:1:2006-09-27,104:2:407945,1:0:0:0:0:0 |title=Turun Sanomat |publisher=Turunsanomat.fi |date=2006-09-27 |accessdate=2009-05-06 |archive-date=2007-06-30 |archive-url=https://archive.today/20070630122159/http://www.turunsanomat.fi/kotimaa/?ts=1,3:1002:0:0,4:2:0:1:2006-09-27,104:2:407945,1:0:0:0:0:0 |url-status=dead }}</ref>
The Turku Bus Station an the [[Turku Central Railway Station]] are currently locatit in different places. The Ceety o Turku is plannin tae combine thir twa in a new greater station complex in the near future. This new traivel centre will conseest o a hotel an several shoppin estates. This centre will connect aw public transportation frae commuter trains tae lang distance buses.
[[Turku Airport]] is locatit {{convert|8|km|0|abbr=off}} tae the north o the ceety centre, partly in the neighbourin municipality o [[Rusko]].
Thare are an aa daily ferry services frae the [[Port o Turku]] tae Swaden an the [[Åland Islands]], operatit i [[Silja Line]], [[Viking Line]] an [[SeaWind Line]]. Thir are something o a Finnish cultural tradeetion (see [[ruotsinlaiva]]), an fowk eften traivel lang distances across Finland tae Turku juist tae tak a [[cruisin (maritime)|cruise]] across the Gulf o Bothnie.
The [[archipelago sea]] boat traffeck is handled bi, amang others, [[S/S Ukkopekka]], an auld [[steamship]] that cruises on the route Turku-[[Naantali]]-Turku.
Turku is the anly ceety in Finland tae hae three lang-distance railway stations: [[Turku Central railway station|Turku Central]], [[Port o Turku]], an [[Kupittaa railway station|Kupittaa]].
==Demographics==
[[File:Turku Vappu 2008.jpg|thumb|Fowk celebratin [[Vappu]] in central Turku.]]
At the end o 2004 the Turku region (includin the [[destricts o Finland|economic destricts]] o Turku an Åboland) haed a population o 319,632, oot o which 174,824 fowk lived in the ceety o Turku. The ceety's population density is 718 indwallers per square kilometre.<ref>{{cite web |url=http://www.turku.fi/Public/default.aspx?contentid=97662&nodeid=4907&culture=en-US&contentlan=2 |title=www.turku.fi » turku.fi » Turku.info » Publications and Reports |publisher=turku.fi |date=2008-06-25 |accessdate=2009-05-06 |archive-date=2011-07-16 |archive-url=https://web.archive.org/web/20110716095845/https://www.turku.fi/Public/default.aspx?contentid=97662&nodeid=4907&culture=en-US&contentlan=2 |url-status=dead }}</ref>
89.4% o Turku's population speak Finnish as thair [[native leidile 5.2% speak Swedish. The next maist widely spoken languages are [[Roushie leid|Roushie]] (1.3%), [[Arabic leid|Arabic]] (0.6%), [[Albanie leid|Albanie]] (0.5%). 95.8% o the population are [[Finnish naitionality law|Finnish ceetizens]], an the maist sizeable minorities are frae [[Roushie]], [[Estonia]], [[Iraq]], an [[Iran]]. Lik aw ither Finnish ceeties, Turku daes nae collect information aboot the ethnic an releegious makeup o hits population.<ref>see ''Turun kaupungin tilastollinen vuosikirja, 2005/2006''</ref>
==Notable fowk==
Famous fowk frae the ceety o Turku include:
*[[Paavo Nurmi]], The [[Flying Finn]], a Finnish 9 time Olympic Champion in lang-distance runnin
*[[Mauno Koivisto]], the 9t Preses o Finland
*[[Matti Salminen]], a Finnish bass sangster
*[[Johan Gadolin]], a Finnish chemist, physicist an mineralogist
*[[Herman Spöring]], a Finnish explorer an botanist
*[[Miikka Kiprusoff]], a Finnish umwhile professional ice hockey goalkeeper who played in [[Calgary Flames]] an [[San Jose Sharks]] during his [[NHL]] career
*[[Christina Krook]] (1742-1806), educator
*The brothers [[Saku Koivu|Saku]] an [[Mikko Koivu]], Finnish ice hockey players playin respectively in [[Anaheim Ducks]] an [[Minnesota Wild]] as an alternate captain an captain.
*[[Darude]], a Finnish dance muisicker, airtist o the hit sang [[Sandstorm (Darude composition)|Sandstorm]]
*[[Teemu Brunila]], a Finnish sangster, songwriter, muisicker an producer
*[[Michael Monroe]], a Finnish rock muisicker, the vocalist o [[Hanoi Rocks]]
*[[Makwan Amirkhani]], Kurdish Finnish MMA fighter in [[UFC]]
*[[Jarno Saarinen]], Grand Prix motorcycle racer
The Turku region haes an aa brought forth mony prominent personalities, includin the [[marshal]], [[Carl Gustaf Emil Mannerheim|Carl Gustaf Mannerheim]].
==Economy==
[[File:Oasis of the Seas 2009-10-18.jpg|thumb|right|[[MS Oasis o the Seas]], the world's lairgest passenger ship wis biggit in Turku.]]
The business destrict in the ceety's economy is centred on the [[Port o Turku]] an ither service-orientit industries. The ceety is an aa a renowned [[high-tech]] centre – the [[Turku Science Park]] aurie in Kupittaa hosts ower 300 companies {{citation needed|date=April 2012}} frae the fields o [[biotechnology]] an [[information technology]], as well as several institutions o heicher learnin that wirk in closely wi the business sector. This cooperative element is seen as a parteecularly important factor wi regards tae the ceety's expectit future economic development, as outlined in the ''Turku Strategy'' that is published annually bi the ceety cooncil. {{citation needed|date=April 2012}}
At least the follaein major Finnish companies hae thair corporate headquarters in Turku: [[HKScan]] an [[Hesburger]]. Ither major companies which hae operations in Turku include [[Bayer]], [[Fläkt Woods]], [[Meyer Werft]], [[Orion Corporation]] an [[Wärtsilä]].
As o 2007, the ceety's [[unemployment]] rate is 9.4%.<ref name="pdf">{{Cite web |url=http://www.turku.fi/Public/download.aspx?ID=59428&GUID=%7B2171A3CC-D0CC-4ACF-A894-86B962BE8B58%7D |title=Archived copy |access-date=2021-01-19 |archive-date=2015-05-12 |archive-url=https://web.archive.org/web/20150512120623/http://www.turku.fi/Public/download.aspx?ID=59428&GUID=%7B2171A3CC-D0CC-4ACF-A894-86B962BE8B58%7D |url-status=dead }}</ref> The problem o unemployment is houever troublesome in the destricts o [[Pansio]], [[Lauste]], an Varissuo, whaur hit hovers at aroond 16%.<ref>{{Cite web |url=http://www.turku.fi/Public/download.aspx?ID=59731&GUID=%7B246B196C-9A7D-4975-8431-50D14A1405D8 |title=Archived copy |access-date=2021-01-19 |archive-date=2015-05-11 |archive-url=https://web.archive.org/web/20150511044102/http://www.turku.fi/Public/download.aspx?ID=59731&GUID=%7B246B196C-9A7D-4975-8431-50D14A1405D8 |url-status=dead }}</ref>
==Education==
[[File:Turun yliopisto.jpg|thumb|right|The main biggin o the [[Varsity o Turku]].]]
Turku haes a langer eddicational history than ony ither Finnish ceety – the first schuil in the ceety, the [[Katedralskolan i Åbo|Cathedral School]], wis foondit alang wi the Cathedral o Turku in the late 13t century. The first [[varsity]] in Finland, the "[[The Ryal Academy o Turku]]" (nou [[Varsity o Helsinki]]), wis established in the ceety in 1640. In 1820, the first school in Finland conformin tae the [[Bell-Lancaster method]] wis foondit in Turku wi the aim o makin primary eddication mair inclusive tae the lawer classes.
Turku is home tae aboot 35,000 higher eddication students.<ref>{{cite web |url=http://www.turku.fi/Public/default.aspx?nodeid=4904&culture=en-US&contentlan=2 |title=www.turku.fi » turku.fi » Turku.info » Turku in Brief |publisher=turku.fi |accessdate=2009-05-06 |archive-date=2011-07-16 |archive-url=https://web.archive.org/web/20110716095212/https://www.turku.fi/Public/default.aspx?nodeid=4904&culture=en-US&contentlan=2 |url-status=dead }}</ref> Thare are twa varsities an several "[[Varsity o applied sciences (Finland)|polytechnics]]" in the toun.
The Finnish [[Varsity o Turku]] is the seicont lairgest varsity in Finland (18,000 students), as measurt bi student enrollment, an ane o the auldest as well, havin been foondit in 1920. [[Åbo Akademi]], foondit 1918 as the seicont varsity o Finland, is Finland's anly Swedish-leid varsity. [[Turku School of Economics|Turku School o Economics]] merged wi The Varsity o Turku in 2010, an Åbo handelshögskola, hits Swedish counterpart, wi Åbo Akademi 1980. The central hospital o Turku, [[TYKS|Turku Varsity Hospital]], is affiliatit wi the Varsity an hit is uised as a teachin hospital.
[[Turku Varsity o Applee'd Sciences]] is the seicont lairgest [[Institute o technology#Finland|polytechnic]] in Finland efter Metropolia Varsity o Applee'd Sciences. An aa [[Novia Varsity o Applee'd Sciences]] an [[Diaconia Varsity o Applee'd Sciences]] hae campuses in the toun.
Turku is ane o anly twa ceeties in Finland tae hae an established [[international school]] (the ither ceety bein Helsinki). [[Turku International School]], locatit in the eastren destrict o [[Varissuo]], haes been operatin syne 2003. Bi an agreement signed atween the ceety o Turku an the [[Varsity o Turku]], [[Turun normaalikoulu]] takes care o the teachin in the international school.<ref>{{cite web|url= http://www.tnk.utu.fi/index.php?id=1389&news_id=125&archive=|title= Turku International School|publisher= [[Varsity o Turku]]|date= 15 January 2006|access-date= 2015-06-01|archive-date= 2008-12-26|archive-url= https://web.archive.org/web/20081226054046/http://www.tnk.utu.fi/index.php?id=1389&news_id=125&archive=|url-status= dead}}</ref>
==Media==
[[File:Turun kaupunginkirjaston päärakennus.jpg|thumb|Main librar o Turku]]
The maist widely read [[leet o Finnish newspapers|newspaper]] o Turku, an the aurie aroond hit, is the daily regional morning newspaper ''[[Turun Sanomat]]'', wi a readership o ower 70% o the population every day. ''[[Åbo Underrättelser]]'', a Swedish leid newspaper published in Turku, is the auldest newspaper in Finland, havin been published syne 1824. The free-o-charge ''Turkulainen'' newspaper is an aa amang the maist popular newspapers, thegither wi the local edeetion o ''[[Metro International]]'' an the naitional evening [[Tabloid (newspaper format)|tabloid]] ''[[Ilta-Sanomat]]''.<ref>see ''Tutkimus: Lehtien lukijapeitot''</ref> Thare are an aa a nummer o local newspapers sic as ''Kulmakunta'' (fir the eastren suburbs o Turku, includin Varissuo an Lauste), an ''Rannikkoseutu'' (fir the aurie aroond the neighbourin ceeties o Raisio an Naantali).
The first Finnish newspaper ''[[Tidningar Utgifne Af et Sällskap i Åbo]]'', in Swedish, wis stairtit in Turku in 1771,<ref>Finnish Wikipedia article about Tidningar Utgifne Af et Sällskap i Åbo: http://fi.wikipedia.org/wiki/Tidningar_Utgifne_Af_et_S%C3%A4llskap_i_%C3%85bo</ref> as well as the first Finnish-leid newspaper ''[[Suomenkieliset Tieto-Sanomat]]'' which wis stairtit in 1775.
The newspaper, ''Turun Sanomat'', an aa operates a regional [[televeesion]] station, cried ''Turku TV''. The Finnish naitional broadcaster, ''[[Yleisradio]]'', screens local news, daily frae Monday tae Friday, fir the Soothwast Finland (includin the regions o [[Finland Proper (region)|Finland Proper]] an [[Satakunta (region)|Satakunta]]) residents. Aw [[leet o Finnish televeesion channels|Finnish naitional TV channels]] are viewable an naitional radio channels audible in the Turku aurie. In addeetion, a nummer o local [[radio]] stations, e.g. ''Auran Aallot'', ''Radio Sata'' an ''Radio Robin Hood'' are operational. Local [[public broadcastin|public service]] radio stations are ''YLE Turun Radio'' in Finnish leid (the regional version o [[YLE Radio Suomi]]) an ''YLE Radio Vega Åboland'' in Swadish leid (the regional version o [[YLE Radio Vega]]).
==Cultur==
[[File:Turun tuomiokirkko.jpg|thumb|right|The [[Cathedral o Turku]], ane o the maist notable historical biggins in Finland.]]
[[Cultur o Finland|Cultural venues]] in Turku include several [[theatre]]s, [[movie theater|cinemas]], an [[airt gallery|airt galleries]], an a ceety philharmonic [[orchestra]]. The ceety's cultural centre organises a nummer o regular events, maist notably the [[Medieval Mercat o Turku|Medieval Mercat]] in Julie each year. Turku is an aa the offeecial [[Christmas]] ceety o Finland, an 'Christmas Peace' in Finland is declared on every 24 December frae the Brinkkala Hall balcony. The [[Turku Music Festival]] an the [[rock festival]] [[Ruisrock]] (held on the island o [[Ruissalo]]) are amang the auldest o hits kynd in [[Scandinavie]]. The ceety an aa hosts anither rock festival, [[Down by the Laituri|Down bi the Laituri]], an ane o the lairgest electronic music festivals in Northren Europe, UMF<ref>{{cite web|url=http://www.uudenmusiikinfestivaali.org/ |title=www.uudenmusiikinfestivaali.org |publisher=www.uudenmusiikinfestivaali.org |date= |accessdate=2011-09-16}}</ref> (Uuden Musiikin Festivaali, "New Music Festival"), in addition tae a vibrant nightlife, centred on the Market Square.
Thare are an aa numerous [[museum]]s, sic as the Turku Airt Museum an the [[Wäinö Aaltonen Museum o Airt]]. The Åbo Akademi Varsity maintains the [[Sibelius Museum]], which is the anly museum in Finland specialisin in the field o miusic. Apart frae thir, thare are an aa several historical museums that display the ceety's medieval period, sic as the [[Turku Castle]], which haes been a functional historical museum syne 1881, an the ''[[Aboa Vetus]]'' museum, biggit in the late 1990s ower the 14t century [[Archaeology|archaeological]] site. The ''[[Luostarinmäki]]'' [[handicrafts]] museum, convertit frae residential biggins that survived the [[Great Fire o Turku]] in 1827, wis the first [[Scandinavia]]n venue tae receive the "Golden Apple" tourism awaird.
Turku is [[European Capital o Culture]] in 2011, an the ceety cooncil haes approved numerous projects tae boost the ceety's image in preparation fir that status.
The [[Declaration o Christmas Peace]] haes been a tradeetion in Finland frae the Middle Ages every year, except in 1939 due tae the [[Winter War]]. The declaration takes place on the [[Old Great Square (Turku)|Old Great Squerr o Turku]], Finland's offeecial 'Christmas Ceety', at noon on Christmas Eve. The declaration ceremony begins wi the hymn ''Jumala ompi linnamme'' ([[Martin Luther]]'s ''[[Ein feste Burg ist unser Gott]]'') an continues wi the Declaration o Christmas Peace read frae a [[pairchment]] row in Finnish an Swadish.
==Sports==
[[File:Paavo Nurmi Marathon, 2007, Aurakatu.jpg|thumb|[[Paavo Nurmi Marathon (Turku)|Paavo Nurmi Marathon]] is ran every simmer.]]
The ceety haes twa fitbaa teams playin at the tap naitional level, the ''[[Veikkausliiga]]'': [[FC Inter Turku|FC Inter]] an [[Turun Palloseura|TPS]], which is playin in seicont heichest level Ykkönen, but TPS is ane o the auldest fitbaa clubs in Finland. Baith teams play thair home matches at [[Veritas Stadion]] in the destrict o [[Kupittaa]].
[[HC TPS]] o Turku is ane o the maist successfu teams in Finnish ice hockey history. hit plays in the Finnish tap league, [[SM-liiga]]. HC TPS haes won the naitional championship 11 times, the latest bein frae saison 2009-2010. [[HK Arena]], locatit in the Artukainen destrict, is uised as the venue fir HC TPS gemmes.
The ''[[Paavo Nurmi Marathon (Turku)|Paavo Nurmi Marathon]]'' is an annual sportin event in Turku, named efter the warld-famous runner [[Paavo Nurmi]], who wis born an raised in the ceety.
Finland's maist successfu [[tennis]] player, [[Jarkko Nieminen]], wis born an lifes in the neighbourin coonty o [[Masku]]
[[Turku Titans]] is a lacrosse club based in Turku wi a relevantly successfu history wi three siller medals an ane gowd medal in the naitional lacrosse league in Finland. The Titans weemen's team haes forby haed a successfu history.<ref>{{cite web |url=http://www.turkutitans.fi/club.htm |title=Turku Titans history |publisher=Turku Titans |accessdate=2010-07-18 |archive-date=2011-07-20 |archive-url=https://web.archive.org/web/20110720194200/https://www.turkutitans.fi/club.htm |url-status=dead }}</ref> The [[FIL U19 2012 World Lacrosse Championships]] are an aa held in the ceety.<ref>{{cite web |url=http://www.2012worldlacrosse.com/ |title=2012 World Lacrosse |publisher=FIL U19 2012 World Lacrosse Championships |accessdate=2010-07-18 |archive-date=2010-12-04 |archive-url=https://web.archive.org/web/20101204114031/http://www.2012worldlacrosse.com/ |url-status=dead }}</ref>
==Internaitional relations==
{{See an aa|Leet o twin touns an sister ceeties in Finland}}
===Twin touns — Sister ceeties===
Turku is [[twin touns an sister ceeties|twinned]] wi:
{| cellpadding="10"
|- style="vertical-align:top"
|
* [[File:Göteborg vapen.svg|25px]] [[Gothenburg]] in [[Swaden]] <small>(syne 1946)</small>
* [[File:Coat of arms of Aarhus.svg|25px]] [[Aarhus]] in [[Denmark]] <small>(syne 1946)</small>
* [[File:Bergen våpen.svg|25px]] [[Bergen]] in [[Norawa]] <small>(syne 1946)</small>
* [[File:Coat of Arms of Saint Petersburg (2003).svg|25px]] [[Saunt Petersburg]] in [[Roushie]] <small>(at the time, Leningrad, USSR) (syne 1953)</small>
* [[File:POL Gdańsk COA.svg|25px]] [[Gdańsk]] in [[Poland]] <small>(syne 1958)</small><ref name="Gdańsk">{{cite web|url=http://www.gdansk.pl/samorzad,62,733.html|title=Gdańsk Official Website: 'Miasta partnerskie'|publisher=[[copyright|©]] 2009 [http://www.gdansk.pl/ Urząd Miejski w Gdańsku]|language=Polish & English|accessdate=2009-07-11|archive-date=2013-07-23|archive-url=https://web.archive.org/web/20130723091807/http://www.gdansk.pl/samorzad%2C62%2C733.html|url-status=dead}}</ref>
* [[File:Rostock Wappen.svg|25px]] [[Rostock]] in [[Germany]] <small>(at the time, [[East Germany|German Democratic Republic]]) (syne 1963)</small>
* [[Varna]] in [[Bulgarie]] <small>(syne 1963)</small>
* [[File:ROU CT Constanta CoA.png|25px]] [[Constanţa]] in [[Romanie]] <small>(syne 1963)</small>
||
||
* [[File:DEU Koeln COA.svg|25px]] [[Cologne]] in [[Germany]] <small>(syne 1967)</small>
* [[File:HUN Szeged Címer.svg|25px]] [[Szeged]] in [[Hungary]] <small>(syne 1971)</small>
* [[File:Coat of Arms of Bratislava.svg|25px]] [[Bratislava]] in [[Slovakie]] <small>(at the time, [[Czechoslovakie]]) (syne 1976)</small><ref name="Bratislava">{{cite web|url=http://www.bratislava-city.sk/bratislava-twin-towns|title=''Bratislava City - Twin Towns''|publisher=[[copyright|©]] 2003-2008 Bratislava-City.sk|accessdate=2008-10-26}}</ref>
* [[File:FlorenceCoA.svg|25px]] [[Florence]] in [[Italy]] <small>(syne 1992)</small>
* [[File:National Emblem of the People's Republic of China.svg|25px]] [[Tianjin]] in [[Fowkrepublic o Cheenae]] <small>(syne 2000)</small>
* [[File:Tartu coat of arms.svg|25px]] [[Tartu]] in [[Estonie]] <small>(syne 2008)</small>
|}
Turku haes co-operation greements wi the follaein ceeties:
* [[File:Coat of arms of Tallinn (greater).svg|25px]] [[Tallinn]] in [[Estonie]] <small>(co-operation greement)</small>
* [[File:Kuressaare coatofarms.png|25px]] [[Kuressaare]] in [[Estonie]] <small>(co-operation greement)</small>
== Notes ==
{{reflist}}
{{Commonscat}}
{{FinlandProper}}
[[Category:Turku| ]]
[[Category:Ceeties an touns in Finland]]
[[Category:Municipalities o Finland Proper]]
{{Stub/Finland}}
{{Stub/Ceety}}
pmgfxhvlsbwdaitvn90annuuhwd0u7i
Leet o neo-Nazi organisations
0
13950
901687
849664
2025-01-03T19:18:45Z
Italiano1922
115108
901687
wikitext
text/x-wiki
{{fixscots|date=Januar 2021}}
This is a leet o '''[[Neo-Nazism|neo-Nazi]] organisations'''.
<!-- Only add groups with sources or Wikipedia articles saying they are neo-Nazi. Add new groups in alphabetical order.-->
===Africae===
*[[Afrikaner Weerstandsbeweging]] - Sooth Africae
*[[Blanke Bevrydingsbeweging]] - Sooth Africae
===Asia===
*[[Aryan League]] - (Naitional Socialist Aryan League - NSAL) - [[Iran]]
*[[Blue Mongolie]] - [[Mongolie]]<ref name="autogenerated1">{{cite web |last=Moxley |first=Mitch |url=http://www.time.com/time/magazine/article/0,9171,1910893,00.html |title=The Neo-Nazis of Mongolia: Swastikas Against China |publisher=TIME |date=2009-07-27 |accessdate=2009-11-03 |archive-date=2009-07-22 |archive-url=https://web.archive.org/web/20090722010422/http://www.time.com/time/magazine/article/0,9171,1910893,00.html |url-status=dead }}</ref>
*[[Dayar Mongol]] - [[Mongolie]]<ref name="autogenerated1"/>
*[[Mongolian Naitional Union]] - [[Mongolia]]<ref name="autogenerated1"/>
*[[Naitional Socialism Association]] - [[Taiwan]]
*[[Naitional Socialist Japanese Wirkers an Welfare Pairty]] - [[Japan]]
*[[SUMKA]] (Iran Naitional-Socialist Workers Party) - [[Iran]]
* [[Tsagaan Khass]] - [[Mongolie]]
===Europe===
* NS/WP - Ukraine
* RDK - Ukraine
* DSHRG Rusich - Roushie
* Azov - Ukraine
*[[Aime & Sers]] - [[Fraunce]]<ref>{{Cite web |url=http://aime-et-sers.com/ |title=Archived copy |access-date=2010-11-28 |archive-date=2010-11-15 |archive-url=https://web.archive.org/web/20101115164238/http://www.aime-et-sers.com/ |url-status=dead }}</ref>
*[[Chrysi Avyi]] (Golden Dawn) - [[Greece]]
*[[Imperium Europa]] - [[Maltae]]
*[[Kärntner Heimatdienst]] (Carinthian Homeland Service) - [[Carinthie (state)|Carinthie]]
*[[Legion Wasa]] - [[Swaden]]
*[[Nacionalni stroj]] (National Alignment) - [[Serbie]]
*[[National Bolshevik Party]] - [[Estonia]]<ref name=ucsj01JAN29 />
*[[National Socialist Movement of Denmark|Danmarks Nationalsocialistiske Bevægelse]] (Naitional Socialist Movement o Denmark) - [[Denmark]]
*[[Naitional Socialist Turkish Movement]] - [[Turkey]]
*[[Nationalsocialistisk Front]] (Naitional Socialist Front) - [[Swaden]]
*[[Norges Nasjonalsosialistiske Bevegelse]] (Naitional Socialist Movement o Norrowey) - [[Norrowey]]
*[[Norske Motstandsbevegelsen]] (Norwegian Resistance Movement) - [[Norrowey]]
*[[Pamyat]] - [[Roushie]]
*[[Roushie Naitional Unity]] - [[Roushie]], [[Estonie]]<ref name=ucsj01JAN29>{{cite web |url=http://www.ucsj.org/news/estonian-security-officer-neo-nazi-groups-skinheads |title=Estonian Security Officer on Neo-Nazi Groups, Skinheads, reported at Union of Councils for Jews in the Former Soviet Union |publisher=Ucsj.org |date= |accessdate=2009-11-03 }}{{Dead link|date=January 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
*[[TürkischeJugend]] - [[Turkey]]
*[[Suomen Vastarintaliike]] - (Finnish Resistance Movement) - [[Finland]]
*[[Svenska Motståndsrörelsen]] - (Swadish Resistance Movement) - [[Swaden]]
*[[Vigrid]] - [[Norrowey]]
*[[Vitt Ariskt Motstånd]] (White Aryan Resistance) - [[Swaden]]
===Internaitional===
*[[Blood an Honour]] - internaitional neo-Nazi netwirk
===North America===
*[[American Nazi Pairty]] - [[Unitit States]]
*[[Aryan Nations]] - [[Unitit States]] an [[Canadae]]
*[[Hammerskins]] - [[Unitit States]] an [[Canadae]]
*[[Heritage Front]] - [[Canadae]]
*[[Naitional Alliance (Unitit States)|Naitional Alliance]] - [[Unitit States]]
*[[Naitional Socialist Movement (Unitit States)|Naitional Socialist Movement]] - [[Unitit States]]
*[[Naitional Socialist Vanguard]] - [[Unitit States]]
*[[Northren Alliance (Canadae)|Northren Alliance]] - [[Canadae]]
*[[NSDAP/AO (1972)|NSDAP/AO]] - [[Unitit States]]
*[[White Aryan Resistance]]
*Atomwaffen Division - Unitit States
===Oceania===
*[[National Action]] - [[Australia]]
*[[New Zealand National Front]] - [[New Zealand]]
*[[Patriotic Youth League]] - [[Australia]]
===South America===
*[[Carecas do ABC]] (ABC region Skinheads) - [[Brazil]]
*[[New Triumph Party]] - [[Argentina]]<ref>{{cite web |url=http://pnt.libreopinion.com/ |title=Partido Nuevo Triunfo - Orden Nacional |publisher=Pnt.libreopinion.com |date= |accessdate=2009-11-03 |archive-date=2005-12-01 |archive-url=https://web.archive.org/web/20051201014732/http://pnt.libreopinion.com/ |url-status=dead }}</ref>
===Unitit Kinrick===
*[[British Movement]]
*[[Combat 18]]
*[[International Third Position]]
*[[League of St. George]]
*[[November 9th Society]] (kent as the British First Party an aw)
*[[National Socialist Movement (UK, 1962)|National Socialist Movement (1960s)]]
*[[National Socialist Movement (United Kingdom)|National Socialist Movement]]
*[[Flag Group|NF Flag Group]]
*[[White Nationalist Party]]
==Notes==
{{Reflist|2}}
{{Nazism}}
{{Antisemitism topics |state=collapsed}}
{{Racism topics |state=collapsed}}
[[Category:Antisemitism]]
[[Category:Neo-Nazism| ]]
[[Category:Neo-fascism]]
[[Category:Racism]]
tt3j6f8pob64a7cafde9hfi7bbqudwn
901693
901687
2025-01-03T21:46:08Z
CiphriusKane
74958
Undae revision [[Special:Diff/901687|901687]] bi [[Special:Contributions/Italiano1922|Italiano1922]] ([[User talk:Italiano1922|Tauk]])Dinnae hae airticles an is unsoorced
901693
wikitext
text/x-wiki
{{fixscots|date=Januar 2021}}
This is a leet o '''[[Neo-Nazism|neo-Nazi]] organisations'''.
<!-- Only add groups with sources or Wikipedia articles saying they are neo-Nazi. Add new groups in alphabetical order.-->
===Africae===
*[[Afrikaner Weerstandsbeweging]] - Sooth Africae
*[[Blanke Bevrydingsbeweging]] - Sooth Africae
===Asia===
*[[Aryan League]] - (Naitional Socialist Aryan League - NSAL) - [[Iran]]
*[[Blue Mongolie]] - [[Mongolie]]<ref name="autogenerated1">{{cite web |last=Moxley |first=Mitch |url=http://www.time.com/time/magazine/article/0,9171,1910893,00.html |title=The Neo-Nazis of Mongolia: Swastikas Against China |publisher=TIME |date=2009-07-27 |accessdate=2009-11-03 |archive-date=2009-07-22 |archive-url=https://web.archive.org/web/20090722010422/http://www.time.com/time/magazine/article/0,9171,1910893,00.html |url-status=dead }}</ref>
*[[Dayar Mongol]] - [[Mongolie]]<ref name="autogenerated1"/>
*[[Mongolian Naitional Union]] - [[Mongolia]]<ref name="autogenerated1"/>
*[[Naitional Socialism Association]] - [[Taiwan]]
*[[Naitional Socialist Japanese Wirkers an Welfare Pairty]] - [[Japan]]
*[[SUMKA]] (Iran Naitional-Socialist Workers Party) - [[Iran]]
* [[Tsagaan Khass]] - [[Mongolie]]
===Europe===
*[[Aime & Sers]] - [[Fraunce]]<ref>{{Cite web |url=http://aime-et-sers.com/ |title=Archived copy |access-date=2010-11-28 |archive-date=2010-11-15 |archive-url=https://web.archive.org/web/20101115164238/http://www.aime-et-sers.com/ |url-status=dead }}</ref>
*[[Chrysi Avyi]] (Golden Dawn) - [[Greece]]
*[[Imperium Europa]] - [[Maltae]]
*[[Kärntner Heimatdienst]] (Carinthian Homeland Service) - [[Carinthie (state)|Carinthie]]
*[[Legion Wasa]] - [[Swaden]]
*[[Nacionalni stroj]] (National Alignment) - [[Serbie]]
*[[National Bolshevik Party]] - [[Estonia]]<ref name=ucsj01JAN29 />
*[[National Socialist Movement of Denmark|Danmarks Nationalsocialistiske Bevægelse]] (Naitional Socialist Movement o Denmark) - [[Denmark]]
*[[Naitional Socialist Turkish Movement]] - [[Turkey]]
*[[Nationalsocialistisk Front]] (Naitional Socialist Front) - [[Swaden]]
*[[Norges Nasjonalsosialistiske Bevegelse]] (Naitional Socialist Movement o Norrowey) - [[Norrowey]]
*[[Norske Motstandsbevegelsen]] (Norwegian Resistance Movement) - [[Norrowey]]
*[[Pamyat]] - [[Roushie]]
*[[Roushie Naitional Unity]] - [[Roushie]], [[Estonie]]<ref name=ucsj01JAN29>{{cite web |url=http://www.ucsj.org/news/estonian-security-officer-neo-nazi-groups-skinheads |title=Estonian Security Officer on Neo-Nazi Groups, Skinheads, reported at Union of Councils for Jews in the Former Soviet Union |publisher=Ucsj.org |date= |accessdate=2009-11-03 }}{{Dead link|date=January 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
*[[TürkischeJugend]] - [[Turkey]]
*[[Suomen Vastarintaliike]] - (Finnish Resistance Movement) - [[Finland]]
*[[Svenska Motståndsrörelsen]] - (Swadish Resistance Movement) - [[Swaden]]
*[[Vigrid]] - [[Norrowey]]
*[[Vitt Ariskt Motstånd]] (White Aryan Resistance) - [[Swaden]]
===Internaitional===
*[[Blood an Honour]] - internaitional neo-Nazi netwirk
===North America===
*[[American Nazi Pairty]] - [[Unitit States]]
*[[Aryan Nations]] - [[Unitit States]] an [[Canadae]]
*[[Hammerskins]] - [[Unitit States]] an [[Canadae]]
*[[Heritage Front]] - [[Canadae]]
*[[Naitional Alliance (Unitit States)|Naitional Alliance]] - [[Unitit States]]
*[[Naitional Socialist Movement (Unitit States)|Naitional Socialist Movement]] - [[Unitit States]]
*[[Naitional Socialist Vanguard]] - [[Unitit States]]
*[[Northren Alliance (Canadae)|Northren Alliance]] - [[Canadae]]
*[[NSDAP/AO (1972)|NSDAP/AO]] - [[Unitit States]]
*[[White Aryan Resistance]]
===Oceania===
*[[National Action]] - [[Australia]]
*[[New Zealand National Front]] - [[New Zealand]]
*[[Patriotic Youth League]] - [[Australia]]
===South America===
*[[Carecas do ABC]] (ABC region Skinheads) - [[Brazil]]
*[[New Triumph Party]] - [[Argentina]]<ref>{{cite web |url=http://pnt.libreopinion.com/ |title=Partido Nuevo Triunfo - Orden Nacional |publisher=Pnt.libreopinion.com |date= |accessdate=2009-11-03 |archive-date=2005-12-01 |archive-url=https://web.archive.org/web/20051201014732/http://pnt.libreopinion.com/ |url-status=dead }}</ref>
===Unitit Kinrick===
*[[British Movement]]
*[[Combat 18]]
*[[International Third Position]]
*[[League of St. George]]
*[[November 9th Society]] (kent as the British First Party an aw)
*[[National Socialist Movement (UK, 1962)|National Socialist Movement (1960s)]]
*[[National Socialist Movement (United Kingdom)|National Socialist Movement]]
*[[Flag Group|NF Flag Group]]
*[[White Nationalist Party]]
==Notes==
{{Reflist|2}}
{{Nazism}}
{{Antisemitism topics |state=collapsed}}
{{Racism topics |state=collapsed}}
[[Category:Antisemitism]]
[[Category:Neo-Nazism| ]]
[[Category:Neo-fascism]]
[[Category:Racism]]
7qq27snnaklpb7u5s8284tpydcd2vpd
901695
901693
2025-01-03T21:49:45Z
CiphriusKane
74958
901695
wikitext
text/x-wiki
<!-- Please dinnae remuive or change this AfD message until the issue is settled -->
<!-- The nomination page for this airticle awreidy existed whan this tag wis eikit. Gin this wis acause the airticle haed been nominatit for deletion afore, an ye wish tae renominate it, please replace "page=Leet o neo-Nazi organisations" wi "page=Leet o neo-Nazi organisations (2nt nomination)" ablo afore gaun on wi the nomination.
-->{{Airticle for deletion/dated|page=Leet o neo-Nazi organisations|timestamp=20250103214945|year=2025|month=Januar|day=3|substed=yes}}
<!-- For administrator uise anely: {{Old AfD multi|page=Leet o neo-Nazi organisations|date=3 Januar 2025|result='''keep'''}} -->
<!-- End o AfD message, feel free tae edit ayont this pynt -->
{{fixscots|date=Januar 2021}}
This is a leet o '''[[Neo-Nazism|neo-Nazi]] organisations'''.
<!-- Only add groups with sources or Wikipedia articles saying they are neo-Nazi. Add new groups in alphabetical order.-->
===Africae===
*[[Afrikaner Weerstandsbeweging]] - Sooth Africae
*[[Blanke Bevrydingsbeweging]] - Sooth Africae
===Asia===
*[[Aryan League]] - (Naitional Socialist Aryan League - NSAL) - [[Iran]]
*[[Blue Mongolie]] - [[Mongolie]]<ref name="autogenerated1">{{cite web |last=Moxley |first=Mitch |url=http://www.time.com/time/magazine/article/0,9171,1910893,00.html |title=The Neo-Nazis of Mongolia: Swastikas Against China |publisher=TIME |date=2009-07-27 |accessdate=2009-11-03 |archive-date=2009-07-22 |archive-url=https://web.archive.org/web/20090722010422/http://www.time.com/time/magazine/article/0,9171,1910893,00.html |url-status=dead }}</ref>
*[[Dayar Mongol]] - [[Mongolie]]<ref name="autogenerated1"/>
*[[Mongolian Naitional Union]] - [[Mongolia]]<ref name="autogenerated1"/>
*[[Naitional Socialism Association]] - [[Taiwan]]
*[[Naitional Socialist Japanese Wirkers an Welfare Pairty]] - [[Japan]]
*[[SUMKA]] (Iran Naitional-Socialist Workers Party) - [[Iran]]
* [[Tsagaan Khass]] - [[Mongolie]]
===Europe===
*[[Aime & Sers]] - [[Fraunce]]<ref>{{Cite web |url=http://aime-et-sers.com/ |title=Archived copy |access-date=2010-11-28 |archive-date=2010-11-15 |archive-url=https://web.archive.org/web/20101115164238/http://www.aime-et-sers.com/ |url-status=dead }}</ref>
*[[Chrysi Avyi]] (Golden Dawn) - [[Greece]]
*[[Imperium Europa]] - [[Maltae]]
*[[Kärntner Heimatdienst]] (Carinthian Homeland Service) - [[Carinthie (state)|Carinthie]]
*[[Legion Wasa]] - [[Swaden]]
*[[Nacionalni stroj]] (National Alignment) - [[Serbie]]
*[[National Bolshevik Party]] - [[Estonia]]<ref name=ucsj01JAN29 />
*[[National Socialist Movement of Denmark|Danmarks Nationalsocialistiske Bevægelse]] (Naitional Socialist Movement o Denmark) - [[Denmark]]
*[[Naitional Socialist Turkish Movement]] - [[Turkey]]
*[[Nationalsocialistisk Front]] (Naitional Socialist Front) - [[Swaden]]
*[[Norges Nasjonalsosialistiske Bevegelse]] (Naitional Socialist Movement o Norrowey) - [[Norrowey]]
*[[Norske Motstandsbevegelsen]] (Norwegian Resistance Movement) - [[Norrowey]]
*[[Pamyat]] - [[Roushie]]
*[[Roushie Naitional Unity]] - [[Roushie]], [[Estonie]]<ref name=ucsj01JAN29>{{cite web |url=http://www.ucsj.org/news/estonian-security-officer-neo-nazi-groups-skinheads |title=Estonian Security Officer on Neo-Nazi Groups, Skinheads, reported at Union of Councils for Jews in the Former Soviet Union |publisher=Ucsj.org |date= |accessdate=2009-11-03 }}{{Dead link|date=January 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
*[[TürkischeJugend]] - [[Turkey]]
*[[Suomen Vastarintaliike]] - (Finnish Resistance Movement) - [[Finland]]
*[[Svenska Motståndsrörelsen]] - (Swadish Resistance Movement) - [[Swaden]]
*[[Vigrid]] - [[Norrowey]]
*[[Vitt Ariskt Motstånd]] (White Aryan Resistance) - [[Swaden]]
===Internaitional===
*[[Blood an Honour]] - internaitional neo-Nazi netwirk
===North America===
*[[American Nazi Pairty]] - [[Unitit States]]
*[[Aryan Nations]] - [[Unitit States]] an [[Canadae]]
*[[Hammerskins]] - [[Unitit States]] an [[Canadae]]
*[[Heritage Front]] - [[Canadae]]
*[[Naitional Alliance (Unitit States)|Naitional Alliance]] - [[Unitit States]]
*[[Naitional Socialist Movement (Unitit States)|Naitional Socialist Movement]] - [[Unitit States]]
*[[Naitional Socialist Vanguard]] - [[Unitit States]]
*[[Northren Alliance (Canadae)|Northren Alliance]] - [[Canadae]]
*[[NSDAP/AO (1972)|NSDAP/AO]] - [[Unitit States]]
*[[White Aryan Resistance]]
===Oceania===
*[[National Action]] - [[Australia]]
*[[New Zealand National Front]] - [[New Zealand]]
*[[Patriotic Youth League]] - [[Australia]]
===South America===
*[[Carecas do ABC]] (ABC region Skinheads) - [[Brazil]]
*[[New Triumph Party]] - [[Argentina]]<ref>{{cite web |url=http://pnt.libreopinion.com/ |title=Partido Nuevo Triunfo - Orden Nacional |publisher=Pnt.libreopinion.com |date= |accessdate=2009-11-03 |archive-date=2005-12-01 |archive-url=https://web.archive.org/web/20051201014732/http://pnt.libreopinion.com/ |url-status=dead }}</ref>
===Unitit Kinrick===
*[[British Movement]]
*[[Combat 18]]
*[[International Third Position]]
*[[League of St. George]]
*[[November 9th Society]] (kent as the British First Party an aw)
*[[National Socialist Movement (UK, 1962)|National Socialist Movement (1960s)]]
*[[National Socialist Movement (United Kingdom)|National Socialist Movement]]
*[[Flag Group|NF Flag Group]]
*[[White Nationalist Party]]
==Notes==
{{Reflist|2}}
{{Nazism}}
{{Antisemitism topics |state=collapsed}}
{{Racism topics |state=collapsed}}
[[Category:Antisemitism]]
[[Category:Neo-Nazism| ]]
[[Category:Neo-fascism]]
[[Category:Racism]]
rj514o5gczn8wxyk71l78646f390zhd
901706
901695
2025-01-04T07:41:51Z
Italiano1922
115108
New organisations
901706
wikitext
text/x-wiki
<!-- Please dinnae remuive or change this AfD message until the issue is settled -->
<!-- The nomination page for this airticle awreidy existed whan this tag wis eikit. Gin this wis acause the airticle haed been nominatit for deletion afore, an ye wish tae renominate it, please replace "page=Leet o neo-Nazi organisations" wi "page=Leet o neo-Nazi organisations (2nt nomination)" ablo afore gaun on wi the nomination.
-->{{Airticle for deletion/dated|page=Leet o neo-Nazi organisations|timestamp=20250103214945|year=2025|month=Januar|day=3|substed=yes}}
<!-- For administrator uise anely: {{Old AfD multi|page=Leet o neo-Nazi organisations|date=3 Januar 2025|result='''keep'''}} -->
<!-- End o AfD message, feel free tae edit ayont this pynt -->
{{fixscots|date=Januar 2021}}
This is a leet o '''[[Neo-Nazism|neo-Nazi]] organisations'''.
<!-- Only add groups with sources or Wikipedia articles saying they are neo-Nazi. Add new groups in alphabetical order.-->
===Africae===
*[[Afrikaner Weerstandsbeweging]] - Sooth Africae
*[[Blanke Bevrydingsbeweging]] - Sooth Africae
===Asia===
*[[Aryan League]] - (Naitional Socialist Aryan League - NSAL) - [[Iran]]
*[[Blue Mongolie]] - [[Mongolie]]<ref name="autogenerated1">{{cite web |last=Moxley |first=Mitch |url=http://www.time.com/time/magazine/article/0,9171,1910893,00.html |title=The Neo-Nazis of Mongolia: Swastikas Against China |publisher=TIME |date=2009-07-27 |accessdate=2009-11-03 |archive-date=2009-07-22 |archive-url=https://web.archive.org/web/20090722010422/http://www.time.com/time/magazine/article/0,9171,1910893,00.html |url-status=dead }}</ref>
*[[Dayar Mongol]] - [[Mongolie]]<ref name="autogenerated1"/>
*[[Mongolian Naitional Union]] - [[Mongolia]]<ref name="autogenerated1"/>
*[[Naitional Socialism Association]] - [[Taiwan]]
*[[Naitional Socialist Japanese Wirkers an Welfare Pairty]] - [[Japan]]
*[[SUMKA]] (Iran Naitional-Socialist Workers Party) - [[Iran]]
* [[Tsagaan Khass]] - [[Mongolie]]
===Europe===
*[[Aime & Sers]] - [[Fraunce]]<ref>{{Cite web |url=http://aime-et-sers.com/ |title=Archived copy |access-date=2010-11-28 |archive-date=2010-11-15 |archive-url=https://web.archive.org/web/20101115164238/http://www.aime-et-sers.com/ |url-status=dead }}</ref>
*[[Chrysi Avyi]] (Golden Dawn) - [[Greece]]
*[[Imperium Europa]] - [[Maltae]]
*[[Kärntner Heimatdienst]] (Carinthian Homeland Service) - [[Carinthie (state)|Carinthie]]
*[[Legion Wasa]] - [[Swaden]]
*[[Nacionalni stroj]] (National Alignment) - [[Serbie]]
*[[National Bolshevik Party]] - [[Estonia]]<ref name=ucsj01JAN29 />
*[[National Socialist Movement of Denmark|Danmarks Nationalsocialistiske Bevægelse]] (Naitional Socialist Movement o Denmark) - [[Denmark]]
*[[Naitional Socialist Turkish Movement]] - [[Turkey]]
*[[Nationalsocialistisk Front]] (Naitional Socialist Front) - [[Swaden]]
*[[Norges Nasjonalsosialistiske Bevegelse]] (Naitional Socialist Movement o Norrowey) - [[Norrowey]]
*[[Norske Motstandsbevegelsen]] (Norwegian Resistance Movement) - [[Norrowey]]
*[https://traditio.wiki/%D0%9F%D0%B0%D0%BC%D1%8F%D1%82%D1%8C_(%D0%BD%D0%B0%D1%86%D0%B8%D0%BE%D0%BD%D0%B0%D0%BB%D1%8C%D0%BD%D0%BE-%D0%BF%D0%B0%D1%82%D1%80%D0%B8%D0%BE%D1%82%D0%B8%D1%87%D0%B5%D1%81%D0%BA%D0%B8%D0%B9_%D1%84%D1%80%D0%BE%D0%BD%D1%82) Pamyat] - [[Roushie]]
*[https://traditio.wiki/%D0%A0%D1%83%D1%81%D1%81%D0%BA%D0%BE%D0%B5_%D0%BD%D0%B0%D1%86%D0%B8%D0%BE%D0%BD%D0%B0%D0%BB%D1%8C%D0%BD%D0%BE%D0%B5_%D0%B5%D0%B4%D0%B8%D0%BD%D1%81%D1%82%D0%B2%D0%BE_(%D0%BE%D0%B1%D1%89%D0%B5%D1%80%D0%BE%D1%81%D1%81%D0%B8%D0%B9%D1%81%D0%BA%D0%BE%D0%B5_%D0%BE%D0%B1%D1%89%D0%B5%D1%81%D1%82%D0%B2%D0%B5%D0%BD%D0%BD%D0%BE%D0%B5_%D0%BF%D0%B0%D1%82%D1%80%D0%B8%D0%BE%D1%82%D0%B8%D1%87%D0%B5%D1%81%D0%BA%D0%BE%D0%B5_%D0%B4%D0%B2%D0%B8%D0%B6%D0%B5%D0%BD%D0%B8%D0%B5) Roushie Naitional Unity] - [[Roushie]], [[Estonie]]<ref name=ucsj01JAN29>{{cite web |url=http://www.ucsj.org/news/estonian-security-officer-neo-nazi-groups-skinheads |title=Estonian Security Officer on Neo-Nazi Groups, Skinheads, reported at Union of Councils for Jews in the Former Soviet Union |publisher=Ucsj.org |date= |accessdate=2009-11-03 }}{{Dead link|date=January 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
*[[:en:National_Socialism_/_White_Power|NS/WP]] - [[Roushie]]
*[[TürkischeJugend]] - [[Turkey]]
*[[Suomen Vastarintaliike]] - (Finnish Resistance Movement) - [[Finland]]
*[[Svenska Motståndsrörelsen]] - (Swadish Resistance Movement) - [[Swaden]]
*[[Vigrid]] - [[Norrowey]]
*[[Vitt Ariskt Motstånd]] (White Aryan Resistance) - [[Swaden]]
===Internaitional===
*[[Blood an Honour]] - internaitional neo-Nazi netwirk
===North America===
*[[American Nazi Pairty]] - [[Unitit States]]
*[[Aryan Nations]] - [[Unitit States]] an [[Canadae]]
*[[Hammerskins]] - [[Unitit States]] an [[Canadae]]
*[[Heritage Front]] - [[Canadae]]
*[[Naitional Alliance (Unitit States)|Naitional Alliance]] - [[Unitit States]]
*[[Naitional Socialist Movement (Unitit States)|Naitional Socialist Movement]] - [[Unitit States]]
*[[Naitional Socialist Vanguard]] - [[Unitit States]]
*[[Northren Alliance (Canadae)|Northren Alliance]] - [[Canadae]]
*[[NSDAP/AO (1972)|NSDAP/AO]] - [[Unitit States]]
*[[White Aryan Resistance]]
===Oceania===
*[[National Action]] - [[Australia]]
*[[New Zealand National Front]] - [[New Zealand]]
*[[Patriotic Youth League]] - [[Australia]]
===South America===
*[[Carecas do ABC]] (ABC region Skinheads) - [[Brazil]]
*[[New Triumph Party]] - [[Argentina]]<ref>{{cite web |url=http://pnt.libreopinion.com/ |title=Partido Nuevo Triunfo - Orden Nacional |publisher=Pnt.libreopinion.com |date= |accessdate=2009-11-03 |archive-date=2005-12-01 |archive-url=https://web.archive.org/web/20051201014732/http://pnt.libreopinion.com/ |url-status=dead }}</ref>
===Unitit Kinrick===
*[[British Movement]]
*[[Combat 18]]
*[[International Third Position]]
*[[League of St. George]]
*[[November 9th Society]] (kent as the British First Party an aw)
*[[National Socialist Movement (UK, 1962)|National Socialist Movement (1960s)]]
*[[National Socialist Movement (United Kingdom)|National Socialist Movement]]
*[[Flag Group|NF Flag Group]]
*[[White Nationalist Party]]
==Notes==
{{Reflist|2}}
{{Nazism}}
{{Antisemitism topics |state=collapsed}}
{{Racism topics |state=collapsed}}
[[Category:Antisemitism]]
[[Category:Neo-Nazism| ]]
[[Category:Neo-fascism]]
[[Category:Racism]]
ahpy5z59pbqxncjbyq7nki4fw1h9vae
901711
901706
2025-01-04T10:37:00Z
CiphriusKane
74958
Undae revision [[Special:Diff/901706|901706]] bi [[Special:Contributions/Italiano1922|Italiano1922]] ([[User talk:Italiano1922|Tauk]])Wikis isna reliable soorces
901711
wikitext
text/x-wiki
<!-- Please dinnae remuive or change this AfD message until the issue is settled -->
<!-- The nomination page for this airticle awreidy existed whan this tag wis eikit. Gin this wis acause the airticle haed been nominatit for deletion afore, an ye wish tae renominate it, please replace "page=Leet o neo-Nazi organisations" wi "page=Leet o neo-Nazi organisations (2nt nomination)" ablo afore gaun on wi the nomination.
-->{{Airticle for deletion/dated|page=Leet o neo-Nazi organisations|timestamp=20250103214945|year=2025|month=Januar|day=3|substed=yes}}
<!-- For administrator uise anely: {{Old AfD multi|page=Leet o neo-Nazi organisations|date=3 Januar 2025|result='''keep'''}} -->
<!-- End o AfD message, feel free tae edit ayont this pynt -->
{{fixscots|date=Januar 2021}}
This is a leet o '''[[Neo-Nazism|neo-Nazi]] organisations'''.
<!-- Only add groups with sources or Wikipedia articles saying they are neo-Nazi. Add new groups in alphabetical order.-->
===Africae===
*[[Afrikaner Weerstandsbeweging]] - Sooth Africae
*[[Blanke Bevrydingsbeweging]] - Sooth Africae
===Asia===
*[[Aryan League]] - (Naitional Socialist Aryan League - NSAL) - [[Iran]]
*[[Blue Mongolie]] - [[Mongolie]]<ref name="autogenerated1">{{cite web |last=Moxley |first=Mitch |url=http://www.time.com/time/magazine/article/0,9171,1910893,00.html |title=The Neo-Nazis of Mongolia: Swastikas Against China |publisher=TIME |date=2009-07-27 |accessdate=2009-11-03 |archive-date=2009-07-22 |archive-url=https://web.archive.org/web/20090722010422/http://www.time.com/time/magazine/article/0,9171,1910893,00.html |url-status=dead }}</ref>
*[[Dayar Mongol]] - [[Mongolie]]<ref name="autogenerated1"/>
*[[Mongolian Naitional Union]] - [[Mongolia]]<ref name="autogenerated1"/>
*[[Naitional Socialism Association]] - [[Taiwan]]
*[[Naitional Socialist Japanese Wirkers an Welfare Pairty]] - [[Japan]]
*[[SUMKA]] (Iran Naitional-Socialist Workers Party) - [[Iran]]
* [[Tsagaan Khass]] - [[Mongolie]]
===Europe===
*[[Aime & Sers]] - [[Fraunce]]<ref>{{Cite web |url=http://aime-et-sers.com/ |title=Archived copy |access-date=2010-11-28 |archive-date=2010-11-15 |archive-url=https://web.archive.org/web/20101115164238/http://www.aime-et-sers.com/ |url-status=dead }}</ref>
*[[Chrysi Avyi]] (Golden Dawn) - [[Greece]]
*[[Imperium Europa]] - [[Maltae]]
*[[Kärntner Heimatdienst]] (Carinthian Homeland Service) - [[Carinthie (state)|Carinthie]]
*[[Legion Wasa]] - [[Swaden]]
*[[Nacionalni stroj]] (National Alignment) - [[Serbie]]
*[[National Bolshevik Party]] - [[Estonia]]<ref name=ucsj01JAN29 />
*[[National Socialist Movement of Denmark|Danmarks Nationalsocialistiske Bevægelse]] (Naitional Socialist Movement o Denmark) - [[Denmark]]
*[[Naitional Socialist Turkish Movement]] - [[Turkey]]
*[[Nationalsocialistisk Front]] (Naitional Socialist Front) - [[Swaden]]
*[[Norges Nasjonalsosialistiske Bevegelse]] (Naitional Socialist Movement o Norrowey) - [[Norrowey]]
*[[Norske Motstandsbevegelsen]] (Norwegian Resistance Movement) - [[Norrowey]]
*[[Pamyat]] - [[Roushie]]
*[[Roushie Naitional Unity]] - [[Roushie]], [[Estonie]]<ref name=ucsj01JAN29>{{cite web |url=http://www.ucsj.org/news/estonian-security-officer-neo-nazi-groups-skinheads |title=Estonian Security Officer on Neo-Nazi Groups, Skinheads, reported at Union of Councils for Jews in the Former Soviet Union |publisher=Ucsj.org |date= |accessdate=2009-11-03 }}{{Dead link|date=January 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
*[[TürkischeJugend]] - [[Turkey]]
*[[Suomen Vastarintaliike]] - (Finnish Resistance Movement) - [[Finland]]
*[[Svenska Motståndsrörelsen]] - (Swadish Resistance Movement) - [[Swaden]]
*[[Vigrid]] - [[Norrowey]]
*[[Vitt Ariskt Motstånd]] (White Aryan Resistance) - [[Swaden]]
===Internaitional===
*[[Blood an Honour]] - internaitional neo-Nazi netwirk
===North America===
*[[American Nazi Pairty]] - [[Unitit States]]
*[[Aryan Nations]] - [[Unitit States]] an [[Canadae]]
*[[Hammerskins]] - [[Unitit States]] an [[Canadae]]
*[[Heritage Front]] - [[Canadae]]
*[[Naitional Alliance (Unitit States)|Naitional Alliance]] - [[Unitit States]]
*[[Naitional Socialist Movement (Unitit States)|Naitional Socialist Movement]] - [[Unitit States]]
*[[Naitional Socialist Vanguard]] - [[Unitit States]]
*[[Northren Alliance (Canadae)|Northren Alliance]] - [[Canadae]]
*[[NSDAP/AO (1972)|NSDAP/AO]] - [[Unitit States]]
*[[White Aryan Resistance]]
===Oceania===
*[[National Action]] - [[Australia]]
*[[New Zealand National Front]] - [[New Zealand]]
*[[Patriotic Youth League]] - [[Australia]]
===South America===
*[[Carecas do ABC]] (ABC region Skinheads) - [[Brazil]]
*[[New Triumph Party]] - [[Argentina]]<ref>{{cite web |url=http://pnt.libreopinion.com/ |title=Partido Nuevo Triunfo - Orden Nacional |publisher=Pnt.libreopinion.com |date= |accessdate=2009-11-03 |archive-date=2005-12-01 |archive-url=https://web.archive.org/web/20051201014732/http://pnt.libreopinion.com/ |url-status=dead }}</ref>
===Unitit Kinrick===
*[[British Movement]]
*[[Combat 18]]
*[[International Third Position]]
*[[League of St. George]]
*[[November 9th Society]] (kent as the British First Party an aw)
*[[National Socialist Movement (UK, 1962)|National Socialist Movement (1960s)]]
*[[National Socialist Movement (United Kingdom)|National Socialist Movement]]
*[[Flag Group|NF Flag Group]]
*[[White Nationalist Party]]
==Notes==
{{Reflist|2}}
{{Nazism}}
{{Antisemitism topics |state=collapsed}}
{{Racism topics |state=collapsed}}
[[Category:Antisemitism]]
[[Category:Neo-Nazism| ]]
[[Category:Neo-fascism]]
[[Category:Racism]]
rj514o5gczn8wxyk71l78646f390zhd
Aleppo
0
13952
901682
865420
2025-01-03T18:30:37Z
Italiano1922
115108
A pairt aboot the takkin o the toun on the 27 o November 2024 haes been addit.
901682
wikitext
text/x-wiki
{{Update}}
{{Infobox settlement
<!--See the Table at Infobox Settlement for all fields and descriptions of usage-->
<!-- Basic info ---------------->
|official_name = Aleppo
|other_name = Ḥalab
|native_name = حلب<!-- for cities whose native name is not in English -->
|nickname = Ash-Shahbaa
|settlement_type = <!--For Town or Village (Leave blank for the default City)-->
|motto =
<!-- images and maps ----------->
|image_skyline = Aleppo, View of the city, Syria.jpg
|imagesize = 300px
|image_caption =
|image_flag =
|flag_size =
|image_seal =
|seal_size =
|image_shield =
|shield_size =
|image_blank_emblem =
|blank_emblem_type =
|blank_emblem_size =
|image_map =
|mapsize =
|map_caption =
|image_map1 =
|mapsize1 =
|map_caption1 =
|image_dot_map =
|dot_mapsize =
|dot_map_caption =
|dot_x = |dot_y =
|pushpin_map = Syria <!-- the name of a location map as per http://en.wikipedia.org/wiki/Template:Location_map -->
|pushpin_label_position =bottom
|pushpin_mapsize =300
|pushpin_map_caption =Location in Sirie
<!-- Location ------------------>
|subdivision_type = Kintra
|subdivision_name = {{Flag|Sirie}}
|subdivision_type1 = [[Govrenorates o Sirie|Govrenorate]]
|subdivision_name1 = [[Aleppo Govrenorate]]
|subdivision_type2 = [[Destricts o Sirie|Destrict]]
|subdivision_name2 = [[Munt Simeon Destrict|Munt Simeon]]
<!-- Politics ----- =
|subdivision_name1 =
|subdivision_type2 ------------>
|government_footnotes =
|government_type =
|leader_title = Heid o Ceety Cooncil
|leader_name = Mohammad Ayman Hallaq
|leader_title1 =
|leader_name1 =
|leader_title2 =
|leader_name2 =
|leader_title3 =
|leader_name3 =
|leader_title4 =
|leader_name4 =
|established_title = <!-- Settled -->
|established_date =
|established_title2 = <!-- Incorporated (town) -->
|established_date2 =
|established_title3 = <!-- Incorporated (city) -->
|established_date3
|area_water_km2 =
|area_total_sq_mi =
|area_land_sq_mi =
|area_water_sq_mi =
|area_water_percen =
<!-- Area --------------------->
|area_magnitude =
|unit_pref = <!--Enter: Imperial, if Imperial (metric) is desired-->
|area_footnotes =
|area_total_km2 =
|area_land_km2 =
|area_urban_km2 = 190
|area_urban_sq_mi =
|area_metro_km2 =
|area_metro_sq_mi =
|area_blank1_title =
|area_blank1_km2 =
|area_blank1_sq_mi =
<!-- Population ----------------------->
|population_as_of = 2004 census
|population_footnotes =
|population_note =
|population_total = 2,132,100
|population_density_km2 =
|population_density_sq_mi =
|population_metro = 2,181,061
|population_density_metro_km2 =
|population_density_metro_sq_mi =
|population_urban =
|population_density_urban_km2 =
|population_density_urban_sq_mi =
|population_blank1_title = Ethnicities
|population_blank1 =
|population_blank2_title = Releegions
|population_blank2 =
|population_density_blank1_km2 =
|population_density_blank1_sq_mi=
<!-- General information --------------->
|timezone = [[Eastren European Time|EET]]
|utc_offset = +2
|timezone_DST = [[Eastren European Staundart Time|EEST]]
|utc_offset_DST = +3
|coordinates = {{coord|36|13|N|37|10|E|region:SY|display=inline}}
|elevation_footnotes = <!--for references: use <ref> </ref> tags-->
|elevation_m = 379
|elevation_ft =
<!-- Area/postal codes and others -------->
|postal_code_type =
|postal_code =
|area_code = Kintra code: 963, Ceety code: 21
|website = [http://www.alp-city.org// Aleppo City]
|footnotes = Sources: Aleppo city area <ref name="Syr-news1">Syria News [http://www.syria-news.com/readnews.php?sy_seq=99523 statement by Syrian Minister of Local Administration, Syria (Arabic, August 2009)] {{Webarchive|url=https://web.archive.org/web/20171009233648/http://syria-news.com/readnews.php?sy_seq=99523 |date=2017-10-09 }}</ref> Sources: City population <ref name="Population facts">Central Bureau of Statistics [http://www.cbssyr.org/new%20web%20site/General_census/census_2004/NH/TAB02-1-2004.htm Aleppo city population] {{Webarchive|url=https://web.archive.org/web/20120520173518/http://www.cbssyr.org/new%20web%20site/General_census/census_2004/NH/TAB02-1-2004.htm |date=2012-05-20 }}</ref>
|blank_name = Demonym
|blank_info = Aleppine
}}
'''Aleppo''' ({{lang-ar|حلب}} Ḥalab {{IPA-ar|ˈħælæb|}}, [[Names o Asie ceeties in different leids#A|ither names]]) is the lairgest ceety in [[Sirie]] an the caipital o [[Aleppo Govrenorate]], the maist muckle [[Govrenorates o Sirie|Sirie govrenorate]]. Wi a population o 2,301,570 (2005 offeecial estimate), it is an aa the lairgest ceety in the [[Levant]].<ref>{{cite web |url=http://unstats.un.org/unsd/demographic/products/dyb/dyb2007/notestab08.pdf |title=UN Demographic Yearbook 2009 |accessdate=2010-04-21}}</ref><ref>Expatify.com [http://www.expatify.com/syria/navigating-the-major-cities-of-syria-aleppo-and-damascus.html Navigating the Major Cities of Syria]</ref>
Aleppo is ane o [[Leet o auldest continuously inhabitit ceeties|the auldest continuously inhabitit ceeties in the warld]]; it haes been inhabitit syne aiblins as early as the 6t millenium BC.<ref>Columbia Encyclopedia, Sixth Edition (2010)</ref><ref name="Syria Gate">[http://www.syriagate.com/Syria/about/cities/Aleppo/aleppo-cm.htm Syria Gate] {{Webarchive|url=https://web.archive.org/web/20101224090112/http://syriagate.com/Syria/about/cities/Aleppo/aleppo-cm.htm |date=2010-12-24 }}</ref> Excavations at [[Tell Qaramel]] (25 km north o Aleppo) shaw the aurie tae hae been inhabitit syne the 11t millenium BC, which maks it the auldest kent human dounset in the warld.<ref name="PaP 2007">{{cite web |url=http://www.eduskrypt.pl/yet_another_sensational_discovery_by_polish_archaeologists_in_syria-info-6775.html |title=Yet another sensational discovery by Polish archaeologists in Syria |author=Anna Ślązak |publisher=Science in Poland service, [[Polish Press Agency]] |date=21 June 2007 |accessdate=2010-11-26 |archive-date=2011-10-01 |archive-url=https://web.archive.org/web/20111001171824/http://www.eduskrypt.pl/yet_another_sensational_discovery_by_polish_archaeologists_in_syria-info-6775.html |url-status=dead }}</ref><ref>{{cite web |url=http://www.pcma.uw.edu.pl/index.php?id=154&L=2 |title=Pre- and Protohistory in the Near East: Tell Qaramel (Syria) | author = R.F. Mazurowski | work = Newsletter 2006 | publisher=Polish Centre of Mediterranean Archaeology, [[Warsaw University]] | date= 2007 | accessdate=2010-11-26}}</ref><ref>{{cite web |url=http://www.newsweek.pl/artykuly/sekcje/nauka/qaramel---osada-pieciu-wiez,48365,1 |title=Qaramel: Five Tower Settlement |author=Magdalena Frender-Majewska |work=Newsweek (Poland) |date=5 November 2009 |accessdate=2010-11-26 }}{{Dead link|date=January 2021 |bot=InternetArchiveBot |fix-attempted=yes }} {{pl}}</ref><ref>{{cite web |url=http://www.national-geographic.pl/artykuly/pokaz/qaramel-najstarsze-miasto-swiata|title=Qaramel: Oldest City in the World | author = | work = National Geographic (Poland) | date= 27 December 2009 | accessdate=2010-11-26}} {{pl}}</ref> Excavations at Tell as-Sawda an Tell al-Ansari, juist sooth o the auld ceety o Aleppo, shaw that the aurie wis occupee'd syne at least the latter pairt o the 3rd millennium BC;<ref>The Oxford encyclopedia o archaeology in the Near East (1997)</ref> an this is an aa whan Aleppo is first mentioned in cuneiform tablets unearthed in [[Ebla]] an [[Mesopotamie]], in which it is notit for its commercial an military proficiency.<ref name="Syria Gate"/><ref>Britannica Concise Encyclopedia (2010)</ref> Sic a lang history is probably due tae its bein a strategic tradin pynt midway atween the Mediterranean Sea an Mesopotamie.
For centuries, Aleppo haes been [[Greater Sirie]]'s lairgest ceety an the Ottoman Empire's third, efter [[Constantinople]] an [[Cairo]].<ref>[http://books.google.com/books?id=QjzYdCxumFcC&pg=PA30&lpg=PA30&dq=Aleppo+third+largest+Ottoman+Empire&source=bl&ots=Pc1aMdCNu7&sig=Gz0APza0iRfEgNZY9UACCvkF7Ps&hl=en&ei=SHjJTOfXH5HSuwOnpu0V&sa=X&oi=book_result&ct=result&resnum=4&ved=0CCEQ6AEwAw#v=onepage&q=Aleppo%20third%20largest%20Ottoman%20Empire&f=false Encyclopedia of the Ottoman Empire]</ref><ref name="Russell, Alexander (1794) The natural history of Aleppo">Russell, Alexander (1794) The natural history of Aleppo</ref><ref name="Gaskin, James J. 1846 Geography and sacred history of Syria p.33">Gaskin, James J. 1846 Geography and sacred history of Syria p.33</ref> Awtho relatively close tae [[Damascus]] in distance, Aleppo is distinct in identity, airchitectur an cultur, aw shaped bi a markedly different history an geography.
The ceety's significance in history haes been its location at the end o the [[Silk Road]], which passed throu central Asie an Mesopotamie. When the [[Suez Canal]] wis inauguratit in 1869, trade wis divertit tae sea an Aleppo began its slow decline. At the faw o the [[Ottoman Empire]] efter Warld War I, Aleppo cedit its northren hinterland tae modren Turkey, as well as the important railwey connectin it tae [[Mosul]]. Then in the 1940s it lost its main access tae the sea, [[Antioch]] an [[Alexandretta]] (Iskenderun), an aa tae Turkey. Feenally, the isolation o Sirie in the past few decades further exacerbatit the situation, awtho aiblins it is this vera decline that haes helped tae preserve the auld ceety o Aleppo, its mediaeval airchitectur an traditional heritage. Aleppo is nou experiencin a noticeable revival an is slowly returnin tae the spotlicht. It recently wan the title o the "Islamic Caipital o Cultur 2006", an haes an aa witnessed a wave o successfu restorations o its treasured monuments.
The toun wis unco important durin the Syrien Civil War. The toun wis taen bi the Syrien opposition on the 27th o November, 2024. It was frae here that the furthir onslaucht taearts Damascus began, that led the owerthrow o Bashar al-Assad's regime.<ref>{{Citation|title=Syrien civil war|date=2025-01-03|url=https://sco.wikipedia.org/w/index.php?title=Syrien_civil_war|work=Wikipedia|access-date=2025-01-03}}</ref>
==Etymology==
{{Infobox Hieroglyphen
|TITEL = Aleppo
|NAME = <hiero>Aa1:D21-Z3-D58-G29-N25</hiero><br />Chalba<br />''{{Unicode|ẖrb3}}''<br />''Aleppo''
}}
[[File:Aleppo at night11.jpg|thumb|left|Aleppo ceety centre]]
Aleppo wis kent tae antiquity as ''Khalpe'', ''Khalibon'', an tae the [[Auncient Greece|Greeks]] as ''Beroea'' (Βέροια). Durin the [[Crusades]], an again durin the [[French Mandate for Sirie an the Lebanon]], the name ''Alep'' wis uised: "Aleppo" is an Italianised version o this. Housomeivver, the auncient name o the ceety, '''Halab''', is o obscure oreegin. Some hae proposed that Halab means 'iron' or 'copper' in Amorite leids syne it wis a major soorce o thir metals in antiquity. ''Halaba'' in Aramaic means white, referrin tae the colour o soil an marble abundant in the aurie. Anither proposed etymology is that the name Halab means "gave oot milk," comin frae the auncient tradeetion that [[Aubraham]] gae milk tae travelers as thay muivit throughoot the region.<ref>[http://www.teachittome.com/seforim2/seforim/travels_of_rabbi_pesachia_of_regensburg.pdf Travels of Rabbi Pesachia of Regensburg]. teachittome.com (p. 53).</ref> The colour o his cous wis ashen (Arab. ''shaheb''); therefore the ceety is an aa cawed '''Halab ash-Shahba''' ("he milked the ash-coloured").
==Internaitional relations==
{{Main|Leet_o_twin_touns_an_sister_ceeties_in_Asie#Sirie|l1=Leet o twin touns an sister ceeties in Sirie}}
The ceety o Aleppo is the caipital o [[Aleppo Govrenorate]] an the centre o [[Munt Simeon (destrict)|Jabal Semaan]] destrict. Aleppo Ceety Cooncil is the govrenin body o the ceety, but the govrenor in his turn, enjoys the heichest authority in the ceety as well as the whole govrenorate.
===Twin touns — sister ceeties===
Currently, Aleppo haes fower sister an pairtner ceeties:
*{{Flagicon|Turkey}} [[İzmir]], [[Turkey]] syne 5 Mey 1993.
*{{Flagicon|France}} [[Lyon]], [[Fraunce]] syne 18 October 2000.
*{{Flagicon|Turkey}} [[Gaziantep]], [[Turkey]] syne 13 November 2005.
*{{Flagicon|Belarus}} [[Brest, Belaroushie|Brest]], [[Belaroushie]] syne 28 Januar 2010.
==References==
{{reflist}}
{{Commonscat}}
{{Aleppo Govrenorate}}
[[Category:Aleppo| ]]
[[Category:Amorite ceeties]]
[[Category:Arabic airchitectur]]
[[Category:Airchaeological steids in Sirie]]
[[Category:Ceeties in Sirie]]
[[Category:Fertile Crescent]]
[[Category:History o Sirie]]
[[Category:Populatit places alang the Silk Road]]
[[Category:Populatit places in Munt Simeon Destrict]]
ax7mp8scbwk7ohzq2l7sqkexspbqh5b
Puerto Rico
0
15891
901700
876203
2025-01-03T22:45:55Z
2A02:8440:7134:E46C:6855:43FF:FED2:FCC7
901700
wikitext
text/x-wiki
{{fixscots}}{{coord|18.2|-66.5|display=title}}
{{Infobox country
|conventional_long_name = Commonweel o Puerto Rico
|native_name = {{nowrap|''Estado Libre Asociado de Puerto Rico''}}
|common_name = Puerto Rico
|image_flag = Flag of Puerto Rico.svg
|image_coat = Coat_of_arms_of_the_Commonwealth_of_Puerto_Rico.svg
|symbol_type = Coat of arms
|other_symbol_type = [[Coat o airms o Puerto Rico|Great Seal]]
|other_symbol = [[File:Seal of the Commonwealth of Puerto Rico.svg|95px]]
|national_motto = {{native phrase|la|"[[Coat of Arms of Puerto Rico#History|Ioannes est nomen eius]]"|italics=off}}
|Englishmotto = "John is his name"
|national_anthem = {{unbulleted list
| "[[La Borinqueña]]"<center>[[File:United States Navy Band - La Borinqueña.ogg]]</center>''[[The Star-Spangled Banner]]''{{ref label|natlanthem|a|}}<center>[[File:The Star-Spangled Banner - U.S. Army 1st Armored Division Band.ogg]]</center>
}}
|image_map = Puerto_Rico_(orthographic_projection).svg
|image_map2 = Rico (1).png
|status = [[Unincorporatit territories o the Unitit States|Unincorporatit Territory]]
|capital = [[San Juan, Puerto Rico|San Juan]]
|coordinates = {{Coord|18|27|N|66|6|W|type:city}}
|largest_city = capital
|official_languages = [[Puerto Rican Spaingie|Spaingie]] (first offeecial leid)<br>[[American Inglis|Inglis]]<ref>{{cite news | url=http://www.efe.com/efe/english/life/p-rico-senate-declares-spanish-over-english-as-first-official-language/50000263-2704154 | title=P. Rico Senate declares Spanish over English as first official language | work=News Report | date=September 4, 2015 | agency=Agencia EFE | accessdate=February 7, 2016 | location=San Juan, Puerto Rico | archive-date=2020-11-01 | archive-url=https://web.archive.org/web/20201101090937/https://www.efe.com/efe/english/life/p-rico-senate-declares-spanish-over-english-as-first-official-language/50000263-2704154 | url-status=dead }}</ref>
|languages_type = [[Lingua franca|Common leids]]
|languages = {{unbulleted list
| Spaingie 94.4%
| Inglis 5.1%
| Ithers 0.5%
}}
|ethnic_groups = {{unbulleted list
| 75.8% [[White Puerto Rican|White]]
| 12.4% [[Afro-Puerto Rican|Black]]
| 3.3% [[Multiracial American|Twa or mair races]]
| 0.5% [[Native American (U.S. Census)|American Indian & Alaskan Native]]
| 0.2% [[Asie American|Asian]]
| 0.1% [[Paceefic Islands American|Paceefic Islander]]
| 7.8% [[2010 Unitit States Census|Ither]]<ref name="2010profile">{{cite web|url=http://www2.census.gov/geo/maps/dc10_thematic/2010_Profile/2010_Profile_Map_Puerto_Rico.pdf |title=2010 Census: Puerto Rico Profile |format=PDF |date= |accessdate=June 26, 2014}}</ref>
}}
|demonym = [[Puerto Rican fowk|Puerto Rican]] <small>(formal)</small><br />[[Puerto Rican fowk#Boricua|Boricua]] <small>(colloquial)</small>
|membership_type = [[Sovereign state]]
|membership = {{USA}}
|government_type = [[Commonweel (U.S. insular aurie)|Commonweel]]{{ref label|govtype|b|}}
|leader_title1 = [[Preses o the Unitit States|Preses]]
|leader_name1 = [[Joe Bidem]]
|leader_title2 = [[Govrenor o Puerto Rico|Govrenor]]
|leader_name2 = [[Jennifer González-Colón]]
|leader_title4 = [[Unitit States Hoose o Representatives|U.S. Hoose Delegate]]
|leader_name4 = [[Resident Commissioner o Puerto Rico|Resident Commissioner]] [[Pablo Hernandez Rivera]]
|legislature = [[Legislative Assembly o Puerto Rico|Legislative Assembly]]
|upper_house = [[Senate o Puerto Rico|Senate]]
|lower_house = [[Hoose o Representatives o Puerto Rico|Hoose o Representatives]]
|sovereignty_type = [[Unincorporatit territories o the Unitit States|Unincorporatit territory]]
|sovereignty_note = within the [[Unitit States]]
|established_event1 = [[Treaty o Paris (1898)|Cession frae Spain]]
|established_date1 = December 10, 1898
|established_event2 = [[Jones–Shafroth Act|U.S. ceetizenship grantit]]
|established_date2 = Mairch 2, 1917
|established_event3 = [[Puerto Rican constitutional referendum, 1952|Constitution adoptit]]
|established_date3 = Julie 25, 1952
|area_rank = 169th
|area_magnitude = 1 E9
|area_km2 = 9,104
|area_sq_mi = 3,515<!--Do not remove per [[WP:MOSNUM]]-->
|percent_water = 1.6
|population_census = 3,725,789
|population_census_year = 2010
|population_estimate = 3,474,182<ref name=PopEstUS>{{cite web|url=http://www.census.gov/popest/data/state/totals/2015/tables/NST-EST2015-01.csv|format=CSV|title=Table 1. Annual Estimates of the Resident Population for the United States, Regions, States, and Puerto Rico: April 1, 2010 to July 1, 2015|date=December 26, 2015|publisher=[[U.S. Census Bureau]]|accessdate=December 26, 2015}}</ref>
|population_estimate_rank = 130t
|population_estimate_year = 2015
|population_density_km2 = 382
|population_density_sq_mi = 988
|population_density_rank = 29t
|GDP_PPP = $127 billion<ref>{{cite web|url=http://data.worldbank.org/indicator/NY.GDP.MKTP.PP.CD/countries/order%3Dwbapi_data_value_2012%20wbapi_data_value%20wbapi_data_value-last?order=wbapi_data_value_2012%20wbapi_data_value%20wbapi_data_value-last&sort=desc&display=default|title=GDP, PPP (current international $)|publisher=}}</ref>
|GDP_PPP_rank = 72nt
|GDP_PPP_year = 2012
|GDP_PPP_per_capita = $34,527<ref>[http://data.worldbank.org/indicator/NY.GDP.PCAP.PP.CD?order=wbapi_data_value_2012+wbapi_data_value+wbapi_data_value-last&sort=desc "GDP per capita, PPP (current international $)," World Development Indicators database], World Bank. Database updated on May 8, 2014. Accessed on May 10, 2014.</ref>
|GDP_PPP_per_capita_rank = 29t
|GDP_nominal = $105.1 billion<ref name="World Development Indicators">{{cite web |url=http://data.worldbank.org/data-catalog/world-development-indicators |title=World Bank World Development Indicators, July 2013 |publisher=World Bank |accessdate=August 21, 2013}}</ref>
|GDP_nominal_rank = 60t
|GDP_nominal_year = 2013
|GDP_nominal_per_capita = $28,509<ref>{{cite web|url=http://www3.weforum.org/docs/GCR2014-15/PuertoRico.pdf |title=The Global Competitiveness Report 2014–2015 (Puerto Rico) |website=World Economic Forum}}</ref>
|GDP_nominal_per_capita_rank = 32nt
|Gini = 0.531
|Gini_ref = <ref>{{cite web |url=http://www.census.gov/prod/2012pubs/acsbr11-02.pdf |title=Household Income for States: 2010 and 2011 |author=<!--Staff writer(s); no by-line.--> |date=September 2012 |website= |publisher=U.S. Census Bureau |accessdate=May 16, 2014}}</ref>
|Gini_year = 2011
|HDI = 0.865
|HDI_ref = <ref>{{cite journal|format=PDF|first=Ricardo R.|last=Fuentes-Ramírez|url=http://revistas.upr.edu/index.php/csj/article/download/106/104|title=An Approximation of Puerto Rico's Human Development Index|journal=Caribbean Studies|volume=42|issue=1|year=2014|pages=253-258|accessdate=June 11, 2016}}</ref>
|HDI_rank = 29t
|HDI_year = 2012
|currency = [[Unitit States dollar]] ($)
|currency_code = USD
|time_zone = [[Atlantic Time Zone|Atlantic]]
|utc_offset = -4
|time_zone_DST = not observed
|utc_offset_DST = -4
|drives_on = right
|cctld = [[.pr]]
|iso3166code = PR
|calling_code = [[Telephone nummers in Puerto Rico|+1-787, +1-939]]
|footnote_a = {{note|natlanthem}} "The Star-Spangled Banner" serves as the naitional anthem for the Unitit States o Americae an its territories.
|footnote_b = {{note|govtype}} "The term 'Commonweel' disna describe or provide for ony specific poleetical status or relationship. It haes, for example, been applied tae baith states an territories. When uised in connection wi auries unner U.S. sovereignty that are nae states, the term broadly describes an aurie that is sel-govrenin unner a constitution o its adoption an whase richt o sel-govrenment will nae be unilaterally widrawn bi Congress."<ref>{{cite web|url=https://fam.state.gov/FAM/07FAM/07FAM1120.html|title=Definition of Terms - 1120 Acquisition of U.S. Nationality in U.S. Territories and Possessions|work=U.S. Department of State Foreign Affairs Manual Volume 7- Consular Affairs|publisher=U.S. Department of State|format=PDF|access-date=2016-06-25|archive-date=2015-12-22|archive-url=https://web.archive.org/web/20151222081013/https://fam.state.gov/FAM/07FAM/07FAM1120.html#M1121_2_1|url-status=dead}}</ref>
}}
[[File:Municipios pr.svg|thumb|Territorial organization]]
[[File:PR Capitol, south side.JPG|thumb|PR Capitol, south side]]
'''Puerto Rico''' ({{IPAc-en|ˌ|p|ɔr|t|ə|_|ˈ|r|iː|k|oʊ}} or {{IPAc-en|ˌ|p|w|ɛər|t|ə|_|ˈ|r|iː|k|oʊ}}),{{#tag:Ref|:The common English language pronunciation corresponds tae '''Porto Rico''', a name uised in 19t century Inglis as well as bi the French an the Dutch. Being easier tae pronoonce for native English speakers, Porto Rico was the common designation for American newspaper reporters even afore Unitit States admeenistration o the territory. Durin United States admeenistration, Porto Rico wis the offeecial spellin frae 1900 tae 1932, appearin in such offeecial documents as the [[Treaty o Paris (1898)|Treaty o Paris]] an the [[Foraker Act]].<ref>{{cite book|author=Patricia Gherovici|title=The Puerto Rican syndrome|url=http://books.google.com/books?id=2jSsxVWxu2sC|year=2003|publisher=Other Press, LLC|isbn=9781892746757|pages=[http://books.google.com/books?id=2jSsxVWxu2sC&pg=PA140 140–141]}}</ref> The spellin wis chynged frae ''Porto'' tae ''Puerto'' in 1932.<ref>{{cite book|author=Pedro A. Malavet|title=America's colony: the political ann cultural conflict between the United States and Puerto Rico|url=http://books.google.com/books?id=pKqVpqGVsJYC|year=2004|publisher=NYU Press|isbn=9780814756805|pages=[http://books.google.com.ph/books?id=pKqVpqGVsJYC&pg=PA43 43], [http://books.google.com.ph/books?id=pKqVpqGVsJYC&pg=PA181 181 note 76]}}</ref>|group=note}} offeecially the '''Commonweel o Puerto Rico''' ({{lang-es|label=[[Spainish leid|Spainish]]|Estado Libre Asociado de Puerto Rico}}, {{IPA-es|esˈtaðo ˈlibɾe asosˈjaðo ðe ˈpweɾto ˈriko|}}—literally '''Associatit Free State o Puerto Rico'''), is an [[Territories o the Unitit States#Unincorporatit organized territories|unincorporatit territory]] o the [[Unitit States]], locatit in the northeastren [[Caribbean Sea]], east o the [[Dominican Republic]] an wast o the [[Virgin Islands]].
== Name ==
Puerto Rico (Spaingie for "rich port") comprises an [[archipelago]] that includes the main island o Puerto Rico an a nummer o smawer islands, the lairgest o which are [[Vieques, Puerto Rico|Vieques]], [[Culebra, Puerto Rico|Culebra]], an [[Mona, Puerto Rico|Mona]]. The main island o Puerto Rico is the smawest bi land aurie o the [[Greater Antilles]]. It, housomeivver, ranks third in population amang that group o fower islands, which an aa include [[Cuba]], [[Hispaniola]], an [[Jamaica]].
[[Puerto Rican fowk|Puerto Ricans]] eften caw the island ''Borinquen'', frae ''Borikén'', its [[Indigenous fowks|indigenous]] [[Taíno]] name, which means "Land o the Valiant Lord".<ref>Allatson, Paul. Key Terms in Latino/a Cultural and Literary Studies, p. 47. Malden, Mass: Blackwell Publishing, 2007. ISBN 1-4051-0250-0.</ref><ref>
[http://www.taino-tribe.org/terms1.htm#anchor250018 Dictionary: Taino Indigenous Peoples of the Caribbean]
Retrieved: February 21, 2008. (Based on the encyclopedia "Clásicos de Puerto Rico", 2nd. edition. Ed. Cayetano Coll y Toste. Publisher: Ediciones Latinoamericanas, S.A., 1972.).</ref><ref>{{cite web|url=http://books.google.com/books?id=qAMQAAAAIAAJ&printsec=frontcover&dq=porto+rico&hl=en&ei=DWt0TNz5N8X6lweyoPTICA&sa=X&oi=book_result&ct=result&resnum=2&ved=0CEIQ6AEwAQ#v=onepage&q=land%20of%20the%20valiant%20lord&f=false |title=H. B. Grose, Advance in the Antilles: the new era in Cuba and Porto Rico, Presbyterian Home Missions, 1910 |publisher=Books.google.com |date=2006-08-08 |accessdate=2011-02-06}}</ref> The terms ''boricua'' an ''borincano'' derive frae ''Borikén'' an ''Borinquen'' respectively, an are commonly uised tae identify someane o Puerto Rican heritage. The island is an aa popularly kent in Spaingie as "''La Isla del Encanto''" which means "The Island o Enchantment" in Inglis.
== References ==
{{reflist}}
==Notes==
<references group="note"/>
{{Commonscat}}
[[Category:Puerto Rico| ]]
[[Category:Caribbean islands o the Unitit States]]
[[Category:Inglis-speakin kintras an territories]]
[[Category:Umwhile Spaingie colonies]]
[[Category:Freely associatit states]]
[[Category:Greater Antilles]]
[[Category:Insular auries o the Unitit States]]
[[Category:Island kintras]]
[[Category:Islands o Puerto Rico]]
[[Category:Spaingie-speakin kintras an territories]]
[[Category:States an territories established in 1898]]
{{Stub/Carib}}
{{Stub/USA}}
4qa93ir5035tiqnwpugr9ap0x0hr23l
Donetsk Oblast
0
18306
901707
896363
2025-01-04T07:57:43Z
Italiano1922
115108
Information haes been addit aboot the current war in the region
901707
wikitext
text/x-wiki
{{Infobox Ukrainian oblast
| name = Donetsk Oblast
| Ukrainian_name = Донецька область
| TransliteratedName = Donets’ka oblast’
| image_flag = Flag_of_Donetsk_Oblast.svg
| image_shield = Coat of Arms of Donetsk Oblast 1999.svg
| nickname = {{lang|uk|Донеччина (''Donechchyna'')}}
| image_map = Map of Ukraine political simple Oblast Donezk.png
| coordinates = {{coord|48.14|37.74|type:adm1st_region:UA|display=inline,title}}
| established_date = 3 Juin 1938
| official_lang = [[Ukrainian language|Ukrainian]], [[Russian Language|Russian]] (regional)<ref name=RUS_UA>{{cite news|title=Русский язык стал региональным в Севастополе, Донецкой и Запорожской обл.|url=http://top.rbc.ru/society/16/08/2012/664886.shtml|accessdate=16 August 2012|newspaper=RosBusinessConsulting|date=16 August 2012|archive-date=2018-12-25|archive-url=https://web.archive.org/web/20181225120747/https://www.rbc.ru/society/16/08/2012/5703fb6b9a7947ac81a6acb1|url-status=dead}}</ref>
| admin_center = [[Donetsk]]
| governor = Andriy Schyschatskyi<ref>[http://www.kyivpost.com/news/nation/detail/118768 Chornobyl cleanup workers stop protests in Donetsk], [[Kyiv Post]] (12 December 2011)</ref>
| governor_party = [[Party of Regions|PR]]<ref>{{uk icon}} [http://news.liga.net/ua/news/politics/544117-yanukovich-priznachiv-novogo-gubernatora-donetsko-oblast.htm Янукович призначив нового губернатора Донецької області], Информационно-аналитический центр "ЛІГА" (12 July 2011)</ref>
| chairman = Andriy Fedoruk<ref name=Fedoruk>[http://www.kyivpost.com/news/nation/detail/110070/ Donetsk Regional Council elects new chairman], [[Kyiv Post]] (4 August 2011)</ref>
| chairman_party = PR<ref name=Fedoruk/>
| council_seats = 150
| raions = 8
| city_raions =
| cities = 52
| CMTs = 131
| villages = 1124
| area_rank = 11t
| area_total_km2 = 26517
| population_as_of = 2006
| population_rank = 1st
| population = 4622900
| Density = 174,34
| salary_as_of = 2006
| salary_rank = 2nt
| salary = 1161
| postal_code = 83000-87999
| PostalCodePrefix = [[Leet o postal codes#U-Z]]
| iso_code = [[ISO 3166-2:UA|UA-14]]
| FIPS_code = [[Leet o FIPS region codes (S-U)#UP: Ukraine|UP05]]
| area_code = [[Aurie code#Ukraine|+380-62]]
| LicencePlateNumber = АН, АТ, ЯН, ЕВ, ЕА, ЕК, ЕМ, ЕС
| website = [http://www.donoda.gov.ua www.donoda.gov.ua]<br />[http://gska2.rada.gov.ua:7777/pls/z7502/A005?rdat1=03.06.2007&rf7571=6942 www.rada.gov.ua]
| footnotes =
}}
'''Donetsk Oblast''' ({{lang-uk|Донецька область}}, ''Donets’ka oblast’''; an aa referred tae as '''Donechchyna''' — {{lang-uk|Донеччина}} ''Donechchyna''; {{lang-ru|Донецкая область}}, ''Donetskaya oblast'') is an [[Admeenistrative diveesions o Ukraine|oblast]] (province) o eastren [[Ukraine]]. Its [[caipital ceety|admeenistrative centre]] is [[Donetsk]]. Historically, the province is an important pairt o the [[Donets Basin|Donbas]] region. Till November, 1961, it bore the name ''Stalino Oblast'' in honour o [[Joseph Stalin]].
Important ceeties athin the oblast include:
[[Sloviansk]], [[Horlivka]], [[Kramatorsk]], [[Makiivka]], [[Mariupol]], [[Yenakiieve]].
==Geografie==
Donetsk Oblast is locatit in sootheastren Ukraine. The aurie o the oblast (26,900 km²), comprises aboot 4.4% o the tot aurie o the kintra. The oblast borders the [[Dnipropetrovsk Oblast|Dnipropetrovsk]] an [[Zaporizhia Oblast]]s on the soothwast, the [[Luhansk Oblast]] on the northeast, the [[Rostov Oblast]] in Roushie on the east, an wi the [[Sea o Azov]] on the sooth.
Its langitude frae north tae sooth is 270 km, frae east tae wast – 190 km. The extreme pynts o the oblast's borders are: ''Bilosarayska Kosa'' ([[Spit (landform)|spit]]) on the sooth, Shevchenko o Velykonovosilkivskyi Raion on the wast, ''Verkhnyi Kut'' o Shakhtarskyi Raion on the east, an ''Lozove'' o [[Krasnolymanskyi Raion]] on the north.
The state historic-airchitectural preserve near the ceety o [[Sviatohirsk]] wi the [[Sviatohirsk Lavra]] wis nominatit for the [[Sieven Wonders o Ukraine]].
[[File:Donetsk oblast detail map.png|thumb|200px|Detailed cairt o Donetsk Oblast]]
==Administrative divisions==
The oblast is subdividit intae 18 [[raions]] (''admeenistrative destricts''). It consists o 28 municipalities, [[Leet o ceeties in Ukraine bi subdiveesion#Donetsk Oblast|52 ceeties]], [[Leet o urban-type settlements in Ukraine bi subdiveesion#Kiev Oblast|131 touns]], an mair nor 1,124 veelages.
The follaein data incorporates the nummer o each type o admeenistrative diveesions o Donetsk Oblast:
<!-- Some of the data here was calculated with the figures available, please fix if you find more correct numbers. -->
* Admeenistrative Center – 1 ([[Donetsk]])
* [[Raions]] — 18;
* Ceety raions — 28;
* Settlements — 1,283, includin:
** Veelages — 1,124;
** Ceeties/Touns — 159, includin:
*** [[Urban-type settlement]] — 131;
*** Ceeties — 52, includin:
**** Ceeties o oblast' subordinance — 28;
**** Ceeties o raion subordinance — 24;
* [[Selsovet]]s — ''N/A''.
The local admeenistration o the oblast' is controlled bi the Donetsk Oblast Rada. The govrenor o the oblast' is the Heid o Donetsk Oblast admeenistration, appointit bi the [[Preses o Ukraine]].
=== Raions ===
{|
|-
|
* [[Amvrosiivskyi Raion|Amvrosiivskyi]]
* [[Artemivskyi Raion|Artemivskyi]]
* [[Dobropilskyi Raion|Dobropilskyi]]
* [[Kostyantynivskyi Raion|Kostyantynivskyi]]
* [[Krasnoarmiiskyi Raion|Krasnoarmiiskyi]]
* [[Krasnolymanskyi Raion|Krasnolymanskyi]]
* [[Marynskyi Raion|Marynskyi]]
* [[Novoazovskyi Raion|Novoazovskyi]]
* [[Oleksandrivskyi Raion|Oleksandrivskyi]]
|
* [[Pershotravnevyi Raion|Pershotravnevyi]]
* [[Shakhtarskyi Raion|Shakhtarskyi]]
* [[Slovyanskyi Raion|Slovyanskyi]]
* [[Starobeshivskyi Raion|Starobeshivskyi]]
* [[Telmanivskyi Raion|Telmanivskyi]]
* [[Velikonovosilkivskyi Raion|Velikonovosilkivskyi]]
* [[Volnovaskyi Raion|Volnovaskyi]]
* [[Volodarskyi Raion (Donetsk Oblast)|Volodarskyi]]
* [[Yasynuvatskyi Raion|Yasynuvatskyi]]
|}
==Demographics==
The population o Donetsk Oblast is 4.7 million (2004), which constitutes 10% o the owerall Ukrainian population, makin it the maist populous an maist densely populatit region in the kintra. Its lairge population is due tae the presence o several big industrial ceeties an numerous veelages agglomeratit aroond them (see [[urbanization]]).
Durin the [[Ukrainian presidential election, 2004|2004 presidential election]], poleetical supporters o [[Viktor Yanukovych]] threatened tae demand [[Autonomous entity|autonomy]] for Donetsk an neighbourin oblasts if the election o thair candidate wis no recognised. Housomeivver, nae offeecial muives wur iver made.
As o the [[Ukrainian Census (2001)|Ukrainian Naitional Census, 2001]], the ethnic groups athin the Donetsk Oblast are: [[Ukrainians]] — 2,744,100 (56.9%), [[Roushies]] — 1,844,400 (38.2%), [[Greeks]] – 77,500 (1.61%), [[Belaroushies]] — 44,500 (0.92%), [[Crimean Tatars]] — 19,200 (0.4%), [[Armenians]] — 15,700 (0.33%), an [[Jews]] – 8,800 (0.18%).<ref name="ukrcensus">[http://www.ukrcensus.gov.ua/eng/regions/reg_don/ Ukrcensus.gov.ua — Donetsk region] {{Webarchive|url=https://web.archive.org/web/20090604192242/http://www.ukrcensus.gov.ua/eng/regions/reg_don/ |date=2009-06-04 }} URL accessed on January 13, 2007</ref>
The leids spoken athin the oblast' are: [[Roushie leid|Roushie]] — 74.9%, [[Ukrainian leid|Ukrainian]] — 24.1%, an [[Armenie leid|Armenie]] — 0.13%.<ref name="ukrcensus"/>
[[File:Donbass economic.jpg|thumb|200px|Cairt o the economic activity in the [[Donbass]], includin the Donetsk Oblast.]]
==Economy==
===Industry===
The Donetsk Oblast covers mair nor ane hauf coal, fieenished steel, [[Coke (fuel)|coke]], cast iron an steel production in Ukraine. Ferrous metallurgy, fuel industry an pouer industry are in demand in the structur o industry production. Thare are aboot 882 industry enterprises that are on independent balance, an 2,095 sma industry enterprises in the oblast.<ref name="CMU">[http://www.kmu.gov.ua/control/en/publish/article?art_id=124489&cat_id=32596 Cabinet of Ministers of Ukraine — Donetsk Region] {{Webarchive|url=https://web.archive.org/web/20171019083729/http://www.kmu.gov.ua/control/en/publish/article?art_id=124489&cat_id=32596 |date=2017-10-19 }} URL accessed on January 13, 2007</ref>
The oblast' haes a developed transport infrastructur which includes the Donetsk railwey (covers 40% o naitional transportation), the Mariupol Port, the Donetsk Internaitional Airport, passenger airports in [[Mariupol]] an [[Kramatorsk]], an dense road seestems. In the Donetsk Oblast twa [[special economic zones]] hae been creatit, ''Donetsk'' an ''Azov'', which hae a privileged tax regime.<ref name="CMU"/>
===Agricultur===
In 1999, the gross grain yield in the oblast wis aboot 999.1 thoosan tons, succar beets – 27.1 thoosan tons, sunflouer seeds – 309.4 thoosan tons, an potatoes – 380.2 thoosan tons.<ref name="CMU"/> An aa, 134.2 thoosan tons o meat, 494.3 thoosan tons o milk an 646.4 million eggs hae been produced. At the beginnin o 1999 thare hae been 2108 ferms athin the oblast.<ref name="CMU"/>
==Ecologie==
The Donetsk Oblast's climate is maistly continental, which is characterised bi het simmers an relatively cauld winters wi chyngeable snaw surfaces. East an sootheast strang winds, heich temperaturs an hivy rain shouers are teepical in the simmer. The average annual rainfallw is 524 mm.
[[File:Khomutovska Steppe.JPG|thumb|250px|A widden brig leads tae the entrance tae the [[Novoazovskyi Raion#Environment|Khomutovska Steppe]] natur preserve in Donetsk Oblast.]]
The basic minerals foond here are: [[coal]] (reserves – 25 billion tons), [[rock salt]], lime carbonate, [[potassium]], [[mercury (element)|mercury]], [[asbestos]], an [[graphite]]. The aurie is an aa rich in fertile black earth.
Important resoorces for recreation athin the aurie are: the mild climate, the [[Sea o Azov]] coast, curative mud, soorces o minerals, an radon an table watter. Due tae these numerous recreation resoorces, mony resort hotels an camps are locatit here. Thare are aboot 26 heal centres an pensions, 52 rest hames an boardin hooses, an rest camps for childer in the oblast.<ref name="CMU"/>
The curative auries in the oblast include the Slovyansk salt lakes an mineral watter soorces. The oblast an aa contains mony pairk zones, some o which are o great naitional value. Thay include the Khomutivsky steppe an the Azov sea coast. Oweraw, the Donetsk Oblast contains abouot 70 objects o natur an pairk fund includin branches o the Ukrainian steppe pairk, 6 state reserves, 10 memorials o natur, landscapes, an 6 pairk tracts.<ref name="CMU"/>
== Roushian invasion o Ukraine ==
A guid feck o the Donetsk Oblast is controlled bi the DFR (ДНР, DPR) - [[Donetsk Fowkrepublic]], that wis aforetime a pairtly recognised state, an nou is a subject o the Roushian Federation wi the richts o a Republic within the RF. Onywey, the annexation o this oblast tae the RF haesna been recognised bi maist o the UN kintras, an bi Ukraine thir territories are regairded as temporarily occupied ([[2022 Roushian invasion o Ukraine|Тимчасово окуповані території України]]).
==See an aw==
* [[Subdivisions o Ukraine]]
* [[Donets Basin]]
==References==
{{Reflist}}
* [http://www.kmu.gov.ua/control/en/publish/article?art_id=124489&cat_id=32596 Information Card of the Region] {{Webarchive|url=https://web.archive.org/web/20171019083729/http://www.kmu.gov.ua/control/en/publish/article?art_id=124489&cat_id=32596 |date=2017-10-19 }} — Offeecial steid o the Cabinet o Meenisters o Ukraine
==Freemit airtins==
{{sisterlinks|Donetsk Oblast}}
<div class="references-small">
* [http://www.citylife.donetsk.ua www.citylife.donetsk.ua] {{Webarchive|url=https://web.archive.org/web/20130307083452/http://www.citylife.donetsk.ua/ |date=2013-03-07 }} — Offeecial Donetsk ceety guide – {{en icon}}
* [http://www.donoda.gov.ua/m1/uk/ donoda.gov.ua]{{Webarchive|url=https://web.archive.org/web/20121201110537/http://www.donoda.gov.ua/main/ua/ |date=2012-12-01 }} — Offeecial steid o Donetsk Oblast Admeenistration {{en icon}}{{uk icon}}{{Ru icon}}
* [http://www.catalogue.biz.ua/eng/guides/guide_index/1/6/ catalogue.biz.ua] {{Webarchive|url=https://web.archive.org/web/20090220151418/http://www.catalogue.biz.ua/eng/guides/guide_index/1/6/ |date=2009-02-20 }} — Post codes directory o Donetsk Oblast {{en icon}}{{uk icon}}{{Ru icon}}
* [[File:Commons-logo.svg|15px]] [http://commons.wikimedia.org/wiki/Category:Donetsk_Oblast '''Wikimedia Commons'''] — Media on Donetsk Oblast
</div>
{{Donetsk Oblast}}
{{Admeenistrative diveesions o Ukraine}}
[[Category:Donetsk Oblast| ]]
[[Category:Oblasts o Ukraine]]
[[Category:States an territories established in 1938]]
7ro8yqnwtm1h2r9xzxnij9efqzk96cr
Admeenistrative diveesions o Ukraine
0
19307
901683
895806
2025-01-03T18:43:44Z
Italiano1922
115108
Information haes been addit aboot Ukraine's tint control ower its ain lands.
901683
wikitext
text/x-wiki
{{update}}
{{Fixscots}}
<div style="float:right;">
{{Ukraine Labelled Map}}
</div>
[[Ukraine]] is subdividit intae 24 '''[[oblast]]s''' ''(regions)'', ane '''[[autonomous republic]]''', an twa "'''ceities wi special status'''". The Ukrainian subdiveesion seestem reflects the kintra's status as a [[unitary state]] (as statit in the [[Constitution o Ukraine|kintra's constitution]]) wi unifeed [[legal]] an [[Local govrenment|admeenistrative]] regime fur ilka unit.
Fur an unnerstaundin o the [[cultural]] an socioeconomic differs athin the kintra, a knawledge o the [[Ukrainian historical regions]] is crucial in studyin the admeenistrative structur.
Follaein the [[2014 Crimean crisis]], the Crimea an [[Sevastopol]] cam unner the the [[Roushian Federation]]'s ''[[de facto]]'' administration, whilk claims thaim as the [[Republic o Crimea]] and the federal ceity o [[Sevastopol]]. Internaitionally, maist states hisnae recognised the Roushian claims. Daurin the Roushie-Ukrainian War (2022), Ukraine tint hauld o maist pairts o the Kherson Oblast, Zaporizhzhina, as weel as Donetsk an Luhansk. Amang ither things, Ukraine tint access tae the Sea o Azov. Houiver, daurin a breinge ower the border wi the Kursk Oblast, Ukraine set up contrule ower the Roushie toun o Sudzha. It wisnae taen intae Ukraine, but a Ukrainian militar command is rinnin it.<ref>{{Citation|title=2022 Roushian invasion o Ukraine|date=2023-07-21|url=https://sco.wikipedia.org/wiki/2022_Roushian_invasion_o_Ukraine|work=Wikipedia|access-date=2025-01-03}}</ref>
Ukraine inheritit its administrative divisions direct frae the [[Republics of the Soviet Union|local republican]] administration o the [[Soviet Union]], the [[Ukrainian Soviet Socialist Republic]], an the oweraw structure didnae chynge signeificantly frae the middle o the 20t yeirhunner til the 2020 reforms; it wis somewhit complex, as aside haein several levels o a territorial subdivision it forby haed a classification fur various populate places, particularly [[Ceities o Ukraine|ceities]]. The 2020 reforms, maugre reteenin the oblasts an twa ceities wi special status (o whilk Sevastopol is - like Crimea - ''de facto'' unner Russian administration), the seicond-tier level wis radically reduced in nummer frae 490 tae 136 districts (''raions''), wi aw the 118 umwhile "ceities o regional significance" merged intae the new districts.
== General scope o admeenistrative diveesion ==
[[File:Map of Ukraine political enwiki.png|thumb|450px|left|Cairt o the first level o admeenistrative diveesion o Ukraine.]]
===Structur===
Thare is three major subdiveesions: [[oblast]] (region), [[raion]] (destrict), an rada (municipality) ceity, toun, an rural.
Ceities aaways hae thair awn form o sel-admeenistration (municipality) dependin on thair status an some mey conseest o thair awn ceity's destricts (raions). A basic an the lawest level o admeenistrative diveesion is a municipality (or rada - cooncil). Municipalities can be ceity, urban or rural, locally abbreviatit as ''miskradas'', ''selyshchna rada'' or ''silradas'', respectively.
;Ceities municipalities
For ensaumple, the municipalities o ''Kiev'' an o ''Sevastopol'' hae the special status o a naitional importance (significance) an ilkane is offeecially classifeed as a ''ceity wi a special status'', whilk admeenistratively is equivalent tae an [[oblast]] (region). Mayors o thae ceities, in general, as govrenors o oblasts is bein appointit bi the [[Preses o Ukraine]]. Housomeivver, the status o the Mayor o Kiev ceity, in pairticular, is somewhit mair complex, an fur mair information see [[Legal status an local govrenment o Kiev]]. The status o the Sevastopol ceity is unique an aw.
On the '''oblast''' level awmaist ilkane haes at least ane ceity o oblast subordination (importance) whilk is the admeenistrative center (caipital) o that oblast. Housomeivver, some ither big ceities athin the oblast mey hae sic status as weel. The ceities o oblast subordination haes the same importance o a hale raion an is aften thair admeenistrative centers. Note that aside the regular raions thare is several ceities in Ukraine uisually o naitional (mentioned earlier) or oblast status that is subdividit intae several ''ceity raions'' o thair ain. Thae raions mey whiles include ither ceities, touns, an/or veelages. In 2010 thare wis 23 sic ceities that hae ceity raions.
A wheen o '''raions''' hae ceity municipalities o its level o subordination (importance) an aw. Thaim are uisually the admeenistrative centers (caipitals). No aw raions (destricts) haes a ceity as thair admeenistrative center; housomeivver, aw the raion (destrict) centers is at least urban-lik (urbanised). Aw admeenistrative centers haes thair ain form o sel-admeenistration. A raion's subordination municipalities mey admeenister several ither adjacent tae thaim local councils (municipalities), uisually rural. If a raion haes several raion (destrict) level ceities, thay mey skare an admeenistrative pouer fur the raion.
;Ither municipalities
As it wis mentioned abuin, aside ceity municipalities thare is urban-lik municipalities. The lawest form o sel-admeenistration is rural municipalities an veelages. A rural municipality mey conseest o ae veelage, uisually big, or combination o ither rural veelages or localities. Some veelages haes some addeitional vera sma settlements an aw. Those settlements thegither wi the hame veelage combine a local (rural) municipality (silrada). For simplicity's sake, silrada (rural municipality) is uisually refert tae as a veelage an is the lawest level o admeenistrative diveesion. The status tae ony settlement is grantit throu the [[Verkhovna Rada]].
;Ither admeenistrations
Thare is some umwhile militar installation-settlements (''viiskove mistechko'') an aw. Syne the faw o the Soviet Union, the secrecy o sic settlements wis "unveiled", housomeivver, thae touns bein subordinatit directly tae the Meenistry o Defence an dae no hae thair awn ceevil admeenistration. Sic military installations are lik ghost touns that are no even identifeed on a cairt. Ane o them is on the mairch o the [[Kiev Oblast|Kiev]] an [[Zhytomyr Oblast]]s cried Makarov-1.<ref>{{ru icon}}[http://podrobnosti.ua/video/podrobnosti/2010/10/31/727577.html In Kiev region a military installation cannot vote] {{Webarchive|url=https://web.archive.org/web/20120404114906/http://podrobnosti.ua/video/podrobnosti/2010/10/31/727577.html |date=2012-04-04 }} (''video'')</ref> Thare is a special territory whilk is unner the jurisdiction o the Emergencies Meenistry an aw. It is the territory whilk suffert the maist frae the [[Chernobyl Catastrophe]], kent as the [[Zone o alienation]]. Some restrictit territories belang the Ecology Meenistry (umwhile Natur Environment) an is conseidert natur [[Zapovednik|sanctuaries]] (preserves).
Thir days, thare is three enclaves. The ceity o [[Slavutych]] is admeenistratively subordinate direct tae the [[Kiev Oblast]], while bein completely surroondit bi [[Belaroushie]] an [[Chernihiv oblast|Chernihiv region]]. Anither enclave is a settlement Bile whilk is locate on the [[Snake Island (Black Sea)|Snake island]] an is fully surroondit bi the [[Black Sea]]. Bile is pairt o the [[Vylkove]] ceity o the [[Odessa Oblast]]. Atoun o [[Kotsyubynske]] ([[Irpin]] municipality) which is pairt o the Kiev region is completely surroondit bi the ceity o Kiev an aw.
Ither nomenclaturs fur local settlements that is nou abandoned include [[khutir]], wirkers' settlement etc.
The follaein table is based on the 2001 Ukrainian Census.
{| class="wikitable"
|-
! Degree o diveesion !! Territorial !! Number !! Ceities/ither settlements !! Number !! Tot settlements
|-
| rowspan="2" | 1 || [[Crimea]] || 1 || - || - || -
|-
| region/oblast || 24 || special status ceity || 2 || rowspan="4" | 459
|-
| rowspan="2" | 2 || destrict/raion || 490 || region level ceity || 178
|-
| - || - || ceity destrict || 118
|-
| rowspan="3" | 3 || - || - || destrict level ceity || 279
|-
| || || || ||
|-
| municipality, toun/urban-type || 783 || ither toun/urban-type settlement || 102 || 885
|-
| 4 || municipality, rural || 10278 || veelage || 27190 || rowspan="2" | 28456
|-
| 5 || - || - || rural settlement/selyshche || 1266
|}
===Types o settlements===
{| border=0 cellspacing=0 cellpadding=2 style="text-align:left; border:1px solid #ddd; font-size:90%;" summary=""
|+ style="text-align:left; font-size:111%; font-weight:bold; padding:.5em 0;" | Settlements bi Status
|- style="background:#ddd; vertical-align:top;"
! style="text-align:center;" colspan=2 | Status [http://gska2.rada.gov.ua:7777/pls/z7502/a002] {{Webarchive|url=https://web.archive.org/web/20071231154652/http://gska2.rada.gov.ua:7777/pls/z7502/a002 |date=2007-12-31 }}
! style="text-align:center;" | Status<br/ >(in [[Ukrainian leid|Ukrainian]])
! style="text-align:center;" | Tot Number<br/ >(as o 2006)
|- style="background:#f0f0f0;"
|colspan=2|'''[[ceity|misto / ceity]]''' || місто || style="text-align:right;" | '''457'''
|-
| || municipality|| місто зі спеціальним статусом || style="text-align:right;" | 2
|-
| || misto oblastnoho znachennia || місто областного значення || style="text-align:right;" | 176
|-
| || misto raionnoho znachennia || місто районного значення || style="text-align:right;" | 279
|- style="background:#f0f0f0;"
|colspan=2|'''[[urban-type settlement|selyshche miskoho typu / toun]]''' || селище міського типу || style="text-align:right;" | '''886'''
|- style="background:#f0f0f0;"
|colspan=2|'''[[veelage|selo / veelage]]''' || сільський населений пункт || style="text-align:right;" | '''28,552'''
|-
| || selysche || селище || style="text-align:right;" | 1,364
|-
| || selo || село || style="text-align:right;" | 27,188
|}
Thare are twa types o settlements: rural an urban.
;Rural
Rural populatit auries (сільський населений пункт) can be aither a veelage (село, [[selo]]) or a rural settlement (селище).
;Urban
Urban populatit auries (міський населений пункт) can be aither a ceity (місто) or an urbanized settlement (селище міського типу). Urbanized settlements for a brevity sake aften are classifeed as touns in the [[Scots leid]].
The chynges tae a settlement status can be done anerlie bi the [[Verkhovna Rada]]. Please, note that the size o a settlement daes no ultimately define its status awtho is a major factor. For ensaumple, the ceity o [[Prypiat]] in Ukraine still retains its status, while haein a population o zero (0) residents due tae its infrastructur: biggins, roads, utility netwirks, etc.
;Ceity vs. toun in Ukraine
The teepical Ukrainian ''misto'' ocht tae be conseidert a [[ceity]], no a [[toun]] (compare tae [[Ceity status in the Unitit Kinrick]]). Housomeivver, the ceity's subordination tae aither oblast or raion should be taken intae accoont an aw, especially in the political sense. Some o urbanized settlements mey be ceities o raion subordination, awtho it coud seem confusin, a type o settlement shoud be considered first as its status is gien for admeenistrative purposes.
==Leet o regions==
{| border=0 cellspacing=0 cellpadding=2 style="text-align:left; border:1px solid #ddd; font-size:90%; " summary="links to Ukraine's oblasts and their capital cities" class=sortable
|+ style="vertical-align:bottom; text-align:left; font-size:111%; font-weight:bold; padding:.5em 0;" | List o Ukraine's oblasts
|- style="background:#ddd; vertical-align:top;"
! style="text-align:left; font-weight:normal;" | Region
! style="text-align:left; font-weight:normal;" | Aurie (sq mi)
! style="text-align:left; font-weight:normal;" | Population (2010)
! style="text-align:left; font-weight:normal;" | Density
! style="text-align:left; font-weight:normal;" | Centre ceity
! style="text-align:left; font-weight:normal;" | Raions/Destricts
! style="text-align:left; font-weight:normal;" | Important ceities
|- style="vertical-align:top;"
|{{flag|Crimea}}
|10,038.0
|1,965,031
|195.76
|[[Simferopol]]
|10
|11
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Cherkasy Oblast}}
|8,069.5
|1,291,135
|160.00
|[[Cherkasy]]
|4
|6
|- style="vertical-align:top;"
|{{flag|Chernihiv Oblast}}
|12,303.1
|1,104,241
|89.75
|[[Chernihiv]]
|5
|3
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Chernivtsi Oblast}}
|3,126.3
|903,782
|289.09
|[[Chernivtsi]]
|3
|2
|- style="vertical-align:top;"
|{{flag|Dnipropetrovsk Oblast}}
|12,322.1
|3,344,073
|271.39
|[[Dnipro]]
|7
|13
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Donetsk Oblast}}
|10,238.3
|4,448,031
|434.45
|[[Donetsk]]
|8
|28
|- style="vertical-align:top;"
|{{flag|Ivano-Frankivsk Oblast}}
|5,366.8
|1,380,770
|257.28
|[[Ivano-Frankivsk]]
|6
|5
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Kharkiv Oblast}}
|12,129.4
|2,755,177
|227.15
|[[Kharkiv]]
|7
|7
|- style="vertical-align:top;"
|{{flag|Kherson Oblast}}
|10,988.9
|1,091,151
|99.30
|[[Kherson]]
|5
|3
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Khmelnytskyi Oblast}}
|7,971.1
|1,331,534
|167.05
|[[Khmelnytskyi, Ukraine|Khmelnytskyi]]
|3
|6
|- style="vertical-align:top;"
|{{flag|Kiev Oblast}}
|10,861.4
|1,719,602
|158.32
|[[Kiev]]
|7
|13
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Kirovohrad Oblast}}
|9,493.5
|1,014,809
|106.90
|[[Kropyvnytskyi]]
|4
|4
|- style="vertical-align:top;"
|{{flag|Luhansk Oblast}}
|10,302.7
|2,300,412
|223.28
|[[Luhansk]]
|8
|4
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Lviv Oblast}}
|8,429.8
|2,545,634
|301.98
|[[Lviv]]
|7
|9
|- style="vertical-align:top;"
|{{flag|Mykolaiv Oblast}}
|9,497.3
|1,186,452
|124.93
|[[Mykolaiv]]
|4
|5
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Odessa Oblast}}
|12,861.1
|2,387,636
|185.65
|[[Odessa]]
|7
|7
|- style="vertical-align:top;"
|{{flag|Poltava Oblast}}
|11,099.7
|1,493,668
|134.57
|[[Poltava]]
|4
|5
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Rivne Oblast}}
|7,740.2
|1,152,576
|148.91
|[[Rivne]]
|4
|4
|- style="vertical-align:top;"
|{{flag|Sumy Oblast}}
|9,202.4
|1,166,765
|126.79
|[[Sumy]]
|5
|7
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Ternopil Oblast}}
|5,337.1
|1,086,694
|203.61
|[[Ternopil]]
|3
|1
|- style="vertical-align:top;"
|{{flag|Vinnytsia Oblast}}
|10,236.7
|1,646,250
|160.82
|[[Vinnytsia]]
|6
|6
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Volyn Oblast}}
|7,777.6
|1,038,223
|133.49
|[[Lutsk]]
|4
|4
|- style="vertical-align:top;"
|{{flag|Zakarpattia Oblast}}
|4,933.2
|1,246,323
|252.64
|[[Uzhhorod]]
|6
|5
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Zaporizhia Oblast}}
|10,494.3
|1,805,431
|172.04
|[[Zaporizhia]]
|5
|5
|- style="vertical-align:top;"
|{{flag|Zhytomyr Oblast}}
|11,518.2
|1,283,201
|111.41
|[[Zhytomyr]]
|4
|5
|- style="vertical-align:top; background:#f0f0f0; "
|{{flag|Kiev}} ''(Kyiv)''
|323.9
|2,782,016
|8589.12
|[[Kiev]]
|10
|1
|- style="vertical-align:top;"
|{{flag|Sevastopol}}
|416.6
|380,301
|912.87
|[[Sevastopol]]
|4
|2
|}
==Namin==
{| border=0 cellspacing=0 cellpadding=2 style="text-align:left; border:1px solid #ddd; font-size:90%;" summary=""
|+ style="text-align:left; font-size:111%; font-weight:bold; padding:.5em 0;" | Names o Ukraine's admeenistrative units
|- style="background:#ddd; vertical-align:top;"
! style="text-align:left; font-weight:normal;" | Ukrainian
! style="text-align:left; font-weight:normal;" | Romanized¹
! style="text-align:left; font-weight:normal;" | Scots widespread
! style="text-align:left; font-weight:normal;" | Scots recommended (formal uise)
! style="text-align:left; font-weight:normal;" | Scots recommended (informal uise)
|- style="vertical-align:top;"
|автономна республіка
|avtonomna respublika
|(autonomous) republic
|autonomous republic
|autonomy
|- style="vertical-align:top; background:#f0f0f0;"
|область
|oblast'
|region², province
|oblast
|province
|- style="vertical-align:top;"
|район
|raion
|destrict, region³, aurie, coonty
|raion
|destrict
|- style="vertical-align:top; background:#f0f0f0;"
|місто
|misto
|ceity, municipality
|misto
|ceity, municipality<sup>5</sup>
|- style="vertical-align:top;"
|місто зі спеціальним статусом
|misto zi spetsial'nym statusom
|special-status municipality, special-charter municipality<sup>4</sup>
|municipality
|municipality, ceity
|- style="vertical-align:top; background:#f0f0f0;"
|місто областного значення
|misto oblastnoho znachennia
|ceity o oblast subordinance
|misto oblastnoho znachennia
|ceity o oblast subordinance
|- style="vertical-align:top;"
|місто районного значення
|misto raionnoho znachennia
|ceity o raion subordinance
|misto raionnoho znachennia
|ceity o raion subordinance
|- style="vertical-align:top; background:#f0f0f0;"
|селище міського типу
|selysche mis'koho typu
|toun, urban-type settlement
|selysche mis'koho typu
|toun, urban-type settlement
|- style="vertical-align:top;"
|сільський населений пункт
|sil'skyi naselenyi punkt
|veelage, rural-type settlement
|selo
|veelage, rural-type settlement
|- style="vertical-align:top; background:#f0f0f0;"
|селище
|selysche
|veelage
|selysche
|veelage
|- style="vertical-align:top;"
|село
|selo
|veelage
|selo
|veelage
|}
Notes
# Romanized uisin Ukrainian Naitional staundart. Details at [[Romanization o Ukrainian]].
# ''Province'' is mair precise acause region mey refer tae supranaitional geographic entity an aw.
# ''Region'' is ambiguous syne it uisually refers tae lairger naitional-level units; ''aurie'' is inaccurate.
* 4. Mey be referred as republican status an aw.
* 5. Ceity refers exclusively tae the ceity admeenistration (uisually smawer ceities), while some ceities include ither urban an rural admeenistrations sic collective admeenistrations form ceity cooncils - [[municipality|municipalities]].
===Oblast===
Wancommon in Inglis leid term ''oblast'' in the Ukraine is interchyngeably uised wi mair common region whilk is a general term uised for oblasts an the Republic o the Crimea. Maist o the Ukraine's [[oblast]] (regions) is named efter thair [[admeenistrative center]]s (aw ceities). Ilka region generally consists o aboot ane tae twa million fowk an haes aboot 20 destricts (raions).
;Nomenclatur grammatical aspect
The name o ilka oblast is a [[relative clause|relative]] [[adjective]], formed bi addin a feminine [[suffix]] tae the respective centre ceity's name. E.g. ''Poltava'' is a centre o ''Poltavs'ka oblast''' (Poltava Oblast). Maist o thaim are whiles refert tae in a feminine noun form an aw, follaein the convention o traditional regional place names, endin wi the suffix "-shchyna". E.g. Poltava Oblast is cried ''Poltavshchyna'' an aw.
Exceptions tae this rule include:
* Twa oblasts, Volyn an Zakarpattia, whilk retain the names o thair respective historical regions, ''Volyn''' ([[Volhynia]]) an ''Zakarpattia'' ([[Carpathia Ruthenie|Transcarpathie]]), whase respective caipitals is [[Lutsk]] an [[Uzhhorod]].
* Twa ceities: [[Kiev]] whilk is an independently admeenistrated ceity frae the surroondin [[Kiev Oblast]] an [[Sevastopol]] whilk, maugre bein locate on the [[Crimean peninsula]], isnae admeenistratively pairt o the [[Crimea]]. Kiev is, housomeivver, the admeenistrative centre o Kiev Oblast (the oblast's admeenistrative bodies is situate inside the ceity) an aw.
An oblast centre in [[Ukraine]] is uisually the lairgest an maist developit ceity in gien region.
Oblasts whiles refert tae as provinces, housomeivver historically provinces wis pairt o admeenistrative diveesion o the [[Roushie Empire]], territories o whilk the day aften ais different. Fur ensaumple, the umwhile Volhynie province encompasses the [[Rivne Oblast]], the [[Volyn Oblast]], an includes some territories in the [[Ternopil Oblast]] an aw. See [[Leet o etymologies o kintra subdiveesion names#Ukraine|Leet o etymologies o kintra subdiveesion names: "Ukraine"]] as weel.
== Autonomous Republic o Crimea ==
The Autonomous Republic o [[Crimea]] ({{lang-uk|Автономна Республіка Крим, Avtonomna Respublika Krym}}, {{lang-crh|Qırım Muhtar Cumhuriyeti}}), umwhile Crimea Oblast o the [[Ukrainian SSR]], is geographically the main pairt o [[Crimean peninsulae]] in the sooth o [[Ukraine]]. Its [[Caipital ceity|caipital]] is [[Simferopol]].
== Raions ==
{{Main|Raions o Ukraine}}
[[Raions o Ukraine|Raions]] is sma territorial units o subdiveesion o Ukraine. Thare is 490 raions in 24 oblasts an [[Crimea]] autonomous republic o Ukraine. An average aurie o Ukrainian raion is 1,200 km2 (463 sq mi), an average [[population]] o raions is 52,000 fowk.
{{Clear}}
==Metro Auries==
Ukraine haes five major agglomeratit metropolitan auries ([[conurbation]]s).
* [[Kiev metropolitan aurie|Kiev]] includes ceities sic as [[Irpin]], [[Boryspil]], [[Fastiv]] amang ithers
* Kharkiv includes ceities sic as [[Chuhuiv]], [[Merefa]], an numerous ither settlements
* Donetsk includes ceities sic as [[Makiivka]], [[Khartsyzk]], an ithers
* Dnipro wi [[Kamianske]] an [[Novomoskovsk, Ukraine|Novomoskovsk]]
* Odessa wi [[Chornomorsk]] an [[Ovidiopol]]
Ither minor metro auries are:
* [[Kryvyi Rih]] an [[Zhovti Vody]]
* [[Lviv]] wi [[Vynnyky]] an [[Pustomyty]]
* [[Horlivka]] an [[Yenakieve]]
* [[Zaporizhia]] wi [[Vilniansk]]
* [[Mykolaiv]] wi [[Voskresenske]]
* [[Luhansk]] wi [[Oleksandrivsk]] an [[Schastia]]
* [[Mariupol]] wi [[Staryi Krym, Donetsk|Staryi Krym]]
Thir conurbation auries are nae offeecially recognised an remain tae be administered accordin tae offeecial [[oblast]]-[[raion]] seestem o subdiveesion.
== Relatit pages ==
* [[Geography o Ukraine]]
* [[Historical regions o Ukraine]]
* [[ISO 3166-2:UA]]
* [[Admeenistrative diveesions development in Ukraine]]
* [[Admeenistrative diveesions o the Ukrainian SSR]]
==References==
{{reflist}}
==Freemit airtins==
*{{uk icon}} [http://gska2.rada.gov.ua:7777/pls/z7502/a002 Subdivisions of Ukraine] {{Webarchive|url=https://web.archive.org/web/20071231154652/http://gska2.rada.gov.ua:7777/pls/z7502/a002 |date=2007-12-31 }} – Verhovna Rada steid
*{{en icon}} [http://www.statoids.com/yua.html List of raions] – sub-subdiveesions o [http://www.statoids.com/uua.html oblasts]
{{Ukraine topics}}
{{Admeenistrative diveesions o Ukraine}}
{{Ukrainian Elections}}
{{Airticles on first-level admeenistrative diveesions o European kintras}}
{{DEFAULTSORT:Admeenistrative Diveesions O Ukraine}}
<!--Categories-->
[[Category:Subdiveesions o Ukraine| ]]
[[Category:Leets o kintra subdiveesions|Ukraine]]
[[Category:Kintra subdiveesions o Europe|Ukraine]]
<!--Other languages-->
48ppkwu2mllzrkcv8o48uig86cno29j
Bryansk Oblast
0
21402
901709
842274
2025-01-04T10:27:20Z
Italiano1922
115108
901709
wikitext
text/x-wiki
{{Infobox Roushie federal subject
|en_name=Bryansk Oblast
|ru_name=Брянская область
|image_map=Bryansk in Russia.svg
|coordinates = {{coord|52|57|N|33|24|E|type:adm1st_region:RU|display=inline,title}}
|image_coa=Coat of Arms of Bryansk Oblast.svg
|coa_caption=[[Coat o airms o Bryansk Oblast]]
|image_flag=Flag of Bryansk Oblast.svg
|flag_caption=[[Flag o Bryansk Oblast]]
|anthem=''[[The Bryansk Forest Sternly Stirred]]''
|anthem_ref
|holiday
|holiday_ref
|political_status=Oblast
|political_status_link=Oblasts o Roushie
|federal_district=[[Central Federal Destrict|Central]]
|economic_region=[[Central economic region|Central]]
|adm_ctr_type=Admeenistrative center
|adm_ctr_name=[[Bryansk]]
|adm_ctr_ref
|pop_2010census=1278217
|pop_2010census_rank=38t
|urban_pop_2010census=69.1%
|rural_pop_2010census=30.9%
|pop_2010census_ref=<ref name="2010Census" />
|pop_density
|pop_density_as_of
|pop_density_ref
|pop_latest
|pop_latest_date
|pop_latest_ref
|area_km2=34900
|area_km2_rank=62nt
|area_km2_ref
|established_date=5 Julie 1944
|established_date_ref
|license_plates=32
|ISO=RU-BRY
|gov_as_of=Mairch 2011
|leader_title=[[Govrenor o Bryansk Oblast|Govrenor]]
|leader_title_ref=<ref name="HeadTitle">Charter, Article 41.3b</ref>
|leader_name=[[Nikolay Denin]]
|leader_name_ref=<ref name="HeadName">Official website of Bryansk Oblast. [http://www.bryanskobl.ru/authority/governor/ Nikolay Vasilyevich Denin, Governor of Bryansk Oblast] {{Webarchive|url=https://web.archive.org/web/20130215073158/http://www.bryanskobl.ru/authority/governor/ |date=2013-02-15 }} {{ru icon}}</ref>
|legislature=[[Bryansk Oblast Duma|Oblast Duma]]
|legislature_ref=<ref name="Legis">Charter, Article 41.3a</ref>
|website=http://www.bryanskobl.ru/
|website_ref
|date=August 2010
}}
'''Bryansk Oblast''' ({{lang-ru|Бря́нская о́бласть}}, ''Bryanskaya oblast'') is a [[federal subjects o Roushie|federal subject]] o [[Roushie]] (an [[oblast]]). Its [[admeenistrative center]] is the [[types o inhabitit localities in Roushie|ceety]] o [[Bryansk]]. Population: 1,278,217 ([[Roushie Census (2010)|2010 Census]] results).<ref name="2010Census">{{ru-pop-ref|2010Census}}</ref>
The mairches o Bryansk Oblast neist Ukraine hae been hauden tae taids bi the RDK. The airts hae been subjek tae odd shots frae Ukraine. There wis nae oncome in the region, but there's a tale gaun aboot that in ane o the clachans o Starodub raion, fowk frae the local cooncil met RDK sodgers wi flooers an singin the sang "Мужество ведёт на небеса".
==Admeenistrative diveesions==
{{Main|Admeenistrative diveesions o Bryansk Oblast}}
[[File:Bryansk admin divisions.png|thumb|left|Admeenistrative diveesions o Bryansk Oblast]]
Bryansk Oblast is dividit intae 27 destricts (''[[raion]]s'') an 4 [[types o inhabitit localities in Roushie|ceeties]]. Thegither thay comprise 12 [[types o inhabitit localities in Roushie|touns]], 24 [[urban-type settlements]], an 224 [[selsoviet]]s.
==Demographics==
Population: 1,278,217 ([[Roushie Census (2010)|2010 Census]]);<ref name="2010Census">{{ru-pop-ref|2010Census}}</ref> {{ru-census|p2002=1,378,941|p1989=1,474,785}}
*Births (2008): 14,319 (11.0 per 1000)
*Daiths (2008): 23,197 (17.8 per 1000)
Births increased bi 7.8% an daiths remained the same in 2008 compared tae 2007.<ref>[http://bryansk.gks.ru/digital/region1/2007/8.3.3.htm Demographical statistics for Bryansk] {{Webarchive|url=https://web.archive.org/web/20120116033405/http://bryansk.gks.ru/digital/region1/2007/8.3.3.htm |date=2012-01-16 }} (in Russian)</ref>
Ethnic composition:<ref name="2010Census" />
*[[Roushies]] - 96.7%
*[[Ukrainians]] - 1.1%
*[[Belaroushies]] - 0.4%
*[[Armenies]] - 0.4%
*[[Romani fowk]] - 0.3%
*[[Jews]] - 0.1%
*Ithers - 1%
*26,825 fowk wur registered frae admeenistrative databases, an coud no declare an ethnicity. It is estimatit that the proportion o ethnicities in this group is the same as that o the declared group.<ref>{{Cite web |url=http://www.perepis-2010.ru/news/detail.php?ID=6936 |title=Archived copy |access-date=2012-01-10 |archive-date=2018-12-25 |archive-url=https://web.archive.org/web/20181225111852/http://www.gks.ru/free_doc/new_site/perepis2010/croc/perepis_itogi1612.htm |url-status=dead }}</ref>
==References==
{{Reflist}}
==Freemit airtins==
{{Commonscat|Bryansk Oblast}}
*{{ru icon}} [http://www.bryanskobl.ru/ Offeecial wabsteid o Bryansk Oblast]
*{{en icon}} [http://russiatrek.org/bryansk-oblast Bryansk oblast natur views]
{{Subdiveesions o Roushie}}
[[Category:Bryansk Oblast| ]]
[[Category:States an territories established in 1944]]
r9tl4e0mz28oj2wywa0o0rn45bnaxq0
901710
901709
2025-01-04T10:36:21Z
CiphriusKane
74958
Undae revision [[Special:Diff/901709|901709]] bi [[Special:Contributions/Italiano1922|Italiano1922]] ([[User talk:Italiano1922|Tauk]])1: Unsoorced 2: Iss isna a place ti be pittin hearsay
901710
wikitext
text/x-wiki
{{Infobox Roushie federal subject
|en_name=Bryansk Oblast
|ru_name=Брянская область
|image_map=Bryansk in Russia.svg
|coordinates = {{coord|52|57|N|33|24|E|type:adm1st_region:RU|display=inline,title}}
|image_coa=Coat of Arms of Bryansk Oblast.svg
|coa_caption=[[Coat o airms o Bryansk Oblast]]
|image_flag=Flag of Bryansk Oblast.svg
|flag_caption=[[Flag o Bryansk Oblast]]
|anthem=''[[The Bryansk Forest Sternly Stirred]]''
|anthem_ref
|holiday
|holiday_ref
|political_status=Oblast
|political_status_link=Oblasts o Roushie
|federal_district=[[Central Federal Destrict|Central]]
|economic_region=[[Central economic region|Central]]
|adm_ctr_type=Admeenistrative center
|adm_ctr_name=[[Bryansk]]
|adm_ctr_ref
|pop_2010census=1278217
|pop_2010census_rank=38t
|urban_pop_2010census=69.1%
|rural_pop_2010census=30.9%
|pop_2010census_ref=<ref name="2010Census" />
|pop_density
|pop_density_as_of
|pop_density_ref
|pop_latest
|pop_latest_date
|pop_latest_ref
|area_km2=34900
|area_km2_rank=62nt
|area_km2_ref
|established_date=5 Julie 1944
|established_date_ref
|license_plates=32
|ISO=RU-BRY
|gov_as_of=Mairch 2011
|leader_title=[[Govrenor o Bryansk Oblast|Govrenor]]
|leader_title_ref=<ref name="HeadTitle">Charter, Article 41.3b</ref>
|leader_name=[[Nikolay Denin]]
|leader_name_ref=<ref name="HeadName">Official website of Bryansk Oblast. [http://www.bryanskobl.ru/authority/governor/ Nikolay Vasilyevich Denin, Governor of Bryansk Oblast] {{Webarchive|url=https://web.archive.org/web/20130215073158/http://www.bryanskobl.ru/authority/governor/ |date=2013-02-15 }} {{ru icon}}</ref>
|legislature=[[Bryansk Oblast Duma|Oblast Duma]]
|legislature_ref=<ref name="Legis">Charter, Article 41.3a</ref>
|website=http://www.bryanskobl.ru/
|website_ref
|date=August 2010
}}
'''Bryansk Oblast''' ({{lang-ru|Бря́нская о́бласть}}, ''Bryanskaya oblast'') is a [[federal subjects o Roushie|federal subject]] o [[Roushie]] (an [[oblast]]). Its [[admeenistrative center]] is the [[types o inhabitit localities in Roushie|ceety]] o [[Bryansk]]. Population: 1,278,217 ([[Roushie Census (2010)|2010 Census]] results).<ref name="2010Census">{{ru-pop-ref|2010Census}}</ref>
==Admeenistrative diveesions==
{{Main|Admeenistrative diveesions o Bryansk Oblast}}
[[File:Bryansk admin divisions.png|thumb|left|Admeenistrative diveesions o Bryansk Oblast]]
Bryansk Oblast is dividit intae 27 destricts (''[[raion]]s'') an 4 [[types o inhabitit localities in Roushie|ceeties]]. Thegither thay comprise 12 [[types o inhabitit localities in Roushie|touns]], 24 [[urban-type settlements]], an 224 [[selsoviet]]s.
==Demographics==
Population: 1,278,217 ([[Roushie Census (2010)|2010 Census]]);<ref name="2010Census">{{ru-pop-ref|2010Census}}</ref> {{ru-census|p2002=1,378,941|p1989=1,474,785}}
*Births (2008): 14,319 (11.0 per 1000)
*Daiths (2008): 23,197 (17.8 per 1000)
Births increased bi 7.8% an daiths remained the same in 2008 compared tae 2007.<ref>[http://bryansk.gks.ru/digital/region1/2007/8.3.3.htm Demographical statistics for Bryansk] {{Webarchive|url=https://web.archive.org/web/20120116033405/http://bryansk.gks.ru/digital/region1/2007/8.3.3.htm |date=2012-01-16 }} (in Russian)</ref>
Ethnic composition:<ref name="2010Census" />
*[[Roushies]] - 96.7%
*[[Ukrainians]] - 1.1%
*[[Belaroushies]] - 0.4%
*[[Armenies]] - 0.4%
*[[Romani fowk]] - 0.3%
*[[Jews]] - 0.1%
*Ithers - 1%
*26,825 fowk wur registered frae admeenistrative databases, an coud no declare an ethnicity. It is estimatit that the proportion o ethnicities in this group is the same as that o the declared group.<ref>{{Cite web |url=http://www.perepis-2010.ru/news/detail.php?ID=6936 |title=Archived copy |access-date=2012-01-10 |archive-date=2018-12-25 |archive-url=https://web.archive.org/web/20181225111852/http://www.gks.ru/free_doc/new_site/perepis2010/croc/perepis_itogi1612.htm |url-status=dead }}</ref>
==References==
{{Reflist}}
==Freemit airtins==
{{Commonscat|Bryansk Oblast}}
*{{ru icon}} [http://www.bryanskobl.ru/ Offeecial wabsteid o Bryansk Oblast]
*{{en icon}} [http://russiatrek.org/bryansk-oblast Bryansk oblast natur views]
{{Subdiveesions o Roushie}}
[[Category:Bryansk Oblast| ]]
[[Category:States an territories established in 1944]]
ij0231ms206nw9ffai4ca1jxpq2cjjz
Banjul
0
36381
901680
901679
2025-01-03T16:29:54Z
Steinbach
28732
Textbook example of spam.
901680
wikitext
text/x-wiki
{{Linkrot}}
{{Infobox settlement
|official_name = Banjul
|other_name =
|native_name =
|nickname =
|settlement_type = <!--For Town or Village (Leave blank for the default City)-->
|motto =
|image_skyline = Banjul-King-Fahad-Mosque-2007.jpg
|imagesize = 300px
|image_caption = Banjul Keeng Fahad Mosque an surroondins
|image_flag =
|flag_size =
|image_seal =
|seal_size =
|image_shield =
|shield_size =
|city_logo =
|citylogo_size =
|image_map = Banjul SPOT 1045.jpg
|mapsize = 300px
|map_caption = Banjul seen frae SPOT satellite
|image_map1 =
|mapsize1 =
|map_caption1 =
|image_dot_map =
|dot_mapsize =
|dot_map_caption =
|dot_x = |dot_y =
|pushpin_label_position = <!-- the position of the pushpin label: left, right, top, bottom, none -->
|pushpin_mapsize =300
|pushpin_map_caption =
|subdivision_type = Kintra
|subdivision_name = [[The Gambie]]
|subdivision_type1 = Diveesion
|subdivision_name1 = Banjul
|subdivision_type2 =
|subdivision_name2 =
|subdivision_type3 =
|subdivision_name3 =
|subdivision_type4 =
|subdivision_name4 =
|government_footnotes =
|government_type =
|leader_title =
|leader_name =
|leader_title1 = <!-- for places with, say, both a mayor and a city manager -->
|leader_name1 =
|leader_title2 =
|leader_name2 =
|leader_title3 =
|leader_name3 =
|leader_title4 =
|leader_name4 =
|established_title =
|established_date =
|established_title2 = <!-- Incorporated (town) -->
|established_date2 =
|established_title3 = <!-- Incorporated (city) -->
|established_date3 =
|area_magnitude =
|unit_pref =Imperial <!--Enter: Imperial, if Imperial (metric) is desired-->
|area_footnotes =
|area_total_km2 =
|area_land_km2 = <!--See table @ Template:Infobox Settlement for details on automatic unit conversion-->
|area_water_km2 =
|area_total_sq_mi =
|area_land_sq_mi =
|area_water_sq_mi =
|area_water_percent =
|area_urban_km2 =93
|area_urban_sq_mi =
|area_metro_km2 =
|area_metro_sq_mi =
|population_as_of =2003
|population_footnotes =
|population_note =
|population_total =34,828
|population_density_km2 = 374.5
|population_density_sq_mi =
|population_metro =
|population_density_metro_km2 =
|population_density_metro_sq_mi =
|population_urban =357,238
|population_density_urban_km2 =
|population_density_urban_sq_mi =
|population_blank1_title =
|population_blank1 =
|population_density_blank1_km2 =
|population_density_blank1_sq_mi =
|timezone =
|utc_offset =
|timezone_DST =
|utc_offset_DST =
|coordinates = {{coord|13|27|11|N|16|34|39|W|region:GM|display=inline}}
|elevation_footnotes = <!--for references: use <ref> </ref> tags-->
|elevation_m =
|elevation_ft =
|postal_code_type = <!-- enter ZIP code, Postcode, Post code, Postal code... -->
|postal_code =
|area_code =
|blank_name =
|blank_info =
|blank1_name =
|blank1_info =
|website =
|footnotes =
}} <!-- Infobox ends -->
'''Banjul''' (umwhile '''Bathurst'''), offeecially the '''Ceety of Banjul''', is the [[caipital ceety|caipital]] o [[The Gambie]], an is in the diveesion o the same name. The population o the ceety proper is anerlie 34,828, wi the '''Greater Banjul Aurie''', which includes the City of Banjul an the Kanifing Municipal Council, at a population o 357,238 (2003 census).<ref>[http://www.statoids.com/ugm.html Gambia Divisions]</ref> Banjul is on St Mary's Island (Banjul Island), whare the [[Gambia River]] enters the [[Atlantic Ocean]]. The island is connectit tae the mainland — bi passenger an vehicle [[Ferry|ferries]] tae the north an bi brigs tae the sooth.
==Etymology==
Banjul taks its name frae the [[Mandé fowks|Mandé fowk]] who gathered specific feebres on the island, which wur uised in the manufactur o ropes. '''Bang julo''' is the Mandinka (Mande) wird for rope feebre.
==History==
In 1651 Banjul wis leased bi the [[Duke o Courland]] frae the keeng o [[Kombo]], as pairt o [[Courland colonization]].<ref>[http://books.google.com/books?id=0C1eWHq8LZ4C&pg=PA43&dq=Juffure+courland&hl=en&ei=XDcQTZ7UC4XGsAPI482mDw&sa=X&oi=book_result&ct=result&resnum=4&ved=0CC8Q6AEwAw#v=onepage&q=Juffure%20courland&f=false]</ref>
In 1816, the Breetish foondit Banjul as a tradin post an base for suppressin the [[sclavery|sclave]] trade. The Breetish renamit the Banjul Island tae St. Mary an first namit Bathurst efter [[Henry Bathurst, 3rd Earl Bathurst|Henry Bathurst]], the secretary o the Breetish Colonial Office, but wis chyngit tae Banjul in 1973.<ref>[http://www.accessgambia.com/information/banjul-history.html History of Banjul]</ref>
[[File:Banjul-Arch22-And-Statue-2007.jpg|thumb|left|''Arch 22'' at the entrance tae Banjul]]
On 22 Julie 1994 Banjul wis the scene o a bluidless militar [[coup d'état]] in which Preses [[Dawda Jawara]] wis owerthrown an replacit bi Preses [[Yahya Jammeh]]. Tae commemorate this event, [[Arch 22]] wis biggit as an entrance portal tae the caipital. The gate is 35 metres taw an staunds at the centre o an open square. It hooses a [[textile]] [[museum]].
Attractions in the ceety include the [[Gambian National Museum]], the [[Albert Market]], [[Banjul State House]], [[Banjul Court House]], [[African Heritage Museum]], twa [[cathedral]]s an several major [[mosque]]s.<ref>[http://www.happytellus.com/banjul/gambia Banjul Gambia - Travel Information] {{Webarchive|url=https://web.archive.org/web/20121004124556/http://www.happytellus.com/banjul/gambia |date=2012-10-04 }}</ref>
Banjul is the destination o the [[Plymouth-Banjul Challenge]], a charity road rally.
==Economy==
Banjul is the kintra's economic an admeenistrative centre an includes the [[Central Bank of The Gambia]]. [[Peanit]] processin is the kintra's principal industry, but [[beeswaux]], [[Arecaceae|paum wid]], [[paum ile]], an skins an hides are shippit frae the port o Banjul an aw.<ref>[http://www.state.gov/r/pa/ei/bgn/5459.htm State Department Information]</ref>
Banjul is the hame o the Gambia Technical Training Institute an aw. GTTI is currently engagit in a pairtnership wi nan-profit organization [[Power Up Gambia]] tae develop a solar energy trainin program.
==Climate==
Banjul haes a vera wairm climate year roond. Unner the [[Köppen climate classification]], Banjul features a [[tropical wet an dry climate]]. The ceety featurs a lengthy [[dry saison]], spannin frae November tae Juin an a relatively short [[wet saison]] coverin the remainin fower month. Housomeivver, durin those fower month, Banjul tends tae see hivy precipitation. August is uisually the rainiest month, wi on average 500 mm o precipitation fawin. Temperaturs are somewha constant, tho it tends tae be slichtly ceuler durin the wet saison than the dry saison.
{{Weather box
|location = Banjul
|metric first = yes
|single line = yes
|temperature colour=pastel
|Jan record high C = 37
|Feb record high C = 39
|Mar record high C = 40
|Apr record high C = 41
|May record high C = 41
|Jun record high C = 38
|Jul record high C = 34
|Aug record high C = 33
|Sep record high C = 34
|Oct record high C = 37
|Nov record high C = 36
|Dec record high C = 36
|year record high C = 41
|Jan high C = 31
|Feb high C = 32
|Mar high C = 34
|Apr high C = 33
|May high C = 32
|Jun high C = 32
|Jul high C = 30
|Aug high C = 29
|Sep high C = 31
|Oct high C = 32
|Nov high C = 32
|Dec high C = 31
|year high C = 32
|Jan low C = 15
|Feb low C = 16
|Mar low C = 17
|Apr low C = 18
|May low C = 19
|Jun low C = 23
|Jul low C = 23
|Aug low C = 23
|Sep low C = 23
|Oct low C = 22
|Nov low C = 18
|Dec low C = 16
|year low C = 19
|Jan record low C = 7
|Feb record low C = 10
|Mar record low C = 12
|Apr record low C = 12
|May record low C = 14
|Jun record low C = 18
|Jul record low C = 21
|Aug record low C = 20
|Sep record low C = 17
|Oct record low C = 16
|Nov record low C = 12
|Dec record low C = 9
|year record low C = 7
|rain colour=green
|Jan rain mm = 3
|Feb rain mm = 3
|Mar rain mm = 0
|Apr rain mm = 0
|May rain mm = 10
|Jun rain mm = 58
|Jul rain mm = 282
|Aug rain mm = 500
|Sep rain mm = 310
|Oct rain mm = 109
|Nov rain mm = 18
|Dec rain mm = 3
|rain colour=green
|Jan rain days = 0
|Feb rain days = 0
|Mar rain days = 0
|Apr rain days = 0
|May rain days = 1
|Jun rain days = 5
|Jul rain days = 16
|Aug rain days = 19
|Sep rain days = 19
|Oct rain days = 9
|Nov rain days = 1
|Dec rain days = 3
|unit rain days = 0.1 mm
|Jan humidity = 47
|Feb humidity = 46
|Mar humidity = 52
|Apr humidity = 61
|May humidity = 69
|Jun humidity = 76
|Jul humidity = 83
|Aug humidity = 86
|Sep humidity = 84
|Oct humidity = 80
|Nov humidity = 69
|Dec humidity = 56
|Jan sun = 279
|Feb sun = 282
|Mar sun = 310
|Apr sun = 300
|May sun = 310
|Jun sun = 270
|Jul sun = 186
|Aug sun = 186
|Sep sun = 180
|Oct sun = 248
|Nov sun = 240
|Dec sun = 279
|source 1 = BBC Weather<ref name="weather1">{{cite web
| url =http://www.bbc.co.uk/weather/2413876 | title =Average Conditions Banjul, Gambia | accessdate =April 11, 2012
| publisher =BBC Weather }}</ref>
|date=August 2010
}}
==Transport==
[[File:1014046-Banjul Albert Market-The Gambia.jpg|thumb|right|Albert Market]]
[[File:Gambia Banjul 0012.jpg|thumb|A street in Banjul]]
Ferries sail frae Banjul tae [[Barra, Gambie|Barra]]. The ceety is servit bi the [[Banjul Internaitional Airport]]. Banjul is on the [[Trans–Wast African Coastal Heich-gate]] connectin it tae [[Dakar]] an [[Bissau]], an will eventually provide a pavit heich-gate link tae 11 ither naitions o the [[Economic Commonty o Wast African States]] (ECOWAS).
Banjul Internaitional Airport wis ane o the primary [[Space Shuttle abort modes#Transoceanic Abort Landing .28TAL.29|Transoceanic Abort Landing]] (TAL) steids for the [[Space Shuttle]]. It wis selectit in September 1987, replacin a TAL steid at Dakar, Senegal, due tae runwey deficiencies an geographic hazards thare. Banjul wis closed as a TAL steid in November 2002, awtho it wis uised for the [[STS-125]] mission tae the [[Hubble Space Telescope]] in 2009.
==Destricts==
[[File:Banjul districts.png|thumb|left|150px|Destricts o Banjul]]
Banjul Diveesion (Greater Banjul Aurie) is dividit inta twa [[destrict]]s:
*Banjul
*[[Kanifing Destrict|Kanifing]]
==Sister ceeties==
*{{flagicon|Belgium}} [[Ostend]] ([[Belgium]])<ref>Cooperation is established in ICT-infrastructure for the B.C.C. and other projects for capacity building. Ostend-based humanitarian organisation Medios vzw is supporting the Female Surgical Ward of the Royal Victoria Teaching Hospital. (more info on http://stedenband.oostende.be {{Webarchive|url=https://web.archive.org/web/20080312172913/http://stedenband.oostende.be/ |date=2008-03-12 }})</ref>
*{{flagicon|United Kingdom}} [[Grimsby]] ([[Unitit Kinrick|UK]])
*{{flagicon|USA}} [[Newark, New Jersey]] ([[Unitit States]]).
*{{flagicon|Taiwan}} [[Taipei]], ([[Republic o Cheenae|Taiwan]]) syne 1997.
==See an aw==
*[[Diveesions o the Gambie]]
*[[Destricts o the Gambie]]
==References==
<references />
==Freemit airtins==
{{Commons category}}
*[http://www.accessgambia.com/ Access Gambia - Hotels, News, Travel & Photos]
*[http://www.lisavandamme.be/gambia_2007.php photo documentary 2007 (Lisa Van Damme) ] {{Webarchive|url=https://web.archive.org/web/20120820121628/http://www.lisavandamme.be/gambia_2007.php |date=2012-08-20 }}
{{Admeenistrative diveesions o The Gambie}}
{{Leet o African caipitals}}
[[Category:Banjul| ]]
[[Category:Local Govrenment Auries o the Gambie]]
[[Category:Populatit places in the Gambie]]
[[Category:Caipitals in Africae]]
[[Category:Serer kintra]]
[[Category:Populatit places established in 1816]]
[[Category:Gambie River]]
[[Category:Umwhile colonies o Courland]]
{{Stub/Africae}}
{{Stub/Ceety}}
3o2wb53j4xxa27x4njmuubqa3oggq2a
Gibraltar
0
37801
901690
885862
2025-01-03T20:28:18Z
CommonsDelinker
411
Replacin' EU-Gibraltar.svg wi' [[File:EU-Gibraltar_(pre-Brexit).svg]] (by [[commons:User:CommonsDelinker|CommonsDelinker]] coz: [[:c:COM:FR|File renamed]]: [[:c:COM:FR#FR2|Criterion 2]] (meaningless or ambiguous name) · according to the map content: this
901690
wikitext
text/x-wiki
{{Infobox country
| conventional_long_name = Gibraltar
| common_name = Gibraltar
| image_flag = Flag of Gibraltar.svg
| image_coat = Coat of arms of Gibraltar1.svg
| symbol_width = 75px
| image_map = EU-Gibraltar (pre-Brexit).svg
| map_caption = {{map caption |location_color=daurk green|country={{nobold|Gibraltar}}|region=Europe |region_color=daurk grey |subregion=the [[European Union]] |subregion_color=green}}
| image_map2 = Gibraltar map-en-edit2.svg
| map2_width = 250px
| map_caption2 = Map o Gibraltar
| national_motto = {{native phrase|la|"Montis Insignia Calpe"|italics=off}}<br/>{{small|"Badge o the Rock o Gibraltar"<ref>{{cite web|url =https://www.gibraltar.gov.gi/national-symbols|title =National Symbols|publisher =Gibraltar.gov.gi|accessdate =21 June 2013|archive-url =https://web.archive.org/web/20141113200625/https://www.gibraltar.gov.gi/national-symbols|archive-date =13 November 2014|dead-url =yes|df =dmy-all}}</ref>}}
| national_anthem = "[[God Save the King]]" {{small|(offeecial)}} <center>[[File:United States Navy Band - God Save the King.oga]]</center><br/>"[[Gibraltar Anthem]]" {{small|(local)}}<ref>{{cite web |url=https://www.cia.gov/library/publications/the-world-factbook/geos/gi.html |title=Gibraltar: National anthem |work=[[CIA World Factbook]] |publisher=[[Central Intelligence Agency]] |accessdate=25 September 2011 |quote=National anthem: name: "Gibraltar Anthem" ... note: adopted 1994; serves as a local anthem; because Gibraltar is a territory of the United Kingdom, "God Save the Queen" remains official (see United Kingdom) |archive-date=2018-04-12 |archive-url=https://web.archive.org/web/20180412173438/https://www.cia.gov/library/publications/the-world-factbook/geos/gi.html |url-status=dead }}</ref>
| status = {{nowrap|[[Breetish Owerseas Territories|Breetish Owerseas Territory]]}}
| official_languages = [[Inglis leid|Inglis]]
| languages_type = Spoken leids
| languages = [[Inglish leid|Inglis]] <br> [[Spaingie leid|Spaingie]] <br>[[Llanito]]
| capital = Gibraltar
| coordinates = {{Coord|36|8|N|5|21|W|type:city}}
| largest_settlement_type = district<br/>{{nobold|(by population)}}
| largest_settlement = [[Westside, Gibraltar|Westside]]
| ethnic_groups = [[Gibraltarian fowk|Gibraltarian]]{{ref label|note_a|a}} <br> [[Breetish fowk|Breetish]] <br> [[Maghrebis]] <br> [[South Asian]]
| demonym = {{nowrap|[[Gibraltarian fowk|Gibraltarian]]<br/>Llanito {{small|([[colloquial]])}}}}
| government_type = [[Representative democracy|Representative democratic]] [[Pairlamentar seestem|pairlamentar]] [[Dependent territory|dependency]] unner [[constitutional monarchy]]
| leader_title1 = [[Monarchy o the Unitit Kinrick|Monarch]]
| leader_name1 = [[Charles III]]
| leader_title2 = [[Govrenor o Gibraltar|Govrenor]]
| leader_name2 = [[David Steel (Ryal Navy officer)|Sir David Steel]]
| leader_title3 = [[Chief Meenister o Gibraltar|Chief Meenister]]
| leader_name3 = [[Fabian Picardo]]
| leader_title4 = [[Mayor o Gibraltar|Mayor]]
| leader_name4 = [[John Gonçalves]]
| leader_title5 = [[Govrenment o the Unitit Kinrick|UK government]] minister{{ref label|note_b|b}}
| leader_name5 = [[Wendy Morton]] [[Member o Pairlament|MP]]
| legislature = [[Gibraltar Pairlament|Pairlament]]
| area_rank = <!-- Area rank should match [[List of countries and dependencies by area]];(should not be any here as it is listed with a dash) -->
| area_km2 = 6.7
| area_sq_mi = 2.6 <!--Do not remove per [[WP:MOSNUM]]-->
| percent_water = 0
| population_estimate = 32,194<ref name="gibraltar.gov.gi">{{cite web|url=https://www.gibraltar.gov.gi/new/sites/default/files/HMGoG_Documents/Full%20Census%20Report%202012%20FINAL.pdf|format=PDF|title=Census of Gibraltar|date=2012|website=Gibraltar.gov.gi|accessdate=3 August 2017}}</ref>
| population_estimate_rank = 222nt
| population_estimate_year = 2015
| population_census =
| population_census_year = 2012
| population_density_km2 = 4,328
| population_density_sq_mi = 11,320 <!--Do not remove per [[WP:MOSNUM]]-->
| population_density_rank = 5t
| GDP_PPP = £1.64 billion
| GDP_PPP_rank =
| GDP_PPP_year = 2013
| GDP_PPP_per_capita = £50,941
| GDP_PPP_per_capita_rank = n/a
| sovereignty_type = [[History o Gibraltar|Formation]]
| established_event1 = [[Captur o Gibraltar|Capturt]]
| established_date1 = 4 August 1704<ref name="New Style">Gibraltar wis capturt on 24 Julie 1704 [[Auld Style]] or 4 August 1704 [[New Style]].</ref>
| established_event2 = [[Treaty o Utrecht|Cedit]]
| established_date2 = 11 Apryle 1713<ref>The treaty wis signed on 31 Mairch 1713 [[Auld Style]] or 11 Apryle 1713 [[New Style]] ([[:s:Peace and Friendship Treaty of Utrecht between France and Great Britain|Peace an Friendship Treaty o Utrecht atween Fraunce an Great Breetain]]).</ref>
| established_event3 = [[Gibraltar Naitional Day|Naitional Day]]
| established_date3 = 10 September 1967
| established_event4 = Jynt the [[European Economic Commonty|EEC]]
| established_date4 = 1 Januar 1973{{ref label|note_c|c}}
| Gini_year =
| Gini_change = <!--increase/decrease/steady-->
| Gini = <!--number only-->
| Gini_ref =
| Gini_rank =
| HDI_year = 2015
| HDI_change = <!--increase/decrease/steady-->
| HDI = 0.961 <!--number only-->
| HDI_ref =<ref>[https://books.google.com/books?id=hGAiCwAAQBAJ&pg=PA62#v=onepage Quality of Life, Balance of Powers, and Nuclear Weapons (2015)] Avakov, Aleksandr Vladimirovich. Algora Publishing, 1 April 2015.</ref>
| HDI_rank = 5th
| currency = [[Gibraltar poond]] ([[Poond sign|£]]){{ref label|note_d|d}}
| currency_code = GIP
| time_zone = [[Central European Time|CET]]
| utc_offset = +1
| time_zone_DST = [[Central European Simmer Time|CEST]]
| utc_offset_DST = +2
| date_format = dd/mm/yyyy
| drives_on = right{{ref label|note_e|e}}
| calling_code = [[+350]]{{ref label|note_f|f}}
| patron_saint = {{unbulleted list |[[Bernard o Clairvaux]] |[[Oor Leddy o Europe]]}}
| cctld = [[.gi]]{{ref label|note_g|g}}
| footnote_a = {{note|note_a}} O mixed [[Genoa|Genoese]], [[Maltese fowk|Maltese]], [[Portuguese fowk|Portuguese]] an [[Spaingie fowk|Spaingie]] strynd.
| footnote_b = {{note|note_b}} Meenister o State in the [[Foreign and Commonwealth Office]] wi responsibility for Europe an the Americaes.
| footnote_c = {{note|note_c}} As a [[Special Member State territories an the European Union|Special Member State territory]] o the Unitit Kinrick.
| footnote_d = {{note|note_d}} Cunyies an sterling notes are issued bi the Govrenment o Gibraltar.
| footnote_e = {{note|note_e}} Unlik aw ither UK dependencies except the [[Breetish Indie Ocean Territory]], syne 16 Juin 1929.
| footnote_f = {{note|note_f}} 9567 frae Spain before 10 Februar 2007.
| footnote_g = {{note|note_g}} The [[.eu]] domain is an aw uised, shared wi ither [[European Union]] member states. <big><br/><br/>[[Postcodes in the Unitit Kinrick#Owvrseas territories|UK Postcode:]] GX11 1AA</big><ref name="gx111aa">{{cite web|url=http://www.upu.int/fileadmin/documentsFiles/activities/addressingUnit/gibEn.pdf|title=Universal Postal Union document on Gibraltar|website=Upu.int|accessdate=3 August 2017|archive-date=2016-04-13|archive-url=https://web.archive.org/web/20160413022455/http://www.upu.int/fileadmin/documentsFiles/activities/addressingUnit/gibEn.pdf|url-status=dead}}</ref>
}}
'''Gibraltar''' ({{IPA-en|dʒɨˈbrɒltəɹ}};{{IPA-es|xiβɾalˈtaɾ}}) is a wee [[Breetish Owerseas Territories|Breetish owerseas territory]] locatit on the soothren end o the [[Iberie Peninsulae]] at the entrance o the [[Mediterranean]]. It haes an aurie o {{convert|6.8|km2|sqmi}} an a [[Gibraltar-Spain border|northren border]] wi [[Andalusie]], [[Spain]]. The [[Rock o Gibraltar]] is the major laundmerk o the region. At its fuit is the densely populatit ceety aurie, hame tae amaist 30,000 [[Gibraltarian fowk|Gibraltarian]]s an ither naitionalities.<ref>{{cite web
| first = Statistics Office
| authorlink =
| last2 =
| first2 =
| authorlink2 = statistics@gibraltar.gov.gi
| title = Abstract of Statistics 2009, Statistics Office of the Government of Gibraltar
| page = 2
| origyear = 2009
| url = http://www.gibraltar.gov.gi/images/stories/PDF/statistics/2009/Abstract%20of%20Statistics%20Report%202009%20Website.pdf
| access-date = 2012-09-14
| archive-date = 2014-12-22
| archive-url = https://web.archive.org/web/20141222033409/https://www.gibraltar.gov.gi/images/stories/PDF/statistics/2009/Abstract%20of%20Statistics%20Report%202009%20Website.pdf
| url-status = dead
}}
''The civilian population includes Gibraltarian residents, other British residents (including the wives and families of UK-based servicemen, but not the servicemen themselves) and non-British residents. Visitors and transients are not included.'' In 2009, this broke down into 23,907 native born, 3,129 UK British, 2,395 Other for a total population of 29,431. On census night there were 31,623 people present in Gibraltar.</ref>
An Anglo-Dutch force [[captur o Gibraltar|captured Gibraltar]] frae Spain in 1704 durin the [[War o the Spaingie Succession]]. The territory wis subsequently cedit tae Breetain "in perpetuity" unner the [[Treaty o Utrecht]] in 1713. It wis an important base for the [[Ryal Navy]]; the day its economy is based lairgely on tourism, financial services, an shippin.<ref name="FCO">[https://web.archive.org/web/20110513205312/http://www.fco.gov.uk/en/travel-and-living-abroad/travel-advice-by-country/country-profile/europe/gibraltar?profile=economy Country Profiles: Gibraltar], [[Foreign and Commonwealth Office]], 6 May 2010; retrieved 15 May 2010</ref><ref name="Maec">[https://archive.today/20121208230635/www.maec.es/subwebs/embajadas/londres/es/menuppal/gibraltar/Paginas/LacuestiondeGibraltar.aspx Informe sobre la cuestión de Gibraltar], Spanish Foreign Ministry {{es icon}}</ref>
The sovereignty o Gibraltar is a major pynt o contention in [[Spain–United Kingdom relations|Anglo-Spaingie relations]] as Spain asserts [[Disputit status o Gibraltar|a claim tae the territory]].<ref name="Maec"/> Gibraltarians rejectit proposals for Spainyie sovereignty in a [[:en:Gibraltar sovereignty referendum, 1967|1967 referendum]] an [[:en:Gibraltar sovereignty referendum, 2002|again in 2002]]. Unner the [[Gibraltar Constitution Order 2006|Gibraltar constitution o 2006]], Gibraltar govrens its awn affairs, tho some pouers, such as defence an foreign relations, remain the responsibility o the UK Govrenment.
==Etymologie==
The name ''Gibraltar'' is the Spaingie derivation o the [[Arabic]] name ''Jabal-ı Tārık'' (جبل طارق), meanin "muntain o Tariq."<ref>{{cite web|url=http://www.gibraltar.gov.gi/gov_depts/port/port_index.htm|title=History of Gibraltar|accessdate=20 December 2007|date=|publisher=Government of Gibraltar|archive-date=2008-01-03|archive-url=https://web.archive.org/web/20080103220336/http://www.gibraltar.gov.gi/gov_depts/port/port_index.htm|url-status=dead}}</ref> It refers tae the geological formation, the [[Rock o Gibraltar]], which in turn wis namit efter the [[Berber fowk|Berber]] [[Umayyad]] general [[Tariq ibn-Ziyad]] who led the initial incursion [[Umayyad conquest o Hispania|intae Iberie in advance o the main Moorish force]] in 711 unner the command o Umayyad Caliph [[Al-Walid I]]. Earlier, it wis kent as ''[[Mons Calpe]]'', ane o the [[Pillars of Hercules]].
The day, Gibraltar is colloquially referred tae as ''Gib'' or ''the Rock''.
==Toun twinnins==
;Current
*[[Ballymena]], [[Northren Ireland]], Unitit Kinrick (2006).
*[[Funchal]], [[Madeira]], [[Portugal]] (2009)
==See an aw==
*[[Gibraltarian fowk]]
==References==
{{Reflist|30em}}
==Freemit airtins==
*[http://dotcom.gi/map Interactive Map o Gibraltar] {{Webarchive|url=https://web.archive.org/web/20070329062117/http://www.dotcom.gi/map/ |date=2007-03-29 }}
*[http://www.gibraltar.com Gibraltar.com – Complete information portal for Gibraltar]
*[http://www.gibraltar.gov.gi Govrenment o Gibraltar]
{{UK ceeties}}
[[Category:Gibraltar| ]]
[[Category:Arabic loanwirds]]
[[Category:Caipitals in Europe]]
[[Category:Inglis-speakin kintras an territories]]
[[Category:Heidlands o Europe]]
[[Category:Jewish Spaingie history]]
[[Category:Peninsulaes o Europe]]
[[Category:Umayyad Caliphate]]
[[Category:Wastren Europe]]
bbc4csaygtg15ob6ewra6ahq9emn6gf
Burj Khalifa
0
49736
901691
877992
2025-01-03T21:42:04Z
InternetArchiveBot
79721
Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5
901691
wikitext
text/x-wiki
{{Fixscots}}
{{Infobox building
| name = Burj Khalifa
| native_name = {{lang|ar|برج خليفة}}
| native_name_lang = ar
| image =
| image_size = 200px
| caption =
| umwhile_names = Burj Dubai
| highest_prev = [[Taipei 101]]
| highest_start = 2010
| status = Complete
| location = [[Dubai]], Unitit Arab Emirates
| coordinates = {{coord|25|11|49.7|N|55|16|26.8|E|region:AE-DU|display=inline,title}}
| architectural = {{convert|828|m|ft|0|abbr=on}}<ref name="CTBUHdb">{{cite web |url=http://skyscrapercenter.com/dubai/burj-khalifa/ |title=Burj Khalifa - The Skyscraper Center |work=Council on Tall Buildings and Urban Habitat |access-date=2013-04-22 |archive-date=2014-03-20 |archive-url=https://web.archive.org/web/20140320163329/http://www.skyscrapercenter.com/dubai/burj-khalifa |url-status=dead }}</ref>
| tip = {{convert|829.8|m|ft|0|abbr=on}}<ref name="CTBUHdb" />
| roof = {{convert|828|m|ft|0|abbr=on}}<ref name="CTBUHdb" />
| tap_floor = {{convert|584.5|m|ft|0|abbr=on}}<ref name="CTBUHdb" />
| observatory = {{convert|452.1|m|ft|0|abbr=on}}<ref name="CTBUHdb" />
| floor_count = 163 [[storey|floor]]s<ref name="CTBUHdb" /><ref name="Baldwin">{{cite news|url=http://gulfnews.com/news/gulf/uae/general/no-more-habitable-floors-to-burj-dubai-1.452275|title=No more habitable floors to Burj Dubai|last=Baldwin|first=Derek|publisher=Gulfnews|date=1 May 2008|accessdate=7 January 2010|archive-date=2018-12-25|archive-url=https://web.archive.org/web/20181225034844/https://gulfnews.com/news/gulf/uae/general/no-more-habitable-floors-to-burj-dubai-1.452275|url-status=dead}}</ref><br />plus 46 maintenance levels in the spire<ref>{{cite web|url=http://www.glasssteelandstone.com/BuildingDetail/701.php|title=The Burj Khalifa|publisher=Glass, Steel and Stone|accessdate=8 January 2010|archive-date=2010-01-03|archive-url=https://web.archive.org/web/20100103111639/http://www.glasssteelandstone.com/BuildingDetail/701.php|url-status=dead}}</ref><br> an 2 parkin levels in the basement
| start_date = Januar 2004
| completion_date = 2010
| opening = 4 Januar 2010<ref name="opening" />
| biggin_type = Mixed-uise
| floor_area = {{convert|309473|m2|sqft|-2|abbr=on}}<ref name="CTBUHdb" />
| cost = [[USD|USD $]] 1.5 billion<ref name="USAtoday">{{cite news|url=http://content.usatoday.com/communities/ondeadline/post/2010/01/dubai-opens-world-tallest-building/1|title=Dubai opens world's tallest building|date=2 January 2010|publisher=[[USA Today]]|accessdate=4 January 2010|location=[[Dubai]]|first=Douglas|last=Stanglin}}</ref>
| developer = [[Emaar Properties]]<ref name="CTBUHdb" />
| architect = [[Adrian Smith (architect)|Adrian Smith]] at SOM
| structural_engineer= [[William F. Baker (engineer)|Bill Baker]] at [[Skidmore, Owings and Merrill|SOM]]<ref>{{cite news|url=http://www.wired.com/culture/design/magazine/15-12/mf_baker|title=Engineer Bill Baker Is the King of Superstable 150-Story Structures|last=Blum|first=Andrew|publisher=Wired|date=27 November 2007|accessdate=11 March 2008|archiveurl=https://archive.today/20120918050220/http://www.wired.com/culture/design/magazine/15-12/mf_baker|archivedate=2012-09-18|url-status=live}}</ref>
| main_contractor = [[Samsung C&T Corporation|Samsung Engineering an<br> Construction Company]],<br> [[Besix]] an [[Arabtec]] <br /> Superveesion Consultant Engineer &<br> Airchitect o Record [[Hyder Consulting]]<br /> Construction Project Manager<br> [[Turner Construction]]<br />[[Grocon]]<ref name="Contractors">{{cite web|url=http://www.designbuild-network.com/projects/burj/|title=Burj Dubai (Dubai Tower) and Dubai Mall, United Arab Emirates|publisher=designbuild-network.com|accessdate=23 March 2009}}</ref><br /> Plannin [[Bauer AG]] an<br> [[Middle East Foondations]]<ref name="Contractors" /><br />Lift contractor [[Otis Elevator Company|Otis]]<ref name="Contractors" /><br /> VT consultant [[Lerch Bates]]<ref name="Contractors" />
| url = {{URL|www.burjkhalifa.ae}}
}}
'''Burj Khalifa''' ({{lang-ar|برج خليفة}}, "Khalifa touer"), kent as ''Burj Dubai'' prior tae its inauguration, is a [[skyscraper]] in [[Dubai]], [[Unitit Arab Emirates]], an is the [[Leet o tallest biggins an structurs in the warld|tallest man-made structur in the warld]], at {{convert|829.8|m|ft|0|abbr=on}}.<ref name="CTBUHdb" /><ref name="DubaiOneInauguration">{{cite news|url=http://online.wsj.com/article/SB10001424052748703580904574638111667658806.html|title=World's Tallest Skyscraper Opens in Dubai |last=Bianchi|first= Stefania|coauthors=Andrew Critchlow|date=4 January 2010|publisher=The Wall Street Journal|publisher=Dow Jones & Company, Inc|accessdate=4 January 2010}}</ref>
Construction began on 21 September 2004, wi the exterior o the structur completit on 1 October 2009. The biggin offeecially opened on 4 Januar 2010,<ref name="opening">{{cite news|url=http://gulfnews.com/business/property/uae/official-opening-of-iconic-burj-dubai-announced-1.523471|title=Official Opening of Iconic Burj Dubai Announced|publisher=Gulfnews|date=4 November 2009|accessdate=4 November 2009|archive-date=2009-11-06|archive-url=https://web.archive.org/web/20091106052129/http://gulfnews.com/business/property/uae/official-opening-of-iconic-burj-dubai-announced-1.523471|url-status=dead}}</ref><ref name="news.bbc.co.uk">{{cite news|url=http://news.bbc.co.uk/2/hi/business/8439618.stm|title=World's tallest building opens in Dubai |date=4 January 2010|publisher=[[BBC]] News |accessdate=4 January 2010}}</ref> an is pairt o the new {{convert|2|km2|acre|-1|abbr=on|adj=on}} development cried [[Dountoun Dubai]] at the 'First Interchynge' alang [[Sheikh Zayed Road]], near Dubai's main business destrict.
The touer's airchitecture an engineering wur performed bi [[Skidmore, Owings an Merrill]] o [[Chicago]], wi [[Adrian Smith (airchitect)|Adrian Smith]] as chief airchitect, an [[William F. Baker (engineer)|Bill Baker]] as chief structural engineer.<ref name="Record High">{{cite news|url=http://www.emaar.com/index.aspx?page=press-release-details&id=361|title=Burj Dubai reaches a record high|publisher=[[Emaar Properties]]|date=21 July 2007|accessdate=24 November 2008}}</ref><ref>{{cite news|url=http://www.architectmagazine.com/industry-news.asp?sectionID=1006&articleID=385534|title=Adrian Smith Leaves SOM, Longtime Skidmore partner bucks retirement to start new firm|last=Keegan|first=Edward|publisher=ArchitectOnline|date=15 October 2006|accessdate=23 March 2009}}</ref> The primary contractor wis [[Samsung C&T]] o [[Sooth Korea]].<ref name="SkyscraperPage">{{cite web|url=http://skyscraperpage.com/cities/?buildingID=7787|title=Burj Dubai, Dubai – SkyscraperPage.com|publisher=SkyscraperPage|accessdate=23 March 2009}}</ref>
==References==
{{Reflist}}
[[Category:Hotel biggins completit in 2009]]
[[Category:Office biggins completit in 2009]]
[[Category:Residential biggins completit in 2009]]
[[Category:Skyscrapers in Dubai]]
[[Category:Skyscrapers ower 350 meters]]
lzq63krbpghoy3jqdjutn0zwftu5lmj
Buddy MacKay
0
70886
901688
678507
2025-01-03T19:48:51Z
2.28.254.177
901688
wikitext
text/x-wiki
{{Infobox Officeholder
|birth_name = Kenneth Hood MacKay, Jr.
|image = Buddy MacKay (official portrait).jpg
|imagesize =
|smallimage =
|caption =
|order = 42nt [[Govrenor o Florida]]
|term_start = 12 December 1998
|term_end = 5 Januar 1999
|lieutenant = ''Nane''
|predecessor = [[Lawton Chiles]]
|successor = [[Jeb Bush]]
|order2 = 14th [[Lieutenant Govrenor o Florida]]
|term_start2 = 8 Januar 1991
|term_end2 = 12 December 1998
|governor2 = [[Lawton Chiles]]
|predecessor2 = [[Bobby Brantley]]
|successor2 = [[Frank Brogan]]
|order3 = [[Executive Office o the Preses o the Unitit States|Presidential Special Envoy for the Americas]]
|term_start3 = 1999
|term_end3 = 2001
|president3 = [[Bill Clinton]]
|predecessor3 = [[Mack McLarty]]
|successor3 = [[Otto Reich]]
|order4 = Member o the [[U.S. Hoose o Representatives]] frae [[Florida]]'s [[Florida's 6t congressional destrict|6t destrict]]
|term_start4 = 3 Januar 1983
|term_end4 = 3 Januar 1989
|predecessor4 = [[Bill Young]]
|successor4 = [[Cliff Stearns]]
|order5 = [[Florida Senate|Florida State Senator frae 6t destrict]]
|term_start5 = 3 Januar 1975
|term_end5 = 5 November 1980
|predecessor5 =
|successor5 = [[George G. Kirkpatrick, Jr.|George Kirkpatrick]]
|birth_date={{Birth date|1933|3|22|mf=y}}
|birth_place=[[Ocala, Florida|Ocala]], [[Florida]], U.S.
|death_date= 31 December 2024 (aged 91)
|death_place= Ocala, Florida, U.S.
|party=[[Democratic Pairty (Unitit States)|Democrat]]
|spouse=Anne Selph (m. 1960)
|profession=[[lawyer]], [[politeecian]]
|education= [[Varsity o Florida]]
|religion=[[Presbyterian]]
|branch=[[United States Air Force]]
|serviceyears=1955-1958
|rank=[[Captain (land)|Captain]]
}}
'''Buddy MacKay''' ('''Kenneth Hood "Buddy" MacKay'''; [[22 Mairch]] [[1933]] - [[31 December]] [[2024]]) wis an American politeecian wha servit as the governor o [[Florida]] atween 1998 an 1999. He previously representit Florida in the Unitit States Hoose o Representatives.
{{Authority control}}
{{DEFAULTSORT:Mackay, Buddy}}
[[Category:1933 births]]
[[Category:American Presbyterians]]
[[Category:Democratic Pairty members o the Unitit States Hoose o Representatives]]
[[Category:Democratic Pairty state govrenors o the Unitit States]]
[[Category:Florida Democrats]]
[[Category:Florida State Senators]]
[[Category:Govrenors o Florida]]
[[Category:Lieutenant Govrenors o Florida]]
[[Category:2024 daiths]]
[[Category:Members o the Florida Hoose o Representatives]]
[[Category:Members o the Unitit States Hoose o Representatives frae Florida]]
[[Category:Militar personnel frae Florida]]
[[Category:Politeecians frae Ocala, Florida]]
[[Category:Unitit States Air Force officers]]
[[Category:Varsity o Florida alumni]]
[[Category:Writers frae Florida]]
[[Category:20t-century American politeecians]]
{{Stub/USA}}
p2z3rkri4pm5snb065w06f29mslakhz
Sudzhansky Destrict
0
85596
901684
898012
2025-01-03T19:01:36Z
Italiano1922
115108
Information anent current happenings in the area haes been addit.
901684
wikitext
text/x-wiki
{{Infobox Russian district
|en_name=Sudzhansky Destrict
|ru_name=Суджанский район
|image_map=Sudzhansky district locator map.png
|map_caption=Location o Sudzhansky Destrict in Kursk Oblast
|coordinates = {{coord|51|12|N|35|16|E|type:adm2nd_region:RU|display=inline,title}}
|lats
|longs
|image_flag=
|flag_caption=
|image_coa=Coat of arms of the Sudzhansky District, Russia.png
|coa_caption=
|anthem
|anthem_ref
|holiday
|holiday_ref
|federal_subject=[[Kursk Oblast]]
|federal_subject_ref=<ref name="KurskO_admlist" />
|adm_data_as_of=January 2013
|adm_ctr_type=[[teeps o inhabitit localities in Roushie|toun]]
|adm_ctr_name=[[Sudzha, Kursk Oblast|Sudzha]]
|adm_ctr_ref=<ref name="KurskO_admlist" />
|town_of_district_significance_type=Touns o destrict significance
|no_of_towns_of_district_significance=1
|selsoviet_type1=Selsoviets
|no_of_selsoviets_type1=21
|no_of_cities_towns=1
|no_of_rural_localities=81
|counts_ref=<ref name="KurskO_admlist" />
|mun_data_as_of=August 2011
|mun_formation1=Sudzhansky Municipal Destrict
|mun_formation1_ref=<ref name="KurskO_mun" />
|mun_formation1_no_of_urban_settlements=1
|mun_formation1_no_of_rural_settlements=16
|mun_formation1_counts_ref=<ref name="KurskO_mun" />
|mun_formation1_leader_title=
|mun_formation1_leader_title_ref=
|mun_formation1_leader_name=
|mun_formation1_leader_name_ref=
|mun_formation1_representative_body=
|mun_formation1_representative_body_ref=
|area_of_what
|area_as_of
|area_km2=996
|area_km2_ref=
|pop_2010census=26964
|urban_pop_2010census=22.4%
|rural_pop_2010census=77.6%
|pop_2010census_ref=<ref name="2010Census" />
|pop_latest=
|pop_latest_date=
|pop_latest_ref=
|established_date=
|established_date_ref=
|prev_name1
|prev_name1_date
|prev_name1_ref
|website=
|website_ref
|commonscat=
|date=August 2011
}}
'''Sudzhansky Destrict''' ({{lang-ru|Суджанский райо́н}}) is a admeenistrative<ref name="KurskO_admlist">Resolution #489</ref> an municipal<ref name="KurskO_mun">Law #48-ZKO</ref> destrict ([[raion]]), ane o the [[admeenistrative diveesions o Kursk Oblast|twinty-aicht]] in [[Kursk Oblast]], [[Roushie]]. It is locatit in the soothwast o the [[oblast]].<!-- and borders with [[ District]] in the north, [[ District]] in the east, [[ District]] in the south, and with [[ District]] in the west.--> The aurie o the destrict is {{convert|996|km2|sp=us}}. Its [[admeenistrative centre]] is the [[teeps o inhabitit localities in Roushie|toun]] o [[Sudzha, Kursk Oblast|Sudzha]].<ref name="KurskO_admlist" /> Population: {{ru-census2010|26,964|;}} 31,466 ([[Roushie Census (2002)|2002 Census]]);<ref name="2002Census">{{ru-pop-ref|2002Census}}</ref> {{su-census1989|34,438|.}} The population o Sudzha accoonts for 22.4% o the destrict's total population.<ref name="2010Census" />
== Ukrainian Haud o' the Land. ==
A gey muckle pairt o' the airt is haudit by Ukraine in the coorse o' the "Kursk Operation". On the grund o' the airt there's aboot twa thoosand sodgers o' the Ukrainian forces, as weel as fechtin' formations o' RDK an' LSR. There's a tale gaun aboot that in Sudzha itsel', members o' the NSBM muisic group "МОЛОТХ" gied a concert in the cultur hoose o' the toun o' Sudzha.
==References==
===Notes===
{{Reflist}}
===Sources===
*{{RussiaAdmMunRef|krs|adm|list}}
*{{RussiaAdmMunRef|krs|mun|list0}}
{{Kursk Oblast}}
{{Use mdy dates|date=April 2013}}
[[Category:Destricts o Kursk Oblast]]
7oojs56ercocejnefuc32l7orlxp0kc
901689
901684
2025-01-03T20:04:56Z
212.35.186.144
901689
wikitext
text/x-wiki
иинкогнито сынок ебучий{{Infobox Russian district
|en_name=Sudzhansky Destrict
|ru_name=Суджанский район
|image_map=Sudzhansky district locator map.png
|map_caption=Location o Sudzhansky Destrict in Kursk Oblast
|coordinates = {{coord|51|12|N|35|16|E|type:adm2nd_region:RU|display=inline,title}}
|lats
|longs
|image_flag=
|flag_caption=
|image_coa=Coat of arms of the Sudzhansky District, Russia.png
|coa_caption=
|anthem
|anthem_ref
|holiday
|holiday_ref
|federal_subject=[[Kursk Oblast]]
|federal_subject_ref=<ref name="KurskO_admlist" />
|adm_data_as_of=January 2013
|adm_ctr_type=[[teeps o inhabitit localities in Roushie|toun]]
|adm_ctr_name=[[Sudzha, Kursk Oblast|Sudzha]]
|adm_ctr_ref=<ref name="KurskO_admlist" />
|town_of_district_significance_type=Touns o destrict significance
|no_of_towns_of_district_significance=1
|selsoviet_type1=Selsoviets
|no_of_selsoviets_type1=21
|no_of_cities_towns=1
|no_of_rural_localities=81
|counts_ref=<ref name="KurskO_admlist" />
|mun_data_as_of=August 2011
|mun_formation1=Sudzhansky Municipal Destrict
|mun_formation1_ref=<ref name="KurskO_mun" />
|mun_formation1_no_of_urban_settlements=1
|mun_formation1_no_of_rural_settlements=16
|mun_formation1_counts_ref=<ref name="KurskO_mun" />
|mun_formation1_leader_title=
|mun_formation1_leader_title_ref=
|mun_formation1_leader_name=
|mun_formation1_leader_name_ref=
|mun_formation1_representative_body=
|mun_formation1_representative_body_ref=
|area_of_what
|area_as_of
|area_km2=996
|area_km2_ref=
|pop_2010census=26964
|urban_pop_2010census=22.4%
|rural_pop_2010census=77.6%
|pop_2010census_ref=<ref name="2010Census" />
|pop_latest=
|pop_latest_date=
|pop_latest_ref=
|established_date=
|established_date_ref=
|prev_name1
|prev_name1_date
|prev_name1_ref
|website=
|website_ref
|commonscat=
|date=August 2011
}}
'''Destrict''' ({{lang-ru|Суджанский райо́н}}) is a admeenistrative<ref name="KurskO_admlist">Resolution #489</ref> an municipal<ref name="KurskO_mun">Law #48-ZKO</ref> destrict ([[raion]]), ane o the [[admeenistrative diveesions o Kursk Oblast|twinty-aicht]] in [[Kursk Oblast]], [[Roushie]]. It is locatit in the soothwast o the [[oblast]].<!-- and borders with [[ District]] in the north, [[ District]] in the east, [[ District]] in the south, and with [[ District]] in the west.--> The aurie o the destrict is {{convert|996|km2|sp=us}}. Its [[admeenistrative centre]] is the [[teeps o inhabitit localities in Roushie|toun]] o [[Sudzha, Kursk Oblast|Sudzha]].<ref name="KurskO_admlist" /> Population: {{ru-census2010|26,964|;}} 31,466 ([[Roushie Census (2002)|2002 Census]]);<ref name="2002Census">{{ru-pop-ref|2002Census}}</ref> {{su-census1989|34,438|.}} The population o Sudzha accoonts % o the destrict's total population.<ref name="2010Census" />
== Ukrainian Haud o' the Land. ==
A gey muckle pairt o' the airt is haudit by Ukraine in the coorse o' the "Kursk Operation". On the grund o' the airt there's aboot twa thoosand sodgers o' the Ukrainian forces, as weel as fechtin' formations o' RDK an' LSR. There's a tale gaun aboot that in Sudzha itsel', members o' the NSBM muisic group "МОЛОТХ" gied a concert in the cultur hoose o' the toun o' Sudzha.
==References==
===Notes===
{{Reflist}}
===Sources===
*{{RussiaAdmMunRef|krs|adm|list}}
*{{RussiaAdmMunRef|krs|mun|list0}}
{{Kursk Oblast}}
{{Use mdy dates|date=April 2013}}
[[Category:Destricts o Kursk Oblast]]
ic7nrd75l3pe8p4zentg96phkzechlh
901692
901689
2025-01-03T21:45:36Z
CiphriusKane
74958
Revertit edit o 212.35.186.144, chynged back tae last version bi Italiano1922
901684
wikitext
text/x-wiki
{{Infobox Russian district
|en_name=Sudzhansky Destrict
|ru_name=Суджанский район
|image_map=Sudzhansky district locator map.png
|map_caption=Location o Sudzhansky Destrict in Kursk Oblast
|coordinates = {{coord|51|12|N|35|16|E|type:adm2nd_region:RU|display=inline,title}}
|lats
|longs
|image_flag=
|flag_caption=
|image_coa=Coat of arms of the Sudzhansky District, Russia.png
|coa_caption=
|anthem
|anthem_ref
|holiday
|holiday_ref
|federal_subject=[[Kursk Oblast]]
|federal_subject_ref=<ref name="KurskO_admlist" />
|adm_data_as_of=January 2013
|adm_ctr_type=[[teeps o inhabitit localities in Roushie|toun]]
|adm_ctr_name=[[Sudzha, Kursk Oblast|Sudzha]]
|adm_ctr_ref=<ref name="KurskO_admlist" />
|town_of_district_significance_type=Touns o destrict significance
|no_of_towns_of_district_significance=1
|selsoviet_type1=Selsoviets
|no_of_selsoviets_type1=21
|no_of_cities_towns=1
|no_of_rural_localities=81
|counts_ref=<ref name="KurskO_admlist" />
|mun_data_as_of=August 2011
|mun_formation1=Sudzhansky Municipal Destrict
|mun_formation1_ref=<ref name="KurskO_mun" />
|mun_formation1_no_of_urban_settlements=1
|mun_formation1_no_of_rural_settlements=16
|mun_formation1_counts_ref=<ref name="KurskO_mun" />
|mun_formation1_leader_title=
|mun_formation1_leader_title_ref=
|mun_formation1_leader_name=
|mun_formation1_leader_name_ref=
|mun_formation1_representative_body=
|mun_formation1_representative_body_ref=
|area_of_what
|area_as_of
|area_km2=996
|area_km2_ref=
|pop_2010census=26964
|urban_pop_2010census=22.4%
|rural_pop_2010census=77.6%
|pop_2010census_ref=<ref name="2010Census" />
|pop_latest=
|pop_latest_date=
|pop_latest_ref=
|established_date=
|established_date_ref=
|prev_name1
|prev_name1_date
|prev_name1_ref
|website=
|website_ref
|commonscat=
|date=August 2011
}}
'''Sudzhansky Destrict''' ({{lang-ru|Суджанский райо́н}}) is a admeenistrative<ref name="KurskO_admlist">Resolution #489</ref> an municipal<ref name="KurskO_mun">Law #48-ZKO</ref> destrict ([[raion]]), ane o the [[admeenistrative diveesions o Kursk Oblast|twinty-aicht]] in [[Kursk Oblast]], [[Roushie]]. It is locatit in the soothwast o the [[oblast]].<!-- and borders with [[ District]] in the north, [[ District]] in the east, [[ District]] in the south, and with [[ District]] in the west.--> The aurie o the destrict is {{convert|996|km2|sp=us}}. Its [[admeenistrative centre]] is the [[teeps o inhabitit localities in Roushie|toun]] o [[Sudzha, Kursk Oblast|Sudzha]].<ref name="KurskO_admlist" /> Population: {{ru-census2010|26,964|;}} 31,466 ([[Roushie Census (2002)|2002 Census]]);<ref name="2002Census">{{ru-pop-ref|2002Census}}</ref> {{su-census1989|34,438|.}} The population o Sudzha accoonts for 22.4% o the destrict's total population.<ref name="2010Census" />
== Ukrainian Haud o' the Land. ==
A gey muckle pairt o' the airt is haudit by Ukraine in the coorse o' the "Kursk Operation". On the grund o' the airt there's aboot twa thoosand sodgers o' the Ukrainian forces, as weel as fechtin' formations o' RDK an' LSR. There's a tale gaun aboot that in Sudzha itsel', members o' the NSBM muisic group "МОЛОТХ" gied a concert in the cultur hoose o' the toun o' Sudzha.
==References==
===Notes===
{{Reflist}}
===Sources===
*{{RussiaAdmMunRef|krs|adm|list}}
*{{RussiaAdmMunRef|krs|mun|list0}}
{{Kursk Oblast}}
{{Use mdy dates|date=April 2013}}
[[Category:Destricts o Kursk Oblast]]
7oojs56ercocejnefuc32l7orlxp0kc
Nazi Germany
0
95455
901686
689547
2025-01-03T19:12:57Z
Italiano1922
115108
901686
wikitext
text/x-wiki
{{Infobox former country
| conventional_long_name = German Reich
| native_name = ''Deutsches Reich'' <small>(1933–43)</small><br />''Großdeutsches Reich'' <small>(1943–45)</small>
| common_name = Germany
| continent = Europe
| country = Germany
| era = [[Interwar period]]/[[World War II]]
| event_start = [[Machtergreifung]]
| year_start =1933
| date_start = 30 Januar
| event1 = [[Gleichschaltung]]
| date_event1 = 27 Februar 1933
| event2 = [[Anschluss]]
| date_event2 = 12 Mairch 1938
| event3 = [[Warld War II]]
| date_event3 = 1 September 1939
| event4 = [[Daith o Adolf Hitler]]
| date_event4 = 30 Aprile 1945
| event_end = [[German Instrument o Surrender|Surrender o Germany]]
| year_end = 1945
| date_end = 8 Mey
| legislature = [[Reichstag (Nazi Germany)|Reichstag]]
| house1 = [[Reichsrat (Germany)|Reichsrat]]
| type_house1 = State cooncil
| p1 = Weimar Republic
| flag_p1 =Flag of Germany (3-2 aspect ratio).svg
| s1 = Allied-occupied Germany{{!}}Occupied Germany
| flag_s1 = Flag of Germany (1946-1949).svg
| border_s1 = no
| s2 = Allied-occupied Austrick{{!}}Occupied Austrick
| flag_s2 = Flag of Austria.svg
| s3 = Republic o Poland (1944–1952){{!}}Poland
| flag_s3 = Flag of Poland (1928-1980).svg
| s4 = Czechoslovak Republic (1945–48){{!}}Czechoslovakie
| flag_s4 = Flag of Czechoslovakia.svg
| s5 = Soviet Union
| flag_s5 = Flag of the Soviet Union (1923-1955).svg
| s6 = Democratic Federal Yugoslavie{{!}}Yugoslavie
| flag_s6 = Flag of the Democratic Federal Yugoslavia.svg
| image_flag = Flag of German Reich (1935–1945).svg{{!}}border<!-- Do not replace with NSDAP flag, as the two are not identical. NSDAP flag is symmetrical, this one is not. -->
| flag = Banner o Germany#Nazi Germany
| image_coat = Reichsadler.svg
| coa_size = 100px
| symbol_type = Emblem
| symbol = Coat of arms of Germany#Nazi Germany
| image_map = German Reich 1942.svg
| image_map_caption = Germany at the height of [[World War II]] success (September to December 1942)
{{plainlist | style = padding-left: 0.6em; text-align: left; |
* {{Legend|#336733|Germany{{efn
| name = annexed
| Includin de facto [[auries annexed bi Nazi Germany|annexed/incorporatit territories]].
}}}}
* {{Legend|#55c255|[[Reichskommissariat|Civil occupied territories]]}}
* {{Legend|#a5dfa5|[[Militar Admeenistration (Nazi Germany)|Militar-admeenistered occupied territories]]}}
}}
| image_map2 = Greater_German_Reich_NS_Administration_1944.png
| image_map2_caption = Admeenistrative diveesions o Germany, Mey 1944
| national_motto =
|national_anthem = {{plainlist |
* ''[[Das Lied der Deutschen]]''<br /><small>"Sang o the Germans"</small><br /><center>[[File:National anthem of Germany - U.S. Army 1st Armored Division Band.ogg]]</center>
* ''[[Horst-Wessel-Lied]]''<br>''{{small|Horst Wessel Sang}}''<br /><center>[[File:Песня Хорста Весселя.ogg]]</center>
}}
| capital = Berlin
| largest_city = caipital
| common_languages = German
| government_type = {{plainlist |
*[[Nazism|Nazi]] [[single-pairty state]]
*[[Totalitarianism|Totalitarian]] [[dictatorship]]
}}
| title_leader = [[Preses o Germany (1919–1945)|Preses]] / [[Führer]]
| leader1 = [[Paul von Hindenburg]]
| year_leader1 = 1933–1934
| leader2 = [[Adolf Hitler]]{{efn
| name = vacant
| The office formally acame vacant on Hitler's daith. His titles war [[Führer und Reichskanzler]] frae August 1934. See {{harvnb|Gesetz über das Staatsoberhaupt|1934}}.
}}
| year_leader2 = 1934–1945
| leader3 = [[Karl Dönitz]]
| year_leader3 = 1945
| title_deputy = [[Leet o Chancellors o Germany#Third Reich (Reichskanzler) (1933–1945)|Chancellor]]
| deputy1= [[Adolf Hitler]]
| year_deputy1 = 1933–1945
| deputy2 = [[Joseph Goebbels]]
| year_deputy2 = 1945
| deputy3 = [[Lutz Graf Schwerin von Krosigk]]
| year_deputy3 = 1945 (as leadin meenister)
| stat_area1 = 633786
| stat_pop1 = 69314000
| stat_year1 = 1939
| ref_area1 ={{efn
| name = statistics
| In 1939, afore Germany acquired control o the last twa regions which had been in its control afore the Versailles Treaty—Alsace-Lorraine, Danzig, an the Pols Corridor—its aurie wis {{convert|633786|km2|sqmi}}. See {{harvnb|Statistisches Jahrbuch|2006}}.
}}
| ref_pop1 = {{sfn|Statistisches Jahrbuch|2006|p=34}}
| currency = [[Reichsmark]] (ℛℳ)
| today = {{Collapsible list |titlestyle = background: transparent; text-align: left; font-weight: normal; |title = 12 countries |{{flag|Germany}} |{{flag|Austria}} |{{flag|Czech Republic}} |{{flag|Poland}} |{{flag|Russia}} ([[Kaliningrad Oblast|Kaliningrad]]) |{{flag|Lithuania}} ([[Klaipėda Region|Klaipėda]]) |{{flag|Slovenia}} |{{flag|France}} ([[Alsace-Lorraine]]) |{{flag|Luxemburg}} |{{flag|Belgium}} ([[Eupen-Malmedy|Eupen-Malmédy]]) |{{flag|Netherlands}} ([[Duivelsberg]]) |{{flag|Slovakia}} ([[Petržalka]], [[Devín]]) }}
}}
'''Nazi Germany''' or the '''Third Reich''' ({{lang-de|Drittes Reich}}) wis the period in the history o [[Germany]] frae 1933 tae 1945, whan it wis a [[dictatorship]] unner the control o [[Adolf Hitler]] an the [[Nazi Pairty]] (NSDAP). Unner Hitler's rule, Germany wis transformed intae a [[Fascism|fascist]] [[Totalitarianism|totalitarian state]] that [[Gleichschaltung|controlled]] nearly aw aspects o life. Nazi Germany ceased tae exist efter the [[Allies o Warld War II|Allied Forces]] defeatit Germany in Mey 1945, endin [[European theatre o Warld War II|Warld War II in Europe]].
Hitler wis appyntit [[Chancellor o Germany]] bi the Preses o the [[Weimar Republic]] [[Paul von Hindenburg]] on 30 Januar 1933. The Nazi Pairty then begoud tae eliminate aw poleetical opposition an consolidate its pouer. Hindenburg dee'd on 2 August 1934 an Hitler becam dictator o Germany bi mergin the offices an pouers o the Chancellery an Presidency. A naitional [[German referendum, 1934|referendum held 19 August 1934]] confirmed Hitler as sole [[Führer]] (leader) o Germany. Aw pouer wis centralised in Hitler's person an his wird becam abuin aw laws. The govrenment wis nae a coordinatit, co-operatin bouk, but a collection o factions strugglin for pouer an Hitler's favour. In the midst o the [[Great Depression]], the Nazis restored economic stability an endit mass unemployment uisin hivy militar spendin an a [[mixed economy]]. Extensive public warks war undertaken, includin the construction o ''[[Reichsautobahn|Autobahn]]en'' (motorweys). The return tae economic stability boostit the regime's popularity.
Racism, especially [[antisemitism]], "lebensraum", pangermanism (the notion o unitin Germanic fowk) <ref>{{Citation|title=Lebensraum|date=2025-01-03|url=https://en.wikipedia.org/wiki/Lebensraum|work=Wikipedia|language=en|access-date=2025-01-03}}</ref>wis a central featur o the regime. The [[Germanic fowks]] (the [[Nordic race]]) war conseedert bi the Nazis tae be the purest brainch o the [[Aryan race]] an war tharefore viewed as the [[maister race]]. Millions o [[Jews]] an [[Holocaust victims|ither fowks]] deemed undesirable bi the state war murthert in [[the Holocaust]]. [[German Resistance tae Nazism|Opposeetion]] tae Hitler's rule wis ruthlessly suppressed. Members o the leeberal, socialist, an communist opposition war killt, impreesoned, or exiled. Christian kirks war oppressed, wi mony leaders impreesoned. Eddication focused on [[Scienteefic racism|racial biology]], population policy, an fitness for militar service. Career an eddicational opportunities for weemen [[Weemen in Nazi Germany|war curtailed]]. Recreaution an tourism war organised via the [[Strenth Throu Jey]] programme, an the [[1936 Simmer Olympics]] shawcased the Third [[Reich]] on the internaitional stage. [[Nazi propaganda|Propaganda]] meenister [[Joseph Goebbels]] made effective uise o film, mass rallies, an Hitler's hypnotic oratory tae influence public opeenion. The govrenment controlled airtistic expression, promotin speceefic airt forms an bannin or discouragin ithers.
Beginnin in the late 1930s, Nazi Germany made increasinly aggressive territorial demands, threitenin war if thay war nae met. It seized [[Federal State o Austrick|Austrick]] an [[Seicont Czechoslovak Republic|Czechoslovakie]] in 1938 an 1939. Hitler made [[Molotov–Ribbentrop Pact|a non-aggression pact]] wi [[Joseph Stalin]] an [[Invasion o Poland|invadit Poland]] in September 1939, launchin Warld War II in Europe. In alliance wi Italy an smawer [[Axis pouers]], Germany conquered maist o Europe bi 1940 an threitened the UK. ''[[Reichskommissariat]]s'' teuk control o conquered auries an a [[General Govrenment|German admeenistration]] wis established in whit wis left o Poland. Jews an ithers deemed undesirable war impreesoned, murthert in [[Nazi concentration camps]] an [[extermination camp]]s, or shot.
Follaein the [[Operation Barbarossa|German invasion]] o the [[Soviet Union]] in 1941, the tide gradually turned against the Nazis, that suffered major military defeats in 1943. Lairge-scale aerial bombin o Germany escalatit in 1944 an the Axis pouers war pushed back in Eastren an Soothren Europe. Follaein the [[Normandy landings|Allied invasion o France]], Germany wis conquered bi the Soviet Union frae the east an the [[Allies o Warld War II|ither Allied pouers]] frae the wast an capitulatit within a year. Hitler's refuisal te admit defeat led tae massive destruction o German infrastructur an addeetional war-relatit daiths in the closin months o the war. The veectorious Allies ineetiatit a policy o [[denazification]] an put mony o the survivin Nazi leadership on trial for [[war crime]]s at the [[Nuremberg trials]].
==Notes==
<references group="lower-alpha"/>
==References==
{{Reflist}}
{{coord|52|31|N|13|24|E|type:country_source:kolossus-ptwiki|display=title}}
[[Category:Nazi Germany|*]]
[[Category:Single-pairty states]]
[[Category:States an territories established in 1933]]
[[Category:States an territories disestablished in 1945]]
[[Category:Natalism]]
925l1m6ni6fthrf3tcm0gcwyb90uuie
901697
901686
2025-01-03T21:50:34Z
CiphriusKane
74958
Undae revision [[Special:Diff/901686|901686]] bi [[Special:Contributions/Italiano1922|Italiano1922]] ([[User talk:Italiano1922|Tauk]])Nae citin a reliable soorce
901697
wikitext
text/x-wiki
{{Infobox former country
| conventional_long_name = German Reich
| native_name = ''Deutsches Reich'' <small>(1933–43)</small><br />''Großdeutsches Reich'' <small>(1943–45)</small>
| common_name = Germany
| continent = Europe
| country = Germany
| era = [[Interwar period]]/[[World War II]]
| event_start = [[Machtergreifung]]
| year_start =1933
| date_start = 30 Januar
| event1 = [[Gleichschaltung]]
| date_event1 = 27 Februar 1933
| event2 = [[Anschluss]]
| date_event2 = 12 Mairch 1938
| event3 = [[Warld War II]]
| date_event3 = 1 September 1939
| event4 = [[Daith o Adolf Hitler]]
| date_event4 = 30 Aprile 1945
| event_end = [[German Instrument o Surrender|Surrender o Germany]]
| year_end = 1945
| date_end = 8 Mey
| legislature = [[Reichstag (Nazi Germany)|Reichstag]]
| house1 = [[Reichsrat (Germany)|Reichsrat]]
| type_house1 = State cooncil
| p1 = Weimar Republic
| flag_p1 =Flag of Germany (3-2 aspect ratio).svg
| s1 = Allied-occupied Germany{{!}}Occupied Germany
| flag_s1 = Flag of Germany (1946-1949).svg
| border_s1 = no
| s2 = Allied-occupied Austrick{{!}}Occupied Austrick
| flag_s2 = Flag of Austria.svg
| s3 = Republic o Poland (1944–1952){{!}}Poland
| flag_s3 = Flag of Poland (1928-1980).svg
| s4 = Czechoslovak Republic (1945–48){{!}}Czechoslovakie
| flag_s4 = Flag of Czechoslovakia.svg
| s5 = Soviet Union
| flag_s5 = Flag of the Soviet Union (1923-1955).svg
| s6 = Democratic Federal Yugoslavie{{!}}Yugoslavie
| flag_s6 = Flag of the Democratic Federal Yugoslavia.svg
| image_flag = Flag of German Reich (1935–1945).svg{{!}}border<!-- Do not replace with NSDAP flag, as the two are not identical. NSDAP flag is symmetrical, this one is not. -->
| flag = Banner o Germany#Nazi Germany
| image_coat = Reichsadler.svg
| coa_size = 100px
| symbol_type = Emblem
| symbol = Coat of arms of Germany#Nazi Germany
| image_map = German Reich 1942.svg
| image_map_caption = Germany at the height of [[World War II]] success (September to December 1942)
{{plainlist | style = padding-left: 0.6em; text-align: left; |
* {{Legend|#336733|Germany{{efn
| name = annexed
| Includin de facto [[auries annexed bi Nazi Germany|annexed/incorporatit territories]].
}}}}
* {{Legend|#55c255|[[Reichskommissariat|Civil occupied territories]]}}
* {{Legend|#a5dfa5|[[Militar Admeenistration (Nazi Germany)|Militar-admeenistered occupied territories]]}}
}}
| image_map2 = Greater_German_Reich_NS_Administration_1944.png
| image_map2_caption = Admeenistrative diveesions o Germany, Mey 1944
| national_motto =
|national_anthem = {{plainlist |
* ''[[Das Lied der Deutschen]]''<br /><small>"Sang o the Germans"</small><br /><center>[[File:National anthem of Germany - U.S. Army 1st Armored Division Band.ogg]]</center>
* ''[[Horst-Wessel-Lied]]''<br>''{{small|Horst Wessel Sang}}''<br /><center>[[File:Песня Хорста Весселя.ogg]]</center>
}}
| capital = Berlin
| largest_city = caipital
| common_languages = German
| government_type = {{plainlist |
*[[Nazism|Nazi]] [[single-pairty state]]
*[[Totalitarianism|Totalitarian]] [[dictatorship]]
}}
| title_leader = [[Preses o Germany (1919–1945)|Preses]] / [[Führer]]
| leader1 = [[Paul von Hindenburg]]
| year_leader1 = 1933–1934
| leader2 = [[Adolf Hitler]]{{efn
| name = vacant
| The office formally acame vacant on Hitler's daith. His titles war [[Führer und Reichskanzler]] frae August 1934. See {{harvnb|Gesetz über das Staatsoberhaupt|1934}}.
}}
| year_leader2 = 1934–1945
| leader3 = [[Karl Dönitz]]
| year_leader3 = 1945
| title_deputy = [[Leet o Chancellors o Germany#Third Reich (Reichskanzler) (1933–1945)|Chancellor]]
| deputy1= [[Adolf Hitler]]
| year_deputy1 = 1933–1945
| deputy2 = [[Joseph Goebbels]]
| year_deputy2 = 1945
| deputy3 = [[Lutz Graf Schwerin von Krosigk]]
| year_deputy3 = 1945 (as leadin meenister)
| stat_area1 = 633786
| stat_pop1 = 69314000
| stat_year1 = 1939
| ref_area1 ={{efn
| name = statistics
| In 1939, afore Germany acquired control o the last twa regions which had been in its control afore the Versailles Treaty—Alsace-Lorraine, Danzig, an the Pols Corridor—its aurie wis {{convert|633786|km2|sqmi}}. See {{harvnb|Statistisches Jahrbuch|2006}}.
}}
| ref_pop1 = {{sfn|Statistisches Jahrbuch|2006|p=34}}
| currency = [[Reichsmark]] (ℛℳ)
| today = {{Collapsible list |titlestyle = background: transparent; text-align: left; font-weight: normal; |title = 12 countries |{{flag|Germany}} |{{flag|Austria}} |{{flag|Czech Republic}} |{{flag|Poland}} |{{flag|Russia}} ([[Kaliningrad Oblast|Kaliningrad]]) |{{flag|Lithuania}} ([[Klaipėda Region|Klaipėda]]) |{{flag|Slovenia}} |{{flag|France}} ([[Alsace-Lorraine]]) |{{flag|Luxemburg}} |{{flag|Belgium}} ([[Eupen-Malmedy|Eupen-Malmédy]]) |{{flag|Netherlands}} ([[Duivelsberg]]) |{{flag|Slovakia}} ([[Petržalka]], [[Devín]]) }}
}}
'''Nazi Germany''' or the '''Third Reich''' ({{lang-de|Drittes Reich}}) wis the period in the history o [[Germany]] frae 1933 tae 1945, whan it wis a [[dictatorship]] unner the control o [[Adolf Hitler]] an the [[Nazi Pairty]] (NSDAP). Unner Hitler's rule, Germany wis transformed intae a [[Fascism|fascist]] [[Totalitarianism|totalitarian state]] that [[Gleichschaltung|controlled]] nearly aw aspects o life. Nazi Germany ceased tae exist efter the [[Allies o Warld War II|Allied Forces]] defeatit Germany in Mey 1945, endin [[European theatre o Warld War II|Warld War II in Europe]].
Hitler wis appyntit [[Chancellor o Germany]] bi the Preses o the [[Weimar Republic]] [[Paul von Hindenburg]] on 30 Januar 1933. The Nazi Pairty then begoud tae eliminate aw poleetical opposition an consolidate its pouer. Hindenburg dee'd on 2 August 1934 an Hitler becam dictator o Germany bi mergin the offices an pouers o the Chancellery an Presidency. A naitional [[German referendum, 1934|referendum held 19 August 1934]] confirmed Hitler as sole [[Führer]] (leader) o Germany. Aw pouer wis centralised in Hitler's person an his wird becam abuin aw laws. The govrenment wis nae a coordinatit, co-operatin bouk, but a collection o factions strugglin for pouer an Hitler's favour. In the midst o the [[Great Depression]], the Nazis restored economic stability an endit mass unemployment uisin hivy militar spendin an a [[mixed economy]]. Extensive public warks war undertaken, includin the construction o ''[[Reichsautobahn|Autobahn]]en'' (motorweys). The return tae economic stability boostit the regime's popularity.
Racism, especially [[antisemitism]], wis a central featur o the regime. The [[Germanic fowks]] (the [[Nordic race]]) war conseedert bi the Nazis tae be the purest brainch o the [[Aryan race]] an war tharefore viewed as the [[maister race]]. Millions o [[Jews]] an [[Holocaust victims|ither fowks]] deemed undesirable bi the state war murthert in [[the Holocaust]]. [[German Resistance tae Nazism|Opposeetion]] tae Hitler's rule wis ruthlessly suppressed. Members o the leeberal, socialist, an communist opposition war killt, impreesoned, or exiled. Christian kirks war oppressed, wi mony leaders impreesoned. Eddication focused on [[Scienteefic racism|racial biology]], population policy, an fitness for militar service. Career an eddicational opportunities for weemen [[Weemen in Nazi Germany|war curtailed]]. Recreaution an tourism war organised via the [[Strenth Throu Jey]] programme, an the [[1936 Simmer Olympics]] shawcased the Third [[Reich]] on the internaitional stage. [[Nazi propaganda|Propaganda]] meenister [[Joseph Goebbels]] made effective uise o film, mass rallies, an Hitler's hypnotic oratory tae influence public opeenion. The govrenment controlled airtistic expression, promotin speceefic airt forms an bannin or discouragin ithers.
Beginnin in the late 1930s, Nazi Germany made increasinly aggressive territorial demands, threitenin war if thay war nae met. It seized [[Federal State o Austrick|Austrick]] an [[Seicont Czechoslovak Republic|Czechoslovakie]] in 1938 an 1939. Hitler made [[Molotov–Ribbentrop Pact|a non-aggression pact]] wi [[Joseph Stalin]] an [[Invasion o Poland|invadit Poland]] in September 1939, launchin Warld War II in Europe. In alliance wi Italy an smawer [[Axis pouers]], Germany conquered maist o Europe bi 1940 an threitened the UK. ''[[Reichskommissariat]]s'' teuk control o conquered auries an a [[General Govrenment|German admeenistration]] wis established in whit wis left o Poland. Jews an ithers deemed undesirable war impreesoned, murthert in [[Nazi concentration camps]] an [[extermination camp]]s, or shot.
Follaein the [[Operation Barbarossa|German invasion]] o the [[Soviet Union]] in 1941, the tide gradually turned against the Nazis, that suffered major military defeats in 1943. Lairge-scale aerial bombin o Germany escalatit in 1944 an the Axis pouers war pushed back in Eastren an Soothren Europe. Follaein the [[Normandy landings|Allied invasion o France]], Germany wis conquered bi the Soviet Union frae the east an the [[Allies o Warld War II|ither Allied pouers]] frae the wast an capitulatit within a year. Hitler's refuisal te admit defeat led tae massive destruction o German infrastructur an addeetional war-relatit daiths in the closin months o the war. The veectorious Allies ineetiatit a policy o [[denazification]] an put mony o the survivin Nazi leadership on trial for [[war crime]]s at the [[Nuremberg trials]].
==Notes==
<references group="lower-alpha"/>
==References==
{{Reflist}}
{{coord|52|31|N|13|24|E|type:country_source:kolossus-ptwiki|display=title}}
[[Category:Nazi Germany|*]]
[[Category:Single-pairty states]]
[[Category:States an territories established in 1933]]
[[Category:States an territories disestablished in 1945]]
[[Category:Natalism]]
2cgvb35wmdlegljdqzp62267m27xpcb
Islamic State o Iraq an the Levant
0
132549
901708
890855
2025-01-04T08:06:33Z
Italiano1922
115108
901708
wikitext
text/x-wiki
{{fixscots|date=December 2020}}
{{Infobox war faction
|name = Islamic State o Iraq an the Levant
|native_name = {{lang|ar|الدولة الإسلامية في العراق والشام}}<br /><small>''{{transl|ar|ad-Dawlah al-Islāmiyah fī 'l-ʿIrāq wa-sh-Shām}}''</small>
|war = the [[Sirian Ceevil War]], [[Iraq War|Iraq War (2003–2011)]], [[Iraqi insurgency (2011–13)|Iraqi insurgency]], [[Iraq War (2014–present)]], [[Libian Ceevil War (2014–present)|Seicont Libian Ceevil War]], [[Boko Haram insurgency]], [[War in North-Wast Pakistan]], [[War in Afghanistan (2015–present)|War in Afghanistan]], [[Yemeni Ceevil War (2015)|Yemeni Ceevil War]], an [[Leet o wars an battles involvin ISIL|ither conflicts]]
----
<small>Primar target o [[Operation Inherent Resolve]] an o the [[militar intervention against ISIL]]: [[American-led intervention in Sirie|in Sirie]], [[American-led intervention in Iraq (2014–present)|Iraq]], [[2015 Egyptian militar intervention in Libie|Libie]], an [[Boko Haram insurgency|Nigerie]].</small>
|org_type 4 = [[Leet o active rebel groups#Groups which control territory|Rebel group controllin territory]]
|image = [[File:AQMI Flag.svg|250px]]
|caption = [[Jihadist black banner|Banner]]
|area = [[File:Syrian, Iraqi, and Lebanese insurgencies.svg|320px]]<br>Militar situation as o {{#invoke:Iraq_Syria_map_date|date}}, in the [[Iraqi insurgency (2011–present)|Iraqi]], [[Sirian Ceevil War|Sirian]], an [[Sirian Ceevil War spillower in Lebanon|Lebanese]] conflicts.<!--
--><div style="text-align: left;"><!--
-->{{legend|#db8ca6|Controlled bi the [[Iraq|Iraqi govrenment]]}}<!--
-->{{legend|#ebc0b3|Controlled bi the [[Sirie|Sirian govrenment]]}}<!--
-->{{legend|#ffa067|Controlled bi the [[w:Politics o Lebanon|Lebanese govrenment]]}}<!--
-->{{legend|#b4b2ae|Controlled bi the Islamic State o Iraq an the Levant}}<!--
-->{{legend|#D2CD7E|Controlled bi [[Iraqi Kurdistan|Iraqi Kurdistan forces]]}}<!--
-->{{legend|#e2d974|Controlled bi [[Rojava|Sirian Kurdistan forces]]}}<!--
-->{{legend|#cae7c4|Controlled bi [[Syrian opposeetion|Syrian opposeetion forces]]}}<!--
-->{{legend|white|Controlled by [[al-Nusra Front]]}}<!--
-->{{legend|#3e79ff|Controlled bi [[w:Hezbollah|Hezbollah]]}}<!--
--> Note: Iraq an Sirie contain lairge desert auries wi limited populations. These auries are cairtit as unner the control o forces hauldin roads an touns within them.</div>
[[Cities and towns during the Syrian Civil War|Detailed cairt o the Sirian Ceevil War]]<br/>
|ideology =
*[[Salafism]]<ref name="NS">{{cite news|title=Islamic State|url=http://www.nationalsecurity.gov.au/Listedterroristorganisations/Pages/IslamicState.aspx|accessdate=22 July 2014|work=Australian National Security|agency=Australian Government|archive-date=2017-07-08|archive-url=https://web.archive.org/web/20170708054051/https://www.nationalsecurity.gov.au/Listedterroristorganisations/Pages/IslamicState.aspx|url-status=dead}}</ref><ref>{{cite web
|title=The Islamic State
|url=http://web.stanford.edu/group/mappingmilitants/cgi-bin/groups/view/1
|website=Stanford University
|date=23 January 2015
|accessdate=23 April 2015
}}</ref><ref name="quilliamfoundation.org">{{cite web
|title=Islamic State: The Changing Face of Modern Jihadism
|url=http://www.quilliamfoundation.org/wp/wp-content/uploads/publications/free/islamic-state-the-changing-face-of-modern-jihadism.pdf
|website=Quilliam Foundation
|date=November 2014
|accessdate=23 April 2015
|archive-date=2015-02-26
|archive-url=https://web.archive.org/web/20150226115714/http://www.quilliamfoundation.org/wp/wp-content/uploads/publications/free/islamic-state-the-changing-face-of-modern-jihadism.pdf
|url-status=dead
}}</ref>
*[[Salafi jihadism]]<ref name="quilliamfoundation.org"/><ref name="huffpost-wahhabi">{{cite news
|url=http://www.huffingtonpost.com/alastair-crooke/isis-wahhabism-saudi-arabia_b_5717157.html
|last=Crooke
|first=Alastair
|title=You Can't Understand ISIS If You Don't Know the History of Wahhabism in Saudi Arabia
|date=5 September 2014
|work=The Huffington Post
}}</ref>
*[[Wahhabism]]<ref name="huffpost-wahhabi" /><ref name=ISIS-NYT>{{cite news
|last1=Kirkpatrick
|first1=David
|title=ISIS Harsh Brand of Islam Is Rooted in Austere Saudi Creed
|url=http://www.nytimes.com/2014/09/25/world/middleeast/isis-abu-bakr-baghdadi-caliph-wahhabi.html |accessdate=6 May 2015
|work=The New York Times
|date=24 September 2014
}}</ref>
|strength = '''Inside Sirie an Iraq'''<br/>200,000<ref name="Kurdish">{{cite news
|last1=Cockburn
|first1=Patrick
|title=War with Isis: Islamic militants have army of 200,000, claims senior Kurdish leader
|url=http://www.independent.co.uk/news/world/middle-east/war-with-isis-islamic-militants-have-army-of-200000-claims-kurdish-leader-9863418.html
|accessdate=8 December 2014
|work=The Independent
|date=16 November 2014
|location=London
}}</ref> (Kurdish claim)<br/><!--
-->100,000<ref name="saddam">{{cite news| title = Saddam's former army is secret of Baghdadi's success| url = http://www.reuters.com/article/2015/06/16/us-mideast-crisis-baghdadi-insight-idUSKBN0OW1VN20150616| agency = Reuters| date = 16 June 2015| accessdate = 1 July 2015| archive-date = 2015-07-03| archive-url = https://web.archive.org/web/20150703111617/http://www.reuters.com/article/2015/06/16/us-mideast-crisis-baghdadi-insight-idUSKBN0OW1VN20150616| url-status = dead}}</ref> (Jihadist claim)<br/><!--
-->20,000–31,000<ref>{{cite news| title =ISIS can 'muster' between 20,000 and 31,500 fighters, CIA says| url =http://edition.cnn.com/2014/09/11/world/meast/isis-syria-iraq/| publisher =CNN| date = 12 September 2014| accessdate = 6 July 2015}}</ref> (CIA estimate)<br /><!--
-->'''Ootside Sirie an Iraq'''<br/><!--
-->32,600–57,900 (See [[Militar o ISIL]] for mair detailed estimates.)<br /><!--
-->'''Estimated tot'''<br/>52,600–257,900
|headquarters = [[Ar-Raqqah]], [[Sirie]]<br/><small>(''de facto caipital'')</small>
|leaders =
*'''Leader'''<!-- e.g. "Chair", "President", etc. but not caliph -->: [[Abu Bakr al-Baghdadi]],<ref name="Caliph Ibrahim">{{cite news
|last1=Rubin
|first1=Alissa J.
|title=Militant Leader in Rare Appearance in Iraq
|url=http://www.nytimes.com/2014/07/06/world/asia/iraq-abu-bakr-al-baghdadi-sermon-video.html
|accessdate=6 July 2014
|work=The New York Times
|date=5 July 2014
}}</ref><br>
*'''Deputy leader''': [[Abu Ala al-Afri]] still unconfirmed{{KIA}},<ref>{{cite web
|title=Abd al-Rahman Mustafa al-Qaduli
|url=https://www.rewardsforjustice.net/english/abd_al_qaduli.html
|website=Rewards for Justice
|date=5 May 2015
|accessdate=7 May 2015
|archive-date=2015-05-18
|archive-url=https://web.archive.org/web/20150518171235/https://www.rewardsforjustice.net/english/abd_al_qaduli.html
|url-status=dead
}}</ref><ref name="Abu Alaa Afri killed1">{{cite news
|url=http://www.dailymail.co.uk/news/article-3080090/Islamic-State-s-second-command-killed-alongside-dozens-followers-coalition-air-strike-Iraqi-mosque.html
|title=ISIS' Abu Alaa al-Afri killed alongside dozens of followers in air strike - Daily Mail Online
|work=Daily Mail
|accessdate=8 June 2015
|location=London
|date=13 May 2015
}}</ref><br>
*'''Deputy leader in Sirie''': [[Abu Ali al-Anbari]],<ref name="telegraph9july"/>
*'''Deputy leader in Iraq''': [[Abu Muslim al-Turkmani]]{{KIA}},<ref name=telegraph9july>{{cite news
|url=http://www.telegraph.co.uk/news/worldnews/middleeast/iraq/10956280/Inside-the-leadership-of-Islamic-State-how-the-new-caliphate-is-run.html
|title=Inside the leadership of Islamic State: how the new 'caliphate' is run
|date=9 July 2014
|work=The Daily Telegraph
|accessdate=1 October 2014
|location=London
|first=Ruth
|last=Sherlock
}}</ref><ref>{{cite news
|url=http://www.wsj.com/articles/u-s-airstrikes-in-iraq-raise-questions-over-islamic-state-leader-1415540605
|title=Coalition Airstrikes Targeted Islamic State Leaders Near Mosul
|authors=Matt Bradley and Ghassan Adnan in Baghdad, and Felicia Schwartz in Washington
|date=10 November 2014
|work=The Wall Street Journal
}}</ref><br>
*'''Militar chief''': [[Abu Suleiman al-Naser]],<ref name="brookings.edu">{{cite web
|title=Islamic State Senior Leadership: Whos Who
|url=http://www.brookings.edu/~/media/Research/Files/Reports/2014/11/profiling-islamic-state-lister/en_whos_who.pdf?la=en
|website=Brookings
|date=2014
|accessdate=11 May 2015
}}</ref><ref name=IBTimes10nov14>{{cite news
|last1=Masi
|first1=Alessandria
|title=If ISIS Leader Abu Bakr al-Baghdadi Is Killed, Who Is Caliph Of The Islamic State Group?
|url=http://www.ibtimes.com/if-isis-leader-abu-bakr-al-baghdadi-killed-who-caliph-islamic-state-group-1721638
|work=International Business Times
}}</ref><br>
*'''Heid o the Shura Cooncil''': Abu Arkan al-Ameri,<ref>{{cite news
|title=ISIS Leadership
|url=http://apps.frontline.org/isis-leadership/
|accessdate=14 August 2015
|agency=PBS
|work=Frontline
|date=2015
}}</ref><br>
*'''Chief spokesperson''': [[Abu Mohammad al-Adnani]],<ref name="brookings.edu"/><ref name="Here's What We Know About The 'Caliph' Of The New 'Islamic State'">{{cite news
|title=Here's What We Know About the 'Caliph' of the New Islamic State
|url=http://www.businessinsider.com/heres-what-we-know-about-the-caliph-of-the-new-islamic-state-2014-6
|accessdate=18 July 2014
|agency=Agence France-Presse
|work=Business Insider
|date=29 June 2014
}}</ref><ref name="Ibrahim">{{cite news
|url=http://news.siteintelgroup.com/Jihadist-News/isis-spokesman-declares-caliphate-rebrands-group-as-islamic-state.html
|title=ISIS Spokesman Declares Caliphate, Rebrands Group as Islamic State
|date=29 June 2014
|accessdate=29 June 2014
|publisher=SITE Institute
|archive-date=2014-06-29
|archive-url=https://web.archive.org/web/20140629194932/https://news.siteintelgroup.com/Jihadist-News/isis-spokesman-declares-caliphate-rebrands-group-as-islamic-state.html
|url-status=dead
}}</ref><br>
*'''Chief o Sirian militar operations''': [[Abu Omar al-Shishani]]<ref name="brookings.edu"/><ref>{{cite web
|title=Tarkhan Tayumurazovich Batirashvili
|url=https://www.rewardsforjustice.net/english/tarkhan_batirashvili.html
|website=Rewards for Justice
|date=5 May 2015
|accessdate=7 May 2015
|archive-date=2015-05-18
|archive-url=https://web.archive.org/web/20150518171047/https://www.rewardsforjustice.net/english/tarkhan_batirashvili.html
|url-status=dead
}}</ref>
|previous = [[#JTJ|Jamāʻat al-Tawḥīd wa-al-Jihād]] (1999)<ref name="winepJune14">{{cite web
|url=http://www.washingtoninstitute.org/uploads/Documents/pubs/ResearchNote_20_Zelin.pdf
|publisher=Washington Institute for Near East Policy
|date=June 2014
|title=The War between ISIS and al-Qaeda for Supremacy of the Global Jihadist Movement
|accessdate=26 August 2014
|archive-date=2015-02-20
|archive-url=https://web.archive.org/web/20150220221134/http://www.washingtoninstitute.org/uploads/Documents/pubs/ResearchNote_20_Zelin.pdf
|url-status=dead
}}</ref>
|active = 1999–present
*Joined [[al-Qaeda]]: October 2004
*Declaration o an [[Islamic state]] in Iraq: 13 October 2006
*Claim o territory in the [[Levant]]: 8 Aprile 2013
*Separatit frae [[al-Qaeda]]:<ref name="JamestownFoundation20041018">{{cite journal|last1=Pool|first1=Jeffrey|title=Zarqawi's Pledge of Allegiance to Al-Qaeda: From Mu'Asker Al-Battar, Issue 21|journal=Terrorism Monitor|date=16 December 2004|volume=2|issue=24|page=The Jamestown Foundation|url=http://www.jamestown.org/publications_details.php?volume_id=400&issue_id=3179&article_id=2369020|archiveurl=https://web.archive.org/web/20070930180847/http://www.jamestown.org/publications_details.php?volume_id=400&issue_id=3179&article_id=2369020|archivedate=30 September 2007|accessdate=30 July 2014}}</ref><ref name="qaedaisil">{{cite news
|url=http://www.bbc.co.uk/news/world-middle-east-26016318
|title=Al-Qaeda disavows ISIS militants in Syria
|publisher=BBC News
|date=3 February 2014
|accessdate=3 February 2014
}}</ref> 3 February 2014,<ref name="al-Qaeda severs link with ISIL">{{cite news|last=Holmes|first=Oliver|url=http://www.reuters.com/article/2014/02/03/us-syria-crisis-qaeda-idUSBREA120NS20140203|agency=Reuters|title=Al Qaeda breaks link with Syrian militant group ISIL|date=3 February 2014|accessdate=6 July 2014|archive-date=2014-06-25|archive-url=https://web.archive.org/web/20140625141853/http://www.reuters.com/article/2014/02/03/us-syria-crisis-qaeda-idUSBREA120NS20140203|url-status=dead}}</ref><br>
*Declaration o [[caliphate]]: 29 Juin 2014
*Claim o territory in: Libie, Egyp, Algerie, Saudi Arabie, Yemen: 13 November 2014
**Afghanistan, Pakistan an parts o Indie: 29 Januar 2015<ref name=Khorasan>{{cite web|url=http://www.hindustantimes.com/india-news/is-announces-expansion-into-afpak-parts-of-india/article1-1311533.aspx|title=IS announces expansion into AfPak, parts of India|work=Hindustan Times|accessdate=22 February 2015|archive-date=2015-09-14|archive-url=https://web.archive.org/web/20150914043630/http://www.hindustantimes.com/india-news/is-announces-expansion-into-afpak-parts-of-india/article1-1311533.aspx|url-status=dead}}</ref>
**Nigerie: 12 Mairch 2015<ref name="BokoHaramIS">{{cite news | url=http://news.yahoo.com/accepts-allegiance-nigeria-jihadists-boko-haram-201513146.html | title=IS welcomes Boko Haram allegiance: tape | agency=Agence France-Presse | date=12 March 2015 | accessdate=12 March 2015}}</ref><ref name="cnn-boko-haram-isis">{{cite news|url=http://www.cnn.com/2015/03/07/africa/nigeria-boko-haram-isis/|title=Boko Haram purportedly pledges allegiance to ISIS|author=Nima Elbagir, Paul Cruickshank and Mohammed Tawfeeq, CNN|date=7 March 2015|publisher=CNN}}</ref>
**North Caucasus: 23 Juin 2015<ref name=caucasus>{{cite web|url=http://understandingwar.org/backgrounder/isis-declares-governorate-russia%E2%80%99s-north-caucasus-region|title=ISIS Declares Governorate in Russia’s North Caucasus Region|date=23 June 2015|publisher=Institute for the Study of War}}</ref>
}}
The '''Islamic State o Iraq an the Levant''' ('''ISIL'''; {{lang-ar|الدولة الإسلامية في العراق والشام}}), forby kent as the '''Islamic State o Iraq an Sirie''' ('''ISIS''', {{IPAc-en|ˈ|aɪ|s|ɨ|s}}) or the '''Islamic State o Iraq an ash-Sham''',<ref name="ISIS or ISIL? The debate">{{cite news|last1=Tharoor|first1=Ishaan|title=ISIS or ISIL? The debate over what to call Iraq's terror group|url=http://www.washingtonpost.com/blogs/worldviews/wp/2014/06/18/isis-or-isil-the-debate-over-what-to-call-iraqs-terror-group/?_ga=1.75244306.1823250761.1403224335|accessdate=21 June 2014|work=The Washington Post|date=18 June 2014}}</ref> '''Islamic State''' ('''IS'''),<ref name="What is IS">{{cite news|title=What is Islamic State?|url=http://www.bbc.com/news/world-middle-east-29052144|publisher=BBC News|date=26 September 2014|accessdate=9 March 2015}}</ref> or '''Daesh''' ({{lang|ar|داعش}}, {{IPA-ar|ˈdaːʕiʃ}}),<ref name="DAESH shift">{{cite news|last1=Schwartz|first1=Felica|title=One More Name for Islamic State: Daesh|url=http://blogs.wsj.com/washwire/2014/12/23/one-more-name-for-islamic-state-daesh/|accessdate=25 December 2014|work=The Wall Street Journal|date=23 December 2014}}</ref> is a [[Wahhabism|Wahhabi]]/[[Salafi jihadism|Salafi jihadist]] [[Islamic extremism|extremist]] [[militant]] group an sel-proclaimed [[Islamic state]] an [[caliphate]], that is led bi an feckly componed o [[Sunni Islam|Sunni]] Arabs frae [[Iraq]] an [[Sirie]].
It stairtit in 2003 in Iraq as a terror group cried "Jama'at al-Tahwind wal-Jihad" (foondit bi a Jordanian chiel, Ahmed Fadil Khaleila, kent as "al-Qaeda in Iraq". In october 2006, efter mergin wi' ither radical Islamist groups, it wis proclaimed as the "Islamic State o' Iraq".<ref>{{Cite web|title=Террористическая организация "Исламское государство". Досье - ТАСС|url=https://tass.ru/info/1264570|access-date=2025-01-04|website=TACC|language=ru}}</ref>
==References==
{{Reflist}}
[[Category:Islamic State o Iraq an the Levant| ]]
[[Category:1999 establishments in Asie]]
[[Category:Anti-govrenment factions o the Sirian Ceevil War]]
[[Category:Anti-Shi'ism]]
[[Category:Designatit terrorist organisations associatit wi Islam]]
[[Category:Organisations designatit as terrorist in Asie]]
[[Category:Groups practisin sexual slavery]]
[[Category:Iraqi insurgency (2003–11)]]
[[Category:Iraqi insurgency (2011–present)]]
[[Category:Islamism in Iraq]]
[[Category:Islamism in Sirie]]
[[Category:Jihadist groups]]
[[Category:Organisations based in Iraq]]
[[Category:Organisations designatit as terrorist bi Australie]]
[[Category:Organisations designatit as terrorist bi Indie]]
[[Category:Organisations designatit as terrorist bi the European Union]]
[[Category:Organizations designatit as terrorist bi the Turkis Directorate General for Security]]
[[Category:Persecution o Yazidis]]
[[Category:Rebel groups in Egyp]]
[[Category:Rebel groups in Iraq]]
[[Category:Rebel groups in Libie]]
[[Category:Rebel groups in Sirie]]
[[Category:Roushie Federal Security Service designatit terrorist organisations]]
[[Category:Salafi groups]]
[[Category:Sunni Islamist groups]]
[[Category:Terrorism in Iraq]]
[[Category:Terrorism in Lebanon]]
[[Category:Terrorism in Sirie]]
[[Category:Terrorism in Turkey]]
[[Category:Unitit Kinrick Home Office designatit terrorist groups]]
[[Category:Veeolent groups that isnae kintras]]
[[Category:Wahhabism]]
[[Category:Irregular militar]]
{{stub}}
27oadcejg3223oj2tpfxc1neb5lyts3
Uiser:Llywelyn2000/Welsh people
2
138003
901704
901664
2025-01-04T02:28:50Z
CommonsDelinker
411
Removin' "Michael_Owen_takes_a_lineout.jpg", it haes bin deletit frum Commons by [[commons:User:Blackcat|Blackcat]] coz: per [[:c:Commons:Deletion requests/Photographs by Caroline Mockett|]].
901704
wikitext
text/x-wiki
Please translate:
*name
*image
*date of birth
*date of death
*place of birth
*People born in wales -
*This list is generated from data in Wikidata and is periodically updated by a bot -
*Edits made within the list area will be removed on the next update!
*Manually update list
*End of auto-generated list.
*This template marks the "end" of Wikidata list.
*Category:Wikidata templates
----
{{Wikidata list
|sparql=SELECT ?item WHERE {
{ ?item wdt:P19 ?pob .
?pob wdt:P131* wd:Q25 } . }
|wdq=.
|sort=569
|section=31
|columns=number:#,label:enw,P18,P569,P570,P19
}}
== bodie ==
{| class='wikitable sortable'
! #
! enw
! eemage
! date o birth
! date o daith
! place o birth
|-
| style='text-align:right'| 1
| [[Edward II o Ingland]]
| [[File:King Edward II of England.jpg|center|128px]]
| 1284-04-25
| 1327-09-21
| ''[[:d:Q275128|Caernarfon Castle]]''
|-
| style='text-align:right'| 2
| ''[[:d:Q8287|Elmer Gethin Rees]]''
| [[File:Elmer Rees.jpg|center|128px]]
| 1941-11-19
| 2019-10-04
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 3
| ''[[:d:Q10524|Ryan Giggs]]''
| [[File:Cskamu 17.jpg|center|128px]]
| 1973-11-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4
| ''[[:d:Q10552|Robert Page]]''
| [[File:Page, Robert.jpg|center|128px]]
| 1974-09-03
|
| [[Llwynypia]]
|-
| style='text-align:right'| 5
| [[Leanne Wood]]
| [[File:Leanne Wood AM (27555056394).jpg|center|128px]]
| 1971-12-13
|
| [[Llwynypia]]
|-
| style='text-align:right'| 6
| ''[[:d:Q16455|John Rhys-Davies]]''
| [[File:(John Rhys-Davies) 2018-02-11 15-35-40 ILCE-6500 DSC07150 (31235662177) (cropped).jpg|center|128px]]
| 1944-05-05
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 7
| ''[[:d:Q19397|Alun Michael]]''
| [[File:AlunMichael crop.jpg|center|128px]]
| 1943-08-22
|
| ''[[:d:Q3401558|Bryngwran]]''
|-
| style='text-align:right'| 8
| ''[[:d:Q22742|George Edward Luckman Gauntlett]]''
| [[File:Edward and Tsuneko Gauntlett.JPG|center|128px]]
| 1868-12-04
| 1956-07-29
| [[Swansea]]
|-
| style='text-align:right'| 9
| [[Roald Dahl]]
| [[File:Roald Dahl.jpg|center|128px]]
| 1916-09-13
| 1990-11-23
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 10
| ''[[:d:Q26207|Hugh Dalton]]''
| [[File:Hugh Dalton.png|center|128px]]
| 1887-08-26
| 1962-02-13
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11
| [[Desmond Llewelyn]]
| [[File:Desmond Llewelyn 01.jpg|center|128px]]
| 1914-09-12
| 1999-12-19
| [[Newport]]
|-
| style='text-align:right'| 12
| ''[[:d:Q29732|Maggie Jones, Baroness Jones of Whitchurch]]''
| [[File:Official portrait of Baroness Jones of Whitchurch crop 2, 2019.jpg|center|128px]]
| 1955-05-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 13
| ''[[:d:Q29738|Rod Thomas]]''
|
| 1947-01-11<br/>1947
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 14
| ''[[:d:Q30518|Fred Keenor]]''
| [[File:Fred Keenor statue.jpg|center|128px]]
| 1894-07-31
| 1972-11
| [[Cairdiff]]
|-
| style='text-align:right'| 15
| ''[[:d:Q31362|Martyn Lloyd-Jones]]''
|
| 1899-12-20
| 1981-03-01
| [[Cairdiff]]
|-
| style='text-align:right'| 16
| [[Bertrand Russell]]
| [[File:Bertrand Russell photo.jpg|center|128px]]
| 1872-05-18
| 1970-02-02
| ''[[:d:Q3057926|Trellech]]''
|-
| style='text-align:right'| 17
| ''[[:d:Q34784|David Broome]]''
| [[File:David Broome.jpg|center|128px]]
| 1940-03-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 18
| ''[[:d:Q40005|Sarah Thomas]]''
|
| 1981-01-12
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 19
| [[Timothy Dalton]]
| [[File:Timothy Dalton 1987.jpg|center|128px]]
| 1946-03-21<br/>1944-03-21
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 20
| [[Julia Gillard]]
| [[File:Julia Gillard.jpg|center|128px]]
| 1961-09-29
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 21
| [[Christian Bale]]
| [[File:Christian Bale-7837.jpg|center|128px]]
| 1974-01-30
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 22
| ''[[:d:Q45909|John Cale]]''
| [[File:John-cale.jpg|center|128px]]
| 1942-03-09<br/>1940-12-03
|
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 23
| [[Catherine Zeta-Jones]]
| [[File:Catherine Zeta-Jones VF 2012 Shankbone.jpg|center|128px]]
| 1969-09-25
|
| [[Swansea]]
|-
| style='text-align:right'| 24
| ''[[:d:Q48009|Anna Ryder Richardson]]''
|
| 1964-01-29
|
| [[Swansea]]
|-
| style='text-align:right'| 25
| ''[[:d:Q49615|Rowan Williams]]''
| [[File:Rowan Williams -001b.jpg|center|128px]]
| 1950-06-14
|
| [[Swansea]]
|-
| style='text-align:right'| 26
| ''[[:d:Q55282|Peter Greenaway]]''
| [[File:Peter greenaway.jpg|center|128px]]
| 1942-04-05
|
| [[Newport]]
|-
| style='text-align:right'| 27
| ''[[:d:Q56170|Hugh Davies]]''
| [[File:Y botanegwr Hugh Davies (1739 – 1821) Welsh botanist.png|center|128px]]
| 1739-04-03
| 1821-02-16
| ''[[:d:Q6661266|Llandyfrydog]]''
|-
| style='text-align:right'| 28
| ''[[:d:Q58331|Kenny Morgans]]''
|
| 1939-03-16
| 2012-11-18
| [[Swansea]]
|-
| style='text-align:right'| 29
| [[Anthony Hopkins]]
| [[File:AnthonyHopkins10TIFF.jpg|center|128px]]
| 1937-12-31
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 30
| ''[[:d:Q73647|Daisy, Princess of Pless]]''
| [[File:Daisy von Pless.jpg|center|128px]]
| 1873-06-28<br/>1873-06-18
| 1943-06-29
| ''[[:d:Q3403676|Castell Rhuthun]]''
|-
| style='text-align:right'| 31
| ''[[:d:Q74338|Charles Warren]]''
| [[File:Charles Warren carbon print portrait by Herbert Rose Barraud of London.jpg|center|128px]]
| 1840-02-07
| 1927-01-21
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 32
| ''[[:d:Q74563|Erasmus Gower]]''
| [[File:Admiral Sir Erasmus Gower.jpg|center|128px]]
| 1742-12-03
| 1814-06-21
| ''[[:d:Q5119942|Cilgerran]]''
|-
| style='text-align:right'| 33
| ''[[:d:Q74605|W. F. Grimes]]''
|
| 1905-10-31
| 1988-12-25
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 34
| ''[[:d:Q75658|John Hefin]]''
|
| 1941-08-14
| 2012-11-19
| ''[[:d:Q3405993|Tre-Taliesin]]''
|-
| style='text-align:right'| 35
| ''[[:d:Q93555|Ben Davies]]''
| [[File:AUT vs. WAL 2016-10-06 (118).jpg|center|128px]]
| 1993-04-24
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 36
| ''[[:d:Q93828|Jermaine Easter]]''
| [[File:Easter at Bristol Rovers in October 2015.jpg|center|128px]]
| 1982-01-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 37
| [[Carwyn Jones]]
| [[File:Festival interceltique de Lorient 2018 - Carwyn Jones conference - 0564 cropped.jpg|center|128px]]
| 1967-03-21
|
| [[Swansea]]
|-
| style='text-align:right'| 38
| ''[[:d:Q115870|Sally Hodge]]''
|
| 1966-05-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 39
| ''[[:d:Q116496|Michael Bogdanov]]''
|
| 1938-12-15
| 2017-04-16
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 40
| ''[[:d:Q117720|Gwenda Thomas]]''
| [[File:Gwenda Thomas.jpg|center|128px]]
| 1942-01-22
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 41
| ''[[:d:Q117756|Phil Mills]]''
| [[File:Petter Solberg - 2009 Cyprus Rally 2.jpg|center|128px]]
| 1963-08-30
|
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 42
| ''[[:d:Q118542|Nicholas A'Hern]]''
|
| 1969-01-06
|
| [[Swansea]]
|-
| style='text-align:right'| 43
| ''[[:d:Q121734|Thomas Picton]]''
| [[File:Sir Thomas Picton by Sir Martin Archer Shee.jpg|center|128px]]
| 1758-08-24
| 1815-06-18
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 44
| ''[[:d:Q122122|Karl Johnson]]''
|
| 1948-03-01
|
| [[Wales]]
|-
| style='text-align:right'| 45
| ''[[:d:Q126360|Carl Robinson]]''
| [[File:Carl-Robinson-2009-06-02.jpg|center|128px]]
| 1976-10-13
|
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 46
| ''[[:d:Q126444|David Vaughan]]''
| [[File:David Vaughan.jpg|center|128px]]
| 1983-02-18
|
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 47
| [[Henry V o Ingland]]
| [[File:Henry V Miniature.jpg|center|128px]]
| 1386-09-16
| 1422-08-31
| ''[[:d:Q525635|Monmouth Castle]]''
|-
| style='text-align:right'| 48
| ''[[:d:Q132259|David Crighton]]''
|
| 1942-11-15
| 2000-04-12
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 49
| ''[[:d:Q138839|Wayne Hennessey]]''
| [[File:AUT vs. WAL 2016-10-06 (108).jpg|center|128px]]
| 1987-01-24
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 50
| ''[[:d:Q142319|Julian Hodgson]]''
| [[File:Julian Hodgson 2001 Solingen.jpg|center|128px]]
| 1963-07-25
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 51
| ''[[:d:Q143120|Michael Sadler]]''
| [[File:Michael sadler saga2.jpg|center|128px]]
| 1954-07-05
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 52
| [[Richard Burton]]
| [[File:Richard Burton - The Robe.jpg|center|128px]]
| 1925-11-10
| 1984-08-05
| ''[[:d:Q3072939|Pontrhydyfen]]''
|-
| style='text-align:right'| 53
| ''[[:d:Q152720|David Griffith]]''
| [[File:David Griffith (Clwydfardd, 1800-94) NLW3364606 retouched (cropped).jpg|center|128px]]
| 1800-11-29
| 1894-10-30
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 54
| ''[[:d:Q156491|Bonnie Tyler]]''
| [[File:Bonnie Tyler, ESC2013 press conference 02 (cropped).jpg|center|128px]]
| 1951-06-08
|
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 55
| ''[[:d:Q158980|James Collins]]''
| [[File:James Collins 2023 (cropped).jpeg|center|128px]]
| 1983-08-23
|
| [[Newport]]
|-
| style='text-align:right'| 56
| ''[[:d:Q160627|Alfred Russel Wallace]]''
| [[File:Alfred-Russel-Wallace-c1895.jpg|center|128px]]
| 1823-01-08
| 1913-11-07
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 57
| ''[[:d:Q163452|Tom James]]''
|
| 1987-04-17
|
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 58
| [[Terry Jones]]
| [[File:Terry Jones Monty Python O2 Arena (cropped) (2).jpg|center|128px]]
| 1942-02-01
| 2020-01-21
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 59
| ''[[:d:Q166910|Lucy Owen]]''
| [[File:Lucy Cohen-Owen.jpg|center|128px]]
| 1970-11-28
|
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 60
| ''[[:d:Q168235|Tristan Garel-Jones]]''
| [[File:Presidente Abugattás recibió a Parlamentario Británico (cropped).jpg|center|128px]]
| 1941-02-28
| 2020-03-23
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 61
| [[T. E. Lawrence]]
| [[File:Te lawrence.jpg|center|128px]]
| 1888-08-16
| 1935-05-19
| ''[[:d:Q2035368|Tremadog]]''
|-
| style='text-align:right'| 62
| ''[[:d:Q171421|Henry Morton Stanley]]''
| [[File:Henry Morton Stanley 1.jpg|center|128px]]
| 1841-01-28
| 1904-05-10
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 63
| ''[[:d:Q172273|Alan Rees]]''
|
| 1938-01-12
| 2024-09-06
| [[Newport]]
|-
| style='text-align:right'| 64
| ''[[:d:Q172835|Tom Pryce]]''
| [[File:Tom Pryce 1975 Watkins Glen.jpg|center|128px]]
| 1949-06-11
| 1977-03-05
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 65
| ''[[:d:Q173689|Shane Summers]]''
|
| 1936-06-23
| 1961-06-01
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 66
| ''[[:d:Q175294|Charles Robert Harington]]''
|
| 1897-08-01
| 1972-02-04
| ''[[:d:Q6661318|Llanerfyl]]''
|-
| style='text-align:right'| 67
| ''[[:d:Q176596|Clive Rowlands]]''
|
| 1938-05-14
| 2023-07-29
| ''[[:d:Q3008014|Cwm-twrch]]''
|-
| style='text-align:right'| 68
| ''[[:d:Q179374|Robert Owen]]''
| [[File:Robert Owen by William Henry Brooke.jpg|center|128px]]
| 1771-05-14
| 1858-11-17
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 69
| [[Tom Jones]]
| [[File:Sir Tom Jones at The Queen's Birthday Party (cropped).jpg|center|128px]]
| 1940-06-07
|
| [[Pontypridd]]
|-
| style='text-align:right'| 70
| ''[[:d:Q181363|Brian David Josephson]]''
| [[File:Brian Josephson, March 2004.jpg|center|128px]]
| 1940-01-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 71
| ''[[:d:Q181774|Ray Milland]]''
| [[File:Ray Milland by A. L. Whitey Schafer, 1947.jpg|center|128px]]
| 1907-01-03
| 1986-03-10
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 72
| [[Gareth Bale]]
| [[File:2022 FIFA World Cup United States 1–1 Wales - (32) (cropped).jpg|center|128px]]
| 1989-07-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 73
| ''[[:d:Q185188|John Conroy]]''
| [[File:Sir John Conroy, 1st Bt by Henry William Pickersgill.jpg|center|128px]]
| 1786-10-21
| 1854-03-02
| ''[[:d:Q3400184|Caerhun]]''
|-
| style='text-align:right'| 74
| [[Geoffrey o Monmouth]]
| [[File:Cotton Claudius B VII f.224 Merlin Vortigern.jpg|center|128px]]
| 1100
| 1155
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 75
| ''[[:d:Q190515|Craig Bellamy]]''
| [[File:Craig Bellamy 2014.jpg|center|128px]]
| 1979-07-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 76
| ''[[:d:Q191023|Dylan Thomas]]''
| [[File:Dylan Thomas, drinking a pint of beer in a pub in Wales.jpg|center|128px]]
| 1914-10-27
| 1953-11-09
| [[Swansea]]
|-
| style='text-align:right'| 77
| [[Duffy (sangster)|Duffy]]
| [[File:Duffy 2010 erdoedy.jpg|center|128px]]
| 1984-06-23
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 78
| ''[[:d:Q194621|Edith Austin]]''
|
| 1867-12-15
| 1953-07-27
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 79
| ''[[:d:Q202153|Gary Speed]]''
| [[File:Gary Speed 2011.jpg|center|128px]]
| 1969-09-08
| 2011-11-27
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 80
| ''[[:d:Q204537|Justin Kerrigan]]''
|
| 1974
|
| [[Cairdiff]]
|-
| style='text-align:right'| 81
| ''[[:d:Q210669|Ken Follett]]''
| [[File:Ken Follett official.jpg|center|128px]]
| 1949-06-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 82
| [[Aaron Ramsey]]
| [[File:Aaron Ramsey 2019.jpg|center|128px]]
| 1990-12-26
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 83
| ''[[:d:Q214513|Mark Hughes]]''
| [[File:1 mark hughes 2015.jpg|center|128px]]
| 1963-11-01
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 84
| ''[[:d:Q215017|Rhys Ifans]]''
| [[File:Rhys Ifans 2011 cropped.jpg|center|128px]]
| 1967-07-22
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 85
| ''[[:d:Q215502|Henry Morgan]]''
| [[File:Morgan,Henry.jpg|center|128px]]
| 1631-01-24
| 1688-08-25
| ''[[:d:Q1403122|Llanrumney]]''
|-
| style='text-align:right'| 86
| ''[[:d:Q216700|Roger Glover]]''
| [[File:Deep Purple - MN Gredos - 03.jpg|center|128px]]
| 1945-11-30
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 87
| ''[[:d:Q218245|Siwan Morris]]''
| [[File:SIWANMORRIS.jpg|center|128px]]
| 1976-02-07
|
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 88
| ''[[:d:Q219354|Ian Rush]]''
| [[File:Ian Rush in Singapore.jpg|center|128px]]
| 1961-10-20
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 89
| ''[[:d:Q219700|Andy Whitfield]]''
| [[File:Andy Whitfield by Gage Skidmore.jpg|center|128px]]
| 1971-10-17
| 2011-09-11
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 90
| ''[[:d:Q221870|Ernest Jones]]''
| [[File:Ernest Jones 1.jpg|center|128px]]
| 1879-01-01
| 1958-02-11
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 91
| ''[[:d:Q221876|Chris Bell]]''
|
| 1960
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 92
| ''[[:d:Q223235|Francis Lewis]]''
| [[File:Francis Lewis.jpg|center|128px]]
| 1713-03-21
| 1803-12-30<br/>1802-12-31
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 93
| ''[[:d:Q225604|Henry of Grosmont, 1st Duke of Lancaster]]''
| [[File:Portrait of Henry, Duke of Lancaster - William Bruges's Garter Book (c.1440-1450), f.8 - BL Stowe MS 594 (cropped).jpg|center|128px]]
| 1310
| 1361-03-23
| ''[[:d:Q731439|Grosmont]]''
|-
| style='text-align:right'| 94
| [[Mary Hopkin]]
| [[File:Mary Hopkin 1969.JPG|center|128px]]
| 1950-05-03
|
| [[Ystradgynlais]]<br/>''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 95
| ''[[:d:Q230996|Nicole Cooke]]''
| [[File:Nicole Cooke Geelong World Cup 2007 podium 1.jpg|center|128px]]
| 1983-04-13
|
| [[Swansea]]
|-
| style='text-align:right'| 96
| ''[[:d:Q231207|Charlotte Church]]''
| [[File:Charlotte Church by Law Keven.jpg|center|128px]]
| 1986-02-21
|
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 97
| ''[[:d:Q234171|Princess Lilian, Duchess of Halland]]''
| [[File:Lilian of Sweden 1940s as Mrs. Craig.jpg|center|128px]]
| 1915-08-30
| 2013-03-10
| [[Swansea]]
|-
| style='text-align:right'| 98
| ''[[:d:Q234174|Marina and the Diamonds]]''
| [[File:Marina Diamandis @ YouTube Theater 03 09 2022 (52297979794).jpg|center|128px]]
| 1985-10-10
|
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 99
| ''[[:d:Q234746|Sarah Siddons]]''
| [[File:Sarah Siddons (1755-1831).jpg|center|128px]]
| 1755-07-05
| 1831-06-08
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 100
| ''[[:d:Q234754|Shirley Bassey]]''
| [[File:Shirley Bassey (1971).jpg|center|128px]]
| 1937-01-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 101
| ''[[:d:Q236309|Dawn French]]''
| [[File:Dawn French 4.jpg|center|128px]]
| 1957-10-11
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 102
| ''[[:d:Q237182|Jem]]''
| [[File:Jem Walking 2005.jpg|center|128px]]
| 1975-05-18<br/>1975-06-18
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 103
| ''[[:d:Q237555|Sarah Waters]]''
| [[File:Sarah Waters.jpg|center|128px]]
| 1966-07-21
|
| ''[[:d:Q1939963|Neyland]]''
|-
| style='text-align:right'| 104
| ''[[:d:Q237778|Siân Phillips]]''
| [[File:Siân Phillips in "Crossing Borders".jpg|center|128px]]
| 1933-05-14
|
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 105
| ''[[:d:Q246379|Mark Delaney]]''
| [[File:Delaney, Mark.jpg|center|128px]]
| 1976-05-13
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 106
| ''[[:d:Q248414|Gary Jones]]''
| [[File:Gary Jones stargate cropped.jpg|center|128px]]
| 1958-01-04
|
| [[Swansea]]
|-
| style='text-align:right'| 107
| ''[[:d:Q251038|Peter George]]''
|
| 1924-03-24<br/>1924-03-26
| 1966-06-01
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 108
| ''[[:d:Q251436|Michael White]]''
|
| 1987-01-08
|
| [[Wales]]
|-
| style='text-align:right'| 109
| ''[[:d:Q253495|Shefali Chowdhury]]''
| [[File:Shefali Chowdhury.jpg|center|128px]]
| 1988-06-20
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 110
| ''[[:d:Q253813|Victor Spinetti]]''
| [[File:6702 Victor Spinetti.jpg|center|128px]]
| 1929-09-02
| 2012-06-18
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 111
| ''[[:d:Q254781|Margaret Price]]''
|
| 1941-04-13
| 2011-01-28
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 112
| ''[[:d:Q254828|Rachel Roberts]]''
| [[File:Rachel Roberts.JPG|center|128px]]
| 1927-09-20
| 1980-11-26
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 113
| ''[[:d:Q254876|Eve Myles]]''
| [[File:Eve Myles 2013.jpg|center|128px]]
| 1978-07-26
|
| [[Ystradgynlais]]
|-
| style='text-align:right'| 114
| ''[[:d:Q257113|Barry Flanagan]]''
| [[File:NeudeBunny.jpg|center|128px]]
| 1941-01-11
| 2009-08-31
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 115
| ''[[:d:Q258600|Barbara Margaret Trimble]]''
|
| 1915-02-21
| 1995
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 116
| ''[[:d:Q259185|Peg Entwistle]]''
| [[File:23Zeruk Green-from sitebuilder 1.jpg|center|128px]]
| 1908-02-05
| 1932-09-16<br/>1932-09-18
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 117
| ''[[:d:Q259707|Stuart Andrew]]''
| [[File:Official portrait of Stuart Andrew crop 2, 2021.jpg|center|128px]]
| 1971-11-25
|
| [[Anglesey]]
|-
| style='text-align:right'| 118
| ''[[:d:Q259988|John Disley]]''
|
| 1928-11-20
| 2016-02-08
| [[Gwynedd]]
|-
| style='text-align:right'| 119
| ''[[:d:Q260670|Dion Fortune]]''
|
| 1890-12-06
| 1946-01-08
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 120
| ''[[:d:Q260772|Guto Bebb]]''
| [[File:Official portrait of Guto Bebb crop 2.jpg|center|128px]]
| 1968-10-09
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 121
| ''[[:d:Q261477|Gareth Llewellyn]]''
|
| 1969-02-27
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 122
| ''[[:d:Q261571|Gwyneth Jones]]''
| [[File:Gwyneth Jones.JPG|center|128px]]
| 1936-11-07
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 123
| ''[[:d:Q262177|Colin Pascoe]]''
| [[File:Colin Pascoe.jpg|center|128px]]
| 1965-04-09
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 124
| ''[[:d:Q262827|Thomas Lewis]]''
| [[File:Thomas Lewis (cardiologist).jpg|center|128px]]
| 1881-12-26
| 1945-03-17
| ''[[:d:Q1401784|Ffynnon Taf]]''
|-
| style='text-align:right'| 125
| [[Robert Walter]]
| [[File:Robert Walter, president European security and Defence Assembly. Session 2009.jpg|center|128px]]
| 1948-05-30
|
| [[Swansea]]
|-
| style='text-align:right'| 126
| ''[[:d:Q264107|Isaac Daniel Hooson]]''
| [[File:I. D. Hooson.jpg|center|128px]]
| 1880-09-02
| 1948-10-18
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 127
| ''[[:d:Q264964|Kevin Brennan]]''
| [[File:Official portrait of Kevin Brennan crop 2.jpg|center|128px]]
| 1959-10-16
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 128
| ''[[:d:Q266062|Gareth John Williams]]''
|
| 1979-12-19
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 129
| ''[[:d:Q266146|Chris Bryant]]''
| [[File:Chris Bryant MP July 2024 Official portrait 2 (cropped).jpg|center|128px]]
| 1962-01-11<br/>1962-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 130
| [[Hywel Williams]]
| [[File:Official portrait of Hywel Williams crop 2.jpg|center|128px]]
| 1953-05-14
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 131
| ''[[:d:Q266434|Roger Williams]]''
| [[File:Roger Williams.jpg|center|128px]]
| 1948-01-22
|
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 132
| ''[[:d:Q266548|Stephen Williams]]''
| [[File:Stephen Williams MP.jpg|center|128px]]
| 1966-10-11
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 133
| [[Alun Cairns]]
| [[File:Official portrait of Rt Hon Alun Cairns MP crop 2.jpg|center|128px]]
| 1970-07-30
|
| [[Swansea]]
|-
| style='text-align:right'| 134
| ''[[:d:Q268875|Herbert Bowden, Baron Aylestone]]''
|
| 1905-01-20
| 1994-04-30
| [[Cairdiff]]
|-
| style='text-align:right'| 135
| ''[[:d:Q269853|Robert Buckland]]''
| [[File:Official portrait of Rt Hon Robert Buckland MP crop 2.jpg|center|128px]]
| 1968-09-22
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 136
| ''[[:d:Q272522|Jill Evans]]''
| [[File:Evans, Jill-1665.jpg|center|128px]]
| 1959-05-08
|
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 137
| ''[[:d:Q272539|Lucy Walter]]''
| [[File:Sir Peter Lely - Lucy Walter.jpg|center|128px]]
| 1630
| 1658-09
| ''[[:d:Q7353760|Roch Castle]]''
|-
| style='text-align:right'| 138
| ''[[:d:Q272570|Jade Jones]]''
| [[File:Jade Jones.jpg|center|128px]]
| 1993-03-21
|
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 139
| ''[[:d:Q272575|Ethel Lina White]]''
|
| 1876
| 1944-08-13
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 140
| ''[[:d:Q272578|Donna Lewis]]''
| [[File:Donna Lewis (cropped).jpg|center|128px]]
| 1959-08-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 141
| ''[[:d:Q272581|Katherine Jenkins]]''
| [[File:Katherine Jenkins in 2022 (cropped).jpg|center|128px]]
| 1980-06-29
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 142
| ''[[:d:Q272592|Aimee-Ffion Edwards]]''
|
| 1987-11-21
|
| [[Newport]]
|-
| style='text-align:right'| 143
| ''[[:d:Q274339|Gwen John]]''
| [[File:Gwen John - Self-portrait (1900).jpg|center|128px]]
| 1876-06-22
| 1939-09-18
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 144
| ''[[:d:Q275421|Emma]]''
| [[File:Emma Booth (8182107944).jpg|center|128px]]
| 1974-08-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 145
| ''[[:d:Q278125|Thomas Mathews]]''
| [[File:Admiral Thomas Mathews.jpg|center|128px]]
| 1676-10
| 1751-10-02
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 146
| ''[[:d:Q278385|Evan Roberts]]''
| [[File:Evan John Roberts.jpg|center|128px]]
| 1878-06-08
| 1951-09-29
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 147
| ''[[:d:Q282493|Edmund Mortimer, 3rd Earl of March]]''
|
| 1352-02-01
| 1381-12-27
| [[Wales]]
|-
| style='text-align:right'| 148
| ''[[:d:Q285249|Ann Clwyd]]''
| [[File:Official portrait of Ann Clwyd crop 2.jpg|center|128px]]
| 1937-03-21
| 2023-07-21
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 149
| ''[[:d:Q285258|Ron Waldron]]''
|
| 1933-12-14
|
| [[Wales]]
|-
| style='text-align:right'| 150
| ''[[:d:Q287292|Andrew Selby]]''
|
| 1988-12-25
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 151
| ''[[:d:Q287791|Gary Owen]]''
|
| 1929
| 1995
| ''[[:d:Q7852544|Tumble]]''
|-
| style='text-align:right'| 152
| ''[[:d:Q289332|George Travers]]''
| [[File:George Twyber Travers.jpg|center|128px]]
| 1877-06-09
| 1945-12-26
| [[Newport]]
|-
| style='text-align:right'| 153
| ''[[:d:Q289342|Sylvia Sleigh]]''
|
| 1916-05-08
| 2010-10-24
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 154
| ''[[:d:Q290367|John Owen]]''
| [[File:Bp John Owen NPG.jpg|center|128px]]
| 1854-08-24
| 1926-11-04
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 155
| ''[[:d:Q291300|Cerys Matthews]]''
| [[File:Cerys Matthews Glastonbury 2008 (cropped).jpg|center|128px]]
| 1969-04-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 156
| ''[[:d:Q291322|Hester Thrale]]''
| [[File:Hester Thrale (cropped).jpg|center|128px]]
| 1741-01-27<br/>1741-01-16
| 1821-05-02
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 157
| ''[[:d:Q291686|Lindy Hemming]]''
|
| 1948-08-21
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 158
| ''[[:d:Q295974|Ioan Gruffudd]]''
| [[File:Ioan Gruffudd at the 2011 Comic-Con International.jpg|center|128px]]
| 1973-10-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 159
| ''[[:d:Q296716|Wayne David]]''
| [[File:Official portrait of Wayne David MP crop 2.jpg|center|128px]]
| 1957-07-01
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 160
| ''[[:d:Q296920|Glyn Davies]]''
| [[File:Glyn Davies (Welsh Politician) profile photo.jpg|center|128px]]
| 1944-02-16
|
| [[Welshpool]]
|-
| style='text-align:right'| 161
| ''[[:d:Q298276|Michael Sheen]]''
| [[File:Michael Sheen crop n2 Good Omens panel at NYCC (61104).jpg|center|128px]]
| 1969-02-05
|
| [[Newport]]
|-
| style='text-align:right'| 162
| ''[[:d:Q302892|Jonathan Edwards]]''
| [[File:Official portrait of Jonathan Edwards crop 2.jpg|center|128px]]
| 1976-04-26
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 163
| ''[[:d:Q303577|Chris Evans]]''
| [[File:Official portrait of Chris Evans crop 2.jpg|center|128px]]
| 1977-07-07
|
| [[Llwynypia]]
|-
| style='text-align:right'| 164
| ''[[:d:Q303716|Jonathan Evans]]''
| [[File:Evans, Jonathan (crop).jpg|center|128px]]
| 1950-06-02
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 165
| ''[[:d:Q303814|Nigel Evans]]''
| [[File:Official portrait of Mr Nigel Evans crop 2.jpg|center|128px]]
| 1957-11-10
|
| [[Swansea]]
|-
| style='text-align:right'| 166
| ''[[:d:Q310733|Simon Davies]]''
| [[File:Simon Davies Wales October 2006.jpg|center|128px]]
| 1979-10-23
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 167
| ''[[:d:Q310934|Hugh Griffith]]''
| [[File:Hugh griffith publicity photo.jpg|center|128px]]
| 1912-05-30
| 1980-05-14
| ''[[:d:Q6761826|Marian-glas]]''
|-
| style='text-align:right'| 168
| ''[[:d:Q311300|Colin Jackson]]''
| [[File:Athletissima 2012 - Colin Jackson (cropped).jpg|center|128px]]
| 1967-02-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 169
| ''[[:d:Q312067|Danny Gabbidon]]''
| [[File:Danny Gabbidon 1.png|center|128px]]
| 1979-08-08
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 170
| [[John Charles]]
| [[File:John Charles, Wales versus Scotland, Ninian Park, 1954.jpg|center|128px]]
| 1931-12-27
| 2004-02-21
| ''[[:d:Q5197236|Cwmbwrla]]''
|-
| style='text-align:right'| 171
| ''[[:d:Q312575|Clive Granger]]''
| [[File:Clive Granger by Olaf Storbeck.jpg|center|128px]]
| 1934-09-04
| 2009-05-27
| [[Swansea]]
|-
| style='text-align:right'| 172
| ''[[:d:Q312702|Jonathan Pryce]]''
| [[File:JonathanPryce2007 cropped.jpg|center|128px]]
| 1947-06-01
|
| ''[[:d:Q5043241|Carmel]]''
|-
| style='text-align:right'| 173
| ''[[:d:Q313250|Joe Allen]]''
| [[File:AUT vs. WAL 2016-10-06 (135).jpg|center|128px]]
| 1990-03-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 174
| ''[[:d:Q313430|Bartholomew Roberts]]''
| [[File:Bartholomew Roberts.png|center|128px]]
| 1682-05-17
| 1722-02-10
| ''[[:d:Q13126879|Little Newcastle]]''
|-
| style='text-align:right'| 175
| ''[[:d:Q314920|Mason Ryan]]''
| [[File:Mason Ryan Cropped.png|center|128px]]
| 1982-01-13
|
| ''[[:d:Q2035368|Tremadog]]''
|-
| style='text-align:right'| 176
| ''[[:d:Q314929|Dick Francis]]''
|
| 1920-10-31
| 2010-02-14
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 177
| ''[[:d:Q316155|John Holloway]]''
|
| 1948-07-19
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 178
| ''[[:d:Q317258|Neil Kinnock]]''
| [[File:Start campagne voor Europese verkiezingen van PvdA (Rotterdam) Neal Kinnoch , k, Bestanddeelnr 932-9811.jpg|center|128px]]
| 1942-03-28
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 179
| [[Mark Williams]]
| [[File:Mark Williams at Snooker German Masters (Martin Rulsch) 2014-01-30 05.jpg|center|128px]]
| 1975-03-21
|
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 180
| ''[[:d:Q317279|Owain Glyndŵr]]''
| [[File:Owain Glyndŵr at Cardiff City Hall.jpg|center|128px]]
| 1359
| 1415
| ''[[:d:Q2369922|Dolwyddelan Castle]]''
|-
| style='text-align:right'| 181
| ''[[:d:Q317887|George Herbert]]''
| [[File:George Herbert.jpg|center|128px]]
| 1593-04-03
| 1633-03-01
| ''[[:d:Q1311946|Trefaldwyn]]''
|-
| style='text-align:right'| 182
| ''[[:d:Q318192|Robert Recorde]]''
| [[File:Robert Recorde (uncropped).jpg|center|128px]]
| 1510
| 1558
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 183
| ''[[:d:Q321465|Thomas Barker]]''
| [[File:Thomas Barker, Barker of Bath - Self Portrait.jpeg|center|128px]]
| 1769
| 1847-12-11
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 184
| ''[[:d:Q322031|John Weathers]]''
| [[File:John Weathers.jpg|center|128px]]
| 1947-02-07
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 185
| ''[[:d:Q322211|Bryn Terfel]]''
| [[File:Bryn Terfel in Stockholm 2013-22.jpg|center|128px]]
| 1965-11-09
|
| ''[[:d:Q7131619|Pant Glas]]''
|-
| style='text-align:right'| 186
| ''[[:d:Q322303|Kim Simmonds]]''
| [[File:Kim Simmonds 2002 (cropped).jpg|center|128px]]
| 1947-12-05<br/>1947-12-06
| 2022-12-13
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 187
| ''[[:d:Q323488|Roy Jenkins]]''
| [[File:Roy Jenkins 1977 (cropped).jpg|center|128px]]
| 1920-11-11
| 2003-01-05
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 188
| ''[[:d:Q325381|Michael Howard]]''
| [[File:Official portrait of Lord Howard of Lympne crop 2, 2023.jpg|center|128px]]
| 1941-07-07
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 189
| ''[[:d:Q325403|Aneurin Bevan]]''
| [[File:Aneurin Bevan (1943).jpg|center|128px]]
| 1897-11-15
| 1960-07-06
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 190
| ''[[:d:Q325417|Gareth Williams]]''
|
| 1941-02-05
| 2003-09-20
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 191
| ''[[:d:Q325437|Vernon Watkins]]''
|
| 1906-06-27
| 1967-10-08
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 192
| ''[[:d:Q325881|Hugh Llewellyn Glyn Hughes]]''
| [[File:Hugh Llewellyn Glyn Hughes 1945.jpg|center|128px]]
| 1892-07-25
| 1973-11-24
| [[Swansea]]
|-
| style='text-align:right'| 193
| ''[[:d:Q327187|Mark Pembridge]]''
|
| 1970-11-29
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 194
| ''[[:d:Q327410|John Graham Chambers]]''
|
| 1843-02-12
| 1883-03-04
| ''[[:d:Q6661303|Plas Llanelli]]''
|-
| style='text-align:right'| 195
| ''[[:d:Q328225|John Hughes]]''
| [[File:1894. Portrait of John Hughes, founder of Hughesovka (cropped).jpg|center|128px]]
| 1814
| 1889-06-17
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 196
| ''[[:d:Q328421|Ricky Valance]]''
|
| 1936-04-10
| 2020-06-12
| ''[[:d:Q8054074|Ynysddu]]''
|-
| style='text-align:right'| 197
| ''[[:d:Q329017|Richard Roberts]]''
| [[File:Roberts Richard from Roe 1916.png|center|128px]]
| 1789-04-22
| 1864-03-11
| ''[[:d:Q3397480|Llanymynech]]''
|-
| style='text-align:right'| 198
| [[Saunt Dauvit]]
| [[File:Eglwys Dewi Sant - St David's Church, Blaenporth, Ceredigion, Wales 20.jpg|center|128px]]
| 512
| 589
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 199
| ''[[:d:Q332314|Michael Heseltine]]''
| [[File:Lord Heseltine, Deputy Prime Minister, UK (1995-97) (10559130986).jpg|center|128px]]
| 1933-03-21
|
| [[Swansea]]
|-
| style='text-align:right'| 200
| ''[[:d:Q332323|Geoffrey Howe]]''
| [[File:Geoffrey Howe (cropped).jpg|center|128px]]
| 1926-12-20
| 2015-10-09
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 201
| ''[[:d:Q332393|John Prescott]]''
| [[File:John Prescott official portrait (cropped).jpg|center|128px]]
| 1938-05-31
| 2024-11-20
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 202
| ''[[:d:Q332759|Francis Pym, Baron Pym]]''
| [[File:Francis Pym (cropped).jpg|center|128px]]
| 1922-02-13
| 2008-03-07
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 203
| ''[[:d:Q332851|Frederick Elwyn Jones, Baron Elwyn-Jones]]''
| [[File:Elwyn Jones in Romania (cropped).jpg|center|128px]]
| 1909-10-24
| 1989-12-04
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 204
| ''[[:d:Q333132|Gwynfor Evans]]''
| [[File:Gwynfor Evans.jpg|center|128px]]
| 1912-09-01
| 2005-04-21
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 205
| [[Rhodri Morgan]]
| [[File:Cropped image of Rhodri Morgan at The Celebration of the Mace 5840623762 b47ba98d73 o.jpg|center|128px]]
| 1939-09-29
| 2017-05-17
| [[Cairdiff]]
|-
| style='text-align:right'| 206
| ''[[:d:Q333168|Karl Jenkins]]''
| [[File:Karl Jenkins - St David Awards 2017.png|center|128px]]
| 1944-02-17
|
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 207
| ''[[:d:Q333309|Ivor Richard, Baron Richard]]''
|
| 1932-05-30
| 2018-03-18
| [[Cairdiff]]
|-
| style='text-align:right'| 208
| ''[[:d:Q333390|Kenneth Baker, Baron Baker of Dorking]]''
| [[File:Official portrait of Lord Baker of Dorking 2020 crop 2.jpg|center|128px]]
| 1934-11-03
|
| [[Newport]]
|-
| style='text-align:right'| 209
| ''[[:d:Q333437|Gordon Macdonald, 1st Baron Macdonald of Gwaenysgor]]''
| [[File:Lord Macdonald.jpg|center|128px]]
| 1888-05-27
| 1966-01-20
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 210
| [[Elfyn Llwyd]]
| [[File:Elfyn Llwyd MP.jpg|center|128px]]
| 1951-09-26
|
| ''[[:d:Q203387|Betws-y-Coed]]''
|-
| style='text-align:right'| 211
| ''[[:d:Q333616|Peter Thomas, Baron Thomas of Gwydir]]''
|
| 1920-07-31
| 2008-02-04
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 212
| ''[[:d:Q333639|Emlyn Hooson, Baron Hooson]]''
|
| 1925-03-26
| 2012-02-21
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 213
| ''[[:d:Q333652|Cledwyn Hughes, Baron Cledwyn of Penrhos]]''
|
| 1916-09-14
| 2001-02-22
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 214
| ''[[:d:Q333823|Gwilym Lloyd George, 1st Viscount Tenby]]''
| [[File:Lieutenant Gwilym Lloyd George.jpg|center|128px]]
| 1894-12-04
| 1967-02-14
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 215
| ''[[:d:Q333828|Paul Murphy]]''
| [[File:Official portrait of Lord Murphy of Torfaen 2020 crop 2.jpg|center|128px]]
| 1948-11-25
|
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 216
| ''[[:d:Q333834|Jim Griffiths]]''
|
| 1890-09-19
| 1975-08-07
| ''[[:d:Q850566|Betws]]''
|-
| style='text-align:right'| 217
| ''[[:d:Q333841|Dafydd Elis-Thomas]]''
| [[File:Official portrait of Lord Elis-Thomas crop 2.jpg|center|128px]]
| 1946-10-18
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 218
| ''[[:d:Q333852|Cheryl Gillan]]''
| [[File:Official portrait of Rt Hon Dame Cheryl Gillan MP crop 2.jpg|center|128px]]
| 1952-04-21
| 2021-04-04
| [[Cairdiff]]
|-
| style='text-align:right'| 219
| ''[[:d:Q333863|David Alfred Thomas, 1st Viscount Rhondda]]''
| [[File:David Alfred Thomas, 1st Viscount Rhondda.jpeg|center|128px]]
| 1856-03-26
| 1918-07-03
| ''[[:d:Q8059773|Ysguborwen]]''
|-
| style='text-align:right'| 220
| ''[[:d:Q333869|Ron Davies]]''
| [[File:Rondavies1998.jpg|center|128px]]
| 1946-08-06
|
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 221
| ''[[:d:Q333876|Leo Abse]]''
|
| 1917-04-22
| 2008-08-19
| [[Cairdiff]]
|-
| style='text-align:right'| 222
| ''[[:d:Q333882|Richard Livsey, Baron Livsey of Talgarth]]''
| [[File:Richard Livsey.jpg|center|128px]]
| 1935-05-02
| 2010-09-16<br/>2010-09-15
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 223
| ''[[:d:Q333919|George Thomas, 1st Viscount Tonypandy]]''
|
| 1909-01-29
| 1997-09-22
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 224
| ''[[:d:Q333924|Elystan Morgan, Baron Elystan-Morgan]]''
|
| 1932-12-07
| 2021-07-07
| [[Ceredigion]]
|-
| style='text-align:right'| 225
| ''[[:d:Q333932|John Morris, Baron Morris of Aberavon]]''
| [[File:Official portrait of Lord Morris of Aberavon crop 2.jpg|center|128px]]
| 1931-11-05
| 2023-06-05
| ''[[:d:Q3404518|Capel Bangor]]''
|-
| style='text-align:right'| 226
| ''[[:d:Q334278|Don Touhig]]''
| [[File:Official portrait of Lord Touhig crop 2, 2022.jpg|center|128px]]
| 1947-12-05
|
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 227
| ''[[:d:Q334411|Donald Anderson, Baron Anderson of Swansea]]''
| [[File:Official portrait of Lord Anderson of Swansea crop 2.jpg|center|128px]]
| 1939-06-17
|
| [[Swansea]]
|-
| style='text-align:right'| 228
| ''[[:d:Q334541|Tony Pulis]]''
| [[File:Tony pulis 2014.jpg|center|128px]]
| 1958-01-16
|
| [[Newport]]
|-
| style='text-align:right'| 229
| ''[[:d:Q334627|Wyn Roberts, Baron Roberts of Conwy]]''
|
| 1930-07-10
| 2013-12-14<br/>2013-12-13
| ''[[:d:Q13644942|Llansadwrn]]''
|-
| style='text-align:right'| 230
| ''[[:d:Q335550|Henry Bruce, 1st Baron Aberdare]]''
| [[File:1stLordAberdare.jpg|center|128px]]
| 1815-04-16
| 1895-02-25
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 231
| ''[[:d:Q335773|Francis Grenfell, 1st Baron Grenfell]]''
| [[File:Francis Wallace Grenfell.jpg|center|128px]]
| 1841-04-29
| 1925-01-27
| [[Swansea]]
|-
| style='text-align:right'| 232
| ''[[:d:Q336459|Geoffrey Lawrence, 1st Baron Oaksey]]''
| [[File:Lord-justice-lawrence-at-nuremberg-72-867.jpg|center|128px]]
| 1880-12-02
| 1971-08-28
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 233
| ''[[:d:Q336521|Eluned Morgan, Baroness Morgan of Ely]]''
| [[File:Eluned Morgan AM (28136582086) (cropped).jpg|center|128px]]
| 1967-02-16
|
| ''[[:d:Q5368392|Trelái]]''
|-
| style='text-align:right'| 234
| ''[[:d:Q336526|Mike German, Baron German]]''
| [[File:Lord German.jpg|center|128px]]
| 1945-05-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 235
| ''[[:d:Q336534|Merlyn Rees]]''
| [[File:Merlyn Rees appearing on "After Dark", 16 July 1988.jpg|center|128px]]
| 1920-12-18
| 2006-01-05
| [[Pontypridd]]
|-
| style='text-align:right'| 236
| ''[[:d:Q336543|Tanni Grey-Thompson]]''
| [[File:Baroness Grey-Thompson.jpg|center|128px]]
| 1969-07-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 237
| ''[[:d:Q336556|George Jeffreys]]''
| [[File:George, 1st Baron Jeffreys of Wem, by John Riley.jpg|center|128px]]
| 1645-05-15
| 1689-04-18
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 238
| ''[[:d:Q336837|Alun Gwynne Jones, Baron Chalfont]]''
| [[File:Bundesarchiv B 145 Bild-F021984-0013, Auswärtiges Amt, Staatsminister Großbritannien.jpg|center|128px]]
| 1919-12-05
| 2020-01-10
| [[Sooth Wales]]
|-
| style='text-align:right'| 239
| ''[[:d:Q337590|Alan Williams]]''
|
| 1930-10-14
| 2014-12-21
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 240
| ''[[:d:Q337822|Vernon Hartshorn]]''
| [[File:Vernon Hartshorn MP.jpg|center|128px]]
| 1872
| 1931-03-13
| [[Crosskeys]]
|-
| style='text-align:right'| 241
| ''[[:d:Q338044|Denzil Davies]]''
|
| 1938-10-09
| 2018-10-10
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 242
| ''[[:d:Q338294|James Henry Thomas]]''
| [[File:James Henry Thomas (1874-1949) portrait.jpg|center|128px]]
| 1874-10-03
| 1949-01-21
| [[Newport]]
|-
| style='text-align:right'| 243
| ''[[:d:Q339786|Chico Slimani]]''
| [[File:Chico Slimani May 07.JPG|center|128px]]
| 1971-04-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 244
| ''[[:d:Q342784|Matthew Rhys]]''
| [[File:Matthew Rhys.jpg|center|128px]]
| 1974-11-08<br/>1974
|
| [[Cairdiff]]
|-
| style='text-align:right'| 245
| ''[[:d:Q342989|John Toshack]]''
| [[File:John Toshack 2011.jpg|center|128px]]
| 1949-03-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 246
| ''[[:d:Q346480|Dave Evans]]''
| [[File:Dave Evans.jpg|center|128px]]
| 1953-07-20
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 247
| ''[[:d:Q346518|Bernard Warburton-Lee]]''
| [[File:VCBernardArmitageWarburtonWarburton-Lee.jpg|center|128px]]
| 1895-09-13
| 1940-04-10
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 248
| ''[[:d:Q348704|Chris Slade]]''
| [[File:Chris Slade.JPG|center|128px]]
| 1946-10-30
|
| [[Pontypridd]]
|-
| style='text-align:right'| 249
| ''[[:d:Q348948|John Evans]]''
| [[File:Map of Missouri River and Vicinity.jpg|center|128px]]
| 1770-04-14
| 1799-05
| ''[[:d:Q428829|Caernarfon]]''<br/>''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 250
| ''[[:d:Q350383|Adam Matthews]]''
| [[File:Adam Matthews.jpg|center|128px]]
| 1992-01-13
|
| [[Swansea]]
|-
| style='text-align:right'| 251
| ''[[:d:Q350686|Adam Rhys Jones]]''
| [[File:Adam Jones (rugby player).jpg|center|128px]]
| 1981-03-08
|
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 252
| ''[[:d:Q350799|Robbie Savage]]''
| [[File:RobbieSavage01.JPG|center|128px]]
| 1974-10-18
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 253
| ''[[:d:Q351606|Walley Barnes]]''
|
| 1920-01-16
| 1975-09-04
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 254
| ''[[:d:Q351615|Dan Lewis]]''
|
| 1902-12-11
| 1965
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 255
| ''[[:d:Q353388|Andy Bell]]''
| [[File:Andy Bell.jpg|center|128px]]
| 1970-08-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 256
| ''[[:d:Q355049|Owain Yeoman]]''
|
| 1978-07-02
|
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 257
| ''[[:d:Q356091|Max Boyce]]''
|
| 1943-09-27
|
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 258
| ''[[:d:Q356108|Rhodri Meilir]]''
| [[File:Rhodri Meilir 2013.jpg|center|128px]]
| 1978-11-18
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 259
| ''[[:d:Q356327|Geraint Thomas]]''
| [[File:Geraint Thomas 2019.jpg|center|128px]]
| 1986-05-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 260
| ''[[:d:Q356392|John Hartson]]''
| [[File:Hartson, John.jpg|center|128px]]
| 1975-04-05
|
| [[Swansea]]
|-
| style='text-align:right'| 261
| ''[[:d:Q357824|Gerald of Wales]]''
| [[File:St.David's Cathedral - Dreieinigkeitskapelle 5 Giraldus Cambrensis.jpg|center|128px]]
| 1146
| 1220s
| ''[[:d:Q1508342|Manorbier Castle]]''
|-
| style='text-align:right'| 262
| ''[[:d:Q357835|Taliesin]]''
| [[File:Finding of Taliesin.jpg|center|128px]]
| 534<br/>518
| 599
| [[Powys]]
|-
| style='text-align:right'| 263
| ''[[:d:Q360522|Johnny Owen]]''
| [[File:Johnny Owen Merthyr Boxer by Aberdare Blog.jpg|center|128px]]
| 1956-01-07
| 1980-11-04
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 264
| ''[[:d:Q361128|Owen Tudor]]''
|
| 1400
| 1461-02-02
| [[Wales]]
|-
| style='text-align:right'| 265
| ''[[:d:Q361465|Gerran Howell]]''
|
| 1991-02-25
|
| [[Wales]]
|-
| style='text-align:right'| 266
| ''[[:d:Q361536|Owen Teale]]''
| [[File:Owen Teale 2.jpg|center|128px]]
| 1961-05-20
|
| [[Swansea]]
|-
| style='text-align:right'| 267
| ''[[:d:Q361981|Russell T Davies]]''
| [[File:Russell T. Davies (cropped).jpg|center|128px]]
| 1963-04-27
|
| [[Swansea]]
|-
| style='text-align:right'| 268
| ''[[:d:Q363711|John Penry]]''
|
| 1563
| 1593-05-29
| ''[[:d:Q17740348|Cefn Brith]]''
|-
| style='text-align:right'| 269
| ''[[:d:Q366078|David Edward Hughes]]''
| [[File:David Edward Hughes.jpg|center|128px]]
| 1831-05-16
| 1900-01-22
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 270
| ''[[:d:Q366807|Phil Campbell]]''
| [[File:Motorhead-johngullo-photograph-sofajockey-com.jpg|center|128px]]
| 1961-05-07
|
| [[Pontypridd]]
|-
| style='text-align:right'| 271
| ''[[:d:Q367554|John Gwilliam]]''
|
| 1923-02-28
| 2016-12-21
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 272
| ''[[:d:Q369985|Valentine Baker]]''
| [[File:Valentine Henry Baker.jpg|center|128px]]
| 1888-08-24
| 1942-09-12
| ''[[:d:Q787395|Llanfairfechan]]''
|-
| style='text-align:right'| 273
| ''[[:d:Q370527|Joe Ledley]]''
| [[File:AUT vs. WAL 2016-10-06 (172).jpg|center|128px]]
| 1987-01-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 274
| ''[[:d:Q371877|William Jones]]''
| [[File:William Jones, the Mathematician.jpg|center|128px]]
| 1675
| 1749-07-01
| ''[[:d:Q13129642|Llanfihangel Tre'r Beirdd]]''
|-
| style='text-align:right'| 275
| ''[[:d:Q373061|Adrian Goldsworthy]]''
| [[File:Adrian Goldsworthy-2 (cropped).jpg|center|128px]]
| 1969
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 276
| ''[[:d:Q377361|Fanny Parkes]]''
|
| 1794-12-08
| 1875-12-21
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 277
| ''[[:d:Q377872|Ivor Powell]]''
|
| 1916-07-05
| 2012-11-06
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 278
| ''[[:d:Q378678|Sophie Dee]]''
| [[File:Sophie Dee AEE 2013.jpg|center|128px]]
| 1984-01-17
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 279
| ''[[:d:Q380859|Rob Partridge]]''
| [[File:Robert Partridge.jpg|center|128px]]
| 1985-09-11
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 280
| ''[[:d:Q380860|Derek Tapscott]]''
|
| 1932-06-30
| 2008-06-12
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 281
| ''[[:d:Q380869|Alastair Reynolds]]''
| [[File:Alastair Reynolds.jpg|center|128px]]
| 1966-03-13
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 282
| ''[[:d:Q380912|Neil Aspinall]]''
|
| 1941-10-13
| 2008-03-24
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 283
| ''[[:d:Q381649|Gareth Cooper]]''
|
| 1979-05-07
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 284
| ''[[:d:Q381664|Vincent Regan]]''
| [[File:Stuttgart 2023 -Comic Con Germany- Vincent Regan- by-RaBoe 023.jpg|center|128px]]
| 1965-05-16
|
| [[Swansea]]
|-
| style='text-align:right'| 285
| ''[[:d:Q381769|Chris Coleman]]''
| [[File:AUT vs. WAL 2016-10-06 (097).jpg|center|128px]]
| 1970-06-10
|
| [[Swansea]]
|-
| style='text-align:right'| 286
| ''[[:d:Q382676|John Greaves]]''
| [[File:John Greaves (musician).jpg|center|128px]]
| 1950-01-23
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 287
| ''[[:d:Q382731|John Warlow]]''
|
| 1939-02-13
|
| [[Wales]]
|-
| style='text-align:right'| 288
| ''[[:d:Q385839|Clive Sullivan]]''
|
| 1943-04-09
| 1985-10-08
| [[Cairdiff]]
|-
| style='text-align:right'| 289
| ''[[:d:Q386316|David Williams]]''
| [[File:David Williams historian Screenshot 2024-03-05-14-51-53-91 965bbf4d18d205f782c6b8409c5773a4.jpg|center|128px]]
| 1900-02-09
| 1978-02-24
| ''[[:d:Q20594376|Llanycefn]]''
|-
| style='text-align:right'| 290
| ''[[:d:Q387265|Vic Crowe]]''
|
| 1932-01-31
| 2009-01-21
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 291
| ''[[:d:Q390440|Jacut]]''
| [[File:St-jacut.jpg|center|128px]]
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 292
| ''[[:d:Q390611|Paul Flynn]]''
|
| 1935-02-09
| 2019-02-17
| [[Cairdiff]]
|-
| style='text-align:right'| 293
| ''[[:d:Q390760|Nick Smith]]''
| [[File:Official portrait of Nick Smith MP crop 2, 2024.jpg|center|128px]]
| 1960-01-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 294
| ''[[:d:Q390825|Hywel Francis]]''
|
| 1946-06-06
| 2021-02-14
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 295
| [[Damian Green]]
| [[File:Official portrait of Damian Green crop 2.jpg|center|128px]]
| 1956-01-17
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 296
| ''[[:d:Q393069|Dai Llewellyn]]''
|
| 1946-04-02
| 2009-01-13
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 297
| ''[[:d:Q394628|Raymond Williams]]''
| [[File:Raymond Williams At Saffron Walden.jpg|center|128px]]
| 1921-08-31
| 1988-01-26
| ''[[:d:Q7130788|Pandy]]''
|-
| style='text-align:right'| 298
| ''[[:d:Q402985|Ryan Day]]''
| [[File:Ryan Day at Snooker German Masters (DerHexer) 2015-02-05 01.jpg|center|128px]]
| 1980-03-23
|
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 299
| ''[[:d:Q428905|Asser]]''
|
| 9th century
| 909
| [[St Davids]]
|-
| style='text-align:right'| 300
| ''[[:d:Q433736|Martha Hughes Cannon]]''
| [[File:Martha Hughes Cannon.jpg|center|128px]]
| 1857-07-01
| 1932-07-10
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 301
| ''[[:d:Q434154|Henry Spinetti]]''
|
| 1951-03-31
|
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 302
| ''[[:d:Q435411|Marilyn Strathern]]''
|
| 1941-03-06
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 303
| ''[[:d:Q436394|Paula Yates]]''
|
| 1959-04-24
| 2000-09-17
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 304
| ''[[:d:Q436648|Richey Edwards]]''
| [[File:Richey Edwards (7227817420).jpg|center|128px]]
| 1967-12-22<br/>1966<br/>1967
| 2014
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 305
| ''[[:d:Q436650|Neville Southall]]''
| [[File:NevilleSouthall.jpg|center|128px]]
| 1958-09-16
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 306
| ''[[:d:Q436693|Ivor Novello]]''
| [[File:Novello LCCN2014715473.jpg|center|128px]]
| 1893-01-15
| 1951-03-06
| [[Cairdiff]]
|-
| style='text-align:right'| 307
| ''[[:d:Q438330|Jo Walton]]''
| [[File:Jo Walton (cropped).jpg|center|128px]]
| 1964-12-01
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 308
| ''[[:d:Q438506|John Yapp]]''
|
| 1983-04-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 309
| ''[[:d:Q438515|Dafydd Jones]]''
|
| 1979-06-24
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 310
| ''[[:d:Q438832|Michael Jones]]''
| [[File:Michael Jones (Fête de la musique, Vitrolles, Bouches-du-Rhône, France).jpg|center|128px]]
| 1952-01-28
|
| [[Welshpool]]
|-
| style='text-align:right'| 311
| ''[[:d:Q440206|Honeysuckle Weeks]]''
| [[File:Honeysuckle weeks november 2008.jpg|center|128px]]
| 1979-08-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 312
| ''[[:d:Q440786|Amanda Levete]]''
| [[File:Amanda Levete.jpg|center|128px]]
| 1955-11-17<br/>1959
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 313
| ''[[:d:Q441467|Peggy Cummins]]''
| [[File:Peggy Cummins. Promotion 1950.jpg|center|128px]]
| 1925-12-18
| 2017-12-29
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 314
| ''[[:d:Q442086|D. W. Davis]]''
| [[File:DWDavis.jpg|center|128px]]
| 1873-04-23
| 1959-08-05<br/>1959-08-03
| [[Cairdiff]]
|-
| style='text-align:right'| 315
| ''[[:d:Q444611|Billy Meredith]]''
| [[File:Billy meredith city.jpg|center|128px]]
| 1874-07-30
| 1958-04-19<br/>1958-04-17
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 316
| ''[[:d:Q444638|Sharon Maguire]]''
|
| 1960-11-28
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 317
| ''[[:d:Q446140|Jon Brown]]''
|
| 1971-02-27
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 318
| ''[[:d:Q446789|Dai Young]]''
|
| 1967-07-26
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 319
| ''[[:d:Q447945|Alun Hoddinott]]''
|
| 1929-08-11
| 2008-03-12
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 320
| ''[[:d:Q447948|Alun Morgan]]''
|
| 1928-02-24
| 2018-11-11
| [[Pontypridd]]
|-
| style='text-align:right'| 321
| ''[[:d:Q447949|Bryn Meredith]]''
|
| 1930-10-21
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 322
| ''[[:d:Q447951|Alun Owen]]''
|
| 1925-11-24
| 1994-12-06
| [[Wales]]
|-
| style='text-align:right'| 323
| ''[[:d:Q447961|Alun Wyn Jones]]''
| [[File:Alun Wyn Jones 2019.jpg|center|128px]]
| 1985-09-19
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 324
| ''[[:d:Q448212|Bobby Windsor]]''
|
| 1948-01-31
|
| [[Newport]]
|-
| style='text-align:right'| 325
| ''[[:d:Q448515|David Nash]]''
|
| 1939-07-15
| 2016-10-30
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 326
| ''[[:d:Q449012|Jamie Roberts]]''
| [[File:Jamie Roberts cropped.jpg|center|128px]]
| 1986-11-08
|
| [[Newport]]
|-
| style='text-align:right'| 327
| ''[[:d:Q449028|Bernice Rubens]]''
|
| 1923<br/>1923-07-26
| 2004-10-13
| [[Cairdiff]]
|-
| style='text-align:right'| 328
| ''[[:d:Q449054|Nina Hamnett]]''
| [[File:Nina Hamnett by Roger Fry 1917.jpg|center|128px]]
| 1890-02-14
| 1956-12-16
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 329
| ''[[:d:Q449100|Rebecca James]]''
| [[File:Rebecca James 2012.jpg|center|128px]]
| 1991-11-29
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 330
| ''[[:d:Q449108|Barry Morgan]]''
| [[File:Barry Morgan (cropped).jpg|center|128px]]
| 1947-01-31
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 331
| ''[[:d:Q449114|Laura Ashley]]''
|
| 1925-09-07
| 1985-09-17
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 332
| ''[[:d:Q449136|Rhoda Broughton]]''
| [[File:Notable women authors of the day - Rhoda Broughton.jpg|center|128px]]
| 1840-11-29
| 1920-06-05
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 333
| ''[[:d:Q449142|Gwladus Ddu]]''
|
| 13rd century
| 1251
| [[Wales]]
|-
| style='text-align:right'| 334
| ''[[:d:Q449734|Elaine Morgan]]''
| [[File:Elaine Morgan in 1998.jpg|center|128px]]
| 1920-11-07
| 2013-07-12
| [[Pontypridd]]
|-
| style='text-align:right'| 335
| ''[[:d:Q449884|Isabel Marshal]]''
| [[File:IsabelaMarshall.jpg|center|128px]]
| 1200-10-09<br/>1200
| 1240-01-17<br/>1240
| ''[[:d:Q1422235|Pembroke Castle]]''
|-
| style='text-align:right'| 336
| ''[[:d:Q449926|Alwyn Williams]]''
|
| 1921-06-08
| 2004-04-04
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 337
| ''[[:d:Q450826|Gwenllian ferch Gruffudd ap Cynan]]''
|
| 1097
| 1136
| ''[[:d:Q319576|Aberffraw]]''
|-
| style='text-align:right'| 338
| ''[[:d:Q455094|Hayley Tullett]]''
|
| 1973-02-17
|
| [[Swansea]]
|-
| style='text-align:right'| 339
| ''[[:d:Q456444|G. E. R. Lloyd]]''
|
| 1933-01-25
|
| [[Swansea]]
|-
| style='text-align:right'| 340
| ''[[:d:Q456519|Henry Somerset, 1st Duke of Beaufort]]''
| [[File:Henry Somerset (1629–1699), 1st Duke of Beaufort, KG, PC.jpg|center|128px]]
| 1629
| 1700-01-21
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 341
| ''[[:d:Q456905|William Davies Evans]]''
| [[File:Evans W.png|center|128px]]
| 1790-01-27
| 1872-08-03
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 342
| ''[[:d:Q459155|Edward Youde]]''
|
| 1924-06-19
| 1986-12-05<br/>1986-12-04
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 343
| ''[[:d:Q459764|Jessie Penn-Lewis]]''
| [[File:Penn Lewis.jpg|center|128px]]
| 1861-02-28
| 1927-08-15
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 344
| ''[[:d:Q460627|Sam Warburton]]''
| [[File:Sam Warburton cropped.jpg|center|128px]]
| 1988-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 345
| ''[[:d:Q460654|Duster Bennett]]''
| [[File:John Mayall and Duster Bennett 1970.JPG|center|128px]]
| 1946-09-23
| 1976-03-26
| [[Welshpool]]
|-
| style='text-align:right'| 346
| ''[[:d:Q460672|Mark Webster]]''
| [[File:2022-06-13 Play-offs (2022 Premier League Darts) by Sandro Halank–059.jpg|center|128px]]
| 1983-08-12
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 347
| ''[[:d:Q460929|Dai Greene]]''
| [[File:David Greene Barcelona 2010.jpg|center|128px]]
| 1986-04-11
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 348
| ''[[:d:Q460934|Morgan Stoddart]]''
|
| 1984-09-23
|
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 349
| ''[[:d:Q462274|Pedro Mexía]]''
| [[File:Retrato de Pedro Mejía.jpg|center|128px]]
| 1497
| 1551-01-17
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 350
| ''[[:d:Q463870|Jon Lilygreen]]''
| [[File:Jon Lilygreen ESC 2010.jpg|center|128px]]
| 1987-08-04
|
| [[Newport]]
|-
| style='text-align:right'| 351
| ''[[:d:Q465029|Sandy Griffiths]]''
| [[File:Sandy Griffiths, Estadio, 1951-05-19 (418) (cropped).jpg|center|128px]]
| 1909-01-17
| 1974-01-21
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 352
| ''[[:d:Q465457|Kelle Marie]]''
| [[File:Kelle Marie at 2006 AEE Friday 2.jpg|center|128px]]
| 1980-10-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 353
| ''[[:d:Q465547|Matthew Elias]]''
|
| 1979-04-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 354
| ''[[:d:Q466171|Harold Lowe]]''
| [[File:Harold Lowe.jpg|center|128px]]
| 1882-11-21
| 1944-05-12
| ''[[:d:Q6661729|Llanrhos]]''
|-
| style='text-align:right'| 355
| ''[[:d:Q466632|Terry Hennessey]]''
|
| 1942-09-01
|
| ''[[:d:Q6661943|Llai]]''
|-
| style='text-align:right'| 356
| ''[[:d:Q466837|Hywel Lloyd]]''
|
| 1985-03-14
|
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 357
| ''[[:d:Q466878|Kelly Sotherton]]''
| [[File:Kelly Sotherton (cropped).jpg|center|128px]]
| 1976-11-13
|
| [[Newport]]
|-
| style='text-align:right'| 358
| ''[[:d:Q467685|Llywelyn Fawr]]''
| [[File:Llywelyn the Great (cropped).JPG|center|128px]]
| 1173
| 1240-04-11<br/>1240
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 359
| ''[[:d:Q467749|Joanna Page]]''
|
| 1978-03-23
|
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 360
| ''[[:d:Q467755|Ruth Ellis]]''
|
| 1926-10-09
| 1955-07-13
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 361
| ''[[:d:Q468004|Margaret John]]''
|
| 1926-12-14
| 2011-02-02
| [[Swansea]]
|-
| style='text-align:right'| 362
| ''[[:d:Q468023|Kay Swinburne]]''
| [[File:Swinburne, Kay-2652.jpg|center|128px]]
| 1967-06-08
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 363
| ''[[:d:Q468060|Helen Watts]]''
|
| 1927-12-07
| 2009-10-07
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 364
| ''[[:d:Q468195|Malo]]''
| [[File:Saint Malo.jpg|center|128px]]
| 520-03-27
| 621-11-15
| ''[[:d:Q1027137|Llancarfan]]''
|-
| style='text-align:right'| 365
| ''[[:d:Q469952|Gwenllian of Wales]]''
|
| 1282-06-12
| 1337-06-07
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 366
| ''[[:d:Q470751|Chris Gunter]]''
| [[File:Chrisgunter.jpg|center|128px]]
| 1989-07-21
|
| [[Newport]]
|-
| style='text-align:right'| 367
| ''[[:d:Q471387|Richard Wilson]]''
| [[File:Mengs - Richard Wilson.jpg|center|128px]]
| 1713-08-01<br/>1714-08-01<br/>1714
| 1782-05-11
| [[Penegoes]]
|-
| style='text-align:right'| 368
| ''[[:d:Q471402|Richard Marquand]]''
|
| 1937-09-22
| 1987-09-04
| ''[[:d:Q3397990|Llanishen]]''
|-
| style='text-align:right'| 369
| ''[[:d:Q472382|Sam Edwards]]''
| [[File:SamEdwardsBetter.jpg|center|128px]]
| 1928-02-01
| 2015-05-07
| [[Swansea]]
|-
| style='text-align:right'| 370
| ''[[:d:Q472691|Cyril Radcliffe, 1st Viscount Radcliffe]]''
| [[File:Cyril-John-Radcliffe-1st-Viscount-Radcliffe.jpg|center|128px]]
| 1899-03-30
| 1977-04-01
| ''[[:d:Q6661917|Llanychan]]''
|-
| style='text-align:right'| 371
| ''[[:d:Q474788|Matthew Rees]]''
| [[File:Wales and British and Irish Lions Hooker, Matthew Rees. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1980-12-09
|
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 372
| ''[[:d:Q478565|Dai Havard]]''
|
| 1950-02-07
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 373
| ''[[:d:Q479115|Joan Ruddock]]''
| [[File:Joan Ruddock.jpg|center|128px]]
| 1943-12-28
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 374
| ''[[:d:Q479188|Chris Ruane]]''
| [[File:Official portrait of Chris Ruane crop 2.jpg|center|128px]]
| 1958-07-18
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 375
| ''[[:d:Q490072|Roger Livesey]]''
| [[File:Roger-Livesey-Storm-Over-Patsy-Stage-1937.jpg|center|128px]]
| 1906-06-25
| 1976-02-04
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 376
| ''[[:d:Q498915|Edgeworth David]]''
| [[File:Sir Tannatt William Edgeworth David (1858-1934).jpg|center|128px]]
| 1858-01-28
| 1934-08-28
| ''[[:d:Q390036|Sain Ffagan]]''<br/>[[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 377
| ''[[:d:Q503493|John Bevan]]''
|
| 1948-03-12
| 1986-06-05
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 378
| ''[[:d:Q503776|Andrew Bishop]]''
| [[File:ST vs Ospreys 08-12-120075.JPG|center|128px]]
| 1985-08-07
|
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 379
| ''[[:d:Q504430|Andrew Davies]]''
| [[File:Andrew Davies (writer).jpg|center|128px]]
| 1936-09-20<br/>1936-09-30
|
| ''[[:d:Q7320726|Rhiwbina]]''
|-
| style='text-align:right'| 380
| ''[[:d:Q504761|George Nares]]''
| [[File:George Strong Nares. Photograph. Wellcome V0026912.jpg|center|128px]]
| 1831-04-24
| 1915-01-15
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 381
| ''[[:d:Q505190|Andrew Hourmont]]''
|
| 1966
|
| [[Cairdiff]]
|-
| style='text-align:right'| 382
| ''[[:d:Q506650|Andrew Pagett]]''
| [[File:Andrew Pagett PHC 2011-1.jpg|center|128px]]
| 1982-04-25
|
| [[Newport]]
|-
| style='text-align:right'| 383
| ''[[:d:Q511364|Rosemary Joshua]]''
|
| 1964-10-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 384
| ''[[:d:Q512413|J. J. Williams]]''
| [[File:John James Williams 2014.jpg|center|128px]]
| 1948-04-01
| 2020-10-29
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 385
| ''[[:d:Q512659|Laura Ford]]''
| [[File:LauraFord.ChinaCats.2.jpg|center|128px]]
| 1961-02-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 386
| ''[[:d:Q513201|Ken Jones]]''
| [[File:Kenneth Jeffrey Jones 1950.jpg|center|128px]]
| 1921-12-30
| 2006-04-18
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 387
| ''[[:d:Q514831|Lyn Evans]]''
| [[File:Lyn Evans - pictures donated by CERN-7.jpg|center|128px]]
| 1945-07-24
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 388
| ''[[:d:Q514898|Aneirin]]''
|
| 525
| 600
| [[Wales]]
|-
| style='text-align:right'| 389
| ''[[:d:Q514935|John Meurig Thomas]]''
| [[File:Sir-john-meurig-thomas rare-book-room.jpg|center|128px]]
| 1932-12-15
| 2020-11-13
| ''[[:d:Q7852544|Tumble]]''
|-
| style='text-align:right'| 390
| ''[[:d:Q515207|Perdita Weeks]]''
|
| 1985-12-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 391
| ''[[:d:Q517287|Dafydd ap Gwilym]]''
| [[File:Dafydd ap Gwilym at Cardiff City Hall.jpg|center|128px]]
| 1320
| 1380
| [[Ceredigion]]<br/>''[[:d:Q29506026|Brogynin Fawr]]''
|-
| style='text-align:right'| 392
| ''[[:d:Q518175|Doris Hare]]''
|
| 1905-03-01
| 2000-05-30
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 393
| ''[[:d:Q518290|Kelly Morgan]]''
|
| 1975-05-22
|
| [[Pontypridd]]
|-
| style='text-align:right'| 394
| ''[[:d:Q519589|Mike Phillips]]''
| [[File:Mike Phillips 2016.jpg|center|128px]]
| 1982-08-29
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 395
| ''[[:d:Q520341|Hugh Evan-Thomas]]''
| [[File:Rear-admiral Sir Hugh Evan-thomas Kcb Mvo- 1917 Art.IWMART1734.jpg|center|128px]]
| 1862-10-27
| 1928-08-30
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 396
| ''[[:d:Q522134|Stuart Urban]]''
|
| 1958-09-11
|
| [[Newport]]
|-
| style='text-align:right'| 397
| ''[[:d:Q522373|Matt Ryan]]''
| [[File:Matt Ryan At Wales Comic-Con Homecoming Wrexham 2022.jpg|center|128px]]
| 1981-04-11
|
| [[Swansea]]
|-
| style='text-align:right'| 398
| ''[[:d:Q523810|Richard Deacon]]''
| [[File:Richard Deacon II (2017).jpg|center|128px]]
| 1949-08-15
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 399
| ''[[:d:Q525714|Andy Fairweather Low]]''
| [[File:Andy Fairweather-Low, July 02 2006.jpg|center|128px]]
| 1948-08-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 400
| ''[[:d:Q525803|David Owen]]''
| [[File:Dewi Wyn o Eifion.jpg|center|128px]]
| 1784-06
| 1841-01-17
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 401
| ''[[:d:Q525873|Shane Williams]]''
| [[File:Shane Williams 2.jpg|center|128px]]
| 1977-02-26
|
| [[Swansea]]
|-
| style='text-align:right'| 402
| ''[[:d:Q526714|Andy Melville]]''
|
| 1968-11-29
|
| [[Swansea]]
|-
| style='text-align:right'| 403
| ''[[:d:Q527084|Andy Powell]]''
| [[File:Andy Powell zoonabar london wasps.jpg|center|128px]]
| 1981-08-23
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 404
| ''[[:d:Q527532|Andy Scott]]''
| [[File:Andy Scott - Wacken Open Air 2018 03.jpg|center|128px]]
| 1949-06-30
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 405
| ''[[:d:Q528311|Owain Cyfeiliog]]''
|
| 1130
| 1197
| [[Wales]]
|-
| style='text-align:right'| 406
| ''[[:d:Q530256|Edwin Regan]]''
|
| 1935-12-31
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 407
| ''[[:d:Q530524|Eva Marshal]]''
| [[File:Eve de Braose.jpg|center|128px]]
| 1203
| 1246
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 408
| ''[[:d:Q530921|Naunton Wayne]]''
|
| 1901-06-22
| 1970-11-17
| [[Pontypridd]]
|-
| style='text-align:right'| 409
| ''[[:d:Q531221|Emyr Wyn Lewis]]''
|
| 1982-10-03
|
| [[Swansea]]
|-
| style='text-align:right'| 410
| ''[[:d:Q531350|Bethan Huws]]''
|
| 1961
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 411
| ''[[:d:Q533245|Jayne Ludlow]]''
| [[File:Jayne Ludlow.jpg|center|128px]]
| 1979-01-07
|
| [[Llwynypia]]
|-
| style='text-align:right'| 412
| ''[[:d:Q533591|Hugh of Rhuddlan]]''
|
| 1150
| 1190
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 413
| ''[[:d:Q533743|Owain Tudur Jones]]''
|
| 1984-10-15
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 414
| ''[[:d:Q534049|Saint Petroc]]''
| [[File:Petroc.png|center|128px]]
| 5th century
| 564-06-04
| [[Wales]]
|-
| style='text-align:right'| 415
| ''[[:d:Q537531|Michael White]]''
| [[File:Michael White PHC 2016-2.jpg|center|128px]]
| 1991-07-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 416
| ''[[:d:Q538289|High Contrast]]''
| [[File:High Contrast AKA Lincoln Barrett.JPG|center|128px]]
| 1979-09-18
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 417
| ''[[:d:Q539515|Gwendoline Davies]]''
|
| 1882-02-11
| 1951-07-03
| [[Wales]]
|-
| style='text-align:right'| 418
| ''[[:d:Q539583|Rachel Rice]]''
|
| 1984-03-07
|
| [[Torfaen]]
|-
| style='text-align:right'| 419
| ''[[:d:Q539596|Tessie O'Shea]]''
|
| 1913-03-13
| 1995-04-21
| [[Cairdiff]]
|-
| style='text-align:right'| 420
| ''[[:d:Q540166|Arthur Machen]]''
| [[File:Arthur Machen - ImgID14891187.jpg|center|128px]]
| 1863-03-03
| 1947-12-15
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 421
| ''[[:d:Q540181|Margaret Davies]]''
|
| 1884-12-14
| 1963-03-13
| ''[[:d:Q6661212|Llandinam]]''
|-
| style='text-align:right'| 422
| ''[[:d:Q541502|Glyn Simon]]''
|
| 1903-04-14
| 1972-06-14
| [[Swansea]]
|-
| style='text-align:right'| 423
| ''[[:d:Q541594|John Prichard]]''
| [[File:John Prichard Grave.jpg|center|128px]]
| 1817-05-06
| 1886-10-13
| ''[[:d:Q6661429|Llangan]]''
|-
| style='text-align:right'| 424
| ''[[:d:Q543665|Anne de Beauchamp, 15th Countess of Warwick]]''
| [[File:AnneWarwick1483.jpg|center|128px]]
| 1444-02-14
| 1449-01-03
| [[Cairdiff]]
|-
| style='text-align:right'| 425
| ''[[:d:Q544101|Sandra Gidley]]''
| [[File:Sandra Gidley, September 2009 1 rotated and cropped.jpg|center|128px]]
| 1957-03-26
|
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 426
| ''[[:d:Q544397|Angus Charles Graham]]''
|
| 1919-07-08
| 1991-03-26
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 427
| ''[[:d:Q544524|Brynle Williams]]''
| [[File:Brynle Williams.jpg|center|128px]]
| 1949-01-09
| 2011-04-01
| ''[[:d:Q5119934|Cilcain]]''
|-
| style='text-align:right'| 428
| ''[[:d:Q545109|Huw Ceredig]]''
|
| 1942-06-22
| 2011-08-16
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 429
| ''[[:d:Q545123|Thomas Pennant]]''
| [[File:ThomasPennant oil.jpeg|center|128px]]
| 1726-06-14
| 1798-12-16
| ''[[:d:Q5303195|Downing]]''
|-
| style='text-align:right'| 430
| ''[[:d:Q545186|Dave Edmunds]]''
| [[File:DaveEdmunds1980crop.jpg|center|128px]]
| 1944-04-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 431
| ''[[:d:Q545198|Julian Winn]]''
|
| 1972-09-23
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 432
| ''[[:d:Q545242|Sam Harrison]]''
| [[File:Samuel Harrison TA 2013 (Cropping).jpg|center|128px]]
| 1992-06-24
|
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 433
| [[Ray Reardon]]
| [[File:Ray Reardon 1949.jpg|center|128px]]
| 1932-10-08
| 2024-07-19
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 434
| ''[[:d:Q545303|Dean Saunders]]''
| [[File:Saunders, Dean 2019.jpg|center|128px]]
| 1964-06-21
|
| [[Swansea]]
|-
| style='text-align:right'| 435
| ''[[:d:Q545328|Tom Ward]]''
|
| 1971-01-11
|
| [[Swansea]]
|-
| style='text-align:right'| 436
| ''[[:d:Q545363|Henry Vaughan]]''
|
| 1621-04-17
| 1695-04-23<br/>1695-04-28
| ''[[:d:Q6661758|Llansantffraed]]''
|-
| style='text-align:right'| 437
| ''[[:d:Q545471|Philip Madoc]]''
|
| 1934-07-05
| 2012-03-05
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 438
| ''[[:d:Q546364|Della Jones]]''
|
| 1946-04-13
|
| ''[[:d:Q16248422|Tonna]]''
|-
| style='text-align:right'| 439
| ''[[:d:Q547154|Richard Meade]]''
| [[File:Richard Meade 1973.jpg|center|128px]]
| 1938-12-04
| 2015-01-08
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 440
| ''[[:d:Q547716|Iolo Morganwg]]''
| [[File:Portrait of Edward Williams, bardd braint a defod (4672175).jpg|center|128px]]
| 1747-03-10
| 1826-12-18
| ''[[:d:Q1027137|Llancarfan]]''
|-
| style='text-align:right'| 441
| ''[[:d:Q548671|Johnny Williams]]''
|
| 1926-12-25
| 2007-02-06
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 442
| ''[[:d:Q549519|Jak Jones]]''
| [[File:Jak Jones PHC 2016-3.jpg|center|128px]]
| 1993-07-29
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 443
| ''[[:d:Q551257|Paulo Radmilovic]]''
| [[File:Paul Radmilovic 1909.jpg|center|128px]]
| 1886-03-05
| 1968-09-29
| [[Cairdiff]]
|-
| style='text-align:right'| 444
| ''[[:d:Q551261|Matthew Stevens]]''
| [[File:Matthew Stevens PHC 2012.jpg|center|128px]]
| 1977-09-11
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 445
| ''[[:d:Q552881|Les Davies]]''
|
| 1984-10-29<br/>1984-10-24
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 446
| ''[[:d:Q553549|Jason Koumas]]''
| [[File:Jason Koumas.jpg|center|128px]]
| 1979-09-25
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 447
| ''[[:d:Q556024|Sasha]]''
| [[File:Sashaspooky (cropped).jpg|center|128px]]
| 1969-09-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 448
| ''[[:d:Q556552|E. E. Clive]]''
| [[File:E.E. Clive in The Little Princess.jpg|center|128px]]
| 1879-08-28<br/>1883-08-28
| 1940-06-06
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 449
| ''[[:d:Q561101|Richard Price]]''
| [[File:Dr Richard Price, DD, FRS - Benjamin West.jpg|center|128px]]
| 1723-02-23
| 1791-04-19
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 450
| ''[[:d:Q561117|William Robert Grove]]''
| [[File:William Robert Grove 2.jpg|center|128px]]
| 1811-07-11
| 1896-08-01
| [[Swansea]]
|-
| style='text-align:right'| 451
| ''[[:d:Q561168|Roy Clarke]]''
|
| 1925-06-01
| 2006-03-13
| [[Newport]]
|-
| style='text-align:right'| 452
| ''[[:d:Q561356|Kevin Allen]]''
|
| 1962-09-15
|
| [[Swansea]]
|-
| style='text-align:right'| 453
| ''[[:d:Q561374|Christian Malcolm]]''
| [[File:Christian Malcolm Barcelona 2010.jpg|center|128px]]
| 1979-06-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 454
| ''[[:d:Q561383|Brian Hibbard]]''
|
| 1946-11-26
| 2012-06-17
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 455
| ''[[:d:Q562540|Augustus John]]''
| [[File:Augustus John by George Charles Beresford (1902) (NPG x13487).jpg|center|128px]]
| 1878-01-04
| 1961-10-31
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 456
| ''[[:d:Q564059|Annabel Schofield]]''
|
| 1963-09-04
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 457
| ''[[:d:Q564905|Anthony Barnes Atkinson]]''
| [[File:Tony Atkinson - Festival Economia 2015.JPG|center|128px]]
| 1944-09-04
| 2017-01-01
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 458
| ''[[:d:Q565725|Anne Rasa]]''
| [[File:Prof. Anne Rasa, Kalahari Trails, Red Dune Route, Northern Cape, South Africa.jpg|center|128px]]
| 1940-04-28
| 2020-11-15
| [[Wales]]
|-
| style='text-align:right'| 459
| ''[[:d:Q567826|John Edward Jones]]''
| [[File:John Edward Jones, governor of Nevada.jpg|center|128px]]
| 1840-12-05
| 1896-04-10
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 460
| ''[[:d:Q573143|Ross Lovegrove]]''
| [[File:Portrait of Ross Lovegrove.jpg|center|128px]]
| 1958-08-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 461
| ''[[:d:Q573284|Anthony George Lyster]]''
| [[File:Anthony George Lyster, dock engineer.jpg|center|128px]]
| 1852
| 1920-03-17
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 462
| ''[[:d:Q574920|Emrys Hughes]]''
| [[File:Emrys Hughes (cropped).jpg|center|128px]]
| 1894-07-10
| 1969-10-18
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 463
| ''[[:d:Q576121|Albert Owen]]''
| [[File:Official portrait of Albert Owen crop 2.jpg|center|128px]]
| 1959-08-10
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 464
| ''[[:d:Q578107|Paul Collier]]''
|
| 1970-07-30
|
| [[Newport]]
|-
| style='text-align:right'| 465
| ''[[:d:Q579550|Peter Biziou]]''
|
| 1944-08-08
|
| [[Wales]]
|-
| style='text-align:right'| 466
| ''[[:d:Q581084|Robert d'Escourt Atkinson]]''
|
| 1898-04-11
| 1982-10-28
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 467
| ''[[:d:Q581262|Emlyn Williams]]''
| [[File:Emlyn Williams.jpg|center|128px]]
| 1905-11-26
| 1987-09-25
| ''[[:d:Q2424760|Mostyn]]''
|-
| style='text-align:right'| 468
| ''[[:d:Q584317|Mervyn Davies]]''
|
| 1946-12-09
| 2012-03-15
| [[Swansea]]
|-
| style='text-align:right'| 469
| ''[[:d:Q585747|Jack Williams]]''
| [[File:Jack Williams 1905.JPG|center|128px]]
| 1882-11-18
| 1911-08-28
| [[Wales]]
|-
| style='text-align:right'| 470
| ''[[:d:Q587649|Percy Jones]]''
| [[File:Up percy jones.png|center|128px]]
| 1947-12-03
|
| [[Wales]]
|-
| style='text-align:right'| 471
| ''[[:d:Q589424|Abraham Matthews]]''
| [[File:Abraham Matthews (ca.1870).jpg|center|128px]]
| 1832-11-07
| 1899-04-01
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 472
| ''[[:d:Q590142|Jamie Jones]]''
| [[File:Jamie Jones PHC 2015-2.JPG|center|128px]]
| 1988-02-14
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 473
| ''[[:d:Q592561|Dafydd ap Gruffudd]]''
|
| 1238-07-11
| 1283-10-03<br/>1283
| ''[[:d:Q21496553|Gwynedd]]''
|-
| style='text-align:right'| 474
| ''[[:d:Q595372|Bob John]]''
|
| 1899-02-03
| 1982-07-17
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 475
| ''[[:d:Q599469|Perce Blackborow]]''
| [[File:Mrschippy.jpg|center|128px]]
| 1894-04-08
| 1949-01-08
| [[Newport]]
|-
| style='text-align:right'| 476
| ''[[:d:Q602404|Teddy Morgan]]''
| [[File:Teddy Morgan.jpg|center|128px]]
| 1880-05-22
| 1949-09-01
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 477
| ''[[:d:Q607265|Stapleton Cotton, 1st Viscount Combermere]]''
| [[File:Stapleton Cotton, 1st Viscount Combermere by Mary Martha Pearson (née Dutton).jpg|center|128px]]
| 1773-11-14
| 1865-02-21
| ''[[:d:Q6662131|Lleweni Hall]]''
|-
| style='text-align:right'| 478
| ''[[:d:Q608262|George Vaughan Maddox]]''
|
| 1802
| 1864-02-27
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 479
| ''[[:d:Q611441|Edward Wingfield Humphreys]]''
| [[File:Edward Wingfield Humphreys.jpg|center|128px]]
| 1841
| 1892-04-27
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 480
| ''[[:d:Q612027|Tommy Cooper]]''
| [[File:Tommy Cooper.jpg|center|128px]]
| 1921-03-19
| 1984-04-15
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 481
| ''[[:d:Q612390|Beuno]]''
| [[File:Saint Beuno Window.png|center|128px]]
| 6th century<br/>570
| 640-04-21
| ''[[:d:Q769782|Kingdom of Powys]]''
|-
| style='text-align:right'| 482
| ''[[:d:Q613119|Dai Rees]]''
|
| 1913-03-31
| 1983-09-10<br/>1983-11-15
| ''[[:d:Q5465078|Font-y-Gary]]''
|-
| style='text-align:right'| 483
| ''[[:d:Q614845|Gary Hocking]]''
| [[File:Gary Hocking (1961).jpg|center|128px]]
| 1937-09-30
| 1962-12-21
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 484
| ''[[:d:Q614928|Cliff Morgan]]''
|
| 1930-04-07
| 2013-08-29
| ''[[:d:Q7837340|Trebanog]]''
|-
| style='text-align:right'| 485
| ''[[:d:Q626445|Llewelyn Davies]]''
|
| 1889-01-09
| 1918-03-16
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 486
| ''[[:d:Q626472|Ernest Norton]]''
| [[File:Ernest Norton.jpg|center|128px]]
| 1893-05-14
| 1966-05-23
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 487
| ''[[:d:Q627588|Mary Glynne]]''
| [[File:Film actress Mary Glynne (SAYRE 2893).jpg|center|128px]]
| 1895-01-25
| 1954-09-19
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 488
| ''[[:d:Q628479|Terry Nation]]''
|
| 1930-08-08
| 1997-03-09
| [[Cairdiff]]
|-
| style='text-align:right'| 489
| ''[[:d:Q631339|Nicky Grist]]''
| [[File:Nicky Grist.png|center|128px]]
| 1961-11-01
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 490
| ''[[:d:Q632606|Francis Kitto]]''
|
| 1897-01-01
| 1926-06-25
| [[Pontypridd]]
|-
| style='text-align:right'| 491
| ''[[:d:Q633039|Richard Amerike]]''
|
| 1440
| 1503
| [[Wales]]
|-
| style='text-align:right'| 492
| ''[[:d:Q634238|Ewart Jones]]''
|
| 1911-03-16
| 2002-05-07
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 493
| ''[[:d:Q634405|Paulinus Aurelianus]]''
| [[File:Saint-Pol-de-Léon - Chapelle Notre-Dame du Kreisker - Sept saints fondateurs bretons - St Pol.jpeg|center|128px]]
| 492
| 573
| ''[[:d:Q13131807|Kingdom of Morgannwg]]''
|-
| style='text-align:right'| 494
| ''[[:d:Q634827|Caradoc of Llancarfan]]''
|
| 12nd century
| 1156
| [[Wales]]
|-
| style='text-align:right'| 495
| ''[[:d:Q642090|Charles Somerset, 4th Duke of Beaufort]]''
| [[File:Charles Somerset, 4th Duke of Beaufort.jpg|center|128px]]
| 1709-09-12
| 1756-10-28
| ''[[:d:Q722585|Cil-y-coed]]''
|-
| style='text-align:right'| 496
| ''[[:d:Q642630|Harry Payne]]''
|
| 1907-12-10
| 2000-12-22
| [[Wales]]
|-
| style='text-align:right'| 497
| ''[[:d:Q642981|Richard Duffy]]''
| [[File:Richard Duffy.png|center|128px]]
| 1985-08-30
|
| [[Swansea]]
|-
| style='text-align:right'| 498
| ''[[:d:Q646592|Harold Day]]''
| [[File:Harold Day.jpg|center|128px]]
| 1897-04-17
| 1918-02-05
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 499
| ''[[:d:Q646614|Phil Woosnam]]''
| [[File:Phil Woosnam, NASL 1975 media guide page 4.png|center|128px]]
| 1932-12-22
| 2013-07-19
| ''[[:d:Q38825|Sir Drefaldwyn]]''<br/>''[[:d:Q635169|Caersws]]''
|-
| style='text-align:right'| 500
| ''[[:d:Q648341|Thighpaulsandra]]''
| [[File:Tighpaul.jpg|center|128px]]
| 1958-06-19
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 501
| ''[[:d:Q655506|Mervyn Stockwood]]''
|
| 1913-05-27
| 1995-01-13
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 502
| ''[[:d:Q657148|Max Kennedy Horton]]''
| [[File:Max Horton 1943 IWM A 20789.jpg|center|128px]]
| 1883-11-29
| 1951-07-30
| ''[[:d:Q7321494|Rhosneigr]]''
|-
| style='text-align:right'| 503
| ''[[:d:Q661947|John Davies]]''
| [[File:Statue of John Davies, Translators' Memorial, St Asaph 12.jpg|center|128px]]
| 1567
| 1644-05-15
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 504
| ''[[:d:Q662951|Roy Mathias]]''
|
| 1949-09-02
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 505
| ''[[:d:Q663216|Matthew Henry]]''
| [[File:MatthewHenry.jpg|center|128px]]
| 1662-10-18
| 1714-06-22
| ''[[:d:Q6089564|Isycoed]]''
|-
| style='text-align:right'| 506
| ''[[:d:Q675493|Henry VII of England]]''
| [[File:Enrique VII de Inglaterra, por un artista anónimo.jpg|center|128px]]
| 1457-01-28
| 1509-04-21
| ''[[:d:Q1422235|Pembroke Castle]]''
|-
| style='text-align:right'| 507
| ''[[:d:Q676629|Kenneth Griffith]]''
|
| 1921-10-12
| 2006-06-25
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 508
| ''[[:d:Q680538|Teilo]]''
| [[File:Llandaf, yr eglwys gadeiriol Llandaf Cathedral De Cymru South Wales 96.JPG|center|128px]]
| 6th century
| 560-02-09
| ''[[:d:Q7162166|Penally]]''
|-
| style='text-align:right'| 509
| ''[[:d:Q685402|Gavin Williams]]''
|
| 1980-07-20
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 510
| ''[[:d:Q686947|John Frost]]''
| [[File:Portrait of J. Frost (4673712) (cropped).jpg|center|128px]]
| 1784-05-25
| 1877-07-27
| [[Newport]]
|-
| style='text-align:right'| 511
| ''[[:d:Q690597|David Jacobs]]''
| [[File:David Jacobs 1913.jpg|center|128px]]
| 1888-04-30
| 1976-06-06
| [[Cairdiff]]
|-
| style='text-align:right'| 512
| ''[[:d:Q691388|Huw Irranca-Davies]]''
| [[File:Huw-irranca-davies.jpg|center|128px]]
| 1963-01-22
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 513
| ''[[:d:Q694996|Anne Main]]''
| [[File:Anne Main (cropped).jpg|center|128px]]
| 1957-05-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 514
| ''[[:d:Q704897|Alan Woods]]''
| [[File:Alan Woods 2018.png|center|128px]]
| 1944<br/>1944-10-23
|
| [[Swansea]]
|-
| style='text-align:right'| 515
| ''[[:d:Q707734|Bernard Fox]]''
| [[File:Bernard Fox Werner Klemperer Hogan's Heroes 1968.JPG|center|128px]]
| 1927-05-11
| 2016-12-14
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 516
| ''[[:d:Q709999|Arthur Herbert]]''
|
| 1855-08-22
| 1921-08-31
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 517
| ''[[:d:Q710220|Donald Swann]]''
| [[File:Donald Swann (1966 publicity photo).jpg|center|128px]]
| 1923-09-30
| 1994-03-23
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 518
| ''[[:d:Q710460|Arthur Loveridge]]''
|
| 1891-05-28
| 1980-02-16
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 519
| ''[[:d:Q711666|Arthur Symons]]''
| [[File:Arthur Symons.jpg|center|128px]]
| 1865-02-28
| 1945-01-22
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 520
| ''[[:d:Q713009|Terry Griffiths]]''
| [[File:Terry Griffith 1991 (cropped).jpg|center|128px]]
| 1947-10-16
| 2024-12-01
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 521
| ''[[:d:Q713440|Glyn Daniel]]''
| [[File:Glyn Daniel at Tinkinswood.png|center|128px]]
| 1914-04-23
| 1986-12-13
| [[Lampeter Velfrey]]
|-
| style='text-align:right'| 522
| ''[[:d:Q713489|David Kelly]]''
|
| 1944-05-14
| 2003-07-17
| [[Llwynypia]]
|-
| style='text-align:right'| 523
| ''[[:d:Q713720|Kevin Sheedy]]''
|
| 1959-10-21
|
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 524
| ''[[:d:Q714480|Henry Stafford]]''
| [[File:Henry Stafford.jpg|center|128px]]
| 1455-09-04
| 1483-11-02
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 525
| ''[[:d:Q714976|Leon Pownall]]''
|
| 1943-04-26
| 2006-06-02
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 526
| ''[[:d:Q717007|Cecil Griffiths]]''
| [[File:CecilGriffiths.JPG|center|128px]]
| 1900-02-18
| 1945-04-11
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 527
| ''[[:d:Q717787|Beau Nash]]''
| [[File:Beau-Nash.jpg|center|128px]]
| 1674-10-18
| 1761-02-03
| [[Swansea]]
|-
| style='text-align:right'| 528
| ''[[:d:Q718057|Jeffrey Weeks]]''
|
| 1945
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 529
| ''[[:d:Q718439|Thomas Coke]]''
| [[File:BpThomasCoke.png|center|128px]]
| 1747-09-09
| 1814-05-03
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 530
| ''[[:d:Q719792|Walter Devereux, 1st Earl of Essex]]''
| [[File:Walter Devereux, 1st Earl of Essex from NPG.jpg|center|128px]]
| 1541-09-16
| 1576-09-22
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 531
| ''[[:d:Q720491|Steve Jones]]''
| [[File:Steve Jones Boston 2018.jpg|center|128px]]
| 1955-08-04
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 532
| ''[[:d:Q720787|David Langford]]''
| [[File:DavidLangford.01.jpg|center|128px]]
| 1953-04-10
|
| [[Newport]]
|-
| style='text-align:right'| 533
| ''[[:d:Q721273|Richard Ian Cox]]''
|
| 1973-10-03
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 534
| ''[[:d:Q722001|Luke Evans]]''
| [[File:Luke Evans in 2018 (cropped 4).jpg|center|128px]]
| 1979-04-15
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 535
| ''[[:d:Q725054|Walter Clopton Wingfield]]''
| [[File:Wingfield.jpg|center|128px]]
| 1833-10-16
| 1912-04-18<br/>1912-04-12
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 536
| ''[[:d:Q725104|Charles Kemble]]''
| [[File:Charles Kemble by J. Dickinson.jpg|center|128px]]
| 1775-11-25
| 1854-11-12
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 537
| ''[[:d:Q725365|Lynn Davies]]''
| [[File:Lynn Davies 1964.jpg|center|128px]]
| 1942-05-20
|
| ''[[:d:Q6964400|Nant-y-moel]]''
|-
| style='text-align:right'| 538
| ''[[:d:Q725516|Kelly Jones]]''
| [[File:Kelly jones cardiff 2005.jpg|center|128px]]
| 1974-06-03
|
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 539
| ''[[:d:Q725519|Keith Allen]]''
| [[File:KeithAllen2009.jpg|center|128px]]
| 1953-09-02
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 540
| ''[[:d:Q725555|J. P. R. Williams]]''
| [[File:J. P. R. Williams 2014.jpg|center|128px]]
| 1949-03-02
| 2024-01-08
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 541
| ''[[:d:Q725556|Roy Vernon]]''
|
| 1937-04-14
| 1993-12-04
| ''[[:d:Q5446245|Ffynnongroew]]''
|-
| style='text-align:right'| 542
| ''[[:d:Q725567|Rob Terry]]''
| [[File:Rob Terry.jpg|center|128px]]
| 1980-04-30
|
| [[Swansea]]
|-
| style='text-align:right'| 543
| ''[[:d:Q725570|Byron Stevenson]]''
|
| 1956-09-07
| 2007-09-06
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 544
| ''[[:d:Q725572|Bradley Dredge]]''
| [[File:Bradley Dredge KLM Open 2010.JPG|center|128px]]
| 1973-07-06
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 545
| ''[[:d:Q725745|R. S. Thomas]]''
|
| 1913-03-29
| 2000-09-25
| [[Cairdiff]]
|-
| style='text-align:right'| 546
| ''[[:d:Q726243|Edward Stafford]]''
| [[File:Edward Stafford 3rd Duke of Buckingham 1520.jpg|center|128px]]
| 1478-02-03
| 1521-05-17
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 547
| ''[[:d:Q727410|Siân James]]''
| [[File:Siân James at Canal Parade Amsterdam - EuroPride 2016 - PvdA (28225698514) (cropped).jpg|center|128px]]
| 1959-06-24
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 548
| ''[[:d:Q727494|Terry Williams]]''
|
| 1948-01-11
|
| [[Swansea]]
|-
| style='text-align:right'| 549
| ''[[:d:Q727897|Gruffydd ap Llywelyn]]''
|
| 1000
| 1063-08-05
| [[Wales]]
|-
| style='text-align:right'| 550
| ''[[:d:Q730648|Steve Upton]]''
|
| 1946-05-24
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 551
| ''[[:d:Q730668|Lewys Glyn Cothi]]''
|
| 1420
| 1490
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 552
| ''[[:d:Q730721|Iolo Goch]]''
|
| 1320
| 1398
| ''[[:d:Q7909529|Vale of Clwyd]]''
|-
| style='text-align:right'| 553
| ''[[:d:Q731353|Ian Flanagan]]''
|
| 1982-01-15
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 554
| ''[[:d:Q735062|Jimmy Murphy]]''
| [[File:Jimmy Murphy statue.JPG|center|128px]]
| 1910-08-08
| 1989-11-14
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 555
| ''[[:d:Q736160|Kim Howells]]''
| [[File:Kim Howells 2.jpg|center|128px]]
| 1946-11-27
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 556
| ''[[:d:Q736226|Clive Thomas]]''
|
| 1936-06-22
|
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 557
| ''[[:d:Q737268|Armel]]''
| [[File:Notre-Dame des Fleurs Plouharnel Saint-Armel Droit.jpg|center|128px]]
| 482
| 570
| ''[[:d:Q13131807|Kingdom of Morgannwg]]''
|-
| style='text-align:right'| 558
| ''[[:d:Q740632|William Mathias]]''
|
| 1934-11-01
| 1992-07-29
| ''[[:d:Q1996667|Whitland]]''
|-
| style='text-align:right'| 559
| ''[[:d:Q741112|Ieuan Evans]]''
| [[File:Ieuan Evans (cropped).jpg|center|128px]]
| 1964-03-21
|
| [[Swansea]]
|-
| style='text-align:right'| 560
| ''[[:d:Q741120|Gareth Jones]]''
| [[File:Gareth-jones (cropped).jpg|center|128px]]
| 1905-08-14
| 1935-08-12
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 561
| ''[[:d:Q741130|Michael Baxandall]]''
|
| 1933-08-18
| 2008-08-12
| [[Cairdiff]]
|-
| style='text-align:right'| 562
| ''[[:d:Q741437|Alfred Edwards]]''
| [[File:Alfred George Edwards by Solomon J Solomon.jpg|center|128px]]
| 1848-11-02
| 1937-07-22
| ''[[:d:Q3402405|Llanymawddwy]]''
|-
| style='text-align:right'| 563
| ''[[:d:Q746440|Saint Wethenoc]]''
|
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 564
| ''[[:d:Q746920|Owen Thomas Jones]]''
|
| 1878-04-16
| 1967-05-05
| ''[[:d:Q3402099|Beulah]]''
|-
| style='text-align:right'| 565
| ''[[:d:Q747068|David Rees]]''
|
| 1918-05-29
| 2013-08-16
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 566
| ''[[:d:Q747672|Mark Titley]]''
|
| 1959-05-03
|
| [[Swansea]]
|-
| style='text-align:right'| 567
| ''[[:d:Q749612|Julian Lewis]]''
| [[File:Official portrait of Dr Julian Lewis crop 2.jpg|center|128px]]
| 1951-09-26
|
| [[Swansea]]
|-
| style='text-align:right'| 568
| ''[[:d:Q750381|Susan Elan Jones]]''
| [[File:Official portrait of Susan Elan Jones crop 2.jpg|center|128px]]
| 1968-06-01
|
| ''[[:d:Q7227631|Ponciau]]''
|-
| style='text-align:right'| 569
| ''[[:d:Q751510|Lloyd Burns]]''
|
| 1984-12-09
|
| ''[[:d:Q7131674|Panteg]]''
|-
| style='text-align:right'| 570
| ''[[:d:Q761573|Catherine Fisher]]''
|
| 1957-10-28
|
| [[Newport]]
|-
| style='text-align:right'| 571
| ''[[:d:Q762958|Harry Secombe]]''
| [[File:Harry Secombe plaque (9367624051).jpg|center|128px]]
| 1921-09-08
| 2001-04-11
| ''[[:d:Q7595549|St Thomas]]''
|-
| style='text-align:right'| 572
| ''[[:d:Q763721|Haydn Tanner]]''
|
| 1917-01-09
| 2009-06-05
| [[Wales]]
|-
| style='text-align:right'| 573
| ''[[:d:Q767764|Mellonius]]''
| [[File:Saint Mellon.JPG|center|128px]]
| 229
| 314
| [[Cairdiff]]
|-
| style='text-align:right'| 574
| ''[[:d:Q770633|Padarn]]''
| [[File:Vannes - cathédrale, vitrail des saints Patern et Mériadec Detail Padarn.jpg|center|128px]]
| 5th century
| 510-04-15
| [[Wales]]
|-
| style='text-align:right'| 575
| ''[[:d:Q771149|James Wilson]]''
| [[File:JAMES WILSON BRFC.jpg|center|128px]]
| 1989-02-26
|
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 576
| ''[[:d:Q772966|Anna Williams]]''
| [[File:Anna Williams by Frances Reynolds.jpg|center|128px]]
| 1706
| 1783-09-06
| ''[[:d:Q7368291|Rosemarket]]''
|-
| style='text-align:right'| 577
| ''[[:d:Q775742|Barry John]]''
| [[File:Barry John.jpg|center|128px]]
| 1945-01-06
| 2024-02-04
| ''[[:d:Q1033068|Cefneithin]]''
|-
| style='text-align:right'| 578
| ''[[:d:Q776095|Joseph Pugsley]]''
|
| 1885-05-10
| 1976-06-13
| [[Swansea]]
|-
| style='text-align:right'| 579
| ''[[:d:Q780432|John Bach]]''
|
| 1946-06-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 580
| ''[[:d:Q780557|Sid Bevan]]''
| [[File:Sid Bevan rugby player.jpg|center|128px]]
| 1877-05-02
| 1933-10-17
| [[Wales]]
|-
| style='text-align:right'| 581
| ''[[:d:Q781211|Ian Gough]]''
| [[File:Ian Gough 2008 (cropped).jpg|center|128px]]
| 1976-11-10
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 582
| ''[[:d:Q786362|Nicky Robinson]]''
| [[File:USO - ASM - 20150905 - Nicky Robinson.jpg|center|128px]]
| 1982-01-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 583
| ''[[:d:Q787209|Chloe-Beth Morgan]]''
| [[File:Miss Wales 08 Chloe Morgan.jpg|center|128px]]
| 1986-08-07
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 584
| ''[[:d:Q829262|Berwyn Jones]]''
|
| 1940-02-13
| 2007-01-12
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 585
| ''[[:d:Q837541|Timothy Richard]]''
| [[File:Timothy-Richard-at-34.jpg|center|128px]]
| 1845-10-10
| 1919-04-17
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 586
| ''[[:d:Q839022|Donald Houston]]''
|
| 1923-11-06
| 1991-10-13
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 587
| ''[[:d:Q847735|Stuart Burrows]]''
| [[File:Hen Gerddi Fy Ngwlad - Favourite Songs Of Wales, album cover.jpg|center|128px]]
| 1933-02-07
|
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 588
| ''[[:d:Q849718|Brinley Newton-John]]''
|
| 1914-03-05
| 1992-07-03
| [[Cairdiff]]
|-
| style='text-align:right'| 589
| ''[[:d:Q855207|Matthew Tuck]]''
| [[File:Bullet for My Valentine - Rock am Ring 2018-4319.jpg|center|128px]]
| 1980-01-20
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 590
| ''[[:d:Q862305|Bill Meilen]]''
|
| 1932-09-16
| 2006-09-04
| [[Cairdiff]]
|-
| style='text-align:right'| 591
| ''[[:d:Q863024|Billy Boston]]''
|
| 1934-08-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 592
| ''[[:d:Q869503|Ted Vizard]]''
|
| 1889-06-07
| 1973-12-25
| ''[[:d:Q5141073|Cogan]]''
|-
| style='text-align:right'| 593
| ''[[:d:Q869553|Billy Jennings]]''
|
| 1893-02-25
| 1968
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 594
| ''[[:d:Q883404|Bleddyn Williams]]''
| [[File:Bleddyn Williams 1950.jpg|center|128px]]
| 1923-02-22
| 2009-07-06
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 595
| ''[[:d:Q885939|Blue Weaver]]''
| [[File:BlueWiki.jpg|center|128px]]
| 1947-03-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 596
| ''[[:d:Q888051|Brochfael ab Elisedd]]''
|
| 8th century
| 773
| [[Powys]]
|-
| style='text-align:right'| 597
| ''[[:d:Q888143|Bob Morgan]]''
|
| 1967-03-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 598
| ''[[:d:Q892605|Alex Thomson]]''
| [[File:Alex Thomson VG2012.jpg|center|128px]]
| 1974-04-18
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 599
| ''[[:d:Q896857|Leighton Durham Reynolds]]''
|
| 1930-02-11
| 1999-12-04
| ''[[:d:Q4666797|Abercanaid]]''
|-
| style='text-align:right'| 600
| ''[[:d:Q897007|Bradley Davies]]''
|
| 1987-01-09
|
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 601
| ''[[:d:Q901131|Dafydd Ifans]]''
|
| 1949-04-21
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 602
| ''[[:d:Q908116|William Hallowes Miller]]''
| [[File:William Hallowes Miller.png|center|128px]]
| 1801-04-06
| 1880-05-20
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 603
| ''[[:d:Q910728|Dudley Lloyd-Evans]]''
|
| 1895
| 1972-03-20
| [[Newport]]
|-
| style='text-align:right'| 604
| ''[[:d:Q912228|Brian Godding]]''
|
| 1945-08-19
| 2023-11-26
| [[Wales]]
|-
| style='text-align:right'| 605
| ''[[:d:Q912373|Brian Huggett]]''
|
| 1936-11-18
| 2024-09-22
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 606
| ''[[:d:Q913050|Brian Savegar]]''
|
| 1932-08-24<br/>1932-07-24
| 2007-03-31
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 607
| ''[[:d:Q914227|Justin Tipuric]]''
| [[File:Justin Tipuric. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1989-08-06
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 608
| ''[[:d:Q919013|Gwilym Simcock]]''
| [[File:Gwilym Simcock IBK.JPG|center|128px]]
| 1981-02-24
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 609
| [[Eric Linklater]]
|
| 1899-03-08
| 1974-11-07
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 610
| ''[[:d:Q922252|Pino Palladino]]''
| [[File:The Who Philadelphia PA Oct. 26, 2008.jpg|center|128px]]
| 1957-10-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 611
| ''[[:d:Q922838|Abraham Rees]]''
| [[File:Abraham Rees by James Lonsdale.jpg|center|128px]]
| 1743
| 1825-06-09
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 612
| ''[[:d:Q924074|Angus McBean]]''
|
| 1904-06-08
| 1990-06-09
| ''[[:d:Q3401149|Newbridge]]''<br/>''[[:d:Q11017004|Newbridge-on-Wye]]''
|-
| style='text-align:right'| 613
| ''[[:d:Q925761|Eric Griffiths]]''
|
| 1940-10-31
| 2005-01-29
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 614
| ''[[:d:Q927275|Christopher Jones]]''
| [[File:Christopher Jones with Wales logo - England Olympic polo team 1920 Antwerp (2).jpg|center|128px]]
| 1886-06-23
| 1937-12-18
| [[Pontypridd]]
|-
| style='text-align:right'| 615
| ''[[:d:Q928194|Enzo Maccarinelli]]''
| [[File:Enzo Maccarinelli.jpg|center|128px]]
| 1980-08-20
|
| [[Swansea]]
|-
| style='text-align:right'| 616
| ''[[:d:Q928575|Derrick Sullivan]]''
|
| 1930-08-10
| 1983-08-31
| [[Newport]]
|-
| style='text-align:right'| 617
| ''[[:d:Q929046|Reginald Brooks-King]]''
| [[File:Reginald Brooks-King.jpg|center|128px]]
| 1861-08-27
| 1938-09-19
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 618
| ''[[:d:Q929476|Richard Barrett]]''
| [[File:Richard Barrett in June 2015.jpg|center|128px]]
| 1959-11-07
|
| [[Swansea]]
|-
| style='text-align:right'| 619
| ''[[:d:Q929691|Rupert Charles Barneby]]''
|
| 1911-10-06
| 2000-12-05
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 620
| ''[[:d:Q930461|Duncan Jones]]''
| [[File:ST vs Ospreys 08-12-120009.JPG|center|128px]]
| 1978-09-18
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 621
| ''[[:d:Q934120|Jonathan Thomas]]''
| [[File:Jonathan Thomas.jpg|center|128px]]
| 1982-12-27
|
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 622
| ''[[:d:Q934428|Isaac Roberts]]''
| [[File:Isaac Roberts.png|center|128px]]
| 1829-01-27
| 1904-07-17
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 623
| ''[[:d:Q934461|Gareth David-Lloyd]]''
| [[File:Gareth David-Lloyd by Gage Skidmore.jpg|center|128px]]
| 1981-03-28
|
| ''[[:d:Q4898677|Bettws]]''
|-
| style='text-align:right'| 624
| ''[[:d:Q934472|Dwayne Peel]]''
| [[File:Dwayne Peel (cropped).jpg|center|128px]]
| 1981-08-31
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 625
| ''[[:d:Q934488|Fred Evans]]''
|
| 1991-02-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 626
| ''[[:d:Q934531|Martyn Williams]]''
| [[File:Martyn Williams.jpg|center|128px]]
| 1975-09-01
|
| [[Pontypridd]]
|-
| style='text-align:right'| 627
| ''[[:d:Q934587|Mark Jones]]''
|
| 1979-11-07
|
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 628
| ''[[:d:Q934631|Gethin Jenkins]]''
| [[File:Gethin Jenkins.jpg|center|128px]]
| 1980-11-17
|
| ''[[:d:Q3406126|Llanilltud Faerdref]]''
|-
| style='text-align:right'| 629
| ''[[:d:Q934769|Huw Bennett]]''
| [[File:Huw Bennett - Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1983-06-11
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 630
| ''[[:d:Q935055|Jimmy Michael]]''
| [[File:Jimmy Michael.jpg|center|128px]]
| 1877-08-18
| 1904-11-21
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 631
| ''[[:d:Q935347|Simon Richardson]]''
| [[File:Simon Richardson London 2012 Paralympic Games torch relay.jpg|center|128px]]
| 1966-11-10
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 632
| ''[[:d:Q939952|Maud de Braose]]''
|
| 1224
| 1301-03-23
| [[Wales]]
|-
| style='text-align:right'| 633
| ''[[:d:Q942249|Freddie Welsh]]''
| [[File:Fred Welsh LCCN2014697376 (3x4a).jpg|center|128px]]
| 1886-03-05
| 1927-07-29
| [[Pontypridd]]
|-
| style='text-align:right'| 634
| ''[[:d:Q942385|Jack Kelsey]]''
|
| 1929-11-19
| 1992-03-18
| [[Swansea]]
|-
| style='text-align:right'| 635
| ''[[:d:Q944231|Ivor Allchurch]]''
| [[File:Swansea Town Football Club (20740154461).jpg|center|128px]]
| 1929-10-16
| 1997-07-10
| [[Swansea]]
|-
| style='text-align:right'| 636
| ''[[:d:Q944974|William Parry]]''
| [[File:Histoire des Jésuites II p130 Complot de William Parry par T Fragonard.jpg|center|128px]]
|
| 1585-03-02
| ''[[:d:Q2573736|Northop]]''
|-
| style='text-align:right'| 637
| ''[[:d:Q945352|Richie Collins]]''
|
| 1962-03-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 638
| ''[[:d:Q949204|Gareth Thomas]]''
| [[File:Gareth Thomas (rugby player).jpg|center|128px]]
| 1974-07-25
|
| ''[[:d:Q7424317|Sarn]]''
|-
| style='text-align:right'| 639
| ''[[:d:Q950220|Henry Bartle Frere]]''
| [[File:BartleFrere.jpg|center|128px]]
| 1815-03-29
| 1884-05-29
| ''[[:d:Q5136816|Clydach]]''
|-
| style='text-align:right'| 640
| ''[[:d:Q950806|Hugh Hamshaw Thomas]]''
| [[File:Hugh Hamshaw Thomas British Mycological Society 1913 a.jpg|center|128px]]
| 1885-05-29
| 1962-06-30
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 641
| ''[[:d:Q953078|Roger Mortimer, 4th Earl of March]]''
|
| 1374-04-11
| 1398-07-20
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 642
| ''[[:d:Q953257|Robert Pugh]]''
|
| 1950
|
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 643
| ''[[:d:Q955586|Matt Rees]]''
|
| 1967
|
| [[Newport]]
|-
| style='text-align:right'| 644
| ''[[:d:Q958043|Isabel Ice]]''
| [[File:Isabel Ice adjusted.jpg|center|128px]]
| 1982-04-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 645
| ''[[:d:Q958919|Conway Rees]]''
| [[File:J Conway Rees.jpg|center|128px]]
| 1870-01-13
| 1932-08-30
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 646
| ''[[:d:Q965304|Gareth Wyatt]]''
|
| 1977-03-04
|
| [[Pontypridd]]<br/>[[Cairdiff]]
|-
| style='text-align:right'| 647
| ''[[:d:Q967593|Jimmy Sangster]]''
|
| 1927-12-02
| 2011-08-19
| ''[[:d:Q13125694|Kinmel Bay]]''
|-
| style='text-align:right'| 648
| ''[[:d:Q968698|Thomas Tomkins]]''
|
| 1572
| 1656-06-09
| [[St Davids]]
|-
| style='text-align:right'| 649
| ''[[:d:Q970171|Peter Carpenter]]''
| [[File:Peter Carpenter.jpg|center|128px]]
| 1891-12-06
| 1971-03-21
| [[Cairdiff]]
|-
| style='text-align:right'| 650
| ''[[:d:Q970206|James Ira Thomas Jones]]''
| [[File:James Ira Jones.jpg|center|128px]]
| 1896-04-18
| 1960-08-30
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 651
| ''[[:d:Q970221|Daniel Wells]]''
| [[File:Daniel Wells at Snooker German Masters (DerHexer) 2013-01-30 03.jpg|center|128px]]
| 1988-07-31
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 652
| ''[[:d:Q971539|David Cotterill]]''
| [[File:David Cotterill.jpg|center|128px]]
| 1987-12-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 653
| ''[[:d:Q975285|Percy Mansell Jones]]''
|
| 1889-04-11
| 1968-01-24
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 654
| ''[[:d:Q975917|Neal Eardley]]''
| [[File:Neal Eardley BCFC 2013.jpg|center|128px]]
| 1988-11-06
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 655
| ''[[:d:Q976254|Paul Davies]]''
|
| 1970-06-22
|
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 656
| ''[[:d:Q977667|Noel Kinsey]]''
|
| 1925-12-24
| 2017-05-20
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 657
| ''[[:d:Q978793|Shakin' Stevens]]''
| [[File:Shakin' Stevens.jpg|center|128px]]
| 1948-12-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 658
| ''[[:d:Q979098|Craig Thomas]]''
|
| 1942-11-24
| 2011-04-04
| [[Cairdiff]]
|-
| style='text-align:right'| 659
| ''[[:d:Q979114|Paul Rhys]]''
|
| 1963-12-19
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 660
| ''[[:d:Q979163|Carwyn James]]''
|
| 1929-11-02<br/>1929
| 1983-01-10<br/>1983
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 661
| ''[[:d:Q979204|Gerald Davies]]''
|
| 1945-02-07
|
| ''[[:d:Q6661740|Llansaint]]''
|-
| style='text-align:right'| 662
| ''[[:d:Q979276|Jason Hughes]]''
|
| 1971
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 663
| ''[[:d:Q979301|John Dawes]]''
| [[File:John Dawes.jpg|center|128px]]
| 1940-06-29
| 2021-04-16
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 664
| ''[[:d:Q979325|Edgar Evans]]''
| [[File:Edgar Evans.jpg|center|128px]]
| 1876-03-07
| 1912-02-17
| ''[[:d:Q2148317|Rhossili]]''
|-
| style='text-align:right'| 665
| ''[[:d:Q979336|Delme Thomas]]''
|
| 1942-09-12
|
| [[Wales]]
|-
| style='text-align:right'| 666
| ''[[:d:Q979372|Henry Jones]]''
| [[File:Sir Henry Jones (1852-1922) NLW3364587.jpg|center|128px]]
| 1852-11-30
| 1922-02-04
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 667
| ''[[:d:Q981330|Grace Coddington]]''
| [[File:Grace Coddington.jpg|center|128px]]
| 1941-04-20
|
| [[Anglesey]]
|-
| style='text-align:right'| 668
| ''[[:d:Q981494|John of Wales]]''
|
| 13rd century
| 1285-04-03
| [[Wales]]
|-
| style='text-align:right'| 669
| ''[[:d:Q981527|Nick Evans]]''
|
| 1947-01-09
|
| [[Newport]]
|-
| style='text-align:right'| 670
| ''[[:d:Q981688|Ryan Bevington]]''
| [[File:Ryan Bevington. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1988-12-09
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 671
| ''[[:d:Q981948|Rob Howley]]''
| [[File:Robert Howley Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1970-10-13
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 672
| ''[[:d:Q983336|Howard Stringer]]''
| [[File:Sir Howard Stringer Shankbone Metropolitan Opera 2009.jpg|center|128px]]
| 1942-02-19
|
| [[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 673
| ''[[:d:Q984365|Nathan Walker]]''
| [[File:Nathan Walker.jpg|center|128px]]
| 1994-02-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 674
| ''[[:d:Q984430|Ranulf de Blondeville]]''
| [[File:Ranulf de Blondeville.jpg|center|128px]]
| 1170
| 1232
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 675
| ''[[:d:Q985138|W. H. Davies]]''
| [[File:William Henry Davies.jpg|center|128px]]
| 1871-07-03
| 1940-09-26
| [[Newport]]
|-
| style='text-align:right'| 676
| ''[[:d:Q986620|Anthony Llewellyn]]''
| [[File:AnthonyLlewellyn.jpg|center|128px]]
| 1933-04-22
| 2013-07-02
| [[Cairdiff]]
|-
| style='text-align:right'| 677
| ''[[:d:Q994769|Robin Llwyd ab Owain]]''
| [[File:Paris 2005 Robin Owain.jpg|center|128px]]
| 1958-06
|
| ''[[:d:Q5200185|Cynwyd]]''
|-
| style='text-align:right'| 678
| ''[[:d:Q995315|Bryony Worthington, Baroness Worthington]]''
| [[File:Bryony Worthington, Baroness Worthington (born 1971) at World Economic Forum Davos 2021.png|center|128px]]
| 1971-09-19
|
| [[Wales]]
|-
| style='text-align:right'| 679
| ''[[:d:Q1003578|Franklin Saunders]]''
|
| 1891-06-03
|
| [[Swansea]]
|-
| style='text-align:right'| 680
| ''[[:d:Q1025420|Caesar Jenkyns]]''
| [[File:CaesarJenkyns.jpg|center|128px]]
| 1866-08-24
| 1941-07-23
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 681
| ''[[:d:Q1029131|Camille Butcher]]''
|
| 1980-11-24
|
| [[Newport]]
|-
| style='text-align:right'| 682
| ''[[:d:Q1035345|Caradoc Freichfras]]''
|
| 470
| 5th century
| [[Wales]]
|-
| style='text-align:right'| 683
| ''[[:d:Q1036305|Carissa Turner]]''
|
| 1989-08-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 684
| ''[[:d:Q1046824|David Sullivan]]''
| [[File:David Sullivan co-owner West Ham United F.C..jpg|center|128px]]
| 1949-02-05<br/>1949-02-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 685
| ''[[:d:Q1055273|Cerith Wyn Evans]]''
|
| 1958
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 686
| ''[[:d:Q1056022|Howard King]]''
|
| 1946-09-01
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 687
| ''[[:d:Q1058973|Jessica Sula]]''
| [[File:Jessica Sula.jpg|center|128px]]
| 1994-05-03
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 688
| ''[[:d:Q1061908|Michael Owen]]''
|
| 1980-11-07
|
| [[Pontypridd]]
|-
| style='text-align:right'| 689
| ''[[:d:Q1063375|Madog ap Llywelyn]]''
|
|
| 1312
| [[Gwynedd]]
|-
| style='text-align:right'| 690
| ''[[:d:Q1063535|Charles Green]]''
| [[File:Bp Charles Green NPG.jpg|center|128px]]
| 1864-08-19
| 1944-05-07
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 691
| ''[[:d:Q1064759|C. H. Dodd]]''
|
| 1884-04-07
| 1973-09-21
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 692
| ''[[:d:Q1065207|Tom Richards]]''
| [[File:Thomas Richards.jpg|center|128px]]
| 1910-03-15
| 1985-01-19
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 693
| ''[[:d:Q1076979|Chris Bartley]]''
| [[File:Chris Bartley2.JPG|center|128px]]
| 1984-02-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 694
| ''[[:d:Q1077147|Chris Czekaj]]''
|
| 1985-12-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 695
| ''[[:d:Q1077808|Chris Type]]''
|
| 1981-10-05
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 696
| ''[[:d:Q1082835|Peter Wingfield]]''
| [[File:Peter Wingfield 20100701 Japan Expo 1.jpg|center|128px]]
| 1962-09-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 697
| ''[[:d:Q1087011|Christopher Timothy]]''
| [[File:Christopher Timothy.jpg|center|128px]]
| 1940-10-14
|
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 698
| ''[[:d:Q1088014|Saunt Tewdrig]]''
| [[File:Tewdrig Sant.JPG|center|128px]]
| 6th century
| No/unknown value
| ''[[:d:Q2253783|Kingdom of Glywysing]]''<br/>[[Wales]]
|-
| style='text-align:right'| 699
| ''[[:d:Q1088032|Llywelyn Bren]]''
|
| 1267
| 1318
| ''[[:d:Q3404686|Senghenydd]]''
|-
| style='text-align:right'| 700
| ''[[:d:Q1092611|Mark Bowen]]''
|
| 1963-12-07
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 701
| ''[[:d:Q1099281|Clayton Blackmore]]''
| [[File:Clayton Blackmore juli 1991.JPG|center|128px]]
| 1964-09-23
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 702
| ''[[:d:Q1101163|Cliff Jones]]''
| [[File:Cliff Jones.jpg|center|128px]]
| 1935-02-07
|
| [[Swansea]]
|-
| style='text-align:right'| 703
| ''[[:d:Q1101282|John Gow]]''
|
| 1930
| 2017-03-19
| [[Swansea]]
|-
| style='text-align:right'| 704
| ''[[:d:Q1102013|C. W. Nicol]]''
| [[File:C.W. Nicol - Headshot in Afan Woodland.jpg|center|128px]]
| 1940-07-17
| 2020-04-03
| [[Neath Port Talbot]]
|-
| style='text-align:right'| 705
| ''[[:d:Q1103370|Stuart Robbins]]''
|
| 1976-11-02
| 2010-04-12
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 706
| ''[[:d:Q1103503|Terry Yorath]]''
| [[File:Terry Yorath, Wales Team, 1988.jpg|center|128px]]
| 1950-03-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 707
| ''[[:d:Q1103587|Gareth Roberts]]''
| [[File:Gareth Roberts.jpg|center|128px]]
| 1978-02-06
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 708
| ''[[:d:Q1106063|Keith Cooper]]''
|
| 1948-03-21
|
| [[Wales]]
|-
| style='text-align:right'| 709
| ''[[:d:Q1106064|Keith Burge]]''
|
| 1950-08-10
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 710
| ''[[:d:Q1115849|Jonathan Davies]]''
|
| 1962-10-24
|
| ''[[:d:Q7842265|Trimsaran]]''
|-
| style='text-align:right'| 711
| ''[[:d:Q1118055|Sydenham Edwards]]''
|
| 1768
| 1819-02-08
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 712
| ''[[:d:Q1118742|James Brewerton]]''
|
| 1979-11-17
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 713
| ''[[:d:Q1125037|John Elsworthy]]''
|
| 1931-07-26
| 2009-05-03
| ''[[:d:Q6964261|Nant-y-derry]]''
|-
| style='text-align:right'| 714
| ''[[:d:Q1129178|Leo Callaghan]]''
|
| 1924-02-05
| 1987-01-08
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 715
| ''[[:d:Q1130154|Gwilym Jenkins]]''
|
| 1932-08-12
| 1982-07-10
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 716
| ''[[:d:Q1130431|Grace Williams]]''
|
| 1906-02-19
| 1977-02-10
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 717
| ''[[:d:Q1131742|Iorwerth Jones]]''
|
| 1927-12-18
| 2023-10-30
| ''[[:d:Q7837990|Trelewis]]''
|-
| style='text-align:right'| 718
| ''[[:d:Q1138615|Craig Mitchell]]''
|
| 1986-05-03
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 719
| ''[[:d:Q1148624|Cyril Frank Colebrook]]''
|
| 1910-07-26
| 1997-01-12
| [[Swansea]]
|-
| style='text-align:right'| 720
| ''[[:d:Q1148937|Iwan Rheon]]''
| [[File:Iwan Rheon by Gage Skidmore.jpg|center|128px]]
| 1985-05-13
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 721
| ''[[:d:Q1153445|Richard Ellis]]''
| [[File:Richard Ellis recipient of the 2023 Gruber Cosmology Prize (iau2302).jpg|center|128px]]
| 1950-05-25
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 722
| ''[[:d:Q1153763|Robin McBryde]]''
|
| 1970-07-03
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 723
| ''[[:d:Q1157150|Dafydd Iwan]]''
| [[File:Dafydd Iwan from Emynau album cover.jpg|center|128px]]
| 1943-08-24
|
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 724
| ''[[:d:Q1157152|Dafydd Llywelyn]]''
|
| 1939-01-10
| 2013-03-25
| [[Sooth Wales]]
|-
| style='text-align:right'| 725
| ''[[:d:Q1157156|Dafydd ap Llywelyn]]''
| [[File:Llywelyn the Great (Dafydd).JPG|center|128px]]
| 1215<br/>1208-03
| 1246-02-25
| [[Wales]]
|-
| style='text-align:right'| 726
| ''[[:d:Q1157833|Dale Appleby]]''
| [[File:Dale Appleby - Sachsentour.JPG|center|128px]]
| 1986-12-09
|
| [[Pontypridd]]
|-
| style='text-align:right'| 727
| ''[[:d:Q1158997|Dan Biggar]]''
| [[File:Dan Biggar 2015.jpg|center|128px]]
| 1989-10-16
|
| [[Swansea]]
|-
| style='text-align:right'| 728
| ''[[:d:Q1160939|Daniel Granville West, Baron Granville-West]]''
|
| 1904-03-17
| 1984-09-23
| [[Newport]]
|-
| style='text-align:right'| 729
| ''[[:d:Q1161262|Daniel Jones]]''
|
| 1912-12-07
| 1993-04-23
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 730
| ''[[:d:Q1164478|Dannie Abse]]''
| [[File:Dannie Abse (2014).jpg|center|128px]]
| 1923-09-22
| 2014-09-28
| [[Cairdiff]]
|-
| style='text-align:right'| 731
| ''[[:d:Q1166651|Darren Morgan]]''
| [[File:Darren Morgan.jpg|center|128px]]
| 1966-05-03
|
| [[Newport]]
|-
| style='text-align:right'| 732
| ''[[:d:Q1173794|David Bowen]]''
|
| 1924-01-31
| 2011-03-31
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 733
| ''[[:d:Q1173795|David Bower]]''
|
| 1969-03
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 734
| ''[[:d:Q1174338|David Emanuel]]''
|
| 1952-11-17
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 735
| ''[[:d:Q1175222|David Lewis]]''
| [[File:Saint David Lewis, engraving 1683.jpg|center|128px]]
| 1616
| 1679-08-27
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 736
| ''[[:d:Q1176710|David Stanley Evans]]''
|
| 1916-01-28
| 2004-11-14
| [[Cairdiff]]
|-
| style='text-align:right'| 737
| ''[[:d:Q1176748|David Stoddart, Baron Stoddart of Swindon]]''
| [[File:Lord Stoddart.jpg|center|128px]]
| 1926-05-04
| 2020-11-14
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 738
| ''[[:d:Q1176766|David Broucher]]''
|
| 1944-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 739
| ''[[:d:Q1177203|David Williams]]''
| [[File:David Williams (mathematician).jpg|center|128px]]
| 1938-04-09
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 740
| ''[[:d:Q1179039|Rob Jones]]''
| [[File:Rob Jones.JPG|center|128px]]
| 1971-11-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 741
| ''[[:d:Q1179945|Frederick Green]]''
| [[File:Oxford univ afc 1874.jpg|center|128px]]
| 1851-06-21
| 1928-07-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 742
| ''[[:d:Q1181577|Deborah Kay Davies]]''
|
| 20th century
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 743
| ''[[:d:Q1183309|Deiniol Jones]]''
|
| 1977-11-18
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 744
| ''[[:d:Q1183310|Deiniol]]''
| [[File:Deiniol Sant Cadeirlan Bangor Cathedral St Deiniol - geograph.org.uk - 593071.jpg|center|128px]]
| 530
| 584
| [[Wales]]
|-
| style='text-align:right'| 745
| ''[[:d:Q1189996|James Fox]]''
| [[File:James Fox.jpg|center|128px]]
| 1976-04-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 746
| ''[[:d:Q1191188|Neil Taylor]]''
| [[File:Neil Taylor vs Arsenal (cropped).jpg|center|128px]]
| 1989-02-07
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 747
| ''[[:d:Q1193243|John T. Houghton]]''
| [[File:John Houghton High Wycombe 20050226.jpg|center|128px]]
| 1931-12-30
| 2020-04-15
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 748
| ''[[:d:Q1195620|Aled Eames]]''
|
| 1921-07-29
| 1996-03-07
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 749
| ''[[:d:Q1200134|Derek Vaughan]]''
| [[File:Visit of Derek Vaughan to the European Commission - 2023 (cropped).jpg|center|128px]]
| 1961-05-02
|
| ''[[:d:Q3244565|Aberfan]]''
|-
| style='text-align:right'| 750
| ''[[:d:Q1209771|Dick Richardson]]''
|
| 1934-06-01
| 1999-07-15
| [[Newport]]
|-
| style='text-align:right'| 751
| ''[[:d:Q1225513|Dill Jones]]''
|
| 1923-08-19
| 1984-06-22
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 752
| ''[[:d:Q1230607|John Owen]]''
|
| 1564
| 1622
| ''[[:d:Q29497284|Plas Du]]''
|-
| style='text-align:right'| 753
| ''[[:d:Q1237175|William Cadogan]]''
| [[File:William Cadogan (physician).jpg|center|128px]]
| 1711
| 1797-02-26
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 754
| ''[[:d:Q1240231|Donald Peers]]''
|
| 1908-07-10
| 1973-08-09<br/>1973-08-08
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 755
| ''[[:d:Q1240482|Donald Davies]]''
| [[File:Donald Davies.jpg|center|128px]]
| 1924-06-07
| 2000-05-28
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 756
| ''[[:d:Q1247700|Clive Merrison]]''
|
| 1945-09-15
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 757
| ''[[:d:Q1249040|Richard Maybery]]''
| [[File:Richard Maybery aviator.jpg|center|128px]]
| 1895-01-04
| 1917-12-19
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 758
| ''[[:d:Q1251830|Doug Mountjoy]]''
|
| 1942-06-08
| 2021-02-14
| ''[[:d:Q105630108|Tir-y-berth]]''
|-
| style='text-align:right'| 759
| ''[[:d:Q1255546|Samuel Parry]]''
|
| 1892
| 1918-05-03
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 760
| ''[[:d:Q1257097|Mark Rowlands]]''
| [[File:Mark Rowlands 2012.jpg|center|128px]]
| 1962
|
| [[Newport]]
|-
| style='text-align:right'| 761
| ''[[:d:Q1258743|Wenna]]''
|
| 463<br/>5th century
| 544-10-18
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 762
| ''[[:d:Q1267203|Gwyneth Glyn]]''
| [[File:Gwyneth Glyn5638.JPG|center|128px]]
| 1979-12-14
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 763
| ''[[:d:Q1269091|Samson Dol]]''
| [[File:Saint Samson.jpg|center|128px]]
| 490
| 565-07-28
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 764
| ''[[:d:Q1273470|E. Brian Davies]]''
| [[File:EbdAlone14012016.jpg|center|128px]]
| 1944-06-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 765
| ''[[:d:Q1281133|Tudwal]]''
| [[File:Saint Tugdual.jpg|center|128px]]
| 490
| 564
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 766
| ''[[:d:Q1282921|Eddie Niedzwiecki]]''
|
| 1959-05-03
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 767
| ''[[:d:Q1292893|Edward Lord]]''
|
| 1781-06-15
| 1859-09-14
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 768
| ''[[:d:Q1293017|Tysilio]]''
| [[File:Buste reliquaire de saint Suliac, Sizun, France.jpg|center|128px]]
| 6th century
| 640
| ''[[:d:Q769782|Kingdom of Powys]]''
|-
| style='text-align:right'| 769
| ''[[:d:Q1293238|George Noakes]]''
|
| 1924-09-13
| 2008-07-14
| [[Ceredigion]]
|-
| style='text-align:right'| 770
| ''[[:d:Q1293950|Edward V. Robertson]]''
| [[File:Edward V Robertson.jpg|center|128px]]
| 1881-05-27
| 1963-04-15
| [[Cairdiff]]
|-
| style='text-align:right'| 771
| ''[[:d:Q1302516|Karl Wallinger]]''
| [[File:Karl Wallinger.jpg|center|128px]]
| 1957-10-19
| 2024-03-10
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 772
| ''[[:d:Q1302969|Eifion Lewis-Roberts]]''
| [[File:Eifion Lewis Roberts (cropped).jpg|center|128px]]
| 1981-02-13
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 773
| ''[[:d:Q1306352|Stanley Baker]]''
| [[File:Sean Connery visit Israel 1967 I.jpg|center|128px]]
| 1928-02-28
| 1976-06-28
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 774
| ''[[:d:Q1310059|Richard Wilson, Baron Wilson of Dinton]]''
| [[File:Official portrait of Lord Wilson of Dinton crop 2, 2022.jpg|center|128px]]
| 1942-10-11
|
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 775
| ''[[:d:Q1310576|Eirian Williams]]''
| [[File:Eirian Williams at Snooker German Masters (DerHexer) 2013-01-30 02.jpg|center|128px]]
| 1955-09-03
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 776
| ''[[:d:Q1320386|Thomas Olivers]]''
| [[File:Thomas Olivers.jpg|center|128px]]
| 1725
| 1799-03
| ''[[:d:Q7837893|Tregynon]]''
|-
| style='text-align:right'| 777
| ''[[:d:Q1329543|Elinor Barker]]''
| [[File:UCI Track World Championships 2020 154.jpg|center|128px]]
| 1994-09-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 778
| ''[[:d:Q1331208|Elizabeth Grünbaum]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 779
| ''[[:d:Q1331217|Elizabeth Griffith]]''
| [[File:Elizabeth griffith.jpg|center|128px]]
| 1727-10-11
| 1793-01-05
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 780
| ''[[:d:Q1333178|Neil Sloane]]''
| [[File:N. J. A. Sloane.jpg|center|128px]]
| 1939-10-10
|
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 781
| ''[[:d:Q1337615|Emily Pfeiffer]]''
| [[File:Emily Pfeiffer.png|center|128px]]
| 1827-11-26
| 1890-01-23
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 782
| ''[[:d:Q1338420|Thomas Button]]''
| [[File:Thomas Button.png|center|128px]]
| 1575<br/>1565
| 1634-04<br/>1634-04-06
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 783
| ''[[:d:Q1343140|Paul Whitehouse]]''
| [[File:Paul Whitehouse in 2017.jpg|center|128px]]
| 1958-05-17
|
| ''[[:d:Q7600082|Stanleytown]]''
|-
| style='text-align:right'| 784
| ''[[:d:Q1343564|Tom Ellis]]''
| [[File:Tom Ellis (2016).jpg|center|128px]]
| 1978-11-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 785
| ''[[:d:Q1351086|Eric Barnes]]''
|
| 1924-01-16
| 2000-10-16
| [[Cairdiff]]
|-
| style='text-align:right'| 786
| ''[[:d:Q1356371|Ernest Howard Griffiths]]''
| [[File:Ernest Howard Griffiths.jpg|center|128px]]
| 1851-06-15
| 1932-03-03
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 787
| ''[[:d:Q1360094|Terry Medwin]]''
|
| 1932-09-25
| 2024-05-01
| [[Swansea]]
|-
| style='text-align:right'| 788
| ''[[:d:Q1361619|Rhys Taylor]]''
| [[File:Taylor, Rhys.jpg|center|128px]]
| 1990-04-07
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 789
| ''[[:d:Q1368597|David Taylor]]''
|
| 1965-08-25
|
| [[Wales]]
|-
| style='text-align:right'| 790
| ''[[:d:Q1369409|Thomas James]]''
| [[File:The Strange and Dangerous Voyage (Thomas James, 1633) - 3 foldout map The Platt of Sayling - 2 The True Portraict.png|center|128px]]
| 1593
| 1635
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 791
| ''[[:d:Q1371735|Julian Cope]]''
| [[File:Julian Cope (cropped).jpg|center|128px]]
| 1957-10-21
|
| ''[[:d:Q5262556|Deri]]''
|-
| style='text-align:right'| 792
| ''[[:d:Q1379647|Evan Evans]]''
|
| 1765-08-04
| 1844-12-09
| [[Wales]]
|-
| style='text-align:right'| 793
| ''[[:d:Q1379655|Evan James Williams]]''
|
| 1903-06-08
| 1945
| ''[[:d:Q15987289|Cwmsychbant]]''
|-
| style='text-align:right'| 794
| ''[[:d:Q1380259|Lee Byrne]]''
|
| 1980-06-01
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 795
| ''[[:d:Q1380938|Stephen Jones]]''
| [[File:Stephen Jones 2014.jpg|center|128px]]
| 1977-12-08
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 796
| ''[[:d:Q1380953|John Bufton]]''
| [[File:John Bufton UKIP MEP for Wales.JPG|center|128px]]
| 1962-08-31
|
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 797
| ''[[:d:Q1380989|Jimmy Wilde]]''
| [[File:Jimmy Wilde.jpg|center|128px]]
| 1892-05-15
| 1969-03-10
| ''[[:d:Q7268591|Quakers Yard]]''
|-
| style='text-align:right'| 798
| ''[[:d:Q1381003|Rhys ap Tewdwr]]''
|
| 997
| 1093
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 799
| ''[[:d:Q1381032|Phil Bennett]]''
| [[File:Phil Bennett.jpg|center|128px]]
| 1948-10-24
| 2022-06-12
| ''[[:d:Q5441920|Felinfoel]]''
|-
| style='text-align:right'| 800
| ''[[:d:Q1381089|Gareth Edwards]]''
| [[File:Gareth Edwards 2014.jpg|center|128px]]
| 1947-07-12
|
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 801
| ''[[:d:Q1381114|Tom James]]''
| [[File:Tom James MBE.jpg|center|128px]]
| 1984-03-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 802
| ''[[:d:Q1381233|Neil Jenkins]]''
| [[File:Neil Jenkins. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1971-07-08
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 803
| ''[[:d:Q1381454|Gomer Edwin Evans]]''
|
| 1947-09-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 804
| ''[[:d:Q1386825|Ryan Jones]]''
| [[File:Ryan Jones. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1981-03-13
|
| [[Newport]]
|-
| style='text-align:right'| 805
| ''[[:d:Q1388537|Hedd Wyn]]''
| [[File:Hedd Wyn 01(a-dg).JPG|center|128px]]
| 1887-01-13
| 1917-07-31
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 806
| ''[[:d:Q1391397|Steve Jones]]''
| [[File:Steve Jones.png|center|128px]]
| 1944-03-24
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 807
| ''[[:d:Q1396040|Sue Jones-Davies]]''
|
| 1949-01-01
|
| [[Wales]]
|-
| style='text-align:right'| 808
| ''[[:d:Q1397897|Rhys Williams]]''
| [[File:Rhys Williams 2006.jpg|center|128px]]
| 1984-02-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 809
| ''[[:d:Q1397946|Lewis Bayly]]''
|
| 1565
| 1631-10-26
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 810
| ''[[:d:Q1398346|Leigh Halfpenny]]''
| [[File:Leigh Halfpenny. Wales Grand Slam Celebration, Senedd 19 March 2012 Leigh Halfpenny. Dathliadau Camp Lawn Cymru, Senedd 19 Mawrth 2012.jpg|center|128px]]
| 1988-12-22
|
| [[Swansea]]
|-
| style='text-align:right'| 811
| ''[[:d:Q1398384|Gruffudd ap Llywelyn ab Iorwerth]]''
| [[File:Llywelyn the Great (Gruffudd).JPG|center|128px]]
| 1200
| 1244-03-01
| [[Gwynedd]]
|-
| style='text-align:right'| 812
| ''[[:d:Q1403116|Arthur Gould]]''
| [[File:Arthur Gould, Newport.jpeg|center|128px]]
| 1864-10-10
| 1919-01-02
| [[Newport]]
|-
| style='text-align:right'| 813
| ''[[:d:Q1403137|Dewi Bebb]]''
|
| 1938-08-07
| 1996-03-14
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 814
| ''[[:d:Q1403150|Derek Quinnell]]''
|
| 1949-05-22
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 815
| ''[[:d:Q1404569|Gareth Jenkins]]''
|
| 1951-09-11
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 816
| ''[[:d:Q1404576|Mike Ruddock]]''
|
| 1959-09-05
|
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 817
| ''[[:d:Q1405258|Jamie Oliver]]''
| [[File:Lostprophetswarped2012mansfield.jpg|center|128px]]
| 1975-07-16
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 818
| ''[[:d:Q1405477|Robert Griffiths]]''
| [[File:Robert Griffiths, Britain Needs Socialism, 2011.jpg|center|128px]]
| 1952-04-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 819
| ''[[:d:Q1407412|Watcyn Thomas]]''
|
| 1906-01-16
| 1977-08-10
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 820
| ''[[:d:Q1407544|Stuart Richardson]]''
| [[File:Stuleedswikipic.JPG|center|128px]]
| 1973-08-15
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 821
| ''[[:d:Q1410416|Jim Sullivan]]''
|
| 1903-12
| 1977-11-01
| [[Cairdiff]]
|-
| style='text-align:right'| 822
| ''[[:d:Q1418483|Geraint Howells]]''
| [[File:Geraint Howells cropped.jpg|center|128px]]
| 1925-04-15
| 2004-04-17
| ''[[:d:Q3399417|Ponterwyd]]''
|-
| style='text-align:right'| 823
| ''[[:d:Q1422009|Valerie Davies]]''
|
| 1912-06-29
| 2001-08-02
| [[Cairdiff]]
|-
| style='text-align:right'| 824
| ''[[:d:Q1423384|Matt Crowell]]''
|
| 1984-07-03
|
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 825
| ''[[:d:Q1423984|Lee Williams]]''
|
| 1974-04-03
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 826
| ''[[:d:Q1427818|Kai Owen]]''
| [[File:Kai Owen Fedcon.jpg|center|128px]]
| 1975-09-04
|
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 827
| ''[[:d:Q1428289|Steve Speirs]]''
|
| 1965-02-22
|
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 828
| ''[[:d:Q1428717|Matthew Rowe]]''
|
| 1988-04-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 829
| ''[[:d:Q1432739|Roy Evans]]''
|
| 1909-10-08
| 1998-05-18
| [[Cairdiff]]
|-
| style='text-align:right'| 830
| ''[[:d:Q1438867|T. G. Jones]]''
|
| 1917-10-12
| 2004-01-03
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 831
| ''[[:d:Q1451848|Brian Godfrey]]''
|
| 1940-05-01
| 2010-02-11
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 832
| ''[[:d:Q1463642|Wallace Smart]]''
|
| 1898-01-07
| 1943-12-23
| [[Cairdiff]]
|-
| style='text-align:right'| 833
| ''[[:d:Q1465068|George Cornwallis-West]]''
| [[File:Georgecornwalliswest.jpg|center|128px]]
| 1874-11-14
| 1951-04-01
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 834
| ''[[:d:Q1475708|Michael Kerstgens]]''
|
| 1960
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 835
| ''[[:d:Q1492803|Nick Whitehead]]''
|
| 1933-05-29
| 2002-10-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 836
| ''[[:d:Q1493339|Pete Ham]]''
| [[File:Pete ham.jpg|center|128px]]
| 1947-04-27
| 1975-04-24
| [[Swansea]]
|-
| style='text-align:right'| 837
| ''[[:d:Q1494329|Mika Chunuonsee]]''
| [[File:Mika Chunuonsee 20180316.jpg|center|128px]]
| 1989-03-26
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 838
| ''[[:d:Q1496438|Gavin Henson]]''
| [[File:Gavin Henson.JPG|center|128px]]
| 1982-02-01
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 839
| ''[[:d:Q1502967|Geoffrey Eglinton]]''
|
| 1927-11-01
| 2016-03-11
| [[Cairdiff]]
|-
| style='text-align:right'| 840
| ''[[:d:Q1507413|Mary Fulbrook]]''
|
| 1951-11-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 841
| ''[[:d:Q1507985|George Nevill, 5th Baron Bergavenny]]''
| [[File:Portrait George Nevill, 5th Baron Bergavenny – Hans Holbein the Younger.jpg|center|128px]]
| 1469
| 1535
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 842
| ''[[:d:Q1517534|John Rees]]''
|
| 1927-03-06
| 1994-10
| [[Wales]]
|-
| style='text-align:right'| 843
| ''[[:d:Q1523841|Gil Reece]]''
|
| 1942-07-02
| 2003-12-20
| [[Cairdiff]]
|-
| style='text-align:right'| 844
| ''[[:d:Q1528561|Ivor Bulmer-Thomas]]''
|
| 1905-11-30
| 1993-10-07
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 845
| ''[[:d:Q1529691|Tom Burke]]''
|
| 1864
| 1914-02-09
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 846
| ''[[:d:Q1530769|Glen Garfield Williams]]''
|
| 1923-09-14
| 1994-03-28
| [[Newport]]
|-
| style='text-align:right'| 847
| ''[[:d:Q1533250|Jonathan Neil Morgan]]''
|
| 1979-05-20
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 848
| ''[[:d:Q1536332|Robert Jenkins]]''
|
| 1700
| 1745
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 849
| ''[[:d:Q1536928|Richard Bell]]''
| [[File:Richard Bell.JPG|center|128px]]
| 1859-11-27
| 1930-05-01
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 850
| ''[[:d:Q1538550|Howard Saint]]''
| [[File:Howard Saint.jpg|center|128px]]
| 1893-01-20
| 1976
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 851
| ''[[:d:Q1538588|Hubert Jones]]''
| [[File:Hubert Jones.jpg|center|128px]]
| 1890-10-07
| 1943-05-14
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 852
| ''[[:d:Q1541902|Graham Bool]]''
|
| 1948-01-22
| 2010-09-17
| [[Cairdiff]]
|-
| style='text-align:right'| 853
| ''[[:d:Q1543275|Granville Beynon]]''
|
| 1914-05-24
| 1996-03-11
| ''[[:d:Q5315782|Dyfnant]]''
|-
| style='text-align:right'| 854
| ''[[:d:Q1545710|Grenville Morris]]''
|
| 1877-04-13
| 1959-11-27
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 855
| ''[[:d:Q1546121|Greville Janner, Baron Janner of Braunstone]]''
| [[File:Lord janner.jpg|center|128px]]
| 1928-07-11
| 2015-12-19
| [[Cairdiff]]
|-
| style='text-align:right'| 856
| ''[[:d:Q1546589|Griff Rhys Jones]]''
| [[File:Griff Rhys Jones 2019.png|center|128px]]
| 1953-11-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 857
| ''[[:d:Q1549580|Michael Williams]]''
| [[File:Lordwilliams.jpg|center|128px]]
| 1949-06-11
| 2017-04-23
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 858
| ''[[:d:Q1555434|Kevin Ratcliffe]]''
| [[File:Kevin Ratcliffe - Panini Football 84 (cropped).png|center|128px]]
| 1960-11-12
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 859
| ''[[:d:Q1557879|Gwilym Prys Prys-Davies, Baron Prys-Davies]]''
|
| 1923-12-08
| 2017-03-28
| ''[[:d:Q13129617|Llanegryn]]''
|-
| style='text-align:right'| 860
| ''[[:d:Q1557923|Gwyn Ashton]]''
| [[File:Gwyn Ashton.jpg|center|128px]]
| 1961
|
| [[Wales]]
|-
| style='text-align:right'| 861
| ''[[:d:Q1557927|Gwyn Prosser]]''
|
| 1943-04-27
|
| [[Swansea]]
|-
| style='text-align:right'| 862
| ''[[:d:Q1558855|Paul James]]''
| [[File:Paul James. Wales Grand Slam Celebration, Senedd 19 March 2012 (cropped).jpg|center|128px]]
| 1982-05-13
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 863
| ''[[:d:Q1562304|Tony Cowell]]''
|
| 1950
|
| [[Wales]]
|-
| style='text-align:right'| 864
| ''[[:d:Q1565118|Gerald Battrick]]''
| [[File:Internationale tenniskampioenschappen te Hilversum, G Battrick met beker, Bestanddeelnr 924-7801.jpg|center|128px]]
| 1947-05-27
| 1998-11-26
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 865
| ''[[:d:Q1565612|George Henry Powell]]''
|
| 1880-04-27
| 1951-12-03
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 866
| ''[[:d:Q1585304|Sir Harford Jones-Brydges, 1st Baronet]]''
| [[File:Portrait of Sir Harford Jones Brydges by Sir Thomas Lawrence.jpg|center|128px]]
| 1764-01-12
| 1847-03-17
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 867
| ''[[:d:Q1585788|Harold Carter]]''
|
| 1925-04-14
| 2017-11-30
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 868
| ''[[:d:Q1586685|Harry Parry]]''
|
| 1912-01-22
| 1956-10-18
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 869
| ''[[:d:Q1586858|Harry Thomas]]''
|
| 1901-02-28
| No/unknown value
| [[Swansea]]
|-
| style='text-align:right'| 870
| ''[[:d:Q1587265|Tom Jones]]''
|
| 1899-12-06
| 1978-02-20
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 871
| ''[[:d:Q1592323|Ronald Noel Walpole]]''
|
| 1903-12-24
| 1986-11
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 872
| ''[[:d:Q1601789|Heledd ferch Cyndrwyn]]''
|
|
|
| ''[[:d:Q837136|Kingdom of Deheubarth]]''
|-
| style='text-align:right'| 873
| ''[[:d:Q1606988|Henry Lloyd]]''
|
| 1720
| 1783-06-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 874
| ''[[:d:Q1618119|Hilary Marquand]]''
| [[File:Hilary Marquand.png|center|128px]]
| 1901-12-24
| 1972-11-06
| [[Cairdiff]]
|-
| style='text-align:right'| 875
| ''[[:d:Q1620977|Jeff Young]]''
|
| 1942-09-16
| 2005-10-03
| [[Wales]]
|-
| style='text-align:right'| 876
| ''[[:d:Q1631875|Howard Marks]]''
| [[File:Dennis Howard Marks (2000).PNG|center|128px]]
| 1945-08-13
| 2016-04-10
| ''[[:d:Q6389163|Kenfig Hill]]''
|-
| style='text-align:right'| 877
| ''[[:d:Q1631915|Howard Spring]]''
|
| 1889-02-10
| 1965-05-03
| [[Cairdiff]]
|-
| style='text-align:right'| 878
| ''[[:d:Q1633006|Darcy Blake]]''
| [[File:Darcy Blake Wales.jpg|center|128px]]
| 1988-12-13
|
| ''[[:d:Q3402398|New Tredegar]]''
|-
| style='text-align:right'| 879
| ''[[:d:Q1634494|Hugh Owen Thomas]]''
| [[File:Hugh Owen Thomas.jpg|center|128px]]
| 1834-08-23
| 1891-01-06
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 880
| ''[[:d:Q1637205|Rachel Trezise]]''
|
| 1978-07-03
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 881
| ''[[:d:Q1639396|Huw Warren]]''
| [[File:Huw warren high res.jpg|center|128px]]
| 1962-05-18
|
| [[Swansea]]
|-
| style='text-align:right'| 882
| ''[[:d:Q1645638|Lyndon Williams]]''
|
| 1964-10-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 883
| ''[[:d:Q1646990|Matthew Williams]]''
| [[File:Williams, Matthew.jpg|center|128px]]
| 1982-11-05
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 884
| ''[[:d:Q1649429|Owen Morris]]''
|
| 1968-05-13
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 885
| ''[[:d:Q1650964|Ron Stitfall]]''
|
| 1925-12-14
| 2008-06-22
| [[Cairdiff]]
|-
| style='text-align:right'| 886
| ''[[:d:Q1655550|Ian Hislop]]''
| [[File:Ian Hislop - 2009.jpg|center|128px]]
| 1960-07-13
|
| ''[[:d:Q1952591|The Mumbles]]''
|-
| style='text-align:right'| 887
| ''[[:d:Q1655630|Ian Simmonds]]''
| [[File:Ian simmonds 2009.jpg|center|128px]]
| 1966
|
| [[Wales]]
|-
| style='text-align:right'| 888
| ''[[:d:Q1655632|Ian Shaw]]''
|
| 1962-06-02
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 889
| ''[[:d:Q1655682|Ian Whyte]]''
| [[File:Stuttgart 2024 - ComicCon - Ian Whyte - by-RaBoe 007.jpg|center|128px]]
| 1971-09-17
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 890
| ''[[:d:Q1663616|Roger Roberts, Baron Roberts of Llandudno]]''
| [[File:Roger Roberts at Bournemouth.jpg|center|128px]]
| 1935-10-23
|
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 891
| ''[[:d:Q1665252|Lewis Oliva]]''
| [[File:2015 UEC Track Elite European Championships 174.JPG|center|128px]]
| 1992-08-23
|
| ''[[:d:Q5266612|Devauden]]''
|-
| style='text-align:right'| 892
| ''[[:d:Q1670013|Raymond FitzGerald]]''
| [[File:National Library of Ireland MS 700 f77v Raymond de Gros.jpg|center|128px]]
| 12nd century
| 1185
| [[Wales]]
|-
| style='text-align:right'| 893
| ''[[:d:Q1677227|Nathan Cleverly]]''
| [[File:Nathan Cleverly.jpg|center|128px]]
| 1987-02-17
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 894
| ''[[:d:Q1680270|James Dean Bradfield]]''
| [[File:Manic Street Preachers in London2005-4.jpg|center|128px]]
| 1969-02-21
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 895
| ''[[:d:Q1680577|James Hook]]''
| [[File:Rugby World Cup 2007 James Hook.jpg|center|128px]]
| 1985-06-27
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 896
| ''[[:d:Q1680613|James J. Davis]]''
| [[File:DAVIS, JAMES. HONORABLE LCCN2016860969.jpg|center|128px]]
| 1873-10-27
| 1947-11-22<br/>1947-11-11
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 897
| ''[[:d:Q1680829|James Miller]]''
|
| 1968-12-18
| 2003-05-02
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 898
| ''[[:d:Q1685695|Jean McFarlane, Baroness McFarlane of Llandaff]]''
|
| 1926-04-01
| 2012-05-13
| [[Cairdiff]]
|-
| style='text-align:right'| 899
| ''[[:d:Q1686156|Sian Evans]]''
| [[File:Kosheen Sian Evans Wien2008.jpg|center|128px]]
| 1971-10-09
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 900
| ''[[:d:Q1686451|Jeffrey John]]''
| [[File:Passio 2010 (5340704340) (Jeffrey John cropped).jpg|center|128px]]
| 1953-02-10
|
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 901
| ''[[:d:Q1686862|Thomas Young]]''
|
| 1507
| 1568-06-26
| ''[[:d:Q19850630|Hodgeston]]''
|-
| style='text-align:right'| 902
| ''[[:d:Q1691410|Joe Erskine]]''
|
| 1934-01-26
| 1990-02-18
| [[Cairdiff]]
|-
| style='text-align:right'| 903
| ''[[:d:Q1691828|Joey Jones]]''
|
| 1955-03-04
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 904
| ''[[:d:Q1699100|John Ainsworth-Davis]]''
| [[File:Butler, Ainsworth-Davis, Lindsay, Griffiths 1920.jpg|center|128px]]
| 1895-04-23
| 1976-01-03
| [[Aberystwyth]]
|-
| style='text-align:right'| 905
| ''[[:d:Q1699421|John Brooks, Baron Brooks of Tremorfa]]''
|
| 1927-04-12
| 2016-03-04
| [[Cairdiff]]
|-
| style='text-align:right'| 906
| ''[[:d:Q1700056|John Ffowcs Williams]]''
|
| 1935-05-25
| 2020-12-12
| [[Wales]]
|-
| style='text-align:right'| 907
| ''[[:d:Q1700207|John Gibson]]''
| [[File:John Gibson by Margaret Sarah Carpenter (née Geddes).jpg|center|128px]]
| 1790-06-19
| 1866-01-27
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 908
| ''[[:d:Q1700863|John Llewellyn Rhys]]''
|
| 1910
| 1940-08-05
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 909
| ''[[:d:Q1700866|John Lloyd]]''
|
| 1943-03-29
|
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 910
| ''[[:d:Q1700884|John Lort Stokes]]''
| [[File:John Lort Stokes.jpg|center|128px]]
| 1811-08-01
| 1885-06-11
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 911
| ''[[:d:Q1700954|John Maddox]]''
|
| 1925-11-27
| 2009-04-12
| ''[[:d:Q7163093|Penllergaer]]''
|-
| style='text-align:right'| 912
| ''[[:d:Q1701334|John Parsons]]''
| [[File:John Parsons..jpg|center|128px]]
| 1954
|
| [[Wales]]
|-
| style='text-align:right'| 913
| ''[[:d:Q1701605|John Rogers Thomas]]''
|
| 1830-03-26<br/>1829-03-26
| 1896-04-05
| [[Newport]]
|-
| style='text-align:right'| 914
| ''[[:d:Q1701635|John Ryan]]''
|
| 1939-09-29
| 2022-11-18
| [[Newport]]
|-
| style='text-align:right'| 915
| ''[[:d:Q1701921|John Thomas]]''
| [[File:Portrait of John Thomas (4671480).jpg|center|128px]]
| 1826-03-01
| 1913-03-19
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 916
| ''[[:d:Q1701969|Tudor Walters]]''
| [[File:Tudor Walters MP.jpg|center|128px]]
| 1868
| 1933-07-16
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 917
| ''[[:d:Q1706931|Timothy Clement-Jones, Baron Clement-Jones]]''
| [[File:Official portrait of Lord Clement-Jones crop 2, 2022.jpg|center|128px]]
| 1949-10-26
|
| [[Wales]]
|-
| style='text-align:right'| 918
| ''[[:d:Q1720081|Scott Quinnell]]''
|
| 1972-08-20
|
| [[Swansea]]
|-
| style='text-align:right'| 919
| ''[[:d:Q1738621|Ken Jones]]''
|
| 1936-01-02
| 2013-01-18
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 920
| ''[[:d:Q1738888|Kenneth Morris]]''
| [[File:Kenneth Morris.png|center|128px]]
| 1879-07-31
| 1937-04-21
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 921
| ''[[:d:Q1739190|Alex Carlile, Baron Carlile of Berriew]]''
| [[File:Official portrait of Lord Carlile of Berriew crop 2.jpg|center|128px]]
| 1948-02-12
|
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 922
| ''[[:d:Q1743733|Leslie Dilley]]''
|
| 1941-01-11
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 923
| ''[[:d:Q1743855|Thomas Jones]]''
| [[File:Thomas Jones 1742–1803.jpg|center|128px]]
| 1742-09-26
| 1803-04-29
| [[Powys]]
|-
| style='text-align:right'| 924
| ''[[:d:Q1748013|Tom Linton]]''
| [[File:Btv1b84489297-p099 (cropped).jpg|center|128px]]
| 1876-06-13
| 1914-11-13
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 925
| ''[[:d:Q1750774|Roger Rees]]''
| [[File:Roger Rees.jpg|center|128px]]
| 1944-05-05
| 2015-07-10
| [[Aberystwyth]]
|-
| style='text-align:right'| 926
| ''[[:d:Q1756405|Alfred Lawrence]]''
| [[File:1stLordTrevethin.jpg|center|128px]]
| 1843-11-24
| 1936-08-03
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 927
| ''[[:d:Q1757629|Tim Wright]]''
| [[File:Tim Wright aka CoLD SToRAGE Circa 2008.jpg|center|128px]]
| 1967-07-31
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 928
| ''[[:d:Q1767904|Twm o'r Nant]]''
| [[File:Twm o'r Nant (4702939).jpg|center|128px]]
| 1739-01
| 1810-04-03
| ''[[:d:Q13129615|Llannefydd]]''
|-
| style='text-align:right'| 929
| ''[[:d:Q1768572|Mel Rees]]''
|
| 1967-01-25
| 1993-05-30
| [[Cairdiff]]
|-
| style='text-align:right'| 930
| ''[[:d:Q1770354|Christian Ribeiro]]''
| [[File:Christian Ribeiro.jpg|center|128px]]
| 1989-12-14
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 931
| ''[[:d:Q1770803|John Humphrys]]''
| [[File:JohnHumphrys.jpg|center|128px]]
| 1943-08-17
|
| ''[[:d:Q7578756|Splott]]''
|-
| style='text-align:right'| 932
| ''[[:d:Q1771428|Craig Morgan]]''
| [[File:Morgan, Craig.jpg|center|128px]]
| 1985-06-16
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 933
| ''[[:d:Q1773997|William Edwards]]''
| [[File:Portrait of Wm. Edwards Archt (4672851) (cropped).jpg|center|128px]]
| 1719-02
| 1789-08-07
| ''[[:d:Q5348100|Eglwys Ilan]]''<br/>''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 934
| ''[[:d:Q1778676|Rhys Day]]''
|
| 1982-08-31
|
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 935
| ''[[:d:Q1799438|Michael Thomas]]''
| [[File:MichaelThomas.jpg|center|128px]]
| 1981-06-04
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 936
| ''[[:d:Q1800397|Julie Gardner]]''
| [[File:Julie Gardner at Comic Con 2008.jpg|center|128px]]
| 1969-06-04
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 937
| ''[[:d:Q1801939|Gary Taylor]]''
|
| 1961-10-14
|
| [[Wales]]
|-
| style='text-align:right'| 938
| ''[[:d:Q1803014|Albert Gladstone]]''
|
| 1886-10-28
| 1967-03-02
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 939
| ''[[:d:Q1807733|Laura Deas]]''
| [[File:2021-02-13 IBSF World Championships Bobsleigh and Skeleton Altenberg 1DX 4145 by Stepro.jpg|center|128px]]
| 1988-08-19
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 940
| ''[[:d:Q1807932|Lauren Francis]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 941
| ''[[:d:Q1808384|Becky Brewerton]]''
| [[File:2009 Women's British Open - Becky Brewerton (3).jpg|center|128px]]
| 1982-10-20
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 942
| ''[[:d:Q1811580|William Cowhig]]''
|
| 1887-04-05
| 1964-08-16
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 943
| ''[[:d:Q1815066|Leighton Rees]]''
|
| 1940-01-17
| 2003-06-08
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 944
| ''[[:d:Q1820758|Mark Lewis Jones]]''
| [[File:Mark Lewis Jones.jpg|center|128px]]
| 1964
|
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 945
| ''[[:d:Q1820785|Leslie Griffiths]]''
| [[File:The Reverend the Lord Griffiths.jpg|center|128px]]
| 1942-02-15
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 946
| ''[[:d:Q1827777|Lisa Palfrey]]''
| [[File:Lisa Palfrey, Tanjimei.jpg|center|128px]]
| 1967-02-09
|
| [[Wales]]
|-
| style='text-align:right'| 947
| ''[[:d:Q1842946|Gareth Wood]]''
|
| 1950-06-07
| 2023-08
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 948
| ''[[:d:Q1849841|Rhydian Roberts]]''
|
| 1983-02-14
|
| [[Wales]]
|-
| style='text-align:right'| 949
| ''[[:d:Q1849861|Aled Jones]]''
| [[File:Aled Jones.jpg|center|128px]]
| 1970-12-29
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 950
| ''[[:d:Q1859256|Richard Brake]]''
| [[File:Richard Brake Comic Con Brussels 2018 (cropped).jpg|center|128px]]
| 1964-11-30
|
| ''[[:d:Q1774850|Ystrad Mynach]]''
|-
| style='text-align:right'| 951
| ''[[:d:Q1866867|Llin Golding, Baroness Golding]]''
| [[File:Official portrait of Baroness Golding crop 2.jpg|center|128px]]
| 1933-03-21
|
| [[Wales]]
|-
| style='text-align:right'| 952
| ''[[:d:Q1871528|Rhodri Giggs]]''
|
| 1977-04-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 953
| ''[[:d:Q1877075|Luke Rowe]]''
| [[File:Luke Rowe (2023).jpg|center|128px]]
| 1990-03-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 954
| ''[[:d:Q1886336|Ben Johnson]]''
| [[File:Ben Johnson Liverpool.JPG|center|128px]]
| 1946-08-24
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 955
| ''[[:d:Q1886591|Mal Ryder]]''
| [[File:Mal (singer).jpg|center|128px]]
| 1944-02-27
|
| ''[[:d:Q3835725|Llanfrechfa]]''
|-
| style='text-align:right'| 956
| ''[[:d:Q1889720|Cadoc]]''
| [[File:Saint Cado.JPG|center|128px]]
| 497
| 580
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 957
| ''[[:d:Q1892607|Marc Evans]]''
| [[File:Marc Evans at JDIFF 2012.jpg|center|128px]]
| 1963
|
| [[Cairdiff]]
|-
| style='text-align:right'| 958
| ''[[:d:Q1894812|Margaret Delacourt-Smith, Baroness Delacourt-Smith of Alteryn]]''
|
| 1916-04-05
| 2010-06-08
| [[Newport]]
|-
| style='text-align:right'| 959
| ''[[:d:Q1900176|Mark Kendall]]''
|
| 1958-09-20
| 2008-05-01
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 960
| ''[[:d:Q1900455|Mark Thomas]]''
|
| 1956
| 2023-07-19
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 961
| ''[[:d:Q1903320|Martin Allen]]''
|
| 1958
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 962
| ''[[:d:Q1904830|Martin Roberts]]''
|
| 1986-06-06
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 963
| ''[[:d:Q1905135|Martin Thomas, Baron Thomas of Gresford]]''
| [[File:Official portrait of Lord Thomas of Gresford crop 2.jpg|center|128px]]
| 1937-03-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 964
| ''[[:d:Q1905841|Martyn Lewis]]''
|
| 1982-08-12
|
| [[Wales]]
|-
| style='text-align:right'| 965
| ''[[:d:Q1909528|Matthew Hughes]]''
| [[File:MatthewHughes.jpg|center|128px]]
| 1978-10-31
|
| ''[[:d:Q2653611|Penmaenmawr]]''
|-
| style='text-align:right'| 966
| ''[[:d:Q1914627|Richie Burnett]]''
|
| 1967-02-07
|
| ''[[:d:Q5197252|Cwmparc]]''
|-
| style='text-align:right'| 967
| ''[[:d:Q1918215|M. J. Trow]]''
|
| 1949
|
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 968
| ''[[:d:Q1921937|Merlyn Oliver Evans]]''
|
| 1910-03-13
| 1973-10-31
| [[Cairdiff]]
|-
| style='text-align:right'| 969
| ''[[:d:Q1922184|Mervyn Johns]]''
| [[File:1944TheHalfwayHouseMervynJohns.jpg|center|128px]]
| 1899-02-18
| 1992-09-06
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 970
| ''[[:d:Q1931375|Mickey Thomas]]''
|
| 1954-07-07
|
| ''[[:d:Q6887543|Mochdre]]''
|-
| style='text-align:right'| 971
| ''[[:d:Q1933109|Mike Davies]]''
|
| 1936-01-09
| 2015-11-02
| [[Swansea]]
|-
| style='text-align:right'| 972
| ''[[:d:Q1933327|Thomas James Powell]]''
|
| 1897-10-12
| 1965-01-29
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 973
| ''[[:d:Q1933580|Mike Walker]]''
|
| 1945-11-28
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 974
| ''[[:d:Q1933591|Mike Zaworotko]]''
|
| 1956-08-14
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 975
| ''[[:d:Q1950162|Stuart Manley]]''
| [[File:Stuart Manley.JPG|center|128px]]
| 1979-01-15
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 976
| ''[[:d:Q1969415|Timothy Benjamin]]''
|
| 1982-05-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 977
| ''[[:d:Q1972440|Timothy Evans]]''
|
| 1924-11-20
| 1950-03-09
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 978
| ''[[:d:Q1974074|Ifor Williams]]''
|
| 1881-04-16
| 1965-11-04
| ''[[:d:Q3398942|Tregarth]]''
|-
| style='text-align:right'| 979
| ''[[:d:Q1974867|Neil Roberts]]''
|
| 1978-04-07
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 980
| ''[[:d:Q1975116|Robert Tear]]''
|
| 1939-03-08
| 2011-03-29
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 981
| ''[[:d:Q1985492|Nick Reilly]]''
| [[File:Nick Reilly 2010.JPG|center|128px]]
| 20th century
|
| [[Anglesey]]
|-
| style='text-align:right'| 982
| ''[[:d:Q1987718|Peredur ap Gwynedd]]''
| [[File:Peredur ap Gwynedd.jpeg|center|128px]]
| 1970-11-05
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 983
| ''[[:d:Q1996125|Shaun MacDonald]]''
| [[File:Shaun MacDonald.jpg|center|128px]]
| 1988-06-17
|
| [[Swansea]]
|-
| style='text-align:right'| 984
| ''[[:d:Q1996147|Non Stanford]]''
| [[File:2022-08-12 European Championships 2022 – Triathlon Elite Women by Sandro Halank–291.jpg|center|128px]]
| 1989-01-08
|
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 985
| ''[[:d:Q1997219|Eleri Earnshaw]]''
| [[File:NC Courage vs Angel City (Oct 2024) 062.jpg|center|128px]]
| 1985-05-17
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 986
| ''[[:d:Q1999688|Norman Solomon]]''
|
| 1933-05-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 987
| ''[[:d:Q2000214|Gary Sprake]]''
|
| 1945-04-03
| 2016-10-18
| [[Swansea]]
|-
| style='text-align:right'| 988
| ''[[:d:Q2005601|Steve Strange]]''
| [[File:Steve Strange at Harrachov World Ski Championships.jpg|center|128px]]
| 1959-05-28
| 2015-02-12
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 989
| ''[[:d:Q2008671|Leslie Palmer]]''
|
| 1910-06-17
| 1997
| [[Cairdiff]]
|-
| style='text-align:right'| 990
| ''[[:d:Q2020469|Kyron Sullivan]]''
| [[File:Kyron Sullivan.JPG|center|128px]]
| 1976-06-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 991
| ''[[:d:Q2027321|Len Allchurch]]''
|
| 1933-09-12
| 2016-11-16
| [[Swansea]]
|-
| style='text-align:right'| 992
| ''[[:d:Q2039045|Wyn Morris]]''
|
| 1929-02-14
| 2010-02-23
| ''[[:d:Q3057926|Trellech]]''
|-
| style='text-align:right'| 993
| ''[[:d:Q2047547|Lewis Robling]]''
|
| 1991-10-03
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 994
| ''[[:d:Q2047865|Mathew Pritchard]]''
| [[File:Matthew Pritchard 2015 -2.jpg|center|128px]]
| 1973-03-30
|
| [[Wales]]
|-
| style='text-align:right'| 995
| ''[[:d:Q2048628|Garry Houston]]''
| [[File:Garry Houston.JPG|center|128px]]
| 1971-05-12
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 996
| ''[[:d:Q2057711|Patrick Jones]]''
| [[File:Patrick Jones, Welsh Poet.jpg|center|128px]]
| 1965
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 997
| ''[[:d:Q2058500|John Perrot]]''
| [[File:Sir John Perrot (c. 1527-1592) mezzotint after George Powle.jpg|center|128px]]
| 1528-11
| 1592-11-03
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 998
| ''[[:d:Q2062366|Tydfil]]''
| [[File:Llandaf, yr eglwys gadeiriol Llandaf Cathedral De Cymru South Wales 98.png|center|128px]]
| No/unknown value
| 480
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 999
| ''[[:d:Q2064266|Baruc]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 1000
| ''[[:d:Q2070562|Lee Walker]]''
| [[File:Lee Walker PHC 2015-3.jpg|center|128px]]
| 1976-02-11
|
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 1001
| ''[[:d:Q2072451|Walter Cowan]]''
| [[File:Rear-admiral Sir Walter Henry Cowan, Kcb, Mvo, Dso - 1920 Art.IWMART3143.jpg|center|128px]]
| 1871-06-11
| 1956-02-14
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 1002
| ''[[:d:Q2078620|Peter Temple-Morris, Baron Temple-Morris]]''
|
| 1938-02-12
| 2018-05-01
| [[Cairdiff]]
|-
| style='text-align:right'| 1003
| ''[[:d:Q2084377|Mike Peters]]''
| [[File:Mike Peters of The Alarm.jpg|center|128px]]
| 1959-02-25
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 1004
| ''[[:d:Q2086073|Philip Bruce White]]''
| [[File:Philip Bruce White, microbiologist, 1891-1946.jpg|center|128px]]
| 1891-12-29
| 1949-03-19
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1005
| ''[[:d:Q2086251|Philip Jenkins]]''
|
| 1952-04-03
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1006
| ''[[:d:Q2086471|Philip Sutton]]''
|
| 1960-05-04
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 1007
| ''[[:d:Q2086499|Philip Vaughan]]''
|
| 1757
| 1824
| [[Wales]]
|-
| style='text-align:right'| 1008
| ''[[:d:Q2099688|Mike Lewis]]''
|
| 1977-08-17
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1009
| ''[[:d:Q2102183|Ritchie Davies]]''
|
| 1971-11-27
|
| [[Wales]]
|-
| style='text-align:right'| 1010
| ''[[:d:Q2114948|Alex Gough]]''
|
| 1970-12-08
|
| [[Newport]]
|-
| style='text-align:right'| 1011
| ''[[:d:Q2116510|Malcolm Davies]]''
|
| 1960-01-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1012
| ''[[:d:Q2120207|Jeffrey Thomas]]''
| [[File:Jeffrey Thomas.jpg|center|128px]]
| 1945
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1013
| ''[[:d:Q2133288|Jamie Donaldson]]''
| [[File:James Donaldson.JPG|center|128px]]
| 1975-10-19
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1014
| ''[[:d:Q2133976|Ray Smith]]''
|
| 1936-05-01
| 1991-12-15
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 1015
| ''[[:d:Q2135567|Barrie Bates]]''
|
| 1969-10-17
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1016
| ''[[:d:Q2140313|William Henry Preece]]''
| [[File:William Henry Preece mca.jpg|center|128px]]
| 1834-02-15
| 1913-11-06
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 1017
| ''[[:d:Q2142612|Martin Phillips]]''
|
| 1960-04-30
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 1018
| ''[[:d:Q2144018|Spencer Davis]]''
| [[File:Spencer Davis 08072006 NSU 01.JPG|center|128px]]
| 1939-07-17
| 2020-10-19
| [[Swansea]]
|-
| style='text-align:right'| 1019
| ''[[:d:Q2148362|Rhys Williams]]''
| [[File:Rhys Williams in Bonanza episode Bitter Water.jpg|center|128px]]
| 1897-12-31
| 1969-05-28
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 1020
| ''[[:d:Q2149093|Richard Bond]]''
|
| 20th century
| 2011-08-01
| [[Cairdiff]]
|-
| style='text-align:right'| 1021
| ''[[:d:Q2149806|Richard Hibbard]]''
| [[File:USO-Gloucester Rugby - 20141025 - Richard Hibbard.jpg|center|128px]]
| 1983-12-13
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1022
| ''[[:d:Q2150376|Richard Pearson]]''
|
| 1918-08-01
| 2011-08-02
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 1023
| ''[[:d:Q2150807|Richard Vaughan]]''
|
| 1978-04-16
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1024
| ''[[:d:Q2156106|Rob Wainwright]]''
| [[File:Rob Wainwright cropped.jpg|center|128px]]
| 1967-09-17
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1025
| ''[[:d:Q2159761|Robin Davies]]''
|
| 1954-01-16
| 2010-02-22
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 1026
| ''[[:d:Q2159914|Robin Sowden-Taylor]]''
|
| 1982-06-09<br/>1982-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1027
| ''[[:d:Q2160835|Eleanor de Clare]]''
| [[File:Elenor de clare.png|center|128px]]
| 1292-10-03
| 1337-06-30
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1028
| ''[[:d:Q2163367|Jan Robbins]]''
|
| 1964-01-03
|
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 1029
| ''[[:d:Q2165437|Ron Griffiths]]''
| [[File:Badfinger 2016.jpg|center|128px]]
| 1946-10-02
|
| [[Swansea]]
|-
| style='text-align:right'| 1030
| ''[[:d:Q2165458|Ron Hewitt]]''
|
| 1928-06-21
| 2001-09-23
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 1031
| ''[[:d:Q2183770|Marc Lloyd Williams]]''
|
| 1973-02-08
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1032
| ''[[:d:Q2186278|Robert Jones]]''
|
| 1857-08-19
| 1898-09-06
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 1033
| ''[[:d:Q2187563|Alfred Hazledine]]''
|
| 1874-09-04
| 1957
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 1034
| ''[[:d:Q2196018|Trevor Ford]]''
| [[File:Trevor Ford (1959).jpg|center|128px]]
| 1923-10-01
| 2003-05-29
| [[Swansea]]
|-
| style='text-align:right'| 1035
| ''[[:d:Q2210169|Marshall James]]''
|
| 1970-10-04
|
| [[Wales]]
|-
| style='text-align:right'| 1036
| ''[[:d:Q2223400|Imogen Thomas]]''
|
| 1982-11-29<br/>1982-11-27
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 1037
| ''[[:d:Q2224511|Sarah Thomas]]''
|
| 1992-10-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1038
| ''[[:d:Q2227475|Saul David]]''
|
| 1966-03
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 1039
| ''[[:d:Q2235810|Evin Crowley]]''
|
| 1945-12-05
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1040
| ''[[:d:Q2245403|Paul Jones]]''
|
| 1967-04-18
|
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 1041
| ''[[:d:Q2250384|Nick Deacy]]''
| [[File:PSV tegen Go Ahead 1-1, Nick Deacy scoort langs doelman Van Zoghel, Bestanddeelnr 929-5477.jpg|center|128px]]
| 1953-07-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1042
| ''[[:d:Q2251359|Chaz Davies]]''
| [[File:Chaz Daytona 2008.jpg|center|128px]]
| 1987-02-10
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 1043
| ''[[:d:Q2255749|Sean Moore]]''
| [[File:Sean Moore 2014.jpg|center|128px]]
| 1968-07-30
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1044
| ''[[:d:Q2262221|Sean Mathias]]''
| [[File:9.24.13WaitingForGodot-NoMansLandPressJunketByLuigiNovi4.2.jpg|center|128px]]
| 1956-03-14
|
| [[Swansea]]
|-
| style='text-align:right'| 1045
| ''[[:d:Q2265631|David Barry]]''
|
| 1943-04-30
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1046
| ''[[:d:Q2271991|Walter Marshall, Baron Marshall of Goring]]''
|
| 1932-03-05
| 1996-02-20
| ''[[:d:Q7379326|Rumney]]''
|-
| style='text-align:right'| 1047
| ''[[:d:Q2276821|Shane Clash]]''
|
| 1979-06-03
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1048
| ''[[:d:Q2277114|Ched Evans]]''
| [[File:Ched Evans.jpg|center|128px]]
| 1988-12-28
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 1049
| ''[[:d:Q2279901|Mark Mouland]]''
| [[File:KLM 2009 Mark Mouland.JPG|center|128px]]
| 1961-04-23
|
| ''[[:d:Q3400328|St Athan]]''
|-
| style='text-align:right'| 1050
| ''[[:d:Q2280729|Dai Astley]]''
|
| 1909-10-11
| 1989-11-07
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 1051
| ''[[:d:Q2282661|Carol Ap Rhys Pryce]]''
| [[File:General Carl Ap pryce.jpg|center|128px]]
| 1876-09-30
| 1955-11-26
| [[Wales]]
|-
| style='text-align:right'| 1052
| ''[[:d:Q2287423|Dwynwen]]''
| [[File:DwynwenCross1.jpg|center|128px]]
| 5th century
| 460
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 1053
| ''[[:d:Q2293838|Gordon Thomas]]''
|
| 1933-02-21
| 2017-03-03
| [[Wales]]
|-
| style='text-align:right'| 1054
| ''[[:d:Q2304861|Rhys Griffiths]]''
|
| 1980-03-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1055
| ''[[:d:Q2318784|Jess Fishlock]]''
| [[File:NC Courage vs Seattle Reign (Apr 2024) 032.jpg|center|128px]]
| 1987-01-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1056
| ''[[:d:Q2322261|Rob Brydon]]''
| [[File:Rob Brydon.jpg|center|128px]]
| 1965-05-03
|
| ''[[:d:Q2477613|Baglan]]''
|-
| style='text-align:right'| 1057
| ''[[:d:Q2344657|Stephen Dodd]]''
| [[File:Stephen Dodd (cropped).JPG|center|128px]]
| 1966-07-15
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1058
| ''[[:d:Q2346871|Steve Brace]]''
|
| 1961-07-07
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1059
| ''[[:d:Q2353120|Paul Parry]]''
| [[File:Parry, Paul.jpg|center|128px]]
| 1980-08-19
|
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 1060
| ''[[:d:Q2354151|Barry Hughes]]''
| [[File:Sparta-trainer Barry Hughes, Bestanddeelnr 930-9802 (cropped).jpg|center|128px]]
| 1937-12-31
| 2019-06-02
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 1061
| ''[[:d:Q2355882|Stuart Cable]]''
| [[File:Stuart Cable4.jpg|center|128px]]
| 1970-05-19
| 2010-06-07
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 1062
| ''[[:d:Q2382658|Don Tarr]]''
|
| 1910-03-11
| 1980-06-04
| [[Wales]]
|-
| style='text-align:right'| 1063
| ''[[:d:Q2383305|T. H. Parry-Williams]]''
| [[File:Gwynedd Museum and Art Gallery 2019 079.jpg|center|128px]]
| 1887-09-21
| 1975-03-03
| ''[[:d:Q1899529|Rhyd-ddu]]''
|-
| style='text-align:right'| 1064
| ''[[:d:Q2386801|Ian Watkins]]''
| [[File:Ian Watkins (2010) (cropped).jpg|center|128px]]
| 1977-07-30
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1065
| ''[[:d:Q2393901|Jim Driscoll]]''
| [[File:Jim Driscoll 1910s.jpg|center|128px]]
| 1880-12-15
| 1925-01-30
| [[Cairdiff]]
|-
| style='text-align:right'| 1066
| ''[[:d:Q2398021|Brychan Brycheiniog]]''
| [[File:Brychan (straightened) Eglwys Aberhonddu (Brecon, Wales) 02.jpg|center|128px]]
| 400
| 480
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 1067
| ''[[:d:Q2413249|Iris Gower]]''
|
| 1935
| 2010-07-20
| ''[[:d:Q1952591|The Mumbles]]''
|-
| style='text-align:right'| 1068
| ''[[:d:Q2421698|Ron Davies]]''
|
| 1942-05-25
| 2013-05-24
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 1069
| ''[[:d:Q2421928|Geraint Lewis]]''
|
| 1974-01-12
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1070
| ''[[:d:Q2422650|Desmond Barrit]]''
|
| 1944-10-19
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 1071
| ''[[:d:Q2423674|George Parsons]]''
|
| 1926-04-21
| 2009-11-24
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 1072
| ''[[:d:Q2424156|Thomas Garnet Henry James]]''
|
| 1923-05-08
| 2009-12-16
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1073
| ''[[:d:Q2424681|Thomas Henry]]''
| [[File:Thomas Henry (1734-1816).jpg|center|128px]]
| 1734-10-26
| 1816-06-18
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1074
| ''[[:d:Q2424831|James Cellan Jones]]''
|
| 1931-07-13
| 2019-08-30
| [[Swansea]]
|-
| style='text-align:right'| 1075
| ''[[:d:Q2426055|Thomas McKenny Hughes]]''
|
| 1832-12-17
| 1917-06-09
| [[Aberystwyth]]
|-
| style='text-align:right'| 1076
| ''[[:d:Q2429227|Sion Bebb]]''
|
| 1968-10-03
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 1077
| ''[[:d:Q2435894|Elizabeth of Rhuddlan]]''
| [[File:Elizabeth from Rhuddlan.jpg|center|128px]]
| 1282-08-07
| 1316-05-05
| ''[[:d:Q1585938|Rhuddlan Castle]]''
|-
| style='text-align:right'| 1078
| ''[[:d:Q2440993|Tommy Farr]]''
| [[File:Tommyfarr.jpg|center|128px]]
| 1913-03-12
| 1986-03-01
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 1079
| ''[[:d:Q2442492|Tony Chappel]]''
|
| 1960-05-28
|
| [[Swansea]]
|-
| style='text-align:right'| 1080
| ''[[:d:Q2446658|Nicky Wire]]''
| [[File:Manic Street Preachers in London2005-6-crop.jpg|center|128px]]
| 1969-01-20
|
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 1081
| ''[[:d:Q2449206|Gwladys]]''
| [[File:St Gwladus in Gwladus.jpg|center|128px]]
| 5th century
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 1082
| ''[[:d:Q2454625|Jack Parry]]''
|
| 1924-01-11
| 2010-01-20
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 1083
| ''[[:d:Q2457794|David Van de Woestijne]]''
|
| 1915-02-18
| 1979-05-19
| ''[[:d:Q6661212|Llandinam]]''
|-
| style='text-align:right'| 1084
| ''[[:d:Q2458875|Tim Wylton]]''
|
| 1940-02-27
|
| ''[[:d:Q3404531|Bangor-on-Dee]]''
|-
| style='text-align:right'| 1085
| ''[[:d:Q2463858|Ashley Richards]]''
| [[File:Jazz Richards.jpg|center|128px]]
| 1991-04-12
|
| [[Swansea]]
|-
| style='text-align:right'| 1086
| ''[[:d:Q2471118|Colin Webster]]''
|
| 1932-07-17
| 2001-03-01
| [[Cairdiff]]
|-
| style='text-align:right'| 1087
| ''[[:d:Q2476024|Christopher Love]]''
| [[File:Portrait of Mr. Christophorus Love (4671633).jpg|center|128px]]
| 1618
| 1651-08-22
| [[Cairdiff]]
|-
| style='text-align:right'| 1088
| ''[[:d:Q2476368|Harry Wilson]]''
| [[File:Harry Wilson 2020.jpg|center|128px]]
| 1997-03-22
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1089
| ''[[:d:Q2476943|Briog]]''
| [[File:015 Plonivel Saint Brieuc.JPG|center|128px]]
| 409
| 502
| [[Ceredigion]]
|-
| style='text-align:right'| 1090
| ''[[:d:Q2480212|Stuart Williams]]''
|
| 1930-07-09
| 2013-11-05
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1091
| ''[[:d:Q2484394|William Boyd Dawkins]]''
| [[File:William Boyd Dawkins.jpg|center|128px]]
| 1838-12-26
| 1929-01-15
| [[Welshpool]]
|-
| style='text-align:right'| 1092
| ''[[:d:Q2487274|David Davies]]''
|
| 1985-03-03
|
| [[Cairdiff]]<br/>''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1093
| ''[[:d:Q2487289|Non]]''
| [[File:Dirinon (31) Chapelle Sainte-Nonne.JPG|center|128px]]
| 5th century
| 6th century
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 1094
| ''[[:d:Q2487332|Mel Charles]]''
|
| 1935-05-14
| 2016-09-24
| [[Swansea]]
|-
| style='text-align:right'| 1095
| ''[[:d:Q2488951|Cynog ap Brychan]]''
|
| 5th century
| 492
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 1096
| ''[[:d:Q2492966|John Williams]]''
| [[File:Victoria Cross Winners- Pre 1914 Q88647.jpg|center|128px]]
| 1857-05-24
| 1932-11-25
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1097
| ''[[:d:Q2500792|Morwenna]]''
| [[File:Church Window at St Morwenna and St John the Baptist's - geograph.org.uk - 413334.jpg|center|128px]]
|
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 1098
| ''[[:d:Q2501319|Aaron of Aleth]]''
| [[File:Saint Aaron.jpg|center|128px]]
| 6th century
| 552
| [[Wales]]
|-
| style='text-align:right'| 1099
| ''[[:d:Q2523538|Marc Jenkins]]''
|
| 1976-07-21
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1100
| ''[[:d:Q2523705|Richard Maldwyn Price]]''
|
| 1890-04-16
| 1952-11-11
| [[Welshpool]]
|-
| style='text-align:right'| 1101
| ''[[:d:Q2526575|Vincent Cronin]]''
|
| 1924-05-24
| 2011-01-25
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1102
| ''[[:d:Q2527728|Laurence Cottle]]''
| [[File:Laurence Cottle.jpg|center|128px]]
| 20th century
|
| [[Swansea]]
|-
| style='text-align:right'| 1103
| ''[[:d:Q2530628|Hywel Simons]]''
|
| 1970-02-10
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1104
| ''[[:d:Q2536632|W. Aubrey Thomas]]''
| [[File:W. Aubrey Thomas 1909.jpg|center|128px]]
| 1866-06-07
| 1951-09-08
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1105
| ''[[:d:Q2537433|Dic Jones]]''
|
| 1934-03-30
| 2009-08-18
| ''[[:d:Q13131979|Tre'r-ddôl]]''
|-
| style='text-align:right'| 1106
| ''[[:d:Q2545239|Alan Durban]]''
|
| 1941-07-07
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1107
| ''[[:d:Q2563910|Saint Lunaire]]''
|
| 509
|
| [[Wales]]
|-
| style='text-align:right'| 1108
| ''[[:d:Q2565483|Méen]]''
| [[File:Rennes (35) Métropole Saint-Pierre - Intérieur - Procession des saints de Bretagne - Saint Austol et Méen.jpg|center|128px]]
| 540
| 617
| [[Wales]]
|-
| style='text-align:right'| 1109
| ''[[:d:Q2567288|John Williams]]''
|
| 1937-06-08
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1110
| ''[[:d:Q2575137|Cynan Garwyn]]''
|
| 545
| 613
| [[Wales]]
|-
| style='text-align:right'| 1111
| ''[[:d:Q2575163|Cadell Ddyrnllwg]]''
|
| 430
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 1112
| ''[[:d:Q2580155|William Nott]]''
| [[File:Sir-William-Nott-by-J-Deffett-Francis.jpg|center|128px]]
| 1782-01-20
| 1845-01-01
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1113
| ''[[:d:Q2587487|Ryan Valentine]]''
| [[File:Valentine, Ryan.jpg|center|128px]]
| 1982-08-19
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1114
| ''[[:d:Q2591794|Wolfgang Wirth]]''
| [[File:Wirth Dr W.jpg|center|128px]]
| 1898-11-02
| 1996-06-12
| [[Newport]]
|-
| style='text-align:right'| 1115
| ''[[:d:Q2596210|Carl Harris]]''
|
| 1956-11-03
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1116
| ''[[:d:Q2596530|Tara Bethan]]''
|
| 1984-12-08
|
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 1117
| ''[[:d:Q2599561|Yanto Barker]]''
| [[File:Yanto Barker 2015.JPG|center|128px]]
| 1980-01-06
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1118
| ''[[:d:Q2603439|Alan Davies]]''
|
| 1948-01-28
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 1119
| ''[[:d:Q2605051|Brian Flynn]]''
|
| 1955-10-12
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1120
| ''[[:d:Q2605207|Paulinus]]''
|
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 1121
| ''[[:d:Q2609520|Nigel Owens]]''
| [[File:Nigel Owens Pro 12 2016.jpg|center|128px]]
| 1971-06-18
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1122
| ''[[:d:Q2609780|Dean Kelley]]''
|
| 1931-09-23<br/>1931
| 1996-01-13
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 1123
| ''[[:d:Q2614469|Cadwgan ap Bleddyn]]''
|
| 1051
| 1111
| [[Powys]]
|-
| style='text-align:right'| 1124
| ''[[:d:Q2624753|William Morgan]]''
| [[File:BpWilliamMorgan.jpg|center|128px]]
| 1547
| 1604-09-10
| ''[[:d:Q14478006|Tŷ Mawr Wybrnant]]''
|-
| style='text-align:right'| 1125
| ''[[:d:Q2631222|Jason James]]''
| [[File:Jay-bfmv.jpg|center|128px]]
| 1981-01-13
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1126
| ''[[:d:Q2641401|Alex Jones]]''
|
| 1988-09-27
| 2019-03-30
| [[Anglesey]]
|-
| style='text-align:right'| 1127
| ''[[:d:Q2662059|Harold Thomas]]''
|
| 1914-02-19
| 1989-12-10
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1128
| ''[[:d:Q2663877|Mel Hopkins]]''
|
| 1934-11-07
| 2010-10-18
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 1129
| ''[[:d:Q2663889|Euros Lyn]]''
| [[File:Euros Lyn.jpg|center|128px]]
| 1971-03-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1130
| ''[[:d:Q2663895|Rosemarie Frankland]]''
|
| 1943-02-01
| 2000-12-02
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1131
| ''[[:d:Q2670636|Meilyr Brydydd]]''
|
| 11st century
| 1137
| [[Wales]]
|-
| style='text-align:right'| 1132
| ''[[:d:Q2682630|Jet Naessens]]''
|
| 1915-09-04
| 2010-06-25
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 1133
| ''[[:d:Q2693197|Phillip Price]]''
| [[File:KLM 2009 Phillip Price.JPG|center|128px]]
| 1966-10-21
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1134
| ''[[:d:Q2696817|Peter Nicholas]]''
|
| 1959-11-10
|
| [[Newport]]
|-
| style='text-align:right'| 1135
| ''[[:d:Q2699091|Hywel Teifi Edwards]]''
|
| 1934-10-15
| 2010-01-04
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1136
| ''[[:d:Q2706947|Grant Nicholas]]''
| [[File:Grant Nicholas.jpg|center|128px]]
| 1967-11-12
|
| [[Newport]]
|-
| style='text-align:right'| 1137
| ''[[:d:Q2707044|Christopher Dawson]]''
| [[File:Christopher Dawson.jpg|center|128px]]
| 1889-10-12
| 1970-05-25
| ''[[:d:Q174734|Hay-on-Wye]]''
|-
| style='text-align:right'| 1138
| ''[[:d:Q2717838|T. Llew Jones]]''
| [[File:Eisteddfod Genedlaethol Cymru, Glynebwy, 1958.jpg|center|128px]]
| 1915-10-11
| 2009-01-09
| ''[[:d:Q3400302|Pentrecwrt]]''
|-
| style='text-align:right'| 1139
| ''[[:d:Q2717918|Arthur Jenkins]]''
|
| 1882-02-03
| 1946-04-25
| ''[[:d:Q7916189|Varteg]]''
|-
| style='text-align:right'| 1140
| ''[[:d:Q2736121|Jon Groom]]''
| [[File:Jongroom.jpg|center|128px]]
| 1953
|
| [[Powys]]
|-
| style='text-align:right'| 1141
| ''[[:d:Q2737983|Lord Arthur Somerset]]''
| [[File:Major Lord Henry Arthur George Somerset (1851-1926), - Vanity fair nov 19 1887.jpg|center|128px]]
| 1851-11-17
| 1926-05-26
| ''[[:d:Q1324473|Troy House]]''
|-
| style='text-align:right'| 1142
| ''[[:d:Q2741543|E. Tegla Davies]]''
| [[File:Tegla.jpg|center|128px]]
| 1880-05-31
| 1967-10-09
| ''[[:d:Q3107398|Llandegla]]''
|-
| style='text-align:right'| 1143
| ''[[:d:Q2742666|Andy Secombe]]''
| [[File:Andy Secombe (7283016042).jpg|center|128px]]
| 1953-04-26
|
| [[Swansea]]<br/>''[[:d:Q24639697|Mumbles Head]]''
|-
| style='text-align:right'| 1144
| ''[[:d:Q2745169|Llywelyn Goch ap Meurig Hen]]''
|
| 1330s
| 1390
| [[Wales]]
|-
| style='text-align:right'| 1145
| ''[[:d:Q2745954|Jim Burns]]''
| [[File:Jim Burns 2005.JPG|center|128px]]
| 1948-04-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1146
| ''[[:d:Q2755519|Nigel Walker]]''
|
| 1963-06-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1147
| ''[[:d:Q2756320|Trezza Azzopardi]]''
|
| 1961
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1148
| ''[[:d:Q2758802|Carannog]]''
| [[File:Statue of St Carannog, Llangrannog, Wales.jpg|center|128px]]
|
|
| [[Ceredigion]]
|-
| style='text-align:right'| 1149
| ''[[:d:Q2782424|Lisa Scott-Lee]]''
| [[File:Nottingham Pride MMB 11c Lisa Scott-Lee.jpg|center|128px]]
| 1975-11-05<br/>1976-11-05
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 1150
| ''[[:d:Q2792014|Jamie Robinson]]''
|
| 1980-04-07
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 1151
| ''[[:d:Q2825023|Adrian Durston]]''
|
| 1975-10-28
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1152
| ''[[:d:Q2825031|Adrian Hadley]]''
|
| 1963-03-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1153
| ''[[:d:Q2825645|Aeron Edwards]]''
|
| 1988-02-16
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1154
| ''[[:d:Q2827000|Anna Maria Bennett]]''
|
| 1746-11-13
| 1808-02-12
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1155
| ''[[:d:Q2830489|Alan Doss]]''
| [[File:Alan Doss close.jpg|center|128px]]
| 1945-01-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1156
| ''[[:d:Q2830554|Alan Llwyd]]''
|
| 1948
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 1157
| ''[[:d:Q2830572|Alan Phillips]]''
|
| 1954-08-21
|
| [[Wales]]
|-
| style='text-align:right'| 1158
| ''[[:d:Q2832399|Aled Brew]]''
| [[File:Aled Brew 02.jpg|center|128px]]
| 1986-08-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1159
| ''[[:d:Q2832925|Alex Darlington]]''
|
| 1988-12-26
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1160
| ''[[:d:Q2833520|Eric Burden]]''
|
| 1945-07-16
|
| ''[[:d:Q7227990|Pont Henri]]''
|-
| style='text-align:right'| 1161
| ''[[:d:Q2837292|Alix Popham]]''
|
| 1979-10-17
|
| [[Newport]]
|-
| style='text-align:right'| 1162
| ''[[:d:Q2837676|Allan Bateman]]''
|
| 1965-03-06
|
| ''[[:d:Q5016879|Caerau]]''
|-
| style='text-align:right'| 1163
| ''[[:d:Q2837744|Allan Martin]]''
|
| 1948-12-11
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1164
| ''[[:d:Q2840540|Alun Thomas]]''
|
| 1926-02-03
| 1991-05-08
| [[Wales]]
|-
| style='text-align:right'| 1165
| ''[[:d:Q2840543|Alun Pask]]''
|
| 1937-09-10
| 1995-11-01
| ''[[:d:Q7228311|Pontllanfraith]]''
|-
| style='text-align:right'| 1166
| ''[[:d:Q2846618|Andrew Grieve]]''
|
| 1939-11-28<br/>1939
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1167
| ''[[:d:Q2846634|Andrew House]]''
|
| 1965-01-23
|
| [[Wales]]
|-
| style='text-align:right'| 1168
| ''[[:d:Q2849138|Andy Legg]]''
|
| 1966-07-28
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1169
| ''[[:d:Q2849189|Andy Williams]]''
|
| 1981-02-07
|
| [[Swansea]]
|-
| style='text-align:right'| 1170
| ''[[:d:Q2852820|Anthony Buchanan]]''
|
| 1955-06-30
|
| [[Ystradgynlais]]
|-
| style='text-align:right'| 1171
| ''[[:d:Q2857635|Paul Amos]]''
| [[File:Paul Amos Animate Florida 2017.jpg|center|128px]]
| 20th century
|
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 1172
| ''[[:d:Q2865205|Arthur Lewis]]''
|
| 1941-09-26
|
| [[Wales]]
|-
| style='text-align:right'| 1173
| ''[[:d:Q2866086|Arwel Thomas]]''
|
| 1974-11-08
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 1174
| ''[[:d:Q2866538|Ashley Evans]]''
|
| 1989-07-18
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1175
| ''[[:d:Q2866548|Ashley Morris]]''
|
| 1984-07-31
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1176
| ''[[:d:Q2866557|Ashley Smith]]''
|
| 1987-02-13
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 1177
| ''[[:d:Q2867035|Paul Bodin]]''
|
| 1964-09-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1178
| ''[[:d:Q2870954|Augusta Hall, Baroness Llanover]]''
| [[File:Augusta Hall.jpg|center|128px]]
| 1802-03-21
| 1896-01-17
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1179
| ''[[:d:Q2884061|Philip Evans]]''
| [[File:Portret van Phillipus Evans, RP-P-1921-1870.jpg|center|128px]]
| 1645
| 1679-07-22
| ''[[:d:Q156990|Monmouth]]''<br/>''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 1180
| ''[[:d:Q2885721|Barry Davies]]''
|
| 1981-03-05
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1181
| ''[[:d:Q2885748|Barry Horne]]''
|
| 1962-05-18
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 1182
| ''[[:d:Q2885757|Barry Jones]]''
|
| 1974-05-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1183
| ''[[:d:Q2885809|Barry Williams]]''
|
| 1974-01-06
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1184
| ''[[:d:Q2898051|Ray Daniel]]''
|
| 1928-11-02
| 1997-11-06
| [[Swansea]]
|-
| style='text-align:right'| 1185
| ''[[:d:Q2899185|Bert Dauncey]]''
| [[File:Bert Dauncey.jpg|center|128px]]
| 1871-12-01
| 1955-10-30
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1186
| ''[[:d:Q2899186|Bert Gould]]''
| [[File:G H Bert Gould.JPG|center|128px]]
| 1870-04-18
| 1913-12-19
| [[Newport]]
|-
| style='text-align:right'| 1187
| ''[[:d:Q2899803|Berwyn Price]]''
|
| 1951-08-15
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1188
| ''[[:d:Q2900084|Charlie Jones]]''
|
| 1899-12-12
| 1966
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1189
| ''[[:d:Q2903163|Bill Clement]]''
|
| 1915-04-09
| 2007-02-10
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1190
| ''[[:d:Q2903257|Bill James]]''
|
| 1929-08-15
| 2023-06-17
| [[Cairdiff]]
|-
| style='text-align:right'| 1191
| ''[[:d:Q2903371|Bill Tamplin]]''
|
| 1917-05-10
| 1989-10-10
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 1192
| ''[[:d:Q2903616|Billy Cleaver]]''
| [[File:Billy Cleaver 1950.jpg|center|128px]]
| 1921-09-15
| 2003-09-29
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1193
| ''[[:d:Q2903678|William McCutcheon]]''
| [[File:William McCutcheon.jpg|center|128px]]
| 1870-06
| 1949-07-03
| [[Swansea]]
|-
| style='text-align:right'| 1194
| ''[[:d:Q2903688|Billy O'Neill]]''
| [[File:Billy O'Neill.jpg|center|128px]]
| 1878-06-05
| 1955-04-02
| [[Cairdiff]]
|-
| style='text-align:right'| 1195
| ''[[:d:Q2903706|Billy Raybould]]''
|
| 1944-03-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1196
| ''[[:d:Q2903719|Billy Spiller]]''
|
| 1886-07-08
| 1970-06-09
| [[Cairdiff]]
|-
| style='text-align:right'| 1197
| ''[[:d:Q2903745|Billy Williams]]''
|
| 1921-09-09
| 2002-08-02
| [[Wales]]
|-
| style='text-align:right'| 1198
| ''[[:d:Q2903748|Billy Williams]]''
|
| 1929-11-23
| 2013-03-29
| [[Wales]]
|-
| style='text-align:right'| 1199
| ''[[:d:Q2907653|Bob Evans]]''
| [[File:Robert Thomas Evans 1950.jpg|center|128px]]
| 1921-02-16
| 2003-04-14
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 1200
| ''[[:d:Q2907680|Bob Gould]]''
| [[File:Robert Bob Gould.JPG|center|128px]]
| 1863-07
| 1931-12-29
| [[Newport]]
|-
| style='text-align:right'| 1201
| ''[[:d:Q2907786|Bob Norster]]''
|
| 1957-06-23
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 1202
| ''[[:d:Q2910477|Charles Nicholl]]''
| [[File:Charles Nicholl.jpg|center|128px]]
| 1870-06-19
| 1939-07-09
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1203
| ''[[:d:Q2911997|Thomas Jones]]''
| [[File:Thomas jones at cambridge.jpg|center|128px]]
| 1756-06-23
| 1807-07-18
| ''[[:d:Q3309484|Aberriw]]''
|-
| style='text-align:right'| 1204
| ''[[:d:Q2913257|John Roberts]]''
|
| 1946-09-11
| 2016-01-04
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 1205
| ''[[:d:Q2913295|David Evans]]''
|
| 1974-10-24
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1206
| ''[[:d:Q2924982|Brian Price]]''
| [[File:Brian Price.jpg|center|128px]]
| 1937-10-30<br/>1937
| 2023-12-18
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 1207
| ''[[:d:Q2925023|Brian Thomas]]''
|
| 1940-05-18
| 2012-07-09
| [[Wales]]
|-
| style='text-align:right'| 1208
| ''[[:d:Q2927242|Elvira Out]]''
|
| 1968-06-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1209
| ''[[:d:Q2928012|William Stadden]]''
| [[File:Buller stadden.JPG|center|128px]]
| 1861
| 1906-12-30
| [[Cairdiff]]
|-
| style='text-align:right'| 1210
| ''[[:d:Q2928014|William Henry Williams]]''
| [[File:William Henry Alexander.jpg|center|128px]]
| 1873-07
| 1936-01-09
| ''[[:d:Q7228312|Pontlotyn]]''
|-
| style='text-align:right'| 1211
| ''[[:d:Q2928233|Bunner Travers]]''
|
| 1913-12-02
| 1998-06-04
| [[Newport]]
|-
| style='text-align:right'| 1212
| ''[[:d:Q2928498|Burke Shelley]]''
| [[File:Burke Shelley.JPG|center|128px]]
| 1950-04-10
| 2022-01-10
| [[Cairdiff]]
|-
| style='text-align:right'| 1213
| ''[[:d:Q2928553|Burnett Bolloten]]''
| [[File:Burnett Bolloten 1980.tif|center|128px]]
| 1909
| 1987
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1214
| ''[[:d:Q2938073|Richard Valentine Pitchford]]''
| [[File:Richard Valentine Pitchford magician.png|center|128px]]
| 1895-11-24
| 1973-11-13
| ''[[:d:Q1952591|The Mumbles]]''
|-
| style='text-align:right'| 1215
| ''[[:d:Q2946640|Ceri Jones]]''
|
| 1977-06-19
|
| [[Newport]]
|-
| style='text-align:right'| 1216
| ''[[:d:Q2946643|Ceri Sherlock]]''
|
| 1954-08
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1217
| ''[[:d:Q2946644|Ceri Sweeney]]''
|
| 1980-01-21
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1218
| ''[[:d:Q2946682|Cerith Rees]]''
|
| 1979-03-01
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1219
| ''[[:d:Q2959086|Charles Foweraker]]''
|
| 1877-03-11
| 1950-07
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 1220
| ''[[:d:Q2959651|Charles Lewis]]''
|
| 1852-08-20
| 1923-05-28
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1221
| ''[[:d:Q2959898|Charlie Newman]]''
| [[File:Charles Henry Newman.jpg|center|128px]]
| 1857-02-28
| 1922-09-28
| [[Newport]]
|-
| style='text-align:right'| 1222
| ''[[:d:Q2960293|Charles Taylor]]''
| [[File:C. G. Taylor.png|center|128px]]
| 1863-05-08
| 1915-01-24
| [[Wales]]
|-
| style='text-align:right'| 1223
| ''[[:d:Q2960849|Charlie Faulkner]]''
|
| 1941-02-27
| 2023-02-09
| [[Newport]]
|-
| style='text-align:right'| 1224
| ''[[:d:Q2960878|Charlie Pritchard]]''
| [[File:Charlie Pritchard.jpg|center|128px]]
| 1882-09-30
| 1916-08-14
| [[Newport]]
|-
| style='text-align:right'| 1225
| ''[[:d:Q2961003|Charlotte Mason]]''
| [[File:Charlotte Mason.jpg|center|128px]]
| 1842-01-01
| 1923-01-16
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1226
| ''[[:d:Q2964639|Chris Addison]]''
| [[File:Chris Addison cropped.jpg|center|128px]]
| 1971-11-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1227
| ''[[:d:Q2964643|Chris Anthony]]''
|
| 1976-07-23
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1228
| ''[[:d:Q2964739|Chris Holloway]]''
|
| 1980-02-05
|
| [[Swansea]]
|-
| style='text-align:right'| 1229
| ''[[:d:Q2964749|Chris Jones]]''
|
| 1985-10-09
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1230
| ''[[:d:Q2964792|Chris Marriott]]''
|
| 1989-09-24
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1231
| ''[[:d:Q2964844|Chris Roberts]]''
|
| 1985-08-14
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1232
| ''[[:d:Q2964900|Chris Wyatt]]''
|
| 1973-06-10
|
| [[Newport]]
|-
| style='text-align:right'| 1233
| ''[[:d:Q2965430|Christian Loader]]''
|
| 1973-10-26
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1234
| ''[[:d:Q2966604|Chris Jenkins]]''
|
| 1961
|
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 1235
| ''[[:d:Q2966638|Christopher Pugsley]]''
| [[File:Christopher Pugsley (cropped).jpg|center|128px]]
| 1947-02-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1236
| ''[[:d:Q2976625|Claude Davey]]''
|
| 1908-12-14
| 2001-02-18
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 1237
| ''[[:d:Q2978734|Clayton Thomas]]''
|
| 1950-09-22
|
| ''[[:d:Q13126340|Bryncoch]]''
|-
| style='text-align:right'| 1238
| ''[[:d:Q2978800|Clem Thomas]]''
|
| 1929-01-28
| 1996-09-05
| [[Cairdiff]]
|-
| style='text-align:right'| 1239
| ''[[:d:Q2979039|Cliff Bowen]]''
| [[File:Clifford Alfred Bowen (1875–1929).png|center|128px]]
| 1875-01-03
| 1929-04-30
| [[Wales]]
|-
| style='text-align:right'| 1240
| ''[[:d:Q2979047|Cliff Davies]]''
| [[File:Cliff Davies 1950.jpg|center|128px]]
| 1919-12-12
| 1967-01-28
| [[Wales]]
|-
| style='text-align:right'| 1241
| ''[[:d:Q2979063|Cliff Pritchard]]''
| [[File:Wales Rugby1905.jpg|center|128px]]
| 1881-10-01
| 1954-12-14
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1242
| ''[[:d:Q2979442|Clive Williams]]''
|
| 1991-01-01
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1243
| ''[[:d:Q2979449|Clive Williams]]''
|
| 1947-11-02
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 1244
| ''[[:d:Q2982642|Colin Noon]]''
|
| 1975-10-24
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1245
| ''[[:d:Q2989294|Howell Davis]]''
| [[File:HowellDavies.jpg|center|128px]]
| 1690
| 1719-06-19
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 1246
| ''[[:d:Q2989336|Shaheen Jafargholi]]''
| [[File:Shaheen Jafargholi 2016.jpg|center|128px]]
| 1997-01-23
|
| [[Swansea]]<br/>[[Wales]]
|-
| style='text-align:right'| 1247
| ''[[:d:Q2993447|Connell Rawlinson]]''
|
| 1991-09-22
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1248
| ''[[:d:Q2993516|Conogan]]''
| [[File:Quimper 12 Cathédrale Saint Conogan.jpg|center|128px]]
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 1249
| ''[[:d:Q3001503|Courtney Meredith]]''
|
| 1926-09-23
| 2024-06-13
| [[Pontypridd]]
|-
| style='text-align:right'| 1250
| ''[[:d:Q3002041|Craig Moses]]''
|
| 1988-04-12
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 1251
| ''[[:d:Q3002042|Craig Morgan]]''
|
| 1978-09-26
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1252
| ''[[:d:Q3002051|Craig Quinnell]]''
|
| 1975-07-09
|
| [[Swansea]]
|-
| style='text-align:right'| 1253
| ''[[:d:Q3002796|Crispin Nash-Williams]]''
|
| 1932-12-19
| 2001-01-20
| [[Cairdiff]]
|-
| style='text-align:right'| 1254
| ''[[:d:Q3008718|Cynan ab Iago]]''
|
| 1014
| 1063-10-14
| ''[[:d:Q319576|Aberffraw]]''
|-
| style='text-align:right'| 1255
| ''[[:d:Q3012007|Dai Fitzgerald]]''
| [[File:Dai Fitzgerald (rygbi).jpg|center|128px]]
| 1872
| 1951-11-30
| [[Cairdiff]]
|-
| style='text-align:right'| 1256
| ''[[:d:Q3012009|David Jones]]''
| [[File:Dai Tarw Jones.jpg|center|128px]]
| 1881-07
| 1933-01-21
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 1257
| ''[[:d:Q3012010|Dai Jones]]''
|
| 1916-04-30
| 20th century
| [[Wales]]
|-
| style='text-align:right'| 1258
| ''[[:d:Q3012016|Dai Morris]]''
|
| 1941-11-11
|
| ''[[:d:Q258665|Rhigos]]''
|-
| style='text-align:right'| 1259
| ''[[:d:Q3014013|Daniel Evans]]''
| [[File:Daniel Evans Ospreys 2017.jpg|center|128px]]
| 1988-11-15
|
| [[Swansea]]
|-
| style='text-align:right'| 1260
| ''[[:d:Q3015228|Danny Coyne]]''
| [[File:Danny Coyne.jpg|center|128px]]
| 1973-08-27
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 1261
| ''[[:d:Q3016529|Darren Morris]]''
| [[File:Darren Morris.jpg|center|128px]]
| 1974-09-24
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1262
| ''[[:d:Q3016531|Darren Moss]]''
|
| 1981-05-24
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1263
| ''[[:d:Q3017152|W. J. A. Davies]]''
|
| 1890-06-21
| 1967-04-26
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 1264
| ''[[:d:Q3018170|David Jones]]''
| [[File:Missionary David Jones.jpg|center|128px]]
| 1796-07
| 1841-05-01
| ''[[:d:Q15987529|Pen-rhiw]]''
|-
| style='text-align:right'| 1265
| ''[[:d:Q3018627|David Pipe]]''
| [[File:David Pipe 12-05-2012 1.jpg|center|128px]]
| 1983-11-05
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1266
| ''[[:d:Q3018684|David Richards]]''
|
| 1954-05-23<br/>1954
|
| [[Neath Port Talbot]]
|-
| style='text-align:right'| 1267
| ''[[:d:Q3018755|David Samuel]]''
|
| 1869-08
| 1943-09-15
| [[Swansea]]
|-
| style='text-align:right'| 1268
| ''[[:d:Q3018959|David Watkins]]''
|
| 1942-03-05
| 2023-09-03
| [[Wales]]
|-
| style='text-align:right'| 1269
| ''[[:d:Q3018998|David Williams]]''
| [[File:Portrait of David Williams (Waun-Waelod) (4672169) (cropped).jpg|center|128px]]
| 1738-12
| 1816-06-29
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 1270
| ''[[:d:Q3023438|Denzil Williams]]''
|
| 1938-10-17
|
| [[Wales]]
|-
| style='text-align:right'| 1271
| ''[[:d:Q3023702|Derek Bevan]]''
|
| 1947-09-03
|
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 1272
| ''[[:d:Q3025583|Dewi Morris]]''
|
| 1964-02-09
|
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 1273
| ''[[:d:Q3025590|Dewi Zephaniah Phillips]]''
|
| 1934-11-24
| 2006-07-25
| [[Swansea]]
|-
| style='text-align:right'| 1274
| ''[[:d:Q3026609|Dick Moriarty]]''
|
| 1957-05-01
|
| [[Wales]]
|-
| style='text-align:right'| 1275
| ''[[:d:Q3026625|Dick Richards]]''
|
| 1890-02-14
| 1934-01-27
| ''[[:d:Q5572835|Glyn Ceiriog]]''
|-
| style='text-align:right'| 1276
| ''[[:d:Q3026630|Dick Thomas]]''
| [[File:Dick Thomas. caps and shirts.jpg|center|128px]]
| 1880-10-14
| 1916-07-07
| [[Wales]]
|-
| style='text-align:right'| 1277
| ''[[:d:Q3026655|Dickie Garrett]]''
|
| 1865
| 1908-02-17
| [[Cairdiff]]
|-
| style='text-align:right'| 1278
| ''[[:d:Q3026670|Dicky Owen]]''
| [[File:Dicky Owen.jpg|center|128px]]
| 1876-11-17
| 1932-02-27
| [[Swansea]]
|-
| style='text-align:right'| 1279
| ''[[:d:Q3033499|Wilf Cude]]''
|
| 1910-06-04
| 1968-05-05
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1280
| ''[[:d:Q3037029|Dorian West]]''
| [[File:Dorian West - Northampton Saints vs Sale October 2009.jpg|center|128px]]
| 1967-10-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1281
| ''[[:d:Q3037194|Dorothy Squires]]''
|
| 1915-03-25
| 1998-04-14
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 1282
| ''[[:d:Q3038019|Douglas McKie]]''
|
| 1896-07-15
| 1967-08-20
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 1283
| ''[[:d:Q3038045|Douglas Vaughan]]''
|
| 1925-07-15
| 1977-04-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1284
| ''[[:d:Q3039882|Hugh Percy Wilkins]]''
|
| 1896-12-04
| 1960-01-23
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1285
| ''[[:d:Q3048504|Edward Edwards]]''
|
| 1803-11-23
| 1879-08-13
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 1286
| ''[[:d:Q3048530|Edward George Bowen]]''
|
| 1911-01-14
| 1991-08-12
| ''[[:d:Q5139596|Cockett]]''
|-
| style='text-align:right'| 1287
| ''[[:d:Q3048577|Edward Jones]]''
| [[File:Bardd y Brenin, Edward Jones (1752–1824) (gcf10063).jpg|center|128px]]
| 1752-03-29
| 1824-04-18
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 1288
| ''[[:d:Q3048652|Edward Ravenscroft]]''
| [[File:Edward Ravenscroft Esqr (BM 1860,1013.73).jpg|center|128px]]
| 1654
| 1707
| ''[[:d:Q684016|Flintshire]]''
|-
| style='text-align:right'| 1289
| ''[[:d:Q3048696|Edward Treharne]]''
| [[File:Wales1881.jpg|center|128px]]
| 1862-03-22
| 1904-12-29
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1290
| ''[[:d:Q3048724|Edward Wynne]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 1291
| ''[[:d:Q3050399|Elaine Morgan]]''
| [[File:Elaine Morgan & Dan Ar Braz.JPG|center|128px]]
| 1960
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1292
| ''[[:d:Q3050565|John Rhys]]''
| [[File:The Right Hon. Sir John Rhŷs, P.C., M.A., D.Litt (5227644) (cropped).jpg|center|128px]]
| 1840-06-21
| 1915-12-17
| ''[[:d:Q3399417|Ponterwyd]]''
|-
| style='text-align:right'| 1293
| ''[[:d:Q3050580|Gwenno Saunders]]''
| [[File:The Pipettes - Gwennoi.jpg|center|128px]]
| 1981-05-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1294
| ''[[:d:Q3050590|Gruff Rhys]]''
| [[File:Turning Tides Festival Gruffest Rhys (48292037606).jpg|center|128px]]
| 1970-07-18
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 1295
| ''[[:d:Q3050840|Elgan Rees]]''
|
| 1954-01-05
|
| [[Wales]]
|-
| style='text-align:right'| 1296
| ''[[:d:Q3053432|Emyr Lewis]]''
|
| 1968-08-29
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1297
| ''[[:d:Q3060850|Euros Childs]]''
| [[File:Euros Childs 2008.jpg|center|128px]]
| 1975-04-16
|
| [[Wales]]
|-
| style='text-align:right'| 1298
| ''[[:d:Q3061325|Evan James]]''
| [[File:Portrait of Evan James (4670936) (cropped).jpg|center|128px]]
| 1809
| 1878-09-30
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1299
| ''[[:d:Q3065503|Lloyd Jones]]''
| [[File:2011 Cup of China Lloyd Jones.jpg|center|128px]]
| 1988-08-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1300
| ''[[:d:Q3069617|William Goscombe John]]''
| [[File:Portrait of Sir William Goscombe John by Simon Harmon Vedder.jpg|center|128px]]
| 1860-02-21
| 1952-12-15
| [[Cairdiff]]
|-
| style='text-align:right'| 1301
| ''[[:d:Q3072247|Filthy Pedro]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 1302
| ''[[:d:Q3072545|Finbarr O'Reilly]]''
| [[File:Finbarr O'Reilly par Claude Truong-Ngoc septembre 2022.jpg|center|128px]]
| 1971
|
| [[Swansea]]
|-
| style='text-align:right'| 1303
| ''[[:d:Q3079096|Frances Thomas]]''
|
| 1943
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 1304
| ''[[:d:Q3080918|Gavin Rees]]''
| [[File:Gavin Rees.jpg|center|128px]]
| 1980-05-10
|
| [[Newport]]
|-
| style='text-align:right'| 1305
| ''[[:d:Q3082655|Frank Hill]]''
| [[File:Frank Hill (Rygbi).jpg|center|128px]]
| 1866-01-13
| 1927-04-20
| [[Cairdiff]]
|-
| style='text-align:right'| 1306
| ''[[:d:Q3086926|Fred Parfitt]]''
| [[File:Fred Parfitt (rygbi).jpg|center|128px]]
| 1869-08-12
| 1953-03-20
| [[Wales]]
|-
| style='text-align:right'| 1307
| ''[[:d:Q3086951|Fred Scrine]]''
| [[File:Fred Scrine.jpg|center|128px]]
| 1877-03-25
| 1962-06-08
| [[Swansea]]
|-
| style='text-align:right'| 1308
| ''[[:d:Q3090747|Fulke Walwyn]]''
|
| 1910-11-08
| 1991-02-18
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1309
| ''[[:d:Q3095279|Garan Evans]]''
|
| 1973-02-16
|
| ''[[:d:Q7842265|Trimsaran]]''
|-
| style='text-align:right'| 1310
| ''[[:d:Q3098294|Gareth Davies]]''
| [[File:Gareth Davies 2012.jpg|center|128px]]
| 1955-09-29
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1311
| ''[[:d:Q3098295|Gareth Delve]]''
| [[File:Garethdelve.jpg|center|128px]]
| 1982-12-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1312
| ''[[:d:Q3098300|Gareth Evans]]''
|
| 1952-11-02
|
| [[Newport]]
|-
| style='text-align:right'| 1313
| ''[[:d:Q3098302|Gareth Gwenlan]]''
|
| 1937-04-26
| 2016-05-08
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 1314
| ''[[:d:Q3098303|Gareth Myles]]''
|
| 1978-12-20
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1315
| ''[[:d:Q3098305|Gareth Prothero]]''
|
| 1941-12-07<br/>1941
|
| [[Wales]]
|-
| style='text-align:right'| 1316
| ''[[:d:Q3098308|Gareth Morgan]]''
|
| 1943-12-22
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 1317
| ''[[:d:Q3098309|Gareth Roberts]]''
|
| 1959-01-15
|
| [[Swansea]]
|-
| style='text-align:right'| 1318
| ''[[:d:Q3098315|Gareth Williams]]''
|
| 1953-04-12
| 2001-12-24
| [[Cairdiff]]
|-
| style='text-align:right'| 1319
| ''[[:d:Q3098316|Gareth Powell Williams]]''
|
| 1954-11-06
| 2018-05-13
| [[Wales]]
|-
| style='text-align:right'| 1320
| ''[[:d:Q3098336|Garfield Owen]]''
|
| 1932-03-20
| 2019-01-17
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 1321
| ''[[:d:Q3098384|Garin Jenkins]]''
|
| 1966-08-18
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 1322
| ''[[:d:Q3099581|Gavin Evans]]''
|
| 1984-07-18
|
| [[Wales]]
|-
| style='text-align:right'| 1323
| ''[[:d:Q3101049|Geoff Evans]]''
|
| 1942-05-01
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1324
| ''[[:d:Q3101064|Geoff Wheel]]''
|
| 1951-06-30
|
| [[Swansea]]
|-
| style='text-align:right'| 1325
| ''[[:d:Q3101068|Geoffrey Conway]]''
|
| 1897-11-15
| 20th century
| [[Cairdiff]]
|-
| style='text-align:right'| 1326
| ''[[:d:Q3101430|George Boots]]''
| [[File:George Boots.JPG|center|128px]]
| 1874-07-02
| 1928-12-30
| ''[[:d:Q4666790|Aberbeeg]]''
|-
| style='text-align:right'| 1327
| ''[[:d:Q3101435|George Bowen]]''
|
| 1863-06
| 1919-01-19
| [[Swansea]]
|-
| style='text-align:right'| 1328
| ''[[:d:Q3101517|George Davies]]''
| [[File:George Davies, Rugby player.JPG|center|128px]]
| 1875-12-25
| 1959-07-23
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 1329
| ''[[:d:Q3101615|George Guest]]''
|
| 1924-02-09
| 2002-11-20
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1330
| ''[[:d:Q3101635|George Hayward]]''
| [[File:George Hayward.jpg|center|128px]]
| 1886-02-13
| 1946-10-13
| [[Swansea]]
|-
| style='text-align:right'| 1331
| ''[[:d:Q3103853|Geraint Evans]]''
| [[File:Geraint Evans.jpg|center|128px]]
| 1922-02-16
| 1992-09-19
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 1332
| ''[[:d:Q3104447|Gerwyn Williams]]''
|
| 1924-04-22
| 2009-02-10
| [[Wales]]
|-
| style='text-align:right'| 1333
| ''[[:d:Q3104663|Gethin Jones]]''
| [[File:Haypresent.jpg|center|128px]]
| 1978-02-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1334
| ''[[:d:Q3108690|Glen Renfrew]]''
|
| 1928<br/>1928-09-15
| 2006<br/>2006-06-29
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1335
| ''[[:d:Q3109363|Glyn Loosmore]]''
|
| 1923-03-03
| 2007-11-29
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1336
| ''[[:d:Q3109364|Glyn Davies]]''
|
| 1927-08-24
| 1976-11-01
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1337
| ''[[:d:Q3109365|Glyn Houston]]''
|
| 1925-10-23<br/>1925-10-25
| 2019-06-30
| ''[[:d:Q3400833|Clydach Vale]]''
|-
| style='text-align:right'| 1338
| ''[[:d:Q3109367|Glyn Moses]]''
|
| 1928-05-30
| 2021-09-29
| [[Wales]]
|-
| style='text-align:right'| 1339
| ''[[:d:Q3113252|Graham Jenkins]]''
|
| 1927-10-25
| 2015-12-14
| [[Neath Port Talbot]]
|-
| style='text-align:right'| 1340
| ''[[:d:Q3116627|Griffith Hughes]]''
|
| 1707
| 1758
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 1341
| ''[[:d:Q3122557|Gwennan Harries]]''
|
| 1988-01-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1342
| ''[[:d:Q3122587|Gwladys Yvonne McKeon]]''
| [[File:Gwladys Yvonne McKeon.jpg|center|128px]]
| 1897-08-23
| 1979-08-15
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1343
| ''[[:d:Q3122593|Gwynne Walters]]''
|
| 1928-07-26
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 1344
| ''[[:d:Q3122600|Gwynne Howell]]''
|
| 1938-06-13
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 1345
| ''[[:d:Q3124567|Michael Moritz]]''
| [[File:Michael Moritz 1.jpg|center|128px]]
| 1954-09-12
|
| [[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 1346
| ''[[:d:Q3127737|Harri Webb]]''
|
| 1920-09-07
| 1994-12-31
| ''[[:d:Q7534773|Sketty]]''
|-
| style='text-align:right'| 1347
| ''[[:d:Q3127791|Harry Bowen]]''
| [[File:Harry bowen, rugby union player.jpg|center|128px]]
| 1864-05-04
| 1913-08-17
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1348
| ''[[:d:Q3127809|Harry Day]]''
| [[File:Harry Day (rygbi).jpg|center|128px]]
| 1863-09
| 1911-07-12
| [[Newport]]
|-
| style='text-align:right'| 1349
| ''[[:d:Q3127841|Harry Jarman]]''
| [[File:Harry Jarman.png|center|128px]]
| 1883-07
| 1928-12-13
| ''[[:d:Q13131732|Talywain]]''
|-
| style='text-align:right'| 1350
| ''[[:d:Q3127937|Harry Vaughan Watkins]]''
|
| 1875-09-10
| 1945-05-16
| [[Wales]]
|-
| style='text-align:right'| 1351
| ''[[:d:Q3128848|Haydn Morgan]]''
|
| 1936-07-30
| 2018-07-23
| [[Wales]]
|-
| style='text-align:right'| 1352
| ''[[:d:Q3129078|Heather Dohollau]]''
|
| 1925-01-22
| 2013-04-30
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 1353
| ''[[:d:Q3129370|Hefin O'Hare]]''
|
| 1979-06-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1354
| ''[[:d:Q3129631|Helen Morgan]]''
|
| 1966-07-20
| 2020-11-19
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 1355
| ''[[:d:Q3133040|Geoff Thomas]]''
|
| 1948-02-18
| 2013-01-13
| [[Swansea]]
|-
| style='text-align:right'| 1356
| ''[[:d:Q3133452|Herbert Godwin]]''
|
| 1935-12-21
| 2006-01
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1357
| ''[[:d:Q3135573|Hilary Summers]]''
|
| 1965
|
| [[Newport]]
|-
| style='text-align:right'| 1358
| ''[[:d:Q3140461|Horace Lyne]]''
| [[File:Horace Lyne.jpg|center|128px]]
| 1860-12-31
| 1949-05-01
| [[Newport]]
|-
| style='text-align:right'| 1359
| ''[[:d:Q3142269|Hugh Iorys Hughes]]''
|
| 1902-04-16
| 1977-08-16
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1360
| ''[[:d:Q3147258|Ian Edwards]]''
|
| 1955-01-30
|
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 1361
| ''[[:d:Q3147273|Ian Hall]]''
|
| 1946-11-04
|
| [[Wales]]
|-
| style='text-align:right'| 1362
| ''[[:d:Q3147329|Ian Stephens]]''
|
| 1952-05-25
|
| [[Wales]]
|-
| style='text-align:right'| 1363
| ''[[:d:Q3147332|Ian Walsh]]''
|
| 1958-09-04
|
| [[St Davids]]
|-
| style='text-align:right'| 1364
| ''[[:d:Q3147333|Ian Watkins]]''
|
| 1962-03-10
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 1365
| ''[[:d:Q3147943|Idwal Rees]]''
|
| 1910-07-25
| 1991-08-31
| [[Swansea]]
|-
| style='text-align:right'| 1366
| ''[[:d:Q3148028|Iestyn Thomas]]''
| [[File:Iestyn thomas scarlets.JPG|center|128px]]
| 1976-12-15
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1367
| ''[[:d:Q3148103|Ifor Jenkins]]''
|
| 1906
| 1972
| [[Neath Port Talbot]]
|-
| style='text-align:right'| 1368
| ''[[:d:Q3156345|Ivor Barry]]''
|
| 1919-04-12
| 2006-12-12
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1369
| ''[[:d:Q3156348|Ivor Morgan]]''
| [[File:Ivor Morgan.jpg|center|128px]]
| 1884-08-15
| 1943-12-10
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 1370
| ''[[:d:Q3157121|Jack Bancroft]]''
| [[File:Jack bancroft rugby union.jpeg|center|128px]]
| 1879-10-09
| 1942-01-07
| [[Swansea]]
|-
| style='text-align:right'| 1371
| ''[[:d:Q3157222|Jack Jones]]''
| [[File:Jack Jones.png|center|128px]]
| 1886-03-03
| 1951-03-19
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1372
| ''[[:d:Q3157267|Jack Matthews]]''
| [[File:Jack Matthews rugby 1950.jpg|center|128px]]
| 1920-06-21
| 2012-07-18
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1373
| ''[[:d:Q3160120|Jacques Vaillant de Guélis]]''
|
| 1907-04-06
| 1945-08-07
| [[Cairdiff]]
|-
| style='text-align:right'| 1374
| ''[[:d:Q3161184|James James]]''
| [[File:James James composer of the music of 'Hen wlad fy nhadau' (5292122).jpg|center|128px]]
| 1832-11-04
| 1902-01-11
| ''[[:d:Q378738|Argoed]]''
|-
| style='text-align:right'| 1375
| ''[[:d:Q3161527|Jamie Corsi]]''
|
| 1987-12-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1376
| ''[[:d:Q3162903|Jason Bowen]]''
|
| 1972-08-24
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1377
| ''[[:d:Q3162947|Jason Hobson]]''
|
| 1983-02-10
|
| [[Swansea]]
|-
| style='text-align:right'| 1378
| ''[[:d:Q3176589|Jeff Squire]]''
|
| 1951-09-23
|
| [[Wales]]
|-
| style='text-align:right'| 1379
| ''[[:d:Q3176811|Jehoida Hodges]]''
| [[File:Jehoida Hodges.jpg|center|128px]]
| 1876-07-15
| 1930-09-13
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 1380
| ''[[:d:Q3178817|Jim Hannan]]''
| [[File:Jim Hannan.jpg|center|128px]]
| 1864-10
| 1905-06-22
| [[Newport]]
|-
| style='text-align:right'| 1381
| ''[[:d:Q3178941|Jim Shanklin]]''
|
| 1948-12-11
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 1382
| ''[[:d:Q3180936|John Arthur Jones]]''
|
| 1857
| 1919
| [[Wales]]
|-
| style='text-align:right'| 1383
| ''[[:d:Q3181054|John Bevan]]''
|
| 1950-10-28
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 1384
| ''[[:d:Q3181079|John Bloomfield]]''
|
| 1942
|
| [[Wales]]
|-
| style='text-align:right'| 1385
| ''[[:d:Q3181171|John Callis]]''
|
|
| 1576
| [[Wales]]
|-
| style='text-align:right'| 1386
| ''[[:d:Q3181347|John Devereux]]''
| [[File:John Devereux.jpg|center|128px]]
| 1966-03-30
|
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 1387
| ''[[:d:Q3181658|John Gwyn Jeffreys]]''
| [[File:John Gwyn Jeffreys cropped.jpg|center|128px]]
| 1809-01-18
| 1885-01-21
| [[Swansea]]
|-
| style='text-align:right'| 1388
| ''[[:d:Q3181859|John Kendall-Carpenter]]''
|
| 1925-09
| 1990-05-24
| [[Cairdiff]]
|-
| style='text-align:right'| 1389
| ''[[:d:Q3181992|John Mantle]]''
|
| 1942-03-13
| 2018-11-18
| [[Cairdiff]]
|-
| style='text-align:right'| 1390
| ''[[:d:Q3182121|John Morgan]]''
|
| 1930-09-21
| 2004-11-15
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 1391
| ''[[:d:Q3182417|John Samuel]]''
|
| 1868
| 1947-12-23
| [[Swansea]]
|-
| style='text-align:right'| 1392
| ''[[:d:Q3182436|John Savage]]''
|
| 1932-05-28
| 2003-05-13
| [[Newport]]
|-
| style='text-align:right'| 1393
| ''[[:d:Q3182765|John Williams]]''
| [[File:Archbishop John Williams 1582 - 1650 portrait.jpg|center|128px]]
| 1582-03-22<br/>1582-03-25
| 1650-03-25
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 1394
| ''[[:d:Q3182987|Johnny Williams]]''
| [[File:Johnnie Williams.jpg|center|128px]]
| 1882-01-03
| 1916-07-12
| [[Wales]]
|-
| style='text-align:right'| 1395
| ''[[:d:Q3183202|Jon Jones]]''
|
| 1967-03-05
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1396
| ''[[:d:Q3183687|Jordan Follows]]''
|
| 1990-03-23
|
| [[Swansea]]
|-
| style='text-align:right'| 1397
| ''[[:d:Q3186047|Josiah Tucker]]''
| [[File:Josiah Tucker, Dean of Gloucester 02259.jpg|center|128px]]
| 1713
| 1799-11-04
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 1398
| ''[[:d:Q3189104|Julian Richards]]''
| [[File:JulianRichards(director).jpg|center|128px]]
| 1968-07-31<br/>1965-07-31
|
| [[Newport]]
|-
| style='text-align:right'| 1399
| ''[[:d:Q3194743|Keith Jarrett]]''
| [[File:Keith Jarrett 2014.jpg|center|128px]]
| 1948-05-18
|
| [[Newport]]
|-
| style='text-align:right'| 1400
| ''[[:d:Q3194950|Kel Coslett]]''
|
| 1942-01-14
|
| [[Wales]]
|-
| style='text-align:right'| 1401
| ''[[:d:Q3195050|Ken Jones]]''
|
| 1941-08-07
| 2022-08-24
| ''[[:d:Q1351146|Cross Hands]]''
|-
| style='text-align:right'| 1402
| ''[[:d:Q3195079|Ken Owens]]''
| [[File:Ken Owens. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1987-01-03
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1403
| ''[[:d:Q3195435|Keri Collins]]''
|
| 1978-09-30
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1404
| ''[[:d:Q3195767|Kevin Morgan]]''
|
| 1977-02-23
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1405
| ''[[:d:Q3195786|Kevin Phillips]]''
|
| 1961-06-15
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1406
| ''[[:d:Q3199733|Kris Thomas]]''
|
| 1983-01-16
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1407
| ''[[:d:Q3228892|Lee Jarvis]]''
|
| 1976-09-30
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1408
| ''[[:d:Q3228894|Lee Kendall]]''
|
| 1981-01-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1409
| ''[[:d:Q3228944|Lee Thomas]]''
|
| 1984-06-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1410
| ''[[:d:Q3236188|Leslie Williams]]''
|
| 1922-05-10
| 2006-01-27
| [[Wales]]
|-
| style='text-align:right'| 1411
| ''[[:d:Q3237297|Lewis Jones]]''
| [[File:Benjamin Lewis Jones 1950.jpg|center|128px]]
| 1931-04-11
| 2024-03-04
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 1412
| ''[[:d:Q3242418|Lisa Lazarus]]''
|
| 1987-11-11
|
| [[Swansea]]
|-
| style='text-align:right'| 1413
| ''[[:d:Q3242440|Lisa Rogers]]''
|
| 1971-09-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1414
| ''[[:d:Q3250688|Caradog Prichard]]''
|
| 1904-11-03
| 1980-02-25
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 1415
| ''[[:d:Q3251003|Tom Macdonald]]''
|
| 1900-11-02
| 1980-02-09
| ''[[:d:Q3401728|Llandre]]''
|-
| style='text-align:right'| 1416
| ''[[:d:Q3257496|Llewellyn Lloyd]]''
| [[File:Llewellyn Lloyd.jpg|center|128px]]
| 1877-07
| 1957-08-01
| [[Newport]]
|-
| style='text-align:right'| 1417
| ''[[:d:Q3257547|Lloyd Williams]]''
| [[File:Lloyd Williams March 2023.jpg|center|128px]]
| 1989-11-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1418
| ''[[:d:Q3257561|Llŷr Ifans]]''
| [[File:Llyr Ifans, Terry Waite ar Asid.jpg|center|128px]]
| 1968-07-22
|
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 1419
| ''[[:d:Q3262891|Lou Phillips]]''
| [[File:Lou Phillips 1900.jpg|center|128px]]
| 1878-02-24
| 1916-03-14
| [[Newport]]
|-
| style='text-align:right'| 1420
| ''[[:d:Q3266024|Lucy Vincent]]''
|
| 1958
|
| [[Wales]]
|-
| style='text-align:right'| 1421
| ''[[:d:Q3269512|Lyndon Mustoe]]''
|
| 1969-01-30
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 1422
| ''[[:d:Q3270230|Goronwy Rees]]''
|
| 1909-11-29
| 1979-12-12
| [[Aberystwyth]]
|-
| style='text-align:right'| 1423
| ''[[:d:Q3273906|Mac Adams]]''
| [[File:Mac Adams.jpg|center|128px]]
| 1943-04-15
|
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 1424
| ''[[:d:Q3278112|Dorothea Bate]]''
| [[File:Dorothea Minola Alice Bate.jpg|center|128px]]
| 1878-11-08
| 1951-01-13
| ''[[:d:Q29488358|Napier House]]''
|-
| style='text-align:right'| 1425
| ''[[:d:Q3281723|Malcolm Thomas]]''
| [[File:Malcolm Campbell Thomas 1950.jpg|center|128px]]
| 1929-04-25
| 2012-04-09
| [[Wales]]
|-
| style='text-align:right'| 1426
| ''[[:d:Q3288217|Marc Limbert]]''
| [[File:Marc limbert (cropped).jpg|center|128px]]
| 1973-10-03
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 1427
| ''[[:d:Q3294221|Mark Ring]]''
|
| 1962-10-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1428
| ''[[:d:Q3294253|Mark Taylor]]''
|
| 1973-02-27
|
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 1429
| ''[[:d:Q3296143|Mary Balogh]]''
|
| 1944-03-24
|
| [[Swansea]]
|-
| style='text-align:right'| 1430
| ''[[:d:Q3296186|Mary Herbert]]''
|
| 1903-10-01
| 1983-01-23
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 1431
| ''[[:d:Q3299493|Matt Jones]]''
| [[File:Matthew Jones.jpg|center|128px]]
| 1980-09-01
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1432
| ''[[:d:Q3299663|Matthew Bancroft]]''
|
| No/unknown value
|
| [[Wales]]
|-
| style='text-align:right'| 1433
| ''[[:d:Q3299703|Matthew Dent]]''
|
| 1981
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1434
| ''[[:d:Q3299747|Matthew Jones]]''
|
| 1984-04-04
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1435
| ''[[:d:Q3299763|Matthew Myers]]''
|
| 1984-11-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1436
| ''[[:d:Q3299818|Matthew Watkins]]''
|
| 1978-09-02
| 2020-03-07
| [[Newport]]
|-
| style='text-align:right'| 1437
| ''[[:d:Q3300771|David Brunt]]''
|
| 1886-06-17
| 1965-02-05
| ''[[:d:Q7605133|Staylittle]]''
|-
| style='text-align:right'| 1438
| ''[[:d:Q3301335|Maurice Richards]]''
|
| 1945-02-02
|
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 1439
| ''[[:d:Q3304186|Mefin Davies]]''
| [[File:Mefin Davies Rugby Union Player.JPG|center|128px]]
| 1972-09-02
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1440
| ''[[:d:Q3304839|Mel Baker]]''
| [[File:Mel Baker.png|center|128px]]
| 1885-07
| 20th century
| [[Newport]]
|-
| style='text-align:right'| 1441
| ''[[:d:Q3308132|Michael David]]''
|
| 1930-05-23
| 1999-01-24<br/>1999-03
| [[Cairdiff]]
|-
| style='text-align:right'| 1442
| ''[[:d:Q3308279|Michael Jones]]''
|
| 1940-12-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1443
| ''[[:d:Q3308429|Michael Paget]]''
| [[File:Bullet for my Valentine - Wacken Open Air 2016-AL2256.jpg|center|128px]]
| 1979-09-12<br/>1978-09-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1444
| ''[[:d:Q3309503|Cy Thomas]]''
|
| 1926-08-05
| 2009-01-02
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 1445
| ''[[:d:Q3309601|Iwan Roberts]]''
| [[File:Iwan Roberts (cropped).jpg|center|128px]]
| 1968-06-26
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1446
| ''[[:d:Q3313332|Mike Gibbins]]''
| [[File:Mike gibbins.jpg|center|128px]]
| 1949-03-12
| 2005-10-04
| [[Swansea]]
|-
| style='text-align:right'| 1447
| ''[[:d:Q3313349|Mike Griffiths]]''
|
| 1962-03-18
|
| ''[[:d:Q3400833|Clydach Vale]]''
|-
| style='text-align:right'| 1448
| ''[[:d:Q3313351|Mike Hall]]''
|
| 1965-10-13
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1449
| ''[[:d:Q3313516|Mike Roberts]]''
|
| 1946-02-20
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 1450
| ''[[:d:Q3323734|Alexandra Roach]]''
|
| 1987-08-23
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 1451
| ''[[:d:Q3324109|Einion ap Gwgon]]''
|
| 12nd century
|
| [[Wales]]
|-
| style='text-align:right'| 1452
| ''[[:d:Q3324117|Llywarch ap Llywelyn]]''
|
| 12nd century
| 1220
| [[Wales]]
|-
| style='text-align:right'| 1453
| ''[[:d:Q3324139|Y Prydydd Bychan]]''
|
| 1200s
|
| [[Wales]]
|-
| style='text-align:right'| 1454
| ''[[:d:Q3324142|Peryf ap Cedifor]]''
|
| 12nd century
|
| [[Wales]]
|-
| style='text-align:right'| 1455
| ''[[:d:Q3330999|Gwgon ap Meurig]]''
|
| 808
| 872
| ''[[:d:Q2578706|Kingdom of Ceredigion]]''
|-
| style='text-align:right'| 1456
| ''[[:d:Q3331107|Hywel Foel ap Griffri ap Pwyll Wyddel]]''
|
| 13rd century
|
| [[Wales]]
|-
| style='text-align:right'| 1457
| ''[[:d:Q3331114|Goronwy Foel]]''
|
|
| 13rd century
| ''[[:d:Q837136|Kingdom of Deheubarth]]''
|-
| style='text-align:right'| 1458
| ''[[:d:Q3331118|Mererid Hopwood]]''
| [[File:Mererid Hopwood, Cadeirydd y cyfarfod Dyfodol i’r Iaith, Yr Egin, Caerfyrddin (cropped).jpg|center|128px]]
| 1964-02-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1459
| ''[[:d:Q3331132|Phylip Brydydd]]''
|
| 1200
| 1225
| [[Wales]]
|-
| style='text-align:right'| 1460
| ''[[:d:Q3331138|Bleddyn Fardd]]''
|
| 1258
| 1284
| [[Wales]]
|-
| style='text-align:right'| 1461
| ''[[:d:Q3331143|Iorwerth Fychan]]''
|
| 13rd century
|
| [[Wales]]
|-
| style='text-align:right'| 1462
| ''[[:d:Q3331150|Gwilym Rhyfel]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 1463
| ''[[:d:Q3331168|Dafydd Benfras]]''
|
| 1230
| 1260
| [[Wales]]
|-
| style='text-align:right'| 1464
| ''[[:d:Q3331180|Llywelyn Fardd I]]''
|
| 1125
| 1200
| [[Wales]]
|-
| style='text-align:right'| 1465
| ''[[:d:Q3332440|Beirdd y Tywysogion]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 1466
| ''[[:d:Q3334867|Nadia Chambers]]''
|
| 1968-01-13
|
| [[Wales]]
|-
| style='text-align:right'| 1467
| ''[[:d:Q3336457|Natasha Harding]]''
| [[File:20150922 1826 W AUT WAL 3962.jpg|center|128px]]
| 1989-03-02
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1468
| ''[[:d:Q3337819|Neil Hamilton]]''
| [[File:Neil Hamilton (politician), March 2008.jpg|center|128px]]
| 1949-03-09
|
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 1469
| ''[[:d:Q3339853|Nick Ward]]''
|
| 1977-11-30
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1470
| ''[[:d:Q3340532|Nicolas Lloyd]]''
|
| 1630
| 1680
| [[Flintshire]]
|-
| style='text-align:right'| 1471
| ''[[:d:Q3341363|Nigel Redman]]''
|
| 1964-08-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1472
| ''[[:d:Q3341371|Nigel Williams]]''
|
| 1961-01-08
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1473
| ''[[:d:Q3343310|Non Evans]]''
| [[File:Non Evans (cropped).jpg|center|128px]]
| 1974-06-20
|
| [[Swansea]]
|-
| style='text-align:right'| 1474
| ''[[:d:Q3343747|Norman Biggs]]''
| [[File:Norman Biggs.jpg|center|128px]]
| 1870-11-03
| 1908-02-27
| [[Cairdiff]]
|-
| style='text-align:right'| 1475
| ''[[:d:Q3343775|Norman Gale]]''
|
| 1939-07-24
| 2005-01-30
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 1476
| ''[[:d:Q3350202|Tony Lewis]]''
|
| 1938-07-06
|
| [[Swansea]]
|-
| style='text-align:right'| 1477
| ''[[:d:Q3357354|Ossie Williams]]''
|
| 1921-04-12
| 1988-03-23
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1478
| ''[[:d:Q3358989|Owen Badger]]''
| [[File:Owen Badger.jpg|center|128px]]
| 1871-11-03
| 1939-03-17
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1479
| ''[[:d:Q3366739|James Williams]]''
|
| 1878-07-28
| 1929-12-21
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 1480
| ''[[:d:Q3367043|Edwin Richards]]''
|
| 1879-12-15
| 1930-12-10
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1481
| ''[[:d:Q3367054|Philip Turnbull]]''
|
| 1879-04-07
| 1930-10-20
| [[Cairdiff]]
|-
| style='text-align:right'| 1482
| ''[[:d:Q3370513|Paul Arnold]]''
|
| 1968-04-28
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 1483
| ''[[:d:Q3371796|Paul Mascarene]]''
| [[File:WLA lacma Smibert Scotland portrait of Paul Mascarene.jpg|center|128px]]
| 1684
| 1760-01-22
| ''[[:d:Q5648626|Hanmer]]''
|-
| style='text-align:right'| 1484
| ''[[:d:Q3371870|Paul Moriarty]]''
|
| 1964-07-16
|
| [[Swansea]]
|-
| style='text-align:right'| 1485
| ''[[:d:Q3375183|Percy Bush]]''
| [[File:Percy Bush 1905.jpg|center|128px]]
| 1879-06-23
| 1955-05-19
| [[Cairdiff]]
|-
| style='text-align:right'| 1486
| ''[[:d:Q3375217|Percy Phillips]]''
|
| 1869-07
| 1947-02-26
| [[Wales]]
|-
| style='text-align:right'| 1487
| ''[[:d:Q3376765|Peter Morgan]]''
|
| 1959-01-01
| 2024-07-28
| ''[[:d:Q4971889|Broad Haven]]''
|-
| style='text-align:right'| 1488
| ''[[:d:Q3377178|Stephen Kinnock]]''
| [[File:Official portrait of Stephen Kinnock MP crop 2.jpg|center|128px]]
| 1970-01-01
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1489
| ''[[:d:Q3378756|Phil Davies]]''
|
| 1963-10-19
|
| [[Neath Port Talbot]]
|-
| style='text-align:right'| 1490
| ''[[:d:Q3378770|Phil Dwyer]]''
| [[File:Phil Dwyer.jpg|center|128px]]
| 1953-10-28
| 2021-11-30
| [[Cairdiff]]
|-
| style='text-align:right'| 1491
| ''[[:d:Q3378979|Philip Burton]]''
|
| 1904-11-30
| 1995-01-28
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 1492
| ''[[:d:Q3379022|Phil Hopkins]]''
| [[File:Philip Hopkins.jpg|center|128px]]
| 1880-01-31
| 1966-09-26
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 1493
| ''[[:d:Q3379099|Philip Wood]]''
|
| 1928-10
| 2008-06
| [[Cairdiff]]
|-
| style='text-align:right'| 1494
| ''[[:d:Q3390705|Laurence Eaves]]''
|
| 1948-05-13
|
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 1495
| ''[[:d:Q3391364|Daniel Evans]]''
| [[File:Daniel Evans.jpg|center|128px]]
| 1973-07-31
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 1496
| ''[[:d:Q3395389|Philip Jones Griffiths]]''
| [[File:Philip Jones Griffiths in Bali, Fall, 2000AD.jpg|center|128px]]
| 1936-02-18
| 2008-03-19
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 1497
| ''[[:d:Q3395436|Tim Vincent]]''
| [[File:Tim Vincent in 2017.jpg|center|128px]]
| 1972-11-04
|
| ''[[:d:Q7114024|Owrtyn]]''
|-
| style='text-align:right'| 1498
| ''[[:d:Q3395446|Daniel Owen]]''
| [[File:Storïau o Hanes Cymru cyf I (Daniel Owen).jpg|center|128px]]
| 1836-10-20
| 1895-10-22
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 1499
| ''[[:d:Q3395608|Joseph Parry]]''
| [[File:Dr Joseph Parry (Pencerdd America, 1841-1903) NLW3364255.jpg|center|128px]]
| 1841-05-21
| 1903-02-17
| ''[[:d:Q23540859|Joseph Parry's Cottage]]''<br/>[[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1500
| ''[[:d:Q3395749|Robert Morton Nance]]''
|
| 1873
| 1959
| [[Cairdiff]]
|-
| style='text-align:right'| 1501
| ''[[:d:Q3395909|Thomas Price]]''
| [[File:Carnhuanawc.jpg|center|128px]]
| 1787-10-02
| 1848-11-07
| ''[[:d:Q56099430|Llanfihangel Bryn Pabuan]]''
|-
| style='text-align:right'| 1502
| ''[[:d:Q3396307|Eileen Beasley]]''
|
| 1921-04-04
| 2012-08-12
| ''[[:d:Q5714715|Henllan Amgoed]]''
|-
| style='text-align:right'| 1503
| ''[[:d:Q3396721|Llywelyn ap Gruffydd Fychan]]''
| [[File:Castell Llanymddyfri Sir Gaerfyrddin gyda cherflun o - LLywelyn ap Gruffydd Fychan 07.JPG|center|128px]]
| 1341
| 1401-10-09
| ''[[:d:Q20586538|Caeo]]''
|-
| style='text-align:right'| 1504
| ''[[:d:Q3396810|Ieuan Wyn Jones]]''
| [[File:Ieuan Wyn Jones 2011.jpg|center|128px]]
| 1949-05-22
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 1505
| ''[[:d:Q3396852|Geraint Bowen]]''
|
| 1915-09-10
| 2011-07-16
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1506
| ''[[:d:Q3396876|Ambrose Bebb]]''
| [[File:William Ambrose Bebb (5236463).jpg|center|128px]]
| 1894-07-04
| 1955-04-27
| ''[[:d:Q15427716|Goginan]]''
|-
| style='text-align:right'| 1507
| ''[[:d:Q3397209|Thomas Vaughan]]''
|
| 1621-04-17
| 1666-02-27
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 1508
| ''[[:d:Q3397314|Richard Gwyn]]''
| [[File:Richard Gwyn.jpg|center|128px]]
| 1537-01-01
| 1584-10-15
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 1509
| ''[[:d:Q3397327|Glanmor Williams]]''
|
| 1920-05-05
| 2005-02-24<br/>2005-02-25
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 1510
| ''[[:d:Q3397435|John Dyer]]''
| [[File:John Dyer Dalziel.jpg|center|128px]]
| 1699
| 1757-12
| ''[[:d:Q770818|Llanfynydd]]''
|-
| style='text-align:right'| 1511
| ''[[:d:Q3397600|William Williams Pantycelyn]]''
| [[File:Portrait of Parch. William Williams, Pant-y-Celyn (4674719) (cropped).jpg|center|128px]]
| 1717-02-11
| 1791-01-11
| ''[[:d:Q3403140|Llanfair-ar-y-bryn]]''
|-
| style='text-align:right'| 1512
| ''[[:d:Q3397651|Howel Harris]]''
| [[File:Howell harris.jpg|center|128px]]
| 1714-01-23
| 1773
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 1513
| ''[[:d:Q3397705|Eifion Williams]]''
|
| 1975-11-15
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1514
| ''[[:d:Q3398027|Owain Owain]]''
| [[File:Owain Owain Traeth Coch circa 1966 01.jpg|center|128px]]
| 1929-12-11
| 1993-12-19
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 1515
| ''[[:d:Q3398074|Mihangel Morgan]]''
|
| 1955-12-07
|
| ''[[:d:Q7837453|Trecynon]]''
|-
| style='text-align:right'| 1516
| ''[[:d:Q3398131|Catrin Finch]]''
| [[File:Catrinfinch-anoriant2008.png|center|128px]]
| 1980-04-24
|
| [[Ceredigion]]
|-
| style='text-align:right'| 1517
| ''[[:d:Q3398315|Tudno]]''
| [[File:1419209 4fdfc842.jpg|center|128px]]
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 1518
| ''[[:d:Q3398331|Siôn Aled Owen]]''
|
| 1957-01-27
|
| [[Wales]]
|-
| style='text-align:right'| 1519
| ''[[:d:Q3398347|Lewis Morris]]''
| [[File:Lewis Morris 1701-1765.JPG|center|128px]]
| 1701-03-02
| 1765-04-11
| ''[[:d:Q13129642|Llanfihangel Tre'r Beirdd]]''
|-
| style='text-align:right'| 1520
| ''[[:d:Q3398374|Meic Stevens]]''
| [[File:Meic Stevens 2011.jpg|center|128px]]
| 1942-03-13
|
| ''[[:d:Q1022259|Solfach]]''
|-
| style='text-align:right'| 1521
| ''[[:d:Q3398381|Richard Hughes Williams]]''
| [[File:Dic Tryfan (Cymeriadau TGJ).jpg|center|128px]]
| 1878
| 1919-07-26
| ''[[:d:Q3396925|Rhosgadfan]]''
|-
| style='text-align:right'| 1522
| ''[[:d:Q3398425|D. J. Williams]]''
| [[File:D.J.Williams memorial stone - geograph.org.uk - 312323.jpg|center|128px]]
| 1885-06-26
| 1970-01-04
| ''[[:d:Q3406111|Llansawel]]''
|-
| style='text-align:right'| 1523
| ''[[:d:Q3398434|Lewis Valentine]]''
| [[File:Parch Lewis Valentine yn ifanc.jpg|center|128px]]
| 1893-06-01
| 1986-03-05
| ''[[:d:Q6661173|Llanddulas]]''
|-
| style='text-align:right'| 1524
| ''[[:d:Q3398467|John Dyfnallt Owen]]''
| [[File:Dyfnallt.jpg|center|128px]]
| 1873-04-07
| 1956-12-28
| ''[[:d:Q11157973|Llan-giwg]]''
|-
| style='text-align:right'| 1525
| ''[[:d:Q3398492|Emily Huws]]''
|
| 1942-03-03
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 1526
| ''[[:d:Q3398669|Jon Lee]]''
|
| 1968-03-28
| 2002-01-07
| [[Newport]]
|-
| style='text-align:right'| 1527
| ''[[:d:Q3398769|Jeremy Bowen]]''
| [[File:Jeremy Bowen at City University.jpg|center|128px]]
| 1960-02-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1528
| ''[[:d:Q3398798|Richard Aaron]]''
|
| 1901-11-06
| 1987-03-29
| ''[[:d:Q7457421|Blaendulais]]''
|-
| style='text-align:right'| 1529
| ''[[:d:Q3398931|Euros Bowen]]''
|
| 1904-09-12
| 1988-04-02
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 1530
| ''[[:d:Q3398951|Urien Wiliam]]''
|
| 1929-11-07
| 2006-10-21
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1531
| ''[[:d:Q3399070|Llywarch y Nam]]''
|
| 1150
| 1160
| [[Wales]]
|-
| style='text-align:right'| 1532
| ''[[:d:Q3399200|April Jones]]''
|
| 2007-04-04
| 2012-10
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 1533
| ''[[:d:Q3399253|Christmas Evans]]''
| [[File:William Roos - Christmas Evans (1835).jpg|center|128px]]
| 1766-12-25
| 1838-07-19
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 1534
| ''[[:d:Q3399280|Rhys Gryg]]''
| [[File:Rice Grug.jpg|center|128px]]
| 1160
| 1234
| [[Wales]]
|-
| style='text-align:right'| 1535
| ''[[:d:Q3399335|D. Gwenallt Jones]]''
|
| 1899-05-18
| 1968<br/>1968-12-24
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 1536
| ''[[:d:Q3399340|Cybi]]''
| [[File:Eglwys Sant Beuno, St Beuno's Church, Penmorfa, Eifionydd, Gwynedd, Cymru Wales 46.JPG|center|128px]]
| 483
| 555-11-08
| [[Cornwall]]<br/>''[[:d:Q7163120|Penmon]]''
|-
| style='text-align:right'| 1537
| ''[[:d:Q3399352|John Parry]]''
| [[File:John Parry (Bardd Alaw) The Welsh Harper (1848) 02.JPG|center|128px]]
| 1776-02-18
| 1851-04-08
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 1538
| ''[[:d:Q3399383|Eliseus Williams]]''
| [[File:Eifion Wyn 01(dg).JPG|center|128px]]
| 1867-05-02
| 1926-10-13
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 1539
| ''[[:d:Q3399427|Ifan ab Owen Edwards]]''
| [[File:Statue of Ifan ab Owen Edwards.jpg|center|128px]]
| 1895-07-25
| 1970-01-23
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 1540
| ''[[:d:Q3399552|John Roberts]]''
| [[File:John Roberts (martyr).webp|center|128px]]
| 1577
| 1610-12-10
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 1541
| ''[[:d:Q3399667|Ian "H" Watkins]]''
| [[File:Ian 'H' Watkins at a Steps in-store album signing, 19th August 2022, HMV Manchester.jpg|center|128px]]
| 1976-05-08
|
| [[Llwynypia]]
|-
| style='text-align:right'| 1542
| ''[[:d:Q3399695|Rowland Williams]]''
| [[File:Portrait of Rowland Williams (4671222) (cropped).jpg|center|128px]]
| 1817-08-16
| 1870
| ''[[:d:Q5642527|Helygain]]''
|-
| style='text-align:right'| 1543
| ''[[:d:Q3399714|Tavis Knoyle]]''
|
| 1990-06-02
|
| [[Powys]]
|-
| style='text-align:right'| 1544
| ''[[:d:Q3399737|Wilf Wooller]]''
|
| 1912-11-20
| 1997-03-10
| ''[[:d:Q2075495|Rhos-on-Sea]]''
|-
| style='text-align:right'| 1545
| ''[[:d:Q3399746|Rhys H. Williams]]''
|
| 1930-07-14
| 1993-01-27
| [[Wales]]
|-
| style='text-align:right'| 1546
| ''[[:d:Q3399819|Scott Williams]]''
| [[File:Scott Williams 2022.jpg|center|128px]]
| 1990-10-10
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1547
| ''[[:d:Q3399836|Thomas Gee]]''
| [[File:Portrait of Thomas Gee (4672372).jpg|center|128px]]
| 1815-01-24
| 1898-09-28
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 1548
| ''[[:d:Q3399847|Alun Lewis]]''
|
| 1915-07-01
| 1944-03-05
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 1549
| ''[[:d:Q3399895|Dafydd ab Edmwnd]]''
|
| 15th century
| 1497
| ''[[:d:Q5648626|Hanmer]]''
|-
| style='text-align:right'| 1550
| ''[[:d:Q3400194|William Evans]]''
|
| 1883-04-22
| 1968-07-16
| ''[[:d:Q6661877|Llanwinio]]''
|-
| style='text-align:right'| 1551
| ''[[:d:Q3400203|John Roberts]]''
| [[File:Revd John Roberts (Ieuan Gwyllt) - cropped, retouched.jpg|center|128px]]
| 1822-12-22
| 1877-05
| [[Aberystwyth]]
|-
| style='text-align:right'| 1552
| ''[[:d:Q3400343|Eluned Phillips]]''
|
| 1914-10-27
| 2009-01-10
| [[Wales]]
|-
| style='text-align:right'| 1553
| ''[[:d:Q3400399|Craig Roberts]]''
| [[File:Craig Roberts at the Moet BIFA British Independent Film Awards 2014 (15356308524).jpg|center|128px]]
| 1991-01-21
|
| ''[[:d:Q6729370|Maesycwmer]]''
|-
| style='text-align:right'| 1554
| ''[[:d:Q3400408|Morgan Llwyd]]''
|
| 1619
| 1659-06-03
| ''[[:d:Q6729249|Maentwrog]]''
|-
| style='text-align:right'| 1555
| ''[[:d:Q3400435|Keidrych Rhys]]''
|
| 1915-12-26
| 1987-05-22
| ''[[:d:Q4898006|Bethlehem]]''
|-
| style='text-align:right'| 1556
| ''[[:d:Q3400440|Daniel Rowland]]''
| [[File:Portrait of Parch. Daniel Rowland, Llangeitho (4674724).jpg|center|128px]]
| 1713
| 1790-10-16
| ''[[:d:Q16542738|Nantcwnlle]]''
|-
| style='text-align:right'| 1557
| ''[[:d:Q3400456|John Robert Jones]]''
|
| 1911-09-04
| 1970-06-03
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 1558
| ''[[:d:Q3400520|Vavasor Powell]]''
|
| 1617
| 1670-10-27
| ''[[:d:Q6423716|Knucklas]]''
|-
| style='text-align:right'| 1559
| ''[[:d:Q3400599|Owen Edwards]]''
|
| 1933-12-26
| 2010-08-31
| [[Aberystwyth]]
|-
| style='text-align:right'| 1560
| ''[[:d:Q3400605|Idris Davies]]''
|
| 1905-01-06
| 1953-04-06
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 1561
| ''[[:d:Q3400624|Sir Harry Llewellyn, 3rd Baronet]]''
| [[File:1952OG-Llewellyn-Foxhunter.jpg|center|128px]]
| 1911-07-18
| 1999-11-15
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 1562
| ''[[:d:Q3400660|Rhygyfarch]]''
|
| 1057
| 1099
| [[St Davids]]
|-
| style='text-align:right'| 1563
| ''[[:d:Q3400672|Nina Davies]]''
| [[File:Nina Davies 2008MarathonChamps.jpg|center|128px]]
| 1974-09-14
|
| [[Vale o Glamorgan]]
|-
| style='text-align:right'| 1564
| ''[[:d:Q3400718|Thomas Stephens]]''
| [[File:Thomas Stephens (1821–1875) (cropped).jpg|center|128px]]
| 1821-04-21
| 1875-01-04
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 1565
| ''[[:d:Q3400803|Jon Ronson]]''
| [[File:Jon Ronson (27846097432) (cropped).jpg|center|128px]]
| 1967-05-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1566
| ''[[:d:Q3400851|Gwyneth Lewis]]''
| [[File:Gwyneth Lewis.jpg|center|128px]]
| 1959-11-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1567
| ''[[:d:Q3400896|Elystan Glodrydd]]''
| [[File:Escutcheon of Elystan Glodrydd.svg|center|128px]]
| 975
| 1010
| [[Wales]]
|-
| style='text-align:right'| 1568
| ''[[:d:Q3400917|Elinor Bennett]]''
| [[File:Talynau A Chan - Folk Songs & Harps, album cover.jpg|center|128px]]
| 1943-04-17
|
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 1569
| ''[[:d:Q3401013|Powys Thomas]]''
|
| 1925-12-25
| 1977-06-22
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1570
| ''[[:d:Q3401048|Lewis Jones]]''
| [[File:LewisJones.jpg|center|128px]]
| 1836-01-30
| 1904-11-24
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 1571
| ''[[:d:Q3401261|John Jones]]''
| [[File:John-jones.png|center|128px]]
| No/unknown value
| 1598-07-12
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 1572
| ''[[:d:Q3401313|Howard Winstone]]''
| [[File:Howard-Winstone-boxer.jpg|center|128px]]
| 1939-04-15
| 2000-09-30
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1573
| ''[[:d:Q3401348|Arwel Hughes]]''
|
| 1909-08-25
| 1988-09-23
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 1574
| ''[[:d:Q3401357|Rhys Gabe]]''
| [[File:Rhys Gabe.jpg|center|128px]]
| 1880-06-22
| 1967-09-15
| [[Wales]]<br/>''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 1575
| ''[[:d:Q3401572|Robert ap Huw]]''
|
| 1580
| 1665
| ''[[:d:Q17742498|Plas Penmynydd]]''
|-
| style='text-align:right'| 1576
| ''[[:d:Q3401584|Simon Weston]]''
| [[File:Simon Weston cropped.jpg|center|128px]]
| 1961-08-08
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1577
| ''[[:d:Q3401592|Cynllo]]''
| [[File:Llangynllo Church - geograph.org.uk - 722642.jpg|center|128px]]
|
|
| [[Ceredigion]]
|-
| style='text-align:right'| 1578
| ''[[:d:Q3401615|Islwyn Ffowc Elis]]''
|
| 1924-11-17
| 2004-01-22
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1579
| ''[[:d:Q3401655|Waldo Williams]]''
| [[File:Waldo Williams dim dyddiad gwella contrast crop.jpg|center|128px]]
| 1904-09-30
| 1971-05-20
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 1580
| ''[[:d:Q3401662|Pennar Davies]]''
|
| 1911-11-12
| 1996<br/>1996-12-29
| ''[[:d:Q27556140|Mountain Ash]]''
|-
| style='text-align:right'| 1581
| ''[[:d:Q3401736|Emrys ap Iwan]]''
| [[File:Emrys ap Iwan (cropped).JPG|center|128px]]
| 1848-03-24
| 1906-01-06
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 1582
| ''[[:d:Q3401751|Irma Chilton]]''
|
| 1930-11-12
| 1990-12-01
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 1583
| ''[[:d:Q3401988|Saint Peris]]''
| [[File:Llanberis Eglwys Sant Padarn - Church of St Padarn, Llanberis, Gwynedd, Wales 16.jpg|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 1584
| ''[[:d:Q3402000|Elin Manahan Thomas]]''
| [[File:Doctor Who Symphonic Spectacular (Leeds 2015) (17603021913).jpg|center|128px]]
| 1977
|
| [[Swansea]]
|-
| style='text-align:right'| 1585
| ''[[:d:Q3402032|Angharad Tomos]]''
| [[File:Angharad Tomos.JPG|center|128px]]
| 1958-07-19
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1586
| ''[[:d:Q3402075|Dic Penderyn]]''
|
| 1808
| 1831-08-13
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 1587
| ''[[:d:Q3402110|John Jones]]''
| [[File:John Jones (Jac Glanygors).jpg|center|128px]]
| 1766-11-10
| 1821-05-21
| ''[[:d:Q5064823|Cerrigydrudion]]''
|-
| style='text-align:right'| 1588
| ''[[:d:Q3402172|Iorwerth Peate]]''
|
| 1901-02-27
| 1982-10-19
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 1589
| ''[[:d:Q3402227|Twm Siôn Cati]]''
|
| 1530<br/>1532-08-10
| 1608
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 1590
| ''[[:d:Q3402307|Gwyn Jones]]''
|
| 1907-05-24
| 1999-12-06
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 1591
| ''[[:d:Q3402381|Anneliese Heard]]''
|
| 1981-11-03
|
| [[Swansea]]
|-
| style='text-align:right'| 1592
| ''[[:d:Q3402447|Kate Roberts]]''
| [[File:Kate Roberts 1923.jpg|center|128px]]
| 1891-02-13
| 1985-04-14
| ''[[:d:Q29499111|Cae'r Gors]]''
|-
| style='text-align:right'| 1593
| ''[[:d:Q3402507|Gwynn ap Gwilym]]''
|
| 1950-06-23
| 2016-07-31
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1594
| ''[[:d:Q3402530|Rhys Davies]]''
| [[File:Rhys Davies 1921.png|center|128px]]
| 1901-11-09
| 1978-08-21
| ''[[:d:Q20161307|Blaenclydach]]''
|-
| style='text-align:right'| 1595
| ''[[:d:Q3402590|Charles Ashton]]''
| [[File:Charles Ashton.jpg|center|128px]]
| 1848-09-04
| 1899-10-13
| ''[[:d:Q11130142|Llawryglyn]]''
|-
| style='text-align:right'| 1596
| ''[[:d:Q3402674|Seren Gibson]]''
|
| 1988-01-16
|
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 1597
| ''[[:d:Q3402724|Sian Adey-Jones]]''
|
| 1957-12
|
| ''[[:d:Q11008013|Bodfari]]''
|-
| style='text-align:right'| 1598
| ''[[:d:Q3402767|Sir Love Jones-Parry, 1st Baronet]]''
| [[File:Love Jones Parry.jpg|center|128px]]
| 1832-01-05
| 1891-12-18
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 1599
| ''[[:d:Q3402902|Vulcana]]''
| [[File:Vulcana1900.jpg|center|128px]]
| 1874-05-06
| 1946-08-08
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1600
| ''[[:d:Q3403069|Robert Croft]]''
| [[File:Robert Croft.jpg|center|128px]]
| 1970-05-25
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 1601
| ''[[:d:Q3403081|Allan Watkins]]''
|
| 1922-04-21
| 2011-08-03
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 1602
| ''[[:d:Q3403131|Theophilus Evans]]''
|
| 1693-02-21
| 1767-09-11
| ''[[:d:Q20598147|Cwm-cou]]''<br/>''[[:d:Q11932059|Llandygwydd]]''
|-
| style='text-align:right'| 1603
| ''[[:d:Q3403145|William Abraham]]''
| [[File:William Abraham - Mabon.jpeg|center|128px]]
| 1842-06-14
| 1922-05-14
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 1604
| ''[[:d:Q3403153|Tiggy Legge-Bourke]]''
|
| 1965-04-01
|
| ''[[:d:Q5566651|Glanusk Park]]''
|-
| style='text-align:right'| 1605
| ''[[:d:Q3403159|Leslie Thomas]]''
| [[File:Leslie Thomas, John Kirkham, Henry Buckton 50796451733) (Thomas cropped).jpg|center|128px]]
| 1931-03-22
| 2014-05-07<br/>2014-05-06<br/>2014
| [[Newport]]
|-
| style='text-align:right'| 1606
| ''[[:d:Q3403217|Primael]]''
|
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 1607
| ''[[:d:Q3403412|Carys Parry]]''
|
| 1981-07-24
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1608
| ''[[:d:Q3403496|Ann Griffiths]]''
|
| 1776-04
| 1805-08
| ''[[:d:Q10989923|Llanfihangel-yng-Ngwynfa]]''
|-
| style='text-align:right'| 1609
| ''[[:d:Q3403511|Llew Smith]]''
|
| 1944-04-16
| 2021-05-26
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 1610
| ''[[:d:Q3403520|Tom Ellis]]''
|
| 1924-03-15
| 2010-04-14
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 1611
| ''[[:d:Q3403524|Eurig Wyn]]''
|
| 1944-10-10
| 2019-06-25
| ''[[:d:Q5741986|Hermon]]''
|-
| style='text-align:right'| 1612
| ''[[:d:Q3403530|Jack Jones]]''
|
| 1884-11-24
| 1970-05-07
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1613
| ''[[:d:Q3403537|Griffith J. Griffith]]''
| [[File:Griffith Jenkins Griffith.jpg|center|128px]]
| 1850-01-04
| 1919-07-06
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 1614
| ''[[:d:Q3403542|John Dillwyn Llewelyn]]''
| [[File:Johndillwyn thoughful.jpg|center|128px]]
| 1810-01-12
| 1882-08<br/>1882-08-24
| [[Swansea]]
|-
| style='text-align:right'| 1615
| ''[[:d:Q3403561|John Thomas]]''
| [[File:John Thomas (Photographer).jpg|center|128px]]
| 1838-04-14
| 1905-10-14
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 1616
| ''[[:d:Q3403718|Sara Sugarman]]''
|
| 1962-10-13<br/>1965-10-13
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 1617
| ''[[:d:Q3403741|Rhys Priestland]]''
| [[File:Rhys Priestland. Wales Grand Slam Celebration, Senedd 19 March 2012 Rhys Priestland. Dathliadau Camp Lawn Cymru, Senedd 19 Mawrth 2012.jpg|center|128px]]
| 1987-01-09
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1618
| ''[[:d:Q3403756|John Blackwell]]''
| [[File:John Blackwell.jpg|center|128px]]
| 1797
| 1840-05-19
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 1619
| ''[[:d:Q3403967|David Cornell]]''
|
| 1991-03-28
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 1620
| ''[[:d:Q3404022|Pete Fowler]]''
|
| 1969
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1621
| ''[[:d:Q3404038|Elizabeth Phillips Hughes]]''
| [[File:Elizabeth Phillips Hughes.jpg|center|128px]]
| 1851-07-12<br/>1851-06-22
| 1925-12-19
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1622
| ''[[:d:Q3404191|James Dickson Innes]]''
| [[File:James Dickson Innes.jpg|center|128px]]
| 1887-02-27
| 1914-08-22
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1623
| ''[[:d:Q3404290|Michael D. Jones]]''
| [[File:Michael Daniel Jones (1822-1898).jpg|center|128px]]
| 1822-03-02
| 1898-12-02
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 1624
| ''[[:d:Q3404358|Julien Macdonald]]''
|
| 1971-03-19
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1625
| ''[[:d:Q3404390|David Davies, 1st Baron Davies]]''
| [[File:David Davies, Esquire (5294050).jpg|center|128px]]
| 1880-05-11
| 1944-06-16
| ''[[:d:Q6661212|Llandinam]]''
|-
| style='text-align:right'| 1626
| ''[[:d:Q3404451|George Fisher]]''
|
| 1909-01-26
| 1970-01-30
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 1627
| ''[[:d:Q3404543|Canna]]''
| [[File:Canna (santez) Santes Canna Llangan disc-headed cross slab (cropped).PNG|center|128px]]
| 6th century
| 6th century
| [[Wales]]
|-
| style='text-align:right'| 1628
| ''[[:d:Q3404550|Elis Gruffydd]]''
|
| 1490
| 1552
| ''[[:d:Q5623571|Gwespyr]]''
|-
| style='text-align:right'| 1629
| ''[[:d:Q3404614|Dilys Cadwaladr]]''
|
| 1902
| 1979
| ''[[:d:Q13129672|Llanrhychwyn]]''
|-
| style='text-align:right'| 1630
| ''[[:d:Q3404816|Tudur Aled]]''
|
| 1465
| 1525
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 1631
| ''[[:d:Q3404909|Ray Gravell]]''
|
| 1951-09-12
| 2007-10-31
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 1632
| ''[[:d:Q3404928|Glyndwr Michael]]''
| [[File:Glyndwr Michael.jpg|center|128px]]
| 1909-01-04
| 1943-01-28
| ''[[:d:Q2564732|Aberbargoed]]''
|-
| style='text-align:right'| 1633
| [[Adam Price]]
| [[File:Adam-price (cropped).jpg|center|128px]]
| 1968-09-23
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1634
| ''[[:d:Q3405113|Cynog Dafis]]''
| [[File:Cynog Dafis yn annerch y dorf Climate Strike, Aberystwyth (cropped).jpg|center|128px]]
| 1938-04-01
|
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 1635
| ''[[:d:Q3405552|W. J. Gruffydd]]''
|
| 1916-09-24
| 2011-04-21
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 1636
| ''[[:d:Q3405562|Pepsi Tate]]''
| [[File:Pepsitate GoM 2007.png|center|128px]]
| 1965-03-10
| 2007-09-18
| [[Wales]]
|-
| style='text-align:right'| 1637
| ''[[:d:Q3405572|John Owen-Jones]]''
| [[File:John Owen-Jones as Jean Valjean.jpg|center|128px]]
| 1971-05-05
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 1638
| ''[[:d:Q3405595|Alun Ffred Jones]]''
| [[File:Alun Ffred Jones.jpg|center|128px]]
| 1949-10-29
|
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 1639
| ''[[:d:Q3405919|Jac Jones]]''
|
| 1943-03-01
|
| ''[[:d:Q9001581|Gwalchmai]]''
|-
| style='text-align:right'| 1640
| ''[[:d:Q3406018|Mary Vaughan Jones]]''
|
| 1918-05-28
| 1983
| ''[[:d:Q1883614|Maenan]]''
|-
| style='text-align:right'| 1641
| ''[[:d:Q3406160|Emyr Humphreys]]''
|
| 1919-04-15
| 2020-09-30
| ''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 1642
| ''[[:d:Q3406214|Gruffudd ap Dafydd ap Tudur]]''
|
| 13rd century
|
| [[Wales]]
|-
| style='text-align:right'| 1643
| ''[[:d:Q3406223|Arthur Owens]]''
|
| 1899-04-14
| 1957-12-24
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 1644
| ''[[:d:Q3420485|Ray Cale]]''
|
| 1922-07-18
| 2006-06-05
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 1645
| ''[[:d:Q3420523|Ray Hopkins]]''
|
| 1946-07-08
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 1646
| ''[[:d:Q3423032|Rees Stephens]]''
| [[File:Rees Stephens 1950.jpg|center|128px]]
| 1922-04-16
| 1998-02-04
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1647
| ''[[:d:Q3423320|Reg Skrimshire]]''
|
| 1878-01-30
| 1963-09-20
| [[Wales]]
|-
| style='text-align:right'| 1648
| ''[[:d:Q3423421|Reggie Gibbs]]''
| [[File:Reggie Gibbs.jpg|center|128px]]
| 1882-05-07
| 1938-11-28
| [[Cairdiff]]
|-
| style='text-align:right'| 1649
| ''[[:d:Q3428841|Rex Willis]]''
| [[File:Rex Willis 1950.jpg|center|128px]]
| 1924-10-25
| 2000-01-19
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 1650
| ''[[:d:Q3429880|Rhys Williams]]''
|
| 1980-02-23
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1651
| ''[[:d:Q3430918|Richard Jones]]''
| [[File:Nova2013 Stereophonics Richard Jones 0001.jpg|center|128px]]
| 1974-05-23
|
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 1652
| ''[[:d:Q3431101|Richard Parks]]''
| [[File:Richard Parks.jpg|center|128px]]
| 1977-08-14
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1653
| ''[[:d:Q3431321|Richard Webster]]''
|
| 1967-07-09
|
| [[Swansea]]
|-
| style='text-align:right'| 1654
| ''[[:d:Q3431329|Richard Garnons Williams]]''
| [[File:Richard Garnons Williams.jpg|center|128px]]
| 1856-06-15
| 1915-09-25
| ''[[:d:Q6662218|Llowes]]''
|-
| style='text-align:right'| 1655
| ''[[:d:Q3433248|Margaretta Williams]]''
| [[File:Rita Williams.jpg|center|128px]]
| 1933
| 2018-09-03
| ''[[:d:Q5197248|Cwmgors]]''
|-
| style='text-align:right'| 1656
| ''[[:d:Q3434143|Robert Ackerman]]''
| [[File:Rob Ackerman 2013, watching the St Pat's Silverstream 2nd XV beat Wellington College.jpg|center|128px]]
| 1961-03-02
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 1657
| ''[[:d:Q3435545|Robert Jones]]''
|
| 1965-10-10
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 1658
| ''[[:d:Q3436303|Robert Sidoli]]''
|
| 1979-06-21
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1659
| ''[[:d:Q3436446|Ray Bennion]]''
|
| 1896-09-01
| 1968-03-12
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1660
| ''[[:d:Q3436554|Robert Wilfort]]''
|
| 1977-04-20
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 1661
| ''[[:d:Q3437797|Bertrand Turnbull]]''
|
| 1887-04-19
| 1943-11-17
| [[Cairdiff]]
|-
| style='text-align:right'| 1662
| ''[[:d:Q3438077|Robert Lyne]]''
|
| 1885-04-02
| 1957-04-13
| [[Newport]]
|-
| style='text-align:right'| 1663
| ''[[:d:Q3439676|Graham Dadds]]''
|
| 1911-03-16
| 1980-03-08
| [[Swansea]]
|-
| style='text-align:right'| 1664
| ''[[:d:Q3439724|William Griffiths]]''
|
| 1922-06-26
| 2010-10-27
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1665
| ''[[:d:Q3441369|Ron Burgess]]''
|
| 1917-04-09
| 2005-02-14
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 1666
| ''[[:d:Q3445568|Rowe Harding]]''
|
| 1901-09-10
| 1991-02-10
| [[Wales]]
|-
| style='text-align:right'| 1667
| ''[[:d:Q3445577|Rowland Griffiths]]''
|
| 1886-03-04
| 1914-05-04
| [[Wales]]
|-
| style='text-align:right'| 1668
| ''[[:d:Q3445664|Rowley Thomas]]''
|
| 1864-07-11
| 1949-01-21
| [[Wales]]
|-
| style='text-align:right'| 1669
| ''[[:d:Q3445745|Roy Bish]]''
| [[File:Rugby Roy Bish stadio Flaminio.jpg|center|128px]]
| 1929-10-20
| 2006-11-08
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1670
| ''[[:d:Q3445756|Roy Burnett]]''
|
| 1926-10-06
| 1998-07-30
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 1671
| ''[[:d:Q3445784|Roy John]]''
| [[File:Ernest Raymond John 1950.jpg|center|128px]]
| 1925-12-03
| 1981-09-30
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1672
| ''[[:d:Q3445807|Roy Paul]]''
|
| 1920-04-18
| 2002-05-21
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 1673
| ''[[:d:Q3449512|Tom Parry Jones]]''
| [[File:Tom -gt.jones.jpg|center|128px]]
| 1935-03-27
| 2013-01-11
| ''[[:d:Q5046060|Carreglefn]]''
|-
| style='text-align:right'| 1674
| ''[[:d:Q3462680|Gareth Miles]]''
| [[File:Gareth Miles.jpg|center|128px]]
| 1938-04-19
| 2023-09-06
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 1675
| ''[[:d:Q3463717|Saunt Cyngar]]''
| [[File:Sculpture of St Congar of Congresbury at the Museum of Somerset 4.JPG|center|128px]]
| 470
| 520-11-27
| [[Wales]]
|-
| style='text-align:right'| 1676
| ''[[:d:Q3463769|Saint Enéour]]''
|
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 1677
| ''[[:d:Q3463819|Saint Guirec]]''
|
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 1678
| ''[[:d:Q3463964|Meilyr]]''
| [[File:San-Maglorio di Dol.JPG|center|128px]]
| 535
| 575
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 1679
| ''[[:d:Q3464537|Sainte Ninnoc]]''
| [[File:Ninnoc.jpg|center|128px]]
| 5th century
| 467
| [[Wales]]
|-
| style='text-align:right'| 1680
| ''[[:d:Q3471137|Samuel Griffith]]''
| [[File:Sir Samuel Walker Griffith.jpg|center|128px]]
| 1845-06-21
| 1920-08-09
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1681
| ''[[:d:Q3476218|Scott Gibbs]]''
|
| 1971-01-23
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1682
| ''[[:d:Q3476277|Scott Morgan]]''
|
| 1978-10-17
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1683
| ''[[:d:Q3477940|Seisyll ap Clydog]]''
|
|
|
| ''[[:d:Q2578706|Kingdom of Ceredigion]]''
|-
| style='text-align:right'| 1684
| ''[[:d:Q3478230|Selwyn Biggs]]''
| [[File:Selwyn Biggs.jpg|center|128px]]
| 1872-07
| 1943-01-12
| [[Cairdiff]]
|-
| style='text-align:right'| 1685
| ''[[:d:Q3484297|Simon Halliday]]''
|
| 1960-07-13
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 1686
| ''[[:d:Q3484454|Simon Spender]]''
|
| 1985-11-15
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 1687
| ''[[:d:Q3485111|Sion Edwards]]''
|
| 1987-08-01
|
| [[Wales]]
|-
| style='text-align:right'| 1688
| ''[[:d:Q3497115|Paul Chapman]]''
| [[File:Paul Chapman playing a gig with Dave Currey and Blake Foster.jpg|center|128px]]
| 1954-06-09
| 2020-06-09
| [[Cairdiff]]
|-
| style='text-align:right'| 1689
| ''[[:d:Q3498839|Steve Aizlewood]]''
|
| 1952-10-09
| 2013-08-06
| [[Newport]]
|-
| style='text-align:right'| 1690
| ''[[:d:Q3498851|Steve Bates]]''
|
| 1963-03-04
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1691
| ''[[:d:Q3498920|Steve Evans]]''
|
| 1979-02-26
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1692
| ''[[:d:Q3498924|Steve Fenwick]]''
|
| 1951-07-23
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1693
| ''[[:d:Q3498965|Steve Jenkins]]''
| [[File:Steve Jenkins October 2020.png|center|128px]]
| 1972-07-16
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1694
| ''[[:d:Q3498970|Steve Jones]]''
|
| 1977-04-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1695
| ''[[:d:Q3499185|Steve Blackmore]]''
|
| 1962-03-03
| 2020-05-07
| [[Cairdiff]]
|-
| style='text-align:right'| 1696
| ''[[:d:Q3499351|Steve Llewellyn]]''
|
| 1924-02-29
| 2002-12-10
| [[Blaenau Gwent]]
|-
| style='text-align:right'| 1697
| ''[[:d:Q3499384|Andrew Howard]]''
| [[File:Andrew Howard 2016.png|center|128px]]
| 1969-06-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1698
| ''[[:d:Q3500815|Stuart Jones]]''
|
| 1984-03-14
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 1699
| ''[[:d:Q3500816|Stuart Lane]]''
|
| 1952-11-12
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1700
| ''[[:d:Q3500845|Stuart Watkins]]''
| [[File:Stuart Watkins.jpg|center|128px]]
| 1941-06-05
|
| [[Newport]]
|-
| style='text-align:right'| 1701
| ''[[:d:Q3501939|Wilfred Abse]]''
|
| 1915-03-15
| 2005-11-04
| [[Cairdiff]]
|-
| style='text-align:right'| 1702
| ''[[:d:Q3506759|Ray Phillips]]''
|
| 1949-03-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1703
| ''[[:d:Q3506825|Steve Williams]]''
|
| 1953-09-17
|
| [[Wales]]
|-
| style='text-align:right'| 1704
| ''[[:d:Q3507204|Tony Bourge]]''
|
| 1948-11-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1705
| ''[[:d:Q3512144|John Plumbe]]''
| [[File:1846 SelfPortrait detail byJohnPlumbe.png|center|128px]]
| 1809-07-13
| 1857-05-28
| ''[[:d:Q16548107|Castle Caereinion]]''
|-
| style='text-align:right'| 1706
| ''[[:d:Q3518894|Terry Cobner]]''
|
| 1946-01-10
|
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 1707
| ''[[:d:Q3518904|Terry Holmes]]''
|
| 1957-03-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1708
| ''[[:d:Q3518922|Terry Price]]''
| [[File:Terence Graham Price 1966.jpg|center|128px]]
| 1945-07-16<br/>1945
| 1993-04-07<br/>1993
| [[Wales]]
|-
| style='text-align:right'| 1709
| ''[[:d:Q3524912|Thomas Bevan]]''
|
| 1796
| 1819-01-31
| ''[[:d:Q55868756|Neuadd-Lwyd]]''
|-
| style='text-align:right'| 1710
| ''[[:d:Q3525028|Tom David]]''
|
| 1948-04-02
|
| [[Pontypridd]]
|-
| style='text-align:right'| 1711
| ''[[:d:Q3525120|Thomas Foley]]''
| [[File:Thomas Foley2.jpg|center|128px]]
| 1757
| 1833-01-09<br/>1833
| ''[[:d:Q29485358|Ridgeway]]''
|-
| style='text-align:right'| 1712
| ''[[:d:Q3525188|Sir Thomas Hanmer]]''
| [[File:Sir Thomas Hanmer by Godfrey Kneller.jpg|center|128px]]
| 1677-09-24
| 1746-05-07
| ''[[:d:Q16245967|Bettisfield]]''
|-
| style='text-align:right'| 1713
| ''[[:d:Q3525255|Thomas Pryce-Jenkins]]''
| [[File:Dr T J Pryce-Jenkins.jpg|center|128px]]
| 1862-02-01
| 1922-08-06
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1714
| ''[[:d:Q3525517|T. Rhys Thomas]]''
| [[File:Thomas Rhys Thomas 2015.jpg|center|128px]]
| 1982-04-23
|
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 1715
| ''[[:d:Q3526537|Gilbert Parkhouse]]''
|
| 1925-10-12
| 2000-08-10
| [[Swansea]]
|-
| style='text-align:right'| 1716
| ''[[:d:Q3526728|Hugh Morris]]''
|
| 1963-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1717
| ''[[:d:Q3526811|Cyril Walters]]''
| [[File:Cyril Walters 1933.jpg|center|128px]]
| 1905-08-28
| 1992-12-23
| ''[[:d:Q3910782|Bedlinog]]''
|-
| style='text-align:right'| 1718
| ''[[:d:Q3526860|Maurice Turnbull]]''
|
| 1906-03-16
| 1944-08-05
| [[Cairdiff]]
|-
| style='text-align:right'| 1719
| ''[[:d:Q3529077|Timothy Richards Lewis]]''
| [[File:Timothy Richards Lewis.jpg|center|128px]]
| 1841-10-31
| 1886-05-07
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1720
| ''[[:d:Q3530718|Tom Evans]]''
|
| 1882-12-31
| 1955-03-19
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 1721
| ''[[:d:Q3530807|Tom Morgan]]''
|
| 1866-11-14
| 1899-03-22
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1722
| ''[[:d:Q3530852|Tom Prydie]]''
| [[File:Tom Prydie 2015.jpg|center|128px]]
| 1992-02-23
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 1723
| ''[[:d:Q3530926|Tom Williams]]''
| [[File:Tom Williams WRU.jpg|center|128px]]
| 1860-07-01
| 1913-02-04
| [[Llwynypia]]
|-
| style='text-align:right'| 1724
| ''[[:d:Q3531420|Tomos Roberts]]''
|
| 1991-09-23
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 1725
| ''[[:d:Q3531720|Tony Clement]]''
|
| 1967-02-08
|
| [[Wales]]
|-
| style='text-align:right'| 1726
| ''[[:d:Q3538565|Trevor Brewer]]''
|
| 1930-08-16
| 2018-07-15
| [[Newport]]
|-
| style='text-align:right'| 1727
| ''[[:d:Q3555478|Venetia Dearden]]''
|
| 1975
|
| [[Powys]]
|-
| style='text-align:right'| 1728
| ''[[:d:Q3555990|Vernon Cooper]]''
|
| 1977-06-12
|
| [[Swansea]]
|-
| style='text-align:right'| 1729
| ''[[:d:Q3555997|Vernon R. Young]]''
| [[File:Young vr portrait 3.jpg|center|128px]]
| 1937-11-15
| 2004-03-30
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 1730
| ''[[:d:Q3561558|Vivian Jenkins]]''
|
| 1911-11-02
| 2004-01-05
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1731
| ''[[:d:Q3566386|Warren Fury]]''
|
| 1985-12-10
|
| [[Swansea]]
|-
| style='text-align:right'| 1732
| ''[[:d:Q3566853|Wayne Proctor]]''
|
| 1972-06-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1733
| ''[[:d:Q3568294|Will Joseph]]''
| [[File:Will Joseph (WRU).jpg|center|128px]]
| 1877-05-10
| 1959
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 1734
| ''[[:d:Q3568414|Billy Bancroft]]''
| [[File:Billy Bancroft.jpg|center|128px]]
| 1871-03-02
| 1959-03-03
| [[Swansea]]
|-
| style='text-align:right'| 1735
| ''[[:d:Q3568451|William Bowen]]''
| [[File:William Bowen (Rygbi).jpg|center|128px]]
| 1862-07
| 1925
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 1736
| ''[[:d:Q3568566|William Dowell]]''
| [[File:William Dowell.jpg|center|128px]]
| 1885-05-21
| 1949-11-09
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1737
| ''[[:d:Q3568591|William Edward de Winton]]''
|
| 1856-09-06
| 1922-08-30
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1738
| ''[[:d:Q3568860|William Ouseley]]''
| [[File:William Ouseley.jpg|center|128px]]
| 1767
| 1842
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 1739
| ''[[:d:Q3569004|Billy Trew]]''
| [[File:Billy Trew 1905.jpg|center|128px]]
| 1879-03-12
| 1926-08-20
| [[Swansea]]
|-
| style='text-align:right'| 1740
| ''[[:d:Q3569085|Willie Llewellyn]]''
| [[File:Willie Llewellyn.jpg|center|128px]]
| 1878-01-01
| 1973-03-12
| [[Wales]]
|-
| style='text-align:right'| 1741
| ''[[:d:Q3570190|Wyatt Gould]]''
|
| 1879-05-18
| 1960-02-09
| [[Newport]]
|-
| style='text-align:right'| 1742
| ''[[:d:Q3570213|Wyn Thomas]]''
|
| 1979-01-11
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1743
| ''[[:d:Q3603082|Aaron Morris]]''
|
| 1989-12-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1744
| ''[[:d:Q3604991|Adam M. Jones]]''
|
| 1980-01-12
|
| [[Swansea]]
|-
| style='text-align:right'| 1745
| ''[[:d:Q3610807|Alexander Vlahos]]''
| [[File:Alexander Vlahos 2013.jpg|center|128px]]
| 1988-07-30
|
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 1746
| ''[[:d:Q3611713|Alice de Lacy, 3rd Countess of Lincoln]]''
|
| 1281-12-25
| 1348-10-02
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 1747
| ''[[:d:Q3614735|Amy Charles]]''
|
| 1970-07-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1748
| ''[[:d:Q3614741|Amy Guy]]''
|
| 1983-12-21
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1749
| ''[[:d:Q3616280|Andrew Lewis]]''
|
| 1973-06-13
|
| [[Swansea]]
|-
| style='text-align:right'| 1750
| ''[[:d:Q3624264|Arthur E. Powell]]''
|
| 1882-09-27
| 1969-03-20
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 1751
| ''[[:d:Q3624265|Arthur Emyr]]''
|
| 1962-07-27
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1752
| ''[[:d:Q3634630|Barbara Sidney]]''
|
| 1563
| 1621-05-24
| ''[[:d:Q1107288|Castell Coety]]''
|-
| style='text-align:right'| 1753
| ''[[:d:Q3638260|Benjamin Piercy]]''
| [[File:Benjamin Piercy.jpg|center|128px]]
| 1827-03-16
| 1888-03-24
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 1754
| ''[[:d:Q3644380|Brett Morse]]''
|
| 1989-02-11
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 1755
| ''[[:d:Q3646166|Brynley Allen]]''
|
| 1921-03-23
| 2005-07-21
| ''[[:d:Q3401786|Gilfach Goch]]''
|-
| style='text-align:right'| 1756
| ''[[:d:Q3648334|Mark Anthony]]''
|
| 1967-03-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1757
| ''[[:d:Q3656278|John Petherick]]''
| [[File:John Petherick.jpg|center|128px]]
| 1813
| 1882-07-15
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 1758
| ''[[:d:Q3661738|Casey Thomas]]''
|
| 1990-11-14
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1759
| ''[[:d:Q3666366|Charles Cook]]''
|
| 1972-10-12
|
| [[Wales]]
|-
| style='text-align:right'| 1760
| ''[[:d:Q3675531|Chris Maxwell]]''
| [[File:Chris Maxwell Wrexham FC at Wembley.jpg|center|128px]]
| 1990-07-30
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 1761
| ''[[:d:Q3681914|Ruth Dunning]]''
|
| 1911-05-17
| 1983-02-27
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 1762
| ''[[:d:Q3682628|Colin Baker]]''
|
| 1934-12-18
| 2021-04-11
| [[Cairdiff]]
|-
| style='text-align:right'| 1763
| ''[[:d:Q3687588|Constance Lewis]]''
| [[File:Constance Edwina, Duchess of Westminster.jpg|center|128px]]
| 1876
| 1970-01-21
| ''[[:d:Q3403676|Castell Rhuthun]]''
|-
| style='text-align:right'| 1764
| ''[[:d:Q3699742|Cystennin I]]''
| [[File:Bronze portrait of Constantinus I in the Musei Capitolini.jpg|center|128px]]
| 361
|
| ''[[:d:Q1309657|Segontium]]''
|-
| style='text-align:right'| 1765
| ''[[:d:Q3701545|Daniel Alfei]]''
|
| 1992-02-23
|
| [[Swansea]]
|-
| style='text-align:right'| 1766
| ''[[:d:Q3701618|Daniel Gooch]]''
|
| 1869-05-25
| 1926-12-22
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 1767
| ''[[:d:Q3703268|David Morgan]]''
|
| 1937-10-06
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1768
| ''[[:d:Q3718921|Eddie Butler]]''
| [[File:Eddie Butler and Iqwal.jpg|center|128px]]
| 1957-05-08
| 2022-09-15
| [[Newport]]
|-
| style='text-align:right'| 1769
| ''[[:d:Q3740753|Penelope Mortimer]]''
|
| 1918-09-19
| 1999-10-19
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 1770
| ''[[:d:Q3743241|William Simons]]''
|
| 1940-11-17
| 2019-06-21
| [[Swansea]]
|-
| style='text-align:right'| 1771
| ''[[:d:Q3751249|H. H. Price]]''
|
| 1899-05-17
| 1984-11-26
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1772
| ''[[:d:Q3751833|Frank Hauser]]''
|
| 1922-08-01
| 2007-10-14
| [[Cairdiff]]
|-
| style='text-align:right'| 1773
| ''[[:d:Q3758994|Gavin Quinnell]]''
|
| 1983-11-25
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1774
| ''[[:d:Q3771885|Glan Letheren]]''
|
| 1956-05-01
| 2024-06-06
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1775
| ''[[:d:Q3773585|Goronwy Owen]]''
|
| 1723-01-01
| 1769-07
| ''[[:d:Q13129624|Llanfair-Mathafarn-Eithaf]]''
|-
| style='text-align:right'| 1776
| ''[[:d:Q3774223|Graham Vearncombe]]''
|
| 1934-03-28
| 1992-11-30
| [[Cairdiff]]
|-
| style='text-align:right'| 1777
| ''[[:d:Q3784998|Henry Somerset, 2nd Duke of Beaufort]]''
| [[File:Michael Dahl (1656-1659-1743) - Henry Somerset (1684–1714), 2nd Duke of Beaufort, KG, in Ducal Robes - 1180909 - National Trust.jpg|center|128px]]
| 1684-04-02
| 1714-05-24
| ''[[:d:Q525635|Monmouth Castle]]''
|-
| style='text-align:right'| 1778
| ''[[:d:Q3786307|Holly Hale]]''
| [[File:Hwe.jpg|center|128px]]
| 1990-11-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1779
| ''[[:d:Q3787233|Howard Passadoro]]''
| [[File:Genoa 1893.png|center|128px]]
| 1871-06-18
| 1921-06-25
| [[Newport]]
|-
| style='text-align:right'| 1780
| ''[[:d:Q3791483|Ian Lougher]]''
| [[File:CopyofTT072.jpg|center|128px]]
| 1963-07-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1781
| ''[[:d:Q3791526|Russell Lloyd]]''
|
| 1916-01-21<br/>1916-01-16
| 2008-01-29<br/>2008-01-21
| [[Swansea]]
|-
| style='text-align:right'| 1782
| ''[[:d:Q3806461|James Berkeley, 1st Baron Berkeley]]''
|
| 1394
| 1463-11
| ''[[:d:Q2630723|Raglan Castle]]''
|-
| style='text-align:right'| 1783
| ''[[:d:Q3806739|James Thomas]]''
|
| 1979-01-16
|
| [[Swansea]]
|-
| style='text-align:right'| 1784
| ''[[:d:Q3807026|Janet Price]]''
|
| 1941
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 1785
| ''[[:d:Q3809621|John Sloman]]''
|
| 1957-04-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1786
| ''[[:d:Q3809908|Jonathan Brown]]''
|
| 1990-04-17
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1787
| ''[[:d:Q3809936|Aitor Ariño]]''
| [[File:2012 2013 - Aitor Ariño - Flickr - Castroquini-FCB.jpg|center|128px]]
| 1992-10-05
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 1788
| ''[[:d:Q3814488|Ken Leek]]''
|
| 1935-07-26
| 2007-11-19
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 1789
| ''[[:d:Q3814797|Kevin Bowring]]''
|
| 1954-05-09
| 2024-10
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1790
| ''[[:d:Q3815276|Kim Ashfield]]''
|
| 1959-01-05
|
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 1791
| ''[[:d:Q3829377|Lee Lucas]]''
| [[File:Lee Lucas 08-02-2014 1.jpg|center|128px]]
| 1992-06-10
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 1792
| ''[[:d:Q3830019|Leigh Richmond Roose]]''
| [[File:Leigh Richmond Roose.jpg|center|128px]]
| 1877-11-27
| 1916-10-07
| ''[[:d:Q5884520|Holt]]''
|-
| style='text-align:right'| 1793
| ''[[:d:Q3830023|Leighton Phillips]]''
|
| 1949-09-26
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1794
| ''[[:d:Q3852373|Maud Chaworth]]''
|
| 1282-02-02
| 1322
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1795
| ''[[:d:Q3857385|Mike England]]''
|
| 1941-12-02
|
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 1796
| ''[[:d:Q3885328|Ralph Evans]]''
|
| 1953-12-20
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 1797
| ''[[:d:Q3896362|Dafydd Jones]]''
| [[File:Portrait of D. Jones, Dolau Bach (4670288) (cropped).jpg|center|128px]]
| 1803
| 1868
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 1798
| ''[[:d:Q3897540|Pat Glover]]''
|
| 1910-09-09
| 1971-09-09
| [[Swansea]]
|-
| style='text-align:right'| 1799
| ''[[:d:Q3898091|Paul James]]''
|
| 1963-11-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1800
| ''[[:d:Q3899285|Penvhyn Llewellyn Neville]]''
|
| 1872-01-22
|
| [[Swansea]]
|-
| style='text-align:right'| 1801
| ''[[:d:Q3900874|Peter Karrie]]''
| [[File:Peterkarrie.gif|center|128px]]
| 1946-08-10
|
| [[Vale o Glamorgan]]
|-
| style='text-align:right'| 1802
| ''[[:d:Q3940078|Roger Freestone]]''
|
| 1968-08-19
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 1803
| ''[[:d:Q3943059|Ryan Doble]]''
|
| 1991-02-01
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1804
| ''[[:d:Q3945649|Sally El Hosaini]]''
|
| 1976-06
|
| [[Swansea]]
|-
| style='text-align:right'| 1805
| ''[[:d:Q3951052|Innes Lloyd]]''
|
| 1925-12-24
| 1991-08-23
| ''[[:d:Q2653611|Penmaenmawr]]''
|-
| style='text-align:right'| 1806
| ''[[:d:Q3960034|Sibyl de Neufmarché]]''
|
| 1100
| 1143
| ''[[:d:Q15107961|Brecon Castle]]''
|-
| style='text-align:right'| 1807
| ''[[:d:Q3961106|Simon Bowman]]''
| [[File:Nicole Scherzinger & the Phantoms - 16.jpg|center|128px]]
| 1961
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1808
| ''[[:d:Q3987390|Amy Roberts]]''
| [[File:Quaregnon - Le Samyn des Dames & Le Samyn, 2 mars 2016, départ (B107).JPG|center|128px]]
| 1994-12-24
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1809
| ''[[:d:Q3990627|George Baker]]''
|
| 1936-04-06
| 2024-04-23
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 1810
| ''[[:d:Q3992473|Tom Griffiths]]''
|
| 1906-02-21
| 1981-12-25
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1811
| ''[[:d:Q3998498|Trevor Edwards]]''
|
| 1937-01-24
| 2024-05-30
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 1812
| ''[[:d:Q4009682|Venissa Head]]''
|
| 1956-09-01
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1813
| ''[[:d:Q4010127|Vernon Pugh]]''
|
| 1945-07-05
| 2003-04-24
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 1814
| ''[[:d:Q4020019|William George Trice]]''
|
| 1848-06-08
| 1920-02-19
| [[Cairdiff]]
|-
| style='text-align:right'| 1815
| ''[[:d:Q4020043|William Henry Gladstone]]''
| [[File:William Henry Gladstone, Vanity Fair, 1882-02-11.jpg|center|128px]]
| 1840-06-03
| 1891-07-04
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 1816
| ''[[:d:Q4020156|William Squire]]''
|
| 1917-04-29
| 1989-05-03
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1817
| ''[[:d:Q4026445|Julie Gore]]''
|
| 1958-08-05
|
| [[Wales]]
|-
| style='text-align:right'| 1818
| ''[[:d:Q4068173|Charles James Apperley]]''
| [[File:Portrait of Nimrod (4671244).jpg|center|128px]]
| 1778-07-22
| 1843-05-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1819
| ''[[:d:Q4072521|Afan]]''
| [[File:St Afan's Church, Llanafan-Fawr - geograph.org.uk - 1468440.jpg|center|128px]]
| 6th century
|
| [[Gwynedd]]
|-
| style='text-align:right'| 1820
| ''[[:d:Q4083831|Mark Bennett]]''
|
| 1963-09-23
|
| [[Newport]]
|-
| style='text-align:right'| 1821
| ''[[:d:Q4086821|Dabheog]]''
| [[File:Monaghan Saint Macartan's Cathedral Window Clogher Saints II Detail Saint Dobheóg of Lough Derg 2013 09 21.jpg|center|128px]]
| 1st millennium
|
| [[Wales]]
|-
| style='text-align:right'| 1822
| ''[[:d:Q4087034|Frederick Birks]]''
| [[File:Frederick Birks VC AWM P02939.023.jpeg|center|128px]]
| 1894-08-16
| 1917-10-21
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 1823
| ''[[:d:Q4101408|Tommy Bamford]]''
|
| 1905-11-02
| 1967-12-12
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 1824
| ''[[:d:Q4111556|Greville Wynne]]''
|
| 1919-03-19
| 1990-02-28
| ''[[:d:Q1774850|Ystrad Mynach]]''
|-
| style='text-align:right'| 1825
| ''[[:d:Q4134498|Gwilym Ddu o Arfon]]''
|
| 13rd century
| 14th century
| [[Wales]]
|-
| style='text-align:right'| 1826
| ''[[:d:Q4160395|David John]]''
| [[File:David John PHC 2016-4.jpg|center|128px]]
| 1984-11-24
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1827
| ''[[:d:Q4160419|Kingsley Jones]]''
|
| 1969-06-19
|
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 1828
| ''[[:d:Q4161903|Dingad of Llandingat]]''
|
|
|
| ''[[:d:Q769782|Kingdom of Powys]]''
|-
| style='text-align:right'| 1829
| ''[[:d:Q4172032|Anthony Davies]]''
|
| 1969-12-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1830
| ''[[:d:Q4201328|Joseph Murray Ince]]''
|
| 1806<br/>1806-04
| 1859-09-24
| [[Lunnon]]<br/>''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 1831
| ''[[:d:Q4207234|Gareth Evans]]''
| [[File:Gareth Evans2.jpg|center|128px]]
| 1980-04
|
| ''[[:d:Q5771888|Hirwaun]]''
|-
| style='text-align:right'| 1832
| ''[[:d:Q4207586|Steve Jones]]''
| [[File:Steve Jones (presenter).jpg|center|128px]]
| 1977-03-16
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 1833
| ''[[:d:Q4212534|Maud Cunnington]]''
|
| 1869-09-24
| 1951-02-28
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1834
| ''[[:d:Q4215697|Tom Carpenter]]''
|
| 1887-08-31
| No/unknown value
| [[Newport]]
|-
| style='text-align:right'| 1835
| ''[[:d:Q4218975|Saunt Cain]]''
| [[File:St Keyne's Well - geograph.org.uk - 1556016.jpg|center|128px]]
| 425
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 1836
| ''[[:d:Q4219999|Cywair]]''
|
| 455<br/>6th century
|
| [[Wales]]
|-
| style='text-align:right'| 1837
| ''[[:d:Q4220725|Wiliam Cynwal]]''
|
| No/unknown value
| 1587
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 1838
| ''[[:d:Q4232388|Gareth Coppack]]''
|
| 1980-04-10
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1839
| ''[[:d:Q4241293|Cristiolus]]''
| [[File:Eglwys St Cristiolus Church, Llangristiolus.jpg|center|128px]]
| 6th century
|
| [[Anglesey]]
|-
| style='text-align:right'| 1840
| ''[[:d:Q4252416|Elizabeth Howard]]''
|
| 1497<br/>1494
| 1558-12-30<br/>1558
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 1841
| ''[[:d:Q4304585|Francis Mostyn]]''
| [[File:The Most Reverend Francis Mostyn (5292133).jpg|center|128px]]
| 1860-08-06
| 1939-10-25
| ''[[:d:Q7678779|Talacre]]''
|-
| style='text-align:right'| 1842
| ''[[:d:Q4328347|Steve Newbury]]''
|
| 1956-04-21
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1843
| ''[[:d:Q4347281|Jack Powell]]''
| [[File:Newton Heath - Jack Powell - First Incarnation.jpg|center|128px]]
| 1860-03-25
| 1947-03-16
| [[Wales]]
|-
| style='text-align:right'| 1844
| ''[[:d:Q4354797|Aubrey Powell]]''
|
| 1918-04-19
| 2009-01-27
| ''[[:d:Q3008014|Cwm-twrch]]''
|-
| style='text-align:right'| 1845
| ''[[:d:Q4355198|Irene Steer]]''
| [[File:Irene Steer 1912 (cropped).jpg|center|128px]]
| 1889-08-10
| 1977-04-18
| [[Cairdiff]]
|-
| style='text-align:right'| 1846
| ''[[:d:Q4360990|Edmund Davies, Baron Edmund-Davies]]''
| [[File:Lord Edmund Davies.jpg|center|128px]]
| 1906-07-15
| 1992-12-26<br/>1992-12-27
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 1847
| ''[[:d:Q4376401|David Price]]''
| [[File:David Powell Price.jpg|center|128px]]
| 1790
| 1854-08-31
| [[Wales]]
|-
| style='text-align:right'| 1848
| ''[[:d:Q4379087|Ian Preece]]''
| [[File:Ian Preece PHC 2017-1.jpg|center|128px]]
| 1982-06-23
|
| [[Newport]]
|-
| style='text-align:right'| 1849
| ''[[:d:Q4385607|Emyr Jones Parry]]''
| [[File:Emyr Jones Parry.jpg|center|128px]]
| 1947-09-21
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 1850
| ''[[:d:Q4411544|Eilian]]''
| [[File:Sant Trillo St Trillo Betws yn Rhos Conwy Gogledd Cymru North Wales 16.JPG|center|128px]]
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 1851
| ''[[:d:Q4457143|Tudclyd]]''
|
| 1st millennium
|
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 1852
| ''[[:d:Q4470042|Cliff Wilson]]''
|
| 1934-05-10
| 1994-05-21
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1853
| ''[[:d:Q4470106|Philip Williams]]''
|
| 1967-06-21
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1854
| ''[[:d:Q4476244|Walter Watkins]]''
|
| 1880
| 1942-05-14
| ''[[:d:Q635169|Caersws]]''
|-
| style='text-align:right'| 1855
| ''[[:d:Q4482653|Mark Fenton]]''
|
| 1972-07-26
|
| [[Swansea]]
|-
| style='text-align:right'| 1856
| ''[[:d:Q4502691|William John Hewlett]]''
|
| 1876
| 1921-07-24
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 1857
| ''[[:d:Q4505352|Arthen ap Seisyll]]''
|
| 8th century
| 807
| [[Ceredigion]]
|-
| style='text-align:right'| 1858
| ''[[:d:Q4529658|Clive Everton]]''
|
| 1937-09-07
| 2024-09-27
| [[Wales]]
|-
| style='text-align:right'| 1859
| ''[[:d:Q4530046|Eluned]]''
| [[File:Eluned (straightened) Eglwys Aberhonddu (Brecon, Wales) 03.jpg|center|128px]]
| 5th century
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 1860
| ''[[:d:Q4539315|Erin Richards]]''
| [[File:Erin Richards filming on Penarth Pier January 2016 (cropped).JPG|center|128px]]
| 1986-05-17
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 1861
| ''[[:d:Q4569597|Griffith John]]''
| [[File:Griffith-John-China.jpg|center|128px]]
| 1831-12-14
| 1912-07-25
| [[Swansea]]
|-
| style='text-align:right'| 1862
| ''[[:d:Q4575731|Geraint Williams]]''
|
| 1962-01-05
|
| ''[[:d:Q5197252|Cwmparc]]''
|-
| style='text-align:right'| 1863
| ''[[:d:Q4647963|A. J. R. Russell-Wood]]''
|
| 1939<br/>1940
| 2010-08-13
| [[Wales]]
|-
| style='text-align:right'| 1864
| ''[[:d:Q4648124|A. M. Esmonde]]''
|
| 1977-08-20
|
| [[Swansea]]
|-
| style='text-align:right'| 1865
| ''[[:d:Q4661867|Aaron Bramwell]]''
|
| 1986-03-01
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 1866
| ''[[:d:Q4661931|Aaron Cook]]''
|
| 1979-12-06
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1867
| ''[[:d:Q4661935|Aaron Coundley]]''
|
| 1989-10-18
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1868
| ''[[:d:Q4663748|Abbas Farid]]''
|
| 1983-10-10
|
| [[Newport]]
|-
| style='text-align:right'| 1869
| ''[[:d:Q4666174|Abdulrahim Abby Farah]]''
|
| 1919-10-22
| 2018-05-14
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1870
| ''[[:d:Q4666550|Abel Davies]]''
| [[File:Abel Christmas Davies.jpg|center|128px]]
| 1861
| 1914-06-18
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 1871
| ''[[:d:Q4666582|Abel J. Jones]]''
|
| 1878-05-26
| 1949-05-08
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 1872
| ''[[:d:Q4667523|Abi Morgan]]''
|
| 1968
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1873
| ''[[:d:Q4668868|Abraham Garrod Thomas]]''
| [[File:Abraham Garrod Thomas2.jpg|center|128px]]
| 1853-10-05
| 1931-01-30
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 1874
| ''[[:d:Q4678792|Adam Brown]]''
|
| 1987-09-25
|
| [[Newport]]
|-
| style='text-align:right'| 1875
| ''[[:d:Q4678942|Adam Davies]]''
|
| 1980-10-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1876
| ''[[:d:Q4679184|Adam Harding]]''
|
| 1993-01-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1877
| ''[[:d:Q4679194|Adam Harrison]]''
|
| 1985-10-30
|
| [[Newport]]
|-
| style='text-align:right'| 1878
| ''[[:d:Q4679263|Adam Hughes]]''
|
| 1990-02-14
|
| [[Newport]]
|-
| style='text-align:right'| 1879
| ''[[:d:Q4679561|Adam O'Brian]]''
|
| 1989-08-21
|
| [[Swansea]]
|-
| style='text-align:right'| 1880
| ''[[:d:Q4679574|Adam Owen]]''
|
| 1980-09-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1881
| ''[[:d:Q4679608|Adam Phillips]]''
| [[File:Adam Phillips. Photogr. by Bracha L. Ettinger.jpg|center|128px]]
| 1954-09-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1882
| ''[[:d:Q4679626|Adam Powell]]''
|
| 1976-12-20
|
| [[Newport]]
|-
| style='text-align:right'| 1883
| ''[[:d:Q4679892|Adam Thomas]]''
|
| 1986-08-22
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 1884
| ''[[:d:Q4679946|Adam Warren]]''
|
| 1991-03-07
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 1885
| ''[[:d:Q4684916|Adrian Cambriani]]''
|
| 1962
|
| [[Swansea]]
|-
| style='text-align:right'| 1886
| ''[[:d:Q4684968|Adrian Davies]]''
|
| 1969-02-09
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1887
| ''[[:d:Q4684982|Adrian Dingle]]''
| [[File:Adrian and Pat Dingle Wedding 1941-12-15.jpg|center|128px]]
| 1911-02-04
| 1974-12-22
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 1888
| ''[[:d:Q4685066|Adrian Griffiths]]''
|
| 1959-11-27
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1889
| ''[[:d:Q4685114|Adrian Holmes]]''
|
| 1974-03-31
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1890
| ''[[:d:Q4685181|Adrian Lewis Morgan]]''
|
| 1973-02-22
|
| ''[[:d:Q3404708|Beddau]]''
|-
| style='text-align:right'| 1891
| ''[[:d:Q4685352|Adrian Shaw]]''
|
| 1972-02-17
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1892
| ''[[:d:Q4685382|Adrian Street]]''
| [[File:Adrian Street.jpg|center|128px]]
| 1940-12-05
| 2023-07-24
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 1893
| ''[[:d:Q4685401|Adrian Tucker]]''
|
| 1976-09-26
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1894
| ''[[:d:Q4704294|Al Lewis]]''
|
| 1984
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 1895
| ''[[:d:Q4706157|Alan Beer]]''
|
| 1950-03-11
|
| [[Swansea]]
|-
| style='text-align:right'| 1896
| ''[[:d:Q4706343|Alan Caughter]]''
|
| 1946-02-19
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1897
| ''[[:d:Q4706459|Alan Curtis]]''
|
| 1954-04-16
|
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 1898
| ''[[:d:Q4706473|Alan David]]''
|
| 1941-12-29
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 1899
| ''[[:d:Q4706576|Alan Edwards]]''
|
| 1943
| 1987
| ''[[:d:Q6389163|Kenfig Hill]]''
|-
| style='text-align:right'| 1900
| ''[[:d:Q4706594|Alan Evans]]''
|
| 1949-06-14
| 1999-04-12
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 1901
| ''[[:d:Q4706644|Alan Fox]]''
|
| 1936-07-10
| 2021-09-16
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 1902
| ''[[:d:Q4706822|Alan Harrington]]''
|
| 1933-11-17
| 2019-12-23
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 1903
| ''[[:d:Q4706991|Alan Jones]]''
|
| 1957-06-01
|
| ''[[:d:Q4733322|Alltwen]]''
|-
| style='text-align:right'| 1904
| ''[[:d:Q4706993|Alan Jones]]''
|
| 1938-11-04
|
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 1905
| ''[[:d:Q4706994|Alan Jones]]''
|
| 1945-10-06
| 2023-03-13
| [[Swansea]]
|-
| style='text-align:right'| 1906
| ''[[:d:Q4707361|Alan Morgan]]''
|
| 1973-11-02
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 1907
| ''[[:d:Q4707362|Alan Morgan]]''
|
| 1940-06-22
| 2011-10-24
| [[Swansea]]
|-
| style='text-align:right'| 1908
| ''[[:d:Q4707517|Alan Petherbridge]]''
|
| 1927-09-10
| 2020-07-30
| [[Swansea]]
|-
| style='text-align:right'| 1909
| ''[[:d:Q4707597|Alan Rees]]''
|
| 1938-02-17
| 2022-03-17
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1910
| ''[[:d:Q4707682|Alan Rudkin]]''
| [[File:AlanRudkin.jpg|center|128px]]
| 1941-11-18
| 2010-09-22
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 1911
| ''[[:d:Q4707769|Alan Simons]]''
|
| 1968-09-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1912
| ''[[:d:Q4707782|Alan Smith]]''
|
| 1949-09-03
|
| [[Newport]]
|-
| style='text-align:right'| 1913
| ''[[:d:Q4707899|Alan Thompson]]''
|
| 1963
| 2017-09-28
| [[Wales]]
|-
| style='text-align:right'| 1914
| ''[[:d:Q4708055|Alan Wilkins]]''
|
| 1953-08-22
|
| ''[[:d:Q7320726|Rhiwbina]]''
|-
| style='text-align:right'| 1915
| ''[[:d:Q4708093|Alan Wood]]''
|
| 1941-01-13
| 2018-03-30
| [[Newport]]
|-
| style='text-align:right'| 1916
| ''[[:d:Q4708112|Alan Wynne Williams]]''
|
| 1945-12-21
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1917
| ''[[:d:Q4708700|Alastair Dalton]]''
|
| 1973-04-27
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1918
| ''[[:d:Q4708724|Alastair Hetherington]]''
|
| 1919-10-31
| 1999-10-03
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 1919
| ''[[:d:Q4708997|Alban Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 1920
| ''[[:d:Q4709005|Alban Hill]]''
|
|
| 1559-12
| [[Wales]]
|-
| style='text-align:right'| 1921
| ''[[:d:Q4709611|Albert Alan Owen]]''
|
| 1948
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1922
| ''[[:d:Q4709696|Albert Barnes]]''
|
| 1913-07-02
| 1990
| [[Cairdiff]]
|-
| style='text-align:right'| 1923
| ''[[:d:Q4709825|Albert Bruntnell]]''
| [[File:Albert Bruntnell.jpg|center|128px]]
| 1866-08-04
| 1929-01-31
| ''[[:d:Q6661614|Llanigon]]''
|-
| style='text-align:right'| 1924
| ''[[:d:Q4709940|Clifford Williams]]''
|
| 1905-06-28
| 1987
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 1925
| ''[[:d:Q4710021|Albert Day]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1926
| ''[[:d:Q4710162|Albert Evans-Jones]]''
| [[File:Cynan 1956 Aberdar.jpg|center|128px]]
| 1895-04-14
| 1970<br/>1970-01-26
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 1927
| ''[[:d:Q4710188|Albert Fear]]''
|
| 1907-08-25
| 2000-07-26
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 1928
| ''[[:d:Q4710243|Albert Freethy]]''
|
| 1885-04-27
| 1966-07-17
| [[Swansea]]
|-
| style='text-align:right'| 1929
| ''[[:d:Q4710353|Albert Green]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 1930
| ''[[:d:Q4710365|Albert Groves]]''
|
| 1886-01
| 1960
| [[Newport]]
|-
| style='text-align:right'| 1931
| ''[[:d:Q4710369|Albert Gubay]]''
|
| 1928-04-09
| 2016-01-05
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 1932
| ''[[:d:Q4710405|Albert Hall]]''
|
| 1918-09-03
| 1998-02
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1933
| ''[[:d:Q4710519|Albert Hybart]]''
|
| 1865
| 1945-01-28
| [[Cairdiff]]
|-
| style='text-align:right'| 1934
| ''[[:d:Q4710573|Albert Jenkins]]''
| [[File:Albertjenkinsrugby.jpg|center|128px]]
| 1895-03-11
| 1953-10-07
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 1935
| ''[[:d:Q4710747|Albert Love]]''
|
| 1911
| 1943-11-08
| [[Cairdiff]]
|-
| style='text-align:right'| 1936
| ''[[:d:Q4711030|Albert Powell]]''
|
| 1893-12-08
| 1979-02-15
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 1937
| ''[[:d:Q4711276|Albert Stitfall]]''
|
| 1924-07-07
| 1998
| [[Cairdiff]]
|-
| style='text-align:right'| 1938
| ''[[:d:Q4711277|Albert Stock]]''
|
| 1897-04-21
| 1969-05-04
| [[Newport]]
|-
| style='text-align:right'| 1939
| ''[[:d:Q4711320|Albert Thomas]]''
|
| 1893-06-07
| 1965-03-21
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 1940
| ''[[:d:Q4711325|Albert Thompson]]''
|
| 1912
|
| ''[[:d:Q3398355|Llanbradach]]''
|-
| style='text-align:right'| 1941
| ''[[:d:Q4711432|Albert Wardell]]''
|
| 1908
|
| [[Wales]]
|-
| style='text-align:right'| 1942
| ''[[:d:Q4711486|Albert Willis]]''
|
| 1876-05-24
| 1954-04-22
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 1943
| ''[[:d:Q4711516|Albert Young]]''
|
| 1917-09-11
| 2013-01-01
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 1944
| ''[[:d:Q4714175|Alec James]]''
|
| 1889-05-22
| 1961-08-14
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 1945
| ''[[:d:Q4714179|Alec Jenkins]]''
|
| 1987-07-07
|
| [[Wales]]
|-
| style='text-align:right'| 1946
| ''[[:d:Q4714181|Alec Jones]]''
|
| 1924-08-12
| 1983-03-20
| ''[[:d:Q3400833|Clydach Vale]]''
|-
| style='text-align:right'| 1947
| ''[[:d:Q4714268|Alec Templeton]]''
| [[File:AlecTempleton.JPG|center|128px]]
| 1910-07-04<br/>1909-07-04
| 1963-03-28
| [[Cairdiff]]
|-
| style='text-align:right'| 1948
| ''[[:d:Q4714328|Aled Davies]]''
|
| 1992-07-19
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1949
| ''[[:d:Q4714330|Aled Davies]]''
| [[File:Aled Davies (29997772112).jpg|center|128px]]
| 1991-05-24
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1950
| ''[[:d:Q4714333|Aled James]]''
| [[File:Aled James.JPG|center|128px]]
| 1982-02-17
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 1951
| ''[[:d:Q4714338|Aled Owen]]''
|
| 1934-01-07
| 2022-08-05
| ''[[:d:Q4981044|Brynteg]]''
|-
| style='text-align:right'| 1952
| ''[[:d:Q4714340|Aled Haydn Jones]]''
| [[File:Aledhaydnjones11.jpg|center|128px]]
| 1976-08-09
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 1953
| ''[[:d:Q4714342|Aled Thomas]]''
|
| 1985-01-02
|
| [[Wales]]
|-
| style='text-align:right'| 1954
| ''[[:d:Q4714343|Aled Williams]]''
|
| 1933-06-14
| 2005-12-08
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 1955
| ''[[:d:Q4714348|Aled Wyn Davies]]''
| [[File:Erwau'r Daith, album cover.jpg|center|128px]]
| 1974-08-03
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 1956
| ''[[:d:Q4716965|Alex Evans]]''
|
| 1991
|
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 1957
| ''[[:d:Q4717057|Alex Givvons]]''
|
| 1913-11-02
| 2002-06-14
| ''[[:d:Q7194170|Pillgwenlli]]''
|-
| style='text-align:right'| 1958
| ''[[:d:Q4717093|Alex Greenfield]]''
|
| 1990-09-07
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 1959
| ''[[:d:Q4717250|Alex Jones]]''
|
| 1988-11-10
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 1960
| ''[[:d:Q4717255|Alex Jones]]''
| [[File:Alex Jones 2008.jpg|center|128px]]
| 1977-03-18
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 1961
| ''[[:d:Q4717296|Alex Kersey-Brown]]''
|
| 1942-11-18
| 2015-11-30
| [[Wales]]
|-
| style='text-align:right'| 1962
| ''[[:d:Q4717348|Alex Lawless]]''
| [[File:Alex Lawless 24-09-2011 1.jpg|center|128px]]
| 1985-03-26
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 1963
| ''[[:d:Q4717889|Alex Titchiner]]''
|
| 1991-06-13
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 1964
| ''[[:d:Q4717948|Alex Walker]]''
|
| 1986-07-31
|
| [[Newport]]
|-
| style='text-align:right'| 1965
| ''[[:d:Q4717998|Alex Winters]]''
|
| 1977-01-10
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 1966
| ''[[:d:Q4718381|Alexander Bland]]''
|
| 1866-11-24
| 1947-10-18
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 1967
| ''[[:d:Q4719014|Alexander Griffith]]''
|
| 1601
| 1676-04-21
| ''[[:d:Q6662969|Llysfaen]]''
|-
| style='text-align:right'| 1968
| ''[[:d:Q4719968|Alexander Rolls]]''
|
| 1818-07-18
| 1882-04-22
| [[Swansea]]
|-
| style='text-align:right'| 1969
| ''[[:d:Q4720591|Alexandra Boyd]]''
|
| 20th century
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 1970
| ''[[:d:Q4721654|Alf Day]]''
|
| 1907-10-02
| 1997-11-15
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 1971
| ''[[:d:Q4721725|Alf Morgans]]''
| [[File:Alf Morgans (1850-1933).jpg|center|128px]]
| 1850-02-17
| 1933-08-10
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 1972
| ''[[:d:Q4721734|Alf Pugh]]''
|
| 1869
| 1942-02-07
| ''[[:d:Q5397307|Esclusham]]''
|-
| style='text-align:right'| 1973
| ''[[:d:Q4721752|Alf Shea]]''
|
| 1898-11-07
| 1969-05-21
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 1974
| ''[[:d:Q4721754|Alf Sherwood]]''
|
| 1923-11-13
| 1990-03-12
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 1975
| ''[[:d:Q4722523|Alfred Davies]]''
|
| 1850
| 1891-04-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 1976
| ''[[:d:Q4722541|Alfred Dickinson]]''
|
| 1914-08-17
| 1998
| ''[[:d:Q2304575|Saltney]]''
|-
| style='text-align:right'| 1977
| ''[[:d:Q4722542|Alfred Dillon]]''
| [[File:Alfred Dillon.jpg|center|128px]]
| 1847
| 1915
| [[Wales]]
|-
| style='text-align:right'| 1978
| ''[[:d:Q4722679|Alfred Francis]]''
|
| 1885-09
| 1968
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 1979
| ''[[:d:Q4722738|Alfred Gooding]]''
|
| 1932-03
| 2018-01-29
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 1980
| ''[[:d:Q4722846|Alfred Higgs]]''
|
| 1904
| 1931
| ''[[:d:Q13131732|Talywain]]''
|-
| style='text-align:right'| 1981
| ''[[:d:Q4722948|Alfred Janes]]''
|
| 1911-06-30
| 1999-02-03
| [[Swansea]]
|-
| style='text-align:right'| 1982
| ''[[:d:Q4723069|Alfred Lewis Jones]]''
| [[File:Portrait of Sir Alfred Lewis Jones. Wellcome L0050182.jpg|center|128px]]
| 1845
| 1909-12-13
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1983
| ''[[:d:Q4723134|Alfred Mathews]]''
| [[File:Albert Agustus Mathews.jpg|center|128px]]
| 1864-02-07
| 1946-08-12
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 1984
| ''[[:d:Q4723318|Alfred Pullin]]''
|
| 1860-07-30
| 1934-06-23
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 1985
| ''[[:d:Q4723516|Alfred Thomas, 1st Baron Pontypridd]]''
| [[File:1906 Sir Alfred Thomas MP.jpg|center|128px]]
| 1840-09-16
| 1927-12-14
| ''[[:d:Q7165413|Penylan]]''
|-
| style='text-align:right'| 1986
| ''[[:d:Q4724154|Algernon Islay de Courcy Lyons]]''
|
| 1922-03-07
| 1993-11-17
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 1987
| ''[[:d:Q4726041|Alice Ormsby-Gore]]''
|
| 1952-04-22
| 1995-04-17
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 1988
| ''[[:d:Q4727193|Alison Statton]]''
| [[File:Alison portret april 26, 1989.jpg|center|128px]]
| 1959
|
| [[Cairdiff]]
|-
| style='text-align:right'| 1989
| ''[[:d:Q4730737|Allan Jones]]''
|
| 1940-01-06
| 1993-09
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 1990
| ''[[:d:Q4730784|Allan Lewis]]''
|
| 1942-10-07
|
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 1991
| ''[[:d:Q4730947|Allan Rogers]]''
|
| 1932-10-24
| 2023-11-28
| ''[[:d:Q3401140|Gelligaer]]''
|-
| style='text-align:right'| 1992
| ''[[:d:Q4731649|Allen Forward]]''
|
| 1921-06-04
| 1994-01-01
| ''[[:d:Q5197227|Cwmavon]]''
|-
| style='text-align:right'| 1993
| ''[[:d:Q4731836|Allen Raine]]''
| [[File:Allen Raine (1836–1908).png|center|128px]]
| 1836-10-06
| 1908-06-21
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 1994
| ''[[:d:Q4732812|Allison Pearson]]''
|
| 1960-07-22
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 1995
| ''[[:d:Q4737488|Alun Davies]]''
|
| 1943
|
| [[Wales]]
|-
| style='text-align:right'| 1996
| ''[[:d:Q4737493|Alun Davies]]''
| [[File:Alun Davies.jpg|center|128px]]
| 1964-02-12
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 1997
| ''[[:d:Q4737495|Alun Evans]]''
| [[File:Alun Evans.jpg|center|128px]]
| 1942-06-11
| 2011-11-12
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 1998
| ''[[:d:Q4737502|Alun Pugh]]''
|
| 1983-03-04
|
| [[Wales]]
|-
| style='text-align:right'| 1999
| ''[[:d:Q4737505|Alun Owen]]''
|
|
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2000
| ''[[:d:Q4737506|Alun Pugh]]''
| [[File:Alun Pugh.jpg|center|128px]]
| 1955-06-09
|
| [[Llwynypia]]
|-
| style='text-align:right'| 2001
| ''[[:d:Q4737508|Alun Richards]]''
|
| 1929-10-27
| 2004-06-02
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2002
| ''[[:d:Q4737513|Alun Talfan Davies]]''
|
| 1913-07-22
| 2000-11-11
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 2003
| ''[[:d:Q4737514|Alun Williams]]''
|
| 1920-08-26
| 1992-03-30
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2004
| ''[[:d:Q4737658|Alvan Williams]]''
|
| 1932-11-21
| 2003-12-22
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 2005
| ''[[:d:Q4738519|Alwyn Harris]]''
|
| 1936-01-31
| 2018-03-11
| ''[[:d:Q4667051|Aberdulais]]''
|-
| style='text-align:right'| 2006
| ''[[:d:Q4738526|Alwyn Jones]]''
|
| 1947-08-30
|
| [[Wales]]
|-
| style='text-align:right'| 2007
| ''[[:d:Q4738533|Alwyn Rice Jones]]''
|
| 1934-03-25
| 2007-08-12
| ''[[:d:Q3400769|Capel Curig]]''
|-
| style='text-align:right'| 2008
| ''[[:d:Q4738536|Alwyn Sheppard Fidler]]''
|
| 1909-05-08
| 1990-01-04
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 2009
| ''[[:d:Q4741760|Ambrose Baker]]''
|
| 1897-07-07
| 1976-11-24
| [[Swansea]]
|-
| style='text-align:right'| 2010
| ''[[:d:Q4746125|Amice de Clare]]''
|
| 1220-05-27
| 1284-01
| [[Monmouthshire]]
|-
| style='text-align:right'| 2011
| ''[[:d:Q4749104|Amy Beth Hayes]]''
|
| 1982-10-08
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2012
| ''[[:d:Q4749165|Amy Dillwyn]]''
| [[File:Harry and Amy Dillwyn (children of Lewis Llewelyn Dillwyn) by M. D. 1853 (3947813464).jpg|center|128px]]
| 1845-05-16
| 1935-12-13
| [[Swansea]]
|-
| style='text-align:right'| 2013
| ''[[:d:Q4749176|Amy Evans]]''
| [[File:AmyEvans1911.jpg|center|128px]]
| 1884-10-24
| 1983-01-05
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 2014
| ''[[:d:Q4756448|Andrew Brown]]''
|
| 1980-04-20
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 2015
| ''[[:d:Q4756669|Andrew Coombs]]''
|
| 1984-10-27
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2016
| ''[[:d:Q4756770|Andrew Davies]]''
| [[File:AndrewDavies.jpg|center|128px]]
| 1983-05-19
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2017
| ''[[:d:Q4756812|Andrew Dilnot]]''
| [[File:Andrew Dilnot 2014.jpg|center|128px]]
| 1960-06-19
|
| [[Swansea]]
|-
| style='text-align:right'| 2018
| ''[[:d:Q4757162|Andrew Gray]]''
|
| 1955-07-21
| 1999-05-07
| [[Cairdiff]]
|-
| style='text-align:right'| 2019
| ''[[:d:Q4757241|Andrew Harris]]''
|
| 1971-02-02
|
| [[Newport]]
|-
| style='text-align:right'| 2020
| ''[[:d:Q4757506|Andrew John]]''
| [[File:Bp Andrew John crop.jpg|center|128px]]
| 1964-01-09
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 2021
| ''[[:d:Q4757532|Andrew Jones]]''
|
| 1972-08-05
|
| [[Swansea]]
|-
| style='text-align:right'| 2022
| ''[[:d:Q4757535|Andrew Jones]]''
|
| 1983-10-06
| 2023-01-19
| [[Swansea]]
|-
| style='text-align:right'| 2023
| ''[[:d:Q4757840|Andrew MacLachlan]]''
|
| 1941-02-27
| 2019
| ''[[:d:Q628633|Trearddur]]''
|-
| style='text-align:right'| 2024
| ''[[:d:Q4757992|Andrew McNeillie]]''
|
| 1946
|
| [[Wales]]
|-
| style='text-align:right'| 2025
| ''[[:d:Q4758034|Andrew Millward]]''
|
| 1972-12-01
|
| [[Wales]]
|-
| style='text-align:right'| 2026
| ''[[:d:Q4758081|Andrew Mumford]]''
|
| 1981-06-18
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2027
| ''[[:d:Q4758266|Andrew Phillip Smith]]''
| [[File:Andrew Phillip Smith.jpeg|center|128px]]
| 1966-02-09
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 2028
| ''[[:d:Q4758350|Andrew RT Davies]]''
| [[File:Andrew RT Davies 2016.jpg|center|128px]]
| 1968
|
| [[Vale o Glamorgan]]
|-
| style='text-align:right'| 2029
| ''[[:d:Q4758389|Andrew Richmond]]''
| [[File:Andrew Richmond (Tyree, cropped).jpg|center|128px]]
| 1832
| 1880-11-15
| [[Wales]]
|-
| style='text-align:right'| 2030
| ''[[:d:Q4758493|Andrew Salter]]''
|
| 1993-06-01
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 2031
| ''[[:d:Q4758799|Andrew Vicari]]''
| [[File:Andrew Vicari at the Celtic Manor (cropped).jpg|center|128px]]
| 1932-04-20
| 2016-10-03
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2032
| ''[[:d:Q4760358|Andy Allen]]''
|
| 1967-04-05
|
| [[Newport]]
|-
| style='text-align:right'| 2033
| ''[[:d:Q4760525|Andy Clement]]''
|
| 1967-11-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2034
| ''[[:d:Q4760597|Andy Dibble]]''
| [[File:Dibble, Andy.jpg|center|128px]]
| 1965-05-08
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 2035
| ''[[:d:Q4760648|Andy Evans]]''
|
| 1975-11-25
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 2036
| ''[[:d:Q4760660|Andy Fenby]]''
|
| 1985-10-24
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 2037
| ''[[:d:Q4760715|Andy Goddard]]''
|
| 1968-06-05
|
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 2038
| ''[[:d:Q4760820|Andy Hockley]]''
|
| 1959-09-04
|
| [[Pontypridd]]
|-
| style='text-align:right'| 2039
| ''[[:d:Q4760823|Andy Holden]]''
|
| 1962-09-14
|
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 2040
| ''[[:d:Q4760865|Andy Jones]]''
|
| 1963-01-09
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2041
| ''[[:d:Q4760958|Andy Lloyd]]''
|
| 1981-04-09
|
| [[Wales]]
|-
| style='text-align:right'| 2042
| ''[[:d:Q4760995|Andy Martin]]''
|
| 1980-02-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2043
| ''[[:d:Q4761069|Andy Moule]]''
|
| 1977-04-16
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2044
| ''[[:d:Q4761195|Andy Puddle]]''
|
| 1956-09-10
|
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 2045
| ''[[:d:Q4761292|Andy Scott-Lee]]''
|
| 1980-03-29<br/>1986-06-20
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 2046
| ''[[:d:Q4761436|Andy Vine]]''
|
| 1944-04-24
|
| [[Swansea]]
|-
| style='text-align:right'| 2047
| ''[[:d:Q4761470|Andy White]]''
|
| 1948-11-06
|
| [[Newport]]
|-
| style='text-align:right'| 2048
| ''[[:d:Q4761604|Aneirin Hughes]]''
| [[File:Aneirin Hughes 2012.jpg|center|128px]]
| 1958-05-08
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 2049
| ''[[:d:Q4761606|Aneirin Talfan Davies]]''
|
| 1909-05-11
| 1980-07-14
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 2050
| ''[[:d:Q4761761|Aneurin Norman]]''
|
| 1991-03-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2051
| ''[[:d:Q4761764|Aneurin Rees]]''
|
| 1858-04-09
| 1932-09-11
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 2052
| ''[[:d:Q4761765|Aneurin Williams]]''
|
| 1859-10-11
| 1924-01-20
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 2053
| ''[[:d:Q4762459|Angela Hazeldine]]''
|
| 1981-07-02
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 2054
| ''[[:d:Q4763155|Angharad James]]''
| [[File:Angharad James 2020-10-22 Cymru v Faroe Islands JS-103.jpg|center|128px]]
| 1994-06-01
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 2055
| ''[[:d:Q4763157|Angharad Llwyd]]''
| [[File:Portrait of Angharad Llwyd (4670528) (cropped).jpg|center|128px]]
| 1780-04-15
| 1866-10-16
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 2056
| ''[[:d:Q4763159|Angharad James]]''
|
| 1677-07-16
| 1749-08-25
| ''[[:d:Q3404501|Nantlle]]''
|-
| style='text-align:right'| 2057
| ''[[:d:Q4763160|Angharad Mason]]''
|
| 1979-05-14
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2058
| ''[[:d:Q4763163|Angharad ferch Meurig]]''
|
| 9th century
|
| [[Wales]]
|-
| style='text-align:right'| 2059
| ''[[:d:Q4766340|Ann Cotton]]''
| [[File:Ann Lesley Cotton From Poverty to Prosperity- Engaging the Next Generation (5579338412) (3).jpg|center|128px]]
| 1950
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2060
| ''[[:d:Q4766441|Ann Harriet Hughes]]''
| [[File:Gwynneth.jpg|center|128px]]
| 1852
| 1910-04-25
| ''[[:d:Q7680325|Talsarnau]]''
|-
| style='text-align:right'| 2061
| ''[[:d:Q4766480|Ann Jones]]''
| [[File:Ann Jones.jpg|center|128px]]
| 1953-11-04
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 2062
| ''[[:d:Q4766483|Ann Keen]]''
| [[File:Ann Keen.jpg|center|128px]]
| 1948-11-26
|
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 2063
| ''[[:d:Q4766531|Ann Maddocks]]''
| [[File:Portrait of Ann Thomas (4674199) (cropped).jpg|center|128px]]
| 1704
| 1727
| ''[[:d:Q29489729|Cefn-ydfa]]''
|-
| style='text-align:right'| 2064
| ''[[:d:Q4767193|Anna Laetitia Waring]]''
|
| 1823
| 1910
| [[Wales]]
|-
| style='text-align:right'| 2065
| ''[[:d:Q4767676|Annabel Giles]]''
|
| 1959-05-20
| 2023-11-20
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 2066
| ''[[:d:Q4768405|Anne Griffith-Jones]]''
| [[File:Anne Griffith-Jones01.jpg|center|128px]]
| 1890-04-15
| 1973
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 2067
| ''[[:d:Q4768477|Anne Johnston]]''
|
| 1932
| 2019-06-26
| [[Wales]]
|-
| style='text-align:right'| 2068
| ''[[:d:Q4768946|Anneka Rice]]''
| [[File:AnnekaRice.jpg|center|128px]]
| 1958-10-04
|
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 2069
| ''[[:d:Q4769415|Annie Powell]]''
|
| 1906-09-08
| 1986-08-29
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 2070
| ''[[:d:Q4772117|Anthony Blackwood]]''
| [[File:Anthony Blackwood.jpg|center|128px]]
| 1982-09-13
|
| [[Wales]]
|-
| style='text-align:right'| 2071
| ''[[:d:Q4772713|Anthony Hicks]]''
|
| 1943-06-26
| 2010-05-26
| [[Swansea]]
|-
| style='text-align:right'| 2072
| ''[[:d:Q4772751|Anthony Howells]]''
| [[File:Anthony Howells.JPG|center|128px]]
| 1832-04-06
| 1915-11-17
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 2073
| ''[[:d:Q4772758|Anthony Hulme]]''
|
| 1910-02-26
| 2007-03-27
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 2074
| ''[[:d:Q4772937|Anthony Leonard Harris]]''
|
| 1935-03-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2075
| ''[[:d:Q4772944|Anthony Ling]]''
|
| 1910-08-10
| 1987-01-12
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 2076
| ''[[:d:Q4772997|Anthony Malarczyk]]''
|
| 1975-07-21
|
| [[Newport]]
|-
| style='text-align:right'| 2077
| ''[[:d:Q4773210|Anthony O'Donnell]]''
|
| 1949
|
| [[Wales]]
|-
| style='text-align:right'| 2078
| ''[[:d:Q4773224|Anthony Oliver]]''
|
| 1922-07-04
| 1995-11
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 2079
| ''[[:d:Q4773354|Anthony Reynolds]]''
|
| 1970
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2080
| ''[[:d:Q4773723|Anthony Williams]]''
|
| 1977-09-20
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2081
| ''[[:d:Q4773726|Anthony Windham Jones]]''
|
| 1879
| 1959-10-23
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2082
| ''[[:d:Q4777220|Antony John Williams]]''
| [[File:Tony Williams, ACS Spring, 2018.jpg|center|128px]]
| 1964-06-05
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 2083
| ''[[:d:Q4782136|Richard Booth]]''
| [[File:Richard George William Pitt Booth.jpg|center|128px]]
| 1938-09-12
| 2019-08-20
| ''[[:d:Q174734|Hay-on-Wye]]''
|-
| style='text-align:right'| 2084
| ''[[:d:Q4783330|Arabella Elizabeth Roupell]]''
| [[File:Arabella Elizabeth Roupell13.png|center|128px]]
| 1817-03-23
| 1914-07-31
| [[Newport]]
|-
| style='text-align:right'| 2085
| ''[[:d:Q4784337|Arash Amel]]''
| [[File:Arash Amel.jpg|center|128px]]
| 1976
|
| [[Wales]]
|-
| style='text-align:right'| 2086
| ''[[:d:Q4786506|Archibald Rowlands]]''
|
| 1892-12-26
| 1953-08-18
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 2087
| ''[[:d:Q4786631|Archie Brown]]''
|
| 1894-11-02
|
| [[Crosskeys]]
|-
| style='text-align:right'| 2088
| ''[[:d:Q4789156|Arfon Griffiths]]''
|
| 1941-08-23
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2089
| ''[[:d:Q4790887|Arise Evans]]''
| [[File:Portrait of One Evins a Welch man was lately comited to New Gate for saying hee was Christ (4670716) (cropped).jpg|center|128px]]
| 1607
| 1660
| ''[[:d:Q6661464|Llangelynnin]]''
|-
| style='text-align:right'| 2090
| ''[[:d:Q4793810|Frances Hoggan]]''
|
| 1843-12-20
| 1927-02-05
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 2091
| ''[[:d:Q4795190|Florence Gwendolen Rees]]''
|
| 1906-07-03
| 1994-10-04
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 2092
| ''[[:d:Q4795256|Arnold Silverstone, Baron Ashdown]]''
|
| 1911-09-28
| 1977-07-24
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2093
| ''[[:d:Q4796062|Arron Davies]]''
| [[File:ArronDavies.jpg|center|128px]]
| 1984-06-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2094
| ''[[:d:Q4797913|Arthur Banks]]''
|
| 1923-10-06
| 1944-12-20
| ''[[:d:Q6661173|Llanddulas]]''
|-
| style='text-align:right'| 2095
| ''[[:d:Q4797944|Arthur Bassett]]''
|
| 1914-06-28
| 1999-12-30
| ''[[:d:Q6389163|Kenfig Hill]]''
|-
| style='text-align:right'| 2096
| ''[[:d:Q4798110|Arthur Brown]]''
| [[File:Arthur Brown Port Vale footballer.jpg|center|128px]]
| 1903-10-10
| 1971-04-03
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2097
| ''[[:d:Q4798124|Arthur Buckler]]''
|
| 1882-04-24
| 1921-03-19
| [[Newport]]
|-
| style='text-align:right'| 2098
| ''[[:d:Q4798130|Arthur Bulkeley]]''
|
| 1445
| 1553
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 2099
| ''[[:d:Q4798338|Arthur Cornish]]''
|
| 1897-06-30
| 1948-07-29
| [[Cairdiff]]
|-
| style='text-align:right'| 2100
| ''[[:d:Q4798355|Arthur Creber]]''
|
| 1909-10-11
| 1966-08-10
| ''[[:d:Q7534773|Sketty]]''
|-
| style='text-align:right'| 2101
| ''[[:d:Q4798409|Arthur Daniels]]''
|
| 1922-09-04
| 2001-10-04
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 2102
| ''[[:d:Q4798571|Arthur Edward Hardinge]]''
| [[File:Arthur Edward Hardinge - retouched.png|center|128px]]
| 1828-03-02
| 1892-07-15
| [[Wales]]
|-
| style='text-align:right'| 2103
| ''[[:d:Q4798596|Arthur Ellis]]''
|
| 1990-06-07
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2104
| ''[[:d:Q4798724|Arthur Francis]]''
|
| 1953-11-29
|
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 2105
| ''[[:d:Q4798875|Arthur Granville]]''
|
| 1911-05-08
| 1987
| [[Llwynypia]]
|-
| style='text-align:right'| 2106
| ''[[:d:Q4798898|Arthur Griffith-Boscawen]]''
| [[File:Portrait of Sir Arthur Griffith Boscawen Wellcome M0003100.jpg|center|128px]]
| 1865-10-18
| 1946-06-01
| ''[[:d:Q7838916|Trevalyn Hall]]''
|-
| style='text-align:right'| 2107
| ''[[:d:Q4798904|Arthur Griffiths]]''
|
| 1908-04-23
| 1995
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 2108
| ''[[:d:Q4799042|Arthur Henry Williams]]''
|
| 1894-12-04
| 1968-10-04
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 2109
| ''[[:d:Q4799063|Arthur Hickman]]''
|
| 1910-08-06
| 1995-02-01
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 2110
| ''[[:d:Q4799128|Arthur Horner]]''
|
| 1894-04-05
| 1968-09-04
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2111
| ''[[:d:Q4799229|Arthur James Herbert]]''
|
| 1820
| 1897
| ''[[:d:Q36789652|Llansantffraed]]''
|-
| style='text-align:right'| 2112
| ''[[:d:Q4799230|Arthur James Mason]]''
| [[File:Arthur James Mason by George Henry.jpg|center|128px]]
| 1851-05-04
| 1928-04-24
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 2113
| ''[[:d:Q4799265|Arthur John Ensor]]''
|
| 1905-01-02
| 1995-01-18
| ''[[:d:Q3397990|Llanishen]]''
|-
| style='text-align:right'| 2114
| ''[[:d:Q4799273|Arthur John Williams]]''
| [[File:Arthur John Williams.jpg|center|128px]]
| 1834-04-14
| 1911-09-12
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2115
| ''[[:d:Q4799341|Arthur Kelton]]''
|
|
| 1549<br/>1550s
| [[Wales]]
|-
| style='text-align:right'| 2116
| ''[[:d:Q4799469|Arthur Lea]]''
|
| 1866-11-23
| 1945-03-23
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2117
| ''[[:d:Q4799486|Arthur Lemon]]''
|
| 1905-04-15
| 1982-05-28
| ''[[:d:Q16248422|Tonna]]''
|-
| style='text-align:right'| 2118
| ''[[:d:Q4799506|Arthur Lever]]''
|
| 1920-03-25
| 2004-08-20
| [[Cairdiff]]
|-
| style='text-align:right'| 2119
| ''[[:d:Q4799542|Arthur Lloyd]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2120
| ''[[:d:Q4800100|Arthur Rees]]''
|
| 1912-11-20
| 1998-05-13
| ''[[:d:Q3401549|Llangadog]]''
|-
| style='text-align:right'| 2121
| ''[[:d:Q4800175|Arthur Rosser]]''
| [[File:Arthur Rosser.jpg|center|128px]]
| 1864
| 1954
| ''[[:d:Q13656930|Oystermouth]]''
|-
| style='text-align:right'| 2122
| ''[[:d:Q4800443|Arthur Thomas]]''
|
| 1895-05-07
| 1953-02-11
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2123
| ''[[:d:Q4800445|Arthur Thomas]]''
|
| 1901
| 1970
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2124
| ''[[:d:Q4800586|Arthur Wade-Evans]]''
|
| 1875-08-31
| 1964-01-04
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 2125
| ''[[:d:Q4800617|Arthur Waters]]''
|
| 1888-02-27
| 1953-11-17
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2126
| ''[[:d:Q4800631|Arthur Weare]]''
|
| 1912-09-21
| 1994
| [[Newport]]
|-
| style='text-align:right'| 2127
| ''[[:d:Q4800988|Artie Moore]]''
|
| 1887-04-29
| 1949-01-20
| ''[[:d:Q7228311|Pontllanfraith]]''
|-
| style='text-align:right'| 2128
| ''[[:d:Q4802552|Arwel Richards]]''
| [[File:ArwelRichardsJune2008.jpg|center|128px]]
| 1982-01-25
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2129
| ''[[:d:Q4805363|Ashley Bateman]]''
|
| 1988-07-07
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 2130
| ''[[:d:Q4805364|Ashley Beck]]''
| [[File:ST vs Ospreys 08-12-120074.JPG|center|128px]]
| 1990-04-15
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2131
| ''[[:d:Q4805629|Ashley Way]]''
|
| 1971-12-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2132
| ''[[:d:Q4812804|Atarah Ben-Tovim]]''
|
| 1940-10-01
| 2022-10-20
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2133
| ''[[:d:Q4815657|Atholl Oakeley]]''
|
| 1900-05-31
| 1987-01
| ''[[:d:Q3401042|Rhoscolyn]]''
|-
| style='text-align:right'| 2134
| ''[[:d:Q4819086|Aubrey Casewell]]''
|
| 1909
| 1974
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 2135
| ''[[:d:Q4819096|Aubrey Davies]]''
|
| 1915-07-11
| 1994-07-25
| [[Swansea]]
|-
| style='text-align:right'| 2136
| ''[[:d:Q4819135|Aubrey Jones]]''
|
| 1911-11-20
| 2003-04-10
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2137
| ''[[:d:Q4819183|Aubrey Richards]]''
|
| 1920-06-06
| 2000-05-29
| [[Swansea]]
|-
| style='text-align:right'| 2138
| ''[[:d:Q4821369|Augustus Anson]]''
| [[File:Augustus Anson VC IWM Q 80462.jpg|center|128px]]
| 1835-03-05
| 1877-11-17
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 2139
| ''[[:d:Q4840761|Baden Powell]]''
|
| 1900-03-13
| 1955-11-25
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 2140
| ''[[:d:Q4846432|Frederick Bowley]]''
|
| 1873-11-09
| 1943-05-31
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 2141
| ''[[:d:Q4848345|Bailey Davies]]''
| [[File:David Bailey Davies.jpg|center|128px]]
| 1884-12-03
| 1968-08-24
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 2142
| ''[[:d:Q4850963|Henry Brinley Richards]]''
| [[File:Portrait of Brinley Richards, composer (4670494).jpg|center|128px]]
| 1819-11-13
| 1885-05-01
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2143
| ''[[:d:Q4858774|Barbara Brooke, Baroness Brooke of Ystradfellte]]''
|
| 1908-01-14
| 2000-09-01
| ''[[:d:Q6661867|Llanwern]]''
|-
| style='text-align:right'| 2144
| ''[[:d:Q4860676|Bari Morgan]]''
|
| 1980-08-13
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2145
| ''[[:d:Q4861635|Barnett Janner]]''
| [[File:Barnett Janner.jpg|center|128px]]
| 1892-06-20
| 1982-05-04<br/>1992-05-04
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2146
| ''[[:d:Q4863526|Barrie Hole]]''
| [[File:Barrie Hole.jpg|center|128px]]
| 1942-09-16
| 2019-03
| [[Swansea]]
|-
| style='text-align:right'| 2147
| ''[[:d:Q4863529|Barrie Jones]]''
|
| 1941-10-10
|
| [[Swansea]]
|-
| style='text-align:right'| 2148
| ''[[:d:Q4863573|Barrie Williams]]''
|
| 1955-11-04<br/>1939-01-06
| 2018-04-23
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2149
| ''[[:d:Q4864199|Barry Elsby]]''
| [[File:Barry Elsby (cropped).jpg|center|128px]]
| 1962
|
| [[Wales]]
|-
| style='text-align:right'| 2150
| ''[[:d:Q4864430|Barry Livesey]]''
|
| 1905
| 1959
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2151
| ''[[:d:Q4864433|Barry Lloyd]]''
|
| 1953-09-06
| 2016-12-01
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2152
| ''[[:d:Q4864507|Barry Metcalf]]''
|
| 1960-09-30
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 2153
| ''[[:d:Q4864878|Barry Watkins]]''
|
| 1921-11-30
| 2004-06-20
| ''[[:d:Q3910782|Bedlinog]]''
|-
| style='text-align:right'| 2154
| ''[[:d:Q4864914|Barry Wright]]''
|
| 1939-07-23
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2155
| ''[[:d:Q4877002|Beata Brookes]]''
|
| 1930-01-21
| 2015-08-17
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 2156
| ''[[:d:Q4878858|Becky Morgan]]''
| [[File:2013 Women's British Open - Becky Morgan (1).jpg|center|128px]]
| 1974-09-05
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2157
| ''[[:d:Q4879027|Beddoe Rees]]''
| [[File:William Beddoe Rees.jpg|center|128px]]
| 1877
| 1931-05-12
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2158
| ''[[:d:Q4879327|Bedo Aeddren]]''
|
| 1500s
|
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 2159
| ''[[:d:Q4879480|Bedwyr Williams]]''
|
| 1974
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 2160
| ''[[:d:Q4885193|Ben Addis]]''
|
|
|
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 2161
| ''[[:d:Q4885297|Ben Beynon]]''
| [[File:Ben Beynon rugby player.jpg|center|128px]]
| 1894-03-14
| 1969-05-21
| [[Swansea]]
|-
| style='text-align:right'| 2162
| ''[[:d:Q4885324|Ben Bowen Thomas]]''
| [[File:Leadership, Paris - UNESCO - PHOTO0000003811 0001.tiff|center|128px]]
| 1899-05-18
| 1977-07-26
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 2163
| ''[[:d:Q4885512|Ben Davies]]''
| [[File:Ben Davies (1873-1930).jpg|center|128px]]
| 1873-06-05
| 1930-06-23
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2164
| ''[[:d:Q4885596|Ben Ellis]]''
|
| 1906-04-11
| 1968
| ''[[:d:Q2564732|Aberbargoed]]''
|-
| style='text-align:right'| 2165
| ''[[:d:Q4885611|Ben Evans]]''
|
| 1975-07-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2166
| ''[[:d:Q4885613|Ben Evans]]''
| [[File:Ben Evans London Broncos.jpg|center|128px]]
| 1992-10-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2167
| ''[[:d:Q4885643|Ben Flower]]''
| [[File:Ben Flower.JPG|center|128px]]
| 1987-10-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2168
| ''[[:d:Q4885931|Ben John]]''
|
| 1991-02-28
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 2169
| ''[[:d:Q4885953|Ben Jones]]''
|
| 1992-07-07
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2170
| ''[[:d:Q4886058|Ben Lewis]]''
|
| 1986-08-26
|
| [[Swansea]]
|-
| style='text-align:right'| 2171
| ''[[:d:Q4886292|Ben Phillips]]''
|
| 1981-09-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2172
| ''[[:d:Q4886365|Ben Roberts]]''
|
| 1950-07-01
| 2021-06-07
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2173
| ''[[:d:Q4886472|Ben Slade]]''
|
| 1976-04-22
|
| [[Newport]]
|-
| style='text-align:right'| 2174
| ''[[:d:Q4886530|Ben Swallow]]''
| [[File:Ben Swallow 18-02-12.png|center|128px]]
| 1989-10-20
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2175
| ''[[:d:Q4886643|Ben Watts-Jones]]''
|
| 1885
|
| [[Wales]]
|-
| style='text-align:right'| 2176
| ''[[:d:Q4886701|Ben Williams]]''
|
| 1892-10-06
| 1959
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 2177
| ''[[:d:Q4886702|Ben Williams]]''
|
| 1900-10-29
| 1968-01-05
| ''[[:d:Q7164562|Penrhiw-ceibr]]''
|-
| style='text-align:right'| 2178
| ''[[:d:Q4887284|Benedict James]]''
|
| 1871-10-31
| 1957-08-14
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 2179
| ''[[:d:Q4888470|Benjamin Davies]]''
| [[File:Ben Davies as Geoffrey Wilder (Dorothy).jpg|center|128px]]
| 1858-01-06
| 1943-03-28<br/>1943
| [[Swansea]]<br/>''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 2180
| ''[[:d:Q4888734|Benjamin Gronow]]''
| [[File:Benjamin Gronow.jpg|center|128px]]
| 1887-03-10
| 1967-11-24
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2181
| ''[[:d:Q4888758|Benjamin Hall]]''
| [[File:Portrait of Benjamin Hall, Esqr. M.P (4670824) (cropped).jpg|center|128px]]
| 1777-09-29
| 1817-07-31
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 2182
| ''[[:d:Q4889295|Benjamin Thomas Williams]]''
|
| 1832-11-19
| 1890-03-21
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 2183
| ''[[:d:Q4889329|Benjamin Vaughan]]''
|
| 1917-12-25
| 2003-08-05
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 2184
| ''[[:d:Q4889528|Benji Webbe]]''
| [[File:Skindred - Elbriot 2018 20.jpg|center|128px]]
| 1967-03-11
|
| [[Newport]]
|-
| style='text-align:right'| 2185
| ''[[:d:Q4889664|Bennett Arron]]''
|
| 1973
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2186
| ''[[:d:Q4891798|Beriah Moore]]''
|
| 1919-12-25
| 2005
| [[Cairdiff]]
|-
| style='text-align:right'| 2187
| ''[[:d:Q4893143|Bernard Frederick]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2188
| ''[[:d:Q4893182|Bernard Gould]]''
|
| 1893
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 2189
| ''[[:d:Q4893213|Bernard Hedges]]''
|
| 1927-11-10
| 2014-02-08
| [[Pontypridd]]
|-
| style='text-align:right'| 2190
| ''[[:d:Q4893330|Bernard Knight]]''
|
| 1931-05-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2191
| ''[[:d:Q4893436|Bernard McNally]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2192
| ''[[:d:Q4893711|Bernard Turnbull]]''
|
| 1904-10-16
| 1984-04-07
| [[Cairdiff]]
|-
| style='text-align:right'| 2193
| ''[[:d:Q4894429|Bernie Lewis]]''
|
| 1945-03-12
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2194
| ''[[:d:Q4895054|Bert Evans]]''
|
| 1922-08-10
| 2008-05-08
| [[Swansea]]
|-
| style='text-align:right'| 2195
| ''[[:d:Q4895128|Bert Hodgkinson]]''
|
| 1884-08-10
| 1939-11-25
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 2196
| ''[[:d:Q4895132|Bert Hollingdale]]''
|
| 1889
| 1961
| [[Swansea]]
|-
| style='text-align:right'| 2197
| ''[[:d:Q4895151|Bert Jenkins]]''
|
| 1885
| 1943-02-04
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 2198
| ''[[:d:Q4895159|Bert Jones]]''
|
| 1906-05-01
| 1982-07-31
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2199
| ''[[:d:Q4895337|Bert Thomas]]''
| [[File:Herbert Samuel ('Bert') Thomas from NPG.jpg|center|128px]]
| 1883-10-13
| 1966-09-06
| [[Newport]]
|-
| style='text-align:right'| 2200
| ''[[:d:Q4895348|Bert Turner]]''
|
| 1909-06-19
| 1981-06-08
| ''[[:d:Q10970286|Brithdir]]''
|-
| style='text-align:right'| 2201
| ''[[:d:Q4895661|Bertie Williams]]''
|
| 1907-03-04
| 1968
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2202
| ''[[:d:Q4895662|Bertie Perkins]]''
|
| 1905-10-19
| 1992-05-06
| [[Swansea]]
|-
| style='text-align:right'| 2203
| ''[[:d:Q4897594|Beth Morris]]''
|
| 1949-03-12
| 2018-03-01
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 2204
| ''[[:d:Q4897683|Bethan Elfyn]]''
|
| 1974
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2205
| ''[[:d:Q4897688|Bethan Jenkins]]''
| [[File:Bethan Jenkins 2011.jpg|center|128px]]
| 1981-12-09
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2206
| ''[[:d:Q4898223|Betsan Powys]]''
| [[File:Betsan Powys 2012.jpg|center|128px]]
| 1965-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2207
| ''[[:d:Q4898236|Betsi Cadwaladr]]''
| [[File:Betsi Cadwaladr.JPG|center|128px]]
| 1789-05-24
| 1860-07-17
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 2208
| ''[[:d:Q4899014|Betty Williams]]''
|
| 1944-07-31
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2209
| ''[[:d:Q4899417|Beverley Jones]]''
|
| 1974-10-17
|
| ''[[:d:Q2183255|Queensferry]]''
|-
| style='text-align:right'| 2210
| ''[[:d:Q4908703|Bill Davies]]''
|
| 1906-08-26
| 1971-10-01
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2211
| ''[[:d:Q4908899|Bill Emery]]''
|
| 1897-08-25
| 1962-12-13
| ''[[:d:Q7165293|Pentrebach]]''
|-
| style='text-align:right'| 2212
| ''[[:d:Q4908928|Bill Evans]]''
|
| 1857-04-24
| 1935-07-01
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 2213
| ''[[:d:Q4908933|Bill Everson]]''
|
| 1906-03-15
| 1966-04-26
| ''[[:d:Q7377542|Rhydri]]''
|-
| style='text-align:right'| 2214
| ''[[:d:Q4909319|Bill Harris]]''
|
| 1928-10-31
| 1989-12
| [[Swansea]]
|-
| style='text-align:right'| 2215
| ''[[:d:Q4909481|Bill Hopkin]]''
|
| 1914-07-01
| 2002-03-03
| [[Newport]]
|-
| style='text-align:right'| 2216
| ''[[:d:Q4910257|Bill Morris]]''
|
| 1869-10-29
| 1946-11-04
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2217
| ''[[:d:Q4910477|Bill Perry]]''
|
| 1886-09-22
| 1970-02-16
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2218
| ''[[:d:Q4910545|Bill Price]]''
|
| 1909-04-01
| 1993-03-10<br/>1993-02-10
| [[Swansea]]
|-
| style='text-align:right'| 2219
| ''[[:d:Q4910664|Bill Roberts]]''
|
| 1908-07-12
| 1976-02-22
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 2220
| ''[[:d:Q4910867|Bill Shortt]]''
|
| 1920-10-13
| 2004-09-20
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2221
| ''[[:d:Q4911257|Bill Waite]]''
|
| 1917-11-29
| 1980
| [[Newport]]
|-
| style='text-align:right'| 2222
| ''[[:d:Q4911295|Bill Watkins]]''
|
| 1923-01-18
| 2005-03-15
| [[Swansea]]
|-
| style='text-align:right'| 2223
| ''[[:d:Q4912140|Billy Baker]]''
|
| 1920-10-03
| 2005-02-06
| ''[[:d:Q7164562|Penrhiw-ceibr]]''
|-
| style='text-align:right'| 2224
| ''[[:d:Q4912156|Billy Bassett]]''
|
| 1912-06-08
| 1977
| ''[[:d:Q10970286|Brithdir]]''
|-
| style='text-align:right'| 2225
| ''[[:d:Q4912241|Billy Bowen]]''
|
| 1897-12-06
| 1960-12-19
| [[Swansea]]
|-
| style='text-align:right'| 2226
| ''[[:d:Q4912305|Billy Butler]]''
| [[File:Billy Butler 2018.jpg|center|128px]]
| 1942-01-24
|
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 2227
| ''[[:d:Q4912428|Billy Davies]]''
| [[File:W.C.Davies.jpg|center|128px]]
| 1883
| 1960
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 2228
| ''[[:d:Q4912429|Billy Davies]]''
| [[File:Billy Davies.jpg|center|128px]]
| 1882
| 1956-02-17
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 2229
| ''[[:d:Q4912481|Billy Douglas]]''
|
| 1863-07-02
| 1943-09-24
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2230
| ''[[:d:Q4912558|Billy Foulkes]]''
|
| 1926-05-29
| 1979-02-07
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2231
| ''[[:d:Q4912588|Billy Geen]]''
| [[File:Billy Geen.jpg|center|128px]]
| 1891-03-14
| 1915-07-31
| [[Newport]]
|-
| style='text-align:right'| 2232
| ''[[:d:Q4912622|Billy Gore]]''
|
| 1919-11-19
| 2010-04-13
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 2233
| ''[[:d:Q4912742|Billy Hughes]]''
|
| 1918-03-06
| 1981-06-16
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2234
| ''[[:d:Q4912750|Billy Hullin]]''
|
| 1942-01-02
| 2012-10-03
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 2235
| ''[[:d:Q4912779|Billy James]]''
|
| 1956-07-18
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2236
| ''[[:d:Q4912896|Billy Lewis]]''
|
| 1864
| 1935
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2237
| ''[[:d:Q4912914|Billy Lucas]]''
|
| 1918-01-15
| 1998
| [[Newport]]
|-
| style='text-align:right'| 2238
| ''[[:d:Q4912940|Billy Mainwaring]]''
|
| 1941-01-24
| 2019-04-03
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2239
| ''[[:d:Q4913055|Billy Moore]]''
|
| 1910-02-17
| 1976-03-31
| ''[[:d:Q7337446|River Garw]]''
|-
| style='text-align:right'| 2240
| ''[[:d:Q4913065|Billy Morris]]''
|
| 1918-07-30
| 2002-12-31
| ''[[:d:Q6661173|Llanddulas]]''
|-
| style='text-align:right'| 2241
| ''[[:d:Q4913219|Billy Reed]]''
|
| 1928-01-25
| 2003
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 2242
| ''[[:d:Q4913221|Billy Rees]]''
|
| 1924-03-10
| 1996-07-27
| ''[[:d:Q3406145|Blaengarw]]''
|-
| style='text-align:right'| 2243
| ''[[:d:Q4913299|Billy Shergold]]''
| [[File:Billy Shergold - Newport County FC.jpg|center|128px]]
| 1923-01-22
| 1968
| [[Newport]]
|-
| style='text-align:right'| 2244
| ''[[:d:Q4913312|Billy Slade]]''
|
| 1941-09-27
| 2019-12-23
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2245
| ''[[:d:Q4913355|Billy Tabram]]''
|
| 1909-01-19
| 1992-04-15
| [[Swansea]]
|-
| style='text-align:right'| 2246
| ''[[:d:Q4913424|Billy Waith]]''
|
| 1950-08-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2247
| ''[[:d:Q4913438|Billy Watkins]]''
|
| 1910
| 1972-01
| [[Wales]]
|-
| style='text-align:right'| 2248
| ''[[:d:Q4913472|Billy Williams]]''
|
| 1905-12-29
| 1973-11-04
| ''[[:d:Q3404679|Crumlin]]''
|-
| style='text-align:right'| 2249
| ''[[:d:Q4924461|Blake Pelly]]''
| [[File:Blake Pelly in 1941.jpg|center|128px]]
| 1907-05-31
| 1990-10-16
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 2250
| ''[[:d:Q4925838|Bleddyn Bowen]]''
|
| 1961-07-16<br/>1961
|
| ''[[:d:Q7837341|Trebanos]]''
|-
| style='text-align:right'| 2251
| ''[[:d:Q4925840|Bleddyn Jones]]''
|
| 1948
| 2021-04-27
| ''[[:d:Q6693348|Lower Brynamman]]''
|-
| style='text-align:right'| 2252
| ''[[:d:Q4925842|Bleddyn Taylor]]''
|
| 1962-01-17
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2253
| ''[[:d:Q4932039|Bob Catley]]''
|
| 1942-09-01
|
| [[Wales]]
|-
| style='text-align:right'| 2254
| ''[[:d:Q4932261|Bob Delgado]]''
|
| 1949-01-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2255
| ''[[:d:Q4932323|Bob Dudley-Jones]]''
|
| 1952-05-26
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2256
| ''[[:d:Q4932383|Bob Evans]]''
|
| 1881-08
| 1962-03-08
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2257
| ''[[:d:Q4932463|Bob Franklin]]''
| [[File:Bob Franklin 1, 2011, jjron.jpg|center|128px]]
| 1965
|
| [[Wales]]
|-
| style='text-align:right'| 2258
| ''[[:d:Q4932881|Bob Humphrys]]''
|
| 1952-04-16
| 2008-08-18
| ''[[:d:Q7578756|Splott]]''
|-
| style='text-align:right'| 2259
| ''[[:d:Q4932960|Bob Jones]]''
|
| 1875-08-30
| 1944-09-21
| [[Pontypridd]]
|-
| style='text-align:right'| 2260
| ''[[:d:Q4933076|Bob Kucera]]''
|
| 1944-11-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2261
| ''[[:d:Q4933698|Bob Pugh]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2262
| ''[[:d:Q4933800|Bob Roberts]]''
|
| 1863
| 1950-03-24
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2263
| ''[[:d:Q4934328|Bob Weaver]]''
|
| 1912
|
| ''[[:d:Q7227631|Ponciau]]''
|-
| style='text-align:right'| 2264
| ''[[:d:Q4934724|Bobby Atherton]]''
|
| 1876-07-29
| 1917-10-19
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 2265
| ''[[:d:Q4934923|Bobby Delahay]]''
|
| 1900-09-02
| 1978-09-12
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2266
| ''[[:d:Q4935708|Bobby Weale]]''
|
| 1903-11-09
| 1970
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 2267
| ''[[:d:Q4935805|Bobi Jones]]''
|
| 1929-05-20
| 2017-11-22
| [[Cairdiff]]
|-
| style='text-align:right'| 2268
| ''[[:d:Q4943807|Claire Curtis-Thomas]]''
|
| 1958-04-30
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2269
| ''[[:d:Q4955010|Bradley Pryce]]''
| [[File:Bradley Pryce.jpg|center|128px]]
| 1981-03-15
|
| [[Newport]]
|-
| style='text-align:right'| 2270
| ''[[:d:Q4955057|Bradley Wadlan]]''
|
| 1988-12-14
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2271
| ''[[:d:Q4958557|Brayley Reynolds]]''
|
| 1935-05-30
| 2023-09-04
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 2272
| ''[[:d:Q4960646|Brenda Chamberlain]]''
| [[File:Brendachamberlain.png|center|128px]]
| 1912
| 1971<br/>1971-07-11
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2273
| ''[[:d:Q4963005|Brian Attley]]''
|
| 1955-08-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2274
| ''[[:d:Q4963078|Brian Bedford]]''
|
| 1933-12-24
| 2022-05-18
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 2275
| ''[[:d:Q4963131|Brian Blears]]''
|
| 1933-11-18
| 2005-11-10
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 2276
| ''[[:d:Q4963178|Brian Bowditch]]''
|
| 1961
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2277
| ''[[:d:Q4963235|Brian Butler]]''
|
| 1948-02-16
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2278
| ''[[:d:Q4963253|Brian Cairns]]''
|
| 1939
| 1993-10
| ''[[:d:Q11020503|Trethomas]]''
|-
| style='text-align:right'| 2279
| ''[[:d:Q4963315|Brian Caswell]]''
|
| 1954-01-13
|
| ''[[:d:Q5623557|Gwernaffield]]''
|-
| style='text-align:right'| 2280
| ''[[:d:Q4963491|Brian Curvis]]''
|
| 1937-08-14
| 2012-01-09
| [[Swansea]]
|-
| style='text-align:right'| 2281
| ''[[:d:Q4963529|Sarah Loosemore]]''
|
| 1961-06-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2282
| ''[[:d:Q4963649|Brian Earnshaw]]''
|
| 1929-12-26
| 2014
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2283
| ''[[:d:Q4963686|Brian Evans]]''
|
| 1936-11-09<br/>1936-02-23
| 2011-05-01
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 2284
| ''[[:d:Q4963687|Brian Evans]]''
|
| 1942-12-02
| 2003-02-26
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 2285
| ''[[:d:Q4963897|Brian Griffiths]]''
|
| 1933-11-21
|
| ''[[:d:Q7165398|Pen-y-cae]]''
|-
| style='text-align:right'| 2286
| ''[[:d:Q4963931|Brian Hancock]]''
| [[File:Brian Hancock.png|center|128px]]
| 1950-08-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2287
| ''[[:d:Q4964112|Brian Hughes]]''
|
| 1937-11-22
| 2018-10-07
| [[Swansea]]
|-
| style='text-align:right'| 2288
| ''[[:d:Q4964202|Brian Jenkins]]''
| [[File:Brian Jenkins 2009.jpg|center|128px]]
| 1942-09-19
|
| [[Pontypridd]]
|-
| style='text-align:right'| 2289
| ''[[:d:Q4964204|Brian Jenkins]]''
|
| 1943-06-20
| 2017-12-24
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2290
| ''[[:d:Q4964251|Brian Jones]]''
|
| 1935-10-10
|
| ''[[:d:Q5197235|Cwmcarn]]''
|-
| style='text-align:right'| 2291
| ''[[:d:Q4964262|Brian Juliff]]''
|
| 1952-12-05
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 2292
| ''[[:d:Q4964454|Brian Law]]''
|
| 1970-01-01
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2293
| ''[[:d:Q4964513|Brian Lloyd]]''
|
| 1948-03-18
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 2294
| ''[[:d:Q4964714|Brian McGuinness]]''
|
| 1927-10-22
| 2019-12-23
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2295
| ''[[:d:Q4964811|Brian Morris, Baron Morris of Castle Morris]]''
|
| 1930-12-04
| 2001-04-30
| [[Cairdiff]]
|-
| style='text-align:right'| 2296
| ''[[:d:Q4964875|Brian Nicholas]]''
|
| 1933-04-20
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2297
| ''[[:d:Q4965053|Brian Plummer]]''
|
| 1936-09-11
| 2003-09-12
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2298
| ''[[:d:Q4965080|Brian Purcell]]''
|
| 1938-11-23
| 1969-01-20
| [[Swansea]]
|-
| style='text-align:right'| 2299
| ''[[:d:Q4965353|Brian Sparks]]''
|
| 1931-06-23
| 2013-06-30
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 2300
| ''[[:d:Q4965445|Ruth Manning-Sanders]]''
|
| 1886-08-21
| 1988-10-12
| [[Swansea]]
|-
| style='text-align:right'| 2301
| ''[[:d:Q4965619|Brian Whitcombe]]''
|
| 1934-10-13
| 2021-01-02
| [[Cairdiff]]
|-
| style='text-align:right'| 2302
| ''[[:d:Q4966702|Bridget Bevan]]''
| [[File:Madam Bevan.jpg|center|128px]]
| 1698-10-30
| 1779-12-11
| ''[[:d:Q6661653|Llannewydd]]''
|-
| style='text-align:right'| 2303
| ''[[:d:Q4967443|Bright Light Bright Light]]''
| [[File:Rod Thomas Trickledown.jpg|center|128px]]
| 1982
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2304
| ''[[:d:Q4968450|Brinley Williams]]''
|
| 1895-04-03
| 1987-01-05
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2305
| ''[[:d:Q4968451|Brinley Richards]]''
|
| 1904-04-13
| 1981-09-18
| ''[[:d:Q107032717|Nantyffyllon]]''
|-
| style='text-align:right'| 2306
| ''[[:d:Q4977546|Bruce George]]''
| [[File:BruceGeorge 21 Jan 2008.jpg|center|128px]]
| 1942-06-01
| 2020-02-24
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 2307
| ''[[:d:Q4980282|Bryan Orritt]]''
|
| 1937-02-22
| 2014-03-24
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 2308
| ''[[:d:Q4980848|Bryn Day]]''
|
| 1919-11-24
| 1977-12
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2309
| ''[[:d:Q4980857|Bryn Evans]]''
|
| 1902-01-16
| 1970-04-29
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 2310
| ''[[:d:Q4980860|Bryn Goldswain]]''
|
| 1922-08-03
| 1983-04-24
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2311
| ''[[:d:Q4980861|Bryn Griffiths]]''
|
| 1982-03-08
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 2312
| ''[[:d:Q4980875|Bryn Howells]]''
|
| 1911-02-09
| 1983-06-06
| ''[[:d:Q5714075|Hendy]]''
|-
| style='text-align:right'| 2313
| ''[[:d:Q4980876|Bryn Jones]]''
|
| 1939-05-26
|
| ''[[:d:Q3401133|Bagillt]]''
|-
| style='text-align:right'| 2314
| ''[[:d:Q4980877|Bryn Jones]]''
|
| 1931-05-20
| 1990-10
| [[Swansea]]
|-
| style='text-align:right'| 2315
| ''[[:d:Q4980879|Bryn Jones]]''
|
| 1948-02-08
|
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 2316
| ''[[:d:Q4980880|Bryn Jones]]''
|
| 1912-02-14
| 1985-10-18
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2317
| ''[[:d:Q4980884|Bryn Lewis]]''
|
| 1891-01-04
| 1917-04-02
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 2318
| ''[[:d:Q4980907|Bryn Merrick]]''
|
| 1958-10-12
| 2015-09-12
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2319
| ''[[:d:Q4980910|Bryn Phillips]]''
|
| 1900-10-11
| 1980
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2320
| ''[[:d:Q4980919|Bryn Williams]]''
|
| 1977-06-06
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 2321
| ''[[:d:Q4981006|Brynley Jones]]''
|
| 1959-05-16
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 2322
| ''[[:d:Q4981007|Brynley F. Roberts]]''
|
| 1931-02-03
| 2023-08-14
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2323
| ''[[:d:Q4981021|Brynmor Williams]]''
|
| 1951-10-29
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 2324
| ''[[:d:Q4983367|Buckley Roderick]]''
| [[File:Lt-Col-W-Buckley-Roderick.jpg|center|128px]]
| 1862-01-17
| 1908-02-01
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2325
| ''[[:d:Q4984759|Buddug Verona James]]''
|
| 1957
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 2326
| ''[[:d:Q4984762|Buddug Williams]]''
|
| 1932
| 2021-07-24
| ''[[:d:Q1033068|Cefneithin]]''
|-
| style='text-align:right'| 2327
| ''[[:d:Q5004293|Byron Anthony]]''
| [[File:Phil Kite.jpg|center|128px]]
| 1984-09-20
|
| [[Newport]]
|-
| style='text-align:right'| 2328
| ''[[:d:Q5004338|Byron Davies]]''
| [[File:Official portrait of Lord Davies of Gower crop 2.jpg|center|128px]]
| 1952-09-04
|
| ''[[:d:Q1141148|Gower Peninsula]]''
|-
| style='text-align:right'| 2329
| ''[[:d:Q5004379|Byron Hayward]]''
|
| 1969-05-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2330
| ''[[:d:Q5006278|C. Anne Wilson]]''
|
| 1927-07-12
| 2023-01-08
| ''[[:d:Q1141148|Gower Peninsula]]''
|-
| style='text-align:right'| 2331
| ''[[:d:Q5006423|C. E. Wynn-Williams]]''
| [[File:C E Wynn Williams 1927.jpg|center|128px]]
| 1903-03-05
| 1979-08-30
| [[Swansea]]
|-
| style='text-align:right'| 2332
| ''[[:d:Q5006871|C. Stewart Sheppard]]''
|
| 1915-11-25
| 2002-03-07
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2333
| ''[[:d:Q5016641|Cadwaladr Bryner Jones]]''
|
| 1872-04-06
| 1954-12-10
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 2334
| ''[[:d:Q5016647|Cadwgan of Llandyfai]]''
|
| 12nd century
| 1241-04-11
| ''[[:d:Q6482424|Lamphey]]''
|-
| style='text-align:right'| 2335
| ''[[:d:Q5016650|Cadwgan ap Meurig]]''
|
|
| 1074
| ''[[:d:Q13131807|Kingdom of Morgannwg]]''
|-
| style='text-align:right'| 2336
| ''[[:d:Q5017482|Cai Griffiths]]''
|
| 1984-01-05
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2337
| ''[[:d:Q5022959|Callum Hart]]''
|
| 1985-12-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2338
| ''[[:d:Q5024269|Calvert Jones]]''
| [[File:David brewster group.jpg|center|128px]]
| 1804-12-04
| 1877-11-07<br/>1877-12
| [[Swansea]]
|-
| style='text-align:right'| 2339
| ''[[:d:Q5026396|Cameron Toshack]]''
|
| 1970-03-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2340
| ''[[:d:Q5026420|Cameron Wright]]''
|
| 1901
| 1979
| [[Wales]]
|-
| style='text-align:right'| 2341
| ''[[:d:Q5032084|Candy Evans]]''
|
| 1903-12
| 1952-01-07
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 2342
| ''[[:d:Q5036555|Captain Beany]]''
|
| 1954
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2343
| ''[[:d:Q5037322|Cara Readle]]''
|
| 1991-01-08
|
| [[Swansea]]
|-
| style='text-align:right'| 2344
| ''[[:d:Q5037598|David Caradoc Evans]]''
| [[File:Caradoc Evans.jpg|center|128px]]
| 1878-12-31
| 1945-01-11
| ''[[:d:Q3404590|Llanfihangel-ar-Arth]]''
|-
| style='text-align:right'| 2345
| ''[[:d:Q5037600|Caradog Roberts]]''
| [[File:Caradog Roberts as Young Man.jpg|center|128px]]
| 1878-10-30
| 1935-03-03
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 2346
| ''[[:d:Q5037601|Caradog Jones]]''
|
| 1962
|
| ''[[:d:Q3401544|Pontrhydfendigaid]]''
|-
| style='text-align:right'| 2347
| ''[[:d:Q5039201|Carey Morris]]''
| [[File:Carey-Morris.jpg|center|128px]]
| 1882-05-17
| 1968-11-17
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 2348
| ''[[:d:Q5040015|Carl Dale]]''
|
| 1966-04-29
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 2349
| ''[[:d:Q5040714|Carl Roberts]]''
|
| 1983-06-17
|
| [[Swansea]]
|-
| style='text-align:right'| 2350
| ''[[:d:Q5040764|Carl Sargent]]''
|
| 1952-12-11
| 2018-09-12
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 2351
| ''[[:d:Q5040766|Carl Sargeant]]''
| [[File:Carl Sargeant.jpg|center|128px]]
| 1968-07-27
| 2017-11-07
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 2352
| ''[[:d:Q5044318|Carol Evans]]''
|
| 1938-11-29
| 2007-10-14
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 2353
| ''[[:d:Q5044730|Carole Seymour-Jones]]''
|
| 1943-03-03
| 2015-05-23
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 2354
| ''[[:d:Q5045217|Caroline Sheen]]''
|
| 1974-01-07
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 2355
| ''[[:d:Q5047746|Carys Hawkins]]''
| [[File:Caryshawkins glory.JPG|center|128px]]
| 1988-08-29<br/>1989-11-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2356
| ''[[:d:Q5051783|Cate Le Bon]]''
| [[File:Cate Le Bon in 2012.jpg|center|128px]]
| 1983-03-04
|
| ''[[:d:Q7162279|Pen-boyr]]''
|-
| style='text-align:right'| 2357
| ''[[:d:Q5052698|Catherine Gladstone]]''
| [[File:Portrait of Mrs. Gladstone (4670770).jpg|center|128px]]
| 1812-01-06
| 1900-06-14
| ''[[:d:Q370127|Hawarden Castle]]''
|-
| style='text-align:right'| 2358
| ''[[:d:Q5053946|Catrin Edwards]]''
|
| 1980-09-15
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2359
| ''[[:d:Q5053948|Catrin Stewart]]''
| [[File:Catrin Stewart.jpg|center|128px]]
| 1988-01-29
|
| [[Wales]]
|-
| style='text-align:right'| 2360
| ''[[:d:Q5053949|Catrin Thomas]]''
|
| 1964-10-05
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 2361
| ''[[:d:Q5055956|Cecil Biggs]]''
|
| 1881-05-02
| 1944-10-05
| [[Cairdiff]]
|-
| style='text-align:right'| 2362
| ''[[:d:Q5056292|Cecil Raleigh]]''
| [[File:Cecil Raleigh (1856–1914).png|center|128px]]
| 1856-01-27
| 1914-11-10
| ''[[:d:Q4667220|Aberystruth]]''
|-
| style='text-align:right'| 2363
| ''[[:d:Q5056310|Cecil Smith]]''
|
| 1904-10-30
| 1977
| ''[[:d:Q6757051|Marchwiel]]''
|-
| style='text-align:right'| 2364
| ''[[:d:Q5056313|Cecil Spiller]]''
|
| 1900-08-19
| 1974-04-05
| [[Cairdiff]]
|-
| style='text-align:right'| 2365
| ''[[:d:Q5056381|Cecil Woodham-Smith]]''
|
| 1896-04-29
| 1977-03-16
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 2366
| ''[[:d:Q5057131|Cedric Morris]]''
| [[File:Frances Hodgkins Cedric Morris.jpg|center|128px]]
| 1889-12-11
| 1982-02-08
| ''[[:d:Q7534773|Sketty]]''
|-
| style='text-align:right'| 2367
| ''[[:d:Q5057382|Ceiri Torjussen]]''
|
| 1976
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2368
| ''[[:d:Q5057386|Ceiron Thomas]]''
|
| 1983-10-23
|
| [[Swansea]]
|-
| style='text-align:right'| 2369
| ''[[:d:Q5057975|Celia Barlow]]''
|
| 1955-09-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2370
| ''[[:d:Q5058868|Cennydd Traherne]]''
|
| 1910-12-14
| 1995-01-26
| ''[[:d:Q5140546|Coedarhydyglyn]]''<br/>''[[:d:Q7590820|St Nicholas]]''
|-
| style='text-align:right'| 2371
| ''[[:d:Q5063221|Cenydd]]''
| [[File:LLangennith church.JPG|center|128px]]
|
|
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 2372
| ''[[:d:Q5064233|Ceri Hughes]]''
|
| 1971-02-26
|
| [[Pontypridd]]
|-
| style='text-align:right'| 2373
| ''[[:d:Q5064236|Ceri Peach]]''
|
| 1939-10-26
| 2018-10-02
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2374
| ''[[:d:Q5064237|Ceri Morgan]]''
|
| 1947-12-22
| 2020-02-29
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 2375
| ''[[:d:Q5064239|Ceri Phillips]]''
|
| 1987-12-06
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 2376
| ''[[:d:Q5064241|Ceri Richards]]''
|
| 1903-06-06
| 1971-11-09
| ''[[:d:Q5315782|Dyfnant]]''
|-
| style='text-align:right'| 2377
| ''[[:d:Q5066169|Chad Bond]]''
| [[File:Chad Bond.jpeg|center|128px]]
| 1987-04-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2378
| ''[[:d:Q5074191|Chard Hayward]]''
|
| 1949
|
| [[Wales]]
|-
| style='text-align:right'| 2379
| ''[[:d:Q5075044|Charles Alexander Harris]]''
| [[File:Sir Charles Alexander Harris (1855-1947).jpg|center|128px]]
| 1855-06-28
| 1947-03-26
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2380
| ''[[:d:Q5075082|Charles Allen Duval]]''
| [[File:C A Duval.jpg|center|128px]]
| 1810-03-19
| 1872-06-14
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 2381
| ''[[:d:Q5075534|Charles Benjamin Redrup]]''
|
| 1878
| 1961
| [[Newport]]
|-
| style='text-align:right'| 2382
| ''[[:d:Q5076594|Charles Curran]]''
|
| 1903
| 1972-09-16
| [[Cairdiff]]
|-
| style='text-align:right'| 2383
| ''[[:d:Q5076682|Charles Dale]]''
|
| 1963-11-28
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 2384
| ''[[:d:Q5077255|Charles Edward Breese]]''
|
| 1867
| 1932-08-15
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 2385
| ''[[:d:Q5077316|Charles Edwards]]''
| [[File:Sir Charles Edwards.jpg|center|128px]]
| 1867-02-19
| 1954-06-15
| ''[[:d:Q60845686|Gravel]]''
|-
| style='text-align:right'| 2386
| ''[[:d:Q5077323|Charles Edwards]]''
|
| 1628
| 1691
| ''[[:d:Q3402947|Rhydycroesau]]''
|-
| style='text-align:right'| 2387
| ''[[:d:Q5078021|Charles Gibbs]]''
| [[File:Charles Lionel Gibbs.JPG|center|128px]]
| 1877-11-11
| 1934-09-05
| [[Newport]]
|-
| style='text-align:right'| 2388
| ''[[:d:Q5078428|Charles Gresford Edmondes]]''
| [[File:Charles Gresford Edmondes.jpg|center|128px]]
| 1838-12-08
| 1893-07-18
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 2389
| ''[[:d:Q5079440|Charles James Jackson]]''
|
| 1849-05-02
| 1923-04-23
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 2390
| ''[[:d:Q5079461|Watkin Williams]]''
| [[File:CJWatkinWilliamsAS.jpg|center|128px]]
| 1827-09-23
| 1884-07-17
| ''[[:d:Q3399915|Llangar]]''
|-
| style='text-align:right'| 2391
| ''[[:d:Q5080412|Charles Lynn Davies]]''
|
| 1929-12-30
|
| ''[[:d:Q4854175|Bancyfelin]]''
|-
| style='text-align:right'| 2392
| ''[[:d:Q5081077|Charles Morgan]]''
|
| 1909-03-23<br/>1909-07-21
| 2000-03
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 2393
| ''[[:d:Q5081341|Charles Octavius Swinnerton Morgan]]''
| [[File:Octavius Morgan.jpg|center|128px]]
| 1803-09-15
| 1888-08-05
| [[Newport]]
|-
| style='text-align:right'| 2394
| ''[[:d:Q5081561|Charles Peart]]''
|
| 1759-12-22
| 1798
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 2395
| ''[[:d:Q5081757|Charles Prestwood Lucas]]''
|
| 1853-08-07
| 1931-05
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 2396
| ''[[:d:Q5081973|Charles Rees]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2397
| ''[[:d:Q5082319|Charles Sage]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2398
| ''[[:d:Q5082587|Charles Spencer]]''
|
| 1903-06-21
| 1941-09-29
| ''[[:d:Q6661223|Llandochau Fach]]''
|-
| style='text-align:right'| 2399
| ''[[:d:Q5082610|Charles St John David]]''
|
| 1855
| 1924-07-17
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 2400
| ''[[:d:Q5082619|Charles Staines]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2401
| ''[[:d:Q5082639|Charles Stanton]]''
| [[File:Charles-Butt-Stanton.jpg|center|128px]]
| 1873-04-07
| 1946-12-06
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 2402
| ''[[:d:Q5082797|Charles Symmons]]''
| [[File:Reverend Dr Charles Symmons, by William Beechey (1753-1839).jpg|center|128px]]
| 1749
| 1826-04-27
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 2403
| ''[[:d:Q5083599|Charles Williams]]''
|
| 1804<br/>1807
| 1877-10-17
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 2404
| ''[[:d:Q5083602|Charles Williams]]''
|
| 1906-07-05
| 1961
| [[Cairdiff]]
|-
| style='text-align:right'| 2405
| ''[[:d:Q5084581|Charli Britton]]''
|
| 1952-12-12
| 2021-08-14
| [[Cairdiff]]
|-
| style='text-align:right'| 2406
| ''[[:d:Q5085086|Charlie Jones]]''
|
| 1911-11-20
| 1985-06-04
| ''[[:d:Q6947883|Mynyddislwyn]]''
|-
| style='text-align:right'| 2407
| ''[[:d:Q5085136|Charlie Landsborough]]''
|
| 1941-10-26
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2408
| ''[[:d:Q5085196|Charlie Martin]]''
|
| 1913-04-21
| 1998-02-19
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2409
| ''[[:d:Q5085359|Charlie Parry]]''
| [[File:Parry 180395.jpg|center|128px]]
| 1870
| 1922-02-04
| ''[[:d:Q6661768|Llansilin]]''
|-
| style='text-align:right'| 2410
| ''[[:d:Q5085395|Charlie Phillips]]''
|
| 1910-06-23
| 1969-10-15
| ''[[:d:Q7926510|Victoria]]''
|-
| style='text-align:right'| 2411
| ''[[:d:Q5085414|Charlie Pugh]]''
|
| 1896-03-07
| 1951-01-23
| [[Pontypridd]]
|-
| style='text-align:right'| 2412
| ''[[:d:Q5085603|Charlie Thomas]]''
|
| 1864
| 1948-03-08
| [[Newport]]
|-
| style='text-align:right'| 2413
| ''[[:d:Q5085718|Charlie Winslade]]''
|
| 1931-11-21
| 1993-10
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2414
| ''[[:d:Q5085957|Charlotte Godley]]''
| [[File:Charlotte Godley sketch, 1877.jpg|center|128px]]
| 1821-11-14
| 1907-01-03
| ''[[:d:Q7165298|Pentrefoelas]]''
|-
| style='text-align:right'| 2415
| ''[[:d:Q5086967|John Thomas]]''
|
| 1826-11-09
| 1908-11-11
| ''[[:d:Q16548107|Castle Caereinion]]''
|-
| style='text-align:right'| 2416
| ''[[:d:Q5092334|Cherry Dee]]''
|
| 1987-06-11
|
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 2417
| ''[[:d:Q5092726|Cheryl Foster]]''
| [[File:Cheryl Foster 20181101.jpg|center|128px]]
| 1980-10-04<br/>1990-10-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2418
| ''[[:d:Q5096125|Chick Jenkins]]''
|
| 1882
| 1932
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 2419
| ''[[:d:Q5105819|Chris Barnard]]''
|
| 1947-08-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2420
| ''[[:d:Q5105905|Chris Birch]]''
|
| 1984-10
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2421
| ''[[:d:Q5106346|Chris Dale]]''
|
| 1972-09-04
|
| [[Wales]]
|-
| style='text-align:right'| 2422
| ''[[:d:Q5106362|Chris Davies]]''
|
| 1991-12-24
|
| [[Wales]]
|-
| style='text-align:right'| 2423
| ''[[:d:Q5106395|Chris Dicomidis]]''
|
| 1985-09-14
|
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 2424
| ''[[:d:Q5106513|Chris Evans]]''
|
| 1962-10-13
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 2425
| ''[[:d:Q5106601|Chris Fry]]''
|
| 1969-10-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2426
| ''[[:d:Q5106660|Chris Giles]]''
|
| 1982-04-16
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2427
| ''[[:d:Q5107005|Chris Jenkins]]''
|
| 1987-12-06
|
| [[Wales]]
|-
| style='text-align:right'| 2428
| ''[[:d:Q5107007|Chris Jenkins]]''
| [[File:Chrisjenkinsbodypower.png|center|128px]]
|
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2429
| ''[[:d:Q5107015|Chris Johns]]''
|
| 1958-08-10
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2430
| ''[[:d:Q5107037|Chris Jones]]''
|
| 1989-09-12
|
| [[Swansea]]
|-
| style='text-align:right'| 2431
| ''[[:d:Q5107253|Chris Llewellyn]]''
| [[File:Chris Llewellyn.jpg|center|128px]]
| 1979-08-28
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2432
| ''[[:d:Q5107359|Chris Marustik]]''
|
| 1961-08-10
| 2015-08-12
| [[Swansea]]
|-
| style='text-align:right'| 2433
| ''[[:d:Q5107567|Chris Needs]]''
|
| 1954-03-12
| 2020-07-26
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 2434
| ''[[:d:Q5107713|Chris Pearce]]''
|
| 1961-08-07
|
| [[Newport]]
|-
| style='text-align:right'| 2435
| ''[[:d:Q5107766|Chris Pike]]''
|
| 1961-10-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2436
| ''[[:d:Q5107913|Chris Rodon]]''
|
| 20th century<br/>1963-06-09
|
| [[Wales]]
|-
| style='text-align:right'| 2437
| ''[[:d:Q5108280|Chris Todd]]''
|
| 1981-08-22
|
| [[Swansea]]
|-
| style='text-align:right'| 2438
| ''[[:d:Q5108299|Chris Townsend]]''
|
| 1966-03-30
|
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 2439
| ''[[:d:Q5109563|Christian Edwards]]''
|
| 1975-11-23
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2440
| ''[[:d:Q5110078|Christian Roberts]]''
|
| 1979-10-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2441
| ''[[:d:Q5110965|Christine Chapman]]''
| [[File:Christine Chapman.jpg|center|128px]]
| 1956-04-07
|
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 2442
| ''[[:d:Q5111036|Christine Gwyther]]''
| [[File:Christinegwyther.jpg|center|128px]]
| 1959
|
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 2443
| ''[[:d:Q5111062|Christine James]]''
| [[File:Christine James Cyn-Archdderwydd Awst 2018 7.jpg|center|128px]]
| 1954-02
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 2444
| ''[[:d:Q5111419|Christmas Samuel]]''
|
| 1674
| 1764-06-18
| ''[[:d:Q6661278|Llanegwad]]''
|-
| style='text-align:right'| 2445
| ''[[:d:Q5111917|Christopher Bassett]]''
|
| 1752-02-27
| 1784-02-08
| ''[[:d:Q4667189|Aberthaw]]''
|-
| style='text-align:right'| 2446
| ''[[:d:Q5112290|Christopher Evans]]''
|
| 1951
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 2447
| ''[[:d:Q5112291|Christopher Evans]]''
|
| 1957-11-29
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2448
| ''[[:d:Q5112292|Christopher Evans]]''
|
| 1931-05-29
| 1979-10-10
| ''[[:d:Q319536|Aberdyfi]]''
|-
| style='text-align:right'| 2449
| ''[[:d:Q5112621|Christopher J. Yorath]]''
| [[File:Christopher J. Yorath.png|center|128px]]
| 1879
| 1932-04-02
| [[Cairdiff]]
|-
| style='text-align:right'| 2450
| ''[[:d:Q5112865|Christopher Meredith]]''
|
| 1954
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 2451
| ''[[:d:Q5112896|Christopher Monger]]''
|
| 1950-11-09
|
| ''[[:d:Q1401784|Ffynnon Taf]]''
|-
| style='text-align:right'| 2452
| ''[[:d:Q5112979|Christopher O'Brien]]''
|
| 1950-11-16
|
| ''[[:d:Q7020578|Newtown]]''
|-
| style='text-align:right'| 2453
| ''[[:d:Q5113133|Christopher Rice Mansel Talbot]]''
| [[File:Christopher Rice Mansel Talbot by Alfred Count D'Orsay in 1834.jpg|center|128px]]
| 1803-05-10
| 1890-01-17
| ''[[:d:Q7164590|Penrice Castle]]''
|-
| style='text-align:right'| 2454
| ''[[:d:Q5113189|Christopher Salmon]]''
| [[File:Christopher Salmon PCC.jpg|center|128px]]
| 1978-06-05
|
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 2455
| ''[[:d:Q5113212|Christopher Seldon]]''
|
| 1953-07-18
|
| ''[[:d:Q5572913|Glyncoch]]''
|-
| style='text-align:right'| 2456
| ''[[:d:Q5113432|Christopher Williams]]''
| [[File:Self Portrait (gcf02743).jpg|center|128px]]
| 1873-01-07
| 1934-07-19
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2457
| ''[[:d:Q5119067|Cian Ciaran]]''
| [[File:Cian Ciaran Summersonic 2008 crop&lighten.jpg|center|128px]]
| 1976-06-16
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2458
| ''[[:d:Q5119143|Ciaran Jenkins]]''
|
| 1984-05-03
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2459
| ''[[:d:Q5119144|Ciaran Joyce]]''
|
| 1987-09-17
|
| [[Wales]]
|-
| style='text-align:right'| 2460
| ''[[:d:Q5125191|Claire Evans]]''
|
| 1983-01-11
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 2461
| ''[[:d:Q5125320|Claire Summers]]''
| [[File:Claire Summers.jpg|center|128px]]
| 1974
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2462
| ''[[:d:Q5125351|Claire Williams]]''
|
| 1987-09-29
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2463
| ''[[:d:Q5126032|Clara Novello Davies]]''
| [[File:ClaraNovelloDavies.tiff|center|128px]]
| 1861-04-07
| 1943-02-07
| [[Cairdiff]]
|-
| style='text-align:right'| 2464
| ''[[:d:Q5126175|Clare Greenwood]]''
|
| 1958-10-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2465
| ''[[:d:Q5129068|Claude Warner]]''
|
| 1882-03-31
| 1965-12-29
| [[Cairdiff]]
|-
| style='text-align:right'| 2466
| ''[[:d:Q5131184|Clem Lewis]]''
|
| 1890-06-22
| 1944-10-27
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2467
| ''[[:d:Q5131308|Clement Davies]]''
| [[File:Clement Davies.jpg|center|128px]]
| 1884-02-19
| 1962-03-23
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 2468
| ''[[:d:Q5131317|Clement Edwards]]''
| [[File:Clem-Edwards-AS.jpg|center|128px]]
| 1869-06-07
| 1938-06-23
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 2469
| ''[[:d:Q5132540|Cliff Birch]]''
|
| 1928-09-01
| 1990
| [[Newport]]
|-
| style='text-align:right'| 2470
| ''[[:d:Q5132577|Cliff Curvis]]''
|
| 1927-11-19
| 2009-04-22
| [[Swansea]]
|-
| style='text-align:right'| 2471
| ''[[:d:Q5132650|Cliff Jones]]''
|
| 1914-03-12
| 1990-11-27
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 2472
| ''[[:d:Q5132743|Cliff Richards]]''
|
| 1901-03-28
| 1964-02-13
| ''[[:d:Q5638416|Hafodyrynys]]''
|-
| style='text-align:right'| 2473
| ''[[:d:Q5132760|Cliff Sear]]''
|
| 1936-09-22
| 2000-07-08
| ''[[:d:Q7321505|Rhostyllen]]''
|-
| style='text-align:right'| 2474
| ''[[:d:Q5132796|Cliff Williams]]''
|
| 1898-04-20
| 1930-05-28
| ''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 2475
| ''[[:d:Q5132853|Clifford Allen, 1st Baron Allen of Hurtwood]]''
|
| 1889-05-09
| 1939-03-03
| [[Newport]]
|-
| style='text-align:right'| 2476
| ''[[:d:Q5132938|Clifford Evans]]''
| [[File:Clifford Evans.png|center|128px]]
| 1912-02-17
| 1985-06-09
| ''[[:d:Q3404686|Senghenydd]]''
|-
| style='text-align:right'| 2477
| ''[[:d:Q5132939|Clifford Evans]]''
|
| 1913-07-14
| 1982-07
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 2478
| ''[[:d:Q5133076|Clifford Williams]]''
|
| 1939-05-27
| 2014-02-02
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 2479
| ''[[:d:Q5133077|Clifford Williams]]''
|
| 1926-12-30
| 2005-08-20
| [[Cairdiff]]
|-
| style='text-align:right'| 2480
| ''[[:d:Q5133081|Clifford Wright]]''
|
| 1922-07-04
| 2014-02-14
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 2481
| ''[[:d:Q5134124|Clinton Greyn]]''
|
| 1936-09-29<br/>1933-09-29
| 2019-03-19
| [[Swansea]]
|-
| style='text-align:right'| 2482
| ''[[:d:Q5134498|Clive Best]]''
|
| 1931-08-04
| 2013-04-17
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 2483
| ''[[:d:Q5134504|Clive Bowen]]''
|
| 1943
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2484
| ''[[:d:Q5134507|Clive Branson]]''
|
| 1951
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2485
| ''[[:d:Q5134542|Clive Davies]]''
|
| 1951-11-07
|
| ''[[:d:Q3072939|Pontrhydyfen]]''
|-
| style='text-align:right'| 2486
| ''[[:d:Q5134585|Clive Griffiths]]''
|
| 1955-01-22
| 2022
| [[Pontypridd]]
|-
| style='text-align:right'| 2487
| ''[[:d:Q5134586|Clive Griffiths]]''
|
| 1954-04-02
|
| [[Swansea]]
|-
| style='text-align:right'| 2488
| ''[[:d:Q5134598|Clive Hill]]''
|
| 1958-04-12
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2489
| ''[[:d:Q5134608|Clive Jenkins]]''
|
| 1926-05-02
| 1999-09-22
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2490
| ''[[:d:Q5134610|Clive Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2491
| ''[[:d:Q5134640|Clive Norling]]''
|
| 1950-04
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2492
| ''[[:d:Q5134670|Clive Shell]]''
|
| 1947-09-09
| 2012-01-06
| ''[[:d:Q3400823|Pîl]]''
|-
| style='text-align:right'| 2493
| ''[[:d:Q5144947|Colin Campbell, 7th Earl Cawdor]]''
|
| 1962-06-30
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2494
| ''[[:d:Q5144972|Colin Casemore]]''
|
| 1940-02-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2495
| ''[[:d:Q5145044|Colin Dixon]]''
|
| 1943-12-03
| 1993-06-21
| ''[[:d:Q5002508|Butetown]]''
|-
| style='text-align:right'| 2496
| ''[[:d:Q5145075|Colin Evans]]''
|
| 1936-11-20
| 1992-11-23
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 2497
| ''[[:d:Q5145089|Colin Fletcher]]''
|
| 1922-03-14
| 2007-06-12
| [[Cairdiff]]
|-
| style='text-align:right'| 2498
| ''[[:d:Q5145124|Colin Gale]]''
|
| 1932-08-31
| 2008-10-27
| [[Pontypridd]]
|-
| style='text-align:right'| 2499
| ''[[:d:Q5145156|Colin Green]]''
|
| 1942-02-10
|
| ''[[:d:Q4980803|Brymbo]]''
|-
| style='text-align:right'| 2500
| ''[[:d:Q5145170|Colin H. Williams]]''
|
| 1950
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2501
| ''[[:d:Q5145200|Colin Hillman]]''
|
| 1961-05-04
| 2009-07-02
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2502
| ''[[:d:Q5145239|Colin Jeavons]]''
|
| 1929-10-20
|
| [[Newport]]
|-
| style='text-align:right'| 2503
| ''[[:d:Q5145249|Colin Jones]]''
|
| 1959-03-21
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 2504
| ''[[:d:Q5145287|Colin Leys]]''
| [[File:ColinLeys-2016-SOAS.jpg|center|128px]]
| 1931-04-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2505
| ''[[:d:Q5145355|Colin McCormack]]''
|
| 1941-12-02
| 2004-06-19
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 2506
| ''[[:d:Q5145479|Colin Phipps]]''
|
| 1934-07-23
| 2009-01-10
| [[Swansea]]
|-
| style='text-align:right'| 2507
| ''[[:d:Q5145499|Colin Randell]]''
|
| 1952-12-12
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2508
| ''[[:d:Q5145585|Colin Standing]]''
|
| 1942
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2509
| ''[[:d:Q5157987|Con Murphy]]''
|
| 1908-09-03
| 1964-07-13
| ''[[:d:Q3244565|Aberfan]]''
|-
| style='text-align:right'| 2510
| ''[[:d:Q5167027|Cooke Davies]]''
|
| 1897-05-26
| 1970-12-29
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 2511
| ''[[:d:Q5173537|Cory Allen]]''
| [[File:Cory Allen at The Arms Park 2013-10-21 17-55.jpg|center|128px]]
| 1993-02-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2512
| ''[[:d:Q5180912|Craig Draper]]''
|
| 1982-12-04
|
| [[Swansea]]
|-
| style='text-align:right'| 2513
| ''[[:d:Q5180944|Craig Evans]]''
|
| 1971-11-15
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2514
| ''[[:d:Q5180983|Craig Gallivan]]''
|
| 1984-02-09
|
| [[Swansea]]
|-
| style='text-align:right'| 2515
| ''[[:d:Q5180995|Craig Goodwin]]''
|
| 1974-02-12
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2516
| ''[[:d:Q5181010|Craig Handley]]''
|
| 1977-07-06
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2517
| ''[[:d:Q5181044|Craig Hill]]''
|
| 1982-05-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2518
| ''[[:d:Q5181147|Craig Lawton]]''
|
| 1972-01-05
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 2519
| ''[[:d:Q5181341|Craig Price]]''
|
| 1989-06-22
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2520
| ''[[:d:Q5181370|Craig Richards]]''
|
| 1959-10-10
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2521
| ''[[:d:Q5181496|Craig Stiens]]''
|
| 1984-07-31
|
| [[Swansea]]
|-
| style='text-align:right'| 2522
| ''[[:d:Q5195826|Curtis McDonald]]''
|
| 1988-03-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2523
| ''[[:d:Q5196810|Cuthbert Taylor]]''
|
| 1909-12-11
| 1977-11-15
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2524
| ''[[:d:Q5200682|Cyril Davies]]''
|
| 1948-09-07
|
| [[Swansea]]
|-
| style='text-align:right'| 2525
| ''[[:d:Q5200745|Cyril Gwynn]]''
|
| 1897-01-19
| 1988
| [[Wales]]
|-
| style='text-align:right'| 2526
| ''[[:d:Q5200787|Cyril Lakin]]''
| [[File:Cyril Lakin.jpg|center|128px]]
| 1893-12-29
| 1948-06-23
| ''[[:d:Q13132002|Cadoxton]]''
|-
| style='text-align:right'| 2527
| ''[[:d:Q5200789|Cyril Lea]]''
| [[File:Cyril Lea (1978).jpg|center|128px]]
| 1934-08-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2528
| ''[[:d:Q5200865|Cyril Rowland]]''
|
| 1905-06-09
| 1971-06-30
| ''[[:d:Q2075495|Rhos-on-Sea]]''
|-
| style='text-align:right'| 2529
| ''[[:d:Q5200894|Cyril Tamplin]]''
|
| 1921-05-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2530
| ''[[:d:Q5200900|Cyril Trailor]]''
|
| 1919-05-15
| 1986-08-28
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2531
| ''[[:d:Q5208339|Daffyd Dyvyr]]''
|
| 1919-12-12
| 1991-11-19
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2532
| ''[[:d:Q5208377|Dafydd Carter]]''
|
| 1992-02-12
|
| [[Wales]]
|-
| style='text-align:right'| 2533
| ''[[:d:Q5208379|Dafydd Ddu o Hiraddug]]''
| [[File:Eglwys Corpus Christi, Tremeirchion Sir Ddinbych Church Denbighshire, North Wales 35.jpg|center|128px]]
| 14th century
| 1371
| ''[[:d:Q16068256|Cwm]]''
|-
| style='text-align:right'| 2534
| ''[[:d:Q5208381|Dafydd Hewitt]]''
|
| 1985-08-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2535
| ''[[:d:Q5208382|Dafydd Gorlech]]''
|
| 1410
| 1490
| ''[[:d:Q13125329|Abergorlech]]''
|-
| style='text-align:right'| 2536
| ''[[:d:Q5208383|Dafydd Ieuan]]''
|
| 1969-03-01
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2537
| ''[[:d:Q5208384|Dafydd Lockyer]]''
|
| 1985-06-05
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2538
| ''[[:d:Q5208385|Dafydd Nanmor]]''
|
| 1420
| 1485
| ''[[:d:Q3401919|Nantmor]]''
|-
| style='text-align:right'| 2539
| ''[[:d:Q5208977|Dai Bevan]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2540
| ''[[:d:Q5208983|Dai Davies]]''
|
| 1896-08-26
| 1976-07-16
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2541
| ''[[:d:Q5208985|Dai Davies]]''
|
| 1880
| 1944
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2542
| ''[[:d:Q5208986|Dai Davies]]''
|
| 1948-04-01
| 2021-02-10
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 2543
| ''[[:d:Q5208987|Dai Davies]]''
| [[File:David Maldwyn Davies 1950.jpg|center|128px]]
| 1925-05-02
| 2003-09-25
| [[Penygraig]]
|-
| style='text-align:right'| 2544
| ''[[:d:Q5208989|Dai Davies]]''
| [[File:David Davies c215f5bacb.jpg|center|128px]]
| 1959-11-26
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 2545
| ''[[:d:Q5208990|Dai Edwards]]''
|
| 1896-03-21
| 1960-08-24
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 2546
| ''[[:d:Q5208992|Dai Dower]]''
|
| 1933-06-20
| 2016-08-01
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 2547
| ''[[:d:Q5208993|Dai Evans]]''
|
| 1872
| 1912
| ''[[:d:Q6729228|Maenclochog]]''
|-
| style='text-align:right'| 2548
| ''[[:d:Q5208994|Dai Evans]]''
|
| 1902-01-28
| 1951
| ''[[:d:Q4666797|Abercanaid]]''
|-
| style='text-align:right'| 2549
| ''[[:d:Q5209000|Dai Francis]]''
|
| 1911-02-05
| 1981-03-30
| ''[[:d:Q7457421|Blaendulais]]''
|-
| style='text-align:right'| 2550
| ''[[:d:Q5209004|Dai Hiddlestone]]''
|
| 1890-06-14
| 1973-11-16
| ''[[:d:Q5714075|Hendy]]''
|-
| style='text-align:right'| 2551
| ''[[:d:Q5209010|Dai Jones]]''
|
| 1941-03-31
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2552
| ''[[:d:Q5209014|Dai Lawrence]]''
|
| 1947-01-18
| 2009-07-21
| [[Swansea]]
|-
| style='text-align:right'| 2553
| ''[[:d:Q5209015|Dai Lewis]]''
| [[File:Dai Lewis (Rygbi).jpg|center|128px]]
| 1866-12-04
| 1943-09-08
| ''[[:d:Q7281814|Radyr]]''
|-
| style='text-align:right'| 2554
| ''[[:d:Q5209023|Dai Nicholas]]''
|
| 1897-08-12
| 1982-04-07
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2555
| ''[[:d:Q5209025|Dai Parker]]''
| [[File:Dai Parker 1930.jpg|center|128px]]
| 1904-08-08
| 1965-06-16
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 2556
| ''[[:d:Q5209027|Dai Prosser]]''
|
| 1912-10-13
| 1973-05-06
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2557
| ''[[:d:Q5209028|Dai Rees]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2558
| ''[[:d:Q5209029|Dai Rees]]''
|
|
|
| ''[[:d:Q5277964|Dinas Cross]]''
|-
| style='text-align:right'| 2559
| ''[[:d:Q5209031|Dai Rees]]''
|
| 1964-09-23
|
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 2560
| ''[[:d:Q5209032|Dai Richards]]''
|
| 1906-10-31
| 1969-10-01
| ''[[:d:Q4666797|Abercanaid]]''
|-
| style='text-align:right'| 2561
| ''[[:d:Q5209035|Dai Royston Bevan]]''
|
| 1928-01-01
| 2008-04-12
| [[Pontypridd]]
|-
| style='text-align:right'| 2562
| ''[[:d:Q5209037|Dai Thomas]]''
|
| 1909-03-30
|
| [[Swansea]]
|-
| style='text-align:right'| 2563
| ''[[:d:Q5209039|Dai Thomas]]''
|
| 1879
| 1958
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 2564
| ''[[:d:Q5209040|Dai Thomas]]''
|
| 1975-09-26
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2565
| ''[[:d:Q5209043|Dai Ward]]''
|
| 1934-07-13
| 1996-01-12
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2566
| ''[[:d:Q5209044|Dai Westacott]]''
|
| 1882
| 1917-08-28
| ''[[:d:Q5595745|Grangetown]]''
|-
| style='text-align:right'| 2567
| ''[[:d:Q5210441|Dale Ford]]''
|
| 1991-12-16
|
| [[Swansea]]
|-
| style='text-align:right'| 2568
| ''[[:d:Q5210694|Dale Williams]]''
|
| 1987-02-25
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 2569
| ''[[:d:Q5211687|Dalton Grant]]''
| [[File:Dalton Grant.jpg|center|128px]]
| 1990-04-21
|
| [[Newport]]
|-
| style='text-align:right'| 2570
| ''[[:d:Q5212277|Damian Keyes]]''
|
| 1976-08-05
|
| [[Swansea]]
|-
| style='text-align:right'| 2571
| ''[[:d:Q5212328|Damian Shirazi]]''
|
| 1983-03-23
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2572
| ''[[:d:Q5212452|Damien Hudd]]''
|
| 1981-02-05
|
| [[Wales]]
|-
| style='text-align:right'| 2573
| ''[[:d:Q5212879|Damon Searle]]''
| [[File:Damon Searle.jpg|center|128px]]
| 1971-10-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2574
| ''[[:d:Q5213131|Dan Beddoe]]''
| [[File:Dan Beddoe facing left in 1918 (cropped).jpg|center|128px]]
| 1863-03-16
| 1937-12-26
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2575
| ''[[:d:Q5213252|Dan Cherry]]''
|
| 1980-02-07
|
| [[Newport]]
|-
| style='text-align:right'| 2576
| ''[[:d:Q5213482|Dan Fish]]''
| [[File:Dan Fish.jpg|center|128px]]
| 1990-12-19
|
| ''[[:d:Q1152204|South Glamorgan]]''
|-
| style='text-align:right'| 2577
| ''[[:d:Q5213554|Dan George]]''
|
| 1986-08-10
|
| [[Wales]]
|-
| style='text-align:right'| 2578
| ''[[:d:Q5213612|Dan Griffiths]]''
|
| 1857-06-20
| 1936-10-29
| ''[[:d:Q5197243|Cwmduad]]''
|-
| style='text-align:right'| 2579
| ''[[:d:Q5213878|Dan Lewis]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2580
| ''[[:d:Q5214493|Dan Thomas]]''
| [[File:Dan-thomas.jpg|center|128px]]
| 1993-10-11
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2581
| ''[[:d:Q5216926|Daniel Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2582
| ''[[:d:Q5217090|Daniel Evans]]''
| [[File:Daniel Ddu.JPG|center|128px]]
| 1792
| 1846-03-28<br/>1846
| ''[[:d:Q6661375|Llanfihangel Ystrad]]''
|-
| style='text-align:right'| 2583
| ''[[:d:Q5217091|Daniel Evans]]''
|
| 1774-01-16
| 1835-03-03
| ''[[:d:Q5348103|Eglwyswrw]]''
|-
| style='text-align:right'| 2584
| ''[[:d:Q5217351|Daniel Griffiths]]''
|
| 1979-02-01
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2585
| ''[[:d:Q5217448|Daniel Hawksford]]''
|
| 1980-04-10
|
| [[Newport]]
|-
| style='text-align:right'| 2586
| ''[[:d:Q5217665|Daniel James]]''
|
| 1848-01-23
| 1920-03-16
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 2587
| ''[[:d:Q5217713|Daniel Jones]]''
|
| 1875-05-31
| 1959-01-01
| ''[[:d:Q7675879|Taibach]]''
|-
| style='text-align:right'| 2588
| ''[[:d:Q5217957|Daniel Lloyd]]''
| [[File:Dan Lloyd a Mr Pinc.jpg|center|128px]]
| 1982-07-26
|
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 2589
| ''[[:d:Q5218257|Daniel Newton]]''
|
| 1989-12-30
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2590
| ''[[:d:Q5218391|Daniel Pascoe]]''
|
| 1900-07-07
| 1971-05-19
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 2591
| ''[[:d:Q5218493|Daniel Protheroe]]''
| [[File:Daniel Protheroe.png|center|128px]]
| 1866-11-05
| 1934-02-25
| [[Ystradgynlais]]
|-
| style='text-align:right'| 2592
| ''[[:d:Q5218767|Daniel Silvan Evans]]''
| [[File:Portrait of Daniel Silvan Evans (4674117).jpg|center|128px]]
| 1818-01-11
| 1903-04-12
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 2593
| ''[[:d:Q5219099|Daniel Williams]]''
| [[File:Daniel Williams (1643-1716).jpg|center|128px]]
| 1643
| 1716-01-26
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2594
| ''[[:d:Q5219402|Danielle Lineker]]''
| [[File:DanielleLineker2010.jpg|center|128px]]
| 1979-06-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2595
| ''[[:d:Q5220206|Danny Canning]]''
|
| 1926-02-21
| 2014-07-11
| ''[[:d:Q7164562|Penrhiw-ceibr]]''
|-
| style='text-align:right'| 2596
| ''[[:d:Q5220344|Danny Ferguson]]''
|
| 1903-01-25
| 1971
| [[Flintshire]]
|-
| style='text-align:right'| 2597
| ''[[:d:Q5220422|Danny Harris]]''
|
| 1937-05-27
|
| [[Penygraig]]
|-
| style='text-align:right'| 2598
| ''[[:d:Q5220457|Danny Hurcombe]]''
|
| 1895
| 1965-03-19
| [[Wales]]
|-
| style='text-align:right'| 2599
| ''[[:d:Q5220672|Danny Newall]]''
|
| 1991-11-01
| 1997-03-06
| [[Newport]]
|-
| style='text-align:right'| 2600
| ''[[:d:Q5220721|Danny Parslow]]''
| [[File:Danny Parslow 2017-08-28 1.jpg|center|128px]]
| 1985-09-11
|
| ''[[:d:Q3401108|Hengoed]]''
|-
| style='text-align:right'| 2601
| ''[[:d:Q5220880|Danny Thomas]]''
|
| 1975-05-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2602
| ''[[:d:Q5220937|Danny Williams]]''
|
| 1979-07-12
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2603
| ''[[:d:Q5220946|Danny Wilson]]''
|
| 1955
|
| [[Wales]]
|-
| style='text-align:right'| 2604
| ''[[:d:Q5222071|Daral Pugh]]''
|
| 1961-06-05
|
| ''[[:d:Q5190499|Crynant]]''
|-
| style='text-align:right'| 2605
| ''[[:d:Q5222678|Dari Taylor]]''
|
| 1944-12-13
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 2606
| ''[[:d:Q5224748|Darren Allinson]]''
| [[File:Darren Allinson 2 crop.jpg|center|128px]]
| 1987-11-13
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2607
| ''[[:d:Q5224868|Darren Daniel]]''
|
| 1986-09-13
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 2608
| ''[[:d:Q5224871|Darren Davies]]''
|
| 1978-08-13
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2609
| ''[[:d:Q5224901|Darren Edwards]]''
|
| 1974-03-25
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2610
| ''[[:d:Q5224966|Darren Heyes]]''
|
| 1967-01-11
|
| [[Swansea]]
|-
| style='text-align:right'| 2611
| ''[[:d:Q5224988|Darren Jeffries]]''
|
| 1982-03-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2612
| ''[[:d:Q5224996|Darren Jones]]''
| [[File:Darrenjones.JPG|center|128px]]
| 1983-08-26
|
| [[Newport]]
|-
| style='text-align:right'| 2613
| ''[[:d:Q5225131|Darran Rowbotham]]''
|
| 1966-10-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2614
| ''[[:d:Q5225192|Darren Thomas]]''
|
| 1972-01-25
|
| [[Swansea]]
|-
| style='text-align:right'| 2615
| ''[[:d:Q5225199|Darren Tinson]]''
|
| 1969-11-15
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 2616
| ''[[:d:Q5225221|Darren Waters]]''
|
| 1985-08-14
|
| ''[[:d:Q3404708|Beddau]]''
|-
| style='text-align:right'| 2617
| ''[[:d:Q5225252|Darren Wynne]]''
|
| 1970-10-12
|
| ''[[:d:Q3405926|Deeside]]''
|-
| style='text-align:right'| 2618
| ''[[:d:Q5228468|Dave Cameron]]''
|
| 1975-08-24
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2619
| ''[[:d:Q5228567|Dave Colclough]]''
| [[File:Dave Colclough.jpg|center|128px]]
| 1964-03-04
| 2016-10-18
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2620
| ''[[:d:Q5228883|Dave Gwyther]]''
|
| 1948-12-06
|
| [[Swansea]]
|-
| style='text-align:right'| 2621
| ''[[:d:Q5228986|Dave Hollins]]''
|
| 1938-02-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2622
| ''[[:d:Q5229055|Dave Jones]]''
|
| 1932-01-07
| 2022
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2623
| ''[[:d:Q5229167|Dave Lee]]''
|
| 1956-11-28
|
| ''[[:d:Q7228311|Pontllanfraith]]''
|-
| style='text-align:right'| 2624
| ''[[:d:Q5229464|Dave Newsham]]''
| [[File:Dave newsham silverstone2012.JPG|center|128px]]
| 1967-07-07
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2625
| ''[[:d:Q5230110|Dave Williams]]''
|
| 1942-03-01
| 2015-02-23
| [[Newport]]
|-
| style='text-align:right'| 2626
| ''[[:d:Q5230426|David Davies]]''
|
| 1935-10-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2627
| ''[[:d:Q5230584|David Abruzzese]]''
|
| 1969-10-08
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2628
| ''[[:d:Q5230801|David Anthony]]''
| [[File:David Anthony and William Groulx at the 2012 Summer Paralympics.jpg|center|128px]]
| 1989-12-18
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2629
| ''[[:d:Q5231301|David Benjamin Rees]]''
| [[File:Dr D.Ben Rees.jpg|center|128px]]
| 1937
|
| ''[[:d:Q922270|Llanddewi Brefi]]''
|-
| style='text-align:right'| 2630
| ''[[:d:Q5231397|David Beynon]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2631
| ''[[:d:Q5231425|David Bishop]]''
|
| 1983-09-22
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 2632
| ''[[:d:Q5231862|David Brynmor Jones]]''
| [[File:1906 Sir David Brynmor Jones MP.jpg|center|128px]]
| 1851<br/>1852
| 1921-08-06<br/>1921
| [[Lunnon]]<br/>[[Swansea]]
|-
| style='text-align:right'| 2633
| ''[[:d:Q5231897|David Burcher]]''
|
| 1972-08-18
|
| [[Newport]]
|-
| style='text-align:right'| 2634
| ''[[:d:Q5232309|David Charles]]''
| [[File:Portrait of David Charles (4674418).jpg|center|128px]]
| 1762-10-11
| 1834
| ''[[:d:Q10987143|Llanfihangel Abercywyn]]''
|-
| style='text-align:right'| 2635
| ''[[:d:Q5232316|David Charles Davies]]''
| [[File:Revd David Charles Davies (1826-91) (1864) NLW3362033.jpg|center|128px]]
| 1826-05-11
| 1891-09-26
| [[Aberystwyth]]
|-
| style='text-align:right'| 2636
| ''[[:d:Q5232685|David Crouch]]''
|
| 1953-10-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2637
| ''[[:d:Q5232755|David D'Auria]]''
|
| 1970-03-26
|
| [[Swansea]]
|-
| style='text-align:right'| 2638
| ''[[:d:Q5232811|David Daniel]]''
| [[File:David Daniel (rygbi).jpg|center|128px]]
| 1871
| 1948-04-30
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2639
| ''[[:d:Q5232812|David Daniel Davis]]''
|
| 1777-06-15
| 1841-12-04
| ''[[:d:Q6661270|Llandyfaelog]]''
|-
| style='text-align:right'| 2640
| ''[[:d:Q5232848|David Davies]]''
| [[File:Trydedd gân David Davies, (Dai'r Cantwr) - yn gosod allan ei alar dwys a'i hiraeth am ei wlad enedigol, yn nghyd â rhybuddion i bawb ochelyd pechod - a dderbyniwyd mewn llythyr at gyfaill (IA wg35-2-181).pdf|center|128px]]
| 1812
| 1874-08-10
| ''[[:d:Q1027137|Llancarfan]]''
|-
| style='text-align:right'| 2641
| ''[[:d:Q5232850|David Davies]]''
|
| 1742
| 1819-02-06
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 2642
| ''[[:d:Q5232851|David Davies]]''
|
| 1870-12-20
| 1958-04-25
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 2643
| ''[[:d:Q5232854|David Davies]]''
|
| 1879
| 1956-09-13
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 2644
| ''[[:d:Q5232856|David Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2645
| ''[[:d:Q5232857|David Davies]]''
| [[File:David Davies industrialist.jpg|center|128px]]
| 1818-12-18
| 1890-07-20
| ''[[:d:Q6661212|Llandinam]]''
|-
| style='text-align:right'| 2646
| ''[[:d:Q5232858|David Davies]]''
|
| 1905
| 1992-02-22
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 2647
| ''[[:d:Q5232859|David Davies]]''
|
| 1915
|
| [[Wales]]
|-
| style='text-align:right'| 2648
| ''[[:d:Q5232862|David Davis]]''
| [[File:Portrait of Revd. David Davis (4673253) (cropped).jpg|center|128px]]
| 1745-02-14
| 1827
| ''[[:d:Q3401686|Llangybi]]''
|-
| style='text-align:right'| 2649
| ''[[:d:Q5232874|David Dawson]]''
|
| 1960
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 2650
| ''[[:d:Q5233287|David Edwards]]''
|
| 1947
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2651
| ''[[:d:Q5233299|David R Edwards]]''
| [[File:David R Edwards, Datblygu (3890950400).jpg|center|128px]]
| 1964-09-03
| 2021-06-20
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 2652
| ''[[:d:Q5233354|David Ellis]]''
|
| 1736-08-31
| 1795
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 2653
| ''[[:d:Q5233447|David Evans]]''
|
| 1830
| 1910-03-01
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 2654
| ''[[:d:Q5233450|David Evans]]''
|
| 1705
| 1788
| ''[[:d:Q6661589|Llangynyw]]''
|-
| style='text-align:right'| 2655
| ''[[:d:Q5233461|David Evans]]''
|
| 1874-02-06
| 1948-05-17
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 2656
| ''[[:d:Q5233468|David Evans]]''
|
| 1988-08-19
|
| [[Swansea]]
|-
| style='text-align:right'| 2657
| ''[[:d:Q5233602|David Felgate]]''
|
| 1960-03-04
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 2658
| ''[[:d:Q5233851|David Freeman]]''
|
| 1928-02-25
| 2015-02-23
| [[Cairdiff]]
|-
| style='text-align:right'| 2659
| ''[[:d:Q5233893|David Fulker]]''
| [[File:David Fulker, geneticist headshot.jpg|center|128px]]
| 1937-03-08
| 1998-07-09
| [[Wales]]
|-
| style='text-align:right'| 2660
| ''[[:d:Q5233969|David Gadsby]]''
|
| 1947-03-26
| 2019-03-09
| [[Cairdiff]]
|-
| style='text-align:right'| 2661
| ''[[:d:Q5233996|David Galloway]]''
| [[File:David Galloway2.1.png|center|128px]]
| 1884
| 1913
| [[Pontypridd]]
|-
| style='text-align:right'| 2662
| ''[[:d:Q5234131|David Giles]]''
|
| 1956-09-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2663
| ''[[:d:Q5234177|David Glyndwr Tudor Williams]]''
|
| 1930-10-22
| 2009-09-06
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2664
| ''[[:d:Q5234352|David Green]]''
|
| 1939-11-10
| 2016-03-19
| ''[[:d:Q3400567|Llanengan]]''
|-
| style='text-align:right'| 2665
| ''[[:d:Q5234398|David Grenfell]]''
| [[File:David Grenfell.jpg|center|128px]]
| 1881-06-16
| 1968-11-21
| ''[[:d:Q7165418|Penyrheol]]''
|-
| style='text-align:right'| 2666
| ''[[:d:Q5234415|David Griffiths]]''
| [[File:David Griffiths.png|center|128px]]
| 1792-12-20
| 1863-03-21
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 2667
| ''[[:d:Q5234488|David Gwilym Morris Roberts]]''
|
| 1925-07
| 2020-07-31
| ''[[:d:Q1024935|Harlech]]''
|-
| style='text-align:right'| 2668
| ''[[:d:Q5234490|Gwyn Williams]]''
|
| 1904<br/>1904-08-24
| 1990<br/>1990-12-24
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2669
| ''[[:d:Q5234492|David Gwynn]]''
|
| 1861-12-28
| 1910-03-08
| [[Swansea]]
|-
| style='text-align:right'| 2670
| ''[[:d:Q5234493|David Gwynne]]''
|
| 1904-12-08
| 1934-12-11
| [[Swansea]]
|-
| style='text-align:right'| 2671
| ''[[:d:Q5234669|David Hamer]]''
|
| 1866<br/>1869-02-01
|
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 2672
| ''[[:d:Q5234749|David Harris]]''
|
| 1879-02-15
| 1958
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 2673
| ''[[:d:Q5234750|David Harris Davies]]''
|
| 1877-10-27
| 1944-09-30
| ''[[:d:Q16248422|Tonna]]''
|-
| style='text-align:right'| 2674
| ''[[:d:Q5234759|David Harrison]]''
|
| 1981-07-30
|
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 2675
| ''[[:d:Q5235221|David Hughes]]''
|
| 1785
| 1850-04-11
| ''[[:d:Q15963888|Trefilan]]''
|-
| style='text-align:right'| 2676
| ''[[:d:Q5235226|David Hughes]]''
|
| 1943-04-27
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 2677
| ''[[:d:Q5235229|David Hughes]]''
|
| 1978-02-01
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2678
| ''[[:d:Q5235233|David Hughes Parry]]''
|
| 1893-01-03
| 1973-01-08
| ''[[:d:Q3398834|Llanaelhaearn]]''
|-
| style='text-align:right'| 2679
| ''[[:d:Q5235561|David James]]''
| [[File:David James, rugby player.JPG|center|128px]]
| 1866
| 1929
| [[Swansea]]
|-
| style='text-align:right'| 2680
| ''[[:d:Q5235562|David James]]''
|
| 1906-10-07
| 1981
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 2681
| ''[[:d:Q5235563|David James]]''
|
| 1985-09-01
|
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 2682
| ''[[:d:Q5235566|David James Davies]]''
|
| 1893-06-02
| 1956-10-11
| ''[[:d:Q5043238|Carmel]]''
|-
| style='text-align:right'| 2683
| ''[[:d:Q5235575|David James Jones]]''
|
| 1886-12-22
| 1947-07-23
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 2684
| ''[[:d:Q5235613|David Jenkins]]''
| [[File:JudgeDavidJenkins.jpg|center|128px]]
| 1582
| 1663-12-06
| ''[[:d:Q7162500|Pendoylan]]''
|-
| style='text-align:right'| 2685
| ''[[:d:Q5235615|David Jenkins]]''
| [[File:Professor David Jenkins (1848–1915) (gcf02646).jpg|center|128px]]
| 1848-12-30
| 1915-12-10
| ''[[:d:Q7837433|Trecastle]]''
|-
| style='text-align:right'| 2686
| ''[[:d:Q5235616|David Jenkins]]''
|
| 1912-05-29
| 2002-03-06
| ''[[:d:Q3400833|Clydach Vale]]''
|-
| style='text-align:right'| 2687
| ''[[:d:Q5235621|David Jenkins]]''
|
| 1914-02-23
| 1979
| [[Wales]]
|-
| style='text-align:right'| 2688
| ''[[:d:Q5235622|David Jenkins]]''
|
| 1904-04-12
| 1951-08-13
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 2689
| ''[[:d:Q5235651|David John]]''
| [[File:Dai John, Salford Rugby League player.png|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 2690
| ''[[:d:Q5235657|David John Bowen]]''
| [[File:Dai Bowen 2013-10-04 23-18.jpg|center|128px]]
| 1891-07-30
| 1912-04-15
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 2691
| ''[[:d:Q5235664|David John Hayward]]''
|
| 1934-03-01
| 2003-11-12
| ''[[:d:Q3404679|Crumlin]]''
|-
| style='text-align:right'| 2692
| ''[[:d:Q5235681|David John Thomas]]''
|
| 1879-03-15
| 1925-10-19
| ''[[:d:Q5315782|Dyfnant]]''
|-
| style='text-align:right'| 2693
| ''[[:d:Q5235729|David Jones]]''
|
| 1765
| 1816
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 2694
| ''[[:d:Q5235732|David Jones]]''
|
| 1949-07-05
| 1995
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 2695
| ''[[:d:Q5235741|David Jones]]''
| [[File:David Jones (1793-1873).jpg|center|128px]]
| 1793-03-08
| 1873-03-29
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 2696
| ''[[:d:Q5235746|David Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2697
| ''[[:d:Q5235758|David Joseph Miller]]''
|
| 1985-03-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2698
| ''[[:d:Q5236556|David Lewis]]''
|
| 1760
| 1850-07-28
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 2699
| ''[[:d:Q5236563|David Lewis]]''
|
| 1520
| 1584-04-27
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2700
| ''[[:d:Q5236567|David Lewis]]''
|
| 1682
| 1760-04
| ''[[:d:Q6661158|Llanddewi Velfrey]]''
|-
| style='text-align:right'| 2701
| ''[[:d:Q5236568|David Lewis]]''
|
| 1814
| 1895-01-23
| [[Ceredigion]]
|-
| style='text-align:right'| 2702
| ''[[:d:Q5236569|David Lewis]]''
|
| No/unknown value
|
| [[Wales]]
|-
| style='text-align:right'| 2703
| ''[[:d:Q5236575|David Ley]]''
|
| 1947
|
| [[Swansea]]
|-
| style='text-align:right'| 2704
| ''[[:d:Q5236683|David Llewellin]]''
| [[File:Davidllewellin.jpg|center|128px]]
| 1960-05-03
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 2705
| ''[[:d:Q5236686|David Llewellyn]]''
|
| 1916-01-17
| 1992-08-09
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2706
| ''[[:d:Q5236691|David Llewellyn]]''
|
| 1970-09-29
|
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 2707
| ''[[:d:Q5236695|David Lloyd]]''
| [[File:Dai Lloyd AM (28170816265).jpg|center|128px]]
| 1956-12-02
|
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 2708
| ''[[:d:Q5236703|David Lloyd]]''
|
| 1656
| 1731-04-06<br/>1731-02-06
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 2709
| ''[[:d:Q5236710|David Lloyd]]''
| [[File:Y Caneuon Cynnar (1940-41), album cover.jpg|center|128px]]
| 1912-04-06
| 1969-03-27
| ''[[:d:Q7838021|Trelogan]]''
|-
| style='text-align:right'| 2710
| ''[[:d:Q5236811|David Luckes]]''
|
| 1968-04-24
|
| [[Newport]]
|-
| style='text-align:right'| 2711
| ''[[:d:Q5237047|David Maidment]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2712
| ''[[:d:Q5237142|David Marquand]]''
|
| 1934-09-20
| 2024-04-23
| [[Cairdiff]]
|-
| style='text-align:right'| 2713
| ''[[:d:Q5237240|David Maurice]]''
|
| 1626
| 1702
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 2714
| ''[[:d:Q5237447|David McNaught]]''
| [[File:David McNaught.jpg|center|128px]]
| 1839-05-28
| 1922-08-10
| ''[[:d:Q7164556|Penpont]]''
|-
| style='text-align:right'| 2715
| ''[[:d:Q5237493|David Melding]]''
| [[File:David Melding AM.jpg|center|128px]]
| 1962-08-28
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2716
| ''[[:d:Q5237715|David Morgan]]''
| [[File:David Morgan, Welsh rugby.jpg|center|128px]]
| 1872-07-14
| 1933-09-13
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2717
| ''[[:d:Q5237721|David Morgan Evans]]''
|
| 1911-04-21
| 1941-05-24
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 2718
| ''[[:d:Q5237724|David Morgan Jenkins]]''
|
| 1901-05-22
| 1968-04-22
| ''[[:d:Q3400823|Pîl]]''
|-
| style='text-align:right'| 2719
| ''[[:d:Q5237740|David Morrell]]''
|
| 1971-10-08
|
| [[Newport]]
|-
| style='text-align:right'| 2720
| ''[[:d:Q5237764|David Moses]]''
|
| 1925
| 1999
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2721
| ''[[:d:Q5238012|David Nicholl]]''
| [[File:David Nicholl (rygbi).jpg|center|128px]]
| 1871-06-14
| 1918-03-11
| ''[[:d:Q6661278|Llanegwad]]''
|-
| style='text-align:right'| 2722
| ''[[:d:Q5238274|David Owen]]''
|
| 1796
| 1866
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 2723
| ''[[:d:Q5238279|David Owen]]''
|
| 1712-01-27
| 1741-08
| ''[[:d:Q20602435|Ynyscynhaearn]]''
|-
| style='text-align:right'| 2724
| ''[[:d:Q5238403|David Parry-Jones]]''
|
| 1933-09-25
| 2017-04-10
| [[Pontypridd]]
|-
| style='text-align:right'| 2725
| ''[[:d:Q5238411|David Parry]]''
|
| 1682
| 1714-12
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 2726
| ''[[:d:Q5238466|David Pearce]]''
|
| 1959-05-08
| 2000-05-20
| [[Newport]]
|-
| style='text-align:right'| 2727
| ''[[:d:Q5238549|David Petersen]]''
|
| 1944
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2728
| ''[[:d:Q5238554|David Phelps]]''
|
| 1977-04-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2729
| ''[[:d:Q5238564|David Phillips Jones]]''
|
| 1881-12-10
| 1936-01-09
| ''[[:d:Q7228398|Pontymoile]]''
|-
| style='text-align:right'| 2730
| ''[[:d:Q5238568|David Pickering]]''
|
| 1960-12-16
|
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2731
| ''[[:d:Q5238682|David Powell]]''
|
| 1944-10-15
| 2023-12-04
| ''[[:d:Q3399645|Dolgarrog]]''
|-
| style='text-align:right'| 2732
| ''[[:d:Q5238710|David Price]]''
|
| 1762
| 1835-12-16
| ''[[:d:Q3404562|Merthyr Cynog]]''
|-
| style='text-align:right'| 2733
| ''[[:d:Q5238724|David Probert]]''
| [[File:David Probert 2009.jpg|center|128px]]
| 1988
|
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 2734
| ''[[:d:Q5238746|David Pugh]]''
|
| 1806
| 1890-07-12
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 2735
| ''[[:d:Q5238956|David Rees-Williams, 1st Baron Ogmore]]''
| [[File:Lord Ogmore.jpg|center|128px]]
| 1903-11-22
| 1976-08-30
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2736
| ''[[:d:Q5238958|David Rees]]''
| [[File:David Rees.jpg|center|128px]]
| 1801-11-14
| 1869-03-31
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 2737
| ''[[:d:Q5239033|David Richards]]''
| [[File:David Richards (Dafydd Ionawr, 1751-1827) (print) NLW3362443 (cropped).jpg|center|128px]]
| 1751-01-22
| 1827-05-12
| ''[[:d:Q7830339|Tywyn]]''
|-
| style='text-align:right'| 2738
| ''[[:d:Q5239120|David Roberts]]''
| [[File:David Roberts (swimmer) 2008.jpg|center|128px]]
| 1980-05-25
|
| ''[[:d:Q3406126|Llanilltud Faerdref]]''
|-
| style='text-align:right'| 2739
| ''[[:d:Q5239157|David Rocyn-Jones]]''
|
| 1862-11-16
| 1953-04-30
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 2740
| ''[[:d:Q5239330|David Ryder Prangley]]''
| [[File:David-ryder-prangley.jpg|center|128px]]
|
|
| ''[[:d:Q3403308|Dinas Powys]]''
|-
| style='text-align:right'| 2741
| ''[[:d:Q5239456|David Samwell]]''
| [[File:David samwell.jpg|center|128px]]
| 1751-10-15
| 1798-11-23
| [[Wales]]
|-
| style='text-align:right'| 2742
| ''[[:d:Q5239892|David Smith]]''
|
| 1930-05-21
| 2018-06-29
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2743
| ''[[:d:Q5240329|David Thaxton]]''
|
| 1982-05-12
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2744
| ''[[:d:Q5240335|David Thomas]]''
| [[File:Photolithograph of Archdeacon D R Thomas, 1897..jpeg|center|128px]]
| 1833
| 1916-10-11
| ''[[:d:Q6661359|Llanfechain]]''
|-
| style='text-align:right'| 2745
| ''[[:d:Q5240339|David Thomas]]''
|
| 1892-09-16<br/>1892
| 1954-06-20
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2746
| ''[[:d:Q5240340|David Thomas]]''
| [[File:Dewi Hefin.jpg|center|128px]]
| 1828-06-04
| 1909-03-09
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 2747
| ''[[:d:Q5240342|David Thomas]]''
|
| 1955-01-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2748
| ''[[:d:Q5240346|David Thomas]]''
| [[File:Portrait of The Editor of 'The Homilist' (4672059).jpg|center|128px]]
| 1813
| 1894-12-30
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 2749
| ''[[:d:Q5240350|David Thomas]]''
|
| 1881-04-15
| 1928-05-13
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 2750
| ''[[:d:Q5240352|David Thomas]]''
| [[File:Industrialist David Thomas.png|center|128px]]
| 1794-11-03
| 1882
| ''[[:d:Q5016593|Llangatwg]]''
|-
| style='text-align:right'| 2751
| ''[[:d:Q5240355|David Thomas]]''
|
| 1829-10-26
| 1905-12-27
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 2752
| ''[[:d:Q5240358|David Thomas]]''
|
| No/unknown value
|
| [[Wales]]
|-
| style='text-align:right'| 2753
| ''[[:d:Q5240743|David W. Spencer]]''
|
| 1837
| 1920
| ''[[:d:Q3400328|St Athan]]''
|-
| style='text-align:right'| 2754
| ''[[:d:Q5240883|David Watts]]''
|
| 1886-03-14
| 1916-07-14
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2755
| ''[[:d:Q5240884|David Watts Morgan]]''
|
| 1867-12-18
| 1933-02-23
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 2756
| ''[[:d:Q5241114|David William Evans]]''
|
| 1866-11-04
| 1926-03-17
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 2757
| ''[[:d:Q5241124|David William Thomas]]''
|
| 1876-08-12
| 1961-08-01
| [[Cairdiff]]
|-
| style='text-align:right'| 2758
| ''[[:d:Q5241128|David Williams]]''
|
| 1709
| 1784-04-05
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2759
| ''[[:d:Q5241134|David Williams]]''
| [[File:David-Williams-Castell-Deudraeth.jpg|center|128px]]
| 1799-06-30<br/>1800-06-30
| 1869-12-15<br/>1869-06-16
| ''[[:d:Q3404510|Llangian]]''
|-
| style='text-align:right'| 2760
| ''[[:d:Q5241135|David Williams]]''
|
| 1955-03-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2761
| ''[[:d:Q5241137|David Williams]]''
|
| 1865-09-08
| 1941-01-22
| [[Swansea]]
|-
| style='text-align:right'| 2762
| ''[[:d:Q5241141|David Williams]]''
|
| 1926-06-08
| 2003-09-26
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2763
| ''[[:d:Q5241167|David Willicombe]]''
|
|
| 2023
| [[Wales]]
|-
| style='text-align:right'| 2764
| ''[[:d:Q5241336|David Wynne]]''
|
| 1900-06-02
| 1983-03-23
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 2765
| ''[[:d:Q5242467|Dawn McCafferty]]''
| [[File:Air Marshall Julian Young with Dawn McCafferty and Carol Vorderman (McCafferty cropped).jpg|center|128px]]
| 1964-04-18
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 2766
| ''[[:d:Q5247441|Gareth Williams]]''
|
| 1978-09-26
| 2010-08-23
| ''[[:d:Q3400948|Valley]]''
|-
| style='text-align:right'| 2767
| ''[[:d:Q5249315|Declan Affley]]''
|
| 1939-09-08
| 1985-06-27
| [[Cairdiff]]
|-
| style='text-align:right'| 2768
| ''[[:d:Q5249348|Declan John]]''
| [[File:Declan John 1.png|center|128px]]
| 1995-06-30
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2769
| ''[[:d:Q5249703|Decuman]]''
| [[File:Killag Church SE 2010 09 27.jpg|center|128px]]
| 7th century
| 706
| ''[[:d:Q7321488|Rhoscrowther]]''
|-
| style='text-align:right'| 2770
| ''[[:d:Q5249730|Deddie Davies]]''
|
| 1938-03-02
| 2016-12-21
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 2771
| ''[[:d:Q5252401|Deian Hopkin]]''
|
| 1944-03-01
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2772
| ''[[:d:Q5252782|Deke Leonard]]''
| [[File:Leonard 2015-09-12.JPG|center|128px]]
| 1944-12-18
| 2017-01-31
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2773
| ''[[:d:Q5254281|Delme Bryn-Jones]]''
|
| 1934-03-29
| 2001-05-25
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 2774
| ''[[:d:Q5254967|Delwyn Williams]]''
|
| 1938-11-01
| 2024-08-22<br/>2024-08-21
| ''[[:d:Q5468045|Forden]]''
|-
| style='text-align:right'| 2775
| ''[[:d:Q5254977|Delyth Evans]]''
| [[File:Delyth Evans.png|center|128px]]
| 1958-03-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2776
| ''[[:d:Q5255333|Demi Holborn]]''
|
| 1992-05-27
|
| [[Wales]]
|-
| style='text-align:right'| 2777
| ''[[:d:Q5257247|Denis Galloway]]''
|
| 1878-03-05
| 1957-05-07
| [[Cairdiff]]
|-
| style='text-align:right'| 2778
| ''[[:d:Q5257297|Denis John Boocker]]''
|
| 1922-01-04
| 1987-06-08
| [[Pontypridd]]
|-
| style='text-align:right'| 2779
| ''[[:d:Q5257677|Denise Gyngell]]''
|
| 1961-08-30
|
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 2780
| ''[[:d:Q5257685|Denise Idris Jones]]''
| [[File:Deniseidrisjones.jpg|center|128px]]
| 1950-12-07
| 2020-07-24
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 2781
| ''[[:d:Q5258121|Dennis A'Court]]''
|
| 1937-07-27
| 2021-05-23
| ''[[:d:Q6770972|Markham]]''
|-
| style='text-align:right'| 2782
| ''[[:d:Q5258163|Dennis Avoth]]''
|
| 1947-10-05
| 2023-12-20
| [[Cairdiff]]
|-
| style='text-align:right'| 2783
| ''[[:d:Q5258234|Dennis Brown]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2784
| ''[[:d:Q5258237|Dennis Burgess]]''
|
| 1926-02-18
| 1980-11-03
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2785
| ''[[:d:Q5258320|Dennis Curling]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2786
| ''[[:d:Q5258496|Dennis Hawkins]]''
|
| 1947-10-22
|
| [[Swansea]]
|-
| style='text-align:right'| 2787
| ''[[:d:Q5258538|Dennis Hughes]]''
|
| 1941-07-03
|
| ''[[:d:Q378738|Argoed]]''
|-
| style='text-align:right'| 2788
| ''[[:d:Q5258574|Dennis John]]''
|
| 1935-01-27
| 2013-04-12
| [[Swansea]]
|-
| style='text-align:right'| 2789
| ''[[:d:Q5258650|Dennis Lewis]]''
|
| 1925-04-21
| 1996-11
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 2790
| ''[[:d:Q5258685|Dennis Madden]]''
|
| 1913
|
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 2791
| ''[[:d:Q5258810|Dennis O'Neill]]''
| [[File:Caro Mio Ben, album cover.jpg|center|128px]]
| 1948-02-25
|
| [[Wales]]
|-
| style='text-align:right'| 2792
| ''[[:d:Q5258940|Dennis Selby]]''
|
| 1920-10-15
| 1969-08-05
| ''[[:d:Q990946|Broughton]]''
|-
| style='text-align:right'| 2793
| ''[[:d:Q5258949|Dennis Shea]]''
|
| 1924-02-07
| 1982-09-22
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2794
| ''[[:d:Q5259321|Densey Clyne]]''
|
| 1922-12-04
| 2019-05-21
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 2795
| ''[[:d:Q5259851|Denys Graham]]''
|
| 1926-06-29
| 2024-10-24
| [[Newport]]
|-
| style='text-align:right'| 2796
| ''[[:d:Q5259856|Denys Irving]]''
|
| 1944-01-04
| 1976-08-05
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 2797
| ''[[:d:Q5260010|Deon Saffery]]''
|
| 1988-01-28
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2798
| ''[[:d:Q5261835|Derek Brewer]]''
|
| 1923-07-13
| 2008-10-23
| [[Cairdiff]]
|-
| style='text-align:right'| 2799
| ''[[:d:Q5261840|Derek Brockway]]''
|
| 1967-10-29
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2800
| ''[[:d:Q5261927|Derek Draper]]''
|
| 1943-05-11
| 2024-09-02
| [[Swansea]]
|-
| style='text-align:right'| 2801
| ''[[:d:Q5262063|Derek Howes]]''
|
| 1913
|
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 2802
| ''[[:d:Q5262090|Derek Jones]]''
| [[File:Sir derek jones.jpg|center|128px]]
| 1952-12-08
|
| ''[[:d:Q7379326|Rumney]]''
|-
| style='text-align:right'| 2803
| ''[[:d:Q5262285|Derek Prag]]''
|
| 1923-08-06
| 2010-01-20
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2804
| ''[[:d:Q5262353|Derek Showers]]''
|
| 1953-01-28
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2805
| ''[[:d:Q5262465|Derek Williams]]''
|
| 1924-11-28
| 2014-09-19
| [[Cairdiff]]
|-
| style='text-align:right'| 2806
| ''[[:d:Q5262848|Dermot Tynan]]''
|
| 1961-09-20
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 2807
| ''[[:d:Q5263378|Derwyn Jones]]''
|
| 1970-11-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2808
| ''[[:d:Q5263401|Deryn Brace]]''
| [[File:Deryn Brace2010.jpg|center|128px]]
| 1975-03-15
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 2809
| ''[[:d:Q5263425|Desmond Barry]]''
|
| 1954
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2810
| ''[[:d:Q5263436|Des Case]]''
|
| 1918
| 1997
| [[Newport]]
|-
| style='text-align:right'| 2811
| ''[[:d:Q5263461|Des Harlock]]''
|
| 1922-12-20
| 1981-04-06
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 2812
| ''[[:d:Q5263558|Des Tennant]]''
|
| 1925-10-17
| 2009-01-12
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 2813
| ''[[:d:Q5264803|Desmond Skirrow]]''
|
| 1923-11-13
| 1976-08-16
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2814
| ''[[:d:Q5264804|Desmond Star]]''
|
| 1983-02-07
|
| ''[[:d:Q6984487|Castell-nedd]]''
|-
| style='text-align:right'| 2815
| ''[[:d:Q5268239|David Roberts]]''
| [[File:David Roberts (Dewi Havhesp, 1831-84) NLW3361824.jpg|center|128px]]
| 1831-05
| 1884-08
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 2816
| ''[[:d:Q5268240|Dewi Morgan]]''
|
| 1877-12-21
| 1971-04-01<br/>1971
| ''[[:d:Q5320352|Dôl-y-bont]]''
|-
| style='text-align:right'| 2817
| ''[[:d:Q5270024|Di Botcher]]''
|
| 1959
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2818
| ''[[:d:Q5271247|Diana Morgan]]''
|
| 1908-05-29
| 1996-12-09
| ''[[:d:Q5052273|Cathedral Road]]''
|-
| style='text-align:right'| 2819
| ''[[:d:Q5271679|Dianne Edwards]]''
|
| 1942
|
| [[Swansea]]
|-
| style='text-align:right'| 2820
| ''[[:d:Q5272311|Dic Aberdaron]]''
| [[File:Dic Aberdaron 1823.jpg|center|128px]]
| 1780
| 1843-12-18
| ''[[:d:Q2556821|Aberdaron]]''
|-
| style='text-align:right'| 2821
| ''[[:d:Q5272316|Dic Goodman]]''
| [[File:Youngtaid.jpg|center|128px]]
| 1920-01-20
| 2013-03-04
| ''[[:d:Q13651447|Mynytho]]''
|-
| style='text-align:right'| 2822
| ''[[:d:Q5273043|Dick Huxtable]]''
|
| 1890-10-13
| 1970-08-29
| [[Swansea]]
|-
| style='text-align:right'| 2823
| ''[[:d:Q5273112|Dick Krzywicki]]''
|
| 1947-02-02
|
| ''[[:d:Q3402867|Penley]]''
|-
| style='text-align:right'| 2824
| ''[[:d:Q5273289|Dick Power]]''
|
| 1903-12-13
|
| ''[[:d:Q3404679|Crumlin]]''
|-
| style='text-align:right'| 2825
| ''[[:d:Q5273450|Dick Thomas]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2826
| ''[[:d:Q5273569|Dick Yates]]''
|
| 1921-06-06
| 1976
| ''[[:d:Q2183255|Queensferry]]''
|-
| style='text-align:right'| 2827
| ''[[:d:Q5273682|Dickie David]]''
|
| 1879-01
| 1939-10-24
| [[Cairdiff]]
|-
| style='text-align:right'| 2828
| ''[[:d:Q5273702|Dickie Morris]]''
|
| 1879-01-01
| 20th century
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 2829
| ''[[:d:Q5273709|Dickie Williams]]''
|
| 1925-03-16
| 1997-03-26
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 2830
| ''[[:d:Q5273850|Dicky Ralph]]''
|
| 1908-01-21
| 1989-10-05
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 2831
| ''[[:d:Q5276961|Dillwyn Miles]]''
|
| 1915-05-25
| 2007-08-01<br/>2007-07
| [[Newport]]
|-
| style='text-align:right'| 2832
| ''[[:d:Q5276963|Dillwyn Thomas]]''
|
| 1905-02-13
| 1996-08-29
| ''[[:d:Q1973162|Neath Abbey]]''
|-
| style='text-align:right'| 2833
| ''[[:d:Q5277103|Dilwyn Lewis]]''
|
| 1924-04-28
| 2000-07-10
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 2834
| ''[[:d:Q5277104|Dilwyn John]]''
|
| 1944-06-03
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 2835
| ''[[:d:Q5277105|Dilys Breese]]''
|
| 1932-06-02
| 2007-08-22
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2836
| ''[[:d:Q5277110|Dilys Elwyn-Edwards]]''
|
| 1918-08-19
| 2011-01-13
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 2837
| ''[[:d:Q5277723|Dimmy Franks]]''
|
| 1876
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2838
| ''[[:d:Q5287114|Doc Sarpolis]]''
|
| 1897-08-31
| 1967-05-28
| [[Newport]]
|-
| style='text-align:right'| 2839
| ''[[:d:Q5290516|Dominic Day]]''
|
| 1985-08-22
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 2840
| ''[[:d:Q5292506|Don Dearson]]''
|
| 1914-05-13
| 1990-12-24
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 2841
| ''[[:d:Q5292513|Don Devereux]]''
|
| 1932-10-18
| 1995-02-08
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2842
| ''[[:d:Q5292576|Don Emery]]''
|
| 1920-06-11
| 1993-11-19
| [[Cairdiff]]
|-
| style='text-align:right'| 2843
| ''[[:d:Q5292760|Don Hayward]]''
| [[File:Don Hayward 1950.jpg|center|128px]]
| 1925-07-30
| 1999-02-16
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 2844
| ''[[:d:Q5293242|Don Oakes]]''
|
| 1928-10-08
| 1977-06-13
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 2845
| ''[[:d:Q5293514|Don Shepherd]]''
| [[File:Don Shepherd.jpg|center|128px]]
| 1927-08-12
| 2017-08-18
| ''[[:d:Q7230620|Port Eynon]]''
|-
| style='text-align:right'| 2846
| ''[[:d:Q5293533|Don Skene]]''
|
| 1936-02-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2847
| ''[[:d:Q5294021|Donald Baverstock]]''
|
| 1924-01-18
| 1995-03-17
| [[Cairdiff]]
|-
| style='text-align:right'| 2848
| ''[[:d:Q5294060|Donald Braithwaite]]''
|
| 1937-02-18
| 2017-03-16
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2849
| ''[[:d:Q5294183|Donald Coleman]]''
|
| 1925-09-19
| 1991-01-14
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2850
| ''[[:d:Q5294449|Donald Gullick]]''
|
| 1924-11-22
| 2000-04-14
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 2851
| ''[[:d:Q5294516|Donald Holroyde Hey]]''
|
| 1904-09-12
| 1987-01-21
| [[Swansea]]
|-
| style='text-align:right'| 2852
| ''[[:d:Q5295244|Donald Vines]]''
|
| 1932-02-06
| 1989-09-17
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 2853
| ''[[:d:Q5295437|Donato Nardiello]]''
|
| 1957-04-09
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 2854
| ''[[:d:Q5296340|Donna Edwards]]''
|
| 1963
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2855
| ''[[:d:Q5298404|Dorothy Edwards]]''
|
| 1902-08-18
| 1934-01-06
| ''[[:d:Q7080139|Cwm Ogwr]]''
|-
| style='text-align:right'| 2856
| ''[[:d:Q5298551|Dorothy Miles]]''
|
| 1931-08-19
| 1993-01-30
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 2857
| ''[[:d:Q5298607|Dorothy Mary Rees]]''
|
| 1898-07-29
| 1987-08-20
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2858
| ''[[:d:Q5298632|Dorothy Simpson]]''
|
| 1933-06-20
| 2020-08-20
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 2859
| ''[[:d:Q5298657|Dorothy Thornhill]]''
| [[File:Official portrait of Baroness Thornhill crop 2, 2024.jpg|center|128px]]
| 1955-05-26
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 2860
| ''[[:d:Q5298825|Rhian O'Sullivan]]''
| [[File:Rhian O'Sullivan at the Dutch Open 2022.jpg|center|128px]]
| 1981-01-20
|
| [[Wales]]
|-
| style='text-align:right'| 2861
| ''[[:d:Q5300818|Doug Phillips]]''
|
| 1919-06-28
| 2000-04-28
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 2862
| ''[[:d:Q5300842|Doug Rees]]''
|
| 1923-02-12
| 2000
| ''[[:d:Q5137115|Clyne]]''
|-
| style='text-align:right'| 2863
| ''[[:d:Q5301021|Doug Witcomb]]''
|
| 1918-04-18
| 1999-08-06
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 2864
| ''[[:d:Q5301326|Douglas Chamberlain]]''
|
| 1931
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2865
| ''[[:d:Q5301668|David Jones]]''
|
| 1914-09-08
| 1997
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 2866
| ''[[:d:Q5301779|Douglas Marsden-Jones]]''
|
| 1893-07-01
| 1955-01-05
| [[Swansea]]
|-
| style='text-align:right'| 2867
| ''[[:d:Q5303665|Dowster]]''
|
| 1977-03-01
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 2868
| ''[[:d:Q5311941|Dudley Peake]]''
|
| 1934-10-26
| 2012-04-28
| [[Swansea]]
|-
| style='text-align:right'| 2869
| ''[[:d:Q5311954|Dudley Price]]''
|
| 1931-11-17
| 2021
| [[Swansea]]
|-
| style='text-align:right'| 2870
| ''[[:d:Q5314279|Duncan Bush]]''
|
| 1946
| 2017-08-18
| [[Cairdiff]]
|-
| style='text-align:right'| 2871
| ''[[:d:Q5318593|Dyfan Dwyfor]]''
|
|
|
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 2872
| ''[[:d:Q5318595|Dyfed Wyn-Evans]]''
|
| 1969
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2873
| ''[[:d:Q5318618|Dyfodwg]]''
|
|
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 2874
| ''[[:d:Q5318721|Dylan Harris]]''
|
| 1926-10-22
| 1988-04-30
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2875
| ''[[:d:Q5318732|Dylan Jones-Evans]]''
| [[File:A713 Dylan Jones Evans 1x1.jpg|center|128px]]
| 1966-05-16<br/>1966-05
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2876
| ''[[:d:Q5321815|E. D. Jones]]''
|
| 1903-12-06
| 1987-03-07
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 2877
| ''[[:d:Q5331614|Eben Upton]]''
| [[File:EbenUpton.jpeg|center|128px]]
| 1978-04-05
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 2878
| ''[[:d:Q5331737|Ebenezer Thomas]]''
| [[File:Eben Fardd.JPG|center|128px]]
| 1802-08
| 1863-02-17
| ''[[:d:Q6661066|Llanarmon]]''
|-
| style='text-align:right'| 2879
| ''[[:d:Q5335402|Ed Shervington]]''
| [[File:Edshervingtonpic.jpg|center|128px]]
| 1985-03-11
|
| [[Newport]]
|-
| style='text-align:right'| 2880
| ''[[:d:Q5335828|Eddie Avoth]]''
|
| 1945-05-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2881
| ''[[:d:Q5336169|Eddie Jones]]''
|
| 1914-04-20
| 1984
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 2882
| ''[[:d:Q5336328|Eddie Morgan]]''
|
| 1913-12-18
| 1978-04-16
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 2883
| ''[[:d:Q5336386|Eddie Parris]]''
|
| 1911-01-31
| 1971-02-27
| ''[[:d:Q7262781|Pwllmeyric]]''
|-
| style='text-align:right'| 2884
| ''[[:d:Q5336493|Eddie Smart]]''
|
| 1946-08-23
| 2000-02-06
| [[Cairdiff]]
|-
| style='text-align:right'| 2885
| ''[[:d:Q5336533|Eddie Thomas]]''
| [[File:EddieThomasSculptureMerthyr.jpg|center|128px]]
| 1926-07-27
| 1997-06-02
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2886
| ''[[:d:Q5336559|Eddie Watkins]]''
|
| 1916-03-02
| 1995-06-28
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 2887
| ''[[:d:Q5336579|Eddie Woods]]''
|
| 1951-07-29
|
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 2888
| ''[[:d:Q5336695|Eddy Temple-Morris]]''
| [[File:Eddie temple morris.jpg|center|128px]]
| 1965-04-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2889
| ''[[:d:Q5337183|Edgar Cooper]]''
|
| 1891-11-12
| 1959-03-15
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2890
| ''[[:d:Q5337227|Edgar Evans]]''
|
| 1912-06-09
| 2007-02-22
| ''[[:d:Q13127611|Cwrtnewydd]]''
|-
| style='text-align:right'| 2891
| ''[[:d:Q5337317|Edgar Jones]]''
|
| 1910-05-04
| 1986-02-11
| ''[[:d:Q7534773|Sketty]]''
|-
| style='text-align:right'| 2892
| ''[[:d:Q5337382|Edgar Montford]]''
|
| 1865
| 1940
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 2893
| ''[[:d:Q5337384|Edgar Morgan]]''
|
| 1896-05-17
| 1983-09-09
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2894
| ''[[:d:Q5337386|Edgar Morgan]]''
|
| 1882-04-15
| 1962
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 2895
| ''[[:d:Q5337422|Edgar Phillips]]''
| [[File:Cyhoeddi Eisteddfod Genedlaethol 1962, Llanelli yn 1961 (1468338).jpg|center|128px]]
| 1889-10-08<br/>1889
| 1962-08-30<br/>1962
| ''[[:d:Q7837785|Trefin]]''
|-
| style='text-align:right'| 2896
| ''[[:d:Q5337424|Edgar Powell]]''
|
| 1899-01-06
| 1955
| [[Cairdiff]]
|-
| style='text-align:right'| 2897
| ''[[:d:Q5337426|Edgar Purnell Hooley]]''
|
| 1860-06-05
| 1942-01-26
| [[Swansea]]
|-
| style='text-align:right'| 2898
| ''[[:d:Q5337436|Edgar Rees Jones]]''
| [[File:Edgar-Jones-AS-Merthyr.jpg|center|128px]]
| 1878-08-27
| 1962-06-16
| ''[[:d:Q5197221|Cwmamman]]''
|-
| style='text-align:right'| 2899
| ''[[:d:Q5338553|Edith Gostick]]''
| [[File:Edith Hannah Gostick.png|center|128px]]
| 1894-01-15
| 1984-07-08
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 2900
| ''[[:d:Q5339515|Edmund Griffith]]''
|
| 1570
| 1637-05-26
| ''[[:d:Q1541249|Llŷn Peninsula]]''
|-
| style='text-align:right'| 2901
| ''[[:d:Q5339668|Edmund Meyrick]]''
|
| 1636-06-11
| 1713-04-24
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 2902
| ''[[:d:Q5339760|Edmund Prys]]''
| [[File:Edmwnd Edmund Prys ar Gofeb Llanelwy, Sir Ddinbych Bible Translators' Memorial St Asaph 01.jpg|center|128px]]
| 1541<br/>1544
| 1624<br/>1623
| ''[[:d:Q29484380|Gerddi Bluog]]''
|-
| style='text-align:right'| 2903
| ''[[:d:Q5339891|Edmund W. Samuel]]''
| [[File:EdmundWSamuel.jpg|center|128px]]
| 1857-11-27
| 1930-03-07
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 2904
| ''[[:d:Q5341722|Edward Baker]]''
|
| 1892-01-07
| 1969-04-08
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2905
| ''[[:d:Q5341900|Edward Bishop]]''
| [[File:Edward Bishop rugby player.jpg|center|128px]]
| 1864-10-10
| 1919-02-24
| [[Swansea]]
|-
| style='text-align:right'| 2906
| ''[[:d:Q5341916|Edward Blayney, 1st Baron Blayney]]''
|
| 1570
| 1629-02-11
| ''[[:d:Q517587|Gregynog Hall]]''
|-
| style='text-align:right'| 2907
| ''[[:d:Q5342184|Edward Cadogan]]''
|
| 1833
| 1890-04-16
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2908
| ''[[:d:Q5342230|Edward Caswell]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2909
| ''[[:d:Q5342535|Edward Davies]]''
|
| 1756-06-07
| 1831-01-07
| ''[[:d:Q20593921|Llanfaredd]]''
|-
| style='text-align:right'| 2910
| ''[[:d:Q5342662|Edward Dumaresq]]''
|
| 1802-06-16
| 1906-04-23
| [[Swansea]]
|-
| style='text-align:right'| 2911
| ''[[:d:Q5342738|Edward Edwards]]''
|
| 1726
| 1783-09-02
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 2912
| ''[[:d:Q5342788|Edward Ernest Hughes]]''
|
| 1877-02-07
| 1953-12-23
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 2913
| ''[[:d:Q5342797|Edward Evans]]''
|
| 1716-03<br/>1716
| 1798-06-21<br/>1798
| ''[[:d:Q6662903|Llwydcoed]]''
|-
| style='text-align:right'| 2914
| ''[[:d:Q5343428|Edward Herbert, 2nd Earl of Powis]]''
| [[File:Edward Herbert, 2nd Earl of Powis, by Francis Grant.jpg|center|128px]]
| 1785-03-22
| 1848-01-17
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 2915
| ''[[:d:Q5343522|Edward Howel Francis]]''
|
| 1924-05-31
| 2014-05-22
| ''[[:d:Q5197227|Cwmavon]]''
|-
| style='text-align:right'| 2916
| ''[[:d:Q5343539|Edward Hughes]]''
|
| 1772-07-09
| 1850-02-11
| ''[[:d:Q6963824|Nannerch]]''
|-
| style='text-align:right'| 2917
| ''[[:d:Q5343621|Edward J. Blythin]]''
|
| 1884-10-10
| 1958-02-14
| ''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 2918
| ''[[:d:Q5343717|Edward James]]''
|
| 1569
| 1610
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 2919
| ''[[:d:Q5343718|Edward James]]''
|
| 1896-04-14
| 1975-03-15
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2920
| ''[[:d:Q5343788|Edward John Lewis]]''
|
| 1859-12-05
| 1925-06-08
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 2921
| ''[[:d:Q5343822|Edward Jones]]''
|
| 1896-03-11
| 1978-11-23
| [[Cairdiff]]
|-
| style='text-align:right'| 2922
| ''[[:d:Q5343827|Edward Jones]]''
| [[File:St Etheldreda, Ely Place, London EC1 - Nave statue - geograph.org.uk - 1613372.jpg|center|128px]]
| No/unknown value
| 1590-05-06
| ''[[:d:Q6661284|Llanelidan]]''
|-
| style='text-align:right'| 2923
| ''[[:d:Q5343829|Edward Jones]]''
|
| No/unknown value
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 2924
| ''[[:d:Q5344278|Edward M. Lewis]]''
| [[File:EdwardMorganLewis.png|center|128px]]
| 1872-12-25
| 1936-03-23<br/>1936-05-23
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 2925
| ''[[:d:Q5344507|Edward Moore]]''
|
| 1835-02-23
| 1916-09-02
| [[Cairdiff]]
|-
| style='text-align:right'| 2926
| ''[[:d:Q5344515|Edward Morgan]]''
|
|
| 1642-04-26
| ''[[:d:Q16245967|Bettisfield]]''
|-
| style='text-align:right'| 2927
| ''[[:d:Q5344711|Edward Owen]]''
| [[File:Edward Owen AM (died 1807).jpg|center|128px]]
| 1728
| 1807-04-05
| ''[[:d:Q6661527|Llangurig]]''
|-
| style='text-align:right'| 2928
| ''[[:d:Q5344713|Edward Owen]]''
|
| 1903
|
| ''[[:d:Q3404679|Crumlin]]''
|-
| style='text-align:right'| 2929
| ''[[:d:Q5344807|Edward Pegge]]''
| [[File:Edward Pegge.jpg|center|128px]]
| 1864-06-05
| 1915-03-21
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 2930
| ''[[:d:Q5344829|Edward Perkins Alexander]]''
|
| 1863-08-07
| 1931-10-26
| ''[[:d:Q7592977|St Donats]]''
|-
| style='text-align:right'| 2931
| ''[[:d:Q5344893|Edward Powell]]''
|
| 1478
| 1540-07
| [[Wales]]
|-
| style='text-align:right'| 2932
| ''[[:d:Q5345025|Edward Relph]]''
| [[File:TedRelph.jpg|center|128px]]
| 1944-05-18
|
| [[Wales]]
|-
| style='text-align:right'| 2933
| ''[[:d:Q5345094|Edward Roderick Davies]]''
|
| 1915-06-02
| 1992-09-08
| ''[[:d:Q5016879|Caerau]]''
|-
| style='text-align:right'| 2934
| ''[[:d:Q5345328|Edward Siggery]]''
|
| 1991-07-18
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2935
| ''[[:d:Q5345410|Edward Stanley, 4th Baron Stanley of Alderley]]''
| [[File:Edward Lyulph Stanley.jpg|center|128px]]
| 1839-05-16
| 1925-03-18
| ''[[:d:Q29502285|Grosvenor Court]]''
|-
| style='text-align:right'| 2936
| ''[[:d:Q5345430|Edward Stephen]]''
| [[File:Revd Edward (Jones) Stephen (Tanymarian, 1822-85) NLW3362706.jpg|center|128px]]
| 1822-12-09
| 1885-05-10
| ''[[:d:Q6729249|Maentwrog]]''
|-
| style='text-align:right'| 2937
| ''[[:d:Q5345587|Edward Thomas]]''
|
|
|
| ''[[:d:Q5530463|Gelli]]''
|-
| style='text-align:right'| 2938
| ''[[:d:Q5345588|Edward Thomas Chapman]]''
|
| 1920-01-13
| 2002-02-03
| ''[[:d:Q7228312|Pontlotyn]]''
|-
| style='text-align:right'| 2939
| ''[[:d:Q5345705|Edward Vaughan]]''
|
|
| 1683
| [[Ceredigion]]
|-
| style='text-align:right'| 2940
| ''[[:d:Q5345834|Edward Welch]]''
|
| 1806
| 1868
| ''[[:d:Q7114024|Owrtyn]]''
|-
| style='text-align:right'| 2941
| ''[[:d:Q5345919|Edward Williams]]''
|
| 1890-07-01
| 1963-05-16
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 2942
| ''[[:d:Q5346009|Edward Wynne]]''
|
| 1681
| 1755-06-30<br/>1755
| ''[[:d:Q11138487|Llantrisant]]''
|-
| style='text-align:right'| 2943
| ''[[:d:Q5346268|Edwin Brooks]]''
|
| 1929-12-01
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 2944
| ''[[:d:Q5346324|Edwin Cross]]''
|
| 1859
| 1924-01-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2945
| ''[[:d:Q5346531|Edwin Hughes]]''
| [[File:Balaclavaned.jpg|center|128px]]
| 1830-12-12
| 1927-05-18
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2946
| ''[[:d:Q5346733|Edwin Pain]]''
|
| 1891-06-02
| 1947-07-14
| [[Swansea]]
|-
| style='text-align:right'| 2947
| ''[[:d:Q5346868|Edwin Thomas Maynard]]''
| [[File:Edwin Thomas Maynard.jpg|center|128px]]
| 1878-03-21
| 1961-11-20
| ''[[:d:Q7898590|Upper Cwmbran]]''
|-
| style='text-align:right'| 2948
| ''[[:d:Q5346920|Edwin Williams]]''
|
| 1898-07-01
| 1983-01-31
| ''[[:d:Q268367|Cwmllynfell]]''
|-
| style='text-align:right'| 2949
| ''[[:d:Q5346948|Edwina Hart]]''
| [[File:Edwina Hart.jpg|center|128px]]
| 1957-04-26
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 2950
| ''[[:d:Q5348887|Eifion Jones]]''
|
| 1925
| 2004
| [[Aberystwyth]]
|-
| style='text-align:right'| 2951
| ''[[:d:Q5349538|Eiluned Lewis]]''
|
| 1900-11-01
| 1979-04-15
| ''[[:d:Q20007204|Penstrowed]]''
|-
| style='text-align:right'| 2952
| ''[[:d:Q5349876|Eirlys Bellin]]''
|
| 1978<br/>2000
|
| ''[[:d:Q13130796|Pont-faen]]''
|-
| style='text-align:right'| 2953
| ''[[:d:Q5349883|Eirug Wyn]]''
|
| 1950-12-11
| 2004-04-25
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 2954
| ''[[:d:Q5353384|Elan Closs Stephens]]''
|
| 1948-06-16
|
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 2955
| ''[[:d:Q5354231|Eleanor Burnham]]''
| [[File:Democracy Day in Ysgol Dyffryn Nantlle, Penygroes, Gwynedd (cropped).jpg|center|128px]]
|
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2956
| ''[[:d:Q5354271|Eleanor Evans]]''
|
| 1893
| 1969-12-20
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 2957
| ''[[:d:Q5354362|Eleanor Pilgrim]]''
|
| 1977-02-15
|
| [[Newport]]
|-
| style='text-align:right'| 2958
| ''[[:d:Q5354460|Eleazar Roberts]]''
| [[File:Eleazar Roberts.jpeg|center|128px]]
| 1825-01-15
| 1912-04-06
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 2959
| ''[[:d:Q5356565|Rhydian Vaughan]]''
| [[File:Rhydian-Vaughan.jpg|center|128px]]
| 1988-03-10
|
| [[Wales]]
|-
| style='text-align:right'| 2960
| ''[[:d:Q5359884|Elfed Evans]]''
|
| 1926-08-28
| 1988-05-13
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 2961
| ''[[:d:Q5359886|Elfed Morris]]''
|
| 1942-06-09
| 2013-11-04
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 2962
| ''[[:d:Q5359947|Elfyn Edwards]]''
|
| 1960-05-04
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 2963
| ''[[:d:Q5359948|Elfyn Evans]]''
| [[File:WRC Central European Rallye 2023 Elfyn Evans (cropped).jpg|center|128px]]
| 1988-12-28
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 2964
| ''[[:d:Q5359949|Elfyn Richards]]''
| [[File:Elfyn Richards (2010).JPG|center|128px]]
| 1914-12-28
| 1995-09-07
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 2965
| ''[[:d:Q5360201|Eli Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 2966
| ''[[:d:Q5360339|Eli Walker]]''
| [[File:ST vs Ospreys 08-12-120076.JPG|center|128px]]
| 1992-03-28
|
| [[Swansea]]
|-
| style='text-align:right'| 2967
| ''[[:d:Q5360573|Elias Owen]]''
| [[File:Elias Owen.jpg|center|128px]]
| 1833-12-02
| 1899-05-19
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 2968
| ''[[:d:Q5360574|Elias Owen]]''
| [[File:Elias Owen Jr..jpg|center|128px]]
| 1863
| 1888-09-20
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 2969
| ''[[:d:Q5360783|Eliezer Williams]]''
|
| 1754-10-04
| 1820-01-20
| ''[[:d:Q107032868|Pibwr-lwyd]]''
|-
| style='text-align:right'| 2970
| ''[[:d:Q5361081|Elin Fflur]]''
| [[File:Dim Gair, album cover.jpg|center|128px]]
| 1984
|
| [[Anglesey]]
|-
| style='text-align:right'| 2971
| ''[[:d:Q5361084|Elin Jones]]''
| [[File:Elin-jones.jpg|center|128px]]
| 1966-09-01
|
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 2972
| ''[[:d:Q5361252|Eliot Richards]]''
| [[File:Eliot Richards 2014-01-18 1.jpg|center|128px]]
| 1991-09-10
|
| ''[[:d:Q3402398|New Tredegar]]''
|-
| style='text-align:right'| 2973
| ''[[:d:Q5361330|Elis James]]''
| [[File:Elis James (41363128095) (cropped).jpg|center|128px]]
| 1980-11-03
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2974
| ''[[:d:Q5362301|Elizabeth Andrews]]''
|
| 1882
| 1960
| ''[[:d:Q5771888|Hirwaun]]''
|-
| style='text-align:right'| 2975
| ''[[:d:Q5362547|Elizabeth Casson]]''
|
| 1881-04-14
| 1954-12-17
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 2976
| ''[[:d:Q5362806|Elizabeth Fritsch]]''
| [[File:Elizabethfritsch.jpg|center|128px]]
| 1940
|
| [[Wales]]
|-
| style='text-align:right'| 2977
| ''[[:d:Q5363240|Elizabeth Morgan]]''
|
| 1930-02-07
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2978
| ''[[:d:Q5363245|Elizabeth Mortimer]]''
|
| 1371-02-12
| 1417-04-20
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 2979
| ''[[:d:Q5363403|Elizabeth Randles]]''
| [[File:Elizabeth Randles.jpg|center|128px]]
| 1801-08-01
| 1829-05-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2980
| ''[[:d:Q5363418|Elizabeth Rees-Williams]]''
|
| 1936-05-01
| 2022-04-15
| [[Cairdiff]]
|-
| style='text-align:right'| 2981
| ''[[:d:Q5363690|Elizabeth Watkin-Jones]]''
|
| 1877-07-13
| 1966-06-09
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 2982
| ''[[:d:Q5364567|Ella Smith]]''
|
| 1983-06-06
|
| [[Wales]]
|-
| style='text-align:right'| 2983
| ''[[:d:Q5364886|Ellen Hunter]]''
|
| 1968-02-12
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 2984
| ''[[:d:Q5365501|Elliot Kear]]''
| [[File:Elliot Kear.jpg|center|128px]]
| 1988-11-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 2985
| ''[[:d:Q5365664|Elliott Hewitt]]''
|
| 1994-05-30
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 2986
| ''[[:d:Q5365877|Ellis Evans]]''
|
| 1930-09-23
| 2013-09-26
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 2987
| ''[[:d:Q5365899|Ellis Harrison]]''
| [[File:Ellis warming up for Bristol Rovers in 2015.PNG|center|128px]]
| 1994-01-29
|
| [[Newport]]
|-
| style='text-align:right'| 2988
| ''[[:d:Q5367919|Eluned Parrott]]''
| [[File:Eluned Parrott (6324905297).jpg|center|128px]]
| 1974
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 2989
| ''[[:d:Q5368039|Elvet Jones]]''
|
| 1912-04-29
| 1989-10-05
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2990
| ''[[:d:Q5368267|Elvyn Bowen]]''
|
| 1907-07-10
| 1965-08-24
| ''[[:d:Q6661651|Llannon]]''
|-
| style='text-align:right'| 2991
| ''[[:d:Q5368370|Elwyn Gwyther]]''
|
| 1921
| 1996
| ''[[:d:Q1141148|Gower Peninsula]]''
|-
| style='text-align:right'| 2992
| ''[[:d:Q5368372|Elwyn Jones]]''
|
| 1923-12-19
| 1982-05-19
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 2993
| ''[[:d:Q5368405|Ely Devons]]''
|
| 1913-07-29
| 1967-12-28
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 2994
| ''[[:d:Q5372673|Emlyn Davies]]''
|
| 1922-01-15
| 2016-09-07
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 2995
| ''[[:d:Q5372676|Emlyn Gwynne]]''
|
| 1898
| 1962
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 2996
| ''[[:d:Q5372680|Emlyn Jenkins]]''
|
| 1910-12-01
| 1993
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 2997
| ''[[:d:Q5372681|Emlyn Jones]]''
|
| 1907-11-29
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 2998
| ''[[:d:Q5372684|Emlyn Walters]]''
|
| 1918-05-20
| 2001-01-21
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 2999
| ''[[:d:Q5372687|Emlyn Watkins]]''
|
| 1904-09-21
| 1978-05-15
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 3000
| ''[[:d:Q5372689|Emlyn Williams]]''
|
| 1903
|
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 3001
| ''[[:d:Q5372690|Emlyn Williams]]''
|
| 1912-01-15
| 1989
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3002
| ''[[:d:Q5372864|Emma Jones]]''
| [[File:Emma jones.jpg|center|128px]]
| 1982-08-21
|
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 3003
| ''[[:d:Q5372866|Emma Jones]]''
|
| 1975-05-23
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 3004
| ''[[:d:Q5372925|Emma Plewa]]''
| [[File:Lewes Ladies 1 QPR Ladies 2 28 02 2016-7651 (24789317084).jpg|center|128px]]
| 1990-09-08
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 3005
| ''[[:d:Q5372963|Emma Stansfield]]''
|
| 1978
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 3006
| ''[[:d:Q5374087|Empire ISIS]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3007
| ''[[:d:Q5374801|Emrys Evans]]''
|
| 1911-04-24
| 1983-06-23
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 3008
| ''[[:d:Q5374802|Emrys G. Bowen]]''
| [[File:Emrys George Bowen.jpg|center|128px]]
| 1900-12-28
| 1983-11-08
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3009
| ''[[:d:Q5374803|Emrys Hughes]]''
|
|
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 3010
| ''[[:d:Q5374804|Emrys James]]''
|
| 1928-09-01
| 1989-02-05
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 3011
| ''[[:d:Q5374805|Emrys Jones]]''
| [[File:Emrys Jones.jpg|center|128px]]
| 1920-08-17
| 2006-08-30
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3012
| ''[[:d:Q5374807|Emrys Roberts]]''
|
| 1910-09-22
| 1990-10-29
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3013
| ''[[:d:Q5374906|Emyr Huws]]''
| [[File:Emyr Huws 2016.jpg|center|128px]]
| 1993-09-30
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3014
| ''[[:d:Q5374908|Emyr Phillips]]''
| [[File:Scarlets.jpg|center|128px]]
| 1987-02-22
|
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 3015
| ''[[:d:Q5375924|Endaf Emlyn]]''
| [[File:Dilyn Y Graen, album cover.jpg|center|128px]]
| 1944-07-31
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3016
| ''[[:d:Q5378861|Enid Charles]]''
|
| 1894-12-29
| 1972-03-26
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 3017
| ''[[:d:Q5378877|Enid Luff]]''
|
| 1935-02-21
| 2022
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 3018
| ''[[:d:Q5379271|Enoch William Bagshaw]]''
| [[File:Enoch W. Bagshaw.jpg|center|128px]]
| 1884-01-31
| 1930-10-03
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 3019
| ''[[:d:Q5379295|Enoch Francis]]''
|
| 1688
| 1740-02-04
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 3020
| ''[[:d:Q5381878|Eos Counsell]]''
| [[File:Eos Chater - Metrocentre 2009.jpg|center|128px]]
| 1976-01-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3021
| ''[[:d:Q5384966|Erasmus Lewes]]''
|
| 1663
| 1745-02-19
| ''[[:d:Q6661564|Llangunllo]]''
|-
| style='text-align:right'| 3022
| ''[[:d:Q5384974|Erasmus Saunders]]''
|
| 1670
| 1724-06-01
| ''[[:d:Q5136827|Clydau]]''
|-
| style='text-align:right'| 3023
| ''[[:d:Q5386383|Eric Dolman]]''
|
| 1903-07-17
| 1969-06-06
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 3024
| ''[[:d:Q5386454|Eric Evans]]''
|
| 1894-02-27
| 1955-06-21
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3025
| ''[[:d:Q5386513|Eric Francis]]''
|
| 1887-08-30
| 1976-01-26
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 3026
| ''[[:d:Q5386843|Eric Jones]]''
| [[File:Eric Jones (solo climber).jpg|center|128px]]
| 1935
|
| [[Wales]]
|-
| style='text-align:right'| 3027
| ''[[:d:Q5387133|Eric Morris]]''
|
| 1940-04-15
| 2011
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 3028
| ''[[:d:Q5387714|Eric Weaver]]''
|
| 1943-07-01
|
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 3029
| ''[[:d:Q5389230|Erin Vaughan]]''
|
| 1986-02-15
|
| [[Newport]]
|-
| style='text-align:right'| 3030
| ''[[:d:Q5392768|Ernest Basil Verney]]''
|
| 1894-08-22
| 1967-08-19
| [[Cairdiff]]
|-
| style='text-align:right'| 3031
| ''[[:d:Q5393040|Ernest Evans]]''
| [[File:Ernest Evans (5292082).jpg|center|128px]]
| 1885-05-17
| 1965-01-18
| [[Aberystwyth]]
|-
| style='text-align:right'| 3032
| ''[[:d:Q5393664|Ernest Peake]]''
|
| 1888-05
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 3033
| ''[[:d:Q5393758|Ernest Rowland]]''
|
| 1864-09-21
| 1940-04-07
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3034
| ''[[:d:Q5393924|Ernest Turner]]''
|
| 1898
| 1951-12-07
| ''[[:d:Q10970286|Brithdir]]''
|-
| style='text-align:right'| 3035
| ''[[:d:Q5394048|Ernest Zobole]]''
|
| 1927-04-25
| 1999-11-27
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 3036
| ''[[:d:Q5394380|Ernie Bryan]]''
|
| 1926-06-06
| 2008-03
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 3037
| ''[[:d:Q5394444|Ernie Curtis]]''
|
| 1907-06-10
| 1992-11
| [[Cairdiff]]
|-
| style='text-align:right'| 3038
| ''[[:d:Q5394472|Ernie Finch]]''
|
| 1899-07-16
| 1983-10-01
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 3039
| ''[[:d:Q5394482|Ernie George]]''
|
| 1871
| 1952-11-28
| ''[[:d:Q2347528|Llantwit Major]]''
|-
| style='text-align:right'| 3040
| ''[[:d:Q5394513|Ernie Harris]]''
|
| 1919-04-24
| 1996-12-04
| [[Cairdiff]]
|-
| style='text-align:right'| 3041
| ''[[:d:Q5394553|Ernie Jenkins]]''
| [[File:Ernie Jenkins.jpg|center|128px]]
| 1880-09-20
| 1958-07-18
| ''[[:d:Q7898590|Upper Cwmbran]]''
|-
| style='text-align:right'| 3042
| ''[[:d:Q5394565|Ernie Jones]]''
|
| 1920-11-12
| 2002-11
| ''[[:d:Q5197236|Cwmbwrla]]''
|-
| style='text-align:right'| 3043
| ''[[:d:Q5394569|Ernie Jones]]''
|
| 1919-12-09
| 2011-05
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 3044
| ''[[:d:Q5394780|Ernie Walley]]''
|
| 1933-04-07
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3045
| ''[[:d:Q5395517|Errie Ball]]''
|
| 1910-11-14
| 2014-07-02
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3046
| ''[[:d:Q5396271|Eryl Thomas]]''
|
| 1910
| 2001
| ''[[:d:Q6661405|Llangadwaladr]]''
|-
| style='text-align:right'| 3047
| ''[[:d:Q5396272|Eryl McNally]]''
|
| 1942-04-11
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3048
| ''[[:d:Q5411301|Eurfyl ap Gwilym]]''
| [[File:Eufryl ap Gwilym, Senedd 2018 (cropped).jpg|center|128px]]
| 1944-11-14
|
| [[Wales]]
|-
| style='text-align:right'| 3049
| ''[[:d:Q5413794|Euros Lewis]]''
|
| 1942-01-31
| 2014-06-23
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3050
| ''[[:d:Q5414305|Eustace Hill]]''
|
| 1869-04-13
| 1933-01-11
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 3051
| ''[[:d:Q5415309|Evan Abraham]]''
|
| 1899
| 1990
| [[Swansea]]
|-
| style='text-align:right'| 3052
| ''[[:d:Q5415360|Evan Davies]]''
|
| 1805
| 1864-06-18
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 3053
| ''[[:d:Q5415361|Evan Davies]]''
|
|
|
| ''[[:d:Q7852544|Tumble]]''
|-
| style='text-align:right'| 3054
| ''[[:d:Q5415380|Evan Evans]]''
|
| 1804-03-08
| 1886-10-29
| ''[[:d:Q922270|Llanddewi Brefi]]''
|-
| style='text-align:right'| 3055
| ''[[:d:Q5415381|Evan Evans]]''
|
| 1731-05-20
| 1788-08-04<br/>1789
| [[Ceredigion]]<br/>''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 3056
| ''[[:d:Q5415404|Evan Griffiths]]''
|
| 1795-01-18
| 1873-08-31
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3057
| ''[[:d:Q5415434|Evan James]]''
|
| 1918-05-10
| 1989-01
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 3058
| ''[[:d:Q5415435|Evan James]]''
| [[File:Evan James, rugby player.JPG|center|128px]]
| 1869
| 1901-08-18
| [[Swansea]]
|-
| style='text-align:right'| 3059
| ''[[:d:Q5415438|Evan Jenkins]]''
|
| 1906-06-26
| 1990
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 3060
| ''[[:d:Q5415457|Evan Lewis]]''
|
| 1818-11-16
| 1901-11-24
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 3061
| ''[[:d:Q5415460|Evan Llewelyn]]''
|
| 1875-06-30
| 1967-06-11
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3062
| ''[[:d:Q5415462|Evan Lloyd]]''
|
| 1734-04-15
| 1776-01-26
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 3063
| ''[[:d:Q5415464|Evan Lloyd]]''
|
| 1871-06-06
| 1951-02-28
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3064
| ''[[:d:Q5415513|Evan Price]]''
|
| 1967-07
|
| [[Wales]]
|-
| style='text-align:right'| 3065
| ''[[:d:Q5415519|Evan Rees]]''
|
| 1896-08-09
| 1978
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 3066
| ''[[:d:Q5415523|Evan Richards]]''
|
| 1862-01-23
| 1931-04-19
| [[Swansea]]
|-
| style='text-align:right'| 3067
| ''[[:d:Q5415524|Evan Rees]]''
| [[File:Evan Rees (Dyfed).png|center|128px]]
| 1850-01-01
| 1923-03-19
| ''[[:d:Q7259990|Puncheston]]''
|-
| style='text-align:right'| 3068
| ''[[:d:Q5415528|Evan Roberts]]''
| [[File:Evan Roberts (rygbi Llanelli a Chymru).jpg|center|128px]]
| 1861-09-19
| 1927-10-16
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3069
| ''[[:d:Q5415557|Evan Thomas]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3070
| ''[[:d:Q5415561|Evan W. Evans]]''
| [[File:Evan W Evans.png|center|128px]]
|
| 1917
| [[Wales]]
|-
| style='text-align:right'| 3071
| ''[[:d:Q5415565|Evan Watkins]]''
|
| 1882
| 1956
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3072
| ''[[:d:Q5415574|Evan Williams]]''
|
| 1906-06-18
| 1976-11-18
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 3073
| ''[[:d:Q5415575|Evan Williams]]''
|
| 1912-05-09
| 2001-07-16
| [[Wales]]
|-
| style='text-align:right'| 3074
| ''[[:d:Q5416255|Eveline Willett Cunnington]]''
|
| 1849-04-23
| 1916-07-30
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 3075
| ''[[:d:Q5418903|Ewan Davies]]''
|
| 1887-06-23
| 1979-09-02
| [[Cairdiff]]
|-
| style='text-align:right'| 3076
| ''[[:d:Q5418983|Ewen MacIntosh]]''
| [[File:Ewen Macintosh.jpg|center|128px]]
| 1973-12-25
| 2024-02-19
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 3077
| ''[[:d:Q5422950|Eynon Evans]]''
|
| 1903-05-18
| 1989
| ''[[:d:Q3403439|Nelson]]''
|-
| style='text-align:right'| 3078
| ''[[:d:Q5422952|Eynon Hawkins]]''
|
| 1920-06-26
| 2001-12-17
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 3079
| ''[[:d:Q5423242|Ezer Griffiths]]''
|
| 1888-11-27
| 1962-02-14
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3080
| ''[[:d:Q5442307|Felix L. Powell]]''
|
| 1878-05-23
| 1942-02-10
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3081
| ''[[:d:Q5446220|Fflur Dafydd]]''
| [[File:Fflur Dafydd au festival Métropolis Bleu 2022.jpg|center|128px]]
| 1978
|
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 3082
| ''[[:d:Q5446237|Ffred Ffransis]]''
|
| 1948-06-14
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 3083
| ''[[:d:Q5451046|Fiona Fox]]''
|
| 1964-11-12
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 3084
| ''[[:d:Q5454825|Fisher Morgan]]''
|
| 1908
| 1959-01-18
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 3085
| ''[[:d:Q5460608|Florence Eleanor Soper]]''
| [[File:W. Bramwell Booth & wife LCCN2014719302.jpg|center|128px]]
| 1861-09-12
| 1957-06-10
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 3086
| ''[[:d:Q5462444|Floyd Havard]]''
|
| 1965-10-16
|
| [[Swansea]]
|-
| style='text-align:right'| 3087
| ''[[:d:Q5480742|Francis Dodd]]''
| [[File:Francis Dodd.png|center|128px]]
| 1874-11-29
| 1949-03-07
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 3088
| ''[[:d:Q5481174|Francis Gulston]]''
|
| 1845-09
| 1917
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 3089
| ''[[:d:Q5481482|Francis Jayne]]''
| [[File:Bp Francis Jayne by Bassano.jpg|center|128px]]
| 1845-01-01
| 1921-08-23
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3090
| ''[[:d:Q5481533|Francis Jones]]''
|
| 1908-07-05
| 1993-12-14
| ''[[:d:Q7837785|Trefin]]''
|-
| style='text-align:right'| 3091
| ''[[:d:Q5485025|Frank Andrews]]''
|
| 1886-02-14
| 1944-11-22
| [[Wales]]
|-
| style='text-align:right'| 3092
| ''[[:d:Q5485358|Frank Blew]]''
|
| 1902
| 1968
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3093
| ''[[:d:Q5486078|Frank Curtis]]''
|
| 1890-11-12
| 1957
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3094
| ''[[:d:Q5486265|Frank Donovan]]''
|
| 1919-02-26
| 2003-04
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 3095
| ''[[:d:Q5486506|Frank Evans]]''
|
| 1897-04-03
| 1972-11-30
| ''[[:d:Q5208304|Dafen]]''
|-
| style='text-align:right'| 3096
| ''[[:d:Q5487506|Frank Jackett]]''
|
| 1927-07-05
| 2010-04-14
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 3097
| ''[[:d:Q5488213|Frank Matson]]''
|
| 1905-11-21
| 1985
| [[Cairdiff]]
|-
| style='text-align:right'| 3098
| ''[[:d:Q5488823|Frank Osmond]]''
|
| 1920
| 1973-01
| [[Newport]]
|-
| style='text-align:right'| 3099
| ''[[:d:Q5488892|Frank Parkin]]''
|
| 1931-05-26
| 2011-09-14
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3100
| ''[[:d:Q5488912|Philip Caveney]]''
|
| 1951
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 3101
| ''[[:d:Q5488986|Frank Phillips]]''
|
| 1873-04-11
| 1955-03-05
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 3102
| ''[[:d:Q5489069|Frank Powell]]''
|
| 1883-10-01
| 1946-12
| [[Cairdiff]]
|-
| style='text-align:right'| 3103
| ''[[:d:Q5489150|Frank Rankmore]]''
|
| 1939-07-21
| 2022-11-28
| [[Cairdiff]]
|-
| style='text-align:right'| 3104
| ''[[:d:Q5489556|Frank Shugars]]''
| [[File:FrankShugars.jpeg|center|128px]]
| 1875-09-22
| 1953-06-16
| [[Pontypridd]]
|-
| style='text-align:right'| 3105
| ''[[:d:Q5490110|Frank Vickery]]''
|
| 1951-06-26
| 2018-06-19
| ''[[:d:Q4923806|Blaencwm]]''
|-
| style='text-align:right'| 3106
| ''[[:d:Q5490126|Frank Vining]]''
|
| 1924-02-29
| 1989-10-27
| ''[[:d:Q3244565|Aberfan]]''
|-
| style='text-align:right'| 3107
| ''[[:d:Q5490324|Frank Whitcombe]]''
|
| 1913-05-29
| 1958-01-17
| ''[[:d:Q5595745|Grangetown]]''
|-
| style='text-align:right'| 3108
| ''[[:d:Q5490382|Frank Williams]]''
|
| 1906-03-10
| 1982
| ''[[:d:Q5057245|Cefn-y-bedd]]''
|-
| style='text-align:right'| 3109
| ''[[:d:Q5490389|Frank Williams]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3110
| ''[[:d:Q5490423|Frank Wilson]]''
|
| 1944-04-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3111
| ''[[:d:Q5490493|Frank Wrentmore]]''
|
| 1884
|
| [[Pontypridd]]
|-
| style='text-align:right'| 3112
| ''[[:d:Q5490537|Frank Young]]''
|
| 1885
| 1941
| [[Cairdiff]]
|-
| style='text-align:right'| 3113
| ''[[:d:Q5491049|Frankie Prince]]''
|
| 1949-12-01
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 3114
| ''[[:d:Q5494458|Fred Andrews]]''
|
| 1864-09-15
| 1929-06-02
| [[Swansea]]
|-
| style='text-align:right'| 3115
| ''[[:d:Q5494638|Fred Birt]]''
|
| 1886-11-10
| 1956-07-05
| [[Newport]]
|-
| style='text-align:right'| 3116
| ''[[:d:Q5494964|Fred Davies]]''
|
| 1871
|
| [[Welshpool]]
|-
| style='text-align:right'| 3117
| ''[[:d:Q5495031|Fred Dyer]]''
| [[File:Fred Dyer - Welsh boxer.jpg|center|128px]]
| 1888-04-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3118
| ''[[:d:Q5495274|Fred Godfrey]]''
|
| 1880-09-17
| 1953-02-22
| [[Swansea]]
|-
| style='text-align:right'| 3119
| ''[[:d:Q5495313|Fred Griffiths]]''
|
| 1873-09-13
| 1917-10-30
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 3120
| ''[[:d:Q5495365|Fred Hando]]''
|
| 1888-03-23
| 1970-02-17
| [[Newport]]
|-
| style='text-align:right'| 3121
| ''[[:d:Q5495472|Fred Hole]]''
|
| 1935-05-08
| 2011-02-04
| [[Cairdiff]]
|-
| style='text-align:right'| 3122
| ''[[:d:Q5495530|Fred Hutchinson]]''
| [[File:Fred Hutchinson (rygbi).jpg|center|128px]]
| 1867
| 1941
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3123
| ''[[:d:Q5495593|Fred Jones]]''
|
| 1867-01
| 1910-12-27
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 3124
| ''[[:d:Q5495604|Fred Jones]]''
|
| 1938-01-11
| 2013-03-22
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 3125
| ''[[:d:Q5495622|Fred Jowett]]''
|
| 1879
| 1939-10-05
| [[Swansea]]
|-
| style='text-align:right'| 3126
| ''[[:d:Q5495881|Fred Mathias]]''
|
| 1898-08-07
| 1955-04-19
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 3127
| ''[[:d:Q5496060|Fred Perrett]]''
|
| 1891-05-09
| 1918-12-01
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 3128
| ''[[:d:Q5496211|Fred Samuel]]''
|
| 1897-01-08
| 1941
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3129
| ''[[:d:Q5496251|Fred Sheldon]]''
|
| 20th century
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 3130
| ''[[:d:Q5496283|Fred Smallwood]]''
|
| 1910-09-16
| 1965-12-01
| ''[[:d:Q16963321|Brynteg]]''
|-
| style='text-align:right'| 3131
| ''[[:d:Q5496333|Fred Stansfield]]''
|
| 1917-12-12
| 2014-03-30
| [[Cairdiff]]
|-
| style='text-align:right'| 3132
| ''[[:d:Q5496506|Fred Warren]]''
|
| 1907-12-23
| 1986
| [[Cairdiff]]
|-
| style='text-align:right'| 3133
| ''[[:d:Q5496831|Freddie Williams]]''
|
| 1926-03-12
| 2013-01-20
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 3134
| ''[[:d:Q5496892|Freddy Morgan]]''
|
| 1908
| 1990
| ''[[:d:Q3401786|Gilfach Goch]]''
|-
| style='text-align:right'| 3135
| ''[[:d:Q5497346|Frederick Barter]]''
| [[File:Frederick Barter.jpg|center|128px]]
| 1891-01-17
| 1953-05-15
| [[Cairdiff]]
|-
| style='text-align:right'| 3136
| ''[[:d:Q5497427|Frederick Brown]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3137
| ''[[:d:Q5498030|Frederick Higginson]]''
|
| 1913-02-17
| 2003-02-12
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 3138
| ''[[:d:Q5498073|Frederick Hughes]]''
|
|
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3139
| ''[[:d:Q5498286|Frederick Llewellyn-Jones]]''
|
| 1866-04-18
| 1941-01-11
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 3140
| ''[[:d:Q5498353|Frederick Margrave]]''
|
| 1858-12-25
| 1946-01-01
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3141
| ''[[:d:Q5498509|Frederick Palmer]]''
| [[File:Engineer Frederick Palmer.png|center|128px]]
| 1862-01-31
| 1934-04-07
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 3142
| ''[[:d:Q5498557|Frederick Phillips]]''
|
| 1884-03-13
| 1948-01-19
| [[Newport]]
|-
| style='text-align:right'| 3143
| ''[[:d:Q5498664|Frederick Rosier]]''
| [[File:Apr 95 Rosiers St Clement Danes cropsm.jpg|center|128px]]
| 1915-10-13
| 1998-09-10
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3144
| ''[[:d:Q5498740|Frederick Smart]]''
|
|
|
| ''[[:d:Q3398389|Whitchurch]]''
|-
| style='text-align:right'| 3145
| ''[[:d:Q5498823|Frederick Talbot]]''
|
| 1908
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 3146
| ''[[:d:Q5499041|Frederick Wilding]]''
| [[File:Frederick wilding.jpg|center|128px]]
| 1852-11-20
| 1945-07-05
| ''[[:d:Q1311946|Trefaldwyn]]''
|-
| style='text-align:right'| 3147
| ''[[:d:Q5499127|Frederick Willis]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3148
| ''[[:d:Q5515655|Gabriel Goodman]]''
| [[File:Gabriel Goodman by GP Harding.jpg|center|128px]]
| 1528-11-06
| 1601-06-17
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 3149
| ''[[:d:Q5516960|Gai Toms]]''
| [[File:Gai Toms.jpg|center|128px]]
| 1976-09-14
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3150
| ''[[:d:Q5522758|Garel Rhys]]''
|
| 1940-02-28
| 2017-02-21
| [[Swansea]]
|-
| style='text-align:right'| 3151
| ''[[:d:Q5522777|Gareth Abraham]]''
|
| 1969-02-13
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3152
| ''[[:d:Q5522779|Gareth Alban Davies]]''
|
| 1926-07-30
| 2009-06-15
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 3153
| ''[[:d:Q5522783|Gareth Armstrong]]''
|
| 1948-09-28<br/>1948-06-25
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 3154
| ''[[:d:Q5522787|Gareth Baber]]''
| [[File:Gareth Baber 2018.jpg|center|128px]]
| 1972-05-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3155
| ''[[:d:Q5522798|Gareth Chapman]]''
|
| 1981-04-16
|
| [[Newport]]
|-
| style='text-align:right'| 3156
| ''[[:d:Q5522812|Gareth Davies]]''
|
| 1975-02-16
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 3157
| ''[[:d:Q5522815|Gareth Davies]]''
|
| 1949-07-11
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3158
| ''[[:d:Q5522816|Gareth Davies]]''
|
| 1959-10-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3159
| ''[[:d:Q5522819|Gareth Davies]]''
|
| 1973-08-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3160
| ''[[:d:Q5522821|Gareth Davies]]''
|
| 1984-03-02
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 3161
| ''[[:d:Q5522825|Gareth Dean]]''
|
| 1981-03-31
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 3162
| ''[[:d:Q5522829|Gareth Edwards]]''
|
| 1976-11-13
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3163
| ''[[:d:Q5522834|Gareth Evans]]''
|
| 1987-01-10
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3164
| ''[[:d:Q5522851|Gareth Glyn]]''
| [[File:Gareth2011small.jpg|center|128px]]
| 1951-07-02
|
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 3165
| ''[[:d:Q5522852|Gareth Griffiths]]''
|
| 1931-11-27
| 2016-12-08
| [[Penygraig]]
|-
| style='text-align:right'| 3166
| ''[[:d:Q5522855|Gareth Gwynn]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 3167
| ''[[:d:Q5522867|Gareth Holgate]]''
|
| 1987-12-03
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3168
| ''[[:d:Q5522872|Gareth Hughes]]''
| [[File:Garethhughes.jpg|center|128px]]
| 1894-08-23
| 1965-10-01
| ''[[:d:Q5208304|Dafen]]''
|-
| style='text-align:right'| 3169
| ''[[:d:Q5522878|Gareth Jelleyman]]''
|
| 1980-11-14
|
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 3170
| ''[[:d:Q5522880|Gareth Jewell]]''
|
| 1983-06-07
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 3171
| ''[[:d:Q5522883|Gareth Jones]]''
|
| 1939-05-14
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 3172
| ''[[:d:Q5522889|Gareth Jones]]''
|
| 1979-12-04
| 2008-06-16
| [[Pontypridd]]
|-
| style='text-align:right'| 3173
| ''[[:d:Q5522905|Gareth Maule]]''
|
| 1987-12-04
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3174
| ''[[:d:Q5522934|Gareth Owen]]''
|
| 1988-11-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3175
| ''[[:d:Q5522939|Gareth Payne]]''
|
| 1935-09-08
| 2004-07-02
| ''[[:d:Q7837990|Trelewis]]''
|-
| style='text-align:right'| 3176
| ''[[:d:Q5522946|Gareth Price]]''
|
| 1980-08-26
|
| [[Swansea]]
|-
| style='text-align:right'| 3177
| ''[[:d:Q5522947|Gareth Price]]''
|
| 1917-08-18
| 1992-07-19
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3178
| ''[[:d:Q5522948|Gareth Pierce]]''
| [[File:Gareth Pierce 2023.jpg|center|128px]]
| 1981-02-19
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 3179
| ''[[:d:Q5522951|Gareth Rees]]''
|
| 1985-04-08
|
| [[Swansea]]
|-
| style='text-align:right'| 3180
| ''[[:d:Q5522960|Gareth Roberts]]''
|
| 1940-05-16
| 2007-02-06
| ''[[:d:Q2653611|Penmaenmawr]]''
|-
| style='text-align:right'| 3181
| ''[[:d:Q5522966|Gareth Salisbury]]''
|
| 1941-03-11
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3182
| ''[[:d:Q5522982|Gareth Thomas]]''
| [[File:Gareth Thomas Clwyd and Aberconwy Count National Assembly Election 2016.JPG|center|128px]]
| 1954-09-25
|
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 3183
| ''[[:d:Q5522989|Gareth Walters]]''
|
| 1928-12-27
| 2012-05-31
| [[Swansea]]
|-
| style='text-align:right'| 3184
| ''[[:d:Q5523005|Gareth Williams]]''
|
| 1988-03-07
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3185
| ''[[:d:Q5523710|Garnon Davies]]''
| [[File:Garnon Davies.jpg|center|128px]]
| 1982-12-16<br/>1983-12-16
|
| ''[[:d:Q3400823|Pîl]]''
|-
| style='text-align:right'| 3186
| ''[[:d:Q5524223|Garry Shephard]]''
|
| 1976-03-30
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3187
| ''[[:d:Q5524777|Gary Buckland]]''
|
| 1986-06-12
|
| ''[[:d:Q7379326|Rumney]]''
|-
| style='text-align:right'| 3188
| ''[[:d:Q5525024|Gary Emmanuel]]''
|
| 1954-02-01
|
| [[Swansea]]
|-
| style='text-align:right'| 3189
| ''[[:d:Q5525472|Gary Ley]]''
|
| 1956
|
| [[Swansea]]
|-
| style='text-align:right'| 3190
| ''[[:d:Q5525478|Gary Lockett]]''
|
| 1976-11-25
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 3191
| ''[[:d:Q5525700|Gary Owen]]''
|
| 1972
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3192
| ''[[:d:Q5525727|Gary Pearce]]''
|
| 1960-11-11
|
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 3193
| ''[[:d:Q5525779|Gary Powell]]''
|
| 1979-10-30
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 3194
| ''[[:d:Q5525836|Gary Roberts]]''
|
| 1959-04-05
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 3195
| ''[[:d:Q5526231|Garyn Preen]]''
|
| 1991-10-25
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 3196
| ''[[:d:Q5526232|Garyn Lucas]]''
|
| 20th century
|
| ''[[:d:Q7321615|Rhydyfelin]]''
|-
| style='text-align:right'| 3197
| ''[[:d:Q5528098|Gavin Cattle]]''
|
| 1980-04-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3198
| ''[[:d:Q5534081|Geoff Charles]]''
| [[File:Geoff Charles self portrait, 1945.jpg|center|128px]]
| 1909-01-28
| 2002-03-07
| ''[[:d:Q4980803|Brymbo]]''
|-
| style='text-align:right'| 3199
| ''[[:d:Q5534127|Geoff Ellis]]''
|
| 1950-05-24
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 3200
| ''[[:d:Q5534167|Geoff Holder]]''
| [[File:Geoffholderlibrary.png|center|128px]]
| 1958
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3201
| ''[[:d:Q5534202|Geoff Lewis]]''
|
| 1935-12-21<br/>1935
|
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 3202
| ''[[:d:Q5534703|Geoffrey James]]''
|
| 1942-01-09
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3203
| ''[[:d:Q5534908|Geoffrey Somerset, 6th Baron Raglan]]''
|
| 1932-08-29
|
| ''[[:d:Q5057283|Cefntilla Court]]''
|-
| style='text-align:right'| 3204
| ''[[:d:Q5534927|Geoffrey Price Thomas]]''
|
| 1941-07-03
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3205
| ''[[:d:Q5536260|George Andrews]]''
|
| 1904-08-24
| 1989-12-28
| [[Newport]]
|-
| style='text-align:right'| 3206
| ''[[:d:Q5536664|George Ballsom]]''
|
| 1912-10-30
| 1983
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 3207
| ''[[:d:Q5536893|George Bennet]]''
|
| 1913-07-08
| 1970-08-31
| ''[[:d:Q5468045|Forden]]''
|-
| style='text-align:right'| 3208
| ''[[:d:Q5536905|George Benson]]''
|
| 1911-01-11
| 1983-06-17
| [[Cairdiff]]
|-
| style='text-align:right'| 3209
| ''[[:d:Q5537002|George Bishop]]''
|
| 1901
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 3210
| ''[[:d:Q5537937|George Clark Williams]]''
|
| 1878-11-02
| 1958-10-15
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3211
| ''[[:d:Q5538123|George Cording]]''
|
| 1878-01-01
| 1946-02-02
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 3212
| ''[[:d:Q5538555|George Dobson]]''
| [[File:George Dobson.jpg|center|128px]]
| 1873
| 1917-06-08
| [[Pontypridd]]
|-
| style='text-align:right'| 3213
| ''[[:d:Q5538902|George Edwards]]''
|
| 1920-12-02
| 2008-10-21
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 3214
| ''[[:d:Q5539049|George Evans]]''
|
| 1935-07-06
| 2000-12
| ''[[:d:Q7321505|Rhostyllen]]''
|-
| style='text-align:right'| 3215
| ''[[:d:Q5539058|George Ewart Evans]]''
|
| 1909-04-01
| 1988-01-11
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 3216
| ''[[:d:Q5539858|George Grant Francis]]''
|
| 1814-01
| 1882-04-21
| [[Swansea]]
|-
| style='text-align:right'| 3217
| ''[[:d:Q5539921|George Griffith]]''
| [[File:George Griffith DD, Bp of St Asaph.jpg|center|128px]]
| 1601
| 1666-11
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 3218
| ''[[:d:Q5539968|George Gummer]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3219
| ''[[:d:Q5540341|George Hay Morgan]]''
| [[File:1906 George Hay Morgan MP.jpg|center|128px]]
| 1866
| 1931-01-24
| ''[[:d:Q174734|Hay-on-Wye]]''
|-
| style='text-align:right'| 3220
| ''[[:d:Q5540434|George Henry Challenger]]''
|
| 1881-06-03
| 1947-12
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3221
| ''[[:d:Q5540460|George Henry Hall, 1st Viscount Hall]]''
| [[File:George Henry Hall 1945.jpg|center|128px]]
| 1881-12-31
| 1965-11-08
| ''[[:d:Q7164562|Penrhiw-ceibr]]''
|-
| style='text-align:right'| 3222
| ''[[:d:Q5540799|George Howells]]''
|
| 1871-05-11
| 1955-11-07
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 3223
| ''[[:d:Q5541549|George Latham]]''
| [[File:George Latham.jpg|center|128px]]
| 1881-01-01
| 1939-07-09
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 3224
| ''[[:d:Q5541703|George Lewis]]''
|
| 1913-10-20
| 1981-08-06
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 3225
| ''[[:d:Q5541706|George Lewis]]''
|
| 1901
| 1988
| [[Wales]]
|-
| style='text-align:right'| 3226
| ''[[:d:Q5541768|George Littlewood Hirst]]''
|
| 1890-05-05
| 1967-07-30
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 3227
| ''[[:d:Q5541799|George Lockwood Morris]]''
| [[File:George Lockwood Morris.jpg|center|128px]]
| 1859-01-29
| 1947-11-23
| [[Swansea]]
|-
| style='text-align:right'| 3228
| ''[[:d:Q5541851|George Lowrie]]''
|
| 1919-12-19
| 1989-05-03
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 3229
| ''[[:d:Q5542118|George Manning]]''
| [[File:George Manning, 1938.jpg|center|128px]]
| 1887-02-11
| 1976-12-29
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 3230
| ''[[:d:Q5542707|George Murphy]]''
|
| 1915-07-22
| 1983-12
| ''[[:d:Q7975053|Wattsville]]''
|-
| style='text-align:right'| 3231
| ''[[:d:Q5543029|George Oliver]]''
|
| 1891-04-03
| 1977-07-21
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3232
| ''[[:d:Q5543080|George Owens]]''
|
| 1894-11-26
| 1978-12
| [[Wales]]
|-
| style='text-align:right'| 3233
| ''[[:d:Q5543081|George Owen]]''
|
| 1552
| 1613-08-26
| ''[[:d:Q1936328|Nevern]]''
|-
| style='text-align:right'| 3234
| ''[[:d:Q5543567|George Prowse]]''
| [[File:George Prowse VC.jpg|center|128px]]
| 1886-08-29
| 1918-09-27
| ''[[:d:Q3401786|Gilfach Goch]]''
|-
| style='text-align:right'| 3235
| ''[[:d:Q5543769|George Reed]]''
|
| 1906-08-08
| 1988-12-11
| ''[[:d:Q390036|Sain Ffagan]]''
|-
| style='text-align:right'| 3236
| ''[[:d:Q5543824|George Reynolds]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 3237
| ''[[:d:Q5543939|George Robert Wythen Baxter]]''
| [[File:George Robert Wythen Baxter.jpg|center|128px]]
| 1814-06-14
| 1854-01-17
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 3238
| ''[[:d:Q5544086|George Rowles]]''
|
| 1866
| 1922-09-12
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3239
| ''[[:d:Q5544096|George Ruddick]]''
|
| 1881
| 1949
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 3240
| ''[[:d:Q5544476|George Shaw]]''
|
| 1931-10-24
| 1984-08-02
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 3241
| ''[[:d:Q5544970|George Sutton]]''
|
| 1922-09-15
| 1995-12-01
| [[Cairdiff]]
|-
| style='text-align:right'| 3242
| ''[[:d:Q5545141|George Thomas]]''
|
| 1930-06-25
| 2014-02
| [[Cairdiff]]
|-
| style='text-align:right'| 3243
| ''[[:d:Q5545143|George Thomas]]''
|
| 1881
| 1916
| ''[[:d:Q7228313|Pontnewydd]]''
|-
| style='text-align:right'| 3244
| ''[[:d:Q5545144|George Thomas]]''
|
| 1857
| 1934-06-14
| [[Newport]]
|-
| style='text-align:right'| 3245
| ''[[:d:Q5545309|George Trefgarne, 1st Baron Trefgarne]]''
| [[File:George-Morgan-Trefgarne-n-Garro-Jones-1st-Baron-Trefgarne.jpg|center|128px]]
| 1894-09-14
| 1960-09-27
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3246
| ''[[:d:Q5545378|George Tuxford]]''
|
| 1870-02-07
| 1942-01-30
| ''[[:d:Q13130691|Penmorfa]]''
|-
| style='text-align:right'| 3247
| ''[[:d:Q5545871|George Warburton]]''
|
| 1934-09-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3248
| ''[[:d:Q5546209|George Whitcombe]]''
| [[File:George Whitcombe.jpg|center|128px]]
| 1902-01-21
| 1986-04-30
| [[Cairdiff]]
|-
| style='text-align:right'| 3249
| ''[[:d:Q5546236|George Whitney]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3250
| ''[[:d:Q5546252|George Wightwick]]''
|
| 1802-08-26
| 1872-07-09
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 3251
| ''[[:d:Q5546607|George Young]]''
|
| 1950-01-05
|
| [[Newport]]
|-
| style='text-align:right'| 3252
| ''[[:d:Q5546629|George Zambellas]]''
| [[File:First Sea Lord Admiral Sir George Zambellas KCB DSC ADC MOD 45155508.jpg|center|128px]]
| 1958-04-04
|
| [[Swansea]]
|-
| style='text-align:right'| 3253
| ''[[:d:Q5546680|George de Cantilupe]]''
|
| 1252
| 1273
| ''[[:d:Q4667087|Abergavenny Castle]]''
|-
| style='text-align:right'| 3254
| ''[[:d:Q5547526|Georgia Henshaw]]''
|
| 1993-07-11
|
| [[Swansea]]
|-
| style='text-align:right'| 3255
| ''[[:d:Q5548803|Geraint Davies]]''
| [[File:Geraint Davies.JPG|center|128px]]
| 1986-03-07
|
| [[Swansea]]
|-
| style='text-align:right'| 3256
| ''[[:d:Q5548804|Geraint F. Lewis]]''
| [[File:2012-09-17 Prof Geraint Lewis Cropped.png|center|128px]]
| 1969-03-14
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3257
| ''[[:d:Q5548806|Geraint Goodwin]]''
|
| 1903-05-01
| 1942-10-10
| ''[[:d:Q13129664|Llanllwchaiarn]]''
|-
| style='text-align:right'| 3258
| ''[[:d:Q5548808|Geraint Davies]]''
| [[File:Geraint Davies (Rhondda).jpg|center|128px]]
| 1948-12-01
|
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 3259
| ''[[:d:Q5548819|Geraint Lloyd Owen]]''
|
| 1941-05-15
|
| ''[[:d:Q13131214|Sarnau]]''
|-
| style='text-align:right'| 3260
| ''[[:d:Q5548821|Geraint Morris]]''
|
| 1941-03-28
| 1997-07-12
| [[Wales]]
|-
| style='text-align:right'| 3261
| ''[[:d:Q5548829|Geraint Wyn Davies]]''
| [[File:Geraint Wyn Davies 2004.JPG|center|128px]]
| 1957-04-20
|
| [[Swansea]]
|-
| style='text-align:right'| 3262
| ''[[:d:Q5549028|Gerald Cordle]]''
|
| 1960-09-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3263
| ''[[:d:Q5549181|Gerald Gladstone]]''
|
| 1901-10-03
| 1978-07-11
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 3264
| ''[[:d:Q5549216|Gerald Hamer]]''
|
| 1886-11-16
| 1972-07-06
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 3265
| ''[[:d:Q5549841|Gerallt Lloyd Owen]]''
|
| 1944-11-06
| 2014-07-15
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 3266
| ''[[:d:Q5553517|Gerwyn Edwards]]''
|
| 1953-06-22
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 3267
| ''[[:d:Q5554439|Gethin Jones]]''
|
| 1981-08-08
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3268
| ''[[:d:Q5554440|Gethin ap Gruffydd]]''
|
|
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3269
| ''[[:d:Q5554442|Gethin Robinson]]''
|
| 1982-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3270
| ''[[:d:Q5558035|Gian M. Fulgoni]]''
| [[File:ComScoreFulgoni.jpg|center|128px]]
| 1948-01-24
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3271
| ''[[:d:Q5561126|Gilbert Morgan]]''
|
| 1908-04-15
| 1973-08-11
| ''[[:d:Q6661603|Llanhilleth]]''
|-
| style='text-align:right'| 3272
| ''[[:d:Q5562222|Gillian Clarke]]''
|
| 1937-06-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3273
| ''[[:d:Q5562229|Gillian Elisa]]''
|
| 1953-08-10
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3274
| ''[[:d:Q5563045|Ginger Jones]]''
|
| 1905
| 1986
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 3275
| ''[[:d:Q5563602|Giotto Griffiths]]''
|
| 1864-09-15
| 1938-07-22
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3276
| ''[[:d:Q5564080|Gipsy Daniels]]''
|
| 1903-02-09
| 1967-06
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3277
| ''[[:d:Q5566441|Gladys Morgan]]''
|
| 1898-11-07
| 1983-04-16
| [[Swansea]]
|-
| style='text-align:right'| 3278
| ''[[:d:Q5566655|Glanville Williams]]''
|
| 1911-02-15
| 1997-04-10
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3279
| ''[[:d:Q5567906|Glen Moody]]''
|
| 1909
| 1989
| [[Pontypridd]]
|-
| style='text-align:right'| 3280
| ''[[:d:Q5568095|Glen Webbe]]''
|
| 1962-01-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3281
| ''[[:d:Q5569151|Glenn Tolley]]''
|
| 1983-09-24
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 3282
| ''[[:d:Q5572832|Glyn Berry]]''
|
| 1946-06-14
| 2006-01-15
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 3283
| ''[[:d:Q5572834|Glyn Davidge]]''
|
| 1933-12-31
| 2006-03-18
| [[Newport]]
|-
| style='text-align:right'| 3284
| ''[[:d:Q5572840|Glyn Garner]]''
| [[File:Glyn Garner.JPG|center|128px]]
| 1976-12-09
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3285
| ''[[:d:Q5572845|Glyn James]]''
|
| 1941-12-17
|
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 3286
| ''[[:d:Q5572850|Glyn Jones]]''
|
| 1958<br/>1959-03-29
|
| [[Newport]]
|-
| style='text-align:right'| 3287
| ''[[:d:Q5572853|Glyn Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3288
| ''[[:d:Q5572857|Glyn Jones]]''
|
| 1905-02-28
| 1995-04-10
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3289
| ''[[:d:Q5572861|Glyn Mathias]]''
|
| 1945-02-19
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 3290
| ''[[:d:Q5572864|Glyn Morgan]]''
|
|
|
| [[Penygraig]]
|-
| style='text-align:right'| 3291
| ''[[:d:Q5572880|Glyn Prosser]]''
|
| 1907-11-27
| 1972-11-13
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 3292
| ''[[:d:Q5572883|Glyn Samuel]]''
|
| 1917-10-26
| 1985-04-14
| [[Swansea]]
|-
| style='text-align:right'| 3293
| ''[[:d:Q5572885|Glyn Shaw]]''
|
| 1951-04-11
| 2022-05-10
| ''[[:d:Q258665|Rhigos]]''
|-
| style='text-align:right'| 3294
| ''[[:d:Q5572889|Glyn Stephens]]''
|
| 1891-11-29
| 1965-04-22
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3295
| ''[[:d:Q5572892|Glyn Taylor]]''
| [[File:GlynTaylor.jpg|center|128px]]
| 1953-08-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3296
| ''[[:d:Q5572896|Glyn Turner]]''
| [[File:Glyn Turner WRU Cap Presentaton 2013.jpg|center|128px]]
| 1947-03-22
|
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 3297
| ''[[:d:Q5572900|Glyn Williams]]''
|
| 1918-11-03
| 2011-05-11
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3298
| ''[[:d:Q5576447|Godfrey Goodman]]''
|
| 1582-02-28<br/>1583-02-28
| 1656-01-19
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 3299
| ''[[:d:Q5576469|Godfrey John]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3300
| ''[[:d:Q5576507|Godfrey Morgan, 1st Viscount Tredegar]]''
| [[File:The Viscount Tredegar.jpg|center|128px]]
| 1831-04-28
| 1913-03-11
| ''[[:d:Q2970467|Ruperra Castle]]''
|-
| style='text-align:right'| 3301
| ''[[:d:Q5581158|Gomer Gunn]]''
|
| 1885
| 1935
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 3302
| ''[[:d:Q5581165|Gomer Hughes]]''
|
| 1910-05-13
| 1974-11-14
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3303
| ''[[:d:Q5582130|Roy Booth]]''
|
| 1938-06-30
| 2024-02-23
| [[Flintshire]]
|-
| style='text-align:right'| 3304
| ''[[:d:Q5584853|Gordon Bastian]]''
|
| 1902-03-30
| 1987-11
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 3305
| ''[[:d:Q5584971|Gordon Child]]''
|
| 1939-11-07
|
| ''[[:d:Q24639697|Mumbles Head]]''
|-
| style='text-align:right'| 3306
| ''[[:d:Q5585060|Gordon Davies]]''
| [[File:Gordon Davies.jpg|center|128px]]
| 1955-08-03
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3307
| ''[[:d:Q5585440|Gordon Lang]]''
|
| 1893-02-25
| 1981-06-20
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 3308
| ''[[:d:Q5585456|Gordon Lewis]]''
|
| 1939-06-23
|
| ''[[:d:Q6947838|Mynyddygarreg]]''
|-
| style='text-align:right'| 3309
| ''[[:d:Q5585653|Gordon Parry, Baron Parry]]''
|
| 1925-11-30
| 2004-09-01
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 3310
| ''[[:d:Q5585662|Gordon Pembery]]''
|
| 1926-10-10
| 2013-03-12
| [[Cairdiff]]
|-
| style='text-align:right'| 3311
| ''[[:d:Q5585685|Gordon Pritchard]]''
|
| 1974-10-01
| 2006-01-31
| [[Cairdiff]]
|-
| style='text-align:right'| 3312
| ''[[:d:Q5585687|Gordon Pritchard]]''
|
| 1954-09-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3313
| ''[[:d:Q5585732|Gordon Richards]]''
|
| 1933-10-23
| 1993-11-17
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 3314
| ''[[:d:Q5586826|Goronwy Roberts, Baron Goronwy-Roberts]]''
| [[File:Goronwy Roberts.jpg|center|128px]]
| 1913-09-20
| 1981-07-23
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 3315
| ''[[:d:Q5591287|Grace McCleen]]''
| [[File:Grace McCleen.jpg|center|128px]]
| 1980-06-07
|
| [[Wales]]
|-
| style='text-align:right'| 3316
| ''[[:d:Q5592729|Graham Coldrick]]''
|
| 1945-11-06
|
| [[Newport]]
|-
| style='text-align:right'| 3317
| ''[[:d:Q5592776|Graham Dixon-Lewis]]''
|
| 1922-07-01
| 2010-08-05
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 3318
| ''[[:d:Q5592968|Graham Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3319
| ''[[:d:Q5592985|Graham Kingston]]''
|
| 1950-11-01
|
| [[Newport]]
|-
| style='text-align:right'| 3320
| ''[[:d:Q5593084|Graham Moore]]''
|
| 1941-03-07
| 2016-02-09
| ''[[:d:Q3401108|Hengoed]]''
|-
| style='text-align:right'| 3321
| ''[[:d:Q5593167|Graham Rathbone]]''
|
| 1942-08-22
| 2012-01-08
| [[Newport]]
|-
| style='text-align:right'| 3322
| ''[[:d:Q5593171|Graham Rees]]''
|
| 1936-04-18
| 1987-07
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3323
| ''[[:d:Q5593294|Graham Sutton]]''
|
| 1903-02-04
| 1977-05-26
| ''[[:d:Q5197235|Cwmcarn]]''
|-
| style='text-align:right'| 3324
| ''[[:d:Q5593332|Graham Walters]]''
|
| 1953-03-01
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3325
| ''[[:d:Q5593359|Graham Williams]]''
|
| 1936-12-31
| 2018-11-25
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3326
| ''[[:d:Q5593360|Graham Williams]]''
|
| 1938-04-02
|
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 3327
| ''[[:d:Q5593419|Grahame Hodgson]]''
|
| 1936-12-01
| 2016-01-23
| ''[[:d:Q7080139|Cwm Ogwr]]''
|-
| style='text-align:right'| 3328
| ''[[:d:Q5596323|Grant Llewellyn]]''
| [[File:Grant Llewellyn.jpg|center|128px]]
| 1960-12-29
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 3329
| ''[[:d:Q5596915|Granville James]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3330
| ''[[:d:Q5596946|Granville Smith]]''
|
| 1937-02-04
| 2024-08-22
| ''[[:d:Q7164562|Penrhiw-ceibr]]''
|-
| style='text-align:right'| 3331
| ''[[:d:Q5602580|Green Gartside]]''
| [[File:Green Gartside 2006.jpg|center|128px]]
| 1955-06-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3332
| ''[[:d:Q5605472|Greg Davies]]''
| [[File:GregDavies-byPhilipRomano.jpg|center|128px]]
| 1968-05-14
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3333
| ''[[:d:Q5606341|Greg Thomas]]''
|
| 1960-08-12
|
| ''[[:d:Q7837341|Trebanos]]''
|-
| style='text-align:right'| 3334
| ''[[:d:Q5606517|Gregg Coombes]]''
|
| 1988-03-01
|
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 3335
| ''[[:d:Q5606843|Gregory Cameron]]''
| [[File:Gregory-Cameron.jpg|center|128px]]
| 1959-06-06
|
| [[Wales]]
|-
| style='text-align:right'| 3336
| ''[[:d:Q5607529|Grenville Millington]]''
|
| 1951-12-10
|
| ''[[:d:Q2183255|Queensferry]]''
|-
| style='text-align:right'| 3337
| ''[[:d:Q5608863|Griffith Arthur Jones]]''
|
| 1827-07-16
| 1906-09-22
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 3338
| ''[[:d:Q5608882|Griffith Davies]]''
| [[File:Portrait of Griffith Davies, F.R.S. 1788-1855 (4671504) (cropped).jpg|center|128px]]
| 1788-12-05
| 1855-03-25
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 3339
| ''[[:d:Q5608888|Griffith Hartwell Jones]]''
| [[File:Griffith Hartwell Jones.jpg|center|128px]]
| 1859-04-16
| 1944
| [[Llanrhaeadr-ym-Mochnant]]
|-
| style='text-align:right'| 3340
| ''[[:d:Q5608910|Griffith Powell]]''
|
| 1561
| 1620-06-15
| ''[[:d:Q3406111|Llansawel]]''
|-
| style='text-align:right'| 3341
| ''[[:d:Q5608920|Griffith Rhys Jones]]''
| [[File:GriffithRhysJonesCaradogAberdare.jpg|center|128px]]
| 1834-12-21
| 1897-12-04
| ''[[:d:Q7837453|Trecynon]]''
|-
| style='text-align:right'| 3342
| ''[[:d:Q5610965|Howard Collins]]''
|
| 1949
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 3343
| ''[[:d:Q5611974|Gruffudd Gryg]]''
|
| 1310
| 1380
| [[Anglesey]]
|-
| style='text-align:right'| 3344
| ''[[:d:Q5611977|Gruffudd Hiraethog]]''
|
|
| 1564
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 3345
| ''[[:d:Q5611979|Gruffudd ab Owain Glyndŵr]]''
|
| 1375
| 1412
| [[Wales]]
|-
| style='text-align:right'| 3346
| ''[[:d:Q5615933|Lee Dainton]]''
|
| 1973-08-22
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3347
| ''[[:d:Q5616240|Ormonde Maddock Dalton]]''
|
| 1866
| 1945
| [[Cairdiff]]
|-
| style='text-align:right'| 3348
| ''[[:d:Q5617820|Thomas Witton Davies]]''
| [[File:T Witton Davies.jpg|center|128px]]
| 1851-02-28
| 1923-05-12
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 3349
| ''[[:d:Q5620625|Gus Broughton]]''
|
| 1904-04-29
| 1981-09-22
| ''[[:d:Q13644928|Llandough]]''
|-
| style='text-align:right'| 3350
| ''[[:d:Q5620755|Gus Risman]]''
|
| 1911-03-21
| 1994-10-17
| [[Cairdiff]]
|-
| style='text-align:right'| 3351
| ''[[:d:Q5621832|Guto'r Glyn]]''
|
| 1430s
| 1490s
| [[Wales]]
|-
| style='text-align:right'| 3352
| ''[[:d:Q5621836|Guto Harri]]''
| [[File:Guto Harri, 2015.jpg|center|128px]]
| 1966-07-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3353
| ''[[:d:Q5621838|Guto Pryce]]''
| [[File:Guto Pryce.jpg|center|128px]]
| 1972-09-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3354
| ''[[:d:Q5622295|Guy Griffiths]]''
|
| 1915-06-06
| 1999-07-12
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 3355
| ''[[:d:Q5622477|Guy Morgan]]''
|
| 1907-12-26
| 1973-07-29
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 3356
| ''[[:d:Q5623379|Gwawr Edwards]]''
|
| 1984
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 3357
| ''[[:d:Q5623469|Gwenan Edwards]]''
| [[File:Gwenan Edwards.jpg|center|128px]]
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3358
| ''[[:d:Q5623522|Gwenllwyfo]]''
|
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 3359
| ''[[:d:Q5623524|Gwenllian Lansdown]]''
|
| 1979
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3360
| ''[[:d:Q5623526|Gwenlyn Parry]]''
|
| 1932-06-08
| 1991-11-05
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 3361
| ''[[:d:Q5623534|Gwenno Teifi]]''
|
| 1987-02-04
|
| [[Wales]]
|-
| style='text-align:right'| 3362
| ''[[:d:Q5623555|Gwerful Mechain]]''
|
|
|
| ''[[:d:Q6804459|Mechain]]''
|-
| style='text-align:right'| 3363
| ''[[:d:Q5623556|Gwerful Fychan]]''
|
| 15th century
| 1490
| ''[[:d:Q7163095|Penllyn]]''
|-
| style='text-align:right'| 3364
| ''[[:d:Q5623621|Gwilym Edwards]]''
| [[File:Parchedig Gwilym Arthur Edwards, MA, DD, Athro yng Ngholeg y Bala (1929–1939), Prifathro yng Ngholeg Diwinyddol Aberystwyth (1939–1949) (gcf10121).jpg|center|128px]]
| 1881-05-31
| 1963-10-05
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3365
| ''[[:d:Q5623630|Gwilym Puw]]''
|
| 1618
| 1689
| ''[[:d:Q5184753|Creuddyn peninsula]]''
|-
| style='text-align:right'| 3366
| ''[[:d:Q5623632|Gwilym R. Jones]]''
|
| 1903-03-24
| 1993-07-29
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 3367
| ''[[:d:Q5623636|Gwilym Tew]]''
|
| 15th century
| 15th century
| ''[[:d:Q7809073|Tir Iarll]]''
|-
| style='text-align:right'| 3368
| ''[[:d:Q5623638|Gwilym Tilsley]]''
|
| 1911
| 1997
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 3369
| ''[[:d:Q5623678|Gwion Edwards]]''
| [[File:GwionEdwardsBntIps1.jpg|center|128px]]
| 1993-03-01
|
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 3370
| ''[[:d:Q5623679|Gwion Hallam]]''
|
| 1973-08-09
|
| [[Swansea]]
|-
| style='text-align:right'| 3371
| ''[[:d:Q5623765|Gwyn Davies]]''
|
| 1908-06-23
| 1992-07-14
| ''[[:d:Q4667120|Aberkenfig]]''
|-
| style='text-align:right'| 3372
| ''[[:d:Q5623767|Gwyn A. Williams]]''
|
| 1925-09-30
| 1995-11-16
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 3373
| ''[[:d:Q5623770|Gwyn Evans]]''
|
| 1957-09-06
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3374
| ''[[:d:Q5623771|Gwyn Francis]]''
|
| 1896-02-02
| 1987-05-07
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 3375
| ''[[:d:Q5623776|Gwyn Hughes]]''
|
| 1941-03-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3376
| ''[[:d:Q5623777|Gwyn Hughes]]''
|
| 1922-05-07
| 1999-03-14
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 3377
| ''[[:d:Q5623783|Gwyn Jones]]''
|
| 1912-02
|
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 3378
| ''[[:d:Q5623785|Gwyn Jones]]''
|
| 1935-03-20
| 2020-11-13
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 3379
| ''[[:d:Q5623786|Gwyn Jones]]''
|
| 1917-03-29
| 2006-07-03
| [[Cairdiff]]
|-
| style='text-align:right'| 3380
| ''[[:d:Q5623788|Gwyn Manning]]''
|
| 1915-08-19
| 2003-02
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3381
| ''[[:d:Q5623791|Gwyn Jones]]''
|
| 1972-10-05
|
| [[Swansea]]
|-
| style='text-align:right'| 3382
| ''[[:d:Q5623794|Gwyn Richards]]''
|
| 1905-12-22
| 1985-12-17
| ''[[:d:Q4980933|Bryncethin]]''
|-
| style='text-align:right'| 3383
| ''[[:d:Q5623795|Gwyn Richards]]''
|
| 1951-11-29
| 2023-10
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3384
| ''[[:d:Q5623796|Gwyn Morgan]]''
|
| 1954-05-28
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3385
| ''[[:d:Q5623802|Gwyn Thomas]]''
|
| 1957-09-26
|
| [[Swansea]]
|-
| style='text-align:right'| 3386
| ''[[:d:Q5623807|Gwyn Thomas]]''
|
| 1892
| 1984
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 3387
| ''[[:d:Q5623808|Gwyn Thomas]]''
|
| 1913-07-06
| 1981-04-13
| ''[[:d:Q5199740|Cymmer]]''
|-
| style='text-align:right'| 3388
| ''[[:d:Q5623809|Gwyn Thomas]]''
|
| 1936-09-02
| 2016-04-13
| ''[[:d:Q3398814|Tanygrisiau]]''
|-
| style='text-align:right'| 3389
| ''[[:d:Q5623810|Gwyn Williams]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3390
| ''[[:d:Q5623812|Gwyndaf Evans]]''
|
| 1959-06-04
|
| ''[[:d:Q5277968|Dinas Mawddwy]]''
|-
| style='text-align:right'| 3391
| ''[[:d:Q5623843|Gwyneth Keyworth]]''
|
| 1990-09-15
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 3392
| ''[[:d:Q5623859|Gwynfor Davies]]''
|
| 1908-08-12
| 1972-03-10
| ''[[:d:Q7417111|Sandy]]''
|-
| style='text-align:right'| 3393
| ''[[:d:Q5623862|Gwynfor Williams]]''
|
| 1956-02-01
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3394
| ''[[:d:Q5623872|Gwynn Evans]]''
|
| 1915-08-13
| 2001-04
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 3395
| ''[[:d:Q5623877|Gwynn Parry Jones]]''
|
| 1891-02-14
| 1963-12-26
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 3396
| ''[[:d:Q5623887|Gwynne Williams]]''
|
| 1937
|
| [[Wales]]
|-
| style='text-align:right'| 3397
| ''[[:d:Q5638525|Hagan Bayley]]''
|
| 1951-02-13
|
| [[Wales]]
|-
| style='text-align:right'| 3398
| ''[[:d:Q5638528|Hagan Evans]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3399
| ''[[:d:Q5648869|Hannah Keryakoplis]]''
|
| 1994-02-01
|
| ''[[:d:Q2752670|Penyffordd]]''
|-
| style='text-align:right'| 3400
| ''[[:d:Q5648940|Hannah Rich]]''
|
| 1991-01-03
|
| ''[[:d:Q7884080|Undy]]''
|-
| style='text-align:right'| 3401
| ''[[:d:Q5660102|Harold Bird-Wilson]]''
| [[File:Harold Bird-Wilson by Cuthbert Orde.jpg|center|128px]]
| 1919-11-20
| 2000-12-27
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 3402
| ''[[:d:Q5660453|Harold Davies]]''
|
| 1898-12-05
| 1976-03-02
| [[Newport]]
|-
| style='text-align:right'| 3403
| ''[[:d:Q5660490|Harold Dickinson]]''
|
| 1911-11-26
| 1997-06-02
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 3404
| ''[[:d:Q5660587|Harold Edwards]]''
|
| 1909-09-07
| 1993
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 3405
| ''[[:d:Q5661301|Harold Jones]]''
|
| 1907-12-22
| 1955-10-16
| ''[[:d:Q7080139|Cwm Ogwr]]''
|-
| style='text-align:right'| 3406
| ''[[:d:Q5661519|Harold Lloyd]]''
|
| 1920-03-12
| 1984
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 3407
| ''[[:d:Q5662786|Harold Williams]]''
|
| 1924-06-17
| 2014-09-12
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 3408
| ''[[:d:Q5667442|Harry Bowcott]]''
| [[File:Harry Bowcott 1930.jpg|center|128px]]
| 1907-04-30
| 2004-12-14
| [[Cairdiff]]
|-
| style='text-align:right'| 3409
| ''[[:d:Q5669252|Harry Greene]]''
|
| 1923-11-21
| 2013-03-04
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 3410
| ''[[:d:Q5669304|Harry Griffiths]]''
|
| 1931-01-04
| 1978-04-25
| [[Swansea]]
|-
| style='text-align:right'| 3411
| ''[[:d:Q5669329|Harry Guest]]''
| [[File:Harry 3 001.jpg|center|128px]]
| 1932
| 2021
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 3412
| ''[[:d:Q5669515|Harry Harris]]''
|
| 1933-11-02
| 2004-06-09
| ''[[:d:Q6732359|Magor]]''
|-
| style='text-align:right'| 3413
| ''[[:d:Q5669781|Harry Holt]]''
|
| 1889
| 1956
| [[Aberystwyth]]
|-
| style='text-align:right'| 3414
| ''[[:d:Q5670114|Harry Jones]]''
|
| 1922-10-06
| 1995-03-20
| ''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 3415
| ''[[:d:Q5670133|Harry Judge]]''
|
| 1928-08-01
| 2019-04-02
| [[Cairdiff]]
|-
| style='text-align:right'| 3416
| ''[[:d:Q5670978|Harry McDaniel]]''
|
|
| 1932-12-02
| [[Newport]]
|-
| style='text-align:right'| 3417
| ''[[:d:Q5671113|Harry Mills]]''
| [[File:Last Ministers UFO 1955.jpg|center|128px]]
| 1874
| 1959-12-20
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 3418
| ''[[:d:Q5671513|Harry Peacock]]''
|
| 1909-02-14
| 1996-03-06
| [[Newport]]
|-
| style='text-align:right'| 3419
| ''[[:d:Q5671568|Harry Phillips]]''
|
| 1903-06-22
| 1978-12-16
| [[Crosskeys]]
|-
| style='text-align:right'| 3420
| ''[[:d:Q5671750|Harry Pugh]]''
|
| 1875
| 1945
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3421
| ''[[:d:Q5671894|Harry Rees]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3422
| ''[[:d:Q5671999|Harry Robinson]]''
|
| 1993-04-16
|
| ''[[:d:Q7165336|Pentyrch]]''
|-
| style='text-align:right'| 3423
| ''[[:d:Q5672058|Harry Royal]]''
|
| 1914
|
| [[Wales]]
|-
| style='text-align:right'| 3424
| ''[[:d:Q5686436|Haydn Dackins]]''
|
| 1912-07-10
| 1943-08-02
| [[Pontypridd]]
|-
| style='text-align:right'| 3425
| ''[[:d:Q5686444|Haydn Davies]]''
|
| 1912-04-23
| 1993-09-04
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3426
| ''[[:d:Q5686464|Haydn Llewellyn Davies]]''
| [[File:Algoma Blue - Haydn Llewellyn Davies 1.jpg|center|128px]]
| 1921-11-11
| 2008-03-24
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 3427
| ''[[:d:Q5686472|Haydn Price]]''
|
| 1883
| 1964-03-07
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 3428
| ''[[:d:Q5701785|Helen Adams]]''
|
| 1978-05-30
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 3429
| ''[[:d:Q5702657|Helen Lederer]]''
| [[File:Helen Lederer in 2010.jpg|center|128px]]
| 1954-09-24
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3430
| ''[[:d:Q5717896|Henry Bayly]]''
|
| 1769
| 1846-04-20
| ''[[:d:Q7201721|Plas Newydd]]''
|-
| style='text-align:right'| 3431
| ''[[:d:Q5718742|Henry Bruce, 2nd Baron Aberdare]]''
| [[File:Oswald Hornby Joseph Birley (1880–1952) - Henry Campbell Bruce (1851–1929), 2nd Baron Aberdare - NMW A 1705 - National Museum Cardiff.jpg|center|128px]]
| 1851-06-19
| 1929-02-20
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 3432
| ''[[:d:Q5720203|Henry Davies]]''
|
| 1865-02-02
| 1934-12-04
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 3433
| ''[[:d:Q5720773|Henry Edwards]]''
| [[File:Henry Thomas Edwards.jpg|center|128px]]
| 1837-09-06
| 1884-05-24
| ''[[:d:Q3402405|Llanymawddwy]]''
|-
| style='text-align:right'| 3434
| ''[[:d:Q5720858|Henry English Fulford]]''
|
| 1859
| 1929-05-15
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 3435
| ''[[:d:Q5722774|Henry Haydn Jones]]''
| [[File:Henry-Haydn-Jones.jpg|center|128px]]
| 1863-12-27
| 1950-07-02
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 3436
| ''[[:d:Q5722978|Henry Hicks]]''
| [[File:Henry Hicks (geologist).jpg|center|128px]]
| 1837-05-26
| 1899-11-18
| [[St Davids]]
|-
| style='text-align:right'| 3437
| ''[[:d:Q5724046|Henry Jones]]''
|
| 1812
| 1891-07-12
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 3438
| ''[[:d:Q5724643|Henry Lannigan]]''
|
| 1863
| 1930-12-24
| [[Wales]]
|-
| style='text-align:right'| 3439
| ''[[:d:Q5724892|Henry Lewis]]''
|
| 1889-08-21
| 1968-01-14
| [[Swansea]]
|-
| style='text-align:right'| 3440
| ''[[:d:Q5724898|Henry Lewis Guy]]''
|
| 1887-06-15
| 1956-07-20
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 3441
| ''[[:d:Q5725614|Henry Maurice]]''
|
| 1634
| 1682-07-30
| ''[[:d:Q2556821|Aberdaron]]''
|-
| style='text-align:right'| 3442
| ''[[:d:Q5726020|Henry Morgan]]''
|
|
| 1559-12-23
| ''[[:d:Q5268253|Dewisland]]''
|-
| style='text-align:right'| 3443
| ''[[:d:Q5726568|Henry Owen]]''
| [[File:Portrait of Rev. Henry Owen, M.D (4671718) (cropped).jpg|center|128px]]
| 1716
| 1795-10-14
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 3444
| ''[[:d:Q5726649|Henry Paget]]''
| [[File:Henry Paget, 1st Earl of Uxbridge Romney.jpg|center|128px]]
| 1744-06-18
| 1812-03-13<br/>1812
| ''[[:d:Q3404314|Llanddaniel Fab]]''
|-
| style='text-align:right'| 3445
| ''[[:d:Q5726737|Henry Parry]]''
| [[File:Portrait of Revd. Henry Parry (4671746) (cropped).jpg|center|128px]]
| 1766
| 1854-12-17
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 3446
| ''[[:d:Q5727523|Henry Richard]]''
| [[File:Henry Richard Esq MP.jpg|center|128px]]
| 1812-04-03
| 1888-08-20
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 3447
| ''[[:d:Q5727766|Henry Rowlands]]''
|
| 1551
| 1616-07-06
| ''[[:d:Q3398367|Sarn Meyllteyrn]]''
|-
| style='text-align:right'| 3448
| ''[[:d:Q5729799|Henry Walter]]''
|
| 1611
| 1678
| ''[[:d:Q7191844|Piercefield House]]''
|-
| style='text-align:right'| 3449
| ''[[:d:Q5729939|Henry Weale]]''
|
| 1897-10-02
| 1959-01-13
| ''[[:d:Q2355142|Shotton]]''
|-
| style='text-align:right'| 3450
| ''[[:d:Q5734947|Herbert Lewis]]''
| [[File:Mr. J Herbert Lewis Y.H.jpg|center|128px]]
| 1858-12-27
| 1933-11-10
| ''[[:d:Q2424760|Mostyn]]''
|-
| style='text-align:right'| 3451
| ''[[:d:Q5735196|Isambard Owen]]''
| [[File:Isambard Owen.jpg|center|128px]]
| 1850-12-28<br/>1857
| 1927-01-14<br/>1927
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 3452
| ''[[:d:Q5735218|Douglas Foley]]''
| [[File:Douglas Foley.jpg|center|128px]]
| 1949
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3453
| ''[[:d:Q5735948|Herbert Wilson]]''
|
| 1929-03-20
| 2008-05-22
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 3454
| ''[[:d:Q5736088|Herbie Evans]]''
| [[File:Evans, Herbie.jpg|center|128px]]
| 1894-08-30
| 1982-11-19
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 3455
| ''[[:d:Q5736164|Herbie Williams]]''
|
| 1940-10-06
|
| [[Swansea]]
|-
| style='text-align:right'| 3456
| ''[[:d:Q5739697|Michael Francis]]''
|
| 1979
|
| [[Wales]]
|-
| style='text-align:right'| 3457
| ''[[:d:Q5761498|Hilda Vaughan]]''
|
| 1892-06-12
| 1985-11-04
| ''[[:d:Q1003123|Builth Wells]]''<br/>[[Wales]]
|-
| style='text-align:right'| 3458
| ''[[:d:Q5800067|Christopher Bale]]''
|
| 1982-05-30
|
| [[Newport]]
|-
| style='text-align:right'| 3459
| ''[[:d:Q5800336|David Rowland]]''
|
| 1568
| 1576
| [[Anglesey]]
|-
| style='text-align:right'| 3460
| ''[[:d:Q5875568|Hockey Driscoll]]''
|
| 1876
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3461
| ''[[:d:Q5882068|Holly Holyoake]]''
|
| 1988-12-31
|
| [[Newport]]
|-
| style='text-align:right'| 3462
| ''[[:d:Q5901548|Horace Blew]]''
|
| 1878-01-20
| 1957-02-01
| ''[[:d:Q5397307|Esclusham]]''
|-
| style='text-align:right'| 3463
| ''[[:d:Q5901653|Horace Cumner]]''
|
| 1918-03-31
| 1999-01-18
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 3464
| ''[[:d:Q5901709|Horace Evans, 1st Baron Evans]]''
|
| 1903-01-01
| 1963-10-26
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3465
| ''[[:d:Q5902209|Horace Viner]]''
|
| 1880
| 1955-06
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 3466
| ''[[:d:Q5907734|Ian Michael]]''
|
| 1936-05-26
| 2020-07-24
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3467
| ''[[:d:Q5919459|Howard Davies]]''
|
| 1916-12-25
| 1987-11-05
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3468
| ''[[:d:Q5920440|Howard Morgan]]''
|
| 1931-06-29
| 2019-03-16
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3469
| ''[[:d:Q5920501|Howard Nicholls]]''
|
| 1931-06-02
| 2011-03-02
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3470
| ''[[:d:Q5920514|Howard Norris]]''
|
| 1934-06-11
| 2015-01-30
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 3471
| ''[[:d:Q5920650|Howard Pritchard]]''
|
| 1958-10-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3472
| ''[[:d:Q5920696|Howard Radford]]''
|
| 1930-09-08
| 2022-01-21
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 3473
| ''[[:d:Q5921646|Syr Hywel y Fwyall]]''
|
| 1330
| 1381
| [[Wales]]
|-
| style='text-align:right'| 3474
| ''[[:d:Q5921673|Howell Arthur Gwynne]]''
| [[File:Howell Arthur Gwynne (1865–1950).png|center|128px]]
| 1865-09-03
| 1950-06-26
| ''[[:d:Q6408281|Kilvey Hill]]''
|-
| style='text-align:right'| 3475
| ''[[:d:Q5921699|Howell Davies]]''
|
| 1885-03-11
| 1961-07-02
| [[Wales]]
|-
| style='text-align:right'| 3476
| ''[[:d:Q5921707|Howell Evans]]''
|
| 1928-03-03
| 2014-09-09
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3477
| ''[[:d:Q5921714|Howell Elvet Lewis]]''
| [[File:Rev H Elvet Lewis (5185309).jpg|center|128px]]
| 1860-04-14
| 1953-12-10
| ''[[:d:Q4923824|Blaenycoed]]''
|-
| style='text-align:right'| 3478
| ''[[:d:Q5921716|Howell Glynne]]''
|
| 1906-01-24
| 1969-11-24
| [[Swansea]]
|-
| style='text-align:right'| 3479
| ''[[:d:Q5921747|Howell Jones]]''
| [[File:Howel-Jones-NeathRFC.jpg|center|128px]]
| 1882-04-05
| 1908-12-01
| ''[[:d:Q7228314|Pontneddfechan]]''
|-
| style='text-align:right'| 3480
| ''[[:d:Q5921750|Howell Lewis]]''
|
| 1888-05-24
| 1971-05-29
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 3481
| ''[[:d:Q5925776|James Iliff]]''
|
| 1923-01-04
| 2014-07-11
| [[Wales]]
|-
| style='text-align:right'| 3482
| ''[[:d:Q5927246|Hubert Day]]''
|
| 1908-05-08
| 1977-06-27
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 3483
| ''[[:d:Q5927578|Hubert Rees]]''
|
| 1928-04-27
| 2009-10-20
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 3484
| ''[[:d:Q5927583|Hubert Rhys]]''
|
| 1897-08-31
| 1970-03-18
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3485
| ''[[:d:Q5927683|Hubert William Lewis]]''
| [[File:Guggs.JPG|center|128px]]
| 1896-05-01
| 1977-02-22
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 3486
| ''[[:d:Q5927692|Hubert Winthrop Young]]''
|
| 1885-07-06
| 1950-04-20
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3487
| ''[[:d:Q5930459|Hugh Cudlipp]]''
|
| 1913-08-28
| 1998-05-17
| [[Cairdiff]]
|-
| style='text-align:right'| 3488
| ''[[:d:Q5930505|Hugh David]]''
|
| 1925-07-17
| 1987-09-11
| [[Aberystwyth]]
|-
| style='text-align:right'| 3489
| ''[[:d:Q5930657|John Hugh Edwards]]''
| [[File:J-Hugh-Edwards.jpg|center|128px]]
| 1869-04-09
| 1945-06-14
| [[Aberystwyth]]
|-
| style='text-align:right'| 3490
| ''[[:d:Q5930689|Hugh Evans]]''
|
| 1919-12-12
| 2010-02-03
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 3491
| ''[[:d:Q5930990|Hugh Gustafson]]''
|
| 1987-07-08
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3492
| ''[[:d:Q5931218|Hugh Ingledew]]''
|
| 1865-10-26
| 1937-02-01
| [[Cairdiff]]
|-
| style='text-align:right'| 3493
| ''[[:d:Q5931495|Hugh Lloyd-Davies]]''
|
| 1926
| 1986
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 3494
| ''[[:d:Q5932035|Hugh Morris]]''
|
| 1872
| 1897-09-20
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 3495
| ''[[:d:Q5932086|Hugh Myddelton]]''
| [[File:Sir Hugh Myddelton, 1st Bt by Cornelius Johnson.jpg|center|128px]]
| 1560
| 1631-12-10
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 3496
| ''[[:d:Q5932209|Hugh Owen]]''
| [[File:Portrait of Sir Hugh Owen (4671720) Exposure.jpg|center|128px]]
| 1804-01-14
| 1881-11-20
| ''[[:d:Q13129635|Llangeinwen]]''
|-
| style='text-align:right'| 3497
| ''[[:d:Q5932383|Hugh Price]]''
| [[File:Hugh Price.jpg|center|128px]]
| 1495
| 1574-08
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 3498
| ''[[:d:Q5932551|Hugh Rowlands]]''
| [[File:Syr-Hugh-Rowlands.jpg|center|128px]]
| 1828-05-06
| 1909-08-01
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 3499
| ''[[:d:Q5932957|Hugh Vincent]]''
|
| 1862-04-27
| 1931-02-22
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3500
| ''[[:d:Q5932997|John Traherne Moggridge]]''
|
| 1842-03-08
| 1874-11-24
| [[Swansea]]
|-
| style='text-align:right'| 3501
| ''[[:d:Q5941416|Humphrey Foulkes]]''
|
| 1673
| 1737
| ''[[:d:Q13129615|Llannefydd]]''
|-
| style='text-align:right'| 3502
| ''[[:d:Q5941466|Humphrey Humphreys]]''
| [[File:Bp Humphrey Humphreys.jpg|center|128px]]
| 1648-11-24
| 1712-11-20
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 3503
| ''[[:d:Q5941475|Humphrey Jones]]''
|
| 1862-12-07
| 1946-06-10
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3504
| ''[[:d:Q5941507|Humphrey Llwyd]]''
| [[File:Humphrey Lhuyd (cropped).jpg|center|128px]]
| 1527
| 1568-08-31
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 3505
| ''[[:d:Q5941550|Humphrey Owen]]''
|
| 1702
| 1768-03-26
| ''[[:d:Q3363693|Meifod]]''
|-
| style='text-align:right'| 3506
| ''[[:d:Q5951215|Huw Bunford]]''
| [[File:HuwBunford1.jpg|center|128px]]
| 1967-09-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3507
| ''[[:d:Q5951222|Huw Dixon]]''
| [[File:Huw Dixon 1992 cropped.jpg|center|128px]]
| 1958
|
| [[Swansea]]
|-
| style='text-align:right'| 3508
| ''[[:d:Q5951232|Huw Edwards]]''
|
|
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 3509
| ''[[:d:Q5951262|Huw Lewis]]''
| [[File:Huw Lewis.jpg|center|128px]]
| 1964-01-17
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3510
| ''[[:d:Q5951270|Huw Morus]]''
|
| 1622
| 1709-08
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 3511
| ''[[:d:Q5951279|Huw Menai]]''
|
| 1886-07-13
| 1961-06-28
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3512
| ''[[:d:Q5951282|Huw Richards]]''
|
| 1960-10-09
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3513
| ''[[:d:Q5951297|Huw Waters]]''
|
| 1986-09-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3514
| ''[[:d:Q5951303|Huw T. Edwards]]''
|
| 1892-11-19
| 1970-11-09
| ''[[:d:Q3399502|Rowen]]''
|-
| style='text-align:right'| 3515
| ''[[:d:Q5951307|Huw Watkins]]''
|
| 1976-07-13
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3516
| ''[[:d:Q5959734|Kim Lawrence]]''
|
| 1938
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 3517
| ''[[:d:Q5962128|Michael Locke]]''
| [[File:Michael "Pancho" Locke 2021.png|center|128px]]
| 1979-03-13
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 3518
| ''[[:d:Q5962726|Hywel Bennett]]''
|
| 1944-04-08
| 2017-07-25
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 3519
| ''[[:d:Q5962743|Hywel Coetmor]]''
|
|
| 1440
| ''[[:d:Q13130344|Nant Conwy]]''
|-
| style='text-align:right'| 3520
| ''[[:d:Q5962754|Hywel David Lewis]]''
|
| 1910-05-21
| 1992-04-06
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 3521
| ''[[:d:Q5962763|Hywel Gwynfryn]]''
|
| 1942-07-13
|
| [[Anglesey]]
|-
| style='text-align:right'| 3522
| ''[[:d:Q5967953|John Evans]]''
| [[File:Revd John Evans (I D Ffraid or Adda Jones, 1814-75) NLW3364082.jpg|center|128px]]
| 1814-07-23
| 1875-03-04
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 3523
| ''[[:d:Q5974169|Lewis Owen]]''
|
| 1572
| 1629
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 3524
| ''[[:d:Q5978031|John Godfrey Parry-Thomas]]''
| [[File:Parry Thomas.jpg|center|128px]]
| 1884-04-06
| 1927-03-03
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3525
| ''[[:d:Q5978168|William Frost]]''
|
| 1848-05-28
| 1935
| ''[[:d:Q3405190|Saundersfoot]]''
|-
| style='text-align:right'| 3526
| ''[[:d:Q5980623|Iain Sinclair]]''
| [[File:Iain Sinclair cheltenham.jpg|center|128px]]
| 1943-06-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3527
| ''[[:d:Q5980849|Ian Barker]]''
|
| 1966-08-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3528
| ''[[:d:Q5980981|Ian Bray]]''
|
| 1962-12-06
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3529
| ''[[:d:Q5981133|Ian Capon]]''
|
| 1977-01-23
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3530
| ''[[:d:Q5981455|Ian Easton]]''
|
| 1917
| 1989
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 3531
| ''[[:d:Q5981808|Ian Hillier]]''
|
| 1979-12-26
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3532
| ''[[:d:Q5981839|Ian Howat]]''
|
| 1958-07-29
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3533
| ''[[:d:Q5981847|Ian Hughes]]''
|
| 1974-08-02
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3534
| ''[[:d:Q5981864|Ian Hutchinson]]''
|
| 1964-10-31
|
| [[Welshpool]]
|-
| style='text-align:right'| 3535
| ''[[:d:Q5981894|Ian Jenkins]]''
|
| 1944-09-12
| 2009-02-19
| [[Cairdiff]]
|-
| style='text-align:right'| 3536
| ''[[:d:Q5982646|Ian Puleston-Davies]]''
| [[File:Ian Puleston-Davies in Midnight Man 2008.jpg|center|128px]]
| 1958-09-06
|
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 3537
| ''[[:d:Q5983385|Ianto Davies]]''
|
| 1892
| 1946
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3538
| ''[[:d:Q5989198|Idloes Owen]]''
|
| 1894-09-10
| 1964
| ''[[:d:Q6820697|Ynysowen]]''
|-
| style='text-align:right'| 3539
| ''[[:d:Q5989587|Idris Cox]]''
|
| 1899-07-15
| 1989-06-25
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3540
| ''[[:d:Q5989612|Idris Hopkins]]''
|
| 1910-10-11
| 1994-10-09
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3541
| ''[[:d:Q5989657|Idris Jones]]''
|
| 1900-01-18
| 1971-07-05
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3542
| ''[[:d:Q5989707|Idris Towill]]''
|
| 1909-11-12
| 1988-09
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3543
| ''[[:d:Q5989861|Idwal Davies]]''
|
| 1915-11-10
| 1990-07-07
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3544
| ''[[:d:Q5989871|Idwal Fisher]]''
|
| 1935-02-03
| 2012-01-05
| [[Swansea]]
|-
| style='text-align:right'| 3545
| ''[[:d:Q5989872|Idwal Jones]]''
|
| 1888-12-08
| 1964-11-14
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 3546
| ''[[:d:Q5989881|Idwal Pugh]]''
|
| 1918-02-10
| 2010-04-21
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 3547
| ''[[:d:Q5989892|Idwal Jones]]''
|
| 1895-06-08
| 1937
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 3548
| ''[[:d:Q5990126|Ieuan Ddu ap Dafydd ab Owain]]''
|
| 1440
| 1480
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3549
| ''[[:d:Q5990139|Ieuan Jones]]''
|
| 1993-07-22
|
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 3550
| ''[[:d:Q5990144|Ieuan Lloyd]]''
|
| 1993-07-09
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 3551
| ''[[:d:Q5990154|Ieuan Rhys Williams]]''
|
| 1909-10-27
| 1973
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 3552
| ''[[:d:Q5990159|Ieuan Rhys]]''
| [[File:Ieuan Head Shots 2009 116 (2).jpg|center|128px]]
| 1961-12-24<br/>1961
|
| ''[[:d:Q7837453|Trecynon]]''
|-
| style='text-align:right'| 3553
| ''[[:d:Q5990172|Ieuan ap Tudur Penllyn]]''
|
| 15th century
|
| [[Gwynedd]]
|-
| style='text-align:right'| 3554
| ''[[:d:Q5991237|Ifor Davies]]''
|
| 1910-06-09
| 1982-06-06
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 3555
| ''[[:d:Q5991239|Ifor Owen]]''
|
| 1915-07-03
| 2007-05-22
| ''[[:d:Q5057281|Cefnddwysarn]]''
|-
| style='text-align:right'| 3556
| ''[[:d:Q5991242|Ifor Leslie Evans]]''
|
| 1897-01-17
| 1952-05-31
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3557
| ''[[:d:Q5995606|Ike Fowler]]''
|
| 1894-08-27
| 1981-06-17
| ''[[:d:Q7131949|Pantyffynnon]]''
|-
| style='text-align:right'| 3558
| ''[[:d:Q5995656|Ike Owens]]''
|
| 1918-11-07
| 1998-10-15
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 3559
| ''[[:d:Q6000246|Illtyd Buller Pole-Evans]]''
|
| 1879-09-03
| 1968-10-16
| ''[[:d:Q13644937|Llanmaes]]''
|-
| style='text-align:right'| 3560
| ''[[:d:Q6001994|Imad Wasim]]''
| [[File:Imad Wasim.png.jpg|center|128px]]
| 1988-12-18
|
| [[Swansea]]
|-
| style='text-align:right'| 3561
| ''[[:d:Q6061783|Ioan Evans]]''
|
| 1927-07-10
| 1984-02-10
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3562
| ''[[:d:Q6061870|John Jones]]''
|
| 1792-02-10
| 1852-05-02
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 3563
| ''[[:d:Q6063518|Iona Jones]]''
|
|
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3564
| ''[[:d:Q6063933|Iorrie Isaacs]]''
|
| 1911-10-12
| 1966-04-25
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 3565
| ''[[:d:Q6063946|Iorwerth Evans]]''
|
| 1906-05-23
| 1985-09-18
| ''[[:d:Q7837990|Trelewis]]''
|-
| style='text-align:right'| 3566
| ''[[:d:Q6063954|Iorwerth Jones]]''
|
| 1903-04-03
| 1983-08-31
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 3567
| ''[[:d:Q6063957|Iorwerth Thomas]]''
| [[File:Iorwerth Thomas.jpg|center|128px]]
| 1895-01-22
| 1966-12-03
| ''[[:d:Q5197252|Cwmparc]]''
|-
| style='text-align:right'| 3568
| ''[[:d:Q6073462|Peter Penry-Jones]]''
|
| 1938
| 2009
| [[Cairdiff]]
|-
| style='text-align:right'| 3569
| ''[[:d:Q6076157|Isaac Cohen]]''
|
| 1914-07-26
| 2007-11-30
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3570
| ''[[:d:Q6076220|Isaac Davis]]''
|
| 1758
| 1810
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 3571
| ''[[:d:Q6076478|Isaac Hayward]]''
|
| 1884-11-17
| 1976-01-03
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 3572
| ''[[:d:Q6084453|Islwyn Davies]]''
|
| 1912-03-20
| 1997
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3573
| ''[[:d:Q6084457|Islwyn Evans]]''
|
| 1898-12-25
| 1974-05-13
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3574
| ''[[:d:Q6084469|Islwyn Morris]]''
|
| 1920-08-26
| 2011-04-26
| [[Swansea]]
|-
| style='text-align:right'| 3575
| ''[[:d:Q6097409|Ivan Sansom]]''
|
| 20th century
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 3576
| ''[[:d:Q6099316|Ivor Atkins]]''
| [[File:Sir Ivor Atkins.jpg|center|128px]]
| 1869-11-29
| 1953-11-26
| [[Cairdiff]]
|-
| style='text-align:right'| 3577
| ''[[:d:Q6099370|Ivor Davies]]''
|
| 1935-11
|
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 3578
| ''[[:d:Q6099383|Ivor Emmanuel]]''
|
| 1927-11-07
| 2007-07-20<br/>2007-07-19
| ''[[:d:Q3072939|Pontrhydyfen]]''<br/>[[Wales]]
|-
| style='text-align:right'| 3579
| ''[[:d:Q6099393|Ivor Griffiths]]''
|
| 1918-06-19
| 1993-10
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 3580
| ''[[:d:Q6099414|Ivor Herbert, 1st Baron Treowen]]''
| [[File:Ivor John Caradoc Herbert.jpg|center|128px]]
| 1851-07-15
| 1933-10-18
| ''[[:d:Q6661073|Llanarth Court]]''
|-
| style='text-align:right'| 3581
| ''[[:d:Q6099424|Ivor Jones]]''
| [[File:Ivor Jones 1930.jpg|center|128px]]
| 1901-12-10
| 1982-11-16
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 3582
| ''[[:d:Q6099429|Ivor Jones]]''
|
| 1899-07-31
| 1974-11-24
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3583
| ''[[:d:Q6099434|Ivor Lewis]]''
| [[File:Ivor Lewis.jpg|center|128px]]
| 1882
| 1958
| [[Wales]]
|-
| style='text-align:right'| 3584
| ''[[:d:Q6099547|Ivor Watts]]''
|
| 1924-12-28
| 2006-03-19
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 3585
| ''[[:d:Q6100562|Iwan Brown]]''
|
| 1986-03-03
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3586
| ''[[:d:Q6100567|Iwan Edwards]]''
|
| 1937-10-05
| 2022-03-04
| [[Wales]]
|-
| style='text-align:right'| 3587
| ''[[:d:Q6100571|Iwan Griffiths]]''
| [[File:Iwan Griffiths The Automatic Tear The Signs Down.jpg|center|128px]]
| 1985-12-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3588
| ''[[:d:Q6105857|J. Gwyn Griffiths]]''
|
| 1911-12-07
| 2004-06-15
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 3589
| ''[[:d:Q6106368|J. Lloyd Williams]]''
|
| 1854-07-10
| 1945-11-15
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 3590
| ''[[:d:Q6106503|J. Meirion Lloyd]]''
|
| 1913-05-04
| 1998-09-30
| ''[[:d:Q3398830|Corris]]''
|-
| style='text-align:right'| 3591
| ''[[:d:Q6107038|J. S. Matthews]]''
| [[File:The Archivist at Work, J. S. Matthews, 1941.jpg|center|128px]]
| 1878-09-07
| 1970-10-01
| [[Wales]]
|-
| style='text-align:right'| 3592
| ''[[:d:Q6109438|Robert East]]''
|
| 1943-07-07<br/>1932-03-20
|
| ''[[:d:Q39480|Porthcawl]]''<br/>[[Lunnon]]
|-
| style='text-align:right'| 3593
| ''[[:d:Q6109742|John Wallace Linton]]''
| [[File:John Wallace Linton.jpg|center|128px]]
| 1905-10-15
| 1943-03-23
| [[Newport]]
|-
| style='text-align:right'| 3594
| ''[[:d:Q6111026|Jack Anthony]]''
|
| 1890-01-21
| 1954-07-10
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 3595
| ''[[:d:Q6111191|Jack Bassett]]''
| [[File:Jack Bassett 1930.jpg|center|128px]]
| 1905-07-11
| 1989-02-19
| ''[[:d:Q7837340|Trebanog]]''
|-
| style='text-align:right'| 3596
| ''[[:d:Q6111207|Jack Beames]]''
|
| 1890-03-01
| 1970
| ''[[:d:Q4666790|Aberbeeg]]''
|-
| style='text-align:right'| 3597
| ''[[:d:Q6111561|Jack Capper]]''
|
| 1931-07-23
| 2009-03-10
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3598
| ''[[:d:Q6111669|Jack Chilcott]]''
|
| 1885-08-19
| 1973-07-01
| ''[[:d:Q6964400|Nant-y-moel]]''
|-
| style='text-align:right'| 3599
| ''[[:d:Q6111756|Jack Compton]]''
|
| 1988-09-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3600
| ''[[:d:Q6111849|Jack Court]]''
|
| 1919-06-13
| 1975-06-29
| ''[[:d:Q7809064|Tir-Phil]]''
|-
| style='text-align:right'| 3601
| ''[[:d:Q6112030|Jack Davies]]''
|
|
|
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 3602
| ''[[:d:Q6112111|Jack Dixon]]''
| [[File:Jack Dixon 2021.jpg|center|128px]]
| 1994-12-13
|
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 3603
| ''[[:d:Q6112296|Jack Edwards]]''
|
| 1918-05-24
| 2006-08-13
| [[Cairdiff]]
|-
| style='text-align:right'| 3604
| ''[[:d:Q6112306|Jack Edwards]]''
|
| 1929-07-06
| 2014-05
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 3605
| ''[[:d:Q6112343|Jack Elwyn Evans]]''
|
| 1897
| 1941-07-15
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 3606
| ''[[:d:Q6112380|Jack Evans]]''
|
| 1889-01-31
| 1971
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 3607
| ''[[:d:Q6112390|Jack Evans]]''
|
| 1928-04-21
| 1996-11-10
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 3608
| ''[[:d:Q6112392|Jack Evans]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3609
| ''[[:d:Q6112394|Jack Evans]]''
|
| 1871-02-23
| 1924-07-19
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 3610
| ''[[:d:Q6112570|Jack Fowler]]''
|
| 1899-12-03
| 1975-02-26
| [[Cairdiff]]
|-
| style='text-align:right'| 3611
| ''[[:d:Q6112751|Jack Gore]]''
|
| 1899-06-16
| 1971-03-18
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 3612
| ''[[:d:Q6112960|Jack Harris]]''
|
| 1986
|
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 3613
| ''[[:d:Q6113228|Jack Howells]]''
|
| 1913-07
| 1990-09-06
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 3614
| ''[[:d:Q6113340|Jack Jenkins]]''
|
| 1880-04-19
| 1971-12-01
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 3615
| ''[[:d:Q6113370|Jack Jones]]''
|
| 1890-01-25
|
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 3616
| ''[[:d:Q6113547|Jack L. Jones]]''
|
| 1869
| 1931-11-24
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 3617
| ''[[:d:Q6113680|Jack Lewis]]''
|
| 1912
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 3618
| ''[[:d:Q6114189|Jack Morley]]''
| [[File:Jack Morley 1930.jpg|center|128px]]
| 1909-07-28
| 1972-03-07
| [[Newport]]
|-
| style='text-align:right'| 3619
| ''[[:d:Q6114314|Jack Newnes]]''
|
| 1895-06-06
| 1969-02-03
| ''[[:d:Q14477598|Trefnant]]''
|-
| style='text-align:right'| 3620
| ''[[:d:Q6114325|Jack Nicholls]]''
|
| 1898-02-14
| 1970
| [[Cairdiff]]
|-
| style='text-align:right'| 3621
| ''[[:d:Q6114479|Jack Owen]]''
|
| 1866
| No/unknown value
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 3622
| ''[[:d:Q6114593|Jack Petersen]]''
|
| 1911-09-02
| 1990<br/>1990-11-22
| [[Cairdiff]]
|-
| style='text-align:right'| 3623
| ''[[:d:Q6114657|Jack Powell]]''
| [[File:Jack Powell, rugby player.jpg|center|128px]]
| 1882-09-14
| 1941-03-20
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3624
| ''[[:d:Q6114683|Jack Pring]]''
|
| 1993-01-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3625
| ''[[:d:Q6114816|Jack Rhapps]]''
|
| 1876-07-15
| 1950-01-23
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 3626
| ''[[:d:Q6114855|Jack Rippon]]''
|
| 1918-07-06
| 1994-12-29
| [[Swansea]]
|-
| style='text-align:right'| 3627
| ''[[:d:Q6115221|Jack Smith]]''
|
| 1911-10-27
| 1975-06-07
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3628
| ''[[:d:Q6115670|Jack Warner]]''
|
| 1911-09-21
| 1980-10-04
| [[Wales]]
|-
| style='text-align:right'| 3629
| ''[[:d:Q6115734|Jack Wetter]]''
|
| 1887-12-29
| 1967-07-29
| [[Newport]]
|-
| style='text-align:right'| 3630
| ''[[:d:Q6115766|Jack Whitfield]]''
|
| 1892-03-23
| 1927-12-26
| [[Newport]]
|-
| style='text-align:right'| 3631
| ''[[:d:Q6115803|Jack Williams]]''
|
| 1886-09-29
| 1953-03-07
| ''[[:d:Q174734|Hay-on-Wye]]''
|-
| style='text-align:right'| 3632
| ''[[:d:Q6116226|Jackie Benyon]]''
|
| 1909
| 1937-06-26
| [[Pontypridd]]
|-
| style='text-align:right'| 3633
| ''[[:d:Q6116246|Jackie Bowen]]''
|
| 1915
| 2009-02-26
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3634
| ''[[:d:Q6116417|Jackie Hughes]]''
|
| 1923-12-13
|
| [[Pontypridd]]
|-
| style='text-align:right'| 3635
| ''[[:d:Q6116543|Jackie Mittell]]''
|
| 1906-02-28
| 1976-03-30
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3636
| ''[[:d:Q6116619|Jackie Roberts]]''
|
| 1918-06-30
| 2001
| [[Swansea]]
|-
| style='text-align:right'| 3637
| ''[[:d:Q6119347|Jacob Thomas]]''
|
| 1833
| 1911-03-03
| ''[[:d:Q6661877|Llanwinio]]''
|-
| style='text-align:right'| 3638
| ''[[:d:Q6120960|Santiago Jorge Bynnon]]''
|
| 1798
| 1883-08-03
| [[Swansea]]
|-
| style='text-align:right'| 3639
| ''[[:d:Q6124605|Jake Cassidy]]''
|
| 1993-02-09
|
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 3640
| ''[[:d:Q6127543|Jamal Easter]]''
|
| 1987-11-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3641
| ''[[:d:Q6128579|Jim Alford]]''
|
| 1913-10-15
| 2004-08-05
| [[Cairdiff]]
|-
| style='text-align:right'| 3642
| ''[[:d:Q6128991|James Augustus St. John]]''
|
| 1795-09-24
| 1875-09-22
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 3643
| ''[[:d:Q6129470|James Bater]]''
|
| 1980-01-07
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3644
| ''[[:d:Q6131297|James Childs Gould]]''
|
| 1882-09-09
| 1944-07-02
| [[Cairdiff]]
|-
| style='text-align:right'| 3645
| ''[[:d:Q6131667|James Conway Davies]]''
|
| 1891
| 1971
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3646
| ''[[:d:Q6132403|James Davies Lewin]]''
| [[File:James Davies Lewin.jpg|center|128px]]
| 1812-04-01
| 1900-03-11
| [[Powys]]
|-
| style='text-align:right'| 3647
| ''[[:d:Q6132803|James Down]]''
|
| 1987-08-29
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3648
| ''[[:d:Q6134726|James Goode]]''
|
| 1982-09-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3649
| ''[[:d:Q6135615|James Harris]]''
| [[File:James Harris.jpg|center|128px]]
| 1990-05-16
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 3650
| ''[[:d:Q6135632|James Harrison]]''
|
| 1880-10-01<br/>1880
| 1957
| [[Welshpool]]
|-
| style='text-align:right'| 3651
| ''[[:d:Q6136198|James Honeyben]]''
|
| 1986-06-10
|
| [[Swansea]]
|-
| style='text-align:right'| 3652
| ''[[:d:Q6136324|James Howell]]''
| [[File:James Howell.jpg|center|128px]]
| 1594
| 1666
| ''[[:d:Q6661427|Llangammarch]]''
|-
| style='text-align:right'| 3653
| ''[[:d:Q6136411|James Humphreys]]''
|
| 1768
| 1830-11-29
| ''[[:d:Q1311946|Trefaldwyn]]''
|-
| style='text-align:right'| 3654
| ''[[:d:Q6136538|James Idwal Jones]]''
|
| 1900-06-30
| 1982-10-18
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 3655
| ''[[:d:Q6137411|James Kitchener Davies]]''
| [[File:J Kitchener Davies.jpg|center|128px]]
| 1902-06-06
| 1952-08-25
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 3656
| ''[[:d:Q6137766|James Langworth]]''
|
| 1973-04-24
|
| [[Newport]]
|-
| style='text-align:right'| 3657
| ''[[:d:Q6137887|James Leadbeater]]''
|
| 1989-01-04
|
| ''[[:d:Q7131674|Panteg]]''
|-
| style='text-align:right'| 3658
| ''[[:d:Q6138035|James Lewis]]''
|
| 1987-11-20
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 3659
| ''[[:d:Q6138128|James Llewellyn Davies]]''
|
| 1886-03-16
| 1917-07-31
| ''[[:d:Q7080139|Cwm Ogwr]]''
|-
| style='text-align:right'| 3660
| ''[[:d:Q6139826|James Milo Griffith]]''
| [[File:Portrait of James Milo Griffith (4670005).jpg|center|128px]]
| 1843-06-11
| 1897-09-08
| ''[[:d:Q4941233|Boncath]]''
|-
| style='text-align:right'| 3661
| ''[[:d:Q6140710|James Owen]]''
|
| 1991-01-14
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3662
| ''[[:d:Q6140907|James Parfitt]]''
|
| 1857-12-23
| 1926-05-17
| ''[[:d:Q5003693|Bwlch]]''
|-
| style='text-align:right'| 3663
| ''[[:d:Q6141939|James Regan]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3664
| ''[[:d:Q6141972|James Relly]]''
|
| 1722
| 1778-04-25
| ''[[:d:Q6176372|Jeffreyston]]''
|-
| style='text-align:right'| 3665
| ''[[:d:Q6142239|James Roberts]]''
|
| 1878
| 20th century
| [[Wales]]
|-
| style='text-align:right'| 3666
| ''[[:d:Q6142242|James Roberts]]''
|
| 1891-01-07
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 3667
| ''[[:d:Q6142792|James Sauvage]]''
|
| 1849-05-09
| 1922-11-27
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 3668
| ''[[:d:Q6143405|James Sommerin]]''
|
|
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 3669
| ''[[:d:Q6143570|James Stephens]]''
|
| 1821-08-08
| 1889-11-14
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 3670
| ''[[:d:Q6144142|James Thomas]]''
|
| 1990-08-07
|
| [[Newport]]
|-
| style='text-align:right'| 3671
| ''[[:d:Q6144426|James Trow]]''
| [[File:JamesTrow23.jpg|center|128px]]
| 1826-12-16<br/>1825
| 1892-09-10<br/>1892
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 3672
| ''[[:d:Q6145491|James Wiegold]]''
| [[File:James Wiegold.jpg|center|128px]]
| 1934-04-15
| 2009-08-04
| ''[[:d:Q16897451|Trecenydd]]''
|-
| style='text-align:right'| 3673
| ''[[:d:Q6145614|James William Richards]]''
|
| 1850-05-31
| 1915-03-09
| [[Swansea]]
|-
| style='text-align:right'| 3674
| ''[[:d:Q6145639|James Williams]]''
|
| 1973-07-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3675
| ''[[:d:Q6145643|James Williams]]''
|
| 1880s<br/>1885-02-15
| 1916-06-05
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 3676
| ''[[:d:Q6145721|James Winstone]]''
|
| 1863-02-09
| 1921-07-27
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 3677
| ''[[:d:Q6146625|Jamie Bevan]]''
| [[File:Jamie Bevan.jpg|center|128px]]
| 20th century
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3678
| ''[[:d:Q6146982|Jamie Harris]]''
|
| 1979-06-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3679
| ''[[:d:Q6147109|Jamie Lewis]]''
|
| 1991-11-08
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3680
| ''[[:d:Q6147282|Jamie Murphy]]''
|
| 1989-12-29
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3681
| ''[[:d:Q6147322|Jamie Owen]]''
|
| 1967-09
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3682
| ''[[:d:Q6147393|Jamie Ringer]]''
|
| 1976-01-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3683
| ''[[:d:Q6147533|Jamie Sylvester]]''
|
| 1971-07-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3684
| ''[[:d:Q6148467|Jan Anderson]]''
|
| 1974-06-17
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 3685
| ''[[:d:Q6151119|Jane Arden]]''
|
| 1927-10-29
| 1982-12-20
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3686
| ''[[:d:Q6151191|Jane Brereton]]''
|
| 1685
| 1740-08-07
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 3687
| ''[[:d:Q6152242|Jane Freeman]]''
|
| 1921-03-15
| 2017-03-09
| [[Wales]]
|-
| style='text-align:right'| 3688
| ''[[:d:Q6153289|Janet Davies]]''
| [[File:JanetDavies.jpg|center|128px]]
| 1938-05-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3689
| ''[[:d:Q6153343|Janet Finch-Saunders]]''
| [[File:Janet Finch-Saunders.jpg|center|128px]]
| 1950-05-20
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 3690
| ''[[:d:Q6154241|Janice Gregory]]''
| [[File:Janice Gregory.jpg|center|128px]]
| 1955-01-10
|
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 3691
| ''[[:d:Q6161756|Jasmine Cresswell]]''
|
| 1941
|
| [[Wales]]
|-
| style='text-align:right'| 3692
| ''[[:d:Q6162253|Jason Cook]]''
|
| 1975-02-27
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 3693
| ''[[:d:Q6162809|Jason Jones]]''
| [[File:Footballer Jason Andrew jones.jpg|center|128px]]
| 1979-05-10
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3694
| ''[[:d:Q6163128|Jason Mohammad]]''
| [[File:2012-03-19 Jason Mohammad at Wales Grand Slam Celebrations.jpg|center|128px]]
| 1975-11-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3695
| ''[[:d:Q6163246|Jason Perry]]''
|
| 1970-04-02
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 3696
| ''[[:d:Q6163292|Jason Price]]''
| [[File:Jason Price.jpg|center|128px]]
| 1977-04-12
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3697
| ''[[:d:Q6163322|Jason Rees]]''
|
| 1969-12-22
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3698
| ''[[:d:Q6163565|Jason Strange]]''
|
| 1973-10-08
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 3699
| ''[[:d:Q6163640|Jason Tovey]]''
|
| 1989-04-28
|
| [[Newport]]
|-
| style='text-align:right'| 3700
| ''[[:d:Q6166525|Jay Curtis]]''
| [[File:Jay Curtis Headshot3.jpg|center|128px]]
| 1984-03-28
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3701
| ''[[:d:Q6167716|Jayce Lewis]]''
| [[File:DSC 0061-Edit.jpg|center|128px]]
| 1984-09-29
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3702
| ''[[:d:Q6167907|Jayne Pierson]]''
| [[File:Jayne Pierson.jpg|center|128px]]
| 1975<br/>1970
|
| [[Swansea]]
|-
| style='text-align:right'| 3703
| ''[[:d:Q6171595|Jean Thomas]]''
|
| 1942-10-01
|
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 3704
| ''[[:d:Q6172646|Jed Williams]]''
|
| 1952-06-12
| 2003-11-10
| [[Cairdiff]]
|-
| style='text-align:right'| 3705
| ''[[:d:Q6173293|Jeff Banks]]''
| [[File:Jeff Banks.jpg|center|128px]]
| 1943-03-17
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 3706
| ''[[:d:Q6173783|Jeff Evans]]''
|
| 1960-02-29
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 3707
| ''[[:d:Q6174089|Jeff Hopkins]]''
|
| 1964-04-14
|
| [[Swansea]]
|-
| style='text-align:right'| 3708
| ''[[:d:Q6174175|Jeff Johnson]]''
|
| 1953-11-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3709
| ''[[:d:Q6174186|Jeff Jones]]''
|
| 1941-12-10
|
| ''[[:d:Q5208304|Dafen]]''
|-
| style='text-align:right'| 3710
| ''[[:d:Q6174369|Jeff Linton]]''
|
| 1909-05-07
| 1989-12-27
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 3711
| ''[[:d:Q6174649|Jeff Parton]]''
|
| 1953-02-24
|
| [[Swansea]]
|-
| style='text-align:right'| 3712
| ''[[:d:Q6175116|Jeff T. Thomas]]''
|
| 20th century
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 3713
| ''[[:d:Q6175154|Jeff Thomas]]''
|
| 1949-05-18
|
| [[Newport]]
|-
| style='text-align:right'| 3714
| ''[[:d:Q6175261|Jeff Whitefoot]]''
|
| 1956-04-18
|
| ''[[:d:Q3401157|Bedwas]]''
|-
| style='text-align:right'| 3715
| ''[[:d:Q6176030|Jeffrey Hamm]]''
| [[File:Flag of the British Union of Fascists.svg|center|128px]]
| 1915-09-15
| 1994-05-04
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 3716
| ''[[:d:Q6176386|Jeffris Hopkins]]''
|
| 1950-08-23
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3717
| ''[[:d:Q6176481|Jehoiada Brewer]]''
|
| 1752
| 1817-08-24
| [[Newport]]
|-
| style='text-align:right'| 3718
| ''[[:d:Q6177041|Jem Evans]]''
|
| 1867
| 1942-10-14
| [[Cairdiff]]
|-
| style='text-align:right'| 3719
| ''[[:d:Q6177165|Jemima Nicholas]]''
|
| 1750
| 1832
| ''[[:d:Q6661716|Llanrhian]]''
|-
| style='text-align:right'| 3720
| ''[[:d:Q6177538|Jenkin Alban Davies]]''
|
| 1885-09-05
| 1976-07-18
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 3721
| ''[[:d:Q6177546|Jenkin Jones]]''
|
| 1639
|
| ''[[:d:Q19799831|Llanddeti]]''
|-
| style='text-align:right'| 3722
| ''[[:d:Q6177549|Jenkin Lloyd Jones]]''
| [[File:Dr. Jenkin Lloyd Jones LCCN2014700500 (cropped).jpg|center|128px]]
| 1843-11-14
| 1918-09-12
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 3723
| ''[[:d:Q6177967|Jennie Eirian Davies]]''
|
| 1925-02-06
| 1982-05-06
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 3724
| ''[[:d:Q6178238|Jennifer Daniel]]''
|
| 1936-05-23
| 2017-08-16
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3725
| ''[[:d:Q6178528|Jennifer Leak]]''
|
| 1947-09-28
| 2024-03-18
| [[Cairdiff]]
|-
| style='text-align:right'| 3726
| ''[[:d:Q6178864|Jennifer Sullivan]]''
|
| 1945
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3727
| ''[[:d:Q6180635|Jere Blake]]''
| [[File:Jere Blake 2.JPG|center|128px]]
| 1875
| 1933-02-15
| [[Cairdiff]]
|-
| style='text-align:right'| 3728
| ''[[:d:Q6181214|Jeremy Charles]]''
|
| 1959-09-26
|
| [[Swansea]]
|-
| style='text-align:right'| 3729
| ''[[:d:Q6181512|Jeremy Huw Williams]]''
|
| 1969-04-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3730
| ''[[:d:Q6181975|Jeremy Treglown]]''
|
| 1946-05-24
|
| [[Anglesey]]
|-
| style='text-align:right'| 3731
| ''[[:d:Q6184422|Jerry Shea]]''
|
| 1892-08-12
| 1947-06-30
| [[Newport]]
|-
| style='text-align:right'| 3732
| ''[[:d:Q6193473|Jim Bacon]]''
|
| 1896
| 1968-12
| [[Newport]]
|-
| style='text-align:right'| 3733
| ''[[:d:Q6194264|Jim Cole]]''
|
| 1925-08-14
| 1997
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3734
| ''[[:d:Q6194552|Jim Davies]]''
|
| 1886
| 1971
| [[Wales]]
|-
| style='text-align:right'| 3735
| ''[[:d:Q6196282|Jim Lang]]''
|
| 1909-10-01
| 1991-12-22
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 3736
| ''[[:d:Q6196963|Jim Mills]]''
|
| 1944-09-24
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3737
| ''[[:d:Q6197427|Jim Pearce]]''
|
| 20th century<br/>1909-09-13
| 1986
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 3738
| ''[[:d:Q6197530|Jim Pleass]]''
|
| 1923-05-21
| 2016-02-16
| [[Cairdiff]]
|-
| style='text-align:right'| 3739
| ''[[:d:Q6197601|Jim Pressdee]]''
|
| 1933-06-19
| 2016-07-20
| ''[[:d:Q24639697|Mumbles Head]]''
|-
| style='text-align:right'| 3740
| ''[[:d:Q6197932|Jim Ryan]]''
|
| 1942-09-06
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 3741
| ''[[:d:Q6198340|Jim Stewart]]''
|
| 1934-08-31
|
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 3742
| ''[[:d:Q6199547|Jimmy Austin]]''
| [[File:Jimmy Austin baseball card.jpg|center|128px]]
| 1879-12-08
| 1965-03-06
| [[Swansea]]
|-
| style='text-align:right'| 3743
| ''[[:d:Q6199562|Jimmy Baker]]''
|
| 1904-05-05
| 1979
| ''[[:d:Q11020503|Trethomas]]''
|-
| style='text-align:right'| 3744
| ''[[:d:Q6200082|Jimmy Evans]]''
|
| 1894-11-29
| 1975
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 3745
| ''[[:d:Q6201287|Jimmy Singer]]''
|
| 1937-08-30
| 2010-07
| ''[[:d:Q5057266|Cefn Hengoed]]''
|-
| style='text-align:right'| 3746
| ''[[:d:Q6204177|Jo Caulfield]]''
| [[File:Jo Caulfield @ The Late Show 2002.jpg|center|128px]]
| 1963-09-26
|
| [[Wales]]
|-
| style='text-align:right'| 3747
| ''[[:d:Q6204983|Joan Elizabeth Curran]]''
|
| 1916-02-26
| 1999-02-10
| [[Swansea]]
|-
| style='text-align:right'| 3748
| ''[[:d:Q6204998|Joan Davis]]''
|
| 1911-06-02
| 2004
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 3749
| ''[[:d:Q6205148|Joan Howson]]''
| [[File:Pettaugh window.jpg|center|128px]]
| 1885
| 1964
| [[Flintshire]]
|-
| style='text-align:right'| 3750
| ''[[:d:Q6207115|Jocelyn Davies]]''
| [[File:Jocelyn Davies 2011.jpg|center|128px]]
| 1959-06-18
|
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 3751
| ''[[:d:Q6207972|Jodie Marie]]''
| [[File:Jodie Marie (53355801223) (sq cropped).jpg|center|128px]]
| 1991-06-12
|
| [[Wales]]
|-
| style='text-align:right'| 3752
| ''[[:d:Q6208659|Joe Blackman]]''
| [[File:JoeBlackman.jpg|center|128px]]
| 1984-08-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3753
| ''[[:d:Q6208866|Joe Burke]]''
| [[File:Joe Burke.jpg|center|128px]]
| 1990-05-18
|
| [[Newport]]
|-
| style='text-align:right'| 3754
| ''[[:d:Q6209387|Joe Davies]]''
|
| 1864-07-12
| 1943-10-07
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 3755
| ''[[:d:Q6209389|Joe Davies]]''
|
| 1888-10<br/>1870<br/>1866
| 1943-10-07
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 3756
| ''[[:d:Q6210509|Joe Jacobson]]''
| [[File:Joe Jacobson 25-04-2011 1.jpg|center|128px]]
| 1986-11-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3757
| ''[[:d:Q6210540|Joe Johns]]''
|
| 1892-09-18
| 1927-09-18
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3758
| ''[[:d:Q6210576|Joe Jones]]''
|
| 1887-01-09
| 1941-07-23
| ''[[:d:Q7321514|Rhosymedre]]''
|-
| style='text-align:right'| 3759
| ''[[:d:Q6210580|Joe Jones]]''
|
| 1916-04-20
| 1974-01-11
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 3760
| ''[[:d:Q6211974|Joe Rees]]''
|
| 1990-08-31
|
| [[Swansea]]
|-
| style='text-align:right'| 3761
| ''[[:d:Q6215184|John Trevor]]''
| [[File:Sir John Trevor.jpg|center|128px]]
| 1637
| 1717-05-20
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 3762
| ''[[:d:Q6218655|John Alf Brown]]''
| [[File:John Alf Brown.jpg|center|128px]]
| 1881-10
| 1936-08-03
| [[Cairdiff]]
|-
| style='text-align:right'| 3763
| ''[[:d:Q6219807|John Avon]]''
|
| 1961
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3764
| ''[[:d:Q6220486|John Ballinger]]''
| [[File:John Ballinger, S. K. Greenslade, Evan Davies Jones and Sir John Williams with the American Ambassador , the Hon. Whitelaw Reid (5449722).jpg|center|128px]]
| 1860-05-12
| 1933-01-08
| ''[[:d:Q7228316|Pontnewynydd]]''
|-
| style='text-align:right'| 3765
| ''[[:d:Q6221041|John Basson Humffray]]''
|
| 1824-04-17
| 1891-03-18
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 3766
| ''[[:d:Q6221065|John Batchelor]]''
| [[File:John Batchelor statue, The Hayes, Cardiff.JPG|center|128px]]
| 1820-04-10
| 1883-05-29
| [[Newport]]
|-
| style='text-align:right'| 3767
| ''[[:d:Q6221241|John Beard]]''
|
| 1943-10-24
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3768
| ''[[:d:Q6221954|John Bird]]''
|
| 1940-11-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3769
| ''[[:d:Q6223123|John Breynton]]''
| [[File:John Breynton.png|center|128px]]
| 1719-04-13
| 1799-07-15
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 3770
| ''[[:d:Q6224066|John Bury]]''
|
| 1925-01-27
| 2000-11-12
| [[Aberystwyth]]
|-
| style='text-align:right'| 3771
| ''[[:d:Q6224716|John Cadogan]]''
|
| 1930-10-08
| 2020-02-09
| ''[[:d:Q7161927|Pembrey]]''
|-
| style='text-align:right'| 3772
| ''[[:d:Q6224719|John Cadvan Davies]]''
| [[File:Revd John Cadvan Davies (Cadvan, 1846-1923) NLW3364602.jpg|center|128px]]
| 1846-10-01
| 1923-10-12
| ''[[:d:Q6661409|Llangadfan]]''
|-
| style='text-align:right'| 3773
| ''[[:d:Q6225143|John Cargill Brough]]''
|
| 1834-02-11
| 1872-09-07
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 3774
| ''[[:d:Q6225585|John Cayo Evans]]''
|
| 1879-03-01
| 1958-03-08
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 3775
| ''[[:d:Q6225635|John Challen]]''
| [[File:John Challen c1895cr.jpg|center|128px]]
| 1863-03-26
| 1937-06-05
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 3776
| ''[[:d:Q6225689|John Chandless]]''
|
| 1884-08-21
| 1968-06-01
| [[Cairdiff]]
|-
| style='text-align:right'| 3777
| ''[[:d:Q6225882|John Cheshire]]''
|
| 1933-02-09
|
| [[Newport]]
|-
| style='text-align:right'| 3778
| ''[[:d:Q6226439|John Coates]]''
|
| 1922-03-30
| 2010-07-10
| [[Swansea]]
|-
| style='text-align:right'| 3779
| ''[[:d:Q6226726|John Collins]]''
|
| 1949-01-21
| 2020-04-14
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 3780
| ''[[:d:Q6228033|John Cutt]]''
|
| 1613
| 1681-04-05
| [[Wales]]
|-
| style='text-align:right'| 3781
| ''[[:d:Q6228290|John D. Reese]]''
|
| 1855-05-06
| 1931-11-29
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 3782
| ''[[:d:Q6228636|John David]]''
|
| 1946-01-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3783
| ''[[:d:Q6228737|John Davies]]''
| [[File:Welsh-bishops (John Davies cropped).jpg|center|128px]]
| 1953-02-06
|
| [[Newport]]
|-
| style='text-align:right'| 3784
| ''[[:d:Q6228759|John Davies]]''
| [[File:John Davies (historian).jpg|center|128px]]
| 1938-04-25
| 2015-02-16
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 3785
| ''[[:d:Q6228764|John Davies]]''
|
| 1941-02-20
| 1969-04-16
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3786
| ''[[:d:Q6228768|John Davies]]''
|
| 1969-02-01
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 3787
| ''[[:d:Q6228770|John Davies]]''
|
| 1625-05-25
| 1693-07-22
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 3788
| ''[[:d:Q6228804|John Davis]]''
|
| 1939-03-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3789
| ''[[:d:Q6229241|John Derrick]]''
|
| 1963-01-15
| 2017-03-22
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 3790
| ''[[:d:Q6230602|John Dyke]]''
|
| 1884-06-20
| 1960-07-09
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 3791
| ''[[:d:Q6231293|John Edward Daniel]]''
| [[File:JEDaniel.jpg|center|128px]]
| 1902-06-26
| 1962-02-11
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3792
| ''[[:d:Q6231366|John Edwards]]''
|
| 1699<br/>1699-12-27
| 1776-12-28
| ''[[:d:Q5572835|Glyn Ceiriog]]''
|-
| style='text-align:right'| 3793
| ''[[:d:Q6231368|John Edwards]]''
|
| 1747
| 1792-09<br/>1792
| ''[[:d:Q5572835|Glyn Ceiriog]]''
|-
| style='text-align:right'| 3794
| ''[[:d:Q6231378|John Edwards]]''
|
| 1605
| 1656
| ''[[:d:Q722585|Cil-y-coed]]''
|-
| style='text-align:right'| 3795
| ''[[:d:Q6231381|John Edwards]]''
|
| 1882-02-28
| 1960-05-23
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 3796
| ''[[:d:Q6231573|John Elias]]''
| [[File:William Roos - John Elias (1839).jpg|center|128px]]
| 1774-05-06
| 1841-06-08
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 3797
| ''[[:d:Q6231655|John Ellis]]''
|
| 1674
| 1735-07
| ''[[:d:Q13644927|Llandegwning]]''
|-
| style='text-align:right'| 3798
| ''[[:d:Q6231675|John Ellis]]''
|
| 1598
| 1665
| ''[[:d:Q6729249|Maentwrog]]''
|-
| style='text-align:right'| 3799
| ''[[:d:Q6231731|John Emanuel]]''
|
| 1948-04-05
|
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 3800
| ''[[:d:Q6231753|John Emlyn-Jones]]''
|
| 1889-01-22
| 1952-03-03
| [[Cairdiff]]
|-
| style='text-align:right'| 3801
| ''[[:d:Q6231972|John Evan Thomas]]''
|
| 1810-01-15
| 1873-10-09
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 3802
| ''[[:d:Q6231977|John Evans]]''
|
| 1816-01-25
| 1879-08-25
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 3803
| ''[[:d:Q6231979|John Evans]]''
|
| 1767-10-02
| 1827-01-25
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 3804
| ''[[:d:Q6231984|John Evans]]''
| [[File:Rev. John Evans, Llwynfortun.jpg|center|128px]]
| 1779-10
| 1847-10-06
| ''[[:d:Q7162285|Pencader]]''
|-
| style='text-align:right'| 3805
| ''[[:d:Q6231990|John Evans]]''
|
| 1867-06-25
| 1958-01-05
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 3806
| ''[[:d:Q6231996|John Evans]]''
| [[File:Bp John Evans.jpg|center|128px]]
| No/unknown value
| 1724-03-22
| ''[[:d:Q6661066|Llanarmon]]''
|-
| style='text-align:right'| 3807
| ''[[:d:Q6232005|John Evans]]''
| [[File:Portrait of John Evans, D.D (4673284).jpg|center|128px]]
| 1680
| 1730-05-23
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3808
| ''[[:d:Q6232012|John Evans]]''
| [[File:John Evans, Careening, from the Pirates of the Spanish Main series (N19) for Allen & Ginter Cigarettes MET DP835003.jpg|center|128px]]
| No/unknown value
| 1723
| [[Wales]]
|-
| style='text-align:right'| 3809
| ''[[:d:Q6232013|John Evans]]''
|
| 1897-09-23
| 1940-03-20
| [[Llwynypia]]
|-
| style='text-align:right'| 3810
| ''[[:d:Q6232015|John Evans]]''
|
| 1911-09-12
| 1943-03-08
| [[Newport]]
|-
| style='text-align:right'| 3811
| ''[[:d:Q6232017|John Evans]]''
|
| 1756-07-04
| 1846-10
| ''[[:d:Q3397480|Llanymynech]]''
|-
| style='text-align:right'| 3812
| ''[[:d:Q6232022|John Evans]]''
| [[File:Johnbocha.jpg|center|128px]]
| 1960
|
| [[Pontypridd]]
|-
| style='text-align:right'| 3813
| ''[[:d:Q6232808|John Faull]]''
|
| 1933-06-30
| 2017-06-21
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 3814
| ''[[:d:Q6233557|John Foley]]''
|
| 1878
| 1949
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 3815
| ''[[:d:Q6234190|John Freeman]]''
|
| 1934
| 2017-06-23
| [[Cairdiff]]
|-
| style='text-align:right'| 3816
| ''[[:d:Q6234314|John Frowen]]''
|
| 1931-10-11
| 2011-08-28
| ''[[:d:Q7837990|Trelewis]]''
|-
| style='text-align:right'| 3817
| ''[[:d:Q6235537|John Glover]]''
|
| 1989-08-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3818
| ''[[:d:Q6235655|John Golightly]]''
|
| 1936-05-18
|
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 3819
| ''[[:d:Q6235701|John Goodman]]''
|
|
| 1645
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 3820
| ''[[:d:Q6235888|John Goulstone Lewis]]''
|
| 1859-12-25
| 1935-05-09
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 3821
| ''[[:d:Q6236103|John Gray]]''
|
| 1936-10-01
| 2003-09-01
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 3822
| ''[[:d:Q6236372|John Griffith]]''
| [[File:Sir John Purser Griffith.jpg|center|128px]]
| 1848-10-05
| 1938-10-21
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 3823
| ''[[:d:Q6236398|John Griffiths]]''
|
| 1835
|
| [[Wales]]
|-
| style='text-align:right'| 3824
| ''[[:d:Q6236400|John Griffiths]]''
| [[File:John Griffiths.jpg|center|128px]]
| 1956-12-19
|
| [[Newport]]
|-
| style='text-align:right'| 3825
| ''[[:d:Q6236405|John Griffiths]]''
| [[File:Portrait of John Griffiths (4672891).jpg|center|128px]]
| 1837-11-29
| 1918-12-01
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 3826
| ''[[:d:Q6236409|John Griffiths]]''
|
| 1837
| 1916
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 3827
| ''[[:d:Q6236665|John Gwenogvryn Evans]]''
| [[File:J. Gwenogvryn Evans (1852–1930), MA, DLitt (gcf01707).jpg|center|128px]]
| 1852-03-20
| 1930-03-25
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 3828
| ''[[:d:Q6236821|John H. Fisher]]''
|
| 1837
| 1895-09-16
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 3829
| ''[[:d:Q6237166|John Habakkuk]]''
|
| 1915-05-13
| 2002-11-03
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 3830
| ''[[:d:Q6237949|John Harris]]''
|
| 1680
| 1738-08-28
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 3831
| ''[[:d:Q6238674|John Hennessey]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3832
| ''[[:d:Q6238798|John Henry Evans]]''
|
| 1872-04-08
| 1947-03-24
| [[Wales]]
|-
| style='text-align:right'| 3833
| ''[[:d:Q6239362|John Hinds]]''
| [[File:John Hinds.jpg|center|128px]]
| 1862-07-26
| 1928-07-23
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3834
| ''[[:d:Q6240277|John Hughes]]''
| [[File:John Hughes (cropped).jpg|center|128px]]
| 1947-07-27
|
| [[Wales]]
|-
| style='text-align:right'| 3835
| ''[[:d:Q6240280|John Hughes]]''
|
| 1965-07-03
|
| [[Swansea]]
|-
| style='text-align:right'| 3836
| ''[[:d:Q6240302|John Hughes]]''
|
| 1855
| 1914-10-02
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 3837
| ''[[:d:Q6240307|John Hughes]]''
|
| 1880
|
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 3838
| ''[[:d:Q6240404|John Humphreys Davies]]''
| [[File:John Humphreys Davies (5292076).jpg|center|128px]]
| 1871-04-15
| 1926-08-10
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 3839
| ''[[:d:Q6240740|John Iltyd Nicholl]]''
| [[File:The House of Commons, 1833 by Sir George Hayter.jpg|center|128px]]
| 1797-08-21
| 1853-01-27
| ''[[:d:Q13644937|Llanmaes]]''
|-
| style='text-align:right'| 3840
| ''[[:d:Q6240907|John Islan Jones]]''
|
| 1874-02-17
| 1968-05-28
| ''[[:d:Q5184909|Cribyn]]''
|-
| style='text-align:right'| 3841
| ''[[:d:Q6241487|John James]]''
| [[File:John James (musician) on stage at Greenwich, U.K., 1982.jpg|center|128px]]
| 1943
|
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 3842
| ''[[:d:Q6241609|John James Williams]]''
| [[File:John James Williams (JJ).jpg|center|128px]]
| 1869-10-08
| 1954-05-06
| [[Wales]]
|-
| style='text-align:right'| 3843
| ''[[:d:Q6241666|John Jarman]]''
|
| 1931-02-04
| 2009-10-21
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 3844
| ''[[:d:Q6241777|John Jenkins]]''
| [[File:John Gwili Jenkins (5254851).jpg|center|128px]]
| 1872-10-08
| 1936-05-16
| ''[[:d:Q5714075|Hendy]]''<br/>''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 3845
| ''[[:d:Q6241779|John Jenkins]]''
|
| 1770-04-08
| 1829-11-20
| ''[[:d:Q3401679|Llangoedmor]]''
|-
| style='text-align:right'| 3846
| ''[[:d:Q6241786|John Jenkins]]''
|
| 1880-04-19
| 1971-12-01
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 3847
| ''[[:d:Q6242001|John Jones]]''
| [[File:Revd John Jones, Talysarn 1796-1857.jpg|center|128px]]
| 1796-03-01
| 1857-08-16
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 3848
| ''[[:d:Q6242004|John Jones]]''
|
| 1775-12-28
| 1834-05-13
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 3849
| ''[[:d:Q6242009|John Jones]]''
|
| 1812-12-11
| 1886-02-28
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 3850
| ''[[:d:Q6242023|John Jones]]''
| [[File:Portrait of Mr. John Jones, Plymouth Dock (4673762).jpg|center|128px]]
| 1766
| 1827-01-10
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 3851
| ''[[:d:Q6242024|John Jones]]''
| [[File:Llun johnjones bangor sas1923 tud272.jpg|center|128px]]
| 1818
| 1898
| ''[[:d:Q5318367|Dwyran]]''
|-
| style='text-align:right'| 3852
| ''[[:d:Q6242032|John Jones]]''
|
| 1700
| 1770-08-08
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 3853
| ''[[:d:Q6242038|John Jones]]''
|
| 1848
| No/unknown value
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3854
| ''[[:d:Q6242042|John Jones]]''
|
| 1895-03-28
| 1962
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 3855
| ''[[:d:Q6242044|John Jones]]''
|
| 1773-03-31
| 1853-04-06
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 3856
| ''[[:d:Q6242046|John Jones]]''
|
| 1916-11-25
| 1978
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 3857
| ''[[:d:Q6242062|John Jones]]''
| [[File:Portrait of John Jones (4671536) (cropped).jpg|center|128px]]
| 1597
| 1660-10-17
| ''[[:d:Q29484376|Maesygarnedd]]''
|-
| style='text-align:right'| 3858
| ''[[:d:Q6242066|John Jones]]''
|
| 1777-09-15
| 1842-11-10
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 3859
| ''[[:d:Q6242070|John Jones]]''
|
| 1578
| 1658
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 3860
| ''[[:d:Q6242277|John Josiah Guest]]''
| [[File:Sir J. J. Guest (?). Mezzotint by W. Walker, 1852, after R. Wellcome V0006515 (cropped).jpg|center|128px]]
| 1785-02-02
| 1852-11-26
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 3861
| ''[[:d:Q6242653|Daniel P Williams]]''
|
| 1882-05-05
| 1947-02-13
| ''[[:d:Q7162078|Pen-y-groes]]''
|-
| style='text-align:right'| 3862
| ''[[:d:Q6242756|John Kelt Edwards]]''
| [[File:J K Edwards & Dr Roberts (5254811) (cropped).jpg|center|128px]]
| 1875-03-04
| 1934-10-11
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 3863
| ''[[:d:Q6243125|John King]]''
|
| 1933-11-29
| 1982-12
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 3864
| ''[[:d:Q6244480|John Leighton Davies]]''
|
| 1927-08-24
| 1995
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 3865
| ''[[:d:Q6244754|John Lewis]]''
|
| 1881-08
| 1954-09-12
| [[Aberystwyth]]
|-
| style='text-align:right'| 3866
| ''[[:d:Q6244759|John Lewis]]''
|
| 1955-10-15
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 3867
| ''[[:d:Q6245031|John Lloyd]]''
| [[File:Portrait of The Reverend John Lloyd Rector of Caerwis (4671619).jpg|center|128px]]
| 1733-03-26
| 1793-05-22
| ''[[:d:Q6661071|Llanarmon-yn-Iâl]]''
|-
| style='text-align:right'| 3868
| ''[[:d:Q6245033|John Lloyd]]''
| [[File:Rev. John Lloyd 1780 by Moses Griffith.jpg|center|128px]]
| 1638
| 1687-02-13
| ''[[:d:Q3403473|Pendine]]''
|-
| style='text-align:right'| 3869
| ''[[:d:Q6245037|John Lloyd]]''
|
| 1754
|
| ''[[:d:Q13644944|Llansteffan]]''
|-
| style='text-align:right'| 3870
| ''[[:d:Q6245044|John Lloyd]]''
|
| 1833-09-03
| 1915-06-06
| ''[[:d:Q29501531|Dinas]]''
|-
| style='text-align:right'| 3871
| ''[[:d:Q6245047|John Lloyd]]''
|
| 1948-02-15
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 3872
| ''[[:d:Q6245058|John Lloyd Morgan]]''
| [[File:John Lloyd Morgan.jpg|center|128px]]
| 1861-02-13
| 1944-05-17
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3873
| ''[[:d:Q6245362|John Love Jones]]''
|
| 1885
| 1913-12-21
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 3874
| ''[[:d:Q6245648|John Lyons]]''
| [[File:JP Lyons.png|center|128px]]
| 1956-11-08
| 1982-11-11
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 3875
| ''[[:d:Q6246101|John MacGregor]]''
|
| 1885-08-27
| 1940-07-24
| [[Pontypridd]]
|-
| style='text-align:right'| 3876
| ''[[:d:Q6247450|John McCarthy]]''
|
| 1967-03-30
|
| [[Wales]]
|-
| style='text-align:right'| 3877
| ''[[:d:Q6248405|John Meirion Morris]]''
|
| 1936-03-14
| 2020-09-18
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 3878
| ''[[:d:Q6248513|John Meredith]]''
|
| 1863
| 1920-11-30
| ''[[:d:Q4980972|Brynhyfryd]]''
|-
| style='text-align:right'| 3879
| ''[[:d:Q6248571|John Metcalf]]''
|
| 1946
|
| [[Swansea]]
|-
| style='text-align:right'| 3880
| ''[[:d:Q6248845|John Mills]]''
|
| 1920-12-19
| 1982
| ''[[:d:Q3401133|Bagillt]]''
|-
| style='text-align:right'| 3881
| ''[[:d:Q6249221|John Montgomery Traherne]]''
|
| 1788-10-05
| 1860-02-05
| ''[[:d:Q5140546|Coedarhydyglyn]]''
|-
| style='text-align:right'| 3882
| ''[[:d:Q6249387|John Morgan]]''
|
| 1886-06-06
| 1957-06-26
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 3883
| ''[[:d:Q6249396|John Morgan]]''
|
| 1855
| 1937-04-11
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 3884
| ''[[:d:Q6249398|John Morgan]]''
|
| 1876-08-24
|
| [[Wales]]
|-
| style='text-align:right'| 3885
| ''[[:d:Q6249412|John Morgan]]''
|
| 1688
| 1733-02-28
| ''[[:d:Q6661464|Llangelynnin]]''
|-
| style='text-align:right'| 3886
| ''[[:d:Q6249473|John Morris-Jones]]''
| [[File:Sir John Morris-Jones.jpg|center|128px]]
| 1864-10-17
| 1929-04-16
| ''[[:d:Q20593558|Llandrygarn]]''
|-
| style='text-align:right'| 3887
| ''[[:d:Q6250035|John Myles]]''
|
| 1621
| 1683-02-03
| [[Wales]]<br/>''[[:d:Q3400273|Clifford]]''
|-
| style='text-align:right'| 3888
| ''[[:d:Q6251165|John Ogwen]]''
|
| 1944-04-25
|
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 3889
| ''[[:d:Q6251311|John Ormond]]''
|
| 1923
| 1990<br/>1990-05-04
| ''[[:d:Q5315782|Dyfnant]]''
|-
| style='text-align:right'| 3890
| ''[[:d:Q6251352|John Osborn Williams]]''
|
| 1886-03-28
| 1963-07-06
| [[Cairdiff]]
|-
| style='text-align:right'| 3891
| ''[[:d:Q6251370|John Osmond]]''
|
| 1946
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 3892
| ''[[:d:Q6251441|John Owen]]''
| [[File:Colonel Sir John Owen of Clenenney, Knt.jpg|center|128px]]
| 1600
| 1666
| ''[[:d:Q13127132|Clenennau]]''
|-
| style='text-align:right'| 3893
| ''[[:d:Q6251444|John Owen]]''
|
| 1698
| 1755-11-08
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 3894
| ''[[:d:Q6251454|John Owen Jones]]''
| [[File:Ap Ffarmwr.jpg|center|128px]]
| 1861-01-01
| 1899-03-02
| ''[[:d:Q7837762|Trefdraeth]]''
|-
| style='text-align:right'| 3895
| ''[[:d:Q6251980|John Parry]]''
| [[File:John Parry (Mormon).jpg|center|128px]]
| 1789-02-10
| 1868-01-13
| ''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 3896
| ''[[:d:Q6251987|John Parry Ddall]]''
| [[File:John Parry, harpist.jpeg|center|128px]]
| 1710
| 1782-10<br/>1782
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 3897
| ''[[:d:Q6251994|John Parsons]]''
|
| 1950-12-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3898
| ''[[:d:Q6253147|John Pook]]''
|
| 1942-02-02
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 3899
| ''[[:d:Q6253276|Sir John Powell]]''
| [[File:SirJohnPowell.jpg|center|128px]]
| 1633
| 1696-09-07
| ''[[:d:Q6661893|Llanwrda]]''
|-
| style='text-align:right'| 3900
| ''[[:d:Q6253393|John Price]]''
|
|
| 1584
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 3901
| ''[[:d:Q6253403|John Price]]''
|
| 1936-11-22
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 3902
| ''[[:d:Q6253405|John Price]]''
|
| 1854
| 1907-11-30
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3903
| ''[[:d:Q6253407|John Price]]''
| [[File:Portrait of J. Price, B.D., F.S.A (4673426).jpg|center|128px]]
| 1735-03-01
| 1813-08-12
| ''[[:d:Q3107398|Llandegla]]''<br/>''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 3904
| ''[[:d:Q6253409|John Price Davies]]''
|
| 1862
| 1955-03-31
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 3905
| ''[[:d:Q6253502|John Pryce]]''
|
| 1828
| 1903-08-15
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 3906
| ''[[:d:Q6253539|John Pullen]]''
|
| 1901-11-01
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 3907
| ''[[:d:Q6253643|John Quantick]]''
|
| 1909-07-06
| 1972
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 3908
| ''[[:d:Q6254476|John Rees]]''
|
| 1857-11-14
| 1949-10-14
| ''[[:d:Q20598284|Cwmgiedd]]''
|-
| style='text-align:right'| 3909
| ''[[:d:Q6254706|John Rhys Evans]]''
| [[File:John-rhys-evans.jpg|center|128px]]
| 1930-09-05
| 2010-01-02
| ''[[:d:Q5900757|Hopkinstown]]''
|-
| style='text-align:right'| 3910
| ''[[:d:Q6254763|John Richard Williams]]''
| [[File:Tryfanwy 01.JPG|center|128px]]
| 1867-09-29
| 1924-03-19
| ''[[:d:Q11015816|Rhostryfan]]''
|-
| style='text-align:right'| 3911
| ''[[:d:Q6255172|John Roberts]]''
|
| 1880-10-16
| 1959-07-29
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 3912
| ''[[:d:Q6255179|John Roberts]]''
|
| 1775
| 1829-07-25
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 3913
| ''[[:d:Q6255191|John Roberts]]''
| [[File:John Roberts (missionary).jpg|center|128px]]
| 1853-03-31
| 1949-01-22
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 3914
| ''[[:d:Q6255264|John Robins]]''
| [[File:John Robins rugby 1950.jpg|center|128px]]
| 1926-05-17
| 2007-02-21
| [[Cairdiff]]
|-
| style='text-align:right'| 3915
| ''[[:d:Q6255691|John Ross]]''
| [[File:John Ross.jpg|center|128px]]
| 1817-05-17
| 1903-02-05
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3916
| ''[[:d:Q6255826|John Rowland]]''
|
| 1936-03-16
| 2002
| [[Newport]]
|-
| style='text-align:right'| 3917
| ''[[:d:Q6255842|John Rowlands]]''
|
| 1938-08-14
| 2015-02-23
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 3918
| ''[[:d:Q6255974|John Russell]]''
|
| 1893-01-27
| 1917-11-06
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 3919
| ''[[:d:Q6256556|John Salusbury]]''
| [[File:Sir John Salisbury by Moses Griffith 02197.jpg|center|128px]]
| 1565
| 1612-07-24<br/>1613
| ''[[:d:Q6662131|Lleweni Hall]]''
|-
| style='text-align:right'| 3920
| ''[[:d:Q6258296|John Smith]]''
| [[File:John Smith MP 2009.jpg|center|128px]]
| 1951-03-17
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 3921
| ''[[:d:Q6258580|John Sparkes]]''
|
| 1954-01-09
|
| [[Swansea]]
|-
| style='text-align:right'| 3922
| ''[[:d:Q6258851|John Stanley Chick]]''
| [[File:John Chick.jpg|center|128px]]
| 1897-12-22
| 1960-01-21
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 3923
| ''[[:d:Q6259367|John Strand-Jones]]''
| [[File:J Strand-Jones-1901.jpg|center|128px]]
| 1877-12-02
| 1958-04-03
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 3924
| ''[[:d:Q6259875|John Sylvester John Gardiner]]''
| [[File:Reverend John Sylvester John Gardiner.jpg|center|128px]]
| 1765
| 1830
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3925
| ''[[:d:Q6260079|John Thomas Pritchard]]''
| [[File:John T. Pritchard (1883-1965) (8276639652).jpg|center|128px]]
| 1883-12-20
| 1965-06-02
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 3926
| ''[[:d:Q6260494|John Thomas]]''
|
| No/unknown value
| 1920-03
| [[Wales]]
|-
| style='text-align:right'| 3927
| ''[[:d:Q6260506|John Thomas]]''
|
| 1736-10-22
| 1769-03-27
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 3928
| ''[[:d:Q6260516|John Thomas]]''
| [[File:Official portrait of Lord Thomas of Cwmgiedd crop 2, 2022.jpg|center|128px]]
| 1947-10-22
|
| [[Wales]]
|-
| style='text-align:right'| 3929
| ''[[:d:Q6260584|John Thomas Job]]''
| [[File:John Thomas Job.jpg|center|128px]]
| 1867-05-21
| 1938-11-04
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 3930
| ''[[:d:Q6260713|John Thorley]]''
|
| 1927
| 2005-07-12
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 3931
| ''[[:d:Q6261173|John Treasure]]''
| [[File:JAPT Karsch.jpg|center|128px]]
| 1924-06-20
| 2004-02-09
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 3932
| ''[[:d:Q6261246|John Trevor]]''
|
|
| 1357
| ''[[:d:Q7839020|Trevor]]''
|-
| style='text-align:right'| 3933
| ''[[:d:Q6261280|John Tripp]]''
|
| 1927-07-22
| 1986-02-16
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 3934
| ''[[:d:Q6261362|John Tudno Williams]]''
| [[File:JTWilliams1976.jpg|center|128px]]
| 1938-12-31
|
| [[Wales]]
|-
| style='text-align:right'| 3935
| ''[[:d:Q6261637|John Uzzell Edwards]]''
|
| 1934-10-10
| 2014-03-05
| ''[[:d:Q5262556|Deri]]''
|-
| style='text-align:right'| 3936
| ''[[:d:Q6261849|John Vaughan, 1st Viscount Lisburne]]''
|
| 1667-12-07
| 1721-03-20<br/>1720-03-20
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 3937
| ''[[:d:Q6261871|John Vaughan]]''
| [[File:John Vaughan (1603-1674), follower of John Michael Wright.jpg|center|128px]]
| 1603-09-14
| 1674-12-10
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 3938
| ''[[:d:Q6262037|John Viriamu Jones]]''
| [[File:John Viriamu Jones.jpg|center|128px]]
| 1856-01-02
| 1901-06-01<br/>1901
| ''[[:d:Q13130712|Pentre Poeth]]''
|-
| style='text-align:right'| 3939
| ''[[:d:Q6262574|John W. Thomas]]''
| [[File:Wisconsin politician John W. Thomas.png|center|128px]]
| 1846-03-31
| 1925-03-08
| [[Wales]]
|-
| style='text-align:right'| 3940
| ''[[:d:Q6262923|John Walter Jones]]''
|
| 1946-03-28
| 2020-09-24
| ''[[:d:Q3397276|Moelfre]]''
|-
| style='text-align:right'| 3941
| ''[[:d:Q6262936|John Walters]]''
|
| 1760-06-11
| 1789-06-28
| [[Wales]]
|-
| style='text-align:right'| 3942
| ''[[:d:Q6263231|John Watson]]''
|
| 1942-05-02
|
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 3943
| ''[[:d:Q6263796|John White]]''
| [[File:Portrait of Effigies of the White's in Tenby Church (4672150).jpg|center|128px]]
| 1590-06-29
| 1645-01-29
| ''[[:d:Q7321488|Rhoscrowther]]''
|-
| style='text-align:right'| 3944
| ''[[:d:Q6263798|John G. White]]''
|
| 1943
|
| [[Wales]]
|-
| style='text-align:right'| 3945
| ''[[:d:Q6264119|John William Best]]''
|
| 1912-08-06
| 2000-04-22
| [[Wales]]
|-
| style='text-align:right'| 3946
| ''[[:d:Q6264149|John William Evans]]''
|
| 1875-05-26
| 1947-07-05
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 3947
| ''[[:d:Q6264172|John William Greene]]''
|
| 1876-09-03
| 1959-10-07
| [[Cairdiff]]
|-
| style='text-align:right'| 3948
| ''[[:d:Q6264353|John Williams]]''
|
| 1762
| 1802-04-03
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 3949
| ''[[:d:Q6264359|John Williams]]''
|
| 1626
| 1673-03-28
| ''[[:d:Q1541249|Llŷn Peninsula]]''
|-
| style='text-align:right'| 3950
| ''[[:d:Q6264368|John Williams]]''
|
| 1907
|
| ''[[:d:Q7321458|Rhos]]''
|-
| style='text-align:right'| 3951
| ''[[:d:Q6264378|John Williams]]''
|
| 1760
| 1826
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 3952
| ''[[:d:Q6265051|John Wynne]]''
|
| 1650
| 1714-12-31
| ''[[:d:Q16934171|Tegeingl]]''<br/>''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 3953
| ''[[:d:Q6265540|John de Ferrers, 1st Baron Ferrers of Chartley]]''
|
| 1271
| 1324
| [[Cairdiff]]
|-
| style='text-align:right'| 3954
| ''[[:d:Q6265659|John de Vere]]''
| [[File:John de Vere, 15th Earl of Oxford cropped.jpg|center|128px]]
| 1488
| 1540-03-21
| [[Swansea]]
|-
| style='text-align:right'| 3955
| ''[[:d:Q6265805|Ioan o Fynwy]]''
|
| 1182
| 1248
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 3956
| ''[[:d:Q6265973|Johnathan Edwards]]''
|
| 1984-07-05
|
| [[Pontypridd]]
|-
| style='text-align:right'| 3957
| ''[[:d:Q6266053|Johnnie Clay]]''
|
| 1898-03-18
| 1973-08-11
| ''[[:d:Q4942682|Bonvilston]]''
|-
| style='text-align:right'| 3958
| ''[[:d:Q6266298|Johnny Basham]]''
| [[File:Johnny Basham 1914.png|center|128px]]
| 1890-09-13
| 1947-06-08
| [[Newport]]
|-
| style='text-align:right'| 3959
| ''[[:d:Q6266931|Johnny Houlston]]''
|
| 1917
| 1962
| [[Cairdiff]]
|-
| style='text-align:right'| 3960
| ''[[:d:Q6266963|Johnny Jenkins]]''
| [[File:Johnny Jenkins (1875–1945).png|center|128px]]
| 1875-11-11
| 1945-11-26
| [[Cairdiff]]
|-
| style='text-align:right'| 3961
| ''[[:d:Q6267335|Johnny Morris]]''
| [[File:John Morris Bass Pro.jpg|center|128px]]
| 1916-06-20
| 1999-05-06
| [[Newport]]
|-
| style='text-align:right'| 3962
| ''[[:d:Q6267578|Johnny Ring]]''
|
| 1900-11-13
| 1984-11-10
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 3963
| ''[[:d:Q6267780|Johnny Thomas]]''
|
| 1880
| 1954-09-25
| ''[[:d:Q4667120|Aberkenfig]]''
|-
| style='text-align:right'| 3964
| ''[[:d:Q6270436|Jon Breakingbury]]''
|
| 1982-10-05
|
| [[Wales]]
|-
| style='text-align:right'| 3965
| ''[[:d:Q6271045|Jon Kenworthy]]''
|
| 1974-08-18
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 3966
| ''[[:d:Q6271100|Jon Langford]]''
| [[File:Langford.gif|center|128px]]
| 1957-10-11
|
| [[Newport]]
|-
| style='text-align:right'| 3967
| ''[[:d:Q6271197|Jon Manchip White]]''
| [[File:Jon Manchip White171.JPG|center|128px]]
| 1924-06-23
| 2013-07-31
| [[Cairdiff]]
|-
| style='text-align:right'| 3968
| ''[[:d:Q6271262|Jon Moore]]''
|
| 1955-11-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3969
| ''[[:d:Q6271270|Jonathan Mould]]''
| [[File:Jon Mould (Edinburgh).jpg|center|128px]]
| 1991-04-04
|
| [[Newport]]
|-
| style='text-align:right'| 3970
| ''[[:d:Q6271344|Jon Owen Jones]]''
|
| 1954-04-19
|
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 3971
| ''[[:d:Q6271440|Jon Raven]]''
|
| 20th century
| 2015-08
| [[Cairdiff]]
|-
| style='text-align:right'| 3972
| ''[[:d:Q6271551|Jon Shanklin]]''
| [[File:Jonathan Shanklin.jpg|center|128px]]
| 1953-09-29
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3973
| ''[[:d:Q6272670|Jonathan Bryant]]''
|
| 1976-10-14
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 3974
| ''[[:d:Q6272774|Jonathan Clark]]''
|
| 1958-11-12
|
| [[Swansea]]
|-
| style='text-align:right'| 3975
| ''[[:d:Q6272787|Jonathan Coates]]''
|
| 1975-06-27
|
| [[Swansea]]
|-
| style='text-align:right'| 3976
| ''[[:d:Q6273019|Jonathan Edwards]]''
|
| 1629
| 1712-07-20
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3977
| ''[[:d:Q6273042|Jonathan Elphick]]''
| [[File:Jonathan Elphick -Boquer Valley -Mallorca -31May2007.jpg|center|128px]]
| 1945
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 3978
| ''[[:d:Q6273065|Jonathan Evans]]''
|
| 1992-07-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3979
| ''[[:d:Q6273235|Jonathan Goodwin]]''
|
| 1980-02-20
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 3980
| ''[[:d:Q6273277|Jonathan Griffiths]]''
|
| 1972-03-05
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 3981
| ''[[:d:Q6273441|Jonathan Humphreys]]''
|
| 1969-02-27
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 3982
| ''[[:d:Q6273443|Jonathan Hughes]]''
|
| 1721-03-17
| 1805-11-25
| ''[[:d:Q29481655|Pengwern Hall]]''
|-
| style='text-align:right'| 3983
| ''[[:d:Q6273500|Jonathan Jones]]''
|
| 1978-10-27
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 3984
| ''[[:d:Q6273665|Jonathan Legard]]''
|
| 1961-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3985
| ''[[:d:Q6273874|Jonathan Meades]]''
| [[File:Meades and Barcham.jpg|center|128px]]
| 1992-03-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3986
| ''[[:d:Q6273991|Jonathan Myerson]]''
|
| 1960-01-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3987
| ''[[:d:Q6274141|Jonathan Phillips]]''
|
| 1982-07-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3988
| ''[[:d:Q6274260|Jonathan Rogers]]''
| [[File:Jonathan Rogers GC.jpg|center|128px]]
| 1920-09-16
| 1964-02-10
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 3989
| ''[[:d:Q6274785|Jonathan Williams]]''
|
| 1752<br/>1754
| 1829-08-19<br/>1829
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 3990
| ''[[:d:Q6275805|Jonny Owen]]''
|
| 1971-07-04
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3991
| ''[[:d:Q6275834|Jonny Vaughton]]''
|
| 1982-01-21
|
| [[Wales]]
|-
| style='text-align:right'| 3992
| ''[[:d:Q6276627|Jordan Howe]]''
|
| 1995-10-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 3993
| ''[[:d:Q6281609|Joseph Booth]]''
|
| 1873
| 1958-04-28
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 3994
| ''[[:d:Q6282275|Joseph Corsi]]''
|
| 1894
| 1959
| [[Cairdiff]]
|-
| style='text-align:right'| 3995
| ''[[:d:Q6282491|Joseph David Jones]]''
| [[File:Portrait of J. D. Jones (4671538).jpg|center|128px]]
| 1827
| 1870-09-17<br/>1870
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 3996
| ''[[:d:Q6282502|Joseph Davies]]''
| [[File:Joseph Davies (1866-1954) portrait.tif|center|128px]]
| 1866-12-11
| 1954-12-03
| [[Newport]]
|-
| style='text-align:right'| 3997
| ''[[:d:Q6282851|Joseph Edward Crawshay Partridge]]''
|
| 1879-07-21
| 1965-08-28
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 3998
| ''[[:d:Q6282865|Joseph Edwards]]''
| [[File:Joseph Edwards (1814–1882) sculptor.jpg|center|128px]]
| 1814-03-05
| 1882-01-09
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 3999
| ''[[:d:Q6283815|Joseph Harris]]''
|
| 1702<br/>1704
| 1764-09-26<br/>1764
| ''[[:d:Q7837765|Trefeca]]''
|-
| style='text-align:right'| 4000
| ''[[:d:Q6283821|Joseph Harris]]''
| [[File:Portrait of Joseph Harris, 'Gomer' (4670840) (cropped).jpg|center|128px]]
| 1773
| 1825-08-10
| ''[[:d:Q6661158|Llanddewi Velfrey]]''<br/>''[[:d:Q3460673|Wolf's Castle]]''
|-
| style='text-align:right'| 4001
| ''[[:d:Q6284379|Joseph Jenkins]]''
|
| 1818-02-27
| 1898-09-26
| [[Wales]]
|-
| style='text-align:right'| 4002
| ''[[:d:Q6285232|Joseph Mahoney]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4003
| ''[[:d:Q6287209|Joseph Stone]]''
|
| 1903-05-27
| 1986-06-17
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4004
| ''[[:d:Q6289200|Josh Navidi]]''
| [[File:Josh Navidi.png|center|128px]]
| 1990-12-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4005
| ''[[:d:Q6289460|Josh Turnbull]]''
| [[File:Josh Turnbull 2023.jpg|center|128px]]
| 1988-03-12
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 4006
| ''[[:d:Q6290254|Joshua T. Owen]]''
| [[File:Joshua T Owen.jpg|center|128px]]
| 1821-03-29
| 1887-11-07
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4007
| ''[[:d:Q6290431|Josiah Boydell]]''
|
| 1752-01-18
| 1817-03-27
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 4008
| ''[[:d:Q6290468|Josiah Duane Hicks]]''
| [[File:JosiahDuaneHicks.jpg|center|128px]]
| 1844-08-01
| 1923-05-09
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 4009
| ''[[:d:Q6290548|Josiah Lewis Morgan]]''
|
| 1893
| 1982-05-11
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 4010
| ''[[:d:Q6290605|Josiah Rees]]''
|
| 1744-10-02
| 1804-09-20
| ''[[:d:Q3403140|Llanfair-ar-y-bryn]]''
|-
| style='text-align:right'| 4011
| ''[[:d:Q6290641|Josiah Towyn Jones]]''
| [[File:Josiah Towyn Jones.jpg|center|128px]]
| 1858-12-28
| 1925-11-16
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 4012
| ''[[:d:Q6290786|Josie d'Arby]]''
| [[File:Josie d'Arby.jpg|center|128px]]
| 1972-10-03
|
| [[Newport]]
|-
| style='text-align:right'| 4013
| ''[[:d:Q6297402|Joyce Bland]]''
|
| 1906-05-10
| 1963-08-24
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4014
| ''[[:d:Q6297656|Joyce Watson]]''
| [[File:Joyce Watson.jpg|center|128px]]
| 1955
|
| ''[[:d:Q3402241|Manorbier]]''
|-
| style='text-align:right'| 4015
| ''[[:d:Q6306064|Jules Williams]]''
| [[File:JulesWilliamsWiki.jpg|center|128px]]
| 1968-07-23
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4016
| ''[[:d:Q6306356|Julia Davis]]''
|
| 1941-02-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4017
| ''[[:d:Q6307044|Julian Cayo-Evans]]''
|
| 1937-04-22
| 1995-03-28
| ''[[:d:Q7514896|Silian]]''
|-
| style='text-align:right'| 4018
| ''[[:d:Q6307356|Julian Lewis Jones]]''
|
| 1968-08-27
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4019
| ''[[:d:Q6308284|Julie James]]''
| [[File:Julie James - National Assembly for Wales.jpg|center|128px]]
| 1957-02-25
|
| [[Swansea]]
|-
| style='text-align:right'| 4020
| ''[[:d:Q6308404|Julie Morgan]]''
| [[File:Julie Morgan.jpg|center|128px]]
| 1944-11-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4021
| ''[[:d:Q6308663|Julien Cahn]]''
| [[File:Sir Julien Cahn.jpg|center|128px]]
| 1882-10-21
| 1944-09-26
| [[Cairdiff]]
|-
| style='text-align:right'| 4022
| ''[[:d:Q6312335|June Knox-Mawer]]''
|
| 1930-05-10
| 2006-04-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4023
| ''[[:d:Q6317431|Justin Burnell]]''
|
| 1967-05-29
|
| [[Wales]]
|-
| style='text-align:right'| 4024
| ''[[:d:Q6319360|Jynine James]]''
| [[File:Jyninejamesbw001.jpg|center|128px]]
| 1972-03-30
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4025
| ''[[:d:Q6369590|Karen Davies]]''
|
| 1965-06-19
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4026
| ''[[:d:Q6369945|Karen Paullada]]''
|
| 20th century
|
| ''[[:d:Q7054913|Corneli]]''<br/>[[Wales]]
|-
| style='text-align:right'| 4027
| ''[[:d:Q6370035|Karen Sinclair]]''
| [[File:Karen Sinclair.jpg|center|128px]]
| 1952-11-20
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4028
| ''[[:d:Q6371796|Karl Francis]]''
| [[File:Karl Francis, 2014 (wedi'i gropio).jpg|center|128px]]
| 1942-04-01<br/>1943
|
| ''[[:d:Q3401157|Bedwas]]''
|-
| style='text-align:right'| 4029
| ''[[:d:Q6371908|Karl Hocking]]''
|
| 1975-06-09
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4030
| ''[[:d:Q6372187|Karl Ready]]''
|
| 1972-08-14
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4031
| ''[[:d:Q6375562|Kate Jarman]]''
|
| 1980-04-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4032
| ''[[:d:Q6375640|Kate McGill]]''
| [[File:Kate McGill 2010.jpg|center|128px]]
| 1990-03-10
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4033
| ''[[:d:Q6376387|Katherine Grant, 12th Countess of Dysart]]''
|
| 1918-06-01
| 2011-11-08
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 4034
| ''[[:d:Q6376590|Katheryn of Berain]]''
| [[File:Adriaen of Cronenburgh, Katheryn of Berain.jpg|center|128px]]
| 1534
| 1591-08-27
| ''[[:d:Q17738193|Berain]]''
|-
| style='text-align:right'| 4035
| ''[[:d:Q6376713|Kathleen Freeman]]''
|
| 1897-06-22
| 1959-02-21
| [[Cairdiff]]
|-
| style='text-align:right'| 4036
| ''[[:d:Q6377256|Kathy Lloyd]]''
|
| 1967-11-13
|
| ''[[:d:Q737888|Portmeirion]]''
|-
| style='text-align:right'| 4037
| ''[[:d:Q6377422|Katie Curtis]]''
| [[File:Katie Prankerd.jpg|center|128px]]
| 1988-11-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4038
| ''[[:d:Q6377553|Katie Sherwood]]''
|
| 1986-01-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4039
| ''[[:d:Q6377585|Katie Williams]]''
|
| 1984-05-24
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4040
| ''[[:d:Q6378533|Katy Wix]]''
| [[File:Katy Wix.jpg|center|128px]]
| 1980-02-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4041
| ''[[:d:Q6380641|Kayne McLaggon]]''
| [[File:Kayne McLaggon.jpg|center|128px]]
| 1990-09-21
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4042
| ''[[:d:Q6382451|Richard Jones Berwyn]]''
| [[File:R.J.Berwyn.jpg|center|128px]]
| 1838
| 1917-12-25
| ''[[:d:Q7837859|Tregeiriog]]''<br/>''[[:d:Q3406382|Glyndyfrdwy]]''
|-
| style='text-align:right'| 4043
| ''[[:d:Q6383816|Keiron Jenkins]]''
|
| 1987-02-17
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 4044
| ''[[:d:Q6383819|Keiron Self]]''
|
| 1971
|
| [[Newport]]
|-
| style='text-align:right'| 4045
| ''[[:d:Q6384028|Keith Barnes]]''
|
| 1934-10-30
| 2024-04-08
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4046
| ''[[:d:Q6384037|Keith Baxter]]''
| [[File:Paul Rogers-Keith Baxter in Sleuth.jpg|center|128px]]
| 1933-04-29
| 2023-09-24
| [[Newport]]
|-
| style='text-align:right'| 4047
| ''[[:d:Q6384099|Keith Bradshaw]]''
|
| 1939-04-07
| 2014-02-02
| ''[[:d:Q5057255|Cefn Cribwr]]''
|-
| style='text-align:right'| 4048
| ''[[:d:Q6384144|Keith Burnett]]''
| [[File:KeithBurnettDec08.jpg|center|128px]]
| 1953-09-30
|
| [[Llwynypia]]
|-
| style='text-align:right'| 4049
| ''[[:d:Q6384255|Keith Davies]]''
| [[File:Keith Davies - National Assembly for Wales.jpg|center|128px]]
|
|
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 4050
| ''[[:d:Q6384474|Keith Haynes]]''
| [[File:Keith Haynes of Picture Frame Seduction.jpg|center|128px]]
| 1963-12-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4051
| ''[[:d:Q6384571|Keith Jones]]''
|
| 1928-10-23
| 2007-08-25
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 4052
| ''[[:d:Q6384761|Keith Miles]]''
|
| 1940
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 4053
| ''[[:d:Q6384884|Keith Peters]]''
|
| 1938-07-26
|
| ''[[:d:Q2477613|Baglan]]''
|-
| style='text-align:right'| 4054
| ''[[:d:Q6384891|Keith Pontin]]''
|
| 1956-06-14
| 2020-08-02
| ''[[:d:Q3404556|Pontyclun]]''
|-
| style='text-align:right'| 4055
| ''[[:d:Q6384900|Keith Pring]]''
|
| 1943-03-11
| 2018-01-25
| [[Newport]]
|-
| style='text-align:right'| 4056
| ''[[:d:Q6385114|Keith Thomas]]''
|
| 1933-01-02
|
| ''[[:d:Q3400611|Wick]]''
|-
| style='text-align:right'| 4057
| ''[[:d:Q6385127|Keith Todd]]''
|
| 1941-03-02
| 2022-01-08
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 4058
| ''[[:d:Q6385196|Keith Webber]]''
|
| 1943-01-05
| 1983-09-26
| [[Cairdiff]]
|-
| style='text-align:right'| 4059
| ''[[:d:Q6387293|Ken Barton]]''
|
| 1937-09-20
| 1982-09-06
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4060
| ''[[:d:Q6387568|Ken Ellis]]''
|
| 1928-01-22
| 2003-07-25
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 4061
| ''[[:d:Q6387817|Ken Hollyman]]''
|
| 1922-11-18
| 2009-05-14
| [[Cairdiff]]
|-
| style='text-align:right'| 4062
| ''[[:d:Q6387901|Ken Jones]]''
| [[File:Ken Jones.jpg|center|128px]]
| No/unknown value
|
| [[Wales]]
|-
| style='text-align:right'| 4063
| ''[[:d:Q6388051|Ken MacDonald]]''
|
| 1898-04-24
|
| [[Wales]]
|-
| style='text-align:right'| 4064
| ''[[:d:Q6388362|Ken Richards]]''
|
| 1934-01-29
| 1972-01-08
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4065
| ''[[:d:Q6388387|Ken Roberts]]''
|
| 1936-03-27
| 2021-02-06
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 4066
| ''[[:d:Q6388417|Ken Rowlands]]''
|
| 1927-07-03
| 2011
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 4067
| ''[[:d:Q6388501|Ken Skates]]''
| [[File:Ken Skates - National Assembly for Wales.jpg|center|128px]]
| 1976-04-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4068
| ''[[:d:Q6388602|Ken Thomas]]''
|
| 1927-02-07
| 2008-08-08
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4069
| ''[[:d:Q6388718|Ken Wookey]]''
|
| 1922-02-23
| 2003-01-11
| [[Newport]]
|-
| style='text-align:right'| 4070
| ''[[:d:Q6388720|Ken Wookey]]''
|
| 1946-12-30
| 1992-12-16
| [[Newport]]
|-
| style='text-align:right'| 4071
| ''[[:d:Q6389658|Llwyd ap Iwan]]''
| [[File:LLwyd Ap Iwan.jpg|center|128px]]
| 1862-02-20
| 1909-12-29
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 4072
| ''[[:d:Q6389808|Kenneth Allott]]''
|
| 1912-08-29
| 1973-05-23
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 4073
| ''[[:d:Q6389993|Kenneth Cooper]]''
|
| 1905
| 1981
| [[Cairdiff]]
|-
| style='text-align:right'| 4074
| ''[[:d:Q6391211|Kenny Simpkins]]''
|
| 1943-12-21
| 2023
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4075
| ''[[:d:Q6391344|Kenrick Harris]]''
|
| 1885-11-15
|
| [[Newport]]
|-
| style='text-align:right'| 4076
| ''[[:d:Q6392945|Kenyon Jones]]''
|
| 1911-09-05
| 1998-12-16
| ''[[:d:Q3397990|Llanishen]]''
|-
| style='text-align:right'| 4077
| ''[[:d:Q6393868|Keri Davies]]''
|
| 20th century
|
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 4078
| ''[[:d:Q6393873|Keri Jones]]''
|
| 1969-11-24
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4079
| ''[[:d:Q6394594|Kerry Morgan]]''
|
| 1988-10-31
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4080
| ''[[:d:Q6395702|Kevin Aherne-Evans]]''
|
| 1980-12-16
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4081
| ''[[:d:Q6396226|Kevin Ellis]]''
| [[File:Kevin Ellis.jpg|center|128px]]
| 1965-05-29
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4082
| ''[[:d:Q6396343|Kevin Gall]]''
| [[File:Kevin Gall York City v. Ebbsfleet United 14-11-09.png|center|128px]]
| 1982-02-04
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4083
| ''[[:d:Q6396787|Kevin Lloyd]]''
|
| 1970-09-26
|
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 4084
| ''[[:d:Q6397382|Kevin Rogers]]''
|
| 1963-09-23
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4085
| ''[[:d:Q6398588|Kezia Burrows]]''
|
|
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4086
| ''[[:d:Q6404453|Kid Chaos]]''
|
| 1966-07-01
|
| [[Swansea]]
|-
| style='text-align:right'| 4087
| ''[[:d:Q6405352|Kieran Crawford]]''
|
| 1982-07-13
|
| [[Newport]]
|-
| style='text-align:right'| 4088
| ''[[:d:Q6413323|Kingsley Jones]]''
|
| 1935-08-05
| 2003-01-26
| [[Pontypridd]]
|-
| style='text-align:right'| 4089
| ''[[:d:Q6414752|Kira Geil]]''
| [[File:European Kira GEIL Tobias EISENBAUER.jpg|center|128px]]
| 1985-06-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4090
| ''[[:d:Q6414951|Kirby Myhill]]''
| [[File:Kirby Myhill.jpg|center|128px]]
| 1992-02-05
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 4091
| ''[[:d:Q6416168|Kirsty Jones]]''
|
| 1978
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 4092
| ''[[:d:Q6437879|Kristian Bell]]''
|
| 1972-04-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4093
| ''[[:d:Q6437885|Kristian Dacey]]''
|
| 1989-07-25
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4094
| ''[[:d:Q6437967|Kristian O'Leary]]''
|
| 1977-08-30
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4095
| ''[[:d:Q6437973|Kristian Phillips]]''
|
| 1990-09-02
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4096
| ''[[:d:Q6446940|Kurt Nogan]]''
|
| 1970-09-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4097
| ''[[:d:Q6450928|Kyffin Williams]]''
| [[File:Cerflun Kyffin Williams statue.jpg|center|128px]]
| 1918-05-09
| 2006-09-01
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 4098
| ''[[:d:Q6451266|Kyle Letheren]]''
| [[File:Kyle Letheren 2017-03-04 1.jpg|center|128px]]
| 1987-12-26
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4099
| ''[[:d:Q6451479|Kyle Tudge]]''
|
| 1987-03-19
|
| [[Newport]]
|-
| style='text-align:right'| 4100
| ''[[:d:Q6452565|Kyron Duke]]''
| [[File:Kyron Duke - Our Greatest Team Parade (1).jpg|center|128px]]
| 1992-10-12
|
| [[Newport]]
|-
| style='text-align:right'| 4101
| ''[[:d:Q6483606|Lancelot Bulkeley]]''
|
| 1568
| 1650
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 4102
| ''[[:d:Q6498889|Laura Evans]]''
| [[File:LauraEvans.jpg|center|128px]]
| 1982
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4103
| ''[[:d:Q6500336|Lauren Phillips]]''
|
| 1981
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4104
| ''[[:d:Q6501718|Laurie Sheffield]]''
|
| 1939-04-27
| 2021-11-09
| [[Swansea]]
|-
| style='text-align:right'| 4105
| ''[[:d:Q6503979|Lawrence Davies]]''
|
| 1977-09-03
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4106
| ''[[:d:Q6504240|Lawrence Jones]]''
|
| 1968-08-01
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 4107
| ''[[:d:Q6504303|Lawrence Langner]]''
| [[File:Lawrence Langner portrait.jpg|center|128px]]
| 1890-05-30
| 1962-12-26
| [[Sooth Wales]]<br/>[[Swansea]]
|-
| style='text-align:right'| 4108
| ''[[:d:Q6513002|Lee Baddeley]]''
|
| 1974-07-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4109
| ''[[:d:Q6513047|Lee Beach]]''
|
| 1982-10-06
|
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 4110
| ''[[:d:Q6513621|Lee Fowler]]''
| [[File:Lee Fowler 07-04-12.png|center|128px]]
| 1983-06-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4111
| ''[[:d:Q6514132|Lee Jarman]]''
|
| 1977-12-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4112
| ''[[:d:Q6514139|Lee Jenkins]]''
|
| 1979-06-28
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4113
| ''[[:d:Q6514183|Lee Jones]]''
|
| 1970-08-09
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4114
| ''[[:d:Q6514659|Lee Nogan]]''
|
| 1969-05-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4115
| ''[[:d:Q6514721|Lee Phillips]]''
|
| 1979-03-18
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4116
| ''[[:d:Q6514744|Lee Powell]]''
|
| 1973-06-02
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4117
| ''[[:d:Q6514983|Lee Selby]]''
| [[File:Lee Selby 2015 (cropped).png|center|128px]]
| 1987-01-14
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4118
| ''[[:d:Q6515526|Lee Williams]]''
| [[File:Lee Williams Celtic Crusaders.jpg|center|128px]]
| 1988-12-19
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4119
| ''[[:d:Q6515531|Lee Williams]]''
|
| 1986-10-27
|
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 4120
| ''[[:d:Q6519569|Leigh Davies]]''
|
| 1976-02-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4121
| ''[[:d:Q6519628|Leigh Loveday]]''
|
| 1973
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4122
| ''[[:d:Q6519732|Leighton Andrews]]''
| [[File:Leighton Andrews.jpg|center|128px]]
| 1957-08-11<br/>1957
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4123
| ''[[:d:Q6519760|Leighton Hodges]]''
|
| 1975-11-25
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 4124
| ''[[:d:Q6519766|Leighton James]]''
|
| 1953-02-16
| 2024-04-19
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 4125
| ''[[:d:Q6519893|Leila Megane]]''
| [[File:Leila Megane.jpg|center|128px]]
| 1891-04-05
| 1960-01-02
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 4126
| ''[[:d:Q6521654|Len Apsey]]''
|
| 1910-02-11
| 1967
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 4127
| ''[[:d:Q6521680|Len Beynon]]''
|
| 1912-04-24
| 1992-08-17
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4128
| ''[[:d:Q6521686|Len Blyth]]''
|
| 1920-11-20
| 1995-06-24
| [[Swansea]]
|-
| style='text-align:right'| 4129
| ''[[:d:Q6521737|Len Davies]]''
| [[File:Davies, Len.jpg|center|128px]]
| 1899-04-28
| 1945-11-23
| [[Cairdiff]]
|-
| style='text-align:right'| 4130
| ''[[:d:Q6521762|Len Evans]]''
|
| 1903-05-20
| 1977-12-26
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 4131
| ''[[:d:Q6521816|Len Hill]]''
|
| 1941-04-14
| 2007-04-10
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4132
| ''[[:d:Q6522001|Len Trump]]''
|
| 1887-04-23
| 1948-06-09
| [[Newport]]
|-
| style='text-align:right'| 4133
| ''[[:d:Q6522013|Len Weare]]''
|
| 1934-07-23
| 2012-09-21
| [[Newport]]
|-
| style='text-align:right'| 4134
| ''[[:d:Q6523015|Lenny Woodard]]''
|
| 1976-04-02
|
| ''[[:d:Q5187462|Croesyceiliog]]''
|-
| style='text-align:right'| 4135
| ''[[:d:Q6524435|Leoline Jenkins]]''
| [[File:Sir Leoline Jenkins by Herbert Tuer.jpg|center|128px]]
| 1625
| 1685-09-01
| ''[[:d:Q6661804|Llantrisant]]''
|-
| style='text-align:right'| 4136
| ''[[:d:Q6524712|Leon Jeanne]]''
|
| 1980-11-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4137
| ''[[:d:Q6525150|Leonard Brockington]]''
| [[File:Leonard Brockington.jpg|center|128px]]
| 1888-04-06
| 1966-09-15
| [[Cairdiff]]
|-
| style='text-align:right'| 4138
| ''[[:d:Q6525189|Leonard Constance]]''
|
| 1922
| 1990
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4139
| ''[[:d:Q6525197|Leonard Cox]]''
|
| 1495
| 1549
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 4140
| ''[[:d:Q6525258|Leonard Eastment]]''
|
| 1901-02-28
| 1956-07-29
| [[Penygraig]]
|-
| style='text-align:right'| 4141
| ''[[:d:Q6525823|Leonard Watkins]]''
|
| 1859-12-07
| 1901-02-07
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4142
| ''[[:d:Q6529155|Les Anthony]]''
|
| 1921-11-21
| 2010-10-30
| ''[[:d:Q7320729|Rhiwfawr]]''
|-
| style='text-align:right'| 4143
| ''[[:d:Q6529820|Les Owen]]''
|
| 1933-04-11
| 2020-06-07
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 4144
| ''[[:d:Q6530036|Les Thomas]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4145
| ''[[:d:Q6530869|Leslie Hardman]]''
| [[File:The Liberation of Bergen-belsen Concentration Camp, April 1945 BU4270.jpg|center|128px]]
| 1913-02-18
| 2008-10-07
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 4146
| ''[[:d:Q6530924|Leslie Jenkins]]''
|
| 1898-08-26
| 1971-06-14
| [[Newport]]
|-
| style='text-align:right'| 4147
| ''[[:d:Q6530940|Leslie Jones]]''
|
| 1911-07-01
| 1981-01
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4148
| ''[[:d:Q6530999|Leslie Manfield]]''
|
| 1915-11-10
| 2006-11-02
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 4149
| ''[[:d:Q6532137|Leszek Borysiewicz]]''
| [[File:Cmglee Cambridge graduation Leszek Borysiewicz.jpg|center|128px]]
| 1951-04-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4150
| ''[[:d:Q6534142|Eleanor Mary Reid]]''
|
| 1860-11-13
| 1953-09-28
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 4151
| ''[[:d:Q6535418|Levi Gibbon]]''
|
| 1807
| 1870-08-01
| ''[[:d:Q264304|Cwmfelin Mynach]]''
|-
| style='text-align:right'| 4152
| ''[[:d:Q6535944|Lew Booth]]''
|
| 1912-02-28
| 1984-07
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4153
| ''[[:d:Q6536139|Lewes Roberts]]''
| [[File:Captain Lewis Roberts.jpg|center|128px]]
| 1596
| 1641-03-12
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 4154
| ''[[:d:Q6536435|Lewis Cobden Thomas]]''
|
| 1865-08-06
| 1928-04-14
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4155
| ''[[:d:Q6536486|Lewis Davies]]''
|
| 1913-01-26
| 2011-12-09
| ''[[:d:Q20161307|Blaenclydach]]''
|-
| style='text-align:right'| 4156
| ''[[:d:Q6536522|Lewis Edwards]]''
| [[File:Revd Dr Lewis Edwards (1809-87) NLW3363289.jpg|center|128px]]
| 1809-10-27
| 1887-07-19
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 4157
| ''[[:d:Q6536534|Lewis Evans]]''
|
| 1755
| 1827
| ''[[:d:Q4868001|Bassaleg]]''<br/>''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4158
| ''[[:d:Q6536535|Lewis Evans]]''
|
| 1987-07-09
|
| [[Newport]]
|-
| style='text-align:right'| 4159
| ''[[:d:Q6536537|Lewis Evans]]''
|
| 1700
| 1756-06-12
| ''[[:d:Q3404407|Llangwnnadl]]''
|-
| style='text-align:right'| 4160
| ''[[:d:Q6536585|Lewis Gilbertson]]''
|
| 1814-11-27
| 1896-04-02
| ''[[:d:Q13131979|Tre'r-ddôl]]''
|-
| style='text-align:right'| 4161
| ''[[:d:Q6536746|Lewis Jones]]''
|
| 1897-12-28
| 1939-01-27
| ''[[:d:Q3400833|Clydach Vale]]''
|-
| style='text-align:right'| 4162
| ''[[:d:Q6536796|Lewis Llewellyn]]''
|
| 1881-11-06
| 1931-02-01
| [[Newport]]
|-
| style='text-align:right'| 4163
| ''[[:d:Q6536798|Lewis Llewelyn Dillwyn]]''
| [[File:Lewis Llewelyn Dillwyn Vanity Fair 13 May 1882.jpg|center|128px]]
| 1814
| 1892-06-19
| [[Swansea]]
|-
| style='text-align:right'| 4164
| ''[[:d:Q6536806|Lewis Lougher]]''
|
| 1871-10-01
| 1955-08-28
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 4165
| ''[[:d:Q6536811|Lewis Lyne]]''
| [[File:Germany Under Allied Occupation BU8524.jpg|center|128px]]
| 1899-08-21
| 1970-11-04
| [[Newport]]
|-
| style='text-align:right'| 4166
| ''[[:d:Q6536889|Lewis Mills]]''
|
| 1989-05-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4167
| ''[[:d:Q6536902|Lewis Morris]]''
| [[File:Lewis Morris woodburytype.png|center|128px]]
| 1833-01-23
| 1907-11-12
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4168
| ''[[:d:Q6536981|Lewis Pugh Pugh]]''
|
| 1837-08-03
| 1908-01-06
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 4169
| ''[[:d:Q6536998|Lewis Reece]]''
| [[File:Lewis Reece.jpg|center|128px]]
| 1991-06-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4170
| ''[[:d:Q6537000|Lewis Rees]]''
|
| 1910-01-07
| 1976-12-21
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 4171
| ''[[:d:Q6537243|Lewis Owen]]''
|
| 16th century
| 1555-10-11
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 4172
| ''[[:d:Q6537490|Lewys Dwnn]]''
|
| 1550
| 1616
| ''[[:d:Q4898676|Bettws Cedewain]]''
|-
| style='text-align:right'| 4173
| ''[[:d:Q6537492|Lewys Morgannwg]]''
|
|
| 1565
| ''[[:d:Q7809073|Tir Iarll]]''<br/>''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 4174
| ''[[:d:Q6538148|Leyton Maxwell]]''
|
| 1979-10-03
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4175
| ''[[:d:Q6539548|Liam Davies]]''
|
| 1986-05-10
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 4176
| ''[[:d:Q6539846|Liam Williams]]''
| [[File:Liam Williams 2013.jpg|center|128px]]
| 1991-04-09
|
| [[Swansea]]
|-
| style='text-align:right'| 4177
| ''[[:d:Q6541894|Martin Hinds]]''
|
| 1941-04-10
| 1988-12-01
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4178
| ''[[:d:Q6548260|Lillie Goodisson]]''
| [[File:Lillie Goodisson.png|center|128px]]
| 1859-04
| 1947-01-10
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 4179
| ''[[:d:Q6548532|Lily Matthews]]''
|
| 1989-09-30
|
| [[Wales]]
|-
| style='text-align:right'| 4180
| ''[[:d:Q6552839|Lindsay Whittle]]''
| [[File:Lindsay Whittle 2011.jpg|center|128px]]
| 1953
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4181
| ''[[:d:Q6555628|Lionel Emmitt]]''
|
| 1930
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4182
| ''[[:d:Q6555769|Lionel Rees]]''
| [[File:Lionel Rees VC IWM Q 68027.jpg|center|128px]]
| 1884-07-31
| 1955-09-28
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4183
| ''[[:d:Q6557938|Lisa Diveney]]''
|
| 1984-05-07
|
| [[Wales]]
|-
| style='text-align:right'| 4184
| ''[[:d:Q6558184|Lisa Lee Dark]]''
|
| 1981-04-16
|
| [[Swansea]]
|-
| style='text-align:right'| 4185
| ''[[:d:Q6572944|Hayley Jones]]''
| [[File:Hayley jones stage two womens tour 2014.jpg|center|128px]]
| 1995-09-26
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4186
| ''[[:d:Q6660144|Liz Fuller]]''
| [[File:Shooter - Movie premiere (439610088) (cropped).jpg|center|128px]]
| 1975-12-30
|
| [[Swansea]]
|-
| style='text-align:right'| 4187
| ''[[:d:Q6660196|Liz Johnson]]''
|
| 1985-12-03
|
| [[Newport]]
|-
| style='text-align:right'| 4188
| ''[[:d:Q6661978|John Jones]]''
| [[File:Portrait of Parchedig John Jones, Llanllyfni (Swydd Gaernarfon) (4673763).jpg|center|128px]]
| 1786
| 1863-02-12
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 4189
| ''[[:d:Q6662032|Llew Ashcroft]]''
|
| 1921-07-10
| 2005-06-13
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 4190
| ''[[:d:Q6662036|Llew Edwards]]''
|
| 1894-10-22
| 1965
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 4191
| ''[[:d:Q6662070|Llewellyn Heycock, Baron Heycock]]''
|
| 1905-08-12
| 1990-03-13
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4192
| ''[[:d:Q6662082|Llewellyn Treharne]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4193
| ''[[:d:Q6662097|Llewelyn David Bevan]]''
|
| 1842-09-11
| 1918-08-09
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4194
| ''[[:d:Q6662102|Llewelyn Davies]]''
|
| 1881
| 1961
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4195
| ''[[:d:Q6662110|Llewelyn Kenrick]]''
| [[File:Llewelyn kenrick.jpg|center|128px]]
| 1847
| 1933-05-29
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 4196
| ''[[:d:Q6662111|Llewelyn Traherne]]''
|
| 1766-03-13
| 1842-12-05
| [[Cairdiff]]
|-
| style='text-align:right'| 4197
| ''[[:d:Q6662119|Llewelyn Wyn Griffith]]''
|
| 1890-08-30
| 1977-09-27
| ''[[:d:Q2075495|Rhos-on-Sea]]''
|-
| style='text-align:right'| 4198
| ''[[:d:Q6662167|Llion Iwan]]''
|
| 1969-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4199
| ''[[:d:Q6662169|Llinor ap Gwynedd]]''
|
| 1974-06-20
|
| ''[[:d:Q3460580|Crymych]]''
|-
| style='text-align:right'| 4200
| ''[[:d:Q6662381|Lloyd Davies]]''
|
| 1877-02-23
| 1957-10-10
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 4201
| ''[[:d:Q6662537|Lloyd Kenyon]]''
| [[File:Lloyd Kenyon, 1st Baron Kenyon by William Davison.jpg|center|128px]]
| 1732-10-05
| 1802-04-04<br/>1802
| ''[[:d:Q5648626|Hanmer]]''
|-
| style='text-align:right'| 4202
| ''[[:d:Q6662689|Lloyd Peers]]''
| [[File:Ospreys - Warm-up - 2012-12-08 - 24.jpg|center|128px]]
| 1991-02-02
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4203
| ''[[:d:Q6662812|Lloyd White]]''
| [[File:Lloyd White Crusaders.jpg|center|128px]]
| 1988-08-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4204
| ''[[:d:Q6662817|Lloyd Williams]]''
|
| 1925-05-30
| 2007-07-18
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 4205
| ''[[:d:Q6662819|Lloyd Williams]]''
|
| 1933-10-19
| 2017-02-25
| ''[[:d:Q1401784|Ffynnon Taf]]''
|-
| style='text-align:right'| 4206
| ''[[:d:Q6662995|Llywelyn Siôn]]''
|
| 1540
| 1615
| [[Bridgend|Pen-y-bont ar Ogwr]]<br/>''[[:d:Q39011804|Llangewydd Castle, Laleston]]''
|-
| style='text-align:right'| 4207
| ''[[:d:Q6674884|Lonza Bowdler]]''
|
| 1901-01-04
| 1962-12-17
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 4208
| ''[[:d:Q6685709|Lou Reed]]''
|
| 1987-09-10
|
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 4209
| ''[[:d:Q6687073|Louis Dyke]]''
| [[File:Louis Dyke.jpg|center|128px]]
| 1888
| 1961-07-12
| [[Cairdiff]]
|-
| style='text-align:right'| 4210
| ''[[:d:Q6688546|Louisa Nott-Bower]]''
|
| 1861
| 1925-09-06
| ''[[:d:Q13132036|Troedyraur]]''
|-
| style='text-align:right'| 4211
| ''[[:d:Q6694820|Lu Corfield]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4212
| ''[[:d:Q6701976|Luke Ford]]''
|
| 1988-03-08
|
| [[Wales]]
|-
| style='text-align:right'| 4213
| ''[[:d:Q6702019|Luke Hamilton]]''
| [[File:Luke Hamilton.png|center|128px]]
| 1992-01-07
|
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 4214
| ''[[:d:Q6708312|Lyn Davies]]''
|
| 1947-09-29
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4215
| ''[[:d:Q6708323|Lyn Harding]]''
| [[File:Mr. Lyn Harding LCCN2014692774 (cropped).jpg|center|128px]]
| 1867-10-12
| 1952-12-26
| ''[[:d:Q7587366|St Brides Wentloog]]''
|-
| style='text-align:right'| 4216
| ''[[:d:Q6708330|Lyn James]]''
|
| 1935-11-13<br/>1929-11-13
| 2017-05-31
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 4217
| ''[[:d:Q6708332|Lyn Jones]]''
|
| 1964-06-05
|
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 4218
| ''[[:d:Q6708718|Lyndon Bateman]]''
|
| 1979-02-02
|
| [[Wales]]
|-
| style='text-align:right'| 4219
| ''[[:d:Q6708735|Lyndon Jones]]''
|
| 1976-11-08
|
| [[Newport]]
|-
| style='text-align:right'| 4220
| ''[[:d:Q6708773|Lyndsay Hugh Morgan]]''
| [[File:Warrant Officer Lindsey Morgan (cropped).jpg|center|128px]]
| 20th century
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4221
| ''[[:d:Q6708817|Lynette Davies]]''
|
| 1948-10-18
| 1993-12-01
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 4222
| ''[[:d:Q6708943|Lynn Bowles]]''
|
| 1963-01-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4223
| [[Lynn Howells]]
| [[File:Lynn Howells 2015.jpg|center|128px]]
| 1950-05-29
|
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 4224
| ''[[:d:Q6709269|Lynn Ungoed-Thomas]]''
|
| 1904-06-29
| 1972-12-04
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4225
| ''[[:d:Q6709334|Lynne Carol]]''
|
| 1914-06-29
| 1990-06-30
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 4226
| ''[[:d:Q6709399|Lynne Neagle]]''
| [[File:Lynne Neagle official portrait 2021 (cropped).JPG|center|128px]]
| 1968-01-18
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4227
| ''[[:d:Q6722772|Macauley Cook]]''
| [[File:Macauley Cook.jpg|center|128px]]
| 1991-12-31
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 4228
| ''[[:d:Q6728347|Madoline Thomas]]''
|
| 1890-01-02
| 1989-12-30
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4229
| ''[[:d:Q6735137|Mai Jones]]''
|
| 1899-02-06
| 1960-05-07
| [[Newport]]
|-
| style='text-align:right'| 4230
| ''[[:d:Q6740608|Mal Griffiths]]''
|
| 1919-03-08
| 1969-04-05
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4231
| ''[[:d:Q6740639|Mal Pope]]''
|
| 1960-05-18
|
| ''[[:d:Q4980972|Brynhyfryd]]''
|-
| style='text-align:right'| 4232
| ''[[:d:Q6742252|Malcolm Collins]]''
|
| 1935
|
| ''[[:d:Q5033865|Canton]]''
|-
| style='text-align:right'| 4233
| ''[[:d:Q6742263|Malcolm Dacey]]''
|
| 1960-07-12
|
| [[Swansea]]
|-
| style='text-align:right'| 4234
| ''[[:d:Q6742267|Malcolm Davies]]''
|
| 1926-01-15
| 2011-02-27
| ''[[:d:Q5197244|Cwmfelin]]''
|-
| style='text-align:right'| 4235
| ''[[:d:Q6742298|Malcolm Edwards]]''
|
| 1939-10-25
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4236
| ''[[:d:Q6742407|Malcolm Johnson]]''
| [[File:Malcolm Johnson - WSIS Forum 2018 (28097516059) (cropped).jpg|center|128px]]
| 1947-06-19
|
| [[Welshpool]]
|-
| style='text-align:right'| 4237
| ''[[:d:Q6742531|Malcolm Nash]]''
|
| 1945-05-09
| 2019-07-30
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4238
| ''[[:d:Q6742541|Malcolm Page]]''
|
| 1947-02-05
|
| ''[[:d:Q6423716|Knucklas]]''
|-
| style='text-align:right'| 4239
| ''[[:d:Q6742570|Malcolm Price]]''
|
| 1937-12-08
| 2024-01-06
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4240
| ''[[:d:Q6742678|Malcolm Uphill]]''
|
| 1935-04-15
| 1999-08-15
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 4241
| ''[[:d:Q6742681|Malcolm Vaughan]]''
|
| 1929-03-22<br/>1929-02-25
| 2010-02-09
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 4242
| ''[[:d:Q6742895|Maldwyn Evans]]''
|
| 1937-11-08
| 2009-12-30
| ''[[:d:Q5530463|Gelli]]''
|-
| style='text-align:right'| 4243
| ''[[:d:Q6742896|Maldwyn James]]''
|
| 1913-06-28
| 2003-07-19
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 4244
| ''[[:d:Q6743287|Mali Harries]]''
|
| 1976-07-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4245
| ''[[:d:Q6746179|Stephen Halden Beattie]]''
| [[File:Stephen Halden Beattie.jpg|center|128px]]
| 1908-03-29
| 1975-04-20
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 4246
| ''[[:d:Q6751586|Mansel Thomas]]''
|
| 1909-06-12
| 1986-01-08
| ''[[:d:Q7228404|Pontygwaith]]''
|-
| style='text-align:right'| 4247
| ''[[:d:Q6755417|Marc Breeze]]''
|
| 1987-02-11
|
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 4248
| ''[[:d:Q6755651|Marc Jones]]''
|
| 1987-04-03
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4249
| ''[[:d:Q6755915|Marc Thomas]]''
|
| 1990-07-15
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4250
| ''[[:d:Q6755964|Marc Williams]]''
|
| 1988-07-27
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 4251
| ''[[:d:Q6758141|Marcus Ebdon]]''
|
| 1970-10-17
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4252
| ''[[:d:Q6759465|Margaret Grey, Lady Bonville]]''
|
| 1397
| No/unknown value
| ''[[:d:Q3403676|Castell Rhuthun]]''
|-
| style='text-align:right'| 4253
| ''[[:d:Q6759490|Margaret Hanmer]]''
|
| 1370
| 1420
| [[Wales]]
|-
| style='text-align:right'| 4254
| ''[[:d:Q6759606|Margaret Lacey]]''
|
| 1910-02-15<br/>1911-10-25
| 1989-10-04<br/>1988-10-04
| [[Conwy Coonty Burgh]]
|-
| style='text-align:right'| 4255
| ''[[:d:Q6759645|Margaret Lindsay Williams]]''
| [[File:Margaret Lindsay Williams & painting of Warren G. Harding.jpg|center|128px]]
| 1888-06-18
| 1960-06-04
| [[Cairdiff]]
|-
| style='text-align:right'| 4256
| ''[[:d:Q6762973|Marie Novello]]''
| [[File:Marie Novello.jpg|center|128px]]
| 1884-03-31
| 1928-06-21
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 4257
| ''[[:d:Q6766497|Mark Aizlewood]]''
|
| 1959-10-01
|
| [[Newport]]
|-
| style='text-align:right'| 4258
| ''[[:d:Q6766803|Mark Bowden]]''
| [[File:A portrait of Mark Bowden by Raphaël Neal, London 2022.jpg|center|128px]]
| 1979-03
|
| [[Wales]]
|-
| style='text-align:right'| 4259
| ''[[:d:Q6766824|Mark Brake]]''
| [[File:Mark Brake.jpg|center|128px]]
| 1958-10-31
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 4260
| ''[[:d:Q6767108|Mark Colbourne]]''
|
| 1969-11-09
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 4261
| ''[[:d:Q6767281|Mark Davies]]''
|
| 1959-12-28
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 4262
| ''[[:d:Q6767282|Mark Davies]]''
|
| 1969-04-18
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4263
| ''[[:d:Q6767286|Mark Davies]]''
| [[File:Mark Davies Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1958-07-09
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 4264
| ''[[:d:Q6767407|Mark Drakeford]]''
| [[File:Mark Drakeford (cropped).jpg|center|128px]]
| 1954-09-19
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 4265
| ''[[:d:Q6767505|Mark Elliott]]''
|
| 1959-03-20
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 4266
| ''[[:d:Q6767547|Mark Evans]]''
|
| 1985-01-02
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4267
| ''[[:d:Q6768134|Mark Hughes]]''
|
| 1962-02-03
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4268
| ''[[:d:Q6768278|Mark Jones]]''
|
| 1979-04-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4269
| ''[[:d:Q6768280|Mark Jones]]''
|
| 1984-08-15
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4270
| ''[[:d:Q6768286|Mark Jones]]''
|
| 1965-06-22
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 4271
| ''[[:d:Q6768584|Mark Lewis]]''
|
| 1982-06-18
|
| [[Wales]]
|-
| style='text-align:right'| 4272
| ''[[:d:Q6768592|Mark Lewis]]''
|
| 1889
| 1968
| [[Pontypridd]]
|-
| style='text-align:right'| 4273
| ''[[:d:Q6768819|Mark McJennett]]''
|
| 1954-09-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4274
| ''[[:d:Q6769161|Mark Parry]]''
|
| 1970-05-21
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4275
| ''[[:d:Q6769232|Mark Peters]]''
|
| 1972-07-06
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4276
| ''[[:d:Q6769267|Mark Pilkington]]''
|
| 1978-03-17
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4277
| ''[[:d:Q6769338|Mark Pritchard]]''
|
| 1985-11-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4278
| ''[[:d:Q6769569|Mark Salmon]]''
|
| 1963-02-23
|
| [[Wales]]
|-
| style='text-align:right'| 4279
| ''[[:d:Q6769646|Mark Sconce]]''
|
| 1968-02-18
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4280
| ''[[:d:Q6769678|Mark Serwotka]]''
| [[File:Mark Serwotka 2008.jpg|center|128px]]
| 1963-04-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4281
| ''[[:d:Q6769814|Mark Stacey]]''
|
| 1964-09-23
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4282
| ''[[:d:Q6770200|Mark Wallace]]''
|
| 1981-11-19
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4283
| ''[[:d:Q6770218|Mark Walton]]''
|
| 1969-06-01
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4284
| ''[[:d:Q6770423|Mark Wool]]''
|
| 1990-02-10
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4285
| ''[[:d:Q6770449|Mark Wyatt]]''
|
| 1957-02-19<br/>1957
|
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 4286
| ''[[:d:Q6774469|Martha Llwyd]]''
|
| 1766
| 1845-10-16
| ''[[:d:Q5200192|Cynwyl Elfed]]''
|-
| style='text-align:right'| 4287
| ''[[:d:Q6775622|Martin Harley]]''
|
| 1975
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4288
| ''[[:d:Q6775799|Martin Jarvis]]''
|
| 1951-09-17
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 4289
| ''[[:d:Q6776739|Martin Thomas]]''
|
| 1959-11-28
|
| ''[[:d:Q3404686|Senghenydd]]''
|-
| style='text-align:right'| 4290
| ''[[:d:Q6777595|Martyn Ashton]]''
| [[File:Martyn Ashton (cropped).jpg|center|128px]]
| 1974-12-02
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4291
| ''[[:d:Q6777631|Martyn Giles]]''
|
| 1983-04-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4292
| ''[[:d:Q6777642|Martyn Jones]]''
|
| 1947-03-01
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4293
| ''[[:d:Q6777644|Martyn Jones]]''
| [[File:Martyn Jones 2009.jpg|center|128px]]
| 1955
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4294
| ''[[:d:Q6777647|Martyn Joseph]]''
| [[File:Martyn Joseph.jpg|center|128px]]
| 1960-07-15
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4295
| ''[[:d:Q6777655|Martyn Lewis]]''
| [[File:Martyn Lewis.jpg|center|128px]]
| 1945-04-07
|
| [[Swansea]]
|-
| style='text-align:right'| 4296
| ''[[:d:Q6777659|Martyn Margetson]]''
| [[File:Martyn Margetson in 2008.JPG|center|128px]]
| 1971-09-08
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4297
| ''[[:d:Q6777660|Martyn Madden]]''
|
| 1973-12-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4298
| ''[[:d:Q6777681|Martyn Sprague]]''
|
| 1949-04-10
|
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 4299
| ''[[:d:Q6777683|Martyn Thomas]]''
|
| 1987-04-24
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4300
| ''[[:d:Q6777688|Martyn Woodroffe]]''
|
| 1950-09-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4301
| ''[[:d:Q6779642|Mary Gladstone]]''
| [[File:Edward Burne-Jones The Golden Stairs.jpg|center|128px]]
| 1847
| 1927
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 4302
| ''[[:d:Q6779667|Mary Grant Price]]''
|
| 1917-02-20
| 2002-03-02
| ''[[:d:Q4971889|Broad Haven]]''
|-
| style='text-align:right'| 4303
| ''[[:d:Q6779879|Mary Jane Innes]]''
|
| 1852-04-18
| 1941-11-14
| ''[[:d:Q6661829|Llanfaches]]''
|-
| style='text-align:right'| 4304
| ''[[:d:Q6780105|Mary Lloyd]]''
| [[File:Mary Charlotte Lloyd.jpg|center|128px]]
| 1819-01-23
| 1896-10-13
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 4305
| ''[[:d:Q6780377|Mary Morgan]]''
|
| 1788
| 1805-04-13
| ''[[:d:Q5566706|Glasbury]]''
|-
| style='text-align:right'| 4306
| ''[[:d:Q6780744|Mary Sophia Allen]]''
| [[File:Mary Sophia Allen (cropped).jpg|center|128px]]
| 1878-03-12
| 1964-12-16
| [[Cairdiff]]
|-
| style='text-align:right'| 4307
| ''[[:d:Q6786991|Mathew Bevan]]''
|
| 1974-06-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4308
| ''[[:d:Q6788852|Matt Johnson]]''
| [[File:Matt Johnson 2013.jpg|center|128px]]
| 1982-11-18
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4309
| ''[[:d:Q6789197|Matt Postle]]''
|
| 1970
|
| [[Newport]]
|-
| style='text-align:right'| 4310
| ''[[:d:Q6789223|Matt Rees]]''
|
|
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 4311
| ''[[:d:Q6790320|Matthew Collins]]''
|
| 1986-03-31
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4312
| ''[[:d:Q6790325|Matthew Compton]]''
|
| 1979-02-04
|
| [[Newport]]
|-
| style='text-align:right'| 4313
| ''[[:d:Q6790439|Matthew Dwyer]]''
| [[File:ST vs Ospreys 08-12-120027.JPG|center|128px]]
| 1985-01-18
|
| [[Newport]]
|-
| style='text-align:right'| 4314
| ''[[:d:Q6790586|Matthew Gravelle]]''
|
| 1976-09-24
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 4315
| ''[[:d:Q6790741|Matthew Jarvis]]''
|
| 1990-08-25
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4316
| ''[[:d:Q6790752|Matthew Jones]]''
|
| 1974
|
| [[Swansea]]
|-
| style='text-align:right'| 4317
| ''[[:d:Q6790774|Matthew Keating]]''
|
| 1869-05-23
| 1937-05-25
| [[Sooth Wales]]
|-
| style='text-align:right'| 4318
| ''[[:d:Q6790988|Matthew Morgan]]''
|
| 1992-04-23
|
| [[Swansea]]
|-
| style='text-align:right'| 4319
| ''[[:d:Q6791026|Matthew Nuthall]]''
|
| 1983-07-06
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4320
| ''[[:d:Q6791076|Matthew Pewtner]]''
|
| 1990-12-26
|
| [[Newport]]
|-
| style='text-align:right'| 4321
| ''[[:d:Q6791116|Matthew Rees]]''
|
| 1982-09-02
|
| [[Swansea]]
|-
| style='text-align:right'| 4322
| ''[[:d:Q6791147|Matthew Robinson]]''
|
| 1973-04-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4323
| ''[[:d:Q6791226|Matthew Silva]]''
|
| 1970-03-15
|
| ''[[:d:Q7838183|Tremorfa]]''
|-
| style='text-align:right'| 4324
| ''[[:d:Q6791328|Matthew Tipton]]''
|
| 1980-06-29
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4325
| ''[[:d:Q6791359|Matthew Vaughan-Davies, 1st Baron Ystwyth]]''
| [[File:Mr. Vaughan Davies, M.P. for Cardiganshire (5236475).jpg|center|128px]]
| 1840-12-17
| 1935-08-21
| ''[[:d:Q29497855|Tanybwlch]]''
|-
| style='text-align:right'| 4326
| ''[[:d:Q6792322|Maudie Edwards]]''
|
| 1906-10-16
| 1991-03-24
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4327
| ''[[:d:Q6792674|Maureen Evans]]''
| [[File:Maureen Evans.png|center|128px]]
| 1940-03-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4328
| ''[[:d:Q6793046|Maurice Edelman]]''
|
| 1911-03-02
| 1975-12-14
| [[Cairdiff]]
|-
| style='text-align:right'| 4329
| ''[[:d:Q6793161|Maurice Griffith]]''
|
| 1507
| 1558-11-20
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4330
| ''[[:d:Q6793398|Maurice Orbach]]''
|
| 1902-07-13
| 1979-04-24
| [[Cairdiff]]
|-
| style='text-align:right'| 4331
| ''[[:d:Q6794260|Mavis Nicholson]]''
|
| 1930-10-19
| 2022-09-08
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 4332
| ''[[:d:Q6795379|Max Wideman]]''
| [[File:MaxWideman2000R2.jpg|center|128px]]
| 1927-01-19
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4333
| ''[[:d:Q6795965|Maxine Evans]]''
|
| 1966-11-09
|
| [[Wales]]
|-
| style='text-align:right'| 4334
| ''[[:d:Q6802996|Me One]]''
|
| 1970-08-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4335
| ''[[:d:Q6804706|Mechell]]''
| [[File:The capped tower of Eglwys Mechell Sant.jpg|center|128px]]
| 6th century
| 6th century
| [[Wales]]
|-
| style='text-align:right'| 4336
| ''[[:d:Q6805202|Meddy Ford]]''
|
| 1989-05-13
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4337
| ''[[:d:Q6807980|Marged Dafydd]]''
|
| 1950-10-26
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4338
| ''[[:d:Q6808694|Megan Lloyd George]]''
| [[File:Meganlloydgeorge (cropped).jpg|center|128px]]
| 1902-04-22
| 1966-05-14
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 4339
| ''[[:d:Q6809953|Meic Stephens]]''
|
| 1938-07-23
| 2018-07-02
| ''[[:d:Q478218|Treforest]]''
|-
| style='text-align:right'| 4340
| ''[[:d:Q6809955|Meic Povey]]''
|
| 1950-11-27
| 2017-12-05
| [[Wales]]
|-
| style='text-align:right'| 4341
| ''[[:d:Q6810308|Meirion Pennar]]''
|
| 1944-12-24
| 2010-12-09
| [[Cairdiff]]
|-
| style='text-align:right'| 4342
| ''[[:d:Q6810741|Mel James]]''
|
| 1948-02-21
| 2022
| [[Wales]]
|-
| style='text-align:right'| 4343
| ''[[:d:Q6810800|Mel Nurse]]''
|
| 1937-10-11
|
| [[Swansea]]
|-
| style='text-align:right'| 4344
| ''[[:d:Q6810830|Mel Rosser]]''
|
| 1901-04-18
| 1988-09-08
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 4345
| ''[[:d:Q6811342|Melanie Roberts]]''
|
| 1988-05-13
|
| ''[[:d:Q2304575|Saltney]]''
|-
| style='text-align:right'| 4346
| ''[[:d:Q6811374|Melanie Walters]]''
|
| 1962-01-30
|
| ''[[:d:Q1952591|The Mumbles]]''
|-
| style='text-align:right'| 4347
| ''[[:d:Q6811900|Melbourne Thomas]]''
|
| 1896-06-11
| 1966-06-23
| ''[[:d:Q6964400|Nant-y-moel]]''
|-
| style='text-align:right'| 4348
| ''[[:d:Q6811901|Melbourne Tierney]]''
|
| 1924
| 2014
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4349
| ''[[:d:Q6813870|Melville De Lloyd]]''
|
| 1917-04-02
| 1985
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 4350
| ''[[:d:Q6814128|Melvyn Ford]]''
|
| 1924
|
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 4351
| ''[[:d:Q6814138|Melvyn Meek]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4352
| ''[[:d:Q6817164|Menna Richards]]''
|
| 1953-02
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 4353
| ''[[:d:Q6817169|Menna Gallie]]''
|
| 1919-03-18
| 1990-06-17
| [[Ystradgynlais]]
|-
| style='text-align:right'| 4354
| ''[[:d:Q6818922|Meredith Edwards]]''
| [[File:Meredith Edwards in One Step Beyond (Justice).jpg|center|128px]]
| 1917-06-10
| 1999-02-08
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 4355
| ''[[:d:Q6819009|Meredydd Evans]]''
|
| 1919-12-09
| 2015-02-21
| ''[[:d:Q13129617|Llanegryn]]''
|-
| style='text-align:right'| 4356
| ''[[:d:Q6819012|Meredydd Hughes]]''
|
| 20th century
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4357
| ''[[:d:Q6819086|Merfyn Jones]]''
|
| 1931-04-30
| 2016-10-04
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4358
| ''[[:d:Q6819154|Meri Huws]]''
| [[File:Meri Huws (cropped).jpg|center|128px]]
|
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 4359
| ''[[:d:Q6820496|Merryl Wyn Davies]]''
|
| 1948-06-23
| 2021-02-01
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4360
| ''[[:d:Q6820803|Merv Hicks]]''
|
| 1943
|
| [[Crosskeys]]
|-
| style='text-align:right'| 4361
| ''[[:d:Q6820867|Mervyn Bennett]]''
|
| 1960-02-20
| 1999
| [[Cairdiff]]
|-
| style='text-align:right'| 4362
| ''[[:d:Q6820875|Mervyn Burtch]]''
|
| 1929-11-07
| 2015-05-12
| ''[[:d:Q1774850|Ystrad Mynach]]''
|-
| style='text-align:right'| 4363
| ''[[:d:Q6820908|Mervyn Hill]]''
|
| 1902-06-23
| 1948-02-27
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 4364
| ''[[:d:Q6820925|Mervyn Levy]]''
|
| 1914-02-11
| 1996-04-14
| [[Swansea]]
|-
| style='text-align:right'| 4365
| ''[[:d:Q6821110|Mesac Thomas]]''
|
| 1816-05-10
| 1892-03-15
| [[Aberystwyth]]
|-
| style='text-align:right'| 4366
| ''[[:d:Q6828351|Michael Baer]]''
|
| 1987-03-31
|
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 4367
| ''[[:d:Q6829403|Michael Condon]]''
|
| 1919-06
| 1960-07-29
| [[Swansea]]
|-
| style='text-align:right'| 4368
| ''[[:d:Q6829746|Michael Davies]]''
|
| 1962-08-18
|
| [[Wales]]
|-
| style='text-align:right'| 4369
| ''[[:d:Q6830117|Michael Elwyn]]''
|
| 1942-08-23
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4370
| ''[[:d:Q6830352|Michael Flynn]]''
|
| 1980-10-07
|
| [[Newport]]
|-
| style='text-align:right'| 4371
| ''[[:d:Q6830845|Michael Gustavius Payne]]''
| [[File:Gustavius Payne - Welsh artist - 2011.jpg|center|128px]]
| 1969-06-25
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4372
| ''[[:d:Q6831441|Michael J. Leahy]]''
|
| 1949-01-07
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4373
| ''[[:d:Q6831686|Michael Johnson]]''
|
| 1941-10-13
| 1991
| [[Swansea]]
|-
| style='text-align:right'| 4374
| ''[[:d:Q6832322|Michael Lort]]''
|
| 1725
| 1790
| [[Wales]]
|-
| style='text-align:right'| 4375
| ''[[:d:Q6833053|Michael Newbold]]''
|
| 1970-01-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4376
| ''[[:d:Q6833756|Michael Raven]]''
|
| 1938-02-06
| 2008-04-15
| [[Cairdiff]]
|-
| style='text-align:right'| 4377
| ''[[:d:Q6833845|Michael Richards]]''
|
| 1950-09-13
|
| [[Newport]]
|-
| style='text-align:right'| 4378
| ''[[:d:Q6833909|Michael Roberts]]''
|
| 1927-05-06
| 1983-02-10
| [[Aberystwyth]]
|-
| style='text-align:right'| 4379
| ''[[:d:Q6834952|Michael Tremellen]]''
|
| 1965-10-30
|
| ''[[:d:Q3403473|Pendine]]''
|-
| style='text-align:right'| 4380
| ''[[:d:Q6837058|Michelle Green]]''
| [[File:Michelle Green.JPG|center|128px]]
| 1982-12-18
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4381
| ''[[:d:Q6838178|Mick Flynn]]''
|
| 1960
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4382
| ''[[:d:Q6838620|Mickey Evans]]''
|
| 1947-06-04
|
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 4383
| ''[[:d:Q6838640|Mickey Gee]]''
|
| 1944-07-03
| 2009-01-21
| [[Cairdiff]]
|-
| style='text-align:right'| 4384
| ''[[:d:Q6846242|Mike Cann]]''
|
| 1965-07-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4385
| ''[[:d:Q6846612|Mike Dowler]]''
|
| 1957-10-12
|
| ''[[:d:Q722585|Cil-y-coed]]''
|-
| style='text-align:right'| 4386
| ''[[:d:Q6846689|Mike Elliott]]''
|
| 1945
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4387
| ''[[:d:Q6847105|Mike Gwilym]]''
| [[File:Mike Gwilym.jpeg|center|128px]]
| 1949-03-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4388
| ''[[:d:Q6847187|Mike Hedges]]''
| [[File:Members of the Fifth Senedd (taken May 11, 2011) Members of the Fifth Senedd Mike Hedges AS MS (28170821805).png|center|128px]]
| 1956-07-08
|
| [[Swansea]]
|-
| style='text-align:right'| 4389
| ''[[:d:Q6847304|Mike Hook]]''
|
| 1982-12-14
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4390
| ''[[:d:Q6847395|Mike Jenkins]]''
| [[File:Mike Jenkins, Welsh poet.jpg|center|128px]]
| 1953
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4391
| ''[[:d:Q6847692|Mike Llewellyn]]''
|
| 1953-11-27
|
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 4392
| ''[[:d:Q6847868|Mike McBurney]]''
|
| 1953-09-12
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4393
| ''[[:d:Q6848187|Mike Nicholas]]''
|
| 1942
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4394
| ''[[:d:Q6848254|Mike O'Shea]]''
|
| 1987-09-04
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4395
| ''[[:d:Q6848353|Mike Pearson]]''
|
| 1988-01-19
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4396
| ''[[:d:Q6848419|Mike Poole]]''
|
| 1986-04-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4397
| ''[[:d:Q6848445|Mike Powell]]''
|
| 1977-02-03
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4398
| ''[[:d:Q6848516|Mike Rayer]]''
|
| 1965-07-21
|
| [[Wales]]
|-
| style='text-align:right'| 4399
| ''[[:d:Q6849180|Mike Voyle]]''
|
| 1978-01-03
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4400
| ''[[:d:Q6849198|Mike Walker]]''
|
| 1966-04-21
|
| [[Wales]]
|-
| style='text-align:right'| 4401
| ''[[:d:Q6849220|Mike Watkins]]''
|
| 1952-01-09
|
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 4402
| ''[[:d:Q6849279|Mike Williams]]''
|
| 1965-12-31
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 4403
| ''[[:d:Q6849282|Mike Williams]]''
|
| 1986-10-27
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 4404
| ''[[:d:Q6849355|Mike Young]]''
|
| 1945
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4405
| ''[[:d:Q6851487|Miles Morgan]]''
| [[File:Miles Morgan by J. S. Hartley - Springfield, MA - DSC03231.JPG|center|128px]]
| 1616
| 1699-05-28
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 4406
| ''[[:d:Q6851560|Miles Thomas]]''
|
| 1897-03-02
| 1980-02-08
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4407
| ''[[:d:Q6860747|Milsom Rees]]''
| [[File:Milsom Rees 1931.jpg|center|128px]]
| 1866-04-20
| 1952-04-25
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4408
| ''[[:d:Q6860753|Milson Hunt]]''
|
| 1926
| 1988
| [[Cairdiff]]
|-
| style='text-align:right'| 4409
| ''[[:d:Q6865038|Mini Grey]]''
|
|
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 4410
| ''[[:d:Q6890179|Moelwyn Hughes]]''
|
| 1897-10-06
| 1955-11-01
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 4411
| ''[[:d:Q6890185|Elizabeth Mary Jones]]''
| [[File:Moelona1917.png|center|128px]]
| 1877-06-21
| 1953-06-05
| ''[[:d:Q7321606|Rhydlewis]]''
|-
| style='text-align:right'| 4412
| ''[[:d:Q6890208|Moelwyn Merchant]]''
|
| 1913-06-05
| 1997-04-22
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4413
| ''[[:d:Q6896659|Molly Parkin]]''
| [[File:Weidenfeld Parkin.jpg|center|128px]]
| 1932-02-03
|
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 4414
| ''[[:d:Q6906709|Monty Lewis]]''
| [[File:Archives of American Art - Monty Lewis - 2587.jpg|center|128px]]
| 1907
| 1997-08-30
| [[Cairdiff]]
|-
| style='text-align:right'| 4415
| ''[[:d:Q6909612|Mordecai Jones]]''
|
| 1813-05-02
| 1880-08-30
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 4416
| ''[[:d:Q6911506|Morfydd Llwyn Owen]]''
|
| 1891-10-01
| 1918-09-07
| ''[[:d:Q478218|Treforest]]''
|-
| style='text-align:right'| 4417
| ''[[:d:Q6911577|Morgan Allen]]''
|
| 1990-03-12
|
| [[Newport]]
|-
| style='text-align:right'| 4418
| ''[[:d:Q6911580|Morgan B. Williams]]''
| [[File:Morgan B. Williams (Pennsylvania Congressman).jpg|center|128px]]
| 1831-09-17
| 1903-10-13
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 4419
| ''[[:d:Q6911650|Morgan Edwards]]''
|
| 1722-05-09
| 1795-01-25
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4420
| ''[[:d:Q6911703|Morgan Hunt]]''
|
| 1931-03-05
| 2012-02
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 4421
| ''[[:d:Q6911720|Morgan John Rhys]]''
|
| 1760-12-08
| 1804-12-07
| ''[[:d:Q3398355|Llanbradach]]''
|-
| style='text-align:right'| 4422
| ''[[:d:Q6911751|Morgan Lloyd]]''
| [[File:Morgan-Lloyd-AS.jpg|center|128px]]
| 1820-07-14
| 1893-09-05
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 4423
| ''[[:d:Q6911804|Morgan Owen]]''
|
| 1585
| 1645-03-05
| ''[[:d:Q6947263|Myddfai]]''
|-
| style='text-align:right'| 4424
| ''[[:d:Q6911815|Morgan Phillips]]''
|
| 1902-06-18
| 1963-01-15
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4425
| ''[[:d:Q6911824|Morgan Rhys]]''
|
| 1716-04-01
| 1779-08-09
| ''[[:d:Q13127117|Cil-y-cwm]]''
|-
| style='text-align:right'| 4426
| ''[[:d:Q6915147|Morus Dwyfech]]''
|
| 1523
| 1590
| [[Wales]]
|-
| style='text-align:right'| 4427
| ''[[:d:Q6915789|Moses Griffith]]''
| [[File:Clynnog by Moses Griffith 1782.jpg|center|128px]]
| 1747-03-25
| 1819-11-11
| ''[[:d:Q3398974|Bryncroes]]''
|-
| style='text-align:right'| 4428
| ''[[:d:Q6915930|Moses Russell]]''
| [[File:Moses Russell.jpg|center|128px]]
| 1888-05-20
| 1946-12-18
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 4429
| ''[[:d:Q6917024|Mostyn Thomas]]''
|
| 1896-01-14
| 1984-08-17
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 4430
| ''[[:d:Q6947452|Myfanwy Howell]]''
|
| 1903-09-01
| 1988-11-14
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 4431
| ''[[:d:Q6947457|Myfanwy Talog]]''
|
| 1944-03-31<br/>1945
| 1995-03-11<br/>1995
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 4432
| ''[[:d:Q6947663|Myles Davies]]''
|
| 1662
| 1715
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 4433
| ''[[:d:Q6948163|John Jones]]''
| [[File:Myrddin Fardd NLW3362574.jpg|center|128px]]
| 1836
| 1921-07-27
| ''[[:d:Q3404510|Llangian]]''
|-
| style='text-align:right'| 4434
| ''[[:d:Q6948612|Myrtle Devenish]]''
|
| 1913
| 2007-01-21
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 4435
| ''[[:d:Q6962803|Nancy Lee]]''
|
| 1970
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4436
| ''[[:d:Q6964248|Nansi Richards]]''
|
| 1888-05-14
| 1979-12-21
| ''[[:d:Q20589424|Pen-y-bont-fawr]]''
|-
| style='text-align:right'| 4437
| ''[[:d:Q6964330|Nantlais Williams]]''
|
| 1874-12-30
| 1959-06-18
| ''[[:d:Q15407742|Gwyddgrug]]''
|-
| style='text-align:right'| 4438
| ''[[:d:Q6968475|Natasha Marsh]]''
|
| 1975
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 4439
| ''[[:d:Q6968486|Natasha Perdue]]''
|
| 1975-07-27
|
| [[Swansea]]
|-
| style='text-align:right'| 4440
| ''[[:d:Q6968912|Nathan Blake]]''
|
| 1972-01-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4441
| ''[[:d:Q6968916|Nathan Bonner-Evans]]''
|
| 1978-10-27<br/>1978-10
|
| [[Swansea]]
|-
| style='text-align:right'| 4442
| ''[[:d:Q6968940|Nathan Buck]]''
|
| 1989-08-17
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4443
| ''[[:d:Q6968941|Nathan Budgett]]''
|
| 1975-11-02
|
| [[Newport]]
|-
| style='text-align:right'| 4444
| ''[[:d:Q6968996|Nathan Craig]]''
|
| 1991-10-25
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4445
| ''[[:d:Q6969312|Nathan Rocyn-Jones]]''
|
| 1902-07-17
| 1984-01-26
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 4446
| ''[[:d:Q6969314|Nathan Rogers]]''
|
| 1638-05-30
| 1708
| ''[[:d:Q6661829|Llanfaches]]''
|-
| style='text-align:right'| 4447
| ''[[:d:Q6969374|Nathan Thomas]]''
|
| 1976-01-22
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4448
| ''[[:d:Q6969436|Nathan Wyburn]]''
| [[File:NathanWyburn-inStudio-C.jpg|center|128px]]
| 1989-10-24
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 4449
| ''[[:d:Q6969699|Nathaniel Jarvis]]''
| [[File:Jarvis, Nathaniel.jpg|center|128px]]
| 1991-10-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4450
| ''[[:d:Q6969710|Nathaniel Jones]]''
| [[File:Nathaniel Cynhafal Jones.jpg|center|128px]]
| 1832-04-19
| 1905-12-14
| ''[[:d:Q16540181|Llangynhafal]]''
|-
| style='text-align:right'| 4451
| ''[[:d:Q6969928|Nathaniel Williams]]''
|
| 1742
| 1826-12-28
| ''[[:d:Q6661877|Llanwinio]]''
|-
| style='text-align:right'| 4452
| ''[[:d:Q6983198|Naz Ball]]''
|
| 1962
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 4453
| ''[[:d:Q6986019|Ned Jenkins]]''
|
| 1904-07-28
| 1990-11-08
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 4454
| ''[[:d:Q6986087|Ned Roberts]]''
|
| 1867
| 1940-06-14
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4455
| ''[[:d:Q6988305|Neil Boobyer]]''
|
| 1972-06-11
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4456
| ''[[:d:Q6988465|Neil Davies]]''
|
| 1980-12-04
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4457
| ''[[:d:Q6988618|Neil Gibson]]''
|
| 1979-10-10
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4458
| ''[[:d:Q6988674|Neil Haddock]]''
|
| 1964-06-22
|
| [[Newport]]
|-
| style='text-align:right'| 4459
| ''[[:d:Q6989019|Neil McPherson]]''
|
| 1892-09-26
| 1957-11-12
| [[Cairdiff]]
|-
| style='text-align:right'| 4460
| ''[[:d:Q6989128|Neil Patel]]''
|
| 1964
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4461
| ''[[:d:Q6989319|Neil Slatter]]''
|
| 1964-05-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4462
| ''[[:d:Q6997045|Nerys Evans]]''
| [[File:Nerys Evans.jpg|center|128px]]
| 1980
|
| ''[[:d:Q6661421|Llangain]]''
|-
| style='text-align:right'| 4463
| ''[[:d:Q7002124|Noah M. Mason]]''
| [[File:NoahMMason.jpg|center|128px]]
| 1882-07-19
| 1965-03-29
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 4464
| ''[[:d:Q7004817|Neville Powell]]''
|
| 1963-09-02
|
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 4465
| ''[[:d:Q7023480|Nia Caron]]''
|
| 1959-10
|
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 4466
| ''[[:d:Q7023504|Nia Roberts]]''
| [[File:OIFF 2015-07-17 143447 - Nia Roberts.jpg|center|128px]]
| 1972-07-05
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 4467
| ''[[:d:Q7024261|Nic Cudd]]''
|
| 1988-10-12
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4468
| ''[[:d:Q7024310|Nic Parry]]''
| [[File:Nic Parry Tachwedd 2014.JPG|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 4469
| ''[[:d:Q7025356|Nicholas Evans]]''
|
| 1907-01-10
| 2004-02-05<br/>2004-02-25
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4470
| ''[[:d:Q7025584|Nicholas Hunt]]''
|
| 1930-11-07
| 2013-10-25
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 4471
| ''[[:d:Q7025678|Nicholas Jones]]''
|
| 1942-10-01
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4472
| ''[[:d:Q7026147|Nicholas Rudall]]''
|
| 1940
| 2018-06-19
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4473
| ''[[:d:Q7027072|Nick Ellis]]''
|
| 1953
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4474
| ''[[:d:Q7027121|Nick Fletcher]]''
|
| 1967-08-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4475
| ''[[:d:Q7027494|Nick Macleod]]''
|
| 1983-03-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4476
| ''[[:d:Q7027777|Nick Ramsay]]''
| [[File:Nick Ramsay 2011.jpg|center|128px]]
| 1975-06-10
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 4477
| ''[[:d:Q7028008|Nick Swetman]]''
|
| 1984-09-27
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4478
| ''[[:d:Q7028665|Nicky Piper]]''
|
| 1966-05-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4479
| ''[[:d:Q7031408|Niel Morgan]]''
|
| 1904-01-30
| 1985-09-14
| ''[[:d:Q5199901|Cyncoed]]''
|-
| style='text-align:right'| 4480
| ''[[:d:Q7032258|Nigel Boulton]]''
|
| 1953-08-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4481
| ''[[:d:Q7032329|Nigel Davies]]''
|
| 1965-03-29
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4482
| ''[[:d:Q7032450|Nigel Heseltine]]''
|
| 1916-07-03
| 1995
| [[Wales]]
|-
| style='text-align:right'| 4483
| ''[[:d:Q7032604|Nigel Pulsford]]''
|
| 1963-04-11
|
| [[Newport]]
|-
| style='text-align:right'| 4484
| ''[[:d:Q7032608|Nigel Rees]]''
|
| 1953-07-11
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4485
| ''[[:d:Q7032660|Nigel Stevenson]]''
|
| 1958-11-02
|
| [[Swansea]]
|-
| style='text-align:right'| 4486
| ''[[:d:Q7032689|Nigel Vaughan]]''
|
| 1959-05-20
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4487
| ''[[:d:Q7032732|Nigel Yates]]''
|
| 1944-07-01
| 2009-01-15
| [[Swansea]]
|-
| style='text-align:right'| 4488
| ''[[:d:Q7039571|Nipper Pat Daly]]''
|
| 1913-02-17
| 1988-09-25
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 4489
| ''[[:d:Q7045349|Noah Ablett]]''
|
| 1883-10-04
| 1935-10-31
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 4490
| ''[[:d:Q7046945|Noel Forbes Humphreys]]''
| [[File:Noel Humphreys.png|center|128px]]
| 1890-12-01
| 1918-03-27
| ''[[:d:Q6661429|Llangan]]''
|-
| style='text-align:right'| 4491
| ''[[:d:Q7047028|Noel Jones]]''
|
| 1932-12-25
| 2009-08-28
| [[Wales]]
|-
| style='text-align:right'| 4492
| ''[[:d:Q7047187|Noel Richards]]''
| [[File:Noel Performing 2019.jpg|center|128px]]
| 1955-02-15
|
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 4493
| ''[[:d:Q7047219|Noel Sullivan]]''
|
| 1980-07-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4494
| ''[[:d:Q7047242|Noel Trigg]]''
|
| 1934-11-28
| 2020-10-29
| [[Newport]]
|-
| style='text-align:right'| 4495
| ''[[:d:Q7051658|Norma Curtis]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 4496
| ''[[:d:Q7052107|Norman Coslett]]''
|
| 1909-11-08
| 1987-11-09
| [[Cairdiff]]
|-
| style='text-align:right'| 4497
| ''[[:d:Q7052209|Norman Fender]]''
|
| 1910-09-02
| 1983-10-24
| [[Cairdiff]]
|-
| style='text-align:right'| 4498
| ''[[:d:Q7052330|Norman Harris]]''
|
| 1918
| 2007
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 4499
| ''[[:d:Q7052397|Norman Jacob]]''
|
| 1901-07-09
| 1970-03-12
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4500
| ''[[:d:Q7052739|Norman Riches]]''
|
| 1883
| 1975-11-06
| [[Cairdiff]]
|-
| style='text-align:right'| 4501
| ''[[:d:Q7053254|Norrie Alden]]''
|
| 1909-11-03
| 1980
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4502
| ''[[:d:Q7071254|Nyree Kindred]]''
|
| 1980-09-21
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 4503
| ''[[:d:Q7080312|Ogwyn Davies]]''
|
| 1925
| 2015-12-26
| ''[[:d:Q7837341|Trebanos]]''
|-
| style='text-align:right'| 4504
| ''[[:d:Q7087219|Olive Wheeler]]''
|
| 1886-05-04
| 1963-09-26
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 4505
| ''[[:d:Q7087625|Oliver James]]''
|
| 1990-10-03
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4506
| ''[[:d:Q7087668|Oliver Lloyd]]''
|
| 1570
| 1625
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 4507
| ''[[:d:Q7087707|Oliver Morris]]''
|
| 1916
| 1944-09-20
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4508
| ''[[:d:Q7087761|Oliver Piper]]''
| [[File:O.J.S. Piper.png|center|128px]]
| 1884-01-13
| 1933-04-22
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4509
| ''[[:d:Q7087790|Oliver Reynolds]]''
|
| 1957
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4510
| ''[[:d:Q7087796|Oliver Robert Gould]]''
|
| 1874-04-04
| 1951-10-07
| [[Pontypridd]]
|-
| style='text-align:right'| 4511
| ''[[:d:Q7087873|Oliver Thornton]]''
|
| 1979-09-10
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4512
| ''[[:d:Q7088315|Ollie Burton]]''
|
| 1941-09-11
|
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 4513
| ''[[:d:Q7088359|Ollie Olds]]''
|
| 1993-08-14
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4514
| ''[[:d:Q7094141|Onllwyn Brace]]''
|
| 1932-11-16<br/>1932
| 2013-07-04
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 4515
| ''[[:d:Q7102440|Orig Williams]]''
|
| 1931-03-20
| 2009-11-12
| ''[[:d:Q3406271|Ysbyty Ifan]]''
|-
| style='text-align:right'| 4516
| ''[[:d:Q7103444|Ormond Jones]]''
|
| 1910-08-24
| 1972-04-10
| ''[[:d:Q7830339|Tywyn]]''
|-
| style='text-align:right'| 4517
| ''[[:d:Q7106669|Osi Rhys Osmond]]''
| [[File:Osi Rhys Osmond.jpg|center|128px]]
| 1942-06-28
| 2015-03-07
| ''[[:d:Q7975053|Wattsville]]''
|-
| style='text-align:right'| 4518
| ''[[:d:Q7106681|Osian Ellis]]''
| [[File:Osian Ellis.jpg|center|128px]]
| 1928-02-08
| 2021-01-05
| ''[[:d:Q5446245|Ffynnongroew]]''
|-
| style='text-align:right'| 4519
| ''[[:d:Q7106908|Michael Berry, Baron Hartwell]]''
|
| 1911-05-18
| 2001-04-03
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4520
| ''[[:d:Q7107483|Ossie Jones]]''
|
| 1909-08-15
| 2002
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 4521
| ''[[:d:Q7107485|Ossie Male]]''
|
| 1893-12-31
| 1975-02-23
| [[Newport]]
|-
| style='text-align:right'| 4522
| ''[[:d:Q7108121|Oswald Griffiths]]''
|
| 1909-01-12
| 1989-12
| [[Wales]]
|-
| style='text-align:right'| 4523
| ''[[:d:Q7114239|Owain Arwel Hughes]]''
|
| 1942-03-21
|
| [[Wales]]
|-
| style='text-align:right'| 4524
| ''[[:d:Q7114242|Owain Fôn Williams]]''
| [[File:Owain Fôn Williams playing for Wales vs Austria 01.jpg|center|128px]]
| 1987-03-17
|
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 4525
| ''[[:d:Q7114245|Owain Hopkins]]''
|
| 1980-12-18
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4526
| ''[[:d:Q7114249|Owain Warlow]]''
|
| 1987-10-25
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4527
| ''[[:d:Q7114467|Owen Edwards]]''
| [[File:Owen Edwards & Louise Walden GBR.png|center|128px]]
| 1987-07-21
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4528
| ''[[:d:Q7114471|Owen Evans]]''
|
| 1876-02-05
| 1945-06-11
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 4529
| ''[[:d:Q7114472|Owen Evans]]''
|
| 1989-02-19
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 4530
| ''[[:d:Q7114528|Owen John Thomas]]''
| [[File:Owen John Thomas.jpg|center|128px]]
| 1939-10-03
| 2024-05-14
| [[Cairdiff]]
|-
| style='text-align:right'| 4531
| ''[[:d:Q7114529|Owen Jones]]''
| [[File:Portrait of Owain Jones, Myfyr (4670959) (cropped).jpg|center|128px]]
| 1741-09-03
| 1814-09-26
| ''[[:d:Q13129629|Llanfihangel Glyn Myfyr]]''
|-
| style='text-align:right'| 4532
| ''[[:d:Q7114531|Owen Jones]]''
|
| 1871-07
| 1955-09-23
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4533
| ''[[:d:Q7114532|Owen Jones]]''
| [[File:Owen Lewis Jones, 1953.jpg|center|128px]]
| 1889-02-06
| 1964-11-05
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 4534
| ''[[:d:Q7114543|Owen Lewis]]''
|
| 1532-12-28
| 1595-10-14
| ''[[:d:Q6661405|Llangadwaladr]]''
|-
| style='text-align:right'| 4535
| ''[[:d:Q7114580|Owen Money]]''
|
| 1947-05-16
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4536
| ''[[:d:Q7114583|Owen Morgan Edwards]]''
| [[File:O.M.Edwards 01b.JPG|center|128px]]
| 1858-12-25
| 1920-05-15
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 4537
| ''[[:d:Q7114598|Owen Phillips]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 4538
| ''[[:d:Q7114599|Owen Phillips]]''
| [[File:Portrait of E. Owen Phillips (4670553).jpg|center|128px]]
| 1826-04-27
| 1897-03-02
| ''[[:d:Q13131980|Trecwn]]''
|-
| style='text-align:right'| 4539
| ''[[:d:Q7114657|Owen Thomas]]''
|
| 1953-04-06
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4540
| ''[[:d:Q7114698|Owen Williams]]''
|
| 1991-10-02
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4541
| ''[[:d:Q7114699|Owen Williams]]''
|
| 1986-01-27
|
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 4542
| ''[[:d:Q7114700|Owen Williams]]''
| [[File:Owen Williams 2023.jpg|center|128px]]
| 1992-02-27
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4543
| ''[[:d:Q7114710|Owen Wynne]]''
|
| 1652
| 1700
| ''[[:d:Q13129688|Llechylched]]''
|-
| style='text-align:right'| 4544
| ''[[:d:Q7114713|Owen Wynne Jones]]''
| [[File:Revd Owen Wynne Jones (Glasynys, 1828-70) NLW3365408 Cropped.jpg|center|128px]]
| 1828-03-04
| 1870-04-04
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4545
| ''[[:d:Q7119548|P. K. Thomas]]''
|
| 1926-06-28
| 2008-01-25
| [[Swansea]]
|-
| style='text-align:right'| 4546
| ''[[:d:Q7128230|Palmer Griffiths]]''
|
| 1880
| 1973
| [[Pontypridd]]
|-
| style='text-align:right'| 4547
| ''[[:d:Q7138398|Parker Williams]]''
|
| 1873-03
| 1958-06-17
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 4548
| ''[[:d:Q7143239|Pat Brain]]''
|
| 1896-03-17
| 1945-12-11
| ''[[:d:Q5016880|Caerau]]''
|-
| style='text-align:right'| 4549
| ''[[:d:Q7143662|Pat Leach]]''
|
| 1985-07-18
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4550
| ''[[:d:Q7143720|Pat McCarthy]]''
|
| 1888-04
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4551
| ''[[:d:Q7143810|Pat Mountain]]''
|
| 1976-08-01
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4552
| ''[[:d:Q7143923|Pat Pocock]]''
|
| 1946-09-24
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4553
| ''[[:d:Q7145521|Patricia Clarke]]''
|
| 1919-07-29
| 2010-01-28
| [[Pontypridd]]
|-
| style='text-align:right'| 4554
| ''[[:d:Q7145665|Patricia Kane]]''
|
| 1929
| 2022-08-12
| [[Cairdiff]]
|-
| style='text-align:right'| 4555
| ''[[:d:Q7145670|Patricia Kern]]''
|
| 1927-07-04
| 2015-10-19
| [[Swansea]]
|-
| style='text-align:right'| 4556
| ''[[:d:Q7146558|Patrick Gibbs]]''
|
| 1915-04-02
| 2008-03-08
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4557
| ''[[:d:Q7146653|Patrick Hannan]]''
|
| 1941-09-26
| 2009-10-11
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 4558
| ''[[:d:Q7147445|Patrick Palmer]]''
|
| 1988-01-19
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4559
| ''[[:d:Q7149015|Paul Affleck]]''
|
| 1966-06-25
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4560
| ''[[:d:Q7149081|Paul Anthony]]''
|
| 1955
|
| [[Wales]]
|-
| style='text-align:right'| 4561
| ''[[:d:Q7149243|Paul Barrett]]''
| [[File:Paul 'Legs' Barrett.jpg|center|128px]]
| 1940-12-14
| 2019-01-20
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 4562
| ''[[:d:Q7149356|Paul Beynon-Davies]]''
|
| 1957
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 4563
| ''[[:d:Q7149394|Paul Blackwell]]''
|
| 1963-01-13
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 4564
| ''[[:d:Q7149548|Paul Brown]]''
|
| 1950
| 1997-11-14
| [[Wales]]
|-
| style='text-align:right'| 4565
| ''[[:d:Q7149821|Paul Child]]''
|
| 1969-09-23
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4566
| ''[[:d:Q7150146|Paul Davies]]''
| [[File:Paul-davies.jpg|center|128px]]
| 1969
|
| [[Wales]]
|-
| style='text-align:right'| 4567
| ''[[:d:Q7150147|Paul Davies]]''
|
| 1952-10-10
|
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 4568
| ''[[:d:Q7150149|Paul Davies]]''
| [[File:DAVIES Paul (GBR).jpg|center|128px]]
| 1966-10-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4569
| ''[[:d:Q7150515|Paul Erickson]]''
|
| 1920-11-22
| 1991-10-27
| [[Cairdiff]]
|-
| style='text-align:right'| 4570
| ''[[:d:Q7150527|Paul Esposti]]''
|
| 1972-11-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4571
| ''[[:d:Q7150900|Paul Giles]]''
|
| 1961-02-21
|
| [[Wales]]
|-
| style='text-align:right'| 4572
| ''[[:d:Q7150980|Paul Grant]]''
|
| 1943-06-26
| 2003-11-23
| [[Swansea]]
|-
| style='text-align:right'| 4573
| ''[[:d:Q7151017|Paul Griffiths]]''
| [[File:Paul Griffiths.jpg|center|128px]]
| 1973-08-08
|
| [[Wales]]
|-
| style='text-align:right'| 4574
| ''[[:d:Q7151019|Paul Griffiths]]''
|
| 1947-11-24
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4575
| ''[[:d:Q7151248|Paul Henry]]''
|
| 1959
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4576
| ''[[:d:Q7151549|Paul James Wheeler]]''
|
| 1947-02-05
|
| [[Newport]]
|-
| style='text-align:right'| 4577
| ''[[:d:Q7152147|Paul Maddy]]''
|
| 1962-08-17
|
| ''[[:d:Q5197235|Cwmcarn]]''
|-
| style='text-align:right'| 4578
| ''[[:d:Q7152438|Paul Mealor]]''
| [[File:Paulmealorphoto.jpeg|center|128px]]
| 1975-11-25
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4579
| ''[[:d:Q7152599|Paul Morgan]]''
|
| 1974-10-03
| 2015-01-12
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 4580
| ''[[:d:Q7153006|Paul Prendiville]]''
|
| 1954-04-10
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4581
| ''[[:d:Q7154096|Paul Turner]]''
|
| 1960-02-13
|
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 4582
| ''[[:d:Q7154348|Paul Whitsun-Jones]]''
|
| 1923-04-25<br/>1923-04-05
| 1974-01-14
| [[Newport]]
|-
| style='text-align:right'| 4583
| ''[[:d:Q7154476|Paul Woods]]''
|
| 1950-10-28
| 2007-11-01
| ''[[:d:Q7228311|Pontllanfraith]]''
|-
| style='text-align:right'| 4584
| ''[[:d:Q7155038|Pauline Jarman]]''
|
| 1945-12-15
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 4585
| ''[[:d:Q7155074|Pauline Peters]]''
|
| 1896-08-28
| 1976
| [[Cairdiff]]
|-
| style='text-align:right'| 4586
| ''[[:d:Q7167285|Percy Coldrick]]''
| [[File:Percy Coldrick.jpeg|center|128px]]
| 1888
| 1953-12-26
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4587
| ''[[:d:Q7167294|Percy Cudlipp]]''
|
| 1905-11-10
| 1962-11-05
| [[Cairdiff]]
|-
| style='text-align:right'| 4588
| ''[[:d:Q7167325|Percy Herbert]]''
| [[File:Percy Egerton Herbert.jpg|center|128px]]
| 1822-04-15
| 1876-10-07
| ''[[:d:Q1377263|Powis Castle]]''
|-
| style='text-align:right'| 4589
| ''[[:d:Q7167388|Percy Herbert, 2nd Baron Powis]]''
| [[File:British (English) School - Sir Percy Herbert (c.1598–1667), 2nd Baron Powis - 1180923 - National Trust.jpg|center|128px]]
| 1598
| 1667<br/>1666-01-19<br/>1667-01-19
| [[Powys]]
|-
| style='text-align:right'| 4590
| ''[[:d:Q7167433|Percy Jones]]''
|
| 1892-12-26
| 1922-12-25
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 4591
| ''[[:d:Q7167435|Percy Jones]]''
|
| 1887-03-23
| 1969-03-31
| [[Pontypridd]]
|-
| style='text-align:right'| 4592
| ''[[:d:Q7167462|Percy Lloyd]]''
|
| 1871-01-05
| 1959-03-10
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 4593
| ''[[:d:Q7167493|Percy Morgan]]''
|
| 1905-01-01
| 1983-03-03
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 4594
| ''[[:d:Q7167764|Peredur Lynch]]''
| [[File:Peredur Lynch ym Mangor, Medi 2018.png|center|128px]]
| 1963-01-13
|
| [[Wales]]
|-
| style='text-align:right'| 4595
| ''[[:d:Q7172097|Pete Lee-Wilson]]''
|
| 1960-04-07
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4596
| ''[[:d:Q7172205|Pete Price]]''
| [[File:Pete Price at Superhero Skyfall 2018-1.jpg|center|128px]]
| 1946-01-25
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4597
| ''[[:d:Q7172477|Peter Aitken]]''
|
| 1954-06-30
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4598
| ''[[:d:Q7172638|Peter Bailey Williams]]''
| [[File:Portrait of Peter Bayley Williams (4673911) (cropped).jpg|center|128px]]
| 1763
| 1836-11-22
| ''[[:d:Q6661270|Llandyfaelog]]''
|-
| style='text-align:right'| 4599
| ''[[:d:Q7172726|Peter Baynham]]''
|
| 1963-06-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4600
| ''[[:d:Q7173295|Peter Clarke]]''
|
| 1948-10-07
| 2007-01-21
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 4601
| ''[[:d:Q7173568|Peter Davies]]''
|
| 1948
| 2020
| [[Wales]]
|-
| style='text-align:right'| 4602
| ''[[:d:Q7173980|Peter Finch]]''
|
| 1947-03-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4603
| ''[[:d:Q7174079|Peter Fraser]]''
|
| 1953
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4604
| ''[[:d:Q7174185|Peter Gatehouse]]''
|
| 1936-05-03
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4605
| ''[[:d:Q7174237|Peter Gill]]''
|
| 1939-09-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4606
| ''[[:d:Q7174347|Peter Gray]]''
|
| 1926-08-25
| 2012-06-07
| [[Newport]]
|-
| style='text-align:right'| 4607
| ''[[:d:Q7174491|Peter Halliday]]''
|
| 1924-06-02
| 2012-02-18
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 4608
| ''[[:d:Q7174549|Peter Harris]]''
|
| 1962-08-23
|
| [[Swansea]]
|-
| style='text-align:right'| 4609
| ''[[:d:Q7175376|Peter Law]]''
| [[File:Peterlaw.jpg|center|128px]]
| 1948-04-01
| 2006-04-25
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4610
| ''[[:d:Q7175499|Peter Locke]]''
|
| 1956-08-14
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4611
| [[Peter Moore (serial killer)|Peter Moore]]
|
| 1940
|
| ''[[:d:Q2020203|Rhyl]]''<br/>[[St Helens, Merseyside|St Helens]]
|-
| style='text-align:right'| 4612
| ''[[:d:Q7175951|Peter Morris]]''
|
| 1854-01-01
| 1884-12-09
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 4613
| ''[[:d:Q7176193|Peter O'Sullivan]]''
|
| 1951-03-04
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 4614
| ''[[:d:Q7176382|Peter Philp]]''
|
| 1920-11-10
| 2006-02-05
| [[Cairdiff]]
|-
| style='text-align:right'| 4615
| ''[[:d:Q7176440|Peter Prendergast]]''
|
| 1946-10-27
| 2007-01-14
| ''[[:d:Q4667208|Abertridwr]]''
|-
| style='text-align:right'| 4616
| ''[[:d:Q7176450|Peter Price]]''
|
| 1949-08-17
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4617
| ''[[:d:Q7176554|Peter Rees]]''
|
| 1932-05-05
|
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 4618
| ''[[:d:Q7176583|Peter Richards]]''
|
| 1970
|
| [[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 4619
| ''[[:d:Q7176642|Peter Rodon]]''
|
| 1940s
| 2000
| [[Wales]]
|-
| style='text-align:right'| 4620
| ''[[:d:Q7176643|Peter Rodrigues]]''
|
| 1944-01-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4621
| ''[[:d:Q7176650|Peter Rogers]]''
| [[File:Psr99.jpg|center|128px]]
| 1940-01-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4622
| ''[[:d:Q7176685|Peter Rowe]]''
|
| 1947
|
| [[Swansea]]
|-
| style='text-align:right'| 4623
| ''[[:d:Q7176768|Peter Sanders]]''
|
| 1942-09-07
|
| [[Newport]]
|-
| style='text-align:right'| 4624
| ''[[:d:Q7176791|Peter Sayer]]''
|
| 1955-05-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4625
| ''[[:d:Q7176927|Peter Shreeves]]''
|
| 1940-11-30
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4626
| ''[[:d:Q7176932|Peter Sidoli]]''
|
| 1980-06-10
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4627
| ''[[:d:Q7176999|Peter Smith]]''
|
| 1978-09-15
|
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 4628
| ''[[:d:Q7177126|Peter Stimpson]]''
|
| 1947-05-25
|
| ''[[:d:Q3244565|Aberfan]]''
|-
| style='text-align:right'| 4629
| ''[[:d:Q7177186|Peter Sunman]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 4630
| ''[[:d:Q7177481|Peter Vaughan]]''
|
| 20th century
|
| ''[[:d:Q3244565|Aberfan]]''
|-
| style='text-align:right'| 4631
| ''[[:d:Q7179526|Peveril William-Powlett]]''
|
| 1898-03-05
| 1985-11-10
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4632
| ''[[:d:Q7181686|Phil Bater]]''
|
| 1955-10-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4633
| ''[[:d:Q7181762|Phil Carradice]]''
|
| 1947
|
| [[Wales]]
|-
| style='text-align:right'| 4634
| ''[[:d:Q7181840|Phil Dollman]]''
|
| 1985-05-15
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4635
| ''[[:d:Q7181880|Phil Evans]]''
|
| 1980-07-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4636
| ''[[:d:Q7181889|Phil Ford]]''
|
| 1961-03-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4637
| ''[[:d:Q7181939|Phil Griffiths]]''
| [[File:Phil Griffiths.jpg|center|128px]]
| 1905-10-25
| 1978-05-14
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 4638
| ''[[:d:Q7181976|Phil Harrington]]''
|
| 1963-11-23
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4639
| ''[[:d:Q7182004|Phil Hill]]''
|
| 1982-05-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4640
| ''[[:d:Q7182043|Phil John]]''
|
| 1981-04-25
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 4641
| ''[[:d:Q7182080|Phil Kerslake]]''
| [[File:Phil Kerslake MNZM (cropped).jpg|center|128px]]
| 1959-05-24
| 2021-12-11
| [[Swansea]]
|-
| style='text-align:right'| 4642
| ''[[:d:Q7182197|Phil Morris]]''
| [[File:Phil Morris speedway rider.jpg|center|128px]]
| 1975-09-10
|
| [[Newport]]
|-
| style='text-align:right'| 4643
| ''[[:d:Q7182228|Phil North]]''
|
| 1965-06-15
|
| [[Newport]]
|-
| style='text-align:right'| 4644
| ''[[:d:Q7182292|Phil Price]]''
|
| 1988-11-10
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4645
| ''[[:d:Q7182339|Phil Roberts]]''
|
| 1950-02-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4646
| ''[[:d:Q7182365|Phil Ryan]]''
|
| 1946-10-21
| 2016-04-30
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4647
| ''[[:d:Q7182476|Phil Thomas]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4648
| ''[[:d:Q7182507|Phil Vance]]''
|
| 1962-11-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4649
| ''[[:d:Q7182544|Phil Whitlock]]''
|
| 1930-05-01
| 2009-12
| ''[[:d:Q6661603|Llanhilleth]]''
|-
| style='text-align:right'| 4650
| ''[[:d:Q7182554|Phil Williams]]''
|
| 1963-02-07
|
| [[Swansea]]
|-
| style='text-align:right'| 4651
| ''[[:d:Q7182555|Phil Williams]]''
| [[File:Phil Williams.png|center|128px]]
| 1939-01-11
| 2003-06-10
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 4652
| ''[[:d:Q7183190|Philip Baxter]]''
| [[File:Philip Baxter.jpg|center|128px]]
| 1905-05-07
| 1989-09-05
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 4653
| ''[[:d:Q7183455|Philip C.J. Donoghue]]''
| [[File:Professor Philip Conrad Donoghue FRS.jpg|center|128px]]
| 1971-04-05
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 4654
| ''[[:d:Q7183607|Philip George]]''
|
| 1978-09-16
|
| [[Swansea]]
|-
| style='text-align:right'| 4655
| ''[[:d:Q7183865|Philip Jones of Fonmon]]''
| [[File:Portrait of Colonel Philip Jones (1618–1674).jpg|center|128px]]
| 1618<br/>1617
| 1674-09-05
| [[Swansea]]
|-
| style='text-align:right'| 4656
| ''[[:d:Q7184059|Philip McGough]]''
|
|
|
| [[Penygraig]]
|-
| style='text-align:right'| 4657
| ''[[:d:Q7184104|Philip Morgan]]''
|
|
|
| [[Newport]]
|-
| style='text-align:right'| 4658
| ''[[:d:Q7184141|Philip Nicholas]]''
|
| 1876-05-30
| 1952-01-31
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 4659
| ''[[:d:Q7184189|Philip Palmer]]''
| [[File:Philip Palmer.jpg|center|128px]]
| 1960-06-07
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4660
| ''[[:d:Q7184201|Philip Pedlar]]''
|
| 1899-04-30
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4661
| ''[[:d:Q7184229|Philip Powell]]''
| [[File:Portrait of Father Philip Powel (4672675) (cropped).jpg|center|128px]]
| 1594-02-02
| 1646-06-30
| ''[[:d:Q7833102|Trallong]]''
|-
| style='text-align:right'| 4662
| ''[[:d:Q7184350|Philip Sayce]]''
|
| 1976-06-03
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4663
| ''[[:d:Q7184351|Philip Sayer]]''
|
| 1946-10-26
| 1989-09-19
| [[Swansea]]
|-
| style='text-align:right'| 4664
| ''[[:d:Q7184597|Philip Yorke]]''
| [[File:Thomas Gainsborough (1727-1788) - Philip Yorke I (1743–1804), MP - 1151302 - National Trust.jpg|center|128px]]
| 1743-07-30
| 1804-03-19
| ''[[:d:Q5385260|Erddig]]''
|-
| style='text-align:right'| 4665
| ''[[:d:Q7184733|Philippa Roles]]''
|
| 1978-03-01
| 2017-05-22
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4666
| ''[[:d:Q7185718|Phillip Joll]]''
|
| 1954-03-14
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4667
| ''[[:d:Q7186356|Phineas John]]''
|
| 1910
| 1985
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 4668
| ''[[:d:Q7186662|Phoebe Davies]]''
| [[File:Phoebe Davies 01.JPG|center|128px]]
| 1864-02-07
| 1912-12-04
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 4669
| ''[[:d:Q7192602|Piers Griffith]]''
|
| 1568
| 1628
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 4670
| ''[[:d:Q7199739|Pixie O'Harris]]''
|
| 1903-10-15
| 1991-04-17
| [[Cairdiff]]
|-
| style='text-align:right'| 4671
| ''[[:d:Q7228389|Ponty Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4672
| ''[[:d:Q7228390|Ponty Thomas]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4673
| ''[[:d:Q7245941|Pritchard Hughes]]''
| [[File:Joshua Pritchard Hughes by Elliott & Fry circa 1910s NPG x159177.jpg|center|128px]]
| 1847-02-13
| 1938-04-08
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 4674
| ''[[:d:Q7253236|Pryce Pryce-Jones]]''
| [[File:Pryce Pryce-Jones.gif|center|128px]]
| 1834-11-16
| 1920-01-11
| ''[[:d:Q13129664|Llanllwchaiarn]]''
|-
| style='text-align:right'| 4675
| ''[[:d:Q7253279|Prys Morgan]]''
|
| 1937
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4676
| ''[[:d:Q7273649|R. Geraint Gruffydd]]''
|
| 1928-06-09
| 2015-03-24
| ''[[:d:Q3402540|Talybont]]''
|-
| style='text-align:right'| 4677
| ''[[:d:Q7274067|R. Tudur Jones]]''
|
| 1921-06-28
| 1998-07-23
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 4678
| ''[[:d:Q7274124|R. Williams Parry]]''
| [[File:R. Williams Parry.jpg|center|128px]]
| 1884-03-06
| 1956-01-04
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 4679
| ''[[:d:Q7279076|Rachael Bland]]''
|
| 1978-01-21
| 2018-09-05
| [[Cairdiff]]
|-
| style='text-align:right'| 4680
| ''[[:d:Q7279216|Rachel Davies]]''
| [[File:720.Rahel o Fon photo portrait web.jpg|center|128px]]
| 1846-08-25
| 1915-11-29
| [[Anglesey]]
|-
| style='text-align:right'| 4681
| ''[[:d:Q7279427|Rachel Thomas]]''
|
| 1905-02-10
| 1995-02-08
| ''[[:d:Q4733322|Alltwen]]''
|-
| style='text-align:right'| 4682
| ''[[:d:Q7286596|Rakesh Aggarwal]]''
|
| 1963-03-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4683
| ''[[:d:Q7287329|Ralph Champneys Williams]]''
| [[File:Ralph Champneys Williams.jpg|center|128px]]
| 1848-03-09
| 1927-06-22
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 4684
| ''[[:d:Q7287596|Ralph Hancock]]''
| [[File:Hancock FRHS.jpg|center|128px]]
| 1893-07-02
| 1950-08-30
| [[Cairdiff]]
|-
| style='text-align:right'| 4685
| ''[[:d:Q7287883|Ralph Morgan]]''
|
| 1920
| 2009
| [[Wales]]
|-
| style='text-align:right'| 4686
| ''[[:d:Q7293962|Raphael Gray]]''
|
| 1982
|
| ''[[:d:Q5137116|Clynderwen]]''
|-
| style='text-align:right'| 4687
| ''[[:d:Q7297200|Ray Bishop]]''
|
| 1955-11-24
|
| ''[[:d:Q3401108|Hengoed]]''
|-
| style='text-align:right'| 4688
| ''[[:d:Q7297448|Ray Elliott]]''
|
| 1929-03-23
| 2006-05-22
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 4689
| ''[[:d:Q7297530|Ray Glastonbury]]''
|
| 1938-12-11
|
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 4690
| ''[[:d:Q7297551|Ray Griffiths]]''
|
| 1931-09-26
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4691
| ''[[:d:Q7297562|Ray Gunter]]''
|
| 1909-08-30
| 1977-04-12
| ''[[:d:Q6661603|Llanhilleth]]''
|-
| style='text-align:right'| 4692
| ''[[:d:Q7297733|Ray Lambert]]''
|
| 1922-07-18
| 2009-10-22
| [[Flintshire]]
|-
| style='text-align:right'| 4693
| ''[[:d:Q7297839|Ray Mielczarek]]''
|
| 1946-02-10
| 2013-10-30
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4694
| ''[[:d:Q7297975|Ray Powell]]''
|
| 1928-06-19
| 2001-12-07
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 4695
| ''[[:d:Q7297992|Ray Prosser]]''
|
| 1927-03-02
| 2020-11-22
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4696
| ''[[:d:Q7297994|Ray Pulis]]''
|
| 1964-11-21
|
| ''[[:d:Q7194170|Pillgwenlli]]''
|-
| style='text-align:right'| 4697
| ''[[:d:Q7298291|Ray Wilcox]]''
|
| 1921-04-12
| 2003-01-26
| [[Wales]]
|-
| style='text-align:right'| 4698
| ''[[:d:Q7298300|Ray Williams]]''
|
| 1927-11-13
| 2014-01-05
| ''[[:d:Q5441920|Felinfoel]]''
|-
| style='text-align:right'| 4699
| ''[[:d:Q7298301|Ray Williams]]''
| [[File:Ray williams weightlifter.jpg|center|128px]]
| 1959-09-09
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 4700
| ''[[:d:Q7298707|Raymond Davies Hughes]]''
|
| 1923-08-11
| 1999-04-04
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 4701
| ''[[:d:Q7298803|Raymond Glendenning]]''
|
| 1907-09-25
| 1974-02-23
| [[Newport]]
|-
| style='text-align:right'| 4702
| ''[[:d:Q7298808|Raymond Gower]]''
|
| 1916-08-15
| 1989-02-22
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 4703
| ''[[:d:Q7299084|Raymond Price]]''
|
| 1924
| 1988
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 4704
| ''[[:d:Q7299161|Raymond Steed]]''
|
| 1928-10-01
| 1943-04-26
| ''[[:d:Q7594726|St Mellons]]''
|-
| style='text-align:right'| 4705
| ''[[:d:Q7299231|Raymond Wilkins]]''
|
| 1950-10-03
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4706
| ''[[:d:Q7301732|Rebecca Evans]]''
|
| 1963-08-19
|
| ''[[:d:Q3072939|Pontrhydyfen]]''
|-
| style='text-align:right'| 4707
| ''[[:d:Q7301733|Rebecca Evans]]''
| [[File:Rebecca Evans AM (27555062324) (cropped).jpg|center|128px]]
| 1976-08-02
|
| ''[[:d:Q3072939|Pontrhydyfen]]''
|-
| style='text-align:right'| 4708
| ''[[:d:Q7301790|Rebecca John]]''
|
| 1970-04-15
|
| [[Vale o Glamorgan]]
|-
| style='text-align:right'| 4709
| ''[[:d:Q7301813|Rebecca Llewellyn]]''
|
| 1985-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4710
| ''[[:d:Q7306428|Redvern Edmunds]]''
|
| 1943-01-10
|
| [[Newport]]
|-
| style='text-align:right'| 4711
| ''[[:d:Q7306435|Redvers Sangoe]]''
|
| 1936-07-06
| 1964-08-14
| [[Cairdiff]]
|-
| style='text-align:right'| 4712
| ''[[:d:Q7306965|Rees G. Richards]]''
| [[File:Rees G Richards.jpg|center|128px]]
| 1842-07-22
| 1917-02-10
| [[Swansea]]
|-
| style='text-align:right'| 4713
| ''[[:d:Q7306966|Rees Davies]]''
|
| 1938-08-06
| 2005-05-16
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 4714
| ''[[:d:Q7306968|Rees Howell Gronow]]''
| [[File:Portrait of R. H. Gronow (4670809).jpg|center|128px]]
| 1794-05-07
| 1865-11-22
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 4715
| ''[[:d:Q7306969|Rees Howells]]''
|
| 1879-10-10
| 1950-02-12
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 4716
| ''[[:d:Q7306970|Rees Richards]]''
|
| 1886
|
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 4717
| ''[[:d:Q7306973|Rees Thomas]]''
|
| 1926-08-31
| 1984-03
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 4718
| ''[[:d:Q7306974|Rees Williams]]''
|
| 1900-01
| 1963-12-30
| ''[[:d:Q3306663|Merthyr Tydfil Coonty Burgh]]''
|-
| style='text-align:right'| 4719
| ''[[:d:Q7306975|Rees Thomas]]''
|
| 1882
| 1926-06-14
| ''[[:d:Q722585|Cil-y-coed]]''
|-
| style='text-align:right'| 4720
| ''[[:d:Q7307724|Reg Anderson]]''
|
| 1914-04-25
| 1972-08-12
| ''[[:d:Q4980972|Brynhyfryd]]''
|-
| style='text-align:right'| 4721
| ''[[:d:Q7307734|Reg Blakemore]]''
|
| 1924-09-01
| 2006-06-20
| [[Newport]]
|-
| style='text-align:right'| 4722
| ''[[:d:Q7307740|Reg Braddick]]''
|
| 1913-08-04
| 1999-12
| [[Cairdiff]]
|-
| style='text-align:right'| 4723
| ''[[:d:Q7307755|Reg Cudlipp]]''
|
| 1910-12-11
| 2005-01-21
| [[Cairdiff]]
|-
| style='text-align:right'| 4724
| ''[[:d:Q7307759|Reg Davies]]''
|
| 1929-05-27
| 2009-02-09
| ''[[:d:Q5199742|Cymmer]]''
|-
| style='text-align:right'| 4725
| ''[[:d:Q7307801|Reg Hunter]]''
|
| 1938-10-25
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 4726
| ''[[:d:Q7307835|Reg Parker]]''
|
| 1921-06-10
| 1997
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 4727
| ''[[:d:Q7307840|Reg Plummer]]''
| [[File:Reg Plummer (rugby player).png|center|128px]]
| 1888-12-29
| 1953-06-18
| [[Newport]]
|-
| style='text-align:right'| 4728
| ''[[:d:Q7307846|Reg Pugh]]''
|
| 1917-07-28
| 1981-10-21
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 4729
| ''[[:d:Q7307859|Reg Spencer]]''
|
| 1908-12-01
| 1981-03-16
| ''[[:d:Q2183255|Queensferry]]''
|-
| style='text-align:right'| 4730
| ''[[:d:Q7307870|Reg Thomas]]''
| [[File:Reginald Thomas 1929.jpg|center|128px]]
| 1907-01-11
| 1946-03-14
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 4731
| ''[[:d:Q7308736|Reginald Hathway]]''
|
| 1907
|
| [[Newport]]
|-
| style='text-align:right'| 4732
| ''[[:d:Q7308776|Reginald Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4733
| ''[[:d:Q7308794|Reginald Lloyd]]''
|
| 1917
|
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 4734
| ''[[:d:Q7308838|Reginald Phillips]]''
|
| 1897-10-19
| 1963-06-07
| [[Newport]]
|-
| style='text-align:right'| 4735
| ''[[:d:Q7319298|Rex Richards]]''
|
| 1934-02-04
| 1989-03-06
| [[Newport]]
|-
| style='text-align:right'| 4736
| ''[[:d:Q7320502|Rhian Davies]]''
|
| 1981-01-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4737
| ''[[:d:Q7320505|Rhian Pugh]]''
|
| 1989-04-16
|
| [[Newport]]
|-
| style='text-align:right'| 4738
| ''[[:d:Q7320507|Rhian Samuel]]''
|
| 1944-02-03
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4739
| ''[[:d:Q7320519|Rhidian Brook]]''
|
| 1964
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 4740
| ''[[:d:Q7320717|Rhisiart ap Rhys]]''
|
|
|
| ''[[:d:Q7809073|Tir Iarll]]''
|-
| style='text-align:right'| 4741
| ''[[:d:Q7320826|Rhod Gilbert]]''
| [[File:Rhod Gilbert.jpg|center|128px]]
| 1968-10-18
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4742
| ''[[:d:Q7321237|Rhodri Davies]]''
|
| 1971
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4743
| ''[[:d:Q7321238|Rhodri Evans]]''
|
| 1989-12-06
|
| [[Swansea]]
|-
| style='text-align:right'| 4744
| ''[[:d:Q7321239|Rhodri Glyn Thomas]]''
| [[File:Rhodri glyn thomas.jpg|center|128px]]
| 1953-04-11
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4745
| ''[[:d:Q7321241|Rhodri Gomer-Davies]]''
| [[File:CDF Glos Dragons 09 (2).jpg|center|128px]]
| 1983-01-11
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4746
| ''[[:d:Q7321243|Rhodri Jones]]''
|
| 1991-12-23
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4747
| ''[[:d:Q7321244|Rhodri McAtee]]''
|
| 1984-08-02
|
| [[Newport]]
|-
| style='text-align:right'| 4748
| ''[[:d:Q7321247|Rhodri Owen]]''
|
| 1972-12-14
|
| [[Wales]]
|-
| style='text-align:right'| 4749
| ''[[:d:Q7321249|Rhodri Williams]]''
| [[File:Rhodri Williams.jpg|center|128px]]
| 1993-05-05
|
| [[Swansea]]
|-
| style='text-align:right'| 4750
| ''[[:d:Q7321251|Rhodri Williams]]''
|
| 1968-05-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4751
| ''[[:d:Q7321762|Rhys Brydydd]]''
|
|
|
| ''[[:d:Q13131807|Kingdom of Morgannwg]]''
|-
| style='text-align:right'| 4752
| ''[[:d:Q7321763|Rhys Buckley]]''
|
| 1989-06-18
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4753
| ''[[:d:Q7321764|Rhys Cadwaladr]]''
|
| 1666
| 1690
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 4754
| ''[[:d:Q7321776|Rhys Evans]]''
| [[File:RhysEvans0811.jpg|center|128px]]
| 1992-10-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4755
| ''[[:d:Q7321779|Rhys Gill]]''
| [[File:Rhys Gill 2019.jpg|center|128px]]
| 1986-10-30
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 4756
| ''[[:d:Q7321781|Rhys Gethin]]''
|
| 14th century
| 1405
| ''[[:d:Q13130344|Nant Conwy]]''
|-
| style='text-align:right'| 4757
| ''[[:d:Q7321793|Rhys Hughes]]''
|
| 1966-09-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4758
| ''[[:d:Q7321794|Rhys Jenkins]]''
|
| 1990-06-15
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 4759
| ''[[:d:Q7321796|Rhys Jones]]''
|
| 1941-02-26
| 2001-09-19
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4760
| ''[[:d:Q7321797|Rhys Jones]]''
| [[File:Rhys Jones - Great Britain Paralympic sprinter 2017.jpg|center|128px]]
| 1994-06-30
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 4761
| ''[[:d:Q7321799|Rhys Jones]]''
|
| 1987-08-23
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4762
| ''[[:d:Q7321814|Rhys Meirion]]''
| [[File:Rhys Meirion 2011 llai.jpg|center|128px]]
| 1966-02-24
|
| ''[[:d:Q2035368|Tremadog]]''
|-
| style='text-align:right'| 4763
| ''[[:d:Q7321821|Rhys Morgan]]''
|
| 1954-06-09
| 2021
| ''[[:d:Q7570735|Southerndown]]''
|-
| style='text-align:right'| 4764
| ''[[:d:Q7321829|Rhys Patchell]]''
| [[File:Rhys Patchell 2022.jpg|center|128px]]
| 1993-05-17
|
| ''[[:d:Q6661223|Llandochau Fach]]''
|-
| style='text-align:right'| 4765
| ''[[:d:Q7321830|Rhys Prichard]]''
|
| 1579
| 1644-12
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 4766
| ''[[:d:Q7321834|Rhys Rees]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4767
| ''[[:d:Q7321835|Rhys Rhys-Williams]]''
|
| 1865-10-20
| 1955-01-29<br/>1955-01-20
| ''[[:d:Q6875781|Miskin]]''
|-
| style='text-align:right'| 4768
| ''[[:d:Q7321838|Rhys Shellard]]''
|
| 1985-06-25
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4769
| ''[[:d:Q7321844|Rhys Webb]]''
| [[File:Rhys Webb. Wales Grand Slam Celebration, Senedd 19 March 2012.jpg|center|128px]]
| 1988-12-09
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4770
| ''[[:d:Q7321847|Rhys Williams]]''
| [[File:Rhys Williams Warrington.JPG|center|128px]]
| 1989-12-08
|
| ''[[:d:Q2364012|Mynydd Isa]]''
|-
| style='text-align:right'| 4771
| ''[[:d:Q7321848|Rhys Williams]]''
|
| 1988-01-27
|
| [[Swansea]]
|-
| style='text-align:right'| 4772
| ''[[:d:Q7321849|Rhys Williams]]''
|
| 1990-01-16
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4773
| ''[[:d:Q7321850|Rhys Wilmot]]''
|
| 1962-02-21
|
| [[Newport]]
|-
| style='text-align:right'| 4774
| ''[[:d:Q7321859|Rhys ap Thomas]]''
| [[File:Portrait of Sir Rhys ab Thomas, Knight Banneret & K-G (4672073).jpg|center|128px]]
| 1449
| 1525
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 4775
| ''[[:d:Q7322910|Riccardo Gabbiadini]]''
|
| 1970-03-11
|
| [[Newport]]
|-
| style='text-align:right'| 4776
| ''[[:d:Q7323024|Rice Mansel]]''
|
| 1487-01-25
| 1559
| ''[[:d:Q645198|Oxwich]]''
|-
| style='text-align:right'| 4777
| ''[[:d:Q7323907|Richard Bagnall-Oakeley]]''
|
| 1865-11-23
| 1947
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 4778
| ''[[:d:Q7324005|Richard Bassett]]''
|
| 1777-11-07
| 1852-08-31
| ''[[:d:Q2347528|Llantwit Major]]''
|-
| style='text-align:right'| 4779
| ''[[:d:Q7324011|Richard Bates]]''
|
| 1829
| 1889-12-07
| [[Wales]]
|-
| style='text-align:right'| 4780
| ''[[:d:Q7324421|Richard Bryn Williams]]''
|
| 1902
| 1981
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 4781
| ''[[:d:Q7324655|Richard Carwardine]]''
| [[File:Carwardine july2010.jpg|center|128px]]
| 1947-01-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4782
| ''[[:d:Q7324802|Richard Clough]]''
| [[File:Sir Richard Clough by Moses Griffith 02188.jpg|center|128px]]
| 1530<br/>1539
| 1570
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 4783
| ''[[:d:Q7324958|Richard Crawley]]''
|
| 1840-12-26
| 1893-03-30
| ''[[:d:Q744944|Raglan]]''
|-
| style='text-align:right'| 4784
| ''[[:d:Q7325106|Richard Davies]]''
| [[File:Richard-Davies-AS-Môn.jpg|center|128px]]
| 1818-11-29
| 1896-10-27
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 4785
| ''[[:d:Q7325108|Richard Davies]]''
| [[File:Richard Davies, Llanbryn-mair (Mynyddog, 1833-77) NLW3364536.jpg|center|128px]]
| 1833-01-10
| 1877-07-14
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 4786
| ''[[:d:Q7325109|Richard Davies]]''
|
| 1926-01-25
| 2015-10-08
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 4787
| ''[[:d:Q7325110|Richard Davies]]''
| [[File:Richard Davies Esgob Llanelwy a Thyddewi Bishp of St Davids, Wales (d. 1581) 02.jpg|center|128px]]
| 1505<br/>1501
| 1581-11-07
| ''[[:d:Q13128908|Gyffin]]''
|-
| style='text-align:right'| 4788
| ''[[:d:Q7325458|Richard Edwards]]''
| [[File:Richard Edwards.jpg|center|128px]]
| 1842
| 1915-10-29
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 4789
| ''[[:d:Q7325461|Richard Edwards]]''
| [[File:Richard Edwards, former Labour AM.jpg|center|128px]]
| 1956-08-25
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4790
| ''[[:d:Q7325487|Richard Ellis]]''
| [[File:Richard Ellis (Cymeriadau TGJ).jpg|center|128px]]
| 1865-12-27
| 1928-09-06
| [[Aberystwyth]]
|-
| style='text-align:right'| 4791
| ''[[:d:Q7325548|Richard Evans]]''
|
| 1983-06-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4792
| ''[[:d:Q7325626|Richard Farrington]]''
|
| 1702
| 1772-10-16
| ''[[:d:Q13129688|Llechylched]]''
|-
| style='text-align:right'| 4793
| ''[[:d:Q7325647|Richard Fenton]]''
| [[File:Richard Fenton.jpg|center|128px]]
| 1746
| 1821-11
| [[St Davids]]
|-
| style='text-align:right'| 4794
| ''[[:d:Q7325812|Richard Fussell]]''
| [[File:ST vs Ospreys 08-12-120089.JPG|center|128px]]
| 1984-04-12
|
| ''[[:d:Q3910782|Bedlinog]]''
|-
| style='text-align:right'| 4795
| ''[[:d:Q7325950|Richard Glynn Vivian]]''
| [[File:Pfeninger, R. E.; R. Glynn Vivian.jpg|center|128px]]
| 1835-08-31
| 1910-06-07
| [[Swansea]]
|-
| style='text-align:right'| 4796
| ''[[:d:Q7326022|Richard Grant]]''
|
| 1984-06-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4797
| ''[[:d:Q7326090|Richard Griffiths]]''
|
| 1756-01-13
| 1826
| ''[[:d:Q17715131|Llanwonno]]''
|-
| style='text-align:right'| 4798
| ''[[:d:Q7326127|Richard Gwyn]]''
| [[File:RGwyn 2008.jpg|center|128px]]
| 1956-07-22
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4799
| ''[[:d:Q7326205|Richard Haig]]''
|
| 1970-12-29
|
| [[Pontypridd]]
|-
| style='text-align:right'| 4800
| ''[[:d:Q7326280|Richard Harrington]]''
|
| 1975-03-12
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4801
| ''[[:d:Q7326420|Richard Herbert]]''
|
| 1972-11-28
| 2012-02-22
| [[Wales]]
|-
| style='text-align:right'| 4802
| ''[[:d:Q7326809|Richard James]]''
| [[File:Richard James at the ICA - 3315264865.jpg|center|128px]]
| 1975-03-27
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4803
| ''[[:d:Q7326900|Richard Johnson]]''
|
| 1972-02-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4804
| ''[[:d:Q7326904|Richard Johnson]]''
|
| 1985
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4805
| ''[[:d:Q7326925|Richard Jones]]''
|
| 1603
| 1650s
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 4806
| ''[[:d:Q7326929|Richard Jones]]''
|
| 1757
| 1814-04-23
| ''[[:d:Q6661917|Llanychan]]''
|-
| style='text-align:right'| 4807
| ''[[:d:Q7327041|Richard Kelly]]''
|
| 1987-09-10
|
| [[Swansea]]
|-
| style='text-align:right'| 4808
| ''[[:d:Q7327422|Richard Llwyd]]''
| [[File:Richard Llwyd.jpeg|center|128px]]
| 1752
| 1835-12-29
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 4809
| ''[[:d:Q7327487|Richard Lucas]]''
|
| 1648
| 1715-06-29
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 4810
| ''[[:d:Q7327515|Richard Lynch]]''
|
| 1965-12
|
| [[Wales]]
|-
| style='text-align:right'| 4811
| ''[[:d:Q7327908|Richard Morris]]''
|
| 1703-02-02
| 1779-12
| ''[[:d:Q13129642|Llanfihangel Tre'r Beirdd]]''
|-
| style='text-align:right'| 4812
| ''[[:d:Q7327948|Richard Mullock]]''
| [[File:Richard Mullock.jpg|center|128px]]
| 1851-05-03
| 1920
| [[Newport]]
|-
| style='text-align:right'| 4813
| ''[[:d:Q7327965|Richard Mustoe]]''
|
| 1981-12-09
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4814
| ''[[:d:Q7327975|Richard Mylan]]''
|
| 1973
|
| [[Swansea]]
|-
| style='text-align:right'| 4815
| ''[[:d:Q7328001|Richard Nanney]]''
|
| 1691
| 1767
| ''[[:d:Q17744296|Cefndeuddwr Farmhouse]]''
|-
| style='text-align:right'| 4816
| ''[[:d:Q7328216|Richard Owen]]''
| [[File:Portrait of Y Parch. Richard Owen, (y diwygiwr enwog) (4671728) (cropped).jpg|center|128px]]
| 1839
| 1887-02-16
| ''[[:d:Q3400997|Llangristiolus]]''
|-
| style='text-align:right'| 4817
| ''[[:d:Q7328258|Richard Page]]''
|
| 1941-02-22
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 4818
| ''[[:d:Q7328276|Richard Parkhouse]]''
|
| 1910-03-02
| 1984-01-01
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 4819
| ''[[:d:Q7328285|Richard Parry-Jones]]''
|
| 1951-09
| 2021-04-16
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4820
| ''[[:d:Q7328358|Richard Pennant, 1st Baron Penrhyn]]''
| [[File:Richard Pennant Thomson 1790s.jpg|center|128px]]
| 1737<br/>1729
| 1808-01-21
| [[Gwynedd]]
|-
| style='text-align:right'| 4821
| ''[[:d:Q7328379|Richard Perryn]]''
| [[File:Richard Perryn.jpg|center|128px]]
| 1723
| 1803-01-02
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 4822
| ''[[:d:Q7328490|Richard Powell]]''
|
| 1971
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 4823
| ''[[:d:Q7328491|Richard Powell]]''
|
| 1864
| 1944
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4824
| ''[[:d:Q7328531|Richard Pryse]]''
|
| 16th century
| 1623-02-07<br/>1623-02-05
| ''[[:d:Q26212157|Gogerddan Mansion]]''
|-
| style='text-align:right'| 4825
| ''[[:d:Q7329060|Richard Singleton]]''
|
| 1988-11-21
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4826
| ''[[:d:Q7329076|Richard Skone]]''
|
| 1974-06-17
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4827
| ''[[:d:Q7329117|Richard Smith]]''
|
| 1973-06-06
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 4828
| ''[[:d:Q7329296|Richard Summers]]''
|
| 1860-07-30
| 1941-12-22
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 4829
| ''[[:d:Q7329418|Richard Tecwyn Williams]]''
|
| 1909-02-20<br/>1909
| 1979-12-29<br/>1979
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 4830
| ''[[:d:Q7329440|Richard Thomas]]''
|
| 1932-03-22
| 1998-12-13
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 4831
| ''[[:d:Q7329445|Richard Thomas]]''
|
| 1753-12-10
| 1780
| ''[[:d:Q20602435|Ynyscynhaearn]]''
|-
| style='text-align:right'| 4832
| ''[[:d:Q7329554|Richard Trevor]]''
| [[File:Richard Trefor (1558 - 1638).jpg|center|128px]]
| 1558
| 1638
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 4833
| ''[[:d:Q7329644|Richard Vaughan]]''
| [[File:Portrait of Ricardvs Vavghanvs (4672123).jpg|center|128px]]
| 1550
| 1607-03-30
| ''[[:d:Q1541249|Llŷn Peninsula]]''
|-
| style='text-align:right'| 4834
| ''[[:d:Q7329946|Richard Whitford]]''
|
| 1495
| 1543
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 4835
| ''[[:d:Q7329960|Richard Wiegold]]''
|
| 1967
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 4836
| ''[[:d:Q7329983|Richard William Allen]]''
|
| 1867-02-01
| 1955-07-17
| [[Cairdiff]]
|-
| style='text-align:right'| 4837
| ''[[:d:Q7329992|Richard William Leslie Wain]]''
|
| 1896-12-05
| 1917-11-20
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4838
| ''[[:d:Q7330013|Richard Williams Morgan]]''
|
| 1815
| 1889
| ''[[:d:Q6661559|Llangynfelyn]]''
|-
| style='text-align:right'| 4839
| ''[[:d:Q7330502|Richie Gendall]]''
|
| 1960-09-25
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4840
| ''[[:d:Q7330545|Richie Morgan]]''
|
| 1946-10-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4841
| ''[[:d:Q7330560|Richie Pugh]]''
|
| 1983-08-10
|
| [[Swansea]]
|-
| style='text-align:right'| 4842
| ''[[:d:Q7330564|Richie Rees]]''
|
| 1983-05-21
|
| [[Swansea]]
|-
| style='text-align:right'| 4843
| ''[[:d:Q7330585|Richie Thomas]]''
|
| 1942-06-18
|
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 4844
| ''[[:d:Q7331266|Rick Brookes]]''
|
| 1948-06-16
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4845
| ''[[:d:Q7332065|Ricky Evans]]''
|
| 1960-06-23
|
| ''[[:d:Q319672|Aberporth]]''
|-
| style='text-align:right'| 4846
| ''[[:d:Q7339945|Rob Appleyard]]''
|
| 1972-12-09
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 4847
| ''[[:d:Q7340065|Rob Davies]]''
|
| 1987-03-24
|
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 4848
| ''[[:d:Q7340119|Rob Evans]]''
|
| 1978-03-14
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 4849
| ''[[:d:Q7340132|Rob Folland]]''
|
| 1979-09-16
|
| [[Swansea]]
|-
| style='text-align:right'| 4850
| ''[[:d:Q7340204|Rob Higgitt]]''
|
| 1981-08-12
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4851
| ''[[:d:Q7340357|Rob McCusker]]''
|
| 1985-12-10
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4852
| ''[[:d:Q7340465|Rob Piercy]]''
|
| 1946-11-28
|
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 4853
| ''[[:d:Q7340921|Robbie James]]''
| [[File:Robbie James.JPG|center|128px]]
| 1957-03-23
| 1998-02-18
| [[Swansea]]
|-
| style='text-align:right'| 4854
| ''[[:d:Q7340978|Robbie Regan]]''
|
| 1968-08-30
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 4855
| ''[[:d:Q7341588|Robert Armstrong-Jones]]''
| [[File:Robert Armstrong-Jones 1933.jpg|center|128px]]
| 1857-12-02
| 1943-01-31
| ''[[:d:Q20602435|Ynyscynhaearn]]''
|-
| style='text-align:right'| 4856
| ''[[:d:Q7342182|Robert Blythe]]''
|
| 1947
| 2018-11-20
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4857
| ''[[:d:Q7342477|Robert Bryan]]''
| [[File:Mr. R. Bryan (5292071).jpg|center|128px]]
| 1858-09-06
| 1920-05-05
| ''[[:d:Q6661071|Llanarmon-yn-Iâl]]''
|-
| style='text-align:right'| 4858
| ''[[:d:Q7342553|Robert Bye]]''
| [[File:Robert Bye VC IWM Q 114616.jpg|center|128px]]
| 1889-12-12
| 1962-08-23
| [[Pontypridd]]
|-
| style='text-align:right'| 4859
| ''[[:d:Q7342900|Robert Chester]]''
|
| 1586
| 1604
| [[Wales]]
|-
| style='text-align:right'| 4860
| ''[[:d:Q7342978|Robert Clift]]''
|
| 1962-08-01
|
| [[Newport]]
|-
| style='text-align:right'| 4861
| ''[[:d:Q7343389|Robert Daniell]]''
| [[File:Robert Daniell.jpg|center|128px]]
| 1646-04-20
| 1718-05-01
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 4862
| ''[[:d:Q7343424|Robert Davies]]''
|
| 1861
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4863
| ''[[:d:Q7343425|Robert Davies]]''
|
| 1863
|
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 4864
| ''[[:d:Q7343426|Robert Davies]]''
|
| 1869
| 1930
| ''[[:d:Q2483466|Caergwrle]]''
|-
| style='text-align:right'| 4865
| ''[[:d:Q7343516|Robert Dewi Williams]]''
|
| 1870-12-29
| 1955-01-25
| ''[[:d:Q3406258|Pandy Tudur]]''
|-
| style='text-align:right'| 4866
| ''[[:d:Q7343531|Robert Dickie]]''
|
| 1964-06-23
| 2010-10-28
| ''[[:d:Q1033068|Cefneithin]]''
|-
| style='text-align:right'| 4867
| ''[[:d:Q7343672|Robert Duffy]]''
|
| 1982-12-02
|
| [[Swansea]]
|-
| style='text-align:right'| 4868
| ''[[:d:Q7344015|Robert Ellis]]''
| [[File:Revd Robert Ellis (Cynddelw, 1812-75) NLW3364283.jpg|center|128px]]
| 1812-02-03
| 1875-08-19
| ''[[:d:Q20589424|Pen-y-bont-fawr]]''
|-
| style='text-align:right'| 4869
| ''[[:d:Q7344030|Robert Ellis]]''
|
| 1956-08-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4870
| ''[[:d:Q7344034|Robert Ellis]]''
|
| 1898-04-11
| 1966-11-02
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 4871
| ''[[:d:Q7344461|Robert Fountain]]''
|
| 1969
|
| [[Wales]]
|-
| style='text-align:right'| 4872
| ''[[:d:Q7345014|Robert Gwilym]]''
|
| 1956-12-02
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4873
| ''[[:d:Q7345142|Robert Hadley]]''
|
| 1951-10-22
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4874
| ''[[:d:Q7345286|Robert Harris]]''
| [[File:Robert Harris, C.M.G., R.C.A. (I0007812).jpg|center|128px]]
| 1849-09-18
| 1919-02-27
| ''[[:d:Q3400184|Caerhun]]''
|-
| style='text-align:right'| 4875
| ''[[:d:Q7345469|Robert Herring]]''
|
| 1903-05-13
| 1975
| [[Wales]]
|-
| style='text-align:right'| 4876
| ''[[:d:Q7345683|Robert Hughes]]''
|
| 1966-12-12
|
| [[Wales]]
|-
| style='text-align:right'| 4877
| ''[[:d:Q7345746|Robert Huw Morgan]]''
| [[File:Robert Huw Morgan Stanford October 2019 001.jpg|center|128px]]
| 1967-08-29
|
| [[Newport]]
|-
| style='text-align:right'| 4878
| ''[[:d:Q7346107|Robert Jermain Thomas]]''
| [[File:Robert Jermain Thomas.jpg|center|128px]]
| 1840-09-07
| 1866-08-31
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 4879
| ''[[:d:Q7346173|Robert Jones]]''
|
| 1868
| 1939
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4880
| ''[[:d:Q7346178|Robert Jones]]''
| [[File:Robert Jones (surgeon).jpg|center|128px]]
| 1857-06-28
| 1933-01-14
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 4881
| ''[[:d:Q7346179|Robert Jones]]''
|
| 1809-01-06
| 1879-03-28
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 4882
| ''[[:d:Q7346183|Robert Jones Derfel]]''
| [[File:Robert Jones Derfel (1824-1905) NLW3364553.jpg|center|128px]]
| 1824-07-24
| 1905<br/>1905-12-17<br/>1905-12-16
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 4883
| ''[[:d:Q7346820|Robert Lee Roberts]]''
|
| 1868
| 1943-03-02
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 4884
| ''[[:d:Q7346876|Robert Lewis-Lloyd]]''
|
| 1836-01-09
| 1915-09-07
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 4885
| ''[[:d:Q7346880|Robert Lewis]]''
|
| 1987-11-20
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 4886
| ''[[:d:Q7347000|Robert Lougher]]''
|
| 1530s
| 1585-06-03
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 4887
| ''[[:d:Q7347323|Robert Mansell]]''
| [[File:Mansell.jpg|center|128px]]
| 1573
| 1656
| ''[[:d:Q6759079|Margam]]''
|-
| style='text-align:right'| 4888
| ''[[:d:Q7347624|Robert Mends]]''
|
| 1767
| 1823-09-04
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 4889
| ''[[:d:Q7347692|Robert Mills-Roberts]]''
| [[File:Preston north end art (Mills-Roberts).jpg|center|128px]]
| 1862-08-05
| 1935-11-27
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 4890
| ''[[:d:Q7347710|Robert Minhinnick]]''
| [[File:Robert Minhinnick.jpg|center|128px]]
| 1952
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 4891
| ''[[:d:Q7347796|Robert Morgan]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4892
| ''[[:d:Q7347797|Robert Morgan]]''
| [[File:Robert Morgan, Bishop of Bangor (1608-73).jpg|center|128px]]
| 1608
| 1673-09-01
| ''[[:d:Q6661272|Llandyssil]]''
|-
| style='text-align:right'| 4893
| ''[[:d:Q7348182|Robert Owen]]''
|
| 1820-05-13
| 1902-04-06
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 4894
| ''[[:d:Q7348749|Robert Parry]]''
|
| 1563
| 1613
| [[Wales]]
|-
| style='text-align:right'| 4895
| ''[[:d:Q7348762|Robert Paterson]]''
|
| 1949-02-27
|
| [[Wales]]
|-
| style='text-align:right'| 4896
| ''[[:d:Q7348841|Robert Perkins]]''
|
| 1966
|
| [[Swansea]]
|-
| style='text-align:right'| 4897
| ''[[:d:Q7349052|Robert Prosser]]''
|
| 1943-11-14
|
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 4898
| ''[[:d:Q7349208|Robert Rees]]''
| [[File:Eos Morlais.gif|center|128px]]
| 1841-04-05
| 1892-06-05
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 4899
| ''[[:d:Q7349268|Robert Richards]]''
|
| 1884-05-07
| 1954-12-22
| ''[[:d:Q13129653|Llangynog]]''
|-
| style='text-align:right'| 4900
| ''[[:d:Q7349272|Robert Richardson-Gardner]]''
| [[File:Robert Richardson-Gardner Vanity Fair 1877-02-17.jpg|center|128px]]
| 1827-06-15
| 1898-01-04
| [[Swansea]]
|-
| style='text-align:right'| 4901
| ''[[:d:Q7349314|Robert Roberts]]''
|
| 1864-07
| 1932-03-15
| ''[[:d:Q7165398|Pen-y-cae]]''
|-
| style='text-align:right'| 4902
| ''[[:d:Q7349356|Robert Rogers]]''
| [[File:Official portrait of Lord Lisvane crop 2.jpg|center|128px]]
| 1950-02-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4903
| ''[[:d:Q7349408|Robert Rowthorn]]''
|
| 1939-08-20
|
| [[Newport]]
|-
| style='text-align:right'| 4904
| ''[[:d:Q7349760|Robert Shields]]''
| [[File:Portrait of Robert Shields (4670523) (cropped).jpg|center|128px]]
| 1827
| 1864-12-23
| [[Cairdiff]]
|-
| style='text-align:right'| 4905
| ''[[:d:Q7350340|Robert Thomas]]''
| [[File:Robert Thomas South Australian Register.jpeg|center|128px]]
| 1781-11
| 1860-07-01
| ''[[:d:Q3397480|Llanymynech]]''
|-
| style='text-align:right'| 4906
| ''[[:d:Q7350341|Robert Thomas]]''
| [[File:Thefamily-sculpture-robert-thomas-7.jpg|center|128px]]
| 1926-08-01
| 1999-05-11
| ''[[:d:Q5197252|Cwmparc]]''
|-
| style='text-align:right'| 4907
| ''[[:d:Q7350584|Robert Vaughan]]''
|
| 1592
| 1667-05-16
| ''[[:d:Q20600573|Hengwrt]]''
|-
| style='text-align:right'| 4908
| ''[[:d:Q7350590|Robert Vaughn]]''
| [[File:Robert Vaughn - Montana pioneer - 1900.jpg|center|128px]]
| 1836-06-05
| 1918-03-23
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 4909
| ''[[:d:Q7350786|Robert Waithman]]''
| [[File:ONL (1887) 1.066 - Alderman Waithman, from an authentic portrait.jpg|center|128px]]
| 1764
| 1833-02-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4910
| ''[[:d:Q7350851|Robert Wanbon]]''
|
| 1943-11-16
| 2022-11-08
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4911
| ''[[:d:Q7351086|Robert William Griffiths]]''
| [[File:RWGriffiths.jpg|center|128px]]
| 1896-05-28
| 1962-01-29
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 4912
| ''[[:d:Q7351121|Robert Williams]]''
| [[File:Robert Williams (Trebor Mai, 1830-77) NLW3364532.jpg|center|128px]]
| 1830-05-25
| 1877-08-05
| ''[[:d:Q13129672|Llanrhychwyn]]''
|-
| style='text-align:right'| 4913
| ''[[:d:Q7352623|Robin Llywelyn]]''
|
| 1958-11-24
|
| [[Gwynedd]]
|-
| style='text-align:right'| 4914
| ''[[:d:Q7352873|Robin Williams]]''
|
| 1959-04-05
|
| [[Anglesey]]
|-
| style='text-align:right'| 4915
| ''[[:d:Q7356255|Rod Jones]]''
|
| 1946-06-14
|
| ''[[:d:Q7320728|Rhiwderin]]''
|-
| style='text-align:right'| 4916
| ''[[:d:Q7356340|Rod Richards]]''
| [[File:Rodrogers1999.jpg|center|128px]]
| 1947-03-12
| 2019-07-13
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4917
| ''[[:d:Q7356419|Rod de'Ath]]''
| [[File:Rod de'Ath cropped.jpg|center|128px]]
| 1950-06-18
| 2014-08-01
| ''[[:d:Q3405190|Saundersfoot]]''
|-
| style='text-align:right'| 4918
| ''[[:d:Q7356486|Roddy Hughes]]''
|
| 1891-06-19
| 1970-02-22
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 4919
| ''[[:d:Q7356492|Roddy Llewellyn]]''
|
| 1947-10-09
|
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 4920
| ''[[:d:Q7356568|Roderic Bowen]]''
|
| 1913-08-06
| 2001-07-18
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 4921
| ''[[:d:Q7356724|Rodger Gifford]]''
|
| 1948-04-12
|
| ''[[:d:Q3398355|Llanbradach]]''
|-
| style='text-align:right'| 4922
| ''[[:d:Q7357782|Roger Addison]]''
|
| 1945
| 2010-03
| [[Wales]]
|-
| style='text-align:right'| 4923
| ''[[:d:Q7358079|Roger Davis]]''
|
| 1946-01-15
|
| ''[[:d:Q3398389|Whitchurch]]''
|-
| style='text-align:right'| 4924
| ''[[:d:Q7358144|Roger Edgeworth]]''
|
| 1485
| 1560
| ''[[:d:Q5884534|Holt Castle]]''
|-
| style='text-align:right'| 4925
| ''[[:d:Q7358146|Roger Edwards]]''
| [[File:Portrait of Roger Edwards (4674356) (cropped).jpg|center|128px]]
| 1811-01-26
| 1886-07-09
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 4926
| ''[[:d:Q7358254|Roger Green]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4927
| ''[[:d:Q7358753|Roger Owen]]''
|
| 1953-12-13
| 2021-07-20
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4928
| ''[[:d:Q7358800|Roger Pratt]]''
|
| 1944
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4929
| ''[[:d:Q7358860|Roger Royle]]''
|
| 1939-01-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4930
| ''[[:d:Q7359001|Roger Thomas]]''
|
| 1925-11-14
| 1994-09-04
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 4931
| ''[[:d:Q7360342|Roland Mathias]]''
|
| 1915-09-04
| 2007-08-16
| ''[[:d:Q7680426|Tal-y-bont on Usk]]''
|-
| style='text-align:right'| 4932
| ''[[:d:Q7360675|Roley Williams]]''
|
| 1927-07-10
| 1999-06-30
| [[Swansea]]
|-
| style='text-align:right'| 4933
| ''[[:d:Q7363525|Ron Berry]]''
|
| 1920-02-23
| 1997-07-16
| ''[[:d:Q4923806|Blaencwm]]''
|-
| style='text-align:right'| 4934
| ''[[:d:Q7363679|Ron Davies]]''
|
| 1932-09-21
| 2007-12
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 4935
| ''[[:d:Q7363680|Ron Davies]]''
| [[File:Ron davies thumbnail.jpg|center|128px]]
| 1921-12-17
| 2013-10-26
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 4936
| ''[[:d:Q7363838|Ron Gostick]]''
|
| 1918-07-18
| 2005-07-16
| [[Wales]]
|-
| style='text-align:right'| 4937
| ''[[:d:Q7363946|Ron Howells]]''
|
| 1927-01-12
| 2011-12-29
| ''[[:d:Q7227990|Pont Henri]]''
|-
| style='text-align:right'| 4938
| ''[[:d:Q7363949|Ron Hughes]]''
|
| 1930-07-01
| 2019-07-30
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 4939
| ''[[:d:Q7363996|Ronald Jones]]''
|
| 1934-08-19<br/>1934
| 2021-12-30
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 4940
| ''[[:d:Q7364275|Ron Powell]]''
|
| 1929-12-02
| 1992-05-25
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 4941
| ''[[:d:Q7364322|Ron Roberts]]''
|
| 1942-09-14
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 4942
| ''[[:d:Q7364652|Ronald Atkins]]''
|
| 1916-06-13
| 2020-12-30
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4943
| ''[[:d:Q7364676|Ronald Bell]]''
|
| 1914-04-14
| 1982-02-27
| [[Cairdiff]]
|-
| style='text-align:right'| 4944
| ''[[:d:Q7364707|Ronald Burge]]''
|
| 1932-10-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4945
| ''[[:d:Q7364729|Ronald Cass]]''
|
| 1923-04-21
| 2006-06-02
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4946
| ''[[:d:Q7364983|Ronald James]]''
|
| 1938-02-05
|
| [[Wales]]
|-
| style='text-align:right'| 4947
| ''[[:d:Q7365011|Ronald Karslake Starr Wood]]''
|
| 1919-04-08
| 2017-04-26
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 4948
| ''[[:d:Q7365062|Ronald Lewis]]''
|
| 1928-12-11
| 1982-01-11
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 4949
| ''[[:d:Q7365384|Ronald Waterhouse]]''
|
| 1926-05-08
| 2011-05-08
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 4950
| ''[[:d:Q7365803|Ronnie Boon]]''
|
| 1909-06-11
| 1998-08-03
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4951
| ''[[:d:Q7365892|Ronnie James]]''
|
| 1917-10-08
| 1977-06-12
| [[Swansea]]
|-
| style='text-align:right'| 4952
| ''[[:d:Q7365964|Ronnie Rees]]''
|
| 1944-04-04
| 2023-10
| [[Ystradgynlais]]
|-
| style='text-align:right'| 4953
| ''[[:d:Q7366940|Rory Pitman]]''
|
| 1989-10-06
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4954
| ''[[:d:Q7366962|Rory Watts-Jones]]''
|
| 1988-12-15<br/>1988-12
|
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 4955
| ''[[:d:Q7368892|Rosie Harris]]''
|
| 1925-07-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4956
| ''[[:d:Q7368928|Rosie Thomas]]''
|
| 1947
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 4957
| ''[[:d:Q7369277|Ross Davies]]''
|
| 1984-03-25
|
| ''[[:d:Q17317956|Trinant]]''
|-
| style='text-align:right'| 4958
| ''[[:d:Q7369288|Ross Divorty]]''
|
| 1988-11-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4959
| ''[[:d:Q7369430|Ross Jamison]]''
| [[File:Ross Jamison.jpg|center|128px]]
| 1990-03-19
|
| [[Wales]]
|-
| style='text-align:right'| 4960
| ''[[:d:Q7369438|Ross Johnson]]''
|
| 1986-03-26
|
| [[Wales]]
|-
| style='text-align:right'| 4961
| ''[[:d:Q7369441|Ross Jones]]''
|
| 1992-01-11
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4962
| ''[[:d:Q7369602|Ross Reid]]''
|
| 1987-08-21
|
| ''[[:d:Q6661600|Llanharry]]''
|-
| style='text-align:right'| 4963
| ''[[:d:Q7369697|Ross Wardle]]''
|
| 1991-04-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4964
| ''[[:d:Q7369797|Rosser Evans]]''
|
| 1867-10-06
|
| ''[[:d:Q5197228|Cwmbach]]''
|-
| style='text-align:right'| 4965
| ''[[:d:Q7371713|Rovi]]''
|
| 1919-11-29
| 1996-06-08
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 4966
| ''[[:d:Q7372121|Rowland Ellis]]''
|
| 1841-04-24
| 1911-12-11
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 4967
| ''[[:d:Q7372122|Rowland Ellis]]''
|
| 1650
| 1731-09
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 4968
| ''[[:d:Q7372152|Rowland Jones]]''
|
| 1722
| 1774
| ''[[:d:Q1002782|Llannor]]''
|-
| style='text-align:right'| 4969
| ''[[:d:Q7372156|Rowland Laugharne]]''
| [[File:Portrait of Coll. Langhorne (4673350) (cropped).jpg|center|128px]]
| 1607
| 1675-11
| ''[[:d:Q7592714|St Brides]]''
|-
| style='text-align:right'| 4970
| ''[[:d:Q7372175|Rowland Phillips]]''
|
| 1965-07-28
|
| [[St Davids]]
|-
| style='text-align:right'| 4971
| ''[[:d:Q7372176|Rowland Prichard]]''
| [[File:Portrait of Mr. Pritchard (4670459).jpg|center|128px]]
| 1812-01-15
| 1887-01-25
| ''[[:d:Q13129650|Llangywer]]''
|-
| style='text-align:right'| 4972
| ''[[:d:Q7372196|Rowland Vaughan]]''
| [[File:Caer Gai, Llanuwchllyn, Plasty o'r 17g y tu fewn i gaer Rhufeinig; a grade II* important mid C17 gentry house withing a Roman fort (Caer Gai); Eryri National Park 10.jpg|center|128px]]
| 1590
| 1667-09-18
| ''[[:d:Q123060428|Caer Gai]]''
|-
| style='text-align:right'| 4973
| ''[[:d:Q7372204|Rowland Williams]]''
|
| 1779-03-27
| 1854-12-28
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 4974
| ''[[:d:Q7372206|Rowland Williams]]''
| [[File:Revd Rowland Williams (Hwfa Mon, 1823-1905) NLW3361827 (cropped).jpg|center|128px]]
| 1823-03
| 1905-11-10
| ''[[:d:Q7837762|Trefdraeth]]''
|-
| style='text-align:right'| 4975
| ''[[:d:Q7372572|Roy Bergiers]]''
|
| 1950-11-11
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 4976
| ''[[:d:Q7372734|Roy Davies]]''
|
| 1928-08-12
| 2013-07-14
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 4977
| ''[[:d:Q7372783|Roy Evans]]''
|
| 1943-07-05
| 1969-01-20
| [[Swansea]]
|-
| style='text-align:right'| 4978
| ''[[:d:Q7372819|Roy Francis]]''
|
| 1919
| 1989-04
| [[Cairdiff]]
|-
| style='text-align:right'| 4979
| ''[[:d:Q7372899|Roy Harris]]''
|
| 1902-08-01
| 1973-08-18
| [[Cairdiff]]
|-
| style='text-align:right'| 4980
| ''[[:d:Q7373003|Roy John]]''
|
| 1911-01-29
| 1973-07-12
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 4981
| ''[[:d:Q7373056|Roy Lambert]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 4982
| ''[[:d:Q7373216|Roy Noble]]''
| [[File:RoyNobleAberdareBlog.jpg|center|128px]]
| 1942-11
|
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 4983
| ''[[:d:Q7375253|Royston Evans]]''
|
| 1939-02-09
|
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 4984
| ''[[:d:Q7377413|Rudolph Feilding, 9th Earl of Denbigh]]''
| [[File:Earl of Denbigh Vanity Fair 23 August 1894.JPG|center|128px]]
| 1859-05-26
| 1939-11-25
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 4985
| ''[[:d:Q7380331|Rupert Morris]]''
|
| 1843-03-16
| 1918-01-02
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 4986
| ''[[:d:Q7381435|Russell Coughlin]]''
|
| 1960-02-15
| 2016-08-03
| [[Swansea]]
|-
| style='text-align:right'| 4987
| ''[[:d:Q7381514|Russell George]]''
| [[File:Russell George.jpg|center|128px]]
| 1974
|
| [[Welshpool]]
|-
| style='text-align:right'| 4988
| ''[[:d:Q7381526|Russell Goodway]]''
|
| 1955-12-23
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 4989
| ''[[:d:Q7381608|Russell Jones]]''
|
| 1978
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 4990
| ''[[:d:Q7381697|Russell Morris]]''
| [[File:Professor Russell Morris FRS.jpg|center|128px]]
| 1967-06-08
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 4991
| ''[[:d:Q7381750|Russell Robins]]''
|
| 1932-02-21
| 2019-09-27
| [[Pontypridd]]
|-
| style='text-align:right'| 4992
| ''[[:d:Q7381817|Russell Taylor]]''
|
| 1914-12-02
| 1965-10-09
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 4993
| ''[[:d:Q7382906|Ruth Bidgood]]''
|
| 1922-07-20
| 2022-03-04
| ''[[:d:Q7457421|Blaendulais]]''
|-
| style='text-align:right'| 4994
| ''[[:d:Q7383015|Ruth Goodman]]''
|
| 1963-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4995
| ''[[:d:Q7383058|Ruth Jones]]''
| [[File:Ruth Jones Little Britain Gavin and Stacey.jpg|center|128px]]
| 1966-09-22
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 4996
| ''[[:d:Q7383062|Ruth Jên]]''
|
| 1964-10-07
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 4997
| ''[[:d:Q7384008|Ryan Davies]]''
| [[File:Ffrindiau Ryan, album cover.jpg|center|128px]]
| 1937-01-22
| 1977-04-22
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 4998
| ''[[:d:Q7384100|Ryan Green]]''
|
| 1980-10-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 4999
| ''[[:d:Q7384121|Ryan Harford]]''
|
| 1982-09-24
|
| ''[[:d:Q7838183|Tremorfa]]''
|-
| style='text-align:right'| 5000
| ''[[:d:Q7384374|Ryan Nicholls]]''
|
| 1973-05-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5001
| ''[[:d:Q7384446|Ryan Prosser]]''
|
| 1988-07-10
|
| [[Wales]]
|-
| style='text-align:right'| 5002
| ''[[:d:Q7384568|Ryan Sylvester]]''
|
| 1975-04-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5003
| ''[[:d:Q7384624|Ryan Watkins]]''
|
| 1983-06-09
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5004
| ''[[:d:Q7385154|Ryland Davies]]''
|
| 1943-02-09
| 2023-11-05
| ''[[:d:Q5197175|Cwm]]''
|-
| style='text-align:right'| 5005
| ''[[:d:Q7387186|S.G. Courteen]]''
|
| 1864-06-17
| 1945-11-25
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 5006
| ''[[:d:Q7387421|Stephen Dewar Holden]]''
|
| 1870-08-23
| 1918-07-07
| ''[[:d:Q2304575|Saltney]]''
|-
| style='text-align:right'| 5007
| ''[[:d:Q7387725|S. O. Davies]]''
| [[File:S.O. Davies portrait 1490010.jpg|center|128px]]
| 1886-11-09
| 1972-02-25
| ''[[:d:Q4666838|Abercwmboi]]''
|-
| style='text-align:right'| 5008
| ''[[:d:Q7401077|Saint Caradoc]]''
|
|
| 1124
| [[Wales]]
|-
| style='text-align:right'| 5009
| ''[[:d:Q7401174|Derfel]]''
|
| 566
| 660-04-06
| [[Wales]]
|-
| style='text-align:right'| 5010
| ''[[:d:Q7401197|Saint Eigen]]''
| [[File:St Eigon, Llanigon - geograph.org.uk - 714248.jpg|center|128px]]
|
| 1st century
| ''[[:d:Q2573736|Northop]]''
|-
| style='text-align:right'| 5011
| ''[[:d:Q7401235|Saint Flewyn]]''
| [[File:Eglwys St Fflewin Church, Llanfflewin, Mynydd Mechell.jpg|center|128px]]
|
|
| [[Gwynedd]]
|-
| style='text-align:right'| 5012
| ''[[:d:Q7401288|Saint Gelert]]''
|
| 7th century
|
| [[Wales]]
|-
| style='text-align:right'| 5013
| ''[[:d:Q7405039|Sally Amis]]''
|
| 1954-01-17<br/>1954-01
| 2000-11-08<br/>2000
| ''[[:d:Q7898360|Uplands]]''
|-
| style='text-align:right'| 5014
| ''[[:d:Q7407397|Sam Davies]]''
|
| 1992-01-30
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5015
| ''[[:d:Q7407398|Sam Davies]]''
|
| 1993-10-06
|
| [[Swansea]]
|-
| style='text-align:right'| 5016
| ''[[:d:Q7407611|Sam Hobbs]]''
|
| 1988-05-13
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5017
| ''[[:d:Q7407791|Sam Lewis]]''
| [[File:ST vs Ospreys 08-12-120025.JPG|center|128px]]
| 1990-09-07
|
| [[Swansea]]
|-
| style='text-align:right'| 5018
| ''[[:d:Q7407801|Sam Livesey]]''
|
| 1873-10-14
| 1936-11-07
| [[Flintshire]]
|-
| style='text-align:right'| 5019
| ''[[:d:Q7407834|Sam Mainwaring]]''
|
| 1841-12-15
| 1907-09-29
| ''[[:d:Q107032804|Penrhiwtyn]]''
|-
| style='text-align:right'| 5020
| ''[[:d:Q7408004|Sam Parry]]''
|
| 1991-12-17
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5021
| ''[[:d:Q7408265|Sam Turner]]''
|
| 1980-09-09
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5022
| ''[[:d:Q7408625|Samantha Bowen]]''
|
| 1986-03-21
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 5023
| ''[[:d:Q7410381|Samson Lee]]''
|
| 1992-11-30
|
| [[Swansea]]
|-
| style='text-align:right'| 5024
| ''[[:d:Q7410805|Samuel Augustus Perry]]''
|
| 1787-03-14
| 1854-01-15
| [[Wales]]
|-
| style='text-align:right'| 5025
| ''[[:d:Q7411260|Samuel Devons]]''
|
| 1914-09-30
| 2006-12-06
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5026
| ''[[:d:Q7411541|Samuel Griffith]]''
| [[File:SamuelGriffithPA.jpg|center|128px]]
| 1816-02-14
| 1893-10-01
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5027
| ''[[:d:Q7411771|Samuel Ifor Enoch]]''
| [[File:Sienoch.jpg|center|128px]]
| 1914-12-26
| 2001-06-10
| ''[[:d:Q5119956|Ciliau Aeron]]''
|-
| style='text-align:right'| 5028
| ''[[:d:Q7411824|Samuel Jagger]]''
| [[File:Samuel Jagger (1).jpg|center|128px]]
| 1904-06-30
| 1964-05-30
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 5029
| ''[[:d:Q7411872|Samuel Jones]]''
|
| 1628
| 1697-09<br/>1697
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 5030
| ''[[:d:Q7412071|Samuel M. Jones]]''
| [[File:Samuel M Jones.png|center|128px]]
| 1846-08-03
| 1904-07-12
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 5031
| ''[[:d:Q7412239|Samuel Moss]]''
|
| 1858-12-13
| 1918-05-14
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 5032
| ''[[:d:Q7412373|Samuel Pearse]]''
| [[File:Samuel Pearse VC (AWM H06653).jpg|center|128px]]
| 1897-07-16
| 1919-08-29
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 5033
| ''[[:d:Q7412490|Samuel Roberts]]''
| [[File:Revd Samuel Roberts (SR, 1800-85) NLW3361790.jpg|center|128px]]
| 1800-03-06
| 1885-09-24
| [[Powys]]
|-
| style='text-align:right'| 5034
| ''[[:d:Q7412628|Samuel Silkin, Baron Silkin of Dulwich]]''
|
| 1918-03-06
| 1988-08-17
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5035
| ''[[:d:Q7412772|Samuel Evans]]''
| [[File:The Times history of the war (1914) (14577874670).jpg|center|128px]]
| 1859-05-04
| 1918-09-13
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 5036
| ''[[:d:Q7412884|Samuel Warren]]''
| [[File:Samuel Warren by John Linnell.jpg|center|128px]]
| 1807-05-23
| 1877-07-29
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5037
| ''[[:d:Q7417378|Sandy Mewies]]''
| [[File:Sandy Mewies.jpg|center|128px]]
| 1950-02-19
|
| ''[[:d:Q4980803|Brymbo]]''
|-
| style='text-align:right'| 5038
| ''[[:d:Q7417391|Sandy Orford]]''
|
| 1911-12-05
| 1986
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5039
| ''[[:d:Q7421612|Sara Edwards]]''
| [[File:Sara Edwards.jpg|center|128px]]
| 1960
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5040
| ''[[:d:Q7421643|Sara Gregory]]''
|
| 1986-08-19
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 5041
| ''[[:d:Q7421653|Sara Head]]''
| [[File:Sara Head (GBR) (6925416825).jpg|center|128px]]
| 1980-04-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5042
| ''[[:d:Q7422270|Sarah Edith Wynne]]''
| [[File:Edith Wynne.jpg|center|128px]]
| 1842-03-11
| 1897-01-24
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 5043
| ''[[:d:Q7422514|Sarah Lark]]''
|
| 1983-01-28
|
| ''[[:d:Q7339915|Rhath]]''
|-
| style='text-align:right'| 5044
| ''[[:d:Q7427449|Saunders Davies]]''
|
| 1937-12-30
| 2018-03-30
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 5045
| ''[[:d:Q7428669|Sawnder Sion]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5046
| ''[[:d:Q7435895|Scott Andrews]]''
|
| 1989-08-01
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 5047
| ''[[:d:Q7435941|Scott Baldwin]]''
| [[File:ST vs Ospreys 08-12-120012.JPG|center|128px]]
| 1988-07-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5048
| ''[[:d:Q7436380|Scott Gammer]]''
|
| 1976-10-24
|
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 5049
| ''[[:d:Q7437554|Scott Young]]''
| [[File:Scott Young.jpg|center|128px]]
| 1976-01-14
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 5050
| ''[[:d:Q7440197|Seaborne Davies]]''
|
| 1904-06-26
| 1984-10-26
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 5051
| ''[[:d:Q7441218|Sean McCarthy]]''
|
| 1967-09-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5052
| ''[[:d:Q7441234|Sean McGoldrick]]''
|
| 1991-12-03
|
| [[Newport]]
|-
| style='text-align:right'| 5053
| ''[[:d:Q7441342|Sean Palfrey]]''
|
| 1968-07-24
|
| [[Wales]]
|-
| style='text-align:right'| 5054
| ''[[:d:Q7441351|Sean Parrish]]''
|
| 1972-03-14
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5055
| ''[[:d:Q7448922|Selwyn Griffith]]''
|
| 1928
| 2011-08-10
| ''[[:d:Q3402550|Bethel]]''
|-
| style='text-align:right'| 5056
| ''[[:d:Q7456519|Seth Joshua]]''
|
| 1858-04-10
| 1925-05-21
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5057
| ''[[:d:Q7459132|Seymour Berry, 1st Baron Buckland]]''
| [[File:Baron Buckland by Goscombe John in Merthyr Tydfil.jpg|center|128px]]
| 1877-09-17
| 1928-05-23
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5058
| ''[[:d:Q7459191|Seymour J. Farmer]]''
|
| 1878-06-20
| 1951-01-16
| [[Cairdiff]]
|-
| style='text-align:right'| 5059
| ''[[:d:Q7459206|Seymour Morris]]''
|
| 1913-02-15
| 1991-10
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 5060
| ''[[:d:Q7459474|Seán Burke]]''
|
| 1961-03-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5061
| ''[[:d:Q7460864|Shadrach Pryce]]''
|
| 1833
| 1914
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 5062
| ''[[:d:Q7488043|Shane Dix]]''
|
| 1960
|
| [[Wales]]
|-
| style='text-align:right'| 5063
| ''[[:d:Q7489879|Sharla Passariello]]''
|
| 1992-01-14
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5064
| ''[[:d:Q7490161|Sharon Morgan]]''
|
| 1949-08-29
|
| ''[[:d:Q6661270|Llandyfaelog]]''
|-
| style='text-align:right'| 5065
| ''[[:d:Q7490820|Shaun Connor]]''
|
| 1975-11-20
|
| ''[[:d:Q7131674|Panteg]]''
|-
| style='text-align:right'| 5066
| ''[[:d:Q7490884|Shaun Hopkins]]''
|
| 1985-02-23
|
| ''[[:d:Q5190499|Crynant]]''
|-
| style='text-align:right'| 5067
| ''[[:d:Q7493819|Shelley Rees]]''
|
| 1974
|
| [[Wales]]
|-
| style='text-align:right'| 5068
| ''[[:d:Q7500411|Shoni Jones]]''
| [[File:Shoni (William John) Jones.jpg|center|128px]]
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 5069
| ''[[:d:Q7500413|Shoni Sguborfawr]]''
|
| 1811
| 1858
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5070
| ''[[:d:Q7506042|Shân Cothi]]''
| [[File:ShânCothi.jpg|center|128px]]
| 1965-10-25
|
| ''[[:d:Q5446199|Ffarmers]]''
|-
| style='text-align:right'| 5071
| ''[[:d:Q7506792|Sian Lloyd]]''
| [[File:Siân Lloyd (news presenter).JPG|center|128px]]
| 1972-06-07
|
| [[Wales]]
|-
| style='text-align:right'| 5072
| ''[[:d:Q7506799|Sian Reese-Williams]]''
|
| 1981-11-18
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 5073
| ''[[:d:Q7507823|Sid Judd]]''
|
| 1928-08-14
| 1959-02-24
| [[Cairdiff]]
|-
| style='text-align:right'| 5074
| ''[[:d:Q7509163|Sidney Jerram]]''
|
| 1891
| 1959
| [[Swansea]]
|-
| style='text-align:right'| 5075
| ''[[:d:Q7509422|Sidney Wilcox]]''
|
| 1893-02-28
| 1973-10-21
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 5076
| ''[[:d:Q7515728|Silvanus Bevan]]''
|
| 1691
| 1765
| [[Swansea]]
|-
| style='text-align:right'| 5077
| ''[[:d:Q7517201|R. Silyn Roberts]]''
| [[File:Silyn 01.JPG|center|128px]]
| 1871-03-28
| 1930-08-13
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 5078
| ''[[:d:Q7518575|Simon Davey]]''
|
| 1970-10-01
|
| [[Swansea]]
|-
| style='text-align:right'| 5079
| ''[[:d:Q7518708|Simon Evans]]''
|
| 1895-08-10
| 1940-08-09
| [[Wales]]
|-
| style='text-align:right'| 5080
| ''[[:d:Q7518821|Simon Gardiner]]''
|
| 1990-10-02
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5081
| ''[[:d:Q7518929|Simon Haworth]]''
|
| 1977-03-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5082
| ''[[:d:Q7519069|Simon Jones]]''
| [[File:Simon Jones.jpg|center|128px]]
| 1978-12-25
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 5083
| ''[[:d:Q7519190|Simon Lee Evans]]''
|
| 1975-10-13
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5084
| ''[[:d:Q7519203|Simon Lewis]]''
|
| 1971
|
| [[Newport]]
|-
| style='text-align:right'| 5085
| ''[[:d:Q7519221|Simon Lloyd]]''
| [[File:Y Parch Simon Lloyd.jpg|center|128px]]
| 1756
| 1836-11-06
| ''[[:d:Q29502896|Plas-yn-Dre]]''
|-
| style='text-align:right'| 5086
| ''[[:d:Q7519575|Simon Price]]''
|
| 1967-09-25
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 5087
| ''[[:d:Q7519973|Simon Wallace]]''
|
| 1957
|
| [[Newport]]
|-
| style='text-align:right'| 5088
| ''[[:d:Q7525296|Siobhan Flynn]]''
| [[File:Siobhan Flynn.jpg|center|128px]]
| 1970-08-15
|
| [[Wales]]
|-
| style='text-align:right'| 5089
| ''[[:d:Q7525303|Siobhán Owen]]''
|
| 1993-10-04
|
| [[Llanfairpwllgwyngyll]]
|-
| style='text-align:right'| 5090
| ''[[:d:Q7525362|Sion Morris]]''
|
| 1977-09-06
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5091
| ''[[:d:Q7525365|Sion Russell Jones]]''
|
| 1986
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5092
| ''[[:d:Q7526403|Sir David Llewellyn, 1st Baronet]]''
|
| 1879-03-09
| 1940-12-15
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5093
| ''[[:d:Q7526659|Sir Evan Davies Jones, 1st Baronet]]''
|
| 1859-04-18
| 1949-04-20
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 5094
| ''[[:d:Q7526702|Sir Francis Edwards, 1st Baronet]]''
| [[File:1906 Francis Edwards MP.jpg|center|128px]]
| 1852-04-28
| 1927-05-10
| ''[[:d:Q319536|Aberdyfi]]''
|-
| style='text-align:right'| 5095
| ''[[:d:Q7526707|Sir Francis Geary, 1st Baronet]]''
| [[File:British School - Admiral Sir Francis Geary (1709-1710–1796) - BHC2706 - Royal Museums Greenwich.jpg|center|128px]]
| 1709
| 1796-02-07
| [[Ceredigion]]
|-
| style='text-align:right'| 5096
| ''[[:d:Q7527724|Sir John Dillwyn-Llewelyn, 1st Baronet]]''
| [[File:John Dillwyn-Llewelyn Vanity Fair 11 October 1900.jpg|center|128px]]
| 1836-05-26
| 1927-07-06
| [[Swansea]]
|-
| style='text-align:right'| 5097
| ''[[:d:Q7527751|Sir John Edwards, 1st Baronet, of Garth]]''
|
| 1770-01-15
| 1850-04-15
| ''[[:d:Q7201716|Plas Machynlleth]]''
|-
| style='text-align:right'| 5098
| ''[[:d:Q7527969|John Nicholl]]''
| [[File:John Nicholl Owen.jpg|center|128px]]
| 1759-03-16
| 1838-08-26
| ''[[:d:Q13644937|Llanmaes]]''
|-
| style='text-align:right'| 5099
| ''[[:d:Q7527984|Sir John Owen, 1st Baronet]]''
| [[File:Sir John Owen 1776 to 1861.jpg|center|128px]]
| 1776
| 1861-02-06
| [[Wales]]
|-
| style='text-align:right'| 5100
| ''[[:d:Q7528143|Sir John Williams, 1st Baronet, of the City of London]]''
| [[File:Sir John Williams, 1st Baronet.jpg|center|128px]]
| 1840-11-06
| 1926-05-24
| ''[[:d:Q13128899|Gwynfe]]''
|-
| style='text-align:right'| 5101
| ''[[:d:Q7528163|Sir John Wynn, 5th Baronet]]''
| [[File:John Wynn, 5th Bt, by English School of the 18th Century.jpg|center|128px]]
| 1628
| 1719<br/>1718-01-07
| [[Wales]]
|-
| style='text-align:right'| 5102
| ''[[:d:Q7528532|Sir Rhys Llewellyn, 2nd Baronet]]''
|
| 1910-03-09
| 1978-04-25
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5103
| ''[[:d:Q7528861|Robert Williames Vaughan]]''
| [[File:Portrait of Sir Robert Williames Vaughan, Bart. M.P. for the County of Merioneth (4674639) (cropped).jpg|center|128px]]
| 1768-03-29
| 1843-04-23
| ''[[:d:Q20600573|Hengwrt]]''
|-
| style='text-align:right'| 5104
| ''[[:d:Q7528986|Sir Stephen Glynne, 9th Baronet]]''
| [[File:Sir Stephen Glynne 01.jpeg|center|128px]]
| 1807-09-22
| 1874-06-17
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 5105
| ''[[:d:Q7529216|Sir Thomas Morgan, 1st Baronet]]''
| [[File:Major-General Sir Thomas Morgan 1604-1679.png|center|128px]]
| 1604<br/>1606
| 1679-04-13<br/>1679
| ''[[:d:Q6661439|Llangattock Lingoed]]''
|-
| style='text-align:right'| 5106
| ''[[:d:Q7529259|Sir Thomas Salusbury, 2nd Baronet]]''
| [[File:Sir Thomas Salusbury and Family.jpg|center|128px]]
| 1612-03<br/>1612
| 1643
| ''[[:d:Q6662131|Lleweni Hall]]''
|-
| style='text-align:right'| 5107
| ''[[:d:Q7529393|Sir Walter Morgan, 1st Baronet]]''
| [[File:Syr Walter Vaughan Morgan.jpg|center|128px]]
| 1831-05-03
| 1916-11-12
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5108
| ''[[:d:Q7529416|Sir Watkin Williams-Wynn, 10th Baronet]]''
|
| 1904-11-30
| 1988-05-13<br/>1988
| [[Wales]]
|-
| style='text-align:right'| 5109
| ''[[:d:Q7529423|Sir Watkin Williams-Wynn, 11th Baronet]]''
|
| 1940-02-18
|
| [[Wales]]
|-
| style='text-align:right'| 5110
| ''[[:d:Q7529424|Sir Watkin Williams-Wynn, 5th Baronet]]''
| [[File:John Jackson (1778–1831) (by or after) - Sir Watkin Williams Wynn (1772–1840), 5th Bt - PCF200 - Denbighshire Heritage Service Store.jpg|center|128px]]
| 1772-10-25
| 1840-01-06
| [[Wales]]
|-
| style='text-align:right'| 5111
| ''[[:d:Q7529427|Sir Watkin Williams-Wynn, 9th Baronet]]''
|
| 1862-06-03
| 1951-11-23
| [[Wales]]
|-
| style='text-align:right'| 5112
| ''[[:d:Q7529640|Sir William James, 1st Baronet]]''
| [[File:Sir William James.jpg|center|128px]]
| 1720
| 1783-12-16
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 5113
| ''[[:d:Q7529825|Sir William Williams, 1st Baronet, of Gray's Inn]]''
| [[File:Portrait of Sir William Williams Bart (4672199) (cropped).jpg|center|128px]]
| 1634
| 1700-07-11
| [[Anglesey]]
|-
| style='text-align:right'| 5114
| ''[[:d:Q7530227|Siri Neal]]''
|
| 1972-08-14
|
| [[Wales]]
|-
| style='text-align:right'| 5115
| ''[[:d:Q7532512|Siw Hughes]]''
| [[File:SiwHughes.jpg|center|128px]]
| 1958-01-16
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5116
| ''[[:d:Q7533472|Siân James]]''
|
| 1930-09-20
| 2021-07-21
| ''[[:d:Q15987290|Coed-y-bryn]]''
|-
| style='text-align:right'| 5117
| ''[[:d:Q7533474|Siân Lloyd]]''
| [[File:Siân Lloyd (weather presenter).jpg|center|128px]]
| 1958-07-03
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 5118
| ''[[:d:Q7533490|Siôn Cent]]''
| [[File:Ceinion Llenyddiaeth Cymreig Cyf I (Siôn Cent).jpg|center|128px]]
| 1367
| 1430
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 5119
| ''[[:d:Q7562994|Sophie Evans]]''
| [[File:Sophie Evans 2013 (10005216415).jpg|center|128px]]
| 1993-02-13
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 5120
| ''[[:d:Q7563011|Sophie Ingle]]''
| [[File:20150922 1827 W AUT WAL 3986.jpg|center|128px]]
| 1991-09-02
|
| ''[[:d:Q6661223|Llandochau Fach]]''
|-
| style='text-align:right'| 5121
| ''[[:d:Q7563068|Sophie Stanton]]''
|
| 1971
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5122
| ''[[:d:Q7576045|Spencer Evans]]''
|
| 1911-09-24
| 1981
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5123
| ''[[:d:Q7576189|Spencer Summers]]''
| [[File:Sir Spencer Summers.jpg|center|128px]]
| 1902-10-27
| 1976-01-19
| ''[[:d:Q684016|Flintshire]]''
|-
| style='text-align:right'| 5124
| ''[[:d:Q7576224|Spencer Wilding]]''
| [[File:Spencer Wilding at the Pan Premiere.jpg|center|128px]]
| 1972-07-26
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5125
| ''[[:d:Q7596554|Staff Jones]]''
|
| 1959-01-04
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 5126
| ''[[:d:Q7597536|Stan Awbery]]''
|
| 1888-07-19
| 1969-05-07
| [[Swansea]]
|-
| style='text-align:right'| 5127
| ''[[:d:Q7597565|Stan Bowsher]]''
|
| 1899-10-03
| 1968
| [[Newport]]
|-
| style='text-align:right'| 5128
| ''[[:d:Q7597610|Stan Davies]]''
|
| 1898-04-24
| 1972-01-17
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 5129
| ''[[:d:Q7597761|Stan Leonard]]''
|
| 1924-10-08
| 1995-08-01
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 5130
| ''[[:d:Q7597805|Stan Morgan]]''
|
| 1920-10-10
| 1971
| ''[[:d:Q4667111|Abergwynfi]]''
|-
| style='text-align:right'| 5131
| ''[[:d:Q7597821|Stan Owen]]''
|
| 1932-03-07<br/>1929-03-07
| 2019-09-12
| [[Pontypridd]]
|-
| style='text-align:right'| 5132
| ''[[:d:Q7597848|Stan Richards]]''
|
| 1917-01-21
| 1987-04-19
| [[Cairdiff]]
|-
| style='text-align:right'| 5133
| ''[[:d:Q7597866|Stan Rowlands]]''
| [[File:Stan Rowlands.jpg|center|128px]]
| 1889-11-12
|
| ''[[:d:Q13125767|Bausley with Criggion]]''
|-
| style='text-align:right'| 5134
| ''[[:d:Q7597900|Stan Stennett]]''
| [[File:Stan Stennett.jpg|center|128px]]
| 1925-07-30
| 2013-11-26
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 5135
| ''[[:d:Q7599810|Stanley Mountain]]''
|
| 1909
|
| [[Newport]]
|-
| style='text-align:right'| 5136
| ''[[:d:Q7599882|Stanley Powell]]''
|
| 1916-07-19
| 1995-01-03
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 5137
| ''[[:d:Q7600045|Stanley Williams]]''
| [[File:Stanley Williams (rugby union).png|center|128px]]
| 1886-11-02
| 1936-04-30
| ''[[:d:Q7359368|Rogerstone]]''
|-
| style='text-align:right'| 5138
| ''[[:d:Q7600051|Stanley Winmill]]''
|
| 1889-05-05
| 1940-06-25
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 5139
| ''[[:d:Q7606146|Stefan Jenkins]]''
|
| 1974-04-17
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5140
| ''[[:d:Q7606231|Stefan Pejic]]''
|
| 1988-06-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5141
| ''[[:d:Q7606592|Steffan Cook]]''
|
| 1989-12-20
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5142
| ''[[:d:Q7606593|Steffan Cravos]]''
|
| 1975
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5143
| ''[[:d:Q7606597|Steffan Jones]]''
|
| 1990-11-22
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 5144
| ''[[:d:Q7606598|Steffan Jones]]''
|
| 1974-02-09
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5145
| ''[[:d:Q7606601|Steffan Rhodri]]''
|
| 1967-03-01
|
| [[Swansea]]
|-
| style='text-align:right'| 5146
| ''[[:d:Q7608097|Steph Davies]]''
| [[File:Steph davies 1.jpg|center|128px]]
| 1987-10-21
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5147
| ''[[:d:Q7608105|Steph Reynolds]]''
|
| 1993-10-23
|
| [[Newport]]
|-
| style='text-align:right'| 5148
| ''[[:d:Q7609085|Stephen Doughty]]''
| [[File:Official portrait of Stephen Doughty MP crop 2.jpg|center|128px]]
| 1980-04-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5149
| ''[[:d:Q7609157|Stephen Evans]]''
|
| 1970-11-27
|
| ''[[:d:Q1067984|Clwyd]]''
|-
| style='text-align:right'| 5150
| ''[[:d:Q7609158|Stephen Evans]]''
|
| 1980-09-25
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 5151
| ''[[:d:Q7609455|Stephen Healey]]''
|
| 1982-09-19
| 2012-05-26
| [[Cairdiff]]
|-
| style='text-align:right'| 5152
| ''[[:d:Q7609929|Stephen Maybery]]''
|
| 1949
| 2020-02
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 5153
| ''[[:d:Q7610382|Stephen Roberts]]''
|
| 1980-02-24
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5154
| ''[[:d:Q7610673|Stephen Thomas]]''
|
| 1865-08-22
| 1937-10-23
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 5155
| ''[[:d:Q7610762|Stephen Volk]]''
|
| 1954-07-03
|
| [[Pontypridd]]
|-
| style='text-align:right'| 5156
| ''[[:d:Q7611777|Steve Alker]]''
|
| 1964-02-14
|
| [[Wales]]
|-
| style='text-align:right'| 5157
| ''[[:d:Q7611798|Steve Andrews]]''
| [[File:Steve Andrews, promotional image.jpg|center|128px]]
| 1950
|
| ''[[:d:Q5033865|Canton]]''
|-
| style='text-align:right'| 5158
| ''[[:d:Q7611858|Steve Balsamo]]''
|
| 1971-05-19
|
| [[Swansea]]
|-
| style='text-align:right'| 5159
| ''[[:d:Q7611877|Steve Barry]]''
|
| 1950-10-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5160
| ''[[:d:Q7611884|Steve Barwick]]''
|
| 1960-09-06
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5161
| ''[[:d:Q7611899|Steve Bayliss]]''
|
| 1960-07-07
|
| [[Ystradgynlais]]
|-
| style='text-align:right'| 5162
| ''[[:d:Q7612324|Steve Curtis]]''
|
| 1948-12-26
| 1994-10-28
| [[Cairdiff]]
|-
| style='text-align:right'| 5163
| ''[[:d:Q7612376|Steve Derrett]]''
|
| 1947-10-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5164
| ''[[:d:Q7612423|Steve Doyle]]''
|
| 1958-06-02
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5165
| ''[[:d:Q7612487|Steve Emery]]''
|
| 1956-02-07
|
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 5166
| ''[[:d:Q7612568|Steve Ford]]''
|
| 1965-08-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5167
| ''[[:d:Q7613188|Steve Lovell]]''
|
| 1960-07-16
|
| [[Swansea]]
|-
| style='text-align:right'| 5168
| ''[[:d:Q7613191|Steve Lowndes]]''
|
| 1960-06-17
|
| [[Newport]]
|-
| style='text-align:right'| 5169
| ''[[:d:Q7613422|Steve Morris]]''
| [[File:Steve Morris -Tom Parker 1922.jpg|center|128px]]
| 1896-09-01
| 1965-05-29<br/>1964-09-02
| [[Newport]]
|-
| style='text-align:right'| 5170
| ''[[:d:Q7613494|Steve O'Shaughnessy]]''
|
| 1967-10-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5171
| ''[[:d:Q7613555|Steve Parry]]''
|
| 1988-10-19
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5172
| ''[[:d:Q7613556|Steve Parry]]''
|
| 1958-09-04
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5173
| ''[[:d:Q7613567|Steve Paulding]]''
|
| 1961-10-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5174
| ''[[:d:Q7613700|Steve Ray]]''
|
| 1906
|
| [[Newport]]
|-
| style='text-align:right'| 5175
| ''[[:d:Q7613774|Steve Robinson]]''
|
| 1968-12-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5176
| ''[[:d:Q7613812|Steve Rowland]]''
|
| 1981-11-02
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5177
| ''[[:d:Q7613936|Steve Sims]]''
|
| 1958-10-10
|
| [[Newport]]
|-
| style='text-align:right'| 5178
| ''[[:d:Q7614093|Steve Tandy]]''
|
| 1980-01-16
|
| ''[[:d:Q7821564|Tonmawr]]''
|-
| style='text-align:right'| 5179
| ''[[:d:Q7614247|Steve Watkin]]''
|
| 1964-09-15
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 5180
| ''[[:d:Q7614248|Steve Watkin]]''
|
| 1971-06-16
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5181
| ''[[:d:Q7614314|Steve Williams]]''
|
| 1974-10-16
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 5182
| ''[[:d:Q7614316|Steve Williams]]''
|
| 1971-10-20
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5183
| ''[[:d:Q7615049|Steven Meo]]''
|
| 1977-09-24
|
| [[Swansea]]
|-
| style='text-align:right'| 5184
| ''[[:d:Q7615264|Steven Shingler]]''
|
| 1991-06-20
|
| [[Swansea]]
|-
| style='text-align:right'| 5185
| ''[[:d:Q7615593|Stevie Lyle]]''
|
| 1979-12-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5186
| ''[[:d:Q7620234|Stormie Mills]]''
| [[File:Stormie Mills (cropped).jpg|center|128px]]
| 1969
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 5187
| ''[[:d:Q7626453|Stuart Davies]]''
|
| 1965-09-02
|
| [[Swansea]]
|-
| style='text-align:right'| 5188
| ''[[:d:Q7626511|Stuart Evans]]''
|
| 1963-06-14
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5189
| ''[[:d:Q7626525|Stuart Ferguson]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5190
| ''[[:d:Q7626565|Stuart Gallacher]]''
|
| 1946-05-22
| 2014-10-19
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5191
| ''[[:d:Q7626628|Stuart Harrison]]''
|
| 1951-09-21
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 5192
| ''[[:d:Q7626870|Stuart Morgan]]''
|
| 1949-09-23
|
| [[Swansea]]
|-
| style='text-align:right'| 5193
| ''[[:d:Q7626948|Stuart Phelps]]''
|
| 1975-12-16
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5194
| ''[[:d:Q7626974|Stuart Prosser]]''
|
| 1887
| 1939-03-12
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 5195
| ''[[:d:Q7627025|Stuart Roberts]]''
|
| 1980-07-22
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5196
| ''[[:d:Q7627026|Stuart Roberts]]''
|
| 1967-03-25
| 2023
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 5197
| ''[[:d:Q7634158|Sue Jones]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 5198
| ''[[:d:Q7636261|Sulien]]''
| [[File:Plaque for Sulien, Llanbadarn Fawr - geograph.org.uk - 2104435.jpg|center|128px]]
| 1011<br/>1012
| 1091
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 5199
| ''[[:d:Q7650929|Suzanne Packer]]''
| [[File:Suzanne Packer at the Chsiwick Book Festival (51449023075) (cropped).jpg|center|128px]]
| 1962-11-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5200
| ''[[:d:Q7651414|Suzy Davies]]''
| [[File:Suzy Davies.jpg|center|128px]]
| 1963
|
| [[Swansea]]
|-
| style='text-align:right'| 5201
| ''[[:d:Q7651983|Sven Hansen]]''
|
| 1876-04-01
| 1958-10-09
| [[Sooth Wales]]
|-
| style='text-align:right'| 5202
| ''[[:d:Q7655213|Sweet Baboo]]''
|
| 1986-08-10
|
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 5203
| ''[[:d:Q7659507|Sybil Christopher]]''
| [[File:Sybil Burton Christopher.JPG|center|128px]]
| 1929-03-27
| 2013-03-09<br/>2013-03-07
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 5204
| ''[[:d:Q7659509|Sybil Connolly]]''
|
| 1921-01-24
| 1998-05-06
| [[Swansea]]
|-
| style='text-align:right'| 5205
| ''[[:d:Q7659682|Syd Fursland]]''
|
| 1914-07-31
| 1990
| [[Llwynypia]]
|-
| style='text-align:right'| 5206
| ''[[:d:Q7659702|Syd Jenkins]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5207
| ''[[:d:Q7659721|Syd Reid]]''
|
| 20th century
|
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 5208
| ''[[:d:Q7659740|Syd Worgan]]''
|
| 1917
| 1996-07-09
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 5209
| ''[[:d:Q7659969|Sydney Hinam]]''
|
| 1898-08-29
| 1982-08-16
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5210
| ''[[:d:Q7660223|Sydney Williams]]''
|
| 1918-04-17
| 1976-08-28
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 5211
| ''[[:d:Q7660931|Sylvia Heal]]''
|
| 1942-07-20
|
| ''[[:d:Q2355142|Shotton]]''
|-
| style='text-align:right'| 5212
| ''[[:d:Q7668222|T. E. Ellis]]''
| [[File:Tom Ellis 01.JPG|center|128px]]
| 1859-02-16
| 1899-04-05
| ''[[:d:Q5057281|Cefnddwysarn]]''
|-
| style='text-align:right'| 5213
| ''[[:d:Q7668266|T. Glynne Davies]]''
|
| 1926-01-12
| 1988-04-10
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 5214
| ''[[:d:Q7668277|T. Gwynn Jones]]''
| [[File:T. Gwynn Jones (1871–1949) (gcf02648).jpg|center|128px]]
| 1871-10-10
| 1949-03-07
| ''[[:d:Q4899223|Betws yn Rhos]]''
|-
| style='text-align:right'| 5215
| ''[[:d:Q7668315|T. Ifor Rees]]''
|
| 1890-02-16<br/>1890
| 1977-02-11<br/>1977
| ''[[:d:Q7321618|Rhydypennau]]''
|-
| style='text-align:right'| 5216
| ''[[:d:Q7668365|T. J. Morgan]]''
|
| 1907-04-22
| 1986
| ''[[:d:Q5566489|Glais]]''
|-
| style='text-align:right'| 5217
| ''[[:d:Q7674964|Taffy Davies]]''
|
| 1910-06-24
| 1995-10-30
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 5218
| ''[[:d:Q7674966|Taffy O'Callaghan]]''
|
| 1906-10-06
| 1946-07-04
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 5219
| ''[[:d:Q7674969|Taffy Williams]]''
|
| 1933-09-28
| 1996-01-03
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5220
| ''[[:d:Q7678702|Tal Harris]]''
|
| 1902-02-04
| 1963-10-01
| [[Cairdiff]]
|-
| style='text-align:right'| 5221
| ''[[:d:Q7678716|Tal Selley]]''
|
| 1980-04-20
|
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 5222
| ''[[:d:Q7679434|Talfryn Evans]]''
|
| 1914-06-10
| 1944-03-31
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5223
| ''[[:d:Q7679435|Talfryn Thomas]]''
|
| 1922-10-31
| 1982-11-04
| [[Swansea]]
|-
| style='text-align:right'| 5224
| ''[[:d:Q7679452|John Jones]]''
| [[File:John Jones, 'Talhaiarn'.jpg|center|128px]]
| 1810-01-19
| 1869-10
| ''[[:d:Q3404936|Llanfair Talhaiarn]]''
|-
| style='text-align:right'| 5225
| ''[[:d:Q7681592|Tammy Jones]]''
|
| 1944-03-12
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5226
| ''[[:d:Q7683954|Tanwg]]''
| [[File:Tanwg.jpg|center|128px]]
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 5227
| ''[[:d:Q7686269|Tarki Micallef]]''
|
| 1961-01-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5228
| ''[[:d:Q7687359|Tasker Watkins]]''
| [[File:Sir Tasker Watkins VC.jpg|center|128px]]
| 1918-11-18
| 2007-09-09
| ''[[:d:Q3403439|Nelson]]''
|-
| style='text-align:right'| 5229
| ''[[:d:Q7692924|Tecwyn Jones]]''
|
| 1941-01-27
|
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 5230
| ''[[:d:Q7692926|Tecwyn Roberts]]''
| [[File:Tecwyn Roberts.jpg|center|128px]]
| 1925-10-10
| 1988-12-27
| ''[[:d:Q3404314|Llanddaniel Fab]]''
|-
| style='text-align:right'| 5231
| ''[[:d:Q7693615|Ted Pooley]]''
| [[File:Ted Pooley.png|center|128px]]
| 1842-02-13
| 1907-07-18
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 5232
| ''[[:d:Q7693850|Ted Ward]]''
|
| 20th century
| 1988
| [[Wales]]
|-
| style='text-align:right'| 5233
| ''[[:d:Q7694070|Teddy Peers]]''
|
| 1886-12-31
| 1935-09-20
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 5234
| ''[[:d:Q7701873|Terence Cook]]''
|
| 1927-06-24
| 2016-01-18
| ''[[:d:Q3401157|Bedwas]]''
|-
| style='text-align:right'| 5235
| ''[[:d:Q7703511|Terrence Robbins]]''
|
| 1937
| 2015-11-17
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5236
| ''[[:d:Q7704135|Terry Boyle]]''
|
| 1958-10-29
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 5237
| ''[[:d:Q7704246|Terry Cooke]]''
|
| 1962-02-21
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5238
| ''[[:d:Q7704251|Terry Cooper]]''
|
| 1950-03-11
|
| ''[[:d:Q5187462|Croesyceiliog]]''
|-
| style='text-align:right'| 5239
| ''[[:d:Q7704285|Terry Davies]]''
|
| 1933-09-24
| 2021-08-05
| ''[[:d:Q6662916|Llwynhendy]]''
|-
| style='text-align:right'| 5240
| ''[[:d:Q7704351|Terry Evans]]''
|
| 1976-01-08
|
| [[Pontypridd]]
|-
| style='text-align:right'| 5241
| ''[[:d:Q7704519|Terry Higgins]]''
|
| 1945-06-10
| 1982-07-04
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5242
| ''[[:d:Q7704540|Terry Hubbard]]''
|
| 1950-11-06
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5243
| ''[[:d:Q7704747|Terry Matthews]]''
|
| 1943-06-06
|
| [[Newport]]
|-
| style='text-align:right'| 5244
| ''[[:d:Q7704824|Terry Morris]]''
| [[File:Terry Morris and Dame Shirley Bassey.jpg|center|128px]]
| 1965-09-06
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5245
| ''[[:d:Q7705046|Terry Stephens]]''
|
| 1935-11-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5246
| ''[[:d:Q7781507|Theo Wharton]]''
| [[File:Theo Wharton 2017-08-05 1.jpg|center|128px]]
| 1994-11-15
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 5247
| ''[[:d:Q7781956|Theodore Price]]''
|
| 1570
| 1631
| ''[[:d:Q13129621|Llanenddwyn]]''
|-
| style='text-align:right'| 5248
| ''[[:d:Q7782307|Theophilus Jones]]''
| [[File:Portrait of Thes. Jones (4672942) (cropped).jpg|center|128px]]
| 1759-10-18
| 1812-01-15
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5249
| ''[[:d:Q7782323|Theophilus Redwood]]''
| [[File:Theophilus Redwood.jpg|center|128px]]
| 1806-04-09
| 1892-03-05
| ''[[:d:Q4950529|Boverton]]''
|-
| style='text-align:right'| 5250
| ''[[:d:Q7787281|Thomas Babington Jones]]''
|
| 1851-01-20
| 1890-08-06
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 5251
| ''[[:d:Q7787333|Thomas Baker Jones]]''
|
| 1862-09-16
| 1959-05-26
| [[Newport]]
|-
| style='text-align:right'| 5252
| ''[[:d:Q7787443|Thomas Bartley]]''
|
| 1874
| 1951-12-24
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 5253
| ''[[:d:Q7787897|Thomas Brigstocke]]''
| [[File:Thomas Brigstocke.jpg|center|128px]]
| 1809-04-17
| 1881-03-11
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5254
| ''[[:d:Q7787900|Thomas Briscoe]]''
|
| 1813-06-30
| 1895-02-16
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5255
| ''[[:d:Q7788056|Thomas Burgoyne]]''
|
| 1827-06-10
| 1920-03-23
| ''[[:d:Q5566244|Gladestry]]''
|-
| style='text-align:right'| 5256
| ''[[:d:Q7788335|Thomas Charles]]''
| [[File:Thomas Charles, Bala.jpg|center|128px]]
| 1755-10-14
| 1814-10-05
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 5257
| ''[[:d:Q7788342|Thomas Charles Edwards]]''
| [[File:Principal Thomas Charles Edwards (1837-1900) NLW3362721.jpg|center|128px]]
| 1837-09-22
| 1900-03-22
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 5258
| ''[[:d:Q7788707|Thomas Crofts]]''
| [[File:Thomas Crofts 1722 Catalogue.jpg|center|128px]]
| 1722
| 1781-11-08
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 5259
| ''[[:d:Q7788864|Thomas David Frank Evans]]''
|
| 1917
| 1996
| ''[[:d:Q15963900|Llanwnnen]]''
|-
| style='text-align:right'| 5260
| ''[[:d:Q7788876|Thomas Davies]]''
|
| 1872
| 1950
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 5261
| ''[[:d:Q7789102|Thomas Duncombe Dee]]''
|
| 1844-11-10
| 1905-07-09
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5262
| ''[[:d:Q7789165|Thomas E. Heywood]]''
|
| 1877-11-29
| 1953-11<br/>1953-11-26
| [[Cairdiff]]
|-
| style='text-align:right'| 5263
| ''[[:d:Q7789203|Thomas E. Stephens]]''
|
| 1884-11-18
| 1966-01-04
| [[Cairdiff]]
|-
| style='text-align:right'| 5264
| ''[[:d:Q7789287|Thomas Edwards]]''
|
| 1779
| 1858-06-04
| ''[[:d:Q2573736|Northop]]''
|-
| style='text-align:right'| 5265
| ''[[:d:Q7789292|Thomas Edwards]]''
|
| 1652
| 1721-09-05
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 5266
| ''[[:d:Q7789331|Thomas Ellis]]''
|
| 1625
| 1673-04
| ''[[:d:Q990100|Dolbenmaen]]''
|-
| style='text-align:right'| 5267
| ''[[:d:Q7789332|Thomas Ellis]]''
|
| 1711
| 1792-02-23
| ''[[:d:Q6812351|Meliden]]''
|-
| style='text-align:right'| 5268
| ''[[:d:Q7789396|Thomas Evans]]''
|
| 1824
| 1866
| [[Wales]]
|-
| style='text-align:right'| 5269
| ''[[:d:Q7789400|Thomas Evans]]''
|
| 1764-06-20
| 1833-01-29<br/>1833
| ''[[:d:Q13128837|Gwernogle]]''
|-
| style='text-align:right'| 5270
| ''[[:d:Q7789414|Thomas Exmewe]]''
| [[File:John Bettes the Elder Sir Thomas Exmewe.jpg|center|128px]]
| 1450s
| 1529
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 5271
| ''[[:d:Q7789686|Thomas Flynn]]''
|
| 1898-02-15
| 1974-07
| [[Wales]]
|-
| style='text-align:right'| 5272
| ''[[:d:Q7789785|Thomas Francis Roberts]]''
| [[File:Dr T. F. Roberts (1860–1919), MA, LLD, Principal of University of Wales, Aberystwyth (1892–1919) (OP81).jpg|center|128px]]
| 1860-09-25
| 1919-08-04
| ''[[:d:Q319536|Aberdyfi]]''
|-
| style='text-align:right'| 5273
| ''[[:d:Q7790073|Thomas Glyn Watkin]]''
|
| 1952
|
| ''[[:d:Q5197252|Cwmparc]]''
|-
| style='text-align:right'| 5274
| ''[[:d:Q7790212|Thomas Griffiths]]''
| [[File:BG T Griffiths.jpg|center|128px]]
| 1865-09-29
| 1947-11-16
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 5275
| ''[[:d:Q7790214|Thomas Griffiths]]''
| [[File:Tom-Griffiths-AS-Pont-y-pŵl.jpg|center|128px]]
| 1867
| 1955-02-04
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5276
| ''[[:d:Q7790335|Thomas Haffield]]''
|
| 1988-01-28
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5277
| ''[[:d:Q7790756|Thomas Hollingdale]]''
| [[File:Tom Hollingdale 1928.jpg|center|128px]]
| 1900-11-12
| 1978-04-14
| ''[[:d:Q7975195|Waunarlwydd]]''
|-
| style='text-align:right'| 5278
| ''[[:d:Q7791002|Thomas Mardy Jones]]''
|
| 1879-01-21
| 1970-08-26
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 5279
| ''[[:d:Q7791373|Thomas Jones]]''
|
| 1870-09-27
| 1955-10-15
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 5280
| ''[[:d:Q7791377|Thomas Jones]]''
|
| 1884
| 1958-02-08
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 5281
| ''[[:d:Q7791381|Thomas Jones]]''
|
| 1810
| 1875-11-29
| ''[[:d:Q6759079|Margam]]''
|-
| style='text-align:right'| 5282
| ''[[:d:Q7791382|Thomas Jones]]''
| [[File:Portrait of Thomas Jones (4673346).jpg|center|128px]]
| 1810-01-24
| 1849-09-16
| ''[[:d:Q20600098|Tan-y-ffridd]]''
|-
| style='text-align:right'| 5283
| ''[[:d:Q7791384|Thomas Jones]]''
|
| 1895-12-13
| 1933-08-20
| ''[[:d:Q7228313|Pontnewydd]]''
|-
| style='text-align:right'| 5284
| ''[[:d:Q7791392|Thomas Joseph-Watkin]]''
|
| 1856-04-13
| 1915-09-28
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5285
| ''[[:d:Q7791847|Thomas Leyson]]''
|
| 1549
|
| [[Wales]]
|-
| style='text-align:right'| 5286
| ''[[:d:Q7791887|Thomas Lloyd-Mostyn]]''
|
| 1830-01-23
| 1861-05-08
| ''[[:d:Q2424760|Mostyn]]''
|-
| style='text-align:right'| 5287
| ''[[:d:Q7791891|Thomas Lloyd]]''
|
| 1640-04-06
| 1694-09-10
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 5288
| ''[[:d:Q7791892|Thomas Lloyd]]''
|
| 1882
| 1938-04-27
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5289
| ''[[:d:Q7792509|Thomas Monaghan]]''
|
| 1833-04-18
| 1895-11-10
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5290
| ''[[:d:Q7792550|Thomas Morgan]]''
|
|
| 1565-06-05
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 5291
| ''[[:d:Q7792552|Thomas Morgan]]''
|
| 1542<br/>1540
| 1595-12-22
| [[Wales]]
|-
| style='text-align:right'| 5292
| ''[[:d:Q7792716|Thomas Neville George]]''
|
| 1904-05-13
| 1980-06-08
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 5293
| ''[[:d:Q7792777|Thomas Nowell]]''
|
| 1730
| 1801-09-23
| [[Cairdiff]]
|-
| style='text-align:right'| 5294
| ''[[:d:Q7792907|Thomas Owen]]''
|
| 1749
| 1812-05
| ''[[:d:Q2278993|Pentraeth]]''
|-
| style='text-align:right'| 5295
| ''[[:d:Q7792960|Thomas Paddison]]''
|
| 1883
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5296
| ''[[:d:Q7793019|Thomas Parker]]''
|
| 1901-05
| 1969-04-17
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 5297
| ''[[:d:Q7793031|Thomas Parry]]''
|
| 1904-08-04
| 1985-04-22
| ''[[:d:Q302496|Carmel]]''
|-
| style='text-align:right'| 5298
| ''[[:d:Q7793039|Thomas Parry]]''
| [[File:Thomas Parry.jpg|center|128px]]
| 1768
| 1824-08-24
| [[Powys]]
|-
| style='text-align:right'| 5299
| ''[[:d:Q7793099|Thomas Penson]]''
| [[File:Church of St David, Newtown - geograph.org.uk - 1424901.jpg|center|128px]]
| 1790
| 1859-05-20
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5300
| ''[[:d:Q7793148|Thomas Phillips]]''
| [[File:Portrait of Sir Thomas Phillips (4671785).jpg|center|128px]]
| 1801
| 1867-05-26
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 5301
| ''[[:d:Q7793237|Thomas Powel]]''
| [[File:Professor Thomas Powel (1845-1922) NLW3364243.jpg|center|128px]]
| 1845
| 1922-05-16
| ''[[:d:Q15242569|Llanwrtyd]]''
|-
| style='text-align:right'| 5302
| ''[[:d:Q7793241|Thomas Powell]]''
|
| 1608
| 1660-12-31
| ''[[:d:Q547052|Brecknockshire]]''<br/>''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5303
| ''[[:d:Q7793275|Tom Price]]''
| [[File:Thomas Price (Australian politician).jpg|center|128px]]
| 1852-01-19
| 1909-05-31
| ''[[:d:Q4980803|Brymbo]]''
|-
| style='text-align:right'| 5304
| ''[[:d:Q7793310|Thomas Prothero]]''
|
| 1780
| 1853-04-24
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 5305
| ''[[:d:Q7793450|Thomas Rees]]''
|
| 1777
| 1864-08-01
| ''[[:d:Q107032579|Gelli-gron]]''
|-
| style='text-align:right'| 5306
| ''[[:d:Q7793451|Thomas Rees]]''
|
| 1806
| 1876-11-17
| ''[[:d:Q3405168|Mynachlog-Ddu]]''
|-
| style='text-align:right'| 5307
| ''[[:d:Q7793503|Thomas Richard Lloyd]]''
|
| 1820
| 1891-05-10
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5308
| ''[[:d:Q7793509|Thomas Richards]]''
| [[File:Thomas Richards 1905.JPG|center|128px]]
| 1859-06-08
| 1931-11-07
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 5309
| ''[[:d:Q7793510|Thomas Richards]]''
|
| 1687
| 1760
| ''[[:d:Q3400212|Llanfarian]]''
|-
| style='text-align:right'| 5310
| ''[[:d:Q7793516|Thomas Richards]]''
|
| 1878-03-15
| 1962-06-24
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 5311
| ''[[:d:Q7793653|T. Rowland Hughes]]''
|
| 1903-04-17
| 1949-10-24
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 5312
| ''[[:d:Q7793755|Thomas Salisbury]]''
| [[File:Thomas Salisbury died 1586 by Moses Griffith 02198.jpg|center|128px]]
| 1564
| 1586-09-20
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5313
| ''[[:d:Q7794427|Thomas Thomas]]''
| [[File:Thomas Thomas.png|center|128px]]
| 1880-04-08
| 1911-08-13
| ''[[:d:Q15221773|Glynarthen]]''
|-
| style='text-align:right'| 5314
| ''[[:d:Q7794430|Thomas Thomas]]''
|
| 1829
| 1913
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 5315
| ''[[:d:Q7795183|Thomas Williams]]''
| [[File:Thomas Williams (Christadelphian).jpg|center|128px]]
| 1847
| 1913
| ''[[:d:Q15265478|Melin y Parc]]''
|-
| style='text-align:right'| 5316
| ''[[:d:Q7795189|Thomas Dominic Williams]]''
|
| 1660
| 1740
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 5317
| ''[[:d:Q7795190|Thomas Williams]]''
|
| 1884-06-18
| 1954-01-12
| [[Newport]]
|-
| style='text-align:right'| 5318
| ''[[:d:Q7795195|Thomas Williams]]''
|
| 1658
| 1726
| ''[[:d:Q3401668|Eglwysbach]]''
|-
| style='text-align:right'| 5319
| ''[[:d:Q7795196|Thomas Williams]]''
|
| No/unknown value
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 5320
| ''[[:d:Q7795206|Thomas Williams of Llanidan]]''
| [[File:Thomas Williams of Llanidan.jpeg|center|128px]]
| 1737-05-13
| 1802-11-30
| ''[[:d:Q3402736|Llanidan]]''
|-
| style='text-align:right'| 5321
| ''[[:d:Q7795299|Thomas Woods]]''
|
| 1890-01-30
|
| [[Wales]]
|-
| style='text-align:right'| 5322
| ''[[:d:Q7795360|Thomas Wynford Rees]]''
| [[File:The War in the Far East- the Burma Campaign 1941-1945 SE3257.jpg|center|128px]]
| 1898-01-12<br/>1898
| 1959-10-15
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 5323
| ''[[:d:Q7795363|Thomas Wynne]]''
|
| 1627-07-20
| 1692-01-16
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 5324
| ''[[:d:Q7795382|Thomas Young]]''
|
| 1992-05-18
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5325
| ''[[:d:Q7795391|Thomas Zacharias]]''
|
| 1860
| 1892-03-30
| [[Wales]]
|-
| style='text-align:right'| 5326
| ''[[:d:Q7795526|Tomos o Fynwy]]''
|
| 12nd century
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 5327
| ''[[:d:Q7800585|Tich Gwilym]]''
| [[File:Tich Gwilym (Aberystwyth, November 1985)-1.jpg|center|128px]]
| 1950-09-10
| 2005-06-19
| [[Llwynypia]]
|-
| style='text-align:right'| 5328
| ''[[:d:Q7803430|Tim Dinsdale]]''
|
| 1924-09-27
| 1987-12-14
| [[Aberystwyth]]
|-
| style='text-align:right'| 5329
| ''[[:d:Q7804161|Tim Rhys-Evans]]''
| [[File:Tim Rhys-Evans conducting at the AMIS Honor Choir 2019 in Beijing.jpg|center|128px]]
| 1972
|
| ''[[:d:Q3402398|New Tredegar]]''
|-
| style='text-align:right'| 5330
| ''[[:d:Q7804257|Tim Selwood]]''
|
| 1944-09-01
| 2021-02-10
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 5331
| ''[[:d:Q7807185|Timothy Everest]]''
| [[File:Timothy Everest.jpg|center|128px]]
| 1961
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5332
| ''[[:d:Q7807530|Timothy Stamps]]''
|
| 1936-10-15
| 2017-11-26
| [[Wales]]
|-
| style='text-align:right'| 5333
| ''[[:d:Q7808784|Tip Williams]]''
|
| 1900-11-28
| 1974-04-24
| ''[[:d:Q4942682|Bonvilston]]''
|-
| style='text-align:right'| 5334
| ''[[:d:Q7810316|Titus Lewis]]''
|
| 1773-02-21
| 1811-05-01
| ''[[:d:Q5119942|Cilgerran]]''
|-
| style='text-align:right'| 5335
| ''[[:d:Q7811780|Toby Charles]]''
|
| 1940
|
| [[Wales]]
|-
| style='text-align:right'| 5336
| ''[[:d:Q7814803|Tom Arthur]]''
| [[File:Tom Arthur 1928.jpg|center|128px]]
| 1906-01-10
| 1986-11-01
| [[Pontypridd]]
|-
| style='text-align:right'| 5337
| ''[[:d:Q7815245|Tom Cave]]''
| [[File:2014 Rallye Deutschland by 2eight DSC2783.jpg|center|128px]]
| 1991-11-16
|
| ''[[:d:Q319536|Aberdyfi]]''
|-
| style='text-align:right'| 5338
| ''[[:d:Q7815265|Tom Cheeseman]]''
|
| 1986-03-22
|
| [[Swansea]]
|-
| style='text-align:right'| 5339
| ''[[:d:Q7815366|Tom Collings]]''
|
| 1938-12-02
| 2014-07-08
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5340
| ''[[:d:Q7815371|Tom Collins]]''
|
| 1895-08-14
| 1957-04-08
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5341
| ''[[:d:Q7815481|Tom Cullen]]''
| [[File:TomCullen.jpg|center|128px]]
| 1985-07-17
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 5342
| ''[[:d:Q7815542|Tom Day]]''
|
| 1907
| 1980-09-18
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 5343
| ''[[:d:Q7815552|Tom Deacon]]''
| [[File:Tom Deacon rugby player.jpg|center|128px]]
| 1868
| 1921-07-21
| [[Swansea]]
|-
| style='text-align:right'| 5344
| ''[[:d:Q7815721|Tom Emanuel]]''
|
| 1915-08-01
| 1997
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 5345
| ''[[:d:Q7815737|Tom Evans]]''
|
| 1907-11-28
| 1993
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 5346
| ''[[:d:Q7815982|Tom Grabham]]''
|
| 1991-06-20
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5347
| ''[[:d:Q7816039|Tom Habberfield]]''
|
| 1992-05-19
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5348
| ''[[:d:Q7816060|Tom Hallett]]''
|
| 1939-04-10
|
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 5349
| ''[[:d:Q7816227|Tom Hooson]]''
|
| 1933-03-16
| 1985-05-08
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 5350
| ''[[:d:Q7816231|Tom Horabin]]''
|
| 1896
| 1956-04-26
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5351
| ''[[:d:Q7816281|Tom Hurry Riches]]''
|
| 1846-11-24
| 1911-09-04
| [[Cairdiff]]
|-
| style='text-align:right'| 5352
| ''[[:d:Q7816300|Tom Isaacs]]''
| [[File:ST vs Ospreys 08-12-120001.JPG|center|128px]]
| 1987-02-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5353
| ''[[:d:Q7816308|Tom Jackson]]''
|
| 1870-03
| 1952-12-02
| [[Swansea]]
|-
| style='text-align:right'| 5354
| ''[[:d:Q7816335|Tom John]]''
|
| 1995-01-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5355
| ''[[:d:Q7816351|Tom Johnson]]''
|
| 1893
| 1948-05-06
| [[Cairdiff]]
|-
| style='text-align:right'| 5356
| ''[[:d:Q7816369|Tom Jones]]''
|
| 1901-04-01
| 1935-07-19
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5357
| ''[[:d:Q7816582|Tom Lewis]]''
|
| 1904-06-07
| 1994-05-31
| ''[[:d:Q1401784|Ffynnon Taf]]''
|-
| style='text-align:right'| 5358
| ''[[:d:Q7816609|Tom Lockyer]]''
| [[File:Tom Lockyer in action for Wales v Croatia.jpg|center|128px]]
| 1994-12-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5359
| ''[[:d:Q7816749|Tom Maynard]]''
| [[File:Tommaynard.jpg|center|128px]]
| 1989-03-25
| 2012-06-18
| [[Cairdiff]]
|-
| style='text-align:right'| 5360
| ''[[:d:Q7817055|Tom Norris]]''
|
|
|
| ''[[:d:Q3400833|Clydach Vale]]''
|-
| style='text-align:right'| 5361
| ''[[:d:Q7817160|Tom Parker]]''
| [[File:Tom Parker.jpeg|center|128px]]
| 1891-03-29
| 1967-11-25
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 5362
| ''[[:d:Q7817323|Tom Ramasut]]''
|
| 1977-08-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5363
| ''[[:d:Q7817340|Tom Reason]]''
|
| 1890-07-04
| 1935-02-15
| ''[[:d:Q5016593|Llangatwg]]''
|-
| style='text-align:right'| 5364
| ''[[:d:Q7817387|Tom Riley]]''
|
| 1985-05-04
|
| ''[[:d:Q5593460|Graig]]''
|-
| style='text-align:right'| 5365
| ''[[:d:Q7817394|Tom Roberts]]''
|
| 1897
| 1972-09-28
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 5366
| ''[[:d:Q7817785|Tom Taylor]]''
|
| 1911-07-07
| 1970-07-20
| [[Cairdiff]]
|-
| style='text-align:right'| 5367
| ''[[:d:Q7817808|Tom Thomas]]''
|
|
|
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 5368
| ''[[:d:Q7817972|Tom Walley]]''
|
| 1945-02-27
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5369
| ''[[:d:Q7817986|Tom Walters]]''
|
| 1909-06-15
| 1968-01-27
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 5370
| ''[[:d:Q7818042|Tom Whittaker]]''
| [[File:Tom Whittaker at Malmstrom-cropped.jpg|center|128px]]
| 1948-06-09
|
| [[Wales]]
|-
| style='text-align:right'| 5371
| ''[[:d:Q7818044|Tom Whittington]]''
|
| 1881-07-29
| 1944-07-19
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5372
| ''[[:d:Q7818067|Tom Williams]]''
|
| 1991-04-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5373
| ''[[:d:Q7819187|Tommy Astbury]]''
|
| 1920-02-09
| 1993-10-19
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 5374
| ''[[:d:Q7819227|Tommy Best]]''
|
| 1920-12-23
| 2018-09-16
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 5375
| ''[[:d:Q7819339|Tommy Davies]]''
|
| 1920-05-07
| 1988-12
| ''[[:d:Q5197248|Cwmgors]]''
|-
| style='text-align:right'| 5376
| ''[[:d:Q7819500|Tommy Harris]]''
|
| 1927-06-05
| 2006-09-27
| ''[[:d:Q3404679|Crumlin]]''
|-
| style='text-align:right'| 5377
| ''[[:d:Q7819577|Tommy Jones-Davies]]''
| [[File:Tommy Jones-Davies 1930.jpg|center|128px]]
| 1906-03-04
| 1960-08-25
| ''[[:d:Q6964312|Nantgaredig]]''
|-
| style='text-align:right'| 5378
| ''[[:d:Q7819582|Tommy Jones]]''
| [[File:Tommy Jones.jpg|center|128px]]
| 1909-12-06
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 5379
| ''[[:d:Q7819747|Tommy Nutter]]''
|
| 1943-04-17
| 1992-08-17
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 5380
| ''[[:d:Q7819760|Tommy O'Sullivan]]''
| [[File:Tommy O'Sullivan.jpg|center|128px]]
| 1995-01-18
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 5381
| ''[[:d:Q7819800|Tommy Rees]]''
|
| 1904-08-22
| 1968-11-10
| ''[[:d:Q3404556|Pontyclun]]''
|-
| style='text-align:right'| 5382
| ''[[:d:Q7819839|Tommy Scourfield]]''
|
| 1909
| 1976-02-14
| [[Pontypridd]]
|-
| style='text-align:right'| 5383
| ''[[:d:Q7819968|Tommy Vile]]''
| [[File:Tommy Vile.jpg|center|128px]]
| 1882-09-06
| 1958-10-30
| [[Newport]]
|-
| style='text-align:right'| 5384
| ''[[:d:Q7819994|Tommy Weale]]''
|
| 1910-12-31
| 1971
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5385
| ''[[:d:Q7820312|Tomos Prys]]''
| [[File:Tomos Prys portrait.jpg|center|128px]]
| 1564
| 1634-08-23
| ''[[:d:Q20591139|Plas Iolyn]]''
|-
| style='text-align:right'| 5386
| ''[[:d:Q7821745|Tony Adams]]''
|
| 1940-12-11
|
| [[Anglesey]]
|-
| style='text-align:right'| 5387
| ''[[:d:Q7821903|Tony Bird]]''
|
| 1974-09-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5388
| ''[[:d:Q7822067|Tony Clark]]''
|
| 1955-09-27
|
| ''[[:d:Q5623567|Gwersyllt]]''
|-
| style='text-align:right'| 5389
| ''[[:d:Q7822122|Tony Cottey]]''
|
| 1966-06-02
|
| [[Swansea]]
|-
| style='text-align:right'| 5390
| ''[[:d:Q7822155|Tony Curtis]]''
|
| 1946
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5391
| ''[[:d:Q7822341|Tony Fisher]]''
|
| 1943
|
| [[Swansea]]
|-
| style='text-align:right'| 5392
| ''[[:d:Q7822639|Tony James]]''
| [[File:Tony James Hereford United.jpg|center|128px]]
| 1978-10-09
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5393
| ''[[:d:Q7822985|Tony Millington]]''
|
| 1943-06-05
| 2015-08-05
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 5394
| ''[[:d:Q7823053|Tony Nelson]]''
|
| 1930-04-12
| 2022-08-27
| [[Cairdiff]]
|-
| style='text-align:right'| 5395
| ''[[:d:Q7823064|Tony Norman]]''
|
| 1958-02-24
|
| ''[[:d:Q3405295|Mancot]]''
|-
| style='text-align:right'| 5396
| ''[[:d:Q7823155|Tony Pennock]]''
|
| 1971-04-10
|
| [[Swansea]]
|-
| style='text-align:right'| 5397
| ''[[:d:Q7823245|Tony Rees]]''
|
| 1964-08-01
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5398
| ''[[:d:Q7823270|Tony Ridler]]''
|
| 1954-01-21
| 2015-01-16
| [[Newport]]
|-
| style='text-align:right'| 5399
| ''[[:d:Q7823281|Tony Roberts]]''
| [[File:Roberts, Tony.jpg|center|128px]]
| 1969-08-04
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 5400
| ''[[:d:Q7823324|Tony Rowley]]''
|
| 1929-09-19
| 2006-04-28
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 5401
| ''[[:d:Q7823414|Tony Simmons]]''
|
| 1948-10-06
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 5402
| ''[[:d:Q7823432|Tony Skuse]]''
|
| 1956-02-09
|
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 5403
| ''[[:d:Q7823625|Tony Villars]]''
|
| 1952-01-24
| 2020-09-09
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5404
| ''[[:d:Q7827600|Tosh Powell]]''
|
| 1908
| 1928-06-02
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5405
| ''[[:d:Q7831207|Tracey Corderoy]]''
| [[File:Tracey Corderoy.jpg|center|128px]]
| 1965-04-12
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5406
| ''[[:d:Q7831231|Tracey Hinton]]''
|
| 1970-03-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5407
| ''[[:d:Q7836739|Hannah Mills]]''
| [[File:Hannah Mills.jpg|center|128px]]
| 1988-02-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5408
| ''[[:d:Q7837812|Trefor Jenkins]]''
| [[File:Trefor Jenkins00.jpg|center|128px]]
| 1932-07-24
|
| ''[[:d:Q6820697|Ynysowen]]''
|-
| style='text-align:right'| 5409
| ''[[:d:Q7838982|Trevil Morgan]]''
|
| 1907-05-07
| 1976-12-18
| ''[[:d:Q5199901|Cyncoed]]''
|-
| style='text-align:right'| 5410
| ''[[:d:Q7839033|Trevor Arnott]]''
|
| 1902-02-16
| 1975-02-02
| ''[[:d:Q7281814|Radyr]]''
|-
| style='text-align:right'| 5411
| ''[[:d:Q7839139|Trevor Every]]''
|
| 1909-12-19
| 1990-01-20
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5412
| ''[[:d:Q7839152|Trevor Foster]]''
|
| 1914-12-03
| 2005-04-02
| [[Newport]]
|-
| style='text-align:right'| 5413
| ''[[:d:Q7839165|Trevor Gardner]]''
|
| 1915-08-24
| 1963-09-28
| [[Cairdiff]]
|-
| style='text-align:right'| 5414
| ''[[:d:Q7839243|Trevor Jones]]''
|
| 1926-12-17
| 2016-09-09
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 5415
| ''[[:d:Q7839282|Trevor Llewellyn]]''
|
| 1898
| 1981
| [[Newport]]
|-
| style='text-align:right'| 5416
| ''[[:d:Q7839287|Trevor Lloyd]]''
|
| 1924-09-05
| 2015-10
| ''[[:d:Q7675879|Taibach]]''
|-
| style='text-align:right'| 5417
| ''[[:d:Q7839340|Trevor Morris]]''
|
| 1920-09-06
| 2003-02-03
| ''[[:d:Q5586893|Gorslas]]''
|-
| style='text-align:right'| 5418
| ''[[:d:Q7839382|Trevor Preece]]''
|
| 1882-10-13
| 1965-09-21
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 5419
| ''[[:d:Q7839401|Trevor Roberts]]''
|
| 1942-02-25
| 1972-06
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5420
| ''[[:d:Q7839460|Trevor Thomas]]''
|
| 1909
| 1969-02-03
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5421
| ''[[:d:Q7839477|Trevor Walters]]''
|
| 1916-01-13
| 1989-06-01
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5422
| ''[[:d:Q7843996|Trish Law]]''
| [[File:Trish Law AM 2007.jpg|center|128px]]
| 1954-03-17
|
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 5423
| ''[[:d:Q7848821|Trystan Gravelle]]''
|
| 1981
|
| ''[[:d:Q7842265|Trimsaran]]''
|-
| style='text-align:right'| 5424
| ''[[:d:Q7851276|Tudor Davies]]''
|
| 1892-11-12
| 1958-04-02
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 5425
| ''[[:d:Q7851307|Tudor Parfitt]]''
|
| 1944-10-10
|
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 5426
| ''[[:d:Q7851330|Tudor Watkins, Baron Watkins]]''
|
| 1903-05-09
| 1983-11-02
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 5427
| ''[[:d:Q7861628|Tyrone O'Sullivan]]''
| [[File:Tyrone OSullivan by Aberdare Blog.jpg|center|128px]]
| 1945-10-24
| 2023-05-27
| [[Wales]]
|-
| style='text-align:right'| 5428
| ''[[:d:Q7861631|Tyrone Powell]]''
|
| 1953-06-17
|
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 5429
| ''[[:d:Q7899835|Urban]]''
|
| No/unknown value
| 1134
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 5430
| ''[[:d:Q7909090|Val Feld]]''
| [[File:Val Feld.png|center|128px]]
| 1947-10-29
| 2001-07-17
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5431
| ''[[:d:Q7909111|Val Lloyd]]''
| [[File:Val Lloyd.jpg|center|128px]]
| 1943-11-16
|
| [[Swansea]]
|-
| style='text-align:right'| 5432
| ''[[:d:Q7917296|Vaughan Jones]]''
|
| 1959-09-08
|
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 5433
| ''[[:d:Q7921085|Verden Allen]]''
| [[File:HunterAllenMotttheHoople.jpg|center|128px]]
| 1944-05-26
|
| [[Wales]]
|-
| style='text-align:right'| 5434
| ''[[:d:Q7922142|Vernon Hill]]''
| [[File:Vernon Hill.jpg|center|128px]]
| 1871-01-30
| 1932-09-29
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 5435
| ''[[:d:Q7922194|Vernon Morris]]''
|
| 1894-06-13
| 1973-01-11
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 5436
| ''[[:d:Q7924902|Vic Rouse]]''
|
| 1936-03-16
|
| [[Swansea]]
|-
| style='text-align:right'| 5437
| ''[[:d:Q7925889|Victor Erle Nash-Williams]]''
|
| 1897-08-21
| 1955
| ''[[:d:Q56087668|Fleur-de-Lys]]''
|-
| style='text-align:right'| 5438
| ''[[:d:Q7927089|Victoria Thornley]]''
|
| 1987-11-30
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5439
| ''[[:d:Q7931505|Vince Griffiths]]''
|
| 1901-05-29
| 1967-01-07
| [[Pontypridd]]
|-
| style='text-align:right'| 5440
| ''[[:d:Q7931909|Vincent Lloyd-Jones]]''
|
| 1901-10-16
| 1986-09-23
| [[Cairdiff]]
|-
| style='text-align:right'| 5441
| ''[[:d:Q7937419|Viv Huzzey]]''
|
| 1876-07-24
| 1929-08-16
| ''[[:d:Q7916189|Varteg]]''
|-
| style='text-align:right'| 5442
| ''[[:d:Q7937718|Vivian Harrison]]''
|
| 1921-12
| 1989-08
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5443
| ''[[:d:Q7937766|Vivian Ridler]]''
|
| 1913
| 2009-01-11
| [[Cairdiff]]
|-
| style='text-align:right'| 5444
| ''[[:d:Q7945802|William Llewelyn Williams]]''
| [[File:W. Llewelyn Williams (5254833) (cropped).jpg|center|128px]]
| 1867-03-10
| 1922-04-22
| ''[[:d:Q6661743|Llansadwrn]]''
|-
| style='text-align:right'| 5445
| ''[[:d:Q7945968|W. S. Gwynn Williams]]''
|
| 1896-04-04
| 1978<br/>1978-11-13
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 5446
| ''[[:d:Q7945972|W. S. Jones]]''
|
| 1920-05-28
| 2007-11-15
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 5447
| ''[[:d:Q7955445|WR Parry]]''
|
| 1890-06-28
| 1955-07-09
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5448
| ''[[:d:Q7964582|Walter Coffin]]''
|
| 1784
| 1867-02-15
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5449
| ''[[:d:Q7964611|Walter Cradock]]''
|
| 1606
| 1659-12-24
| ''[[:d:Q6661540|Llangwm]]''
|-
| style='text-align:right'| 5450
| ''[[:d:Q7964653|Walter Davis]]''
|
| 1888-09-29
| 1937-05-20
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 5451
| ''[[:d:Q7964728|Walter E. Rees]]''
| [[File:Walter E Rees.png|center|128px]]
| 1863-04-13
| 1949-06-06
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5452
| ''[[:d:Q7964785|Walter Evans]]''
|
| 1867
| 1897-05-10
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 5453
| ''[[:d:Q7965162|Walter Horatio Wilson]]''
| [[File:StateLibQld 1 110840 Honourable Walter Horatio Wilson 1887.jpg|center|128px]]
| 1839-07-15
| 1902-02-23
| ''[[:d:Q7321514|Rhosymedre]]''
|-
| style='text-align:right'| 5454
| ''[[:d:Q7965269|Walter Jenkin Evans]]''
| [[File:Professor Walter Jenkin Evans (1856–1927), Carmarthen Presbyterian College (gcf02731).jpg|center|128px]]
| 1856-04-01
| 1927-02-10
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5455
| ''[[:d:Q7965470|Walter Lloyd]]''
|
| 1580
| 1662
| ''[[:d:Q6661336|Llanfair Clydogau]]''
|-
| style='text-align:right'| 5456
| ''[[:d:Q7965658|Walter Monslow, Baron Monslow]]''
|
| 1895-01-26
| 1966-10-12
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5457
| ''[[:d:Q7965863|Walter Powell]]''
|
| 1842-04-17
| 1881-12-10
| [[Newport]]
|-
| style='text-align:right'| 5458
| ''[[:d:Q7965960|Walter Rice Evans]]''
|
| 1863-09-10
| 1909-06-08
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5459
| ''[[:d:Q7965980|Walter Robbins]]''
|
| 1910-11-24
| 1979
| [[Cairdiff]]
|-
| style='text-align:right'| 5460
| ''[[:d:Q7966122|Walter Shaw Sparrow]]''
|
| 1862
| 1940-03-11
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5461
| ''[[:d:Q7966361|Walter W. Thomas]]''
|
| 1849-04
| 1912-10-30
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5462
| ''[[:d:Q7970188|Warren Feeney, Sr.]]''
|
| 1949
|
| [[Swansea]]
|-
| style='text-align:right'| 5463
| ''[[:d:Q7972932|Wat Jones]]''
|
| 1917-07-06
| 1994-08-23
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 5464
| ''[[:d:Q7976022|Wayne Atwood]]''
|
| 1964-07-24
|
| [[Wales]]
|-
| style='text-align:right'| 5465
| ''[[:d:Q7976043|Wayne Bickerton]]''
|
| 1941-07-11
| 2015-11-29<br/>2015-11-28
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 5466
| ''[[:d:Q7976202|Wayne Edwards]]''
|
| 1966
| 1993-01-13
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 5467
| ''[[:d:Q7976216|Wayne Evans]]''
|
| 1971-08-25
| 2023-07-02
| [[Abermule]]
|-
| style='text-align:right'| 5468
| ''[[:d:Q7976218|Wayne Evans]]''
|
| 1984-06-03
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5469
| ''[[:d:Q7976374|Wayne Jones]]''
|
| 1948-10-20
|
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 5470
| ''[[:d:Q7976416|Wayne Law]]''
|
| 1978-09-04
|
| [[Swansea]]
|-
| style='text-align:right'| 5471
| ''[[:d:Q7976425|Wayne Lock]]''
|
| 1956-04-13
|
| [[Pontypridd]]
|-
| style='text-align:right'| 5472
| ''[[:d:Q7976496|Wayne Mumford]]''
|
| 1964-11-03
|
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 5473
| ''[[:d:Q7976534|Wayne Phillips]]''
|
| 1970-12-15
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5474
| ''[[:d:Q7976580|Wayne Russell]]''
|
| 1967-11-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5475
| ''[[:d:Q7976757|Wayne Warren]]''
|
| 1962-12-06
|
| [[Wales]]
|-
| style='text-align:right'| 5476
| ''[[:d:Q7982581|Wendy Albiston]]''
|
| 1969-01-13
|
| [[Pontypridd]]
|-
| style='text-align:right'| 5477
| ''[[:d:Q7982737|Wendy Mulford]]''
|
| 1941
|
| [[Wales]]
|-
| style='text-align:right'| 5478
| ''[[:d:Q7983858|Wesley Burns]]''
| [[File:Wes Burns 1.jpg|center|128px]]
| 1994-11-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5479
| ''[[:d:Q7990708|Wharton Davies]]''
|
| 1873-11-10
| 1961-06-05
| ''[[:d:Q3403708|St Ishmael's]]''
|-
| style='text-align:right'| 5480
| ''[[:d:Q7998393|Wickham Powell]]''
|
| 1892-09-13
| 1961-03-20
| [[Cairdiff]]
|-
| style='text-align:right'| 5481
| ''[[:d:Q8001663|Wilf Hughes]]''
|
| 1910-07-12
| 1984-04-21
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 5482
| ''[[:d:Q8001666|Wilf Lewis]]''
|
| 1903-07-01
| 1976
| [[Swansea]]
|-
| style='text-align:right'| 5483
| ''[[:d:Q8001693|Wilf Walsh]]''
|
| 1917-07-29
| 1977
| ''[[:d:Q7228312|Pontlotyn]]''
|-
| style='text-align:right'| 5484
| ''[[:d:Q8001810|Wilfred Hodder]]''
|
| 1896-05-06
| 1957-11-12
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 5485
| ''[[:d:Q8001847|Wilfred Mitford Davies]]''
|
| 1895-02-23
| 1966-03-19
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 5486
| ''[[:d:Q8001858|Wilfred Pallott]]''
|
| 1884-11-05
| 1957-11-07
| [[Cairdiff]]
|-
| style='text-align:right'| 5487
| ''[[:d:Q8001891|Wilfred Trubshaw]]''
|
| 1870
| 1944-12-21
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 5488
| ''[[:d:Q8002410|Wiliam Midleton]]''
|
| 1550
| 1600
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 5489
| ''[[:d:Q8002411|William Owen Roberts]]''
|
| 1960
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5490
| ''[[:d:Q8002713|Will Bragg]]''
|
| 1986-10-24
|
| [[Newport]]
|-
| style='text-align:right'| 5491
| ''[[:d:Q8002779|Will Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5492
| ''[[:d:Q8002780|Will Davies]]''
|
| 1906-02-14
| 1975-10-05
| ''[[:d:Q5197248|Cwmgors]]''
|-
| style='text-align:right'| 5493
| ''[[:d:Q8002851|Will Harries]]''
|
| 1987-03-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5494
| ''[[:d:Q8002875|Will Hopkins]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5495
| ''[[:d:Q8002998|Will Osborne]]''
|
| 1875-06-11
| 1942-03-24
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 5496
| ''[[:d:Q8003002|Will Owen]]''
|
| 1988-09-02
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5497
| ''[[:d:Q8003009|Will Parker]]''
|
| 1873
| 1955-11-10
| [[Swansea]]
|-
| style='text-align:right'| 5498
| ''[[:d:Q8003012|Will Paynter]]''
|
| 1903
| 1984-12-11
| [[Cairdiff]]
|-
| style='text-align:right'| 5499
| ''[[:d:Q8003041|Will Roberts]]''
|
| 1994-04-24
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 5500
| ''[[:d:Q8003042|Will Roberts]]''
|
| 1907-12-21
| 2000-03-11
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 5501
| ''[[:d:Q8003141|Will Taylor]]''
|
| 1991-03-04
|
| [[Swansea]]
|-
| style='text-align:right'| 5502
| ''[[:d:Q8004161|William Addams Williams]]''
|
| 1787-08-10
| 1861-09-05
| ''[[:d:Q13129646|Llangybi]]''
|-
| style='text-align:right'| 5503
| ''[[:d:Q8004223|William Albert Jenkins]]''
|
| 1878-09-09
| 1968-10-23
| [[Swansea]]
|-
| style='text-align:right'| 5504
| ''[[:d:Q8004251|William Alexander]]''
|
| 1874-07-16
| 1937-11-01
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 5505
| ''[[:d:Q8004673|William Aubrey]]''
| [[File:WilliamAubrey.jpg|center|128px]]
| 1529
| 1595-06-25
| ''[[:d:Q52158053|Cantref]]''
|-
| style='text-align:right'| 5506
| ''[[:d:Q8005020|William Banks]]''
|
| 1925-01-11
| 1991-08
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 5507
| ''[[:d:Q8005220|William Baxter]]''
|
| 1650
| 1723-05-31
| ''[[:d:Q13129655|Llanllugan]]''
|-
| style='text-align:right'| 5508
| ''[[:d:Q8005289|William Beck]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 5509
| ''[[:d:Q8005312|William Bedloe]]''
|
| 1650-04-20
| 1680-08-20
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 5510
| ''[[:d:Q8005480|William Berry, 1st Viscount Camrose]]''
| [[File:Sir Wm. Berry LCCN2014715089.jpg|center|128px]]
| 1879-06-23
| 1954-06-15
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5511
| ''[[:d:Q8005633|William Blethyn]]''
|
| 16th century
| 1591
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 5512
| ''[[:d:Q8005643|William Bloomfield Douglas]]''
| [[File:William Bloomfield Douglas.jpeg|center|128px]]
| 1822-09-25
| 1906-03-05
| [[Aberystwyth]]
|-
| style='text-align:right'| 5513
| ''[[:d:Q8005819|William Brace]]''
| [[File:William Brace.JPG|center|128px]]
| 1865-09-23
| 1947-10-12
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 5514
| ''[[:d:Q8005843|William Bradshaw]]''
| [[File:William Bradshaw by Enoch Seeman.jpg|center|128px]]
| 1671
| 1732
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5515
| ''[[:d:Q8006111|William Bulkeley]]''
|
| 1691-11-04
| 1760
| ''[[:d:Q13129631|Llanfechell]]''
|-
| style='text-align:right'| 5516
| ''[[:d:Q8006477|William Camden Edwards]]''
|
| 1777
| 1855-08-22
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 5517
| ''[[:d:Q8006723|William Charles Fuller]]''
|
| 1884-03-13
| 1974-12-29
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 5518
| ''[[:d:Q8007106|William Cope, 1st Baron Cope]]''
| [[File:Lord Cope.jpg|center|128px]]
| 1870-08-18
| 1946-07-15
| ''[[:d:Q7339915|Rhath]]''
|-
| style='text-align:right'| 5519
| ''[[:d:Q8007183|William Cove]]''
|
| 1888-05-21
| 1963-03-15
| [[Pontypridd]]
|-
| style='text-align:right'| 5520
| ''[[:d:Q8007280|William Crawshay II]]''
| [[File:William Crawshay II (1788–1867).jpg|center|128px]]
| 1788-03-27
| 1867-08-04
| ''[[:d:Q7162500|Pendoylan]]''
|-
| style='text-align:right'| 5521
| ''[[:d:Q8007617|William David Owen]]''
|
| 1874-10-21
| 1925-11-04
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 5522
| ''[[:d:Q8007618|William David Phillips]]''
|
| 1855-08-16
| 1918-10-15
| [[Cairdiff]]
|-
| style='text-align:right'| 5523
| ''[[:d:Q8007633|William Davies]]''
| [[File:Syr-William-Davies-AS-Sir-Benfro.jpg|center|128px]]
| 1821-08-23
| 1895-11-23
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5524
| ''[[:d:Q8007637|William Davies]]''
|
| 1882-04-13
| 1966-01-21
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5525
| ''[[:d:Q8007641|William Davies]]''
|
| 1890-12-27
| 1967-09-18
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 5526
| ''[[:d:Q8007642|William Davies]]''
|
| No/unknown value
| 1593-07-27
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 5527
| ''[[:d:Q8007644|William Davies]]''
|
| 1916-08-23
|
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 5528
| ''[[:d:Q8008479|William Edwards]]''
|
| 1851-01-22
| 1940-02-12
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5529
| ''[[:d:Q8008480|William Edwards]]''
|
| 1938-01-06
| 2007-08-16
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 5530
| ''[[:d:Q8008498|William Egan]]''
|
| 1872
| 1946
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 5531
| ''[[:d:Q8008562|William Ellis Bailiff]]''
|
| 1882-03-19
| 1972
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 5532
| ''[[:d:Q8008626|William Erbery]]''
|
| 1604
| 1654-04
| ''[[:d:Q39011988|Roath Dogfield]]''
|-
| style='text-align:right'| 5533
| ''[[:d:Q8008690|William Evans]]''
|
| 1895-11-24
| 1988-09-20
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 5534
| ''[[:d:Q8008691|William Evans]]''
|
| 1853-09
| 1919-04-23
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 5535
| ''[[:d:Q8008695|William Evans]]''
|
|
|
| ''[[:d:Q6661277|Llanedi]]''
|-
| style='text-align:right'| 5536
| ''[[:d:Q8008698|William Evans]]''
| [[File:William George Evans (1883 – 1946).jpg|center|128px]]
| 1883-03-23
| 1946-01-23
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 5537
| ''[[:d:Q8009059|William Finney]]''
|
| 1866-08-13
| 1927-05-08
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 5538
| ''[[:d:Q8009287|William Foxwist]]''
|
| 1610
| 1673
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5539
| ''[[:d:Q8009291|William Frame]]''
| [[File:The Pierhead Building, Cardiff Bay - geograph.org.uk - 852953.jpg|center|128px]]
| 1848
| 1906-04
| ''[[:d:Q1035742|Cardiff Castle]]''
|-
| style='text-align:right'| 5540
| ''[[:d:Q8009876|William Gilbert Rees]]''
| [[File:William Gilbert Rees, July 1853.jpg|center|128px]]
| 1827-04-06
| 1898-10-31
| ''[[:d:Q18160141|Haroldston St. Issell's]]''
|-
| style='text-align:right'| 5541
| ''[[:d:Q8010078|William Graham]]''
| [[File:William Graham - National Assembly for Wales.jpg|center|128px]]
| 1949-11-18
|
| [[Newport]]
|-
| style='text-align:right'| 5542
| ''[[:d:Q8010301|William Gwynn]]''
| [[File:Gwynn William.JPG|center|128px]]
| 1856
| 1897-04-01
| [[Swansea]]
|-
| style='text-align:right'| 5543
| ''[[:d:Q8010926|William Harris]]''
|
| 1884-04-28
| 1956-01-23
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 5544
| ''[[:d:Q8011018|William Havard]]''
| [[File:Bishop Havard by Evan Walters.jpg|center|128px]]
| 1889-10-23
| 1956-08-17
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 5545
| ''[[:d:Q8012147|William Henry Scourfield]]''
|
| 1776
| 1843-01-31
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 5546
| ''[[:d:Q8012148|William Henry Seager]]''
| [[File:WHSeager.jpg|center|128px]]
| 1862
| 1941-03-10
| [[Cairdiff]]
|-
| style='text-align:right'| 5547
| ''[[:d:Q8012259|William Herbert Waring]]''
|
| 1885-10-13
| 1918-10-08
| [[Welshpool]]
|-
| style='text-align:right'| 5548
| ''[[:d:Q8012322|William Higgins]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5549
| ''[[:d:Q8012504|William Hopper]]''
|
| 1922
| 2008-09
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5550
| ''[[:d:Q8012598|William Howell]]''
|
| 1863-12
|
| [[Swansea]]
|-
| style='text-align:right'| 5551
| ''[[:d:Q8012638|Billy Hughes]]''
|
| 1865
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 5552
| ''[[:d:Q8013054|Gerry Humphreys]]''
|
| 1931-05-11
| 2006-12-05
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 5553
| ''[[:d:Q8013397|William Jackson]]''
|
| 1876-01-27
| 1954-03-25
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 5554
| ''[[:d:Q8013423|William James]]''
|
| 1902-07-16
| 1972-02-27
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 5555
| ''[[:d:Q8013623|W. J. Gruffydd]]''
| [[File:W. J. Gruffydd.jpg|center|128px]]
| 1881-02-14
| 1954-09-29
| ''[[:d:Q3402550|Bethel]]''
|-
| style='text-align:right'| 5556
| ''[[:d:Q8013655|William John Parry]]''
| [[File:WJParry.jpg|center|128px]]
| 1842-03-28
| 1927-09-01
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 5557
| ''[[:d:Q8013687|William Johnson]]''
|
| No/unknown value
| 1997-06-13
| [[Wales]]
|-
| style='text-align:right'| 5558
| ''[[:d:Q8013720|William Jones]]''
|
| 1755-11-18
| 1821-10-12
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5559
| ''[[:d:Q8013725|William Jones]]''
| [[File:William Jones AS Arfon.jpg|center|128px]]
| 1859
| 1915-05-09
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 5560
| ''[[:d:Q8013728|William Jones]]''
|
| 1876
| 1918-05-06
| ''[[:d:Q7164562|Penrhiw-ceibr]]''
|-
| style='text-align:right'| 5561
| ''[[:d:Q8013729|William Jones]]''
| [[File:William Jones (1726-1795).jpeg|center|128px]]
| 1726-06
| 1795-08-20
| ''[[:d:Q6661409|Llangadfan]]''
|-
| style='text-align:right'| 5562
| ''[[:d:Q8013731|William Jones]]''
|
| 1676-02-26
| 1725-11-29
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 5563
| ''[[:d:Q8014533|William Lewis, 1st Baron Merthyr]]''
| [[File:William Lewis, 1st Baron Merthyr.jpg|center|128px]]
| 1837-08-05
| 1914-08-27
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5564
| ''[[:d:Q8014542|William James Lewis]]''
|
| 1847-01-10
| 1926-04-16
| ''[[:d:Q13129674|Llanwyddelan]]''
|-
| style='text-align:right'| 5565
| ''[[:d:Q8014552|William Lewis Thomas]]''
|
| 1913-06-30
| 1995-02-01
| [[Ystradgynlais]]
|-
| style='text-align:right'| 5566
| ''[[:d:Q8014626|William Llewellyn Morgan]]''
|
| 1884-01-01
| 1960-04-11
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5567
| ''[[:d:Q8014627|William Llewellyn Thomas]]''
|
| 1872-05-06
| 1943-01-09
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5568
| ''[[:d:Q8014630|William Llewelyn Davies]]''
|
| 1887-10-11
| 1952-11-11
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 5569
| ''[[:d:Q8014638|William Lloyd]]''
|
| 1782-12-29
| 1857-05-16
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5570
| ''[[:d:Q8014765|William Lucas Collins]]''
|
| 1815
| 1887-03-24
| ''[[:d:Q645198|Oxwich]]''
|-
| style='text-align:right'| 5571
| ''[[:d:Q8015052|William Mainwaring]]''
|
| 1884
| 1971-05-18
| ''[[:d:Q5446227|Fforestfach]]''
|-
| style='text-align:right'| 5572
| ''[[:d:Q8015101|William Mansel]]''
| [[File:WilliamLortMansel.jpg|center|128px]]
| 1753-04-02
| 1820-06-27
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 5573
| ''[[:d:Q8015535|William Meggitt]]''
|
| 1894
| 1927-01-28
| [[Newport]]
|-
| style='text-align:right'| 5574
| ''[[:d:Q8015629|William Milbourne James]]''
| [[File:William M James the judge.jpg|center|128px]]
| 1807
| 1881-06-07
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5575
| ''[[:d:Q8015715|William Molloy, Baron Molloy]]''
|
| 1918-10-26
| 2001-05-26
| [[Swansea]]
|-
| style='text-align:right'| 5576
| ''[[:d:Q8015809|William Morgan]]''
| [[File:Thomas Lawrence - Portrait of William Morgan (1750-1833).jpg|center|128px]]
| 1750-05-26
| 1833-05-04
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5577
| ''[[:d:Q8015812|William Morgan]]''
|
| No/unknown value
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 5578
| ''[[:d:Q8016046|William Nathaniel Jones]]''
|
| 1858-03-20
| 1934-05-24
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 5579
| ''[[:d:Q8016190|William Norton]]''
|
| 1862-04-28
| 1898-12-17
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5580
| ''[[:d:Q8016385|William Osborne Smith]]''
| [[File:William Osborne Smith -Past masters, St Paul's Lodge, 374, ERmontage of 36 photographs (HS85-10-25525) (cropped).jpg|center|128px]]
| 1833
| 1887-05-11
| [[Wales]]
|-
| style='text-align:right'| 5581
| ''[[:d:Q8016424|William Owen Pughe]]''
| [[File:William Owen Pughe.jpg|center|128px]]
| 1759-08-07
| 1835-06-04
| ''[[:d:Q3400119|Llanfihangel-y-Pennant]]''
|-
| style='text-align:right'| 5582
| ''[[:d:Q8016742|William Penfro Rowlands]]''
|
| 1860-04-19
| 1937-10-22
| ''[[:d:Q18160658|Llys-y-frân]]''
|-
| style='text-align:right'| 5583
| ''[[:d:Q8017032|William Powell]]''
|
| 1948-08-03
| 2022-03-23
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 5584
| ''[[:d:Q8017036|William Powell]]''
| [[File:William Powell - National Assembly for Wales.jpg|center|128px]]
|
|
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 5585
| ''[[:d:Q8017083|William Price]]''
| [[File:William Price painting (2).jpg|center|128px]]
| 1800-03-04
| 1893-01-23
| ''[[:d:Q7377542|Rhydri]]''
|-
| style='text-align:right'| 5586
| ''[[:d:Q8017260|William R. P. George]]''
|
| 1912-10-20
| 2006-11-20
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 5587
| ''[[:d:Q8017443|William Rees]]''
| [[File:Dr William Rees (Gwilym Hiraethog, 1802-83) (1870) NLW3364252.jpg|center|128px]]
| 1802-11-08
| 1883-11-08
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 5588
| ''[[:d:Q8017448|William Rees Morgan Davies]]''
| [[File:William Rees-Davies.png|center|128px]]
| 1863-05-11
| 1939-04-14
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 5589
| ''[[:d:Q8017467|William Reid Clanny]]''
|
| 1776
| 1850-01-10
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5590
| ''[[:d:Q8017511|William Rhodes]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5591
| ''[[:d:Q8017514|William Rhys-Herbert]]''
|
| 1868
| 1921-10-03
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 5592
| ''[[:d:Q8017521|William Richard Arnold]]''
|
| 1881-07-07
| 1957-07-30
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 5593
| ''[[:d:Q8017537|William Richards]]''
|
| 1991-12-18
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 5594
| ''[[:d:Q8017538|William Richards]]''
| [[File:William Richards minister.jpg|center|128px]]
| 1749
| 1818-09-13
| ''[[:d:Q16898205|Penrydd]]''
|-
| style='text-align:right'| 5595
| ''[[:d:Q8017648|William Roberts]]''
|
| 1585
| 1665-08-12
| ''[[:d:Q13129677|Llanynys]]''
|-
| style='text-align:right'| 5596
| ''[[:d:Q8017651|William Roberts]]''
|
| 1859
|
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 5597
| ''[[:d:Q8017653|William Roberts]]''
|
| 1863
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 5598
| ''[[:d:Q8017657|William Roberts]]''
| [[File:William Roberts (physician).jpg|center|128px]]
| 1830-03-18
| 1899-04-16
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 5599
| ''[[:d:Q8017668|William Robertson]]''
|
| 1873<br/>1874-04-08
| No/unknown value
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 5600
| ''[[:d:Q8017750|William Roos]]''
|
| 1808-04-30
| 1878-07-04
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 5601
| ''[[:d:Q8017810|William Rowland]]''
|
| 1904-02-24
| 1942-04-12
| ''[[:d:Q2075495|Rhos-on-Sea]]''
|-
| style='text-align:right'| 5602
| ''[[:d:Q8018052|William Salesbury]]''
| [[File:William Salesbury on the Translator's Memorial; Llanelwy - St Asaph, Cymru 07.jpg|center|128px]]
| 1520
| 1584
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 5603
| ''[[:d:Q8018108|William Sandham]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5604
| ''[[:d:Q8018129|William Sarvis]]''
|
| 1898-07
| 1968-03-22
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5605
| ''[[:d:Q8019049|William T. Davies]]''
| [[File:William Tecumseh Davies (1831–1912), Lieutenant Governor of Pennsylvania from 1887–91.jpg|center|128px]]
| 1831-12-20
| 1912-09-21
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 5606
| ''[[:d:Q8019284|William Thomas]]''
| [[File:Revd William Thomas (Gwilym Marles, 1834-79) (U) NLW3364226.jpg|center|128px]]
| 1834-04-07
| 1879-12-11
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 5607
| ''[[:d:Q8019287|William Thomas]]''
| [[File:Portrait of William Thomas, 'Islwyn' (4671182).jpg|center|128px]]
| 1832-04-03
| 1878-11-20
| ''[[:d:Q8054074|Ynysddu]]''
|-
| style='text-align:right'| 5608
| ''[[:d:Q8019290|William Thomas]]''
|
| 1734
| 1799-09-03
| ''[[:d:Q6759079|Margam]]''
|-
| style='text-align:right'| 5609
| ''[[:d:Q8019294|William Thomas]]''
|
| 1885
|
| [[Wales]]
|-
| style='text-align:right'| 5610
| ''[[:d:Q8019295|William Thomas]]''
|
| No/unknown value
| 1972
| [[Wales]]
|-
| style='text-align:right'| 5611
| ''[[:d:Q8019440|William Todd-Jones]]''
|
| 1958
|
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 5612
| ''[[:d:Q8020060|William Watkin Edward Wynne]]''
| [[File:Portrait of William Watkin Edward Wynne (4674672) (cropped).jpg|center|128px]]
| 1801-12-23
| 1880-06-09
| ''[[:d:Q11047227|Peniarth]]''
|-
| style='text-align:right'| 5613
| ''[[:d:Q8020385|William Williams]]''
| [[File:William-Williams-AS.jpg|center|128px]]
| 1840-11-14
| 1904-04-21
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 5614
| ''[[:d:Q8020386|William Williams]]''
| [[File:VCWilliamWilliams.jpg|center|128px]]
| 1890-10-05
| 1965-10-22
| [[Anglesey]]
|-
| style='text-align:right'| 5615
| ''[[:d:Q8020391|William Williams]]''
|
| 1856
| No/unknown value
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 5616
| ''[[:d:Q8020392|William Williams]]''
|
| 1859-02-11
| 1892-04-22
| [[Ceredigion]]
|-
| style='text-align:right'| 5617
| ''[[:d:Q8020395|William Williams]]''
|
| 1925-03-28
| 2007-12-27
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 5618
| ''[[:d:Q8020396|William Williams]]''
|
| No/unknown value
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 5619
| ''[[:d:Q8020402|William Williams]]''
|
| 1927-02-25
| 2011-01-27
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 5620
| ''[[:d:Q8020407|William Williams of Wern]]''
| [[File:Revd William Williams (1781-1840) (print) NLW3365416.jpg|center|128px]]
| 1781
| 1840-03-17
| ''[[:d:Q3402212|Llanfachreth]]''
|-
| style='text-align:right'| 5621
| ''[[:d:Q8020624|William Wynn-Williams]]''
| [[File:1882 MHRs William Wynn-Williams.jpg|center|128px]]
| 1828
| 1913-10-27
| ''[[:d:Q3399915|Llangar]]''
|-
| style='text-align:right'| 5622
| ''[[:d:Q8020629|William Wynne]]''
|
| 1671
| 1704-05
| ''[[:d:Q17744479|Garthewin]]''
|-
| style='text-align:right'| 5623
| ''[[:d:Q8020631|William Wynter]]''
|
| 1521
| 1589-02-20
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5624
| ''[[:d:Q8021457|Willie Davies]]''
|
| 1916-08-23
| 2002-09-26
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 5625
| ''[[:d:Q8021458|Willie Davies]]''
|
| 1900-03-10
| 1953
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 5626
| ''[[:d:Q8021846|Willie Thomas]]''
| [[File:Willie Thomas (Rygbi).jpg|center|128px]]
| 1866-03-22
| 1921-10-11
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 5627
| ''[[:d:Q8021889|Willie Whitehill]]''
|
| 1934-06-13
|
| [[Newport]]
|-
| style='text-align:right'| 5628
| ''[[:d:Q8023109|Wilson Jones]]''
| [[File:1946 AIK-Birmingham ity FC.jpg|center|128px]]
| 1914-04-29
| 1986-01-09
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5629
| ''[[:d:Q8025410|Winifred Maxwell, Countess of Nithsdale]]''
| [[File:Winifred Maxwell, Countess of Nithsdale.jpg|center|128px]]
| 1672
| 1749
| [[Welshpool]]
|-
| style='text-align:right'| 5630
| ''[[:d:Q8026122|Winston Roddick]]''
|
| 1940-10-02
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5631
| ''[[:d:Q8040064|Wyn Davies]]''
|
| 1942-03-20
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5632
| ''[[:d:Q8040067|Wyn Davies]]''
| [[File:Wyn Davies (cropped).jpg|center|128px]]
| 1952-05-08
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 5633
| ''[[:d:Q8040069|Wyn Calvin]]''
| [[File:Wyn Calvin.jpg|center|128px]]
| 1925-08-28
| 2022-01-25
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 5634
| ''[[:d:Q8040073|Wyn Williams]]''
| [[File:Wyn Williams.JPG|center|128px]]
| 1951-03-31
|
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 5635
| ''[[:d:Q8040109|Wyndham Emery]]''
|
| 1897
| 1969
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5636
| ''[[:d:Q8040147|Wynford Dore]]''
|
| 1949-06-10
|
| ''[[:d:Q7821209|Tongwynlais]]''
|-
| style='text-align:right'| 5637
| ''[[:d:Q8040155|Wynford Vaughan-Thomas]]''
| [[File:The Wynford Vaughan-Thomas Memorial (5665468287).jpg|center|128px]]
| 1908-08-15
| 1987-02-04
| [[Swansea]]
|-
| style='text-align:right'| 5638
| ''[[:d:Q8040203|Wynne Hooper]]''
|
| 1952-06-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 5639
| ''[[:d:Q8040207|Wynne Evans]]''
| [[File:A Song In My Heart.jpg|center|128px]]
| 1972-01-27
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5640
| ''[[:d:Q8040449|Wyre Davies]]''
|
|
|
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 5641
| ''[[:d:Q8049836|Yasmin Yusuff]]''
|
| 1955
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5642
| ''[[:d:Q8069294|Zephaniah Williams]]''
| [[File:Zephaniah Williams - Illustrated Australian News (1874).jpg|center|128px]]
| 1795
| 1874-05-08
| ''[[:d:Q378738|Argoed]]''
|-
| style='text-align:right'| 5643
| ''[[:d:Q8073285|Zoe Lyons]]''
| [[File:Zoe Lyons Cigar Wink High Res.jpg|center|128px]]
| 1971-10-03
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 5644
| ''[[:d:Q8451565|Robert Wade]]''
|
| 1962
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 5645
| ''[[:d:Q8784090|Nathan Craze]]''
|
| 1986-11-26
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5646
| ''[[:d:Q9218440|Edward Lyndon Rees]]''
| [[File:L.Ryees DBay.jpg|center|128px]]
| 1939-01-19
|
| [[Wales]]
|-
| style='text-align:right'| 5647
| ''[[:d:Q9275390|Graham Harcourt]]''
|
| 1934
| 2015
| [[Swansea]]
|-
| style='text-align:right'| 5648
| ''[[:d:Q9346589|Evan Jenkins]]''
|
| 1895-05-02
| 1959-11-02
| ''[[:d:Q13128409|Ffair Rhos]]''
|-
| style='text-align:right'| 5649
| ''[[:d:Q9357296|Teresa Helena Higginson]]''
| [[File:Teresa Helena Higginson Servant of God.jpg|center|128px]]
| 1844-05-27
| 1905-02-15
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 5650
| ''[[:d:Q9371662|Wayne Cegielski]]''
|
| 1956-01-11
|
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 5651
| ''[[:d:Q10314880|Kyle Redmond-Jones]]''
|
| 1986-03-06
|
| [[Wales]]
|-
| style='text-align:right'| 5652
| ''[[:d:Q10379452|Lee Jones]]''
|
| 1973-05-29
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5653
| ''[[:d:Q10382040|Lot Jones]]''
| [[File:Lot Jones Footballer.jpg|center|128px]]
| 1882-06-28<br/>1882-04
| 1941-07-13
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 5654
| ''[[:d:Q10387537|Nathan Jones]]''
| [[File:Nathan Jones (Welsh footballer).jpg|center|128px]]
| 1973-05-28
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 5655
| ''[[:d:Q10388322|Malcolm Allen]]''
|
| 1967-03-21
|
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 5656
| ''[[:d:Q10391964|Billy Thomas]]''
|
| 1903-08-20
| 1992
| [[Wales]]
|-
| style='text-align:right'| 5657
| ''[[:d:Q10392508|John Mahoney]]''
|
| 1946-09-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5658
| ''[[:d:Q10395857|Ivor Perry]]''
|
| 1904-08
|
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 5659
| ''[[:d:Q10396757|Neil Edwards]]''
|
| 1970-12-05
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5660
| ''[[:d:Q10407045|Kaid Mohamed]]''
| [[File:Kaid Mohamed York City v. Bath City 16-10-10 1.png|center|128px]]
| 1984-07-23
|
| ''[[:d:Q5368392|Trelái]]''
|-
| style='text-align:right'| 5661
| ''[[:d:Q10409543|Dudley Lewis]]''
|
| 1962-11-17
|
| [[Swansea]]
|-
| style='text-align:right'| 5662
| ''[[:d:Q10409906|Bernard Purdie]]''
|
| 1949-04-20
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5663
| ''[[:d:Q10413935|Karl Elsey]]''
|
| 1958-11-20
|
| [[Swansea]]
|-
| style='text-align:right'| 5664
| ''[[:d:Q10416121|Horace Williams]]''
|
| 1900
| 1960-10-29
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 5665
| ''[[:d:Q10427199|Nigel Edwards]]''
|
| 1950-12-31
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5666
| ''[[:d:Q10428766|Jason Rowbotham]]''
|
| 1969-01-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5667
| ''[[:d:Q10429555|Linden Jones]]''
|
| 1961-03-05
|
| ''[[:d:Q3402398|New Tredegar]]''
|-
| style='text-align:right'| 5668
| ''[[:d:Q10433007|Paul Wheeler]]''
|
| 1965-01-03
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 5669
| ''[[:d:Q10441659|Richard Jones]]''
|
| 1969-04-26
|
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 5670
| ''[[:d:Q10449958|Harry Beadles]]''
| [[File:Harry Beadles.jpg|center|128px]]
| 1897-09-28
| 1958-08-29
| ''[[:d:Q13129664|Llanllwchaiarn]]''
|-
| style='text-align:right'| 5671
| ''[[:d:Q10455270|John Hughes]]''
|
| 1942-02-18
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 5672
| ''[[:d:Q10459260|Ted Hughes]]''
| [[File:Edward "Ted" Hughes.jpg|center|128px]]
| 1876
|
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 5673
| ''[[:d:Q10477308|Richard Hurlin]]''
|
| 1984-01-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5674
| ''[[:d:Q10480632|Milly Durrant]]''
|
| 1985-05-09
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 5675
| ''[[:d:Q10488853|Morrys Scott]]''
|
| 1970-12-17
|
| [[Swansea]]
|-
| style='text-align:right'| 5676
| ''[[:d:Q10493312|Steve Gammon]]''
|
| 1939-09-24
|
| [[Swansea]]
|-
| style='text-align:right'| 5677
| ''[[:d:Q10495488|Jack Lewis]]''
|
| 1902-01-16
| No/unknown value
| [[Newport]]
|-
| style='text-align:right'| 5678
| ''[[:d:Q10499403|Robert Roberts]]''
|
| 1865
| 1945-10-01
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 5679
| ''[[:d:Q10501113|James Trainer]]''
| [[File:James Trainer.jpg|center|128px]]
| 1863-01-07
| 1915-08-05
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5680
| ''[[:d:Q10510315|Frank Hoddinott]]''
|
| 1894-11-29<br/>1894-11-26
| 1980-11
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5681
| ''[[:d:Q10510353|Tony James]]''
|
| 1919-09-16
| 1981
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 5682
| ''[[:d:Q10511916|Harry Montford]]''
|
| 1859
| 1942
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 5683
| ''[[:d:Q10513359|Nicola Davies]]''
|
| 1985-12-28
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5684
| ''[[:d:Q10513486|Zac Evans]]''
|
| 1991-06-03
|
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 5685
| ''[[:d:Q10514110|Loren Dykes]]''
| [[File:Loren Dykes.jpg|center|128px]]
| 1988-02-05
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 5686
| ''[[:d:Q10514727|Wyndham Evans]]''
|
| 1951-03-19
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5687
| ''[[:d:Q10517262|David Davies]]''
|
| 1888-10-01
| No/unknown value
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 5688
| ''[[:d:Q10518079|Ibrahim Farah]]''
| [[File:Farah, Ibrahim.jpg|center|128px]]
| 1992-01-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5689
| ''[[:d:Q10519662|John Pugsley]]''
|
| 1900-04-01
| 1976
| ''[[:d:Q5595745|Grangetown]]''
|-
| style='text-align:right'| 5690
| ''[[:d:Q10521309|David Summerhayes]]''
|
| 1940s
|
| [[Wales]]
|-
| style='text-align:right'| 5691
| ''[[:d:Q10524861|Bert Gray]]''
|
| 1900-09-23
| 1969-12-16
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 5692
| ''[[:d:Q10525511|Bill Roberts]]''
|
| 1859-03-18
| 1945-06-12
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5693
| ''[[:d:Q10527809|Idwal Davies]]''
|
| 1899-08-17
| 1980-06-07
| ''[[:d:Q3401129|Ewloe]]''
|-
| style='text-align:right'| 5694
| ''[[:d:Q10538955|Percy Roberts]]''
|
| 20th century
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5695
| ''[[:d:Q10546480|Harry Hanford]]''
|
| 1907-10-09
| 1996
| ''[[:d:Q4923812|Blaengwynfi]]''
|-
| style='text-align:right'| 5696
| ''[[:d:Q10548006|Les Jones]]''
|
| 1940-11-09
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5697
| ''[[:d:Q10548318|Harvey Jones]]''
|
| 1936-08-16
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5698
| ''[[:d:Q10554425|Alan Halsall]]''
|
| 1940-11-17
|
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 5699
| ''[[:d:Q10555802|Roy Finch]]''
|
| 1922-04-07
| 2007-08-14
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 5700
| ''[[:d:Q10555958|Carl Slee]]''
|
| 1947-11-30
|
| [[Swansea]]
|-
| style='text-align:right'| 5701
| ''[[:d:Q10556877|Robert Speakman]]''
|
| 1980-12-05
|
| [[Swansea]]
|-
| style='text-align:right'| 5702
| ''[[:d:Q10556901|Micky Bloor]]''
|
| 1949-03-25
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5703
| ''[[:d:Q10567797|Desmond Brayley, Baron Brayley]]''
| [[File:Desmond Brayley.jpg|center|128px]]
| 1917-01-29
| 1977-03-16
| [[Pontypridd]]
|-
| style='text-align:right'| 5704
| ''[[:d:Q10965002|Gwladus ferch Senana]]''
|
| 13rd century
|
| [[Wales]]
|-
| style='text-align:right'| 5705
| ''[[:d:Q10969182|Gwyn Griffiths]]''
|
| 1941-01-11
| 2018-04-29
| ''[[:d:Q15963881|Swyddffynnon]]''
|-
| style='text-align:right'| 5706
| ''[[:d:Q10970620|Nigel Jenkins]]''
|
| 1949-07-20
| 2014-01-28
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 5707
| ''[[:d:Q10976448|Hannah Stone]]''
|
| 1987-04-27
|
| [[Swansea]]
|-
| style='text-align:right'| 5708
| ''[[:d:Q10978349|Edward Richard]]''
|
| 1714-03
| 1777-02-28
| ''[[:d:Q3402138|Ystrad Meurig]]''
|-
| style='text-align:right'| 5709
| ''[[:d:Q10982897|William Williams]]''
|
| 1832
| 1900-11-12
| ''[[:d:Q23727092|Bontnewydd]]''<br/>''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5710
| ''[[:d:Q10994531|Marged ferch Ifan]]''
|
| 1699<br/>1768
| 1788
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 5711
| ''[[:d:Q10995139|Afan Ferddig]]''
|
| 7th century
| 8th century
| [[Wales]]
|-
| style='text-align:right'| 5712
| ''[[:d:Q10997050|Dyddgu Owen]]''
|
| 1906
| 1992
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 5713
| ''[[:d:Q11001414|Huw Garmon]]''
|
| 1966-10-15
|
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 5714
| ''[[:d:Q11003861|William Williams]]''
| [[File:William Crwys Williams (Crwys).jpg|center|128px]]
| 1875-01-04
| 1968-01-13
| ''[[:d:Q5180813|Craig Cefn Parc]]''
|-
| style='text-align:right'| 5715
| ''[[:d:Q11005077|Rhiannon Davies Jones]]''
|
| 1921-11-03
| 2014-10-22
| ''[[:d:Q3395863|Llanbedr]]''
|-
| style='text-align:right'| 5716
| ''[[:d:Q11010724|Sion Jones]]''
|
| 1979
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5717
| ''[[:d:Q11017673|Humphrey Owen Jones]]''
|
| 1878-02-20
| 1912-08-12
| ''[[:d:Q15427716|Goginan]]''
|-
| style='text-align:right'| 5718
| ''[[:d:Q11024973|John Harries]]''
|
| 1785
| 1839-05-11<br/>1839
| ''[[:d:Q13127612|Cwrt-y-cadno]]''
|-
| style='text-align:right'| 5719
| ''[[:d:Q11025719|Jane Edwards]]''
|
| 1938
|
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 5720
| ''[[:d:Q11026121|Llŷr Williams]]''
|
| 1976
|
| ''[[:d:Q7165288|Pentre Bychan]]''
|-
| style='text-align:right'| 5721
| ''[[:d:Q11063761|Dafydd Huws]]''
|
| 1949
| 2020-04-15
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5722
| ''[[:d:Q11129881|Ernest Willows]]''
|
| 1886-07-11
| 1926-08-23
| [[Cairdiff]]
|-
| style='text-align:right'| 5723
| ''[[:d:Q11155368|Tecwyn Ifan]]''
| [[File:Goreuon, album cover.jpg|center|128px]]
| 1952-05
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 5724
| ''[[:d:Q11161686|Idwal Robling]]''
|
| 1927
| 2011-06-09
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 5725
| ''[[:d:Q11162843|Jonathan Morgan]]''
| [[File:Jonathan-Morgan.jpg|center|128px]]
| 1974-11-12
|
| ''[[:d:Q7821209|Tongwynlais]]''
|-
| style='text-align:right'| 5726
| ''[[:d:Q11193133|Rowena Hill]]''
| [[File:Rowenahill01.jpg|center|128px]]
| 1938
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5727
| ''[[:d:Q11208643|Thomas Tudor]]''
| [[File:ThomasTudor.jpg|center|128px]]
| 1785-07-03
| 1885
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 5728
| ''[[:d:Q11246040|Ralph Hancock]]''
|
| 1887-12-20
| 1914-10-29
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 5729
| ''[[:d:Q11280238|Beriah Gwynfe Evans]]''
| [[File:Beriah Gwynfe Evans (cropped).jpg|center|128px]]
| 1848-02-12
| 1927-11-04
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 5730
| ''[[:d:Q11288719|Walter Gibb]]''
|
| 1919-03-26
| 2006-10-04
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 5731
| ''[[:d:Q11351025|Lorna Morgan]]''
| [[File:Lorna Morgan.JPG|center|128px]]
| 1976-02-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5732
| ''[[:d:Q11679925|Archibald Dickson]]''
| [[File:Captain Archibald Dickson Uniform cropped.jpg|center|128px]]
| 1892
| 1939-11-19
| [[Cairdiff]]
|-
| style='text-align:right'| 5733
| ''[[:d:Q11685171|John Daniel Evans]]''
| [[File:John Daniel Evans (1862-1943).jpg|center|128px]]
| 1862
| 1943-03-06
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 5734
| ''[[:d:Q11685219|John Stone]]''
|
| 1924-05-26
| 2007
| [[Cairdiff]]
|-
| style='text-align:right'| 5735
| ''[[:d:Q11738693|Ken Buffin]]''
|
| 1923-11-01
| 1972
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 5736
| ''[[:d:Q11801889|Richard Williams]]''
| [[File:Portrait of a Man in Black, Follower of Hans Holbein the Younger, c. 1600.png|center|128px]]
| 1510
| 1544-10-20
| ''[[:d:Q3397990|Llanishen]]''
|-
| style='text-align:right'| 5737
| ''[[:d:Q11833942|Rebecca Rowe]]''
|
| 1981-05-16
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5738
| ''[[:d:Q11866743|John George Williams]]''
|
| 1913-04-04<br/>1913
| 1997-12-28<br/>1997
| [[Cairdiff]]
|-
| style='text-align:right'| 5739
| ''[[:d:Q11891034|Robert Prys-Jones]]''
|
| 1949
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5740
| ''[[:d:Q11921104|Esyllt T. Lawrence]]''
| [[File:Esyllt T. Lawrence.jpg|center|128px]]
| 1917-12-03
| 1995-04-04
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 5741
| ''[[:d:Q11935381|Maredudd ap Rhys Gryg]]''
|
| 13rd century
| 1271-07-27
| ''[[:d:Q3401324|Dryslwyn Castle]]''
|-
| style='text-align:right'| 5742
| ''[[:d:Q11963604|Chris Twiddy]]''
|
| 1976-01-19
|
| [[Pontypridd]]
|-
| style='text-align:right'| 5743
| ''[[:d:Q11964288|Cyril Jenkins]]''
|
| 1889-10-09<br/>1885-10-09
| 1978-03-15
| [[Swansea]]<br/>''[[:d:Q5315782|Dyfnant]]''
|-
| style='text-align:right'| 5744
| ''[[:d:Q12025739|Joe Dunthorne]]''
|
| 1982
|
| [[Swansea]]
|-
| style='text-align:right'| 5745
| ''[[:d:Q12065586|Penry Williams]]''
| [[File:Portrait of Penry Williams (4671215).jpg|center|128px]]
| 1802
| 1885-07-27<br/>1885
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5746
| ''[[:d:Q12072266|Henry Vivian, 1st Baron Swansea]]''
| [[File:Henry Hussey Vivian, Vanity Fair, 1886-06-05.jpg|center|128px]]
| 1821-07-06
| 1894-11-28
| [[Swansea]]
|-
| style='text-align:right'| 5747
| ''[[:d:Q12072959|Morgan Williams]]''
| [[File:Morgan Williams.jpg|center|128px]]
| 1878-04-21
| 1970-08-04
| [[Wales]]
|-
| style='text-align:right'| 5748
| ''[[:d:Q12162082|Darran Smith]]''
|
| 1975-09-18
|
| [[Pontypridd]]
|-
| style='text-align:right'| 5749
| ''[[:d:Q12300610|Adrian Lloyd Hughes]]''
| [[File:Adrian Lloyd Hughes.jpg|center|128px]]
| 1962-01-02
|
| [[Wales]]
|-
| style='text-align:right'| 5750
| ''[[:d:Q12346622|Douglas B. Gregor]]''
|
| 1909-02-06
| 1995-03-26
| [[Swansea]]
|-
| style='text-align:right'| 5751
| ''[[:d:Q12386943|Daniel ap Llosgwrn Mew]]''
|
| 12nd century
|
| [[Wales]]
|-
| style='text-align:right'| 5752
| ''[[:d:Q12390330|Gwernen ap Clyddno]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5753
| ''[[:d:Q12407875|Hugh Holland]]''
|
| 1569
| 1633-07-23
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5754
| ''[[:d:Q12740776|Shelagh Roberts]]''
|
| 1924-10-13
| 1992-01-16
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 5755
| ''[[:d:Q12784125|Albert Edward Nash]]''
|
| 1882
| 1944-06-04
| [[Wales]]
|-
| style='text-align:right'| 5756
| ''[[:d:Q12794838|Lewis Henry Owain Pugh]]''
|
| 1907-05-18
| 1981-03-10
| ''[[:d:Q5566621|Glandyfi]]''
|-
| style='text-align:right'| 5757
| ''[[:d:Q12795056|Llewellyn Isaac Gethin Morgan-Owen]]''
|
| 1879-03-31
| 1960-11-14
| ''[[:d:Q6661212|Llandinam]]''
|-
| style='text-align:right'| 5758
| ''[[:d:Q12813930|Clive Kingston]]''
|
| 1915-04-08
| 1994
| [[Newport]]
|-
| style='text-align:right'| 5759
| ''[[:d:Q12859012|Margaret Purves]]''
|
| 1935
| 2021
| [[Cairdiff]]
|-
| style='text-align:right'| 5760
| ''[[:d:Q12881301|Betty Bartlett-Ambatielos]]''
|
| 1917-10
| 2011-10-16
| [[Pontypridd]]
|-
| style='text-align:right'| 5761
| ''[[:d:Q12977437|Kay Green]]''
|
| 1927-09-25
| 1997-11-30
| [[Swansea]]
|-
| style='text-align:right'| 5762
| ''[[:d:Q12988572|Lynne Thomas]]''
|
| 1939-09-29
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5763
| ''[[:d:Q13107212|Jones Hewson]]''
| [[File:Jones Hewson (1874–1902) as Luiz in The Gondoliers.png|center|128px]]
| 1874-09-02
| 1902
| [[Swansea]]
|-
| style='text-align:right'| 5764
| ''[[:d:Q13125438|Aled Pugh]]''
| [[File:AledPugh2020.jpg|center|128px]]
| 1980
|
| [[Wales]]
|-
| style='text-align:right'| 5765
| ''[[:d:Q13125439|Aled Rhys Hughes]]''
| [[File:Aled Rhys Hughes.jpg|center|128px]]
| 1966
|
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 5766
| ''[[:d:Q13125469|Alun Jones]]''
|
| 1946
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 5767
| ''[[:d:Q13125471|Alun Llywelyn-Williams]]''
|
| 1913-08-27
| 1988-05-09
| [[Cairdiff]]
|-
| style='text-align:right'| 5768
| ''[[:d:Q13125540|Annes Glynn]]''
|
|
|
| ''[[:d:Q16103637|Brynsiencyn]]''
|-
| style='text-align:right'| 5769
| ''[[:d:Q13125546|Anthony K. Campbell]]''
|
| 1945
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5770
| ''[[:d:Q13125580|Arfon Gwilym]]''
|
| 1950-09-01
|
| ''[[:d:Q13131064|Rhydymain]]''
|-
| style='text-align:right'| 5771
| ''[[:d:Q13125586|Arfon Wyn]]''
|
| 1952-08-26
|
| [[Llanfairpwllgwyngyll]]
|-
| style='text-align:right'| 5772
| ''[[:d:Q13125608|Arthur Howard Williams]]''
|
| 1950-07-11
|
| ''[[:d:Q3404556|Pontyclun]]''
|-
| style='text-align:right'| 5773
| ''[[:d:Q13125609|Arthur of Bardsey]]''
|
| 12nd century
|
| [[Gwynedd]]
|-
| style='text-align:right'| 5774
| ''[[:d:Q13125672|Benjamin Thomas Hopkins]]''
|
| 1897-12-03
| 1981-01-21
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 5775
| ''[[:d:Q13125957|Ben Davies]]''
| [[File:Ben Davies, Pant-teg.jpg|center|128px]]
| 1864
| 1937-01-02
| ''[[:d:Q268367|Cwmllynfell]]''
|-
| style='text-align:right'| 5776
| ''[[:d:Q13125985|Benjamin Francis]]''
| [[File:Portrait of The Revd. Benjamin Francis, A.M (4670733) (cropped).jpg|center|128px]]
| 1734
| 1799-12-14
| ''[[:d:Q5058788|Cenarth]]''
|-
| style='text-align:right'| 5777
| ''[[:d:Q13125995|Beryl Williams]]''
|
| 1937-12-12
| 2004-06<br/>2004-06-18
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 5778
| ''[[:d:Q13126247|Brinley Rees]]''
|
| 1919-12-27
| 2004-10-21
| ''[[:d:Q3404696|Tondu]]''
|-
| style='text-align:right'| 5779
| ''[[:d:Q13126293|Bruce Griffiths]]''
| [[File:Llen Natur Conference May 2017 26.jpg|center|128px]]
| 1938
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 5780
| ''[[:d:Q13126322|Bryan Martin Davies]]''
|
| 1933-04-08
| 2015-08-19<br/>2015-08-26
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 5781
| ''[[:d:Q13126457|Cadwallon ap Gruffydd]]''
|
| 1090s
| 1132
| [[Gwynedd]]
|-
| style='text-align:right'| 5782
| ''[[:d:Q13126875|Cassie Jane Davies]]''
|
| 1898-03-20
| 1988-04-17
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 5783
| ''[[:d:Q13126878|Caryl Lewis]]''
|
| 1978-07-07
|
| [[Birkenhead]]<br/>''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 5784
| ''[[:d:Q13126947|Catrin Dafydd]]''
| [[File:Catrin Dafydd Bardd y Goron Awst 2018 cropped 4.jpg|center|128px]]
| 1982
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5785
| ''[[:d:Q13127291|Crach Ffinnant]]''
|
| 14th century
|
| ''[[:d:Q769782|Kingdom of Powys]]''
|-
| style='text-align:right'| 5786
| ''[[:d:Q13127753|D. J. Davies]]''
|
| 1885-09-02
| 1970-06-04
| [[Wales]]
|-
| style='text-align:right'| 5787
| ''[[:d:Q13127762|Dafydd Benwyn]]''
|
| 16th century
|
| ''[[:d:Q6661452|Llangeinor]]''
|-
| style='text-align:right'| 5788
| ''[[:d:Q13127765|Dafydd Alaw]]''
|
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 5789
| ''[[:d:Q13127766|Dafydd Nicolas]]''
|
| 1705
| 1774
| ''[[:d:Q6661579|Llangynwyd]]''
|-
| style='text-align:right'| 5790
| ''[[:d:Q13127784|Dan Isaac Davies]]''
| [[File:Portrait of Dan Isaac Davies (4669990).jpg|center|128px]]
| 1839-01-24
| 1887-05-28
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 5791
| ''[[:d:Q13127787|Damian Walford Davies]]''
|
| 1971-01-16
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 5792
| ''[[:d:Q13127791|Daniel Morden]]''
|
| 1964
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 5793
| ''[[:d:Q13127792|Daniel Rees]]''
| [[File:Daniel Rees (Cymeriadau TGJ).jpg|center|128px]]
| 1855
| 1931-11-08
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 5794
| ''[[:d:Q13127794|D. Simon Evans]]''
|
| 1921-05-29
| 1998-03-04
| ''[[:d:Q770818|Llanfynydd]]''
|-
| style='text-align:right'| 5795
| ''[[:d:Q13127810|David Davies]]''
| [[File:Portrait of David (Dewi Emlyn) Davies (4673062) (cropped).jpg|center|128px]]
| 1817-11-09
| 1888-08-02
| ''[[:d:Q5058788|Cenarth]]''
|-
| style='text-align:right'| 5796
| ''[[:d:Q13127814|David Ffrangcon-Davies]]''
| [[File:David Ffrangcon Davies.jpg|center|128px]]
| 1855-12-11
| 1918-04-13<br/>1918
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 5797
| ''[[:d:Q13127816|David Rowlands]]''
| [[File:Revd David Rowlands (Dewi Mon, 1836-1907) NLW3361826.jpg|center|128px]]
| 1836-03-04
| 1907
| ''[[:d:Q15272454|Rhosybol]]''
|-
| style='text-align:right'| 5798
| ''[[:d:Q13127818|David Mathew Williams]]''
|
| 1900-05-03
| 1970-11-29
| ''[[:d:Q13126981|Cellan]]''
|-
| style='text-align:right'| 5799
| ''[[:d:Q13127821|David Tecwyn Lloyd]]''
|
| 1914-10-22
| 1992-08-22
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 5800
| ''[[:d:Q13127822|David Myrddin Lloyd]]''
|
| 1909-04-15
| 1981-08-17
| ''[[:d:Q5446227|Fforestfach]]''
|-
| style='text-align:right'| 5801
| ''[[:d:Q13127823|David Miall Edwards]]''
| [[File:David-Miall-Edwards.jpg|center|128px]]
| 1873-01-22
| 1941-01-29
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 5802
| ''[[:d:Q13127839|Deiniolen]]''
|
| 6th century
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5803
| ''[[:d:Q13127844|Deio ab Ieuan Du]]''
|
|
|
| ''[[:d:Q6661559|Llangynfelyn]]''
|-
| style='text-align:right'| 5804
| ''[[:d:Q13127867|Dewi Emrys]]''
| [[File:Dewi Emrys.jpg|center|128px]]
| 1881-05-28
| 1952-09-20
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 5805
| ''[[:d:Q13127868|Dewi 'Pws' Morris]]''
| [[File:Ras yr Iaith dau ddraig a Dewi Pws 2016 Cei Newydd (cropped).jpg|center|128px]]
| 1948-04-21
| 2024-08-22
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 5806
| ''[[:d:Q13127871|Dewi Nantbrân]]''
|
| 18th century
| 1781-10-12
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 5807
| ''[[:d:Q13127926|Dona]]''
|
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 5808
| ''[[:d:Q13128004|Dwywe]]''
| [[File:Church of St Dwywe, Dyffryn Ardudwy.jpg|center|128px]]
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 5809
| ''[[:d:Q13128010|Dyfan Roberts]]''
|
| 1949-06
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 5810
| ''[[:d:Q13128017|Dyfrig Wynn Jones]]''
|
| 1977-01
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5811
| ''[[:d:Q13128018|Dyfnallt Morgan]]''
|
| 1917-05-24
| 1994-10-06
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5812
| ''[[:d:Q13128080|Edward Dafydd]]''
|
| 16th century
|
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 5813
| ''[[:d:Q13128085|Edward Charles]]''
|
| 1757
| 1828
| ''[[:d:Q16071047|Clocaenog]]''
|-
| style='text-align:right'| 5814
| ''[[:d:Q13128086|Edward David Hughes]]''
|
| 1906-06-18
| 1963-06-30
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 5815
| ''[[:d:Q13128095|Efa ferch Madog]]''
|
| 12nd century
|
| [[Powys]]
|-
| style='text-align:right'| 5816
| ''[[:d:Q13128122|Eigra Lewis Roberts]]''
|
| 1939-08-07
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 5817
| ''[[:d:Q13128224|Elena Puw Morgan]]''
|
| 1900-04-19
| 1973-08-17
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 5818
| ''[[:d:Q13128262|Emyr Davies]]''
| [[File:Hugh Emyr Davies (Emyr).jpg|center|128px]]
| 1878-05-31
| 1950-11-21
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 5819
| ''[[:d:Q13128265|Emyr Wyn]]''
|
| 1952
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5820
| ''[[:d:Q13128270|Enghenedl]]''
| [[File:The Llanynghenedl Standing Stone, Anglesey. - geograph.org.uk - 110758.jpg|center|128px]]
| 6th century
|
| [[Anglesey]]
|-
| style='text-align:right'| 5821
| ''[[:d:Q13128283|Enid Pierce Roberts]]''
|
| 1917
| 2010-07-09
| ''[[:d:Q6661409|Llangadfan]]''
|-
| style='text-align:right'| 5822
| ''[[:d:Q13128321|Evan Thomas Davies]]''
|
| 1878-04-10
| 1969-12-25<br/>1969
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5823
| ''[[:d:Q13128322|Evan Jones]]''
| [[File:Evan Jones (Ieuan Gwynedd).jpg|center|128px]]
| 1820-09-05
| 1852-02-23
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 5824
| ''[[:d:Q13128324|Evan Davies]]''
| [[File:Portrait of Evan Davies (4672729).jpg|center|128px]]
| 1801-01-06
| 1888-02-23
| [[Wales]]
|-
| style='text-align:right'| 5825
| ''[[:d:Q13128327|Evan Jones]]''
|
| 1787
| 1859-10
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 5826
| ''[[:d:Q13128330|Evan Keri Evans]]''
| [[File:E Keri Evans.jpg|center|128px]]
| 1860-05-02
| 1941-06-07
| ''[[:d:Q16247790|Pont Ceri]]''
|-
| style='text-align:right'| 5827
| ''[[:d:Q13128331|Evan Evans]]''
| [[File:Ieuan Glan Geirionydd.JPG|center|128px]]
| 1795-04-20
| 1855-01-21
| ''[[:d:Q29483107|Tan-y-Celyn]]''
|-
| style='text-align:right'| 5828
| ''[[:d:Q13128333|Evan Jenkin Evans]]''
|
| 1882-05-20
| 1944-07-02
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 5829
| ''[[:d:Q13128566|Gareth Wynn Jones]]''
|
| 1937
| 2007
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 5830
| ''[[:d:Q13128575|Garry Owen]]''
|
| 1958-05-04
|
| [[Swansea]]
|-
| style='text-align:right'| 5831
| ''[[:d:Q13128587|Gary Slaymaker]]''
|
| 1963-11-08
|
| ''[[:d:Q5197224|Cwmann]]''
|-
| style='text-align:right'| 5832
| ''[[:d:Q13128611|George Lewis]]''
|
| 1763
| 1822-06-05
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 5833
| ''[[:d:Q13128619|Geraint Jarman]]''
| [[File:GeraintJarman.jpg|center|128px]]
| 1950-08-17
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5834
| ''[[:d:Q13128623|Geraint Jones]]''
|
|
|
| [[Gwynedd]]
|-
| style='text-align:right'| 5835
| ''[[:d:Q13128625|Geraint Griffiths]]''
|
| 1949
|
| ''[[:d:Q3072939|Pontrhydyfen]]''
|-
| style='text-align:right'| 5836
| ''[[:d:Q13128662|Glyn M. Ashton]]''
|
| 1910
| 1991
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 5837
| ''[[:d:Q13128670|Glyn Wise]]''
|
| 1988-01-09
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 5838
| ''[[:d:Q13128682|Golyddan Fardd]]''
|
| 7th century
|
| [[Gwynedd]]
|-
| style='text-align:right'| 5839
| ''[[:d:Q13128702|Goronwy ap Heilin]]''
|
|
| 1283
| ''[[:d:Q6661279|Llaneilian]]''
|-
| style='text-align:right'| 5840
| ''[[:d:Q13128777|Gronw Ddu o Fôn]]''
|
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 5841
| ''[[:d:Q13128779|Gruffudd Llwyd]]''
|
| 13rd century
| 1335-07-12
| [[Anglesey]]
|-
| style='text-align:right'| 5842
| ''[[:d:Q13128780|Gronw Ddu]]''
|
|
|
| [[Gwynedd]]
|-
| style='text-align:right'| 5843
| ''[[:d:Q13128784|Gruffydd Young]]''
|
| 1370
| 1435
| [[Flintshire]]
|-
| style='text-align:right'| 5844
| ''[[:d:Q13128786|Gruffudd ab Ieuan ap Llywelyn Fychan]]''
|
| 1485
| 1553
| ''[[:d:Q6662131|Lleweni Hall]]''
|-
| style='text-align:right'| 5845
| ''[[:d:Q13128794|Gruffudd ap Nicolas]]''
|
| 15th century<br/>1385
| 1461
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 5846
| ''[[:d:Q13128795|Gruffudd ap Llywelyn Lwyd]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5847
| ''[[:d:Q13128796|Gruffydd Sion Pritchard]]''
|
| 1987-12-22
|
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 5848
| ''[[:d:Q13128800|Gruffydd Robert]]''
|
| 1527
| 1598
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 5849
| ''[[:d:Q13128857|Gwilym Owen]]''
|
| 1880-07-19
| 1940-11-09
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 5850
| ''[[:d:Q13128861|Gwilym Thomas Hughes]]''
|
| 1895
| 1978
| ''[[:d:Q5572835|Glyn Ceiriog]]''
|-
| style='text-align:right'| 5851
| ''[[:d:Q13128891|Gwyn Elfyn]]''
|
| 1960-02-29
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5852
| ''[[:d:Q13128896|Gwynhoedl]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 5853
| ''[[:d:Q13128901|Gwynin]]''
|
|
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 5854
| ''[[:d:Q13129026|Heledd Cynwal]]''
|
| 1975-05-14
|
| ''[[:d:Q4898006|Bethlehem]]''
|-
| style='text-align:right'| 5855
| ''[[:d:Q13129028|Hywel Heilyn]]''
|
|
|
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 5856
| ''[[:d:Q13129090|Hilma Lloyd Edwards]]''
|
| 1959
|
| ''[[:d:Q3396864|Bontnewydd]]''
|-
| style='text-align:right'| 5857
| ''[[:d:Q13129092|Hillyn]]''
|
| 13rd century
|
| [[Ceredigion]]
|-
| style='text-align:right'| 5858
| ''[[:d:Q13129132|Hopcyn ap Tomas]]''
|
| 1330s
|
| ''[[:d:Q1767482|Ynysforgan]]''
|-
| style='text-align:right'| 5859
| ''[[:d:Q13129135|Horace Charles Jones]]''
|
| 1906-02-06
| 1998-09-12
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5860
| ''[[:d:Q13129158|Hugh Bevan]]''
|
| 1911
| 1979
| ''[[:d:Q7424466|Saron]]''
|-
| style='text-align:right'| 5861
| ''[[:d:Q13129159|Hugh Evans]]''
| [[File:Hugh Evans Cwm eithin.jpg|center|128px]]
| 1854-09-14
| 1934-06-30
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 5862
| ''[[:d:Q13129160|Hugh Brython Hughes]]''
|
| 1848-04-08
| 1913-07-24
| ''[[:d:Q3398942|Tregarth]]''
|-
| style='text-align:right'| 5863
| ''[[:d:Q13129165|Hugh Hughes]]''
| [[File:Hugh Hughes (Hugh Tegai, 1805-64) (print) NLW3361210.jpg|center|128px]]
| 1805
| 1864-12-08
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 5864
| ''[[:d:Q13129166|Hugh Jones]]''
|
| 1749-11-24
| 1825-04-16
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 5865
| ''[[:d:Q13129169|Hugh Hughes]]''
|
| 1693-08-01
| 1776-05-06
| ''[[:d:Q6661266|Llandyfrydog]]''
|-
| style='text-align:right'| 5866
| ''[[:d:Q13129177|Hugh Hughes]]''
|
| 1824-08-20
| 1898-03-07
| [[Anglesey]]
|-
| style='text-align:right'| 5867
| ''[[:d:Q13129190|Huw Chiswell]]''
| [[File:Huw Chiswell - 4492516889.jpg|center|128px]]
| 1961-05-11
|
| [[Swansea]]
|-
| style='text-align:right'| 5868
| ''[[:d:Q13129194|Huw Jones]]''
|
| 1700
| 1782
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 5869
| ''[[:d:Q13129199|Huw Llywelyn Davies]]''
|
| 1945-02-19
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 5870
| ''[[:d:Q13129200|Huw Llwyd]]''
|
| 1568
| 1630
| ''[[:d:Q29484382|Cynfal-fawr]]''
|-
| style='text-align:right'| 5871
| ''[[:d:Q13129201|Huw Edwards]]''
| [[File:Huw Edwards (James Tamim crop).jpg|center|128px]]
| 1961-08-18
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 5872
| ''[[:d:Q13129204|Huw Pritchard]]''
|
| 1976-01-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5873
| ''[[:d:Q13129206|Huw Stephens]]''
| [[File:Meltdown Festival Sunday Surprises Huw Stephens (41075747240).jpg|center|128px]]
| 1981-05-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5874
| ''[[:d:Q13129207|Hydwedd Boyer]]''
|
| 1912-10-31
| 1970
| ''[[:d:Q4733322|Alltwen]]''
|-
| style='text-align:right'| 5875
| ''[[:d:Q13129225|Ian Cottrell]]''
|
| 1973-06-08
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 5876
| ''[[:d:Q13129235|Idwal Jones]]''
|
| 1910-08-01
| 1985-05-31
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 5877
| ''[[:d:Q13129236|Idris Caffrey]]''
|
|
|
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 5878
| ''[[:d:Q13129237|Idris Foster]]''
|
| 1911-07-23
| 1984-06-18
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 5879
| ''[[:d:Q13129239|Iestyn Garlick]]''
|
| 1952-07
|
| [[Swansea]]
|-
| style='text-align:right'| 5880
| ''[[:d:Q13129240|Ifan Morgan Jones]]''
|
| 1984-04
|
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 5881
| ''[[:d:Q13129262|Ioan Bowen Rees]]''
|
| 1929-01-13
| 1999-05-04
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 5882
| ''[[:d:Q13129264|John Jenkin]]''
|
| 1716
| 1796
| ''[[:d:Q6661964|Llechryd]]''
|-
| style='text-align:right'| 5883
| ''[[:d:Q13129265|Iorwerth ab y Cyriog]]''
|
| 14th century
|
| [[Anglesey]]
|-
| style='text-align:right'| 5884
| ''[[:d:Q13129267|Iolo Ceredig Jones]]''
| [[File:Iolo Ceredig Jones.jpg|center|128px]]
| 1947-08-02
| 2021-09-06
| ''[[:d:Q15987290|Coed-y-bryn]]''
|-
| style='text-align:right'| 5885
| ''[[:d:Q13129276|Isaac Carter]]''
|
| No/unknown value
| 1741-05-04
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 5886
| ''[[:d:Q13129280|Isaac Hughes]]''
|
| 1852
| 1928-12-03
| ''[[:d:Q7268591|Quakers Yard]]''
|-
| style='text-align:right'| 5887
| ''[[:d:Q13129281|Isaac Foulkes]]''
| [[File:Mr. Isaac Foulkes (Llyfrbryf) ganwyd Tachwedd 9fed, 1836 ; bu farw Tachwedd 2il, 1904 (5294020).jpg|center|128px]]
| 1836-11-09
| 1904-11-02
| [[Llanfwrog, Denbighshire|Llanfwrog]]
|-
| style='text-align:right'| 5888
| ''[[:d:Q13129288|Iwan Bala]]''
| [[File:Iwan Bala (2009).jpg|center|128px]]
| 1956-05-13
|
| ''[[:d:Q13131214|Sarnau]]''
|-
| style='text-align:right'| 5889
| ''[[:d:Q13129291|J. Brynach Davies]]''
|
| 1873
| 1923-05
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 5890
| ''[[:d:Q13129292|Iwan Llwyd]]''
|
| 1957-11-15
| 2010-05-28
| ''[[:d:Q3402958|Carno]]''
|-
| style='text-align:right'| 5891
| ''[[:d:Q13129296|James Spinther James]]''
| [[File:James Spinther James.jpg|center|128px]]
| 1837-04
| 1914-11-05
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 5892
| ''[[:d:Q13129297|James Nicholas]]''
|
| 1928-03-19
| 2013-09-29
| [[St Davids]]
|-
| style='text-align:right'| 5893
| ''[[:d:Q13129299|Jane Hughes]]''
|
| 1811
| 1878
| ''[[:d:Q3403463|Pontrobert]]''
|-
| style='text-align:right'| 5894
| ''[[:d:Q13129300|Jane Cave]]''
| [[File:Jane Cave from her book.jpg|center|128px]]
| 1754
| 1813
| [[Wales]]
|-
| style='text-align:right'| 5895
| ''[[:d:Q13129307|Jenkin Morgan Edwards]]''
|
| 1903
| 1978
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 5896
| ''[[:d:Q13129308|Jenny Ogwen]]''
|
| 1944
|
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 5897
| ''[[:d:Q13129316|T. James Jones]]''
| [[File:Y Prifardd Jim Parc Nest (cropped).JPG|center|128px]]
| 1934-04-09
|
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 5898
| ''[[:d:Q13129318|John Ambrose Lloyd]]''
| [[File:John Ambrose Lloyd.jpg|center|128px]]
| 1815-06-14
| 1874-11-14
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 5899
| ''[[:d:Q13129319|John Dafydd]]''
|
| 1727
| 1783
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 5900
| ''[[:d:Q13129321|John Barnard Jenkins]]''
| [[File:John-Jenkins.jpg|center|128px]]
| 1933-03-11
| 2020-12-17
| [[Cairdiff]]
|-
| style='text-align:right'| 5901
| ''[[:d:Q13129322|John Elwyn Jones]]''
|
| 1921
| 2008-09-25
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 5902
| ''[[:d:Q13129327|John Griffith Williams]]''
|
| 1915
| 1987
| ''[[:d:Q3404407|Llangwnnadl]]''
|-
| style='text-align:right'| 5903
| ''[[:d:Q13129328|John Geraint Jenkins]]''
|
| 1929-01-04
| 2009-08-05
| ''[[:d:Q927739|Llangrannog]]''
|-
| style='text-align:right'| 5904
| ''[[:d:Q13129329|John Gwilym Jones]]''
|
| 1936-12-16
|
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 5905
| ''[[:d:Q13129332|John Gruffydd Moelwyn Hughes]]''
|
| 1866-05-30
| 1944-06-25
| ''[[:d:Q3398814|Tanygrisiau]]''
|-
| style='text-align:right'| 5906
| ''[[:d:Q13129334|John Humphreys Parry]]''
|
| 1786
| 1825-02-12
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 5907
| ''[[:d:Q13129335|John Griffith]]''
| [[File:John Griffith (Y Gohebydd, 1821-77) NLW3365401.jpg|center|128px]]
| 1821-12-06
| 1877-12-13
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 5908
| ''[[:d:Q13129338|John Lloyd]]''
|
| 1797
| 1875
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5909
| ''[[:d:Q13129341|John Lloyd-Jones]]''
|
| 1885-10-14<br/>1885
| 1956-02-01<br/>1956
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 5910
| ''[[:d:Q13129342|John Parry]]''
| [[File:Dr John Parry.jpg|center|128px]]
| 1812-03-23
| 1874-01-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 5911
| ''[[:d:Q13129344|John Robert Pryse]]''
|
| 1840-06-10
| 1862-11-13
| ''[[:d:Q4657278|Llanrhuddlad]]''
|-
| style='text-align:right'| 5912
| ''[[:d:Q13129345|John Roberts Evans]]''
|
| 1914
| 1982
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 5913
| ''[[:d:Q13129347|John Owen Griffith]]''
|
| 1828
| 1881-11-22
| ''[[:d:Q428829|Caernarfon]]''<br/>[[Welshpool]]
|-
| style='text-align:right'| 5914
| ''[[:d:Q13129355|John Williams]]''
|
| 1728
| 1806-08-26
| ''[[:d:Q14508467|Blaenpennal]]''
|-
| style='text-align:right'| 5915
| ''[[:d:Q13129356|John Thomas]]''
| [[File:Portrait of Y bardd yn ei wely (4674271).jpg|center|128px]]
| 1786-09-17
| 1859-07-08
| ''[[:d:Q3405649|Chwilog]]''
|-
| style='text-align:right'| 5916
| ''[[:d:Q13129357|John Roderick Rees]]''
|
| 1920
| 2009-10
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 5917
| ''[[:d:Q13129358|John Williams]]''
| [[File:Reverend John Williams (1853–1921) (gcf10374).jpg|center|128px]]
| 1854-12-24
| 1921-11-01
| ''[[:d:Q6661266|Llandyfrydog]]''
|-
| style='text-align:right'| 5918
| ''[[:d:Q13129360|John Rowlands]]''
|
| 1915-09-23
| 2006-06-04
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 5919
| ''[[:d:Q13129361|John Williams]]''
|
| 1811-04-07
| 1862-08-27
| ''[[:d:Q16540181|Llangynhafal]]''
|-
| style='text-align:right'| 5920
| ''[[:d:Q13129363|Joshua Thomas]]''
| [[File:Portrait of Joshua Thomas (4673043) (cropped).jpg|center|128px]]
| 1719-02-22
| 1797-08-25
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 5921
| ''[[:d:Q13129368|Josiah Jones]]''
|
| 1807-07-04
| 1887
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 5922
| ''[[:d:Q13129369|Josiah Thomas Jones]]''
|
| 1799-09-23
| 1873-01-27
| ''[[:d:Q5136827|Clydau]]''
|-
| style='text-align:right'| 5923
| ''[[:d:Q13129373|Kate Crockett]]''
|
|
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 5924
| ''[[:d:Q13129493|Laura Anne Jones]]''
| [[File:Laura Anne Jones MS.jpg|center|128px]]
| 1979-02-02
|
| [[Newport]]
|-
| style='text-align:right'| 5925
| ''[[:d:Q13129508|Leah Owen]]''
|
| 1953-10-13
| 2024-01-04
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5926
| ''[[:d:Q13129533|Lewis Davies]]''
|
| 1863-05-18
| 1951-05-18
| ''[[:d:Q5771888|Hirwaun]]''
|-
| style='text-align:right'| 5927
| ''[[:d:Q13129535|Lewis William Lewis]]''
| [[File:Lewis William Lewis (Llew Llwyfo, 1831-1901) NLW3364260.jpg|center|128px]]
| 1831-03-31
| 1901-03-23
| ''[[:d:Q20594352|Llanwenllwyfo]]''
|-
| style='text-align:right'| 5928
| ''[[:d:Q13129536|Lewis o Gaerleon]]''
|
| 15th century
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 5929
| ''[[:d:Q13129538|Lewis Hopkin]]''
|
| 1708
| 1771
| [[Wales]]
|-
| style='text-align:right'| 5930
| ''[[:d:Q13129541|Lewis Holme Lewis]]''
|
| 1866
| 1955-04-03
| ''[[:d:Q7162285|Pencader]]''
|-
| style='text-align:right'| 5931
| ''[[:d:Q13129679|Llechid]]''
| [[File:Llanllechid Church - geograph.org.uk - 110331.jpg|center|128px]]
| 6th century
|
| [[Gwynedd]]
|-
| style='text-align:right'| 5932
| ''[[:d:Q13129698|Lleucu Llwyd]]''
|
|
|
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 5933
| ''[[:d:Q13129915|Manon Rhys]]''
|
| 1948-04-26
|
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 5934
| ''[[:d:Q13129942|Margaret Williams]]''
|
|
|
| ''[[:d:Q16103637|Brynsiencyn]]''
|-
| style='text-align:right'| 5935
| ''[[:d:Q13129949|Mari Lövgreen]]''
|
| 1983
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5936
| ''[[:d:Q13129962|Martin Davis]]''
|
| 1957
|
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 5937
| ''[[:d:Q13129976|Maureen Rhys]]''
|
|
|
| ''[[:d:Q3402521|Cwm y Glo]]''
|-
| style='text-align:right'| 5938
| ''[[:d:Q13130138|Mici Plwm]]''
|
| 1944-06-12
|
| ''[[:d:Q3405667|Llan Ffestiniog]]''
|-
| style='text-align:right'| 5939
| ''[[:d:Q13130248|Moses Glyn Jones]]''
|
| 1913-11-11
| 1994-09-27
| ''[[:d:Q13651447|Mynytho]]''
|-
| style='text-align:right'| 5940
| ''[[:d:Q13130254|Morys Clynnog]]''
|
| 1525
| 1581
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 5941
| ''[[:d:Q13130283|Muriel Drinkwater]]''
|
| 1933
| 1946-06-27
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5942
| ''[[:d:Q13130336|Myron Wyn Evans]]''
|
| 1950-05-26
| 2019-05-02
| [[Swansea]]
|-
| style='text-align:right'| 5943
| ''[[:d:Q13130346|Nans Jones]]''
|
| 1915
| 2009-05-18
| ''[[:d:Q22673780|Penrhosgarnedd]]''
|-
| style='text-align:right'| 5944
| ''[[:d:Q13130360|Nerys Hughes]]''
|
| 1941-11-08
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 5945
| ''[[:d:Q13130551|Owain Meirion]]''
|
| 1803
| 1868-06-24
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 5946
| ''[[:d:Q13130554|Owen Jones]]''
| [[File:Portrait of Owen Jones, 'Meudwy Môn' (4670352) (cropped).jpg|center|128px]]
| 1806-07-15
| 1889-10-11
| ''[[:d:Q10987925|Llanfihangel Ysgeifiog]]''
|-
| style='text-align:right'| 5947
| ''[[:d:Q13130555|Owen Gruffydd]]''
| [[File:Owen Gruffydd.JPG|center|128px]]
| 1643
| 1730-12-06<br/>1730
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 5948
| ''[[:d:Q13130556|Owen Williams]]''
| [[File:Owen Williams (Owain Gwyrfai, 1790-1874) NLW3362699.jpg|center|128px]]
| 1790-01-10
| 1874-10-03
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 5949
| ''[[:d:Q13130558|Owen Owen]]''
|
| 1847-10-13
| 1910-03-27
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 5950
| ''[[:d:Q13130596|Paul Panton]]''
|
| 1727-05-04
| 1797-05-24
| ''[[:d:Q3401133|Bagillt]]''
|-
| style='text-align:right'| 5951
| ''[[:d:Q13130598|Peblig]]''
| [[File:Llanbeblig Hours (f. 3v.) A bishop, possibly St. Peblig, blessing and wearing a mitre, and holding a crosier.jpg|center|128px]]
| 380
|
| [[Wales]]
|-
| style='text-align:right'| 5952
| ''[[:d:Q13130599|Paul Sheppard]]''
|
| 1978-01-12
|
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 5953
| ''[[:d:Q13130737|Peter Jones]]''
| [[File:Portrait of Peter Jones, Bard, Llynlleifiad (4672939) (cropped).jpg|center|128px]]
| 1775-09-17
| 1845-01-26
| ''[[:d:Q3398962|Garndolbenmaen]]''
|-
| style='text-align:right'| 5954
| ''[[:d:Q13130915|R. Gerallt Jones]]''
|
| 1934-09-11
| 1999-01-09
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 5955
| ''[[:d:Q13130916|Ronald Lockley]]''
|
| 1903-11-08
| 2000-04-12
| [[Cairdiff]]
|-
| style='text-align:right'| 5956
| ''[[:d:Q13131021|Rhiannon Wyn]]''
|
| 1979-03-19
|
| ''[[:d:Q3402429|Groeslon]]''
|-
| style='text-align:right'| 5957
| ''[[:d:Q13131044|Rhosier Smyth]]''
|
| 1541
| 1625
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 5958
| ''[[:d:Q13131071|Rhydwen Williams]]''
|
| 1916-08-29
| 1997-08-02
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 5959
| ''[[:d:Q13131075|Rhys Iorwerth]]''
|
| 1983-04-01
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 5960
| ''[[:d:Q13131078|Rhys Jones]]''
|
| 1927
| 2015-01-14
| ''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 5961
| ''[[:d:Q13131094|Richard Williams]]''
|
| 1790
| 1865
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 5962
| ''[[:d:Q13131102|Robert Alun Roberts]]''
|
| 1894-03-10
| 1969-05-19
| ''[[:d:Q3404501|Nantlle]]''
|-
| style='text-align:right'| 5963
| ''[[:d:Q13131111|Robert Williams]]''
|
| 1810-06-29
| 1881-04-26
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 5964
| ''[[:d:Q13131118|Robyn Léwis]]''
|
| 1929-10
| 2019-08-12
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 5965
| ''[[:d:Q13131119|Robin Williams]]''
|
| 1923
| 2004
| ''[[:d:Q14508708|Rhoslan]]''
|-
| style='text-align:right'| 5966
| ''[[:d:Q13131184|Samantha Wynne Rhydderch]]''
|
| 1966
|
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 5967
| ''[[:d:Q13131210|Sarah Jacob]]''
| [[File:Sarah jacob.jpg|center|128px]]
| 1857-05-12
| 1869-12-17
| ''[[:d:Q3404590|Llanfihangel-ar-Arth]]''
|-
| style='text-align:right'| 5968
| ''[[:d:Q13131218|Sassie Rees]]''
|
| 1916
| 2013-03-03
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 5969
| ''[[:d:Q13131449|Sian Owen]]''
|
| 1965-04-08
| 2013-10-03
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 5970
| ''[[:d:Q13131459|Simon B. Jones]]''
|
| 1894-07-05
| 1964-07-27
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 5971
| ''[[:d:Q13131617|Stephen J. Williams]]''
|
| 1896-02-11<br/>1896
| 1992-08-02<br/>1992
| [[Ystradgynlais]]
|-
| style='text-align:right'| 5972
| ''[[:d:Q13131712|Sue Noake]]''
|
| 1952
| 2004-09-10
| [[Wales]]
|-
| style='text-align:right'| 5973
| ''[[:d:Q13131848|Thomas Jacob Thomas]]''
| [[File:Thomas Jacob Thomas (Sarnicol).jpg|center|128px]]
| 1873-04-13
| 1945-12-02
| ''[[:d:Q11054093|Capel Cynon]]''
|-
| style='text-align:right'| 5974
| ''[[:d:Q13131852|Thomas Hudson-Williams]]''
|
| 1873-02-04
| 1961-04-12
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 5975
| ''[[:d:Q13131853|Thomas James Jenkin]]''
|
| 1885-01-08
| 1965
| ''[[:d:Q6729228|Maenclochog]]''<br/>''[[:d:Q29505758|Budloy]]''
|-
| style='text-align:right'| 5976
| ''[[:d:Q13131854|Thomas Evans]]''
|
| 1840-09-08<br/>1840
| 1865-04-29<br/>1865
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 5977
| ''[[:d:Q13131856|Thomas Jones]]''
| [[File:Tudno 00.JPG|center|128px]]
| 1844-04-28
| 1895-05-18
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 5978
| ''[[:d:Q13131857|Thomas Evan Nicholas]]''
| [[File:T. E. Nicholas and D. J. Williams conversing at a CND rally at Aberystwyth (6773943208).jpg|center|128px]]
| 1879-10-06
| 1971-04-19
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 5979
| ''[[:d:Q13131858|Thomas Iorwerth Ellis]]''
| [[File:Thomas Iorwerth Ellis (5292079).jpg|center|128px]]
| 1899-12-19
| 1970-04-20
| [[Gwynedd]]
|-
| style='text-align:right'| 5980
| ''[[:d:Q13131864|Thomas Williams]]''
|
| 1848-09-08
| 1927-01-18
| ''[[:d:Q3365170|Cwmaman]]''
|-
| style='text-align:right'| 5981
| ''[[:d:Q13131865|Thomas Williams]]''
|
| 1769
| 1848
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 5982
| ''[[:d:Q13131866|Thomas Williams]]''
| [[File:Gwilym Morganwg, bard.jpg|center|128px]]
| 1778-11-20
| 1835-08-13
| ''[[:d:Q19799831|Llanddeti]]''
|-
| style='text-align:right'| 5983
| ''[[:d:Q13131882|Thomas Jones]]''
| [[File:Glan Alun.JPG|center|128px]]
| 1811-03-11
| 1866-03-29
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 5984
| ''[[:d:Q13131904|Tim Jones]]''
|
| 1962
|
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 5985
| ''[[:d:Q13131944|Tom Parri Jones]]''
|
| 1905
| 1980
| [[Anglesey]]
|-
| style='text-align:right'| 5986
| ''[[:d:Q13131982|Trebor Lloyd Evans]]''
|
| 1909-02-05
| 1979-07-13
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 5987
| ''[[:d:Q13132053|Tudur Dylan Jones]]''
| [[File:Tudur Dylan Jones.jpg|center|128px]]
| 1965-06-30
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 5988
| ''[[:d:Q13132095|Saunt Tybïe]]''
| [[File:Entrance to Llandybie Parish Church - geograph.org.uk - 4445311.jpg|center|128px]]
|
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 5989
| ''[[:d:Q13132101|Tyfaelog]]''
| [[File:St Tyfaelog's Church, Pontlottyn - geograph.org.uk - 1152586.jpg|center|128px]]
|
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 5990
| ''[[:d:Q13132174|Vaughan Hughes]]''
|
| 1947-11-16
| 2024-01-06
| [[Anglesey]]
|-
| style='text-align:right'| 5991
| ''[[:d:Q13132175|Vaughan Roderick]]''
|
| 1957-06-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 5992
| ''[[:d:Q13132177|Vernon Jones]]''
|
| 20th century
|
| ''[[:d:Q3401604|Bow Street]]''
|-
| style='text-align:right'| 5993
| ''[[:d:Q13132185|W. Gareth Jones]]''
|
| 1936
|
| ''[[:d:Q7653726|Cwm Tawe]]''
|-
| style='text-align:right'| 5994
| ''[[:d:Q13132190|William Rhys Nicholas]]''
|
| 1914-06-23
| 1996-10-02
| ''[[:d:Q13131775|Tegryn]]''
|-
| style='text-align:right'| 5995
| ''[[:d:Q13132358|William John Griffith]]''
|
| 1875-09-15
| 1931-10-07
| ''[[:d:Q319576|Aberffraw]]''
|-
| style='text-align:right'| 5996
| ''[[:d:Q13132359|William John Roberts]]''
| [[File:Llanrwst Poets (1876) (8363305937).jpg|center|128px]]
| 1828
| 1904-12-06
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 5997
| ''[[:d:Q13132360|William Jones]]''
|
| 1896-09-24
| 1961-01-18
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 5998
| ''[[:d:Q13132361|William Jones]]''
|
| 1764
| 1822-05-02
| ''[[:d:Q5200185|Cynwyd]]''
|-
| style='text-align:right'| 5999
| ''[[:d:Q13132362|William Williams]]''
| [[File:Portrait of William Williams, 'Gwilym Cyfeiliog' (4672196) (cropped).jpg|center|128px]]
| 1801-01-04
| 1876-06-03
| ''[[:d:Q20601420|Winllan]]''
|-
| style='text-align:right'| 6000
| ''[[:d:Q13132363|William Morris]]''
|
| 1705-05-06
| 1763-12-29
| [[Anglesey]]
|-
| style='text-align:right'| 6001
| ''[[:d:Q13132364|William Spurrell]]''
|
| 1813-07-30
| 1889-04-22
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6002
| ''[[:d:Q13132366|William Rowlands]]''
| [[File:Portrait of Y Parch. Wm. Rowlands, 'Gwilym Lleyn' (4671153).jpg|center|128px]]
| 1802-08-24<br/>1802
| 1865-03-21
| ''[[:d:Q3398974|Bryncroes]]''
|-
| style='text-align:right'| 6003
| ''[[:d:Q13132369|William Owen Stanley]]''
| [[File:Portrait of Hon. W. O. Stanley, M.P (4673027).jpg|center|128px]]
| 1802
| 1884
| [[Anglesey]]
|-
| style='text-align:right'| 6004
| ''[[:d:Q13157407|Henry Harries]]''
|
| 1821
| 1862<br/>1849
| ''[[:d:Q13127612|Cwrt-y-cadno]]''
|-
| style='text-align:right'| 6005
| ''[[:d:Q13157452|J. E. Caerwyn Williams]]''
|
| 1912-01-17
| 1999-06-10
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 6006
| ''[[:d:Q13218562|David Griffiths]]''
|
| 1867
| 1935
| [[Aberystwyth]]
|-
| style='text-align:right'| 6007
| ''[[:d:Q13231953|Neil A. Oakman]]''
|
| 1962
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6008
| ''[[:d:Q13341457|Isaac Williams]]''
| [[File:Portrait of Revd. Isaac Williams (4671204).jpg|center|128px]]
| 1802-12-12
| 1865-05-01
| [[Aberystwyth]]
|-
| style='text-align:right'| 6009
| ''[[:d:Q13405416|Einir Dafydd]]''
|
| 1989
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6010
| ''[[:d:Q13405418|Bryn Fôn]]''
| [[File:Bryn Fon gan Dogfael.jpg|center|128px]]
| 1954-08-27
|
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 6011
| ''[[:d:Q13405478|Mark Joseph]]''
| [[File:Mark joseph.jpg|center|128px]]
| 1965-02-01
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6012
| ''[[:d:Q13405589|Iris Williams]]''
|
| 1946-04-20
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6013
| ''[[:d:Q13406331|Mary Dillwyn]]''
| [[File:Mary Dillwyn M.D. 1853.jpg|center|128px]]
| 1816
| 1906-12
| [[Wales]]
|-
| style='text-align:right'| 6014
| ''[[:d:Q13415127|James Holmes-Siedle]]''
|
| 1910-11-01
| 1995-05-22
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6015
| ''[[:d:Q13416998|Catrin Collier]]''
| [[File:Catrin Collier - colour.jpg|center|128px]]
| 1948
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6016
| ''[[:d:Q13423692|Mary Letitia Green]]''
|
| 1886-11-27
| 1978-01-15
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 6017
| ''[[:d:Q13522455|Ian Buckett]]''
|
| 1967-12-23
| 2024-07-07
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 6018
| ''[[:d:Q13522489|John Rice Jones]]''
| [[File:Judge John Rice Jones.JPG|center|128px]]
| 1759-02-11
| 1824-02-01
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 6019
| ''[[:d:Q13522522|Hugh Schofield]]''
|
| 1961-08-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6020
| ''[[:d:Q13530049|John Stradling Thomas]]''
|
| 1925-06-10
| 1991-03-29
| ''[[:d:Q1067991|Dyfed]]''
|-
| style='text-align:right'| 6021
| ''[[:d:Q13563004|Gillian Gill]]''
|
| 1942-06-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6022
| ''[[:d:Q13581065|Jamie Jones]]''
|
| 1980-10-28
|
| [[Wales]]
|-
| style='text-align:right'| 6023
| ''[[:d:Q13583800|Hugh Price Hughes]]''
| [[File:Hugh Price Hughes3.jpg|center|128px]]
| 1847-02-08
| 1902-11-17
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6024
| ''[[:d:Q13584022|Edward Morgan Humphreys]]''
|
| 1882-05-14
| 1955-06-11
| ''[[:d:Q922365|Dyffryn Ardudwy]]''
|-
| style='text-align:right'| 6025
| ''[[:d:Q13616740|John T. Lewis]]''
| [[File:JohnLewis01.jpg|center|128px]]
| 1932-04-15
| 2004-01-21
| [[Swansea]]
|-
| style='text-align:right'| 6026
| ''[[:d:Q13634239|Edwyn Cynrig Roberts]]''
| [[File:EdwynCynrigRoberts.jpg|center|128px]]
| 1837-02-28
| 1893-09-17
| ''[[:d:Q5119934|Cilcain]]''
|-
| style='text-align:right'| 6027
| ''[[:d:Q13634263|Ellis Wynne]]''
| [[File:Ellis Wynne plaque.jpg|center|128px]]
| 1671-03-07
| 1734-07-13
| ''[[:d:Q29484377|Y Lasynys Fawr]]''
|-
| style='text-align:right'| 6028
| ''[[:d:Q13635446|Grahame Davies]]''
|
| 1964
|
| ''[[:d:Q5140559|Coedpoeth]]''
|-
| style='text-align:right'| 6029
| ''[[:d:Q13635559|Gwallter Mechain]]''
| [[File:Walter Davies (Gwallter Mechain).jpg|center|128px]]
| 1761-07-15
| 1849-12-05
| ''[[:d:Q6661359|Llanfechain]]''
|-
| style='text-align:right'| 6030
| ''[[:d:Q13637417|Ian Jeremiah]]''
|
| 1970
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6031
| ''[[:d:Q13638382|Iolo Williams]]''
| [[File:Iolo Williams.jpg|center|128px]]
| 1962-08-22
|
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 6032
| ''[[:d:Q13639581|John Ceiriog Hughes]]''
| [[File:Portrait of John Ceiriog Hughes (4674472).jpg|center|128px]]
| 1832-09-25
| 1887-04-23
| ''[[:d:Q13129603|Llanarmon Dyffryn Ceiriog]]''
|-
| style='text-align:right'| 6033
| ''[[:d:Q13643306|Leslie Norris]]''
|
| 1921-05-21
| 2006-04-06
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6034
| ''[[:d:Q13643406|Lewys Daron]]''
|
| 16th century
| 1530
| ''[[:d:Q2556821|Aberdaron]]''
|-
| style='text-align:right'| 6035
| ''[[:d:Q13645303|Lucy Christopher]]''
|
| 1981
|
| [[Wales]]
|-
| style='text-align:right'| 6036
| ''[[:d:Q13646991|Mark Donovan]]''
| [[File:Mark Donovan.jpg|center|128px]]
| 1968-10-12
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6037
| ''[[:d:Q13703019|Haydn Morris]]''
|
| 1891-02-18
| 1965-12-21
| ''[[:d:Q6661077|Llanarthney]]''
|-
| style='text-align:right'| 6038
| ''[[:d:Q14095064|Mark Whitby]]''
|
| 1973-08-12
|
| [[Swansea]]
|-
| style='text-align:right'| 6039
| ''[[:d:Q14159639|Heather Jones]]''
|
| 1949-06-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6040
| ''[[:d:Q14420732|Rhun ap Iorwerth]]''
| [[File:Rhun ap Iorwerth official portrait (cropped).jpg|center|128px]]
| 1972-08-27
|
| ''[[:d:Q7821690|Tonteg]]''
|-
| style='text-align:right'| 6041
| ''[[:d:Q14476341|Terwyn Davies]]''
| [[File:Terwyn davies.jpg|center|128px]]
| 1979-04-03
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6042
| ''[[:d:Q14476852|Thomas Jones]]''
| [[File:Er cof am y diweddar Barch Thos Jones, Dynbych .. NLW3364382.jpg|center|128px]]
| 1756
| 1820-06-16
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 6043
| ''[[:d:Q14480365|William Ambrose]]''
| [[File:Revd Williams Ambrose (1813-73) NLW3362510.jpg|center|128px]]
| 1813-08-01
| 1873-10-31
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6044
| ''[[:d:Q14480438|William Glyn]]''
|
| 1504
| 1558-05-21
| ''[[:d:Q5714157|Heneglwys]]''
|-
| style='text-align:right'| 6045
| ''[[:d:Q14508446|Aled Jones Williams]]''
|
| 1956
|
| ''[[:d:Q3400157|Llanwnda]]''
|-
| style='text-align:right'| 6046
| ''[[:d:Q14508501|Gruffudd Fychan ap Gruffudd ab Ednyfed]]''
|
| 1330s
|
| [[Wales]]
|-
| style='text-align:right'| 6047
| ''[[:d:Q14508527|John Jones]]''
|
| 1904-05-03
| 1956-10-13
| ''[[:d:Q6661740|Llansaint]]''
|-
| style='text-align:right'| 6048
| ''[[:d:Q14508658|Myrddin ap Dafydd]]''
|
| 1956-07-25
|
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 6049
| ''[[:d:Q14593035|Isaac D. Seyburn]]''
|
| 1824-03
| 1895-03-06
| [[Wales]]
|-
| style='text-align:right'| 6050
| ''[[:d:Q14626703|Eleanor Vachell]]''
|
| 1879-01-08
| 1948-12-06
| [[Cairdiff]]
|-
| style='text-align:right'| 6051
| ''[[:d:Q14918258|John Lloyd]]''
|
| 17th century
| 1679-07-22
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 6052
| ''[[:d:Q14945454|Richard John Lloyd Price]]''
| [[File:Richard John Lloyd Price of Rhiwlas, Vanity Fair, 1885-10-10.jpg|center|128px]]
| 1843-04-17
| 1923-01-09
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 6053
| ''[[:d:Q14945645|J. D. Davies]]''
| [[File:David davies.jpg|center|128px]]
| 1957-04-01
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6054
| ''[[:d:Q14945647|Arthur Evanson]]''
|
| 1859-09-15
| 1934-12-31
| ''[[:d:Q11029875|Llansoy]]''
|-
| style='text-align:right'| 6055
| ''[[:d:Q14945657|Hugh Jones]]''
| [[File:St Grwst.jpg|center|128px]]
| 1816
| 1897
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 6056
| ''[[:d:Q14945659|John Lewis]]''
|
| 1580
|
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 6057
| ''[[:d:Q14945665|John Mason]]''
|
| 1920-06-09
| 2009-10-31
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6058
| ''[[:d:Q14945672|Owen Owen]]''
| [[File:Owen Owen (arolygydd ysgolion).jpg|center|128px]]
| 1850
| 1920-03-14
| ''[[:d:Q3402021|Llaniestyn]]''
|-
| style='text-align:right'| 6059
| ''[[:d:Q14945674|Emlyn Rhoderick]]''
|
| 1920-09-29
| 2007-03-24
| [[Pontypridd]]
|-
| style='text-align:right'| 6060
| ''[[:d:Q14945676|William Bowen Rowlands]]''
|
| 1837
| 1906-09-04<br/>1906
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 6061
| ''[[:d:Q14945684|Hugh Williams]]''
|
| 1722
| 1779
| ''[[:d:Q3400567|Llanengan]]''
|-
| style='text-align:right'| 6062
| ''[[:d:Q14946841|Mark Evans]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6063
| ''[[:d:Q14949171|Paul Atherton]]''
| [[File:Paul Atherton.jpg|center|128px]]
| 1968-03-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6064
| ''[[:d:Q14949184|Clement Price Thomas]]''
|
| 1893-11-22
| 1973-03-19
| ''[[:d:Q1868842|Abercarn]]''
|-
| style='text-align:right'| 6065
| ''[[:d:Q14949186|Hilary Tann]]''
|
| 1947-11-02
| 2023-02-08
| [[Llwynypia]]
|-
| style='text-align:right'| 6066
| ''[[:d:Q14982023|John Walters]]''
|
| 1721-08-22
| 1797-06-01
| ''[[:d:Q6661277|Llanedi]]''
|-
| style='text-align:right'| 6067
| ''[[:d:Q15008212|Dafydd Bullock]]''
|
| 1953
|
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 6068
| ''[[:d:Q15049074|Daniel Lleufer Thomas]]''
| [[File:Daniel Lleufer Thomas.jpg|center|128px]]
| 1863-08-29
| 1940-08-08
| ''[[:d:Q7680110|Talyllychau]]''
|-
| style='text-align:right'| 6069
| ''[[:d:Q15050659|Leo McAuliffe]]''
|
| 1933-12-16
| 2018-03
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 6070
| ''[[:d:Q15052584|Martin Daunton]]''
|
| 1949-02-07
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6071
| ''[[:d:Q15052605|Richard Evans]]''
|
| 1968-04-12
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 6072
| ''[[:d:Q15054657|John Lasarus Williams]]''
|
| 1924-10-29
| 2004-06-15
| ''[[:d:Q3404757|Llangoed]]''
|-
| style='text-align:right'| 6073
| ''[[:d:Q15062913|Matt Parry]]''
|
| 1994-01-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6074
| ''[[:d:Q15074921|Watkin Hezekiah Williams]]''
| [[File:Watcyn Wyn.jpg|center|128px]]
| 1844-03-07
| 1905-11-19
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 6075
| ''[[:d:Q15077570|Trebor Edwards]]''
| [[File:Trebor Edwards.jpg|center|128px]]
| 1939
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 6076
| ''[[:d:Q15109553|Jim Ede]]''
|
| 1895-04-07
| 1990-03-15
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6077
| ''[[:d:Q15109565|Leslie Gilbert Illingworth]]''
| [[File:Illingworth.jpg|center|128px]]
| 1902-09-02
| 1979-12-20
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6078
| ''[[:d:Q15148558|József Richter]]''
| [[File:Hungarian National Circus 2014 Richter József Jr. 02.jpg|center|128px]]
| 1992-04-07
|
| [[Swansea]]
|-
| style='text-align:right'| 6079
| ''[[:d:Q15149236|Jonathan Jones]]''
|
| 1976
|
| [[Wales]]
|-
| style='text-align:right'| 6080
| ''[[:d:Q15244394|Griffith Williams]]''
| [[File:Gutyn Peris.JPG|center|128px]]
| 1769-02-02
| 1838-06-21
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 6081
| ''[[:d:Q15285212|Owain Doull]]''
| [[File:Antoing - Triptyque des Monts et Châteaux, étape 1, 4 avril 2014, départ (100).JPG|center|128px]]
| 1993-05-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6082
| ''[[:d:Q15378581|Peter Thomas]]''
|
| 1932-10-18
|
| ''[[:d:Q478218|Treforest]]''
|-
| style='text-align:right'| 6083
| ''[[:d:Q15378630|Thomas Davis]]''
|
| 1837-12-11
| 1919-03-24
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 6084
| ''[[:d:Q15378639|Phil Clift]]''
|
| 1918-09-03
| 2005-05-22
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 6085
| ''[[:d:Q15378641|Joseph Davis]]''
| [[File:Joseph Davis 1865 public domain USGov.jpg|center|128px]]
| 1838-05-22
| 1895-05-22
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6086
| ''[[:d:Q15401784|Simon Cox]]''
|
| 1952-03-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6087
| ''[[:d:Q15427153|Patricia Llewellyn]]''
|
| 1962-02-07
| 2017-10-22
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6088
| ''[[:d:Q15428968|Dean Gratton]]''
|
| 1968
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6089
| ''[[:d:Q15429196|Benjamin Evans]]''
| [[File:Reverend Benjamin Evans (Telynfab) (1845–1900) (gcf10105).jpg|center|128px]]
| 1844-05-02
| 1900-08-23
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 6090
| ''[[:d:Q15429403|John Vaughan]]''
|
| 1871-07-31
| 1956-01-21
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 6091
| ''[[:d:Q15433564|Stephen Knight]]''
|
| 1960
|
| [[Wales]]
|-
| style='text-align:right'| 6092
| ''[[:d:Q15434762|Jack Livesey]]''
|
| 1901-06-11
| 1961-10-12
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6093
| ''[[:d:Q15435915|Bernard Lloyd]]''
|
| 1934-01-30
| 2018-12-12
| [[Newport]]
|-
| style='text-align:right'| 6094
| ''[[:d:Q15438714|W. D. Davies]]''
|
| 1911-12-09
| 2001-06-12
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 6095
| ''[[:d:Q15446774|Ian Hamilton]]''
| [[File:Ian Hamilton, Author image 2012.jpg|center|128px]]
| 1946-05-24
|
| [[Toronto]]<br/>''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 6096
| ''[[:d:Q15447289|Chris Hann]]''
|
| 1953-08-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6097
| ''[[:d:Q15452420|Louis Barnett Abrahams]]''
|
| 1839-10-03
| 1918-06-03
| [[Swansea]]
|-
| style='text-align:right'| 6098
| ''[[:d:Q15453116|Michael Shepherd]]''
|
| 1923-07-30
| 1995-08-21
| [[Cairdiff]]
|-
| style='text-align:right'| 6099
| ''[[:d:Q15453135|John Hughes]]''
| [[File:John Hughes editor 1985.jpg|center|128px]]
| 1930-04-28
| 2022-12-14
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6100
| ''[[:d:Q15453626|John Bowen]]''
| [[File:John Bowen (bishop).png|center|128px]]
| 1815-11-21
| 1859-06-02
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 6101
| ''[[:d:Q15453717|Charles Wynford Parsons]]''
|
| 1901-07-22
| 1950-08-26
| [[Swansea]]
|-
| style='text-align:right'| 6102
| ''[[:d:Q15453874|Paul Ferris]]''
|
| 1929
| 2018
| [[Swansea]]
|-
| style='text-align:right'| 6103
| ''[[:d:Q15453944|Terence Rees]]''
|
| 1928-02-24
| 2014-11
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6104
| ''[[:d:Q15454409|Myfanwy Haycock]]''
|
| 1913-03-23
| 1963-11-09
| ''[[:d:Q7228316|Pontnewynydd]]''
|-
| style='text-align:right'| 6105
| ''[[:d:Q15456236|William Williams]]''
| [[File:Portrait of W. Williams (4673914).jpg|center|128px]]
| 1788-02-12
| 1865-04-26
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 6106
| ''[[:d:Q15456259|Eric Mival]]''
| [[File:Mival and Barrie 2019.jpg|center|128px]]
| 1939-07-18
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 6107
| ''[[:d:Q15458784|Peter Reynolds]]''
| [[File:Peter Reynolds Korea (cropped).jpg|center|128px]]
| 1958-01-12
| 2016-10-11
| [[Cairdiff]]
|-
| style='text-align:right'| 6108
| ''[[:d:Q15459489|John James]]''
|
| 1939-03-14
| 2018-05-14
| [[Cairdiff]]
|-
| style='text-align:right'| 6109
| ''[[:d:Q15460120|T. Harri Jones]]''
|
| 1921-12-21
| 1965-01-30
| ''[[:d:Q6661068|Llanafan Fawr]]''
|-
| style='text-align:right'| 6110
| ''[[:d:Q15460527|Paul Carey Jones]]''
|
| 1974
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6111
| ''[[:d:Q15460645|John Trevor]]''
| [[File:Sion Trevor - John Trevor (1563–1630) memorial St Cynfarch Ch, Hope, Flintshire Cymru Wales 08.jpg|center|128px]]
| 1563
| 1630
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 6112
| ''[[:d:Q15491437|William Ifor Jones]]''
| [[File:William Ifor Jones.jpg|center|128px]]
| 1900-01-23
| 1988-11-11
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6113
| ''[[:d:Q15493820|Howard Thomas]]''
|
| 1909-03-05
| 1986-11-06
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 6114
| ''[[:d:Q15523834|Charles William King]]''
| [[File:Retrato de C. W. King (1847) - Visconde de Meneses.png|center|128px]]
| 1818-09-05
| 1888-03-25
| [[Newport]]
|-
| style='text-align:right'| 6115
| ''[[:d:Q15619225|William Glynne-Jones]]''
|
| 1907
| 1977
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6116
| ''[[:d:Q15624399|John Evans]]''
| [[File:Bardd Cocos 01.JPG|center|128px]]
| 1826
| 1888
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 6117
| ''[[:d:Q15631605|Mark Sampson]]''
| [[File:Mark Sampson, England Ladies v Montenegro 5 4 2014 1058.jpg|center|128px]]
| 1982-10-18
|
| ''[[:d:Q5184032|Creigiau]]''
|-
| style='text-align:right'| 6118
| ''[[:d:Q15637773|Kenneth "Ken" Davies]]''
|
| 1916-05-29
| 1984
| ''[[:d:Q3406145|Blaengarw]]''
|-
| style='text-align:right'| 6119
| ''[[:d:Q15637838|John Cooke]]''
|
| 1922-01-16
| 2011-04-25
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 6120
| ''[[:d:Q15710759|Neil Thomas]]''
|
| 1968-04-06
|
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 6121
| ''[[:d:Q15712409|Nic Strange]]''
|
| 1987-03-26
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6122
| ''[[:d:Q15806311|Donald Marcus Kelway Marendaz]]''
|
| 1897-01-17
| 1988-11-06
| [[Neath Port Talbot]]
|-
| style='text-align:right'| 6123
| ''[[:d:Q15831077|Daniel Font]]''
|
| 1993-02-22
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 6124
| ''[[:d:Q15831079|Raj Popat]]''
|
| 1986-06-17
|
| ''[[:d:Q7359368|Rogerstone]]''
|-
| style='text-align:right'| 6125
| ''[[:d:Q15840050|Peter Creed]]''
|
| 1987-03-31
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 6126
| ''[[:d:Q15954198|Hans Busk]]''
|
| 1772-05-28
| 1862-02-08
| [[Wales]]
|-
| style='text-align:right'| 6127
| ''[[:d:Q15967265|Sir John Beynon, 1st Baronet]]''
|
| 1864-12-02
| 1944-10-13
| ''[[:d:Q5050623|Castleton]]''
|-
| style='text-align:right'| 6128
| ''[[:d:Q15967282|Thomas Dalton-Morgan]]''
|
| 1917-03-23
| 2004-09-18
| [[Cairdiff]]
|-
| style='text-align:right'| 6129
| ''[[:d:Q15967649|Denis Crowley-Milling]]''
|
| 1919-03-22
| 1996-12-01
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6130
| ''[[:d:Q15967923|Robert Fry]]''
| [[File:Sir Robert Fry - Self Portrait.jpg|center|128px]]
| 1951-04-06
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6131
| ''[[:d:Q15969655|Meredith Thomas]]''
| [[File:Air Vice-Marshal Meredith Thomas.jpg|center|128px]]
| 1892-07-06
| 1984-05-20
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 6132
| ''[[:d:Q15971211|Wilfrith Green]]''
|
| 1872
| 1937-05-29
| [[St Davids]]
|-
| style='text-align:right'| 6133
| ''[[:d:Q15983646|N. E. Yorke Davis]]''
| [[File:Nathaniel Edward Yorke-Davies Vanity Fair 1900-04-12.jpg|center|128px]]
| 1841-04-26
| 1914-05-22
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 6134
| ''[[:d:Q15983878|Francis James Burgoyne]]''
|
| 1858
| 1913-10-18
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 6135
| ''[[:d:Q15983891|William Retlaw Williams]]''
|
| 1863
| 1944-03-20
| ''[[:d:Q4666761|Aberclydach]]''
|-
| style='text-align:right'| 6136
| ''[[:d:Q15989799|James Allen]]''
|
| 1802-07-15<br/>1802
| 1897-06-26<br/>1897
| ''[[:d:Q5000782|Burton]]''
|-
| style='text-align:right'| 6137
| ''[[:d:Q15990059|William Hughes]]''
|
| 1535
| 1600-11-18
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 6138
| ''[[:d:Q15990317|Horace Thomas]]''
|
| 1890-07-28
| 1916-09-03
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6139
| ''[[:d:Q15990363|Thomas Williams]]''
|
| 1725-06
| 1770-06-19
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 6140
| ''[[:d:Q15991307|Charlotte Voake]]''
|
| 1957
|
| [[Wales]]
|-
| style='text-align:right'| 6141
| ''[[:d:Q15991633|Robert Williams]]''
|
| 1695
| 1763
| ''[[:d:Q5385173|Erbistog]]''
|-
| style='text-align:right'| 6142
| ''[[:d:Q15992732|John Thomas Burton Wollaston]]''
|
| 1841-01-19
| 1911-10-14
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 6143
| ''[[:d:Q15993118|Huw Jenkins]]''
|
| 1944-10-24
| 2013-08-21
| [[Swansea]]
|-
| style='text-align:right'| 6144
| ''[[:d:Q15993548|Tony Summers]]''
|
| 1924-01-03
| 2013-11-21
| [[Newport]]
|-
| style='text-align:right'| 6145
| ''[[:d:Q15994385|Sarah Cruddas]]''
| [[File:Sarah Cruddas (cropped).jpg|center|128px]]
| 1984-12-08
|
| [[Wales]]
|-
| style='text-align:right'| 6146
| ''[[:d:Q15994396|William Davies]]''
|
| 1814-07-13
| 1891-02-13
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 6147
| ''[[:d:Q15994452|George Phillips Bevan]]''
|
| 1830-08-13
| 1889-08-03
| ''[[:d:Q4877452|Beaufort]]''
|-
| style='text-align:right'| 6148
| ''[[:d:Q15994548|Carl Jones]]''
|
| 1954-07-20
|
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 6149
| ''[[:d:Q15994588|John Lloyd]]''
|
| 1750-01-25<br/>1749
| 1815-04-24
| [[Flintshire]]
|-
| style='text-align:right'| 6150
| ''[[:d:Q15994666|Thomas Richard Owen]]''
| [[File:Thomas Richard Owen, SWGA president 1966-1968.png|center|128px]]
| 1918
| 1990
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6151
| ''[[:d:Q15994689|William Phillips]]''
|
| 1822-05-04
| 1905-10-23
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 6152
| ''[[:d:Q15994726|Harry Morrey Salmon]]''
|
| 1892-12-20
| 1985-04-27
| [[Cairdiff]]
|-
| style='text-align:right'| 6153
| ''[[:d:Q15996134|Gus Merry]]''
|
| 1888-03
| 1943-12-14
| [[Newport]]
|-
| style='text-align:right'| 6154
| ''[[:d:Q15996281|Howell Idris]]''
| [[File:The disillusionment of Idris like a cork out of a soda-water bottle! (5236536).jpg|center|128px]]
| 1842-08-05
| 1925-02-10
| ''[[:d:Q5000782|Burton]]''
|-
| style='text-align:right'| 6155
| ''[[:d:Q15997564|James John Thomas]]''
| [[File:James John Thomas.jpg|center|128px]]
| 1868
| 1947-08-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6156
| ''[[:d:Q15997566|Herbert Charles Tippet]]''
|
| 1892-02-27
| 1947-11-28
| [[Newport]]
|-
| style='text-align:right'| 6157
| ''[[:d:Q15997578|Job Wilding]]''
|
| 1862
| 1947-03-15
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6158
| ''[[:d:Q15998021|Phil Tanner]]''
|
| 1862-02-16
| 1950-02-19
| ''[[:d:Q6661467|Llangynydd]]''
|-
| style='text-align:right'| 6159
| ''[[:d:Q15998730|Joe Pullman]]''
|
| 1876-01-28
| 1955-07
| [[Cairdiff]]
|-
| style='text-align:right'| 6160
| ''[[:d:Q15998907|Nathaniel Walters]]''
|
| 1875-05-23
| 1956-02-22
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6161
| ''[[:d:Q15999154|Edgar Long]]''
|
| 1907
| 1958-01-31
| ''[[:d:Q1141148|Gower Peninsula]]''
|-
| style='text-align:right'| 6162
| ''[[:d:Q15999184|Gilbert Rattenbury]]''
|
| 1878-02-28
| 1958-08-14
| [[Cairdiff]]
|-
| style='text-align:right'| 6163
| ''[[:d:Q15999292|Dick Duckfield]]''
|
| 1907-07-02
| 1959-12-30
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6164
| ''[[:d:Q15999400|Sir Evan Williams, 1st Baronet]]''
|
| 1871-07-02
| 1959-02-03
| ''[[:d:Q6662916|Llwynhendy]]''
|-
| style='text-align:right'| 6165
| ''[[:d:Q15999402|Frank Williams]]''
|
| 1910-01-26
| 1959-07-07
| [[Cairdiff]]
|-
| style='text-align:right'| 6166
| ''[[:d:Q15999467|Joseph Jones]]''
|
| 1899-03-15
| 1960-01-27
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 6167
| ''[[:d:Q15999888|Percy Latham]]''
| [[File:Percy Holland Latham c1905.jpg|center|128px]]
| 1873-02-03
| 1922-06-22
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 6168
| ''[[:d:Q15999899|Martin Davies]]''
|
| 1974-06-28
|
| [[Swansea]]
|-
| style='text-align:right'| 6169
| ''[[:d:Q15999960|Gary Richards]]''
|
| 1963-08-02
|
| [[Swansea]]
|-
| style='text-align:right'| 6170
| ''[[:d:Q16000236|Lewis Pugh Evans]]''
| [[File:Lewis Pugh Evans VC IWM HU 93411.jpg|center|128px]]
| 1881-01-03
| 1962-11-30
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 6171
| ''[[:d:Q16003649|Young Allsopp]]''
| [[File:Young Allsopp, boxer.png|center|128px]]
| 1901-12-21
| 1964-11-10
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 6172
| ''[[:d:Q16003708|James Phillips Jones]]''
|
| 1883-11-23
| 1964-12-04
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6173
| ''[[:d:Q16003922|Billy Tudor]]''
|
| 1918<br/>1918-02-14
| 1965
| ''[[:d:Q2355142|Shotton]]''
|-
| style='text-align:right'| 6174
| ''[[:d:Q16004072|Malcolm McColm]]''
| [[File:MalcolmMcColm1956.jpg|center|128px]]
| 1914-06-25
| 1966-05-02
| [[Cairdiff]]
|-
| style='text-align:right'| 6175
| ''[[:d:Q16004090|Howard Poole]]''
| [[File:Howard Poole 1930.jpg|center|128px]]
| 1905-08-15
| 1966-01-20
| [[Cairdiff]]
|-
| style='text-align:right'| 6176
| ''[[:d:Q16005766|Edward Benson]]''
|
| 1907-11-20
| 1967-09-11
| [[Cairdiff]]
|-
| style='text-align:right'| 6177
| ''[[:d:Q16005824|Colin Jones]]''
|
| 1928
| 1967
| [[Newport]]
|-
| style='text-align:right'| 6178
| ''[[:d:Q16005835|Ronald Lewis]]''
|
| 1916-01-16
| 1967-12-30
| ''[[:d:Q7162698|Pengam]]''
|-
| style='text-align:right'| 6179
| ''[[:d:Q16005869|Ivor Rees]]''
| [[File:Ivor Rees VC IWM Q 70903.jpg|center|128px]]
| 1893-10-18
| 1967-03-11
| ''[[:d:Q5441920|Felinfoel]]''
|-
| style='text-align:right'| 6180
| ''[[:d:Q16005912|Bobbie Williams]]''
|
| 1886
| 1967-10-29
| ''[[:d:Q7821209|Tongwynlais]]''
|-
| style='text-align:right'| 6181
| ''[[:d:Q16006585|Herbert Huntingdon]]''
|
| 1898-01-15
| 1969
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6182
| ''[[:d:Q16007439|Albert Mays]]''
|
| 1929-04-18
| 1973-07-05
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 6183
| ''[[:d:Q16007473|Wick Powell]]''
|
| 1905
| 1973
| ''[[:d:Q4666790|Aberbeeg]]''
|-
| style='text-align:right'| 6184
| ''[[:d:Q16007476|Kenneth Raikes]]''
|
| 1889-05-09
| 1973-11-29
| ''[[:d:Q6744584|Malpas]]''
|-
| style='text-align:right'| 6185
| ''[[:d:Q16007482|Trevor Rowlands]]''
|
| 1922-02-02
| 1973-07-22
| ''[[:d:Q7975052|Wattstown]]''
|-
| style='text-align:right'| 6186
| ''[[:d:Q16007521|Morris Meredith Williams]]''
|
| 1881-09-18
| 1973-10-07
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 6187
| ''[[:d:Q16007647|Bessie Jones]]''
|
| 1887
| 1974-11
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 6188
| ''[[:d:Q16007792|Trevor Edmunds]]''
|
| 1903-12-07
| 1975
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6189
| ''[[:d:Q16007849|Tom Morgan]]''
|
| 1893-04-11
| 1975-04-06
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 6190
| ''[[:d:Q16007857|R. Ifor Parry]]''
|
| 1908
| 1975-12-18
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 6191
| ''[[:d:Q16008200|Glyn Gething]]''
|
| 1892-06-16
| 1977-03-20
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6192
| ''[[:d:Q16008355|Owen Davies]]''
|
| 1914
| 1978
| [[Wales]]
|-
| style='text-align:right'| 6193
| ''[[:d:Q16008415|William Marsh]]''
|
| 1917-09-10
| 1978-02-06
| ''[[:d:Q3401149|Newbridge]]''
|-
| style='text-align:right'| 6194
| ''[[:d:Q16008683|Harold Finch]]''
|
| 1898-05-02
| 1979-07-16
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6195
| ''[[:d:Q16008703|Tyssul Griffiths]]''
|
| 1919-06-06
| 1979
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6196
| ''[[:d:Q16008819|Jackie Williams]]''
|
| 1911-03-29
| 1987-10-12
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6197
| ''[[:d:Q16009241|Thomas Danter]]''
|
| 1922-12-01
| 1980-09
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6198
| ''[[:d:Q16009948|George Crisp]]''
|
| 1911-06-30
| 1982
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6199
| ''[[:d:Q16010271|Len Attewell]]''
|
| 1895-12-31
| 1983-02-26
| ''[[:d:Q6966749|Nash]]''
|-
| style='text-align:right'| 6200
| ''[[:d:Q16011255|Leslie Harris]]''
|
| 1915-07-20
| 1985-10-28
| [[Cairdiff]]
|-
| style='text-align:right'| 6201
| ''[[:d:Q16011565|Howard Ford]]''
|
| 1905-12-18
| 1986-03-28
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 6202
| ''[[:d:Q16011583|Bert Hodges]]''
|
| 1905-01-29
| 1986-09-23
| [[Newport]]
|-
| style='text-align:right'| 6203
| ''[[:d:Q16011855|Ernie Carless]]''
|
| 1912-09-09
| 1987-09-26
| ''[[:d:Q13132002|Cadoxton]]''
|-
| style='text-align:right'| 6204
| ''[[:d:Q16011912|Jimmy Jewell]]''
|
| 1953
| 1987-10-31
| [[Sooth Wales]]
|-
| style='text-align:right'| 6205
| ''[[:d:Q16012094|David Jones]]''
|
| 1914-06-10
| 1988-05-30
| ''[[:d:Q8054074|Ynysddu]]''
|-
| style='text-align:right'| 6206
| ''[[:d:Q16012333|Wynne Samuel]]''
|
| 1911-10-17
| 1989-06-05
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 6207
| ''[[:d:Q16012454|David Jones]]''
|
| 1920-03-09
| 1990-04-18
| ''[[:d:Q4667120|Aberkenfig]]''
|-
| style='text-align:right'| 6208
| ''[[:d:Q16012809|Roderick Jones]]''
|
| 1910-06-02
| 1992-09-16
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 6209
| ''[[:d:Q16013064|Dennis Powell]]''
| [[File:Boxing - Dennis Powell v Mel Brown (USA).jpg|center|128px]]
| 1924-12-12
| 1993-05-27
| ''[[:d:Q6661162|Llanddewi Skirrid]]''
|-
| style='text-align:right'| 6210
| ''[[:d:Q16013604|Thomas Nathaniel Davies]]''
|
| 1922
| 1996
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 6211
| ''[[:d:Q16013662|Willie Jones]]''
|
| 1916-10-31
| 1996-07-25
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6212
| ''[[:d:Q16013737|John Roberts]]''
|
| 1913-02-24
| 1996-04-20
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 6213
| ''[[:d:Q16015013|Walter Vickery]]''
|
| 1909-10-25
| 2000-04-07
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6214
| ''[[:d:Q16015267|Dafydd Rowlands]]''
|
| 1931-12-25
| 2001-04-26
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 6215
| ''[[:d:Q16015315|David Thomas]]''
|
| 1911-11-25
| 2001-09-19
| [[Swansea]]
|-
| style='text-align:right'| 6216
| ''[[:d:Q16015743|Leslie James Bennett]]''
|
| 1920
| 2003-10-18
| [[Sooth Wales]]
|-
| style='text-align:right'| 6217
| ''[[:d:Q16015797|Graham Davies]]''
|
| 1921-10-03
| 2003
| [[Swansea]]
|-
| style='text-align:right'| 6218
| ''[[:d:Q16015856|Norah Isaac]]''
|
| 1914-12-03
| 2003-08-03
| ''[[:d:Q5016879|Caerau]]''
|-
| style='text-align:right'| 6219
| ''[[:d:Q16015862|Michael John]]''
|
| 1943-04-29
| 2003-06-06
| [[Swansea]]
|-
| style='text-align:right'| 6220
| ''[[:d:Q16017367|Aubrey Darmody]]''
|
| 1921-05-17
| 2006-02-09
| [[Swansea]]
|-
| style='text-align:right'| 6221
| ''[[:d:Q16017775|Clive Graham]]''
|
| 1937-10-07
| 2007-06-11
| [[Swansea]]
|-
| style='text-align:right'| 6222
| ''[[:d:Q16017871|Geoffrey Olsen]]''
|
| 1943-11-04
| 2007-12-06
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6223
| ''[[:d:Q16018255|Graham Reynolds]]''
|
| 1937-09-23
| 2008-02-27
| [[Newport]]
|-
| style='text-align:right'| 6224
| ''[[:d:Q16018720|Jim Davies]]''
| [[File:Jim Davies 1951.png|center|128px]]
| 1926-12-06
| 2010-08-15
| [[Cairdiff]]
|-
| style='text-align:right'| 6225
| ''[[:d:Q16018796|Katrina Jacks]]''
|
| 1986
| 2010-05-16
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6226
| ''[[:d:Q16018799|Denzil Jones]]''
|
| 1926
| 2010-12-25
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6227
| ''[[:d:Q16019700|Jocelyn Hay]]''
|
| 1927-07-30
| 2014-01-21
| [[Swansea]]
|-
| style='text-align:right'| 6228
| ''[[:d:Q16022834|Noel Birch]]''
| [[File:Major-general James Frederick Noel Birch, Cb Art.IWMART1784.jpg|center|128px]]
| 1865-12-29
| 1939-10-04
| ''[[:d:Q13129669|Llanrhaeadr-yng-Nghinmeirch]]''
|-
| style='text-align:right'| 6229
| ''[[:d:Q16022941|Edwin Rowlands]]''
|
| 1867-03-15
| 1939-08-06
| ''[[:d:Q775880|Pensarn]]''
|-
| style='text-align:right'| 6230
| ''[[:d:Q16026297|John Aeron Thomas]]''
| [[File:J Aeron Thomas.jpg|center|128px]]
| 1850-11-24
| 1935-02-01
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 6231
| ''[[:d:Q16026316|William Arthur Evelyn]]''
|
| 1860-10-04
| 1935-01-06
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 6232
| ''[[:d:Q16029271|James Watts]]''
| [[File:James Watts (rygbi).jpg|center|128px]]
| 1878-03
| 1933-02-02
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6233
| ''[[:d:Q16029495|John Jones]]''
|
| 1854
| 1913
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 6234
| ''[[:d:Q16029927|Edward Thomas John]]''
| [[File:Edward John.jpg|center|128px]]
| 1857-03-14<br/>1857
| 1931-02-16<br/>1931
| [[Pontypridd]]
|-
| style='text-align:right'| 6235
| ''[[:d:Q16030023|David Davies]]''
|
| 1858
| 1930-06
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 6236
| ''[[:d:Q16030060|Huw Robert Jones]]''
|
| 1894-06-03
| 1930-08
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 6237
| ''[[:d:Q16030073|Bobby Lloyd]]''
|
| 1888-07
| 1930-01-18
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 6238
| ''[[:d:Q16030266|David Morgan]]''
|
| 1840-02-14
| 1900-07-05
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6239
| ''[[:d:Q16030721|Sir Osmond Williams, 1st Baronet]]''
| [[File:Arthur Osmond Williams, Vanity Fair, 1909-12-01.jpg|center|128px]]
| 1849-03-17
| 1927-01-28
| ''[[:d:Q10989234|Llanfihangel-y-traethau]]''
|-
| style='text-align:right'| 6240
| ''[[:d:Q16030806|David Howell]]''
| [[File:Llawdden.jpg|center|128px]]
| 1831-08-16
| 1903-01-15<br/>1903
| ''[[:d:Q6661429|Llangan]]''
|-
| style='text-align:right'| 6241
| ''[[:d:Q16030858|Eliezer Pugh]]''
|
| 1815-06-28
| 1903-12-08
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 6242
| ''[[:d:Q16031163|James Bevan Bowen]]''
|
| 1828-05-21
| 1905-11-14
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 6243
| ''[[:d:Q16031849|John Williams]]''
| [[File:John Williams 1905.JPG|center|128px]]
| 1861
| 1922-06-20
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 6244
| ''[[:d:Q16037727|Thomas Humphreys]]''
|
|
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6245
| ''[[:d:Q16037803|Hopkin Maddock]]''
| [[File:Hopkin Maddock.jpg|center|128px]]
| 1881
| 1921-12-15
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 6246
| ''[[:d:Q16037844|Owen Morgan]]''
| [[File:Owen Morgan, Morien.jpg|center|128px]]
| 1836
| 1921-12-16
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 6247
| ''[[:d:Q16041125|Lyndon Sims]]''
|
| 1917-01-20
| 1999-04
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 6248
| ''[[:d:Q16043610|Richard Watkins Richards]]''
| [[File:Richard Watkins Richards.jpg|center|128px]]
| 1863
| 1920
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 6249
| ''[[:d:Q16043621|John Stevens]]''
| [[File:JohnStevens.png|center|128px]]
| 1840-12-04
| 1920-08-05
| ''[[:d:Q6661964|Llechryd]]''
|-
| style='text-align:right'| 6250
| ''[[:d:Q16059274|Henry Bracy]]''
| [[File:HenryBracyAustralia.jpg|center|128px]]
| 1846-01-08
| 1917-01-31
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6251
| ''[[:d:Q16059441|William Creese]]''
|
| 1870-01-15
| 1918-10-23
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 6252
| ''[[:d:Q16059767|David Edwards]]''
|
| 1841
| 1897-04-14
| [[Wales]]
|-
| style='text-align:right'| 6253
| ''[[:d:Q16059778|John Griffiths]]''
| [[File:Archddeacon John Griffiths.jpg|center|128px]]
| 1820-05-11
| 1897-09-01
| ''[[:d:Q5119956|Ciliau Aeron]]''<br/>''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 6254
| ''[[:d:Q16060029|David Davies]]''
|
| 1840
| 1894-06-18
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 6255
| ''[[:d:Q16062191|Eleanor Bufton]]''
| [[File:Eleanor Bufton-3.jpg|center|128px]]
| 1840
| 1893-04-09
| [[Wales]]
|-
| style='text-align:right'| 6256
| ''[[:d:Q16062277|Robert J. Davies]]''
|
| 1839-08-02
| 1892-05-06
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 6257
| ''[[:d:Q16062575|Enoch Salisbury]]''
|
| 1819-11-07
| 1890-10-17
| ''[[:d:Q3401133|Bagillt]]''
|-
| style='text-align:right'| 6258
| ''[[:d:Q16062627|Samuel Goldsworthy]]''
|
| 1855-02-11
| 1889-09-28
| [[Swansea]]
|-
| style='text-align:right'| 6259
| ''[[:d:Q16062637|James Rhys Jones]]''
| [[File:Reverend J R Kilsby Jones 1813-89.jpg|center|128px]]
| 1813-02-04
| 1889-02-04
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 6260
| ''[[:d:Q16062664|Thomas Purnell]]''
|
| 1834
| 1889
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 6261
| ''[[:d:Q16063361|Henry Beor]]''
| [[File:StateLibQld 1 131563 Portrait Honourable Henry R. Beor, ca. 1880.jpg|center|128px]]
| 1846-02-07
| 1880-12-25
| [[Swansea]]
|-
| style='text-align:right'| 6262
| ''[[:d:Q16065475|John Mills]]''
|
| 1812-12-19
| 1873-07-28
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 6263
| ''[[:d:Q16065541|Evan Jones]]''
|
| 1788-05-14
| 1872-08-18
| [[Wales]]
|-
| style='text-align:right'| 6264
| ''[[:d:Q16065913|John Lloyd Vaughan Watkins]]''
| [[File:Portrait of Coll. Lloyd V. Watkins, M.P (4674634) (cropped).jpg|center|128px]]
| 1802
| 1865-09-28
| ''[[:d:Q7450887|Sennybridge]]''
|-
| style='text-align:right'| 6265
| ''[[:d:Q16066202|John Williams]]''
| [[File:John Williams 'Yr Hen Syr'.jpg|center|128px]]
| 1792-04-11
| 1858-12-27
| ''[[:d:Q3402138|Ystrad Meurig]]''
|-
| style='text-align:right'| 6266
| ''[[:d:Q16066761|Dai St. John]]''
|
| 1871-04-01
| 1899-11-23
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 6267
| ''[[:d:Q16066973|Joe Moran]]''
|
| 1880
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6268
| ''[[:d:Q16069708|Lydia Hall]]''
|
| 1987-12-14
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6269
| ''[[:d:Q16073356|David Jones]]''
| [[File:Dan Jones 1928.jpg|center|128px]]
| 1901
| 1968-12-16
| [[Wales]]
|-
| style='text-align:right'| 6270
| ''[[:d:Q16079066|Len Orchard]]''
|
| 1912
|
| [[Newport]]
|-
| style='text-align:right'| 6271
| ''[[:d:Q16087651|Jackie Sutton]]''
|
| 1920-05-28
| 2010-11-13
| [[Cairdiff]]
|-
| style='text-align:right'| 6272
| ''[[:d:Q16089618|Robert Jones]]''
|
| 1921
|
| [[Wales]]
|-
| style='text-align:right'| 6273
| ''[[:d:Q16089619|Archie Lamb]]''
|
| 1921-10-23
| 2021-10-19
| [[Swansea]]
|-
| style='text-align:right'| 6274
| ''[[:d:Q16089913|Glenys Cour]]''
|
| 1924
|
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 6275
| ''[[:d:Q16090378|Robert Morris]]''
|
| 1926-11-27
| 2007-12-29
| [[Swansea]]
|-
| style='text-align:right'| 6276
| ''[[:d:Q16090862|Haydn Morris]]''
|
| 1928-07-14
| 2021-01
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 6277
| ''[[:d:Q16091470|Owen Harries]]''
|
| 1930
| 2020-06-25
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 6278
| ''[[:d:Q16091496|Les Jones]]''
|
| 1930-01-01
| 2016-01-06
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 6279
| ''[[:d:Q16091540|Edward Millward]]''
|
| 1930-06-28
| 2020-04-18
| [[Cairdiff]]
|-
| style='text-align:right'| 6280
| ''[[:d:Q16091844|Ted Grace]]''
|
| 1931-03-13
| 2020-08-22
| [[Swansea]]
|-
| style='text-align:right'| 6281
| ''[[:d:Q16092619|Hugh Davies]]''
|
| 1932-07-23
| 2017-12-02
| ''[[:d:Q7161927|Pembrey]]''
|-
| style='text-align:right'| 6282
| ''[[:d:Q16095921|Don Ward]]''
|
| 1934-08-30
|
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 6283
| ''[[:d:Q16097086|Robert Alwyn Hughes]]''
|
| 1935-05-30
| 2020-12-26
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 6284
| ''[[:d:Q16097119|Vincent Kane]]''
|
| 1935-01-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6285
| ''[[:d:Q16104409|Frank Clarke]]''
|
| 1936-10-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6286
| ''[[:d:Q16104421|Billy Davies]]''
|
| 1936-07-03
| 2022-07-17
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6287
| ''[[:d:Q16104431|Phil Edwards]]''
|
| 1936-05-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6288
| ''[[:d:Q16104440|Valerie Ganz]]''
|
| 1936
| 2015
| ''[[:d:Q1952591|The Mumbles]]''
|-
| style='text-align:right'| 6289
| ''[[:d:Q16104637|Fenton Coles]]''
|
| 1937-09-14
|
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 6290
| ''[[:d:Q16104808|Juliet Ace]]''
|
| 1938-06-27
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6291
| ''[[:d:Q16105402|David Lewis]]''
|
| 1940-12-18<br/>1940-10-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6292
| ''[[:d:Q16105688|Judith M. Lumley]]''
| [[File:Judith-lumley.jpg|center|128px]]
| 1941-02-15
| 2018-10-25
| [[Cairdiff]]
|-
| style='text-align:right'| 6293
| ''[[:d:Q16106220|Howard Cole]]''
| [[File:Howard.cole.jpg|center|128px]]
| 1943-12-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6294
| ''[[:d:Q16106245|Pete Drummond]]''
|
| 1943-07-29<br/>1943
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6295
| ''[[:d:Q16106590|John Cooper]]''
|
| 1944-09-03
|
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 6296
| ''[[:d:Q16106615|Ken Elias]]''
|
| 1944
|
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 6297
| ''[[:d:Q16106933|Hywel Evans]]''
|
| 1945-01-09
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 6298
| ''[[:d:Q16106974|John Harris]]''
|
| 1945
|
| ''[[:d:Q7442720|Sebastopol]]''
|-
| style='text-align:right'| 6299
| ''[[:d:Q16106989|Neville Hughes]]''
|
| 1945-06-01
| 2015-06-28
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 6300
| ''[[:d:Q16106997|John Jeffery]]''
|
| 1945-02-26
|
| ''[[:d:Q3404041|Oakdale]]''
|-
| style='text-align:right'| 6301
| ''[[:d:Q16107026|Brian Lewis]]''
|
| 1945-07-18
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6302
| ''[[:d:Q16107406|Kevin Lyons]]''
|
| 1946-12-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6303
| ''[[:d:Q16107436|Ian Morris]]''
|
| 1946-06-27
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6304
| ''[[:d:Q16107553|Lawrence Williams]]''
|
| 1946-11-20
| 2023-05-26
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6305
| ''[[:d:Q16116092|Pat Murphy]]''
|
| 1947-12-19
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6306
| ''[[:d:Q16123852|David Nott]]''
| [[File:David Nott addressing the Keep Her Safe conference in 2013.jpg|center|128px]]
| 1956
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6307
| ''[[:d:Q16135575|Hilary Boyd]]''
|
| 1949-10-04<br/>1949-06-23
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 6308
| ''[[:d:Q16144618|Lorraine Barrett]]''
| [[File:Lorraine Barrett AM.jpg|center|128px]]
| 1950-03-18
|
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 6309
| ''[[:d:Q16145283|Michael Hollingsworth]]''
|
| 1950-02-05
|
| [[Swansea]]<br/>[[Canadae]]
|-
| style='text-align:right'| 6310
| ''[[:d:Q16146280|Dan Baker]]''
|
| 1992-07-05
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6311
| ''[[:d:Q16146480|Martin J. Ball]]''
|
| 1951-02-23
|
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 6312
| ''[[:d:Q16148201|Paul Chapman]]''
|
| 1951-09-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6313
| ''[[:d:Q16148758|Nick Griffiths]]''
|
| 1951-12-24
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6314
| ''[[:d:Q16148893|Clive Hicks-Jenkins]]''
|
| 1951-06-11
|
| [[Newport]]
|-
| style='text-align:right'| 6315
| ''[[:d:Q16150175|Roger Argente]]''
|
| 1962
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6316
| ''[[:d:Q16150554|Nicky Stevens]]''
|
| 1949-12-03
|
| [[Wales]]
|-
| style='text-align:right'| 6317
| ''[[:d:Q16152009|Barry Tucker]]''
|
| 1952-08-28
|
| [[Swansea]]
|-
| style='text-align:right'| 6318
| ''[[:d:Q16154488|Rakie Ayola]]''
|
| 1968-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6319
| ''[[:d:Q16156023|Kieran Evans]]''
|
| 1969-02-08
|
| [[St Davids]]
|-
| style='text-align:right'| 6320
| ''[[:d:Q16185522|Marc Phillips]]''
|
| 1953-12-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6321
| ''[[:d:Q16186256|Keith Griffiths]]''
| [[File:Keith Griffiths at TEDx Nov2015.jpg|center|128px]]
| 1954-10-12
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6322
| ''[[:d:Q16186314|Les Keen]]''
|
| 1954-11-13
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6323
| ''[[:d:Q16187020|James Coombes]]''
|
| 1956-10-08
|
| [[Newport]]
|-
| style='text-align:right'| 6324
| ''[[:d:Q16188850|Roger Blake]]''
|
| 1957-12-21
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6325
| ''[[:d:Q16190199|Philip Bounds]]''
| [[File:PhilipBounds2011.jpg|center|128px]]
| 1950
| 2020-04-08
| [[Swansea]]
|-
| style='text-align:right'| 6326
| ''[[:d:Q16190509|Helen Griffin]]''
|
| 1958
| 2018-06-29
| [[Swansea]]
|-
| style='text-align:right'| 6327
| ''[[:d:Q16191114|David Rees]]''
| [[File:David Rees (5804396479).jpg|center|128px]]
| 1957-01-17
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6328
| ''[[:d:Q16191353|Thomas Thomas]]''
|
| 1899-02-19
| 1980-07-30
| [[Cairdiff]]
|-
| style='text-align:right'| 6329
| ''[[:d:Q16192714|David Garner]]''
| [[File:Installing 846.jpg|center|128px]]
| 1958-05
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 6330
| ''[[:d:Q16192753|Roger Highfield]]''
| [[File:Dr Roger Highfield.JPG|center|128px]]
| 1958
|
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 6331
| ''[[:d:Q16193115|Stephen Garlick]]''
|
| 1959-07-07
|
| [[Swansea]]
|-
| style='text-align:right'| 6332
| ''[[:d:Q16193706|Peter Lawlor]]''
|
| 1960-05-08
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 6333
| ''[[:d:Q16193861|Kelvin Smart]]''
|
| 1960-12-18
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 6334
| ''[[:d:Q16194126|Gareth Jones]]''
| [[File:Violet Berlin and Gareth Jones (Gareth Jones).jpg|center|128px]]
| 1961-07-05
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6335
| ''[[:d:Q16194528|Mark Evans]]''
|
| 1962-04-10
|
| [[Anglesey]]
|-
| style='text-align:right'| 6336
| ''[[:d:Q16195606|David Martyn Jones]]''
|
| 1964
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6337
| ''[[:d:Q16195738|Kerry Peers]]''
|
| 1964-11-01
|
| ''[[:d:Q2622469|Northop Hall]]''
|-
| style='text-align:right'| 6338
| ''[[:d:Q16195981|Gary M Dobbs]]''
| [[File:Gary Dobbs.jpg|center|128px]]
| 1965
|
| [[Rhondda Cynon Taf]]
|-
| style='text-align:right'| 6339
| ''[[:d:Q16197935|Albert Bumford]]''
|
| 20th century
|
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 6340
| ''[[:d:Q16198194|Lew Baker]]''
|
| 1825
| 19th century
| [[Wales]]
|-
| style='text-align:right'| 6341
| ''[[:d:Q16199209|Justin Chaston]]''
|
| 1968-11-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6342
| ''[[:d:Q16199534|Ian Lloyd]]''
|
|
| 1989
| ''[[:d:Q5197252|Cwmparc]]''
|-
| style='text-align:right'| 6343
| ''[[:d:Q16199536|Osian Roberts]]''
| [[File:Osian Roberts.jpg|center|128px]]
| 1965-08-18
|
| [[Anglesey]]
|-
| style='text-align:right'| 6344
| ''[[:d:Q16199645|Jesse Meredith]]''
|
| 1906
| 1974
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 6345
| ''[[:d:Q16199881|Norman Pugh]]''
|
| 1911
|
| ''[[:d:Q13128677|Godre'r Graig]]''
|-
| style='text-align:right'| 6346
| ''[[:d:Q16200395|Rees Hopkin Rhys]]''
|
| 1819-03-19
| 1899-08-13
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6347
| ''[[:d:Q16203457|Emmeline Lewis Lloyd]]''
| [[File:CharletStraton.jpg|center|128px]]
| 1827-11-18
| 1913-09-22
| ''[[:d:Q1324865|Elan Valley]]''
|-
| style='text-align:right'| 6348
| ''[[:d:Q16205127|Ruth Hunt, Baroness Hunt of Bethnal Green]]''
| [[File:Official portrait of Baroness Hunt of Bethnal Green crop 2, 2022.jpg|center|128px]]
| 1980-03-12<br/>1980-06-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6349
| ''[[:d:Q16205567|William Latham Bevan]]''
| [[File:William lathan bevan.jpg|center|128px]]
| 1821-05-01
| 1908-08-24
| ''[[:d:Q4877452|Beaufort]]''
|-
| style='text-align:right'| 6350
| ''[[:d:Q16205582|Gavin Dacey]]''
|
| 1984
|
| [[Wales]]
|-
| style='text-align:right'| 6351
| ''[[:d:Q16205780|Howell de Francis]]''
|
|
|
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 6352
| ''[[:d:Q16205902|Thomas Grey]]''
|
|
| 1915-01-03
| [[Wales]]
|-
| style='text-align:right'| 6353
| ''[[:d:Q16206111|Hywel Davies]]''
|
| 1981-12-19
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6354
| ''[[:d:Q16206117|Jennifer Davies]]''
|
| 1982-03-11
|
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 6355
| ''[[:d:Q16206127|Jonathan Davies]]''
|
| 1980-02-23
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6356
| ''[[:d:Q16206141|Tom Llewellyn]]''
|
|
|
| ''[[:d:Q3398389|Whitchurch]]''
|-
| style='text-align:right'| 6357
| ''[[:d:Q16206142|Rob Davies]]''
| [[File:Rob Davies 2016.jpg|center|128px]]
| 1984-08-14
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6358
| ''[[:d:Q16206326|William Rees]]''
|
| 1899-04-14
| 1968
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 6359
| ''[[:d:Q16206367|Johnny Rogers]]''
|
| 1892-10-01
| 1958-07-26
| ''[[:d:Q4667111|Abergwynfi]]''
|-
| style='text-align:right'| 6360
| ''[[:d:Q16206879|Hugh Lloyd]]''
|
| 1586
| 1667-06-07
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 6361
| ''[[:d:Q16207211|Richard Elis]]''
|
| 1975
|
| [[Wales]]
|-
| style='text-align:right'| 6362
| ''[[:d:Q16207950|Hannah Jones]]''
|
| 1996-09-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6363
| ''[[:d:Q16208301|Gareth Duke]]''
|
| 1986-06-18
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 6364
| ''[[:d:Q16208797|Russell Gomer]]''
|
|
|
| ''[[:d:Q478218|Treforest]]''
|-
| style='text-align:right'| 6365
| ''[[:d:Q16210221|Glyn Meredith]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6366
| ''[[:d:Q16210390|Louisa Henrietta Sheridan]]''
|
| 1810
| 1842
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 6367
| ''[[:d:Q16211037|Dominic Evans]]''
|
| 1970-04-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6368
| ''[[:d:Q16212127|Ness Flowers]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6369
| ''[[:d:Q16212417|Amy Hill]]''
| [[File:Amy hill stage two womens tour 2014.jpg|center|128px]]
| 1995-07-04
|
| [[Newport]]
|-
| style='text-align:right'| 6370
| ''[[:d:Q16212823|Rachel James]]''
| [[File:2016 2017 UCI Track World Cup Apeldoorn 228.jpg|center|128px]]
| 1988-08-30
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6371
| ''[[:d:Q16213085|Nathan Stephens]]''
|
| 1988-04-11
|
| ''[[:d:Q6389163|Kenfig Hill]]''
|-
| style='text-align:right'| 6372
| ''[[:d:Q16213713|Toby Radford]]''
|
| 1971-12-03
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 6373
| ''[[:d:Q16213798|Neil Swain]]''
|
| 1971-09-04
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6374
| ''[[:d:Q16213945|Steve Evans]]''
|
| 1972-01-07
|
| [[Wales]]
|-
| style='text-align:right'| 6375
| ''[[:d:Q16213995|Mark Hill]]''
|
| 1972-12-22
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 6376
| ''[[:d:Q16214561|Leigh Phillips]]''
| [[File:Leigh Phillips (Composer).jpg|center|128px]]
| 1973-08-14
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 6377
| ''[[:d:Q16215062|Nicola Reynolds]]''
|
| 1972-07-26
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6378
| ''[[:d:Q16215512|Jimmy Richards]]''
|
| 1975-12-11
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6379
| ''[[:d:Q16216112|Nathan Strong]]''
|
| 1976-01-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6380
| ''[[:d:Q16216574|James Griffiths]]''
|
| 1977-01-02
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 6381
| ''[[:d:Q16216635|Damien Lacey]]''
|
| 1977-08-03
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6382
| ''[[:d:Q16221709|Nathan Brew]]''
|
| 1982-04-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6383
| ''[[:d:Q16222166|Ifan Evans]]''
|
| 1983-07-22
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6384
| ''[[:d:Q16222332|Kate Alicia Morgan]]''
|
| 1983-06-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6385
| ''[[:d:Q16222538|Nathan Williams]]''
|
| 1983-10-05
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 6386
| ''[[:d:Q16223279|James Merriman]]''
|
| 1984-01-17
|
| [[Wales]]
|-
| style='text-align:right'| 6387
| ''[[:d:Q16223286|Jonathan Mills]]''
| [[File:USO-Sale Sharks - 20131205 - Jonathan Mills.jpg|center|128px]]
| 1984-02-12
|
| [[Wales]]
|-
| style='text-align:right'| 6388
| ''[[:d:Q16223405|Scott Roberts]]''
|
| 1984-10-05
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 6389
| ''[[:d:Q16223639|Nicky Griffiths]]''
|
| 1985-04-07
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6390
| ''[[:d:Q16223817|James Morgan]]''
|
| 1985-08-08
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6391
| ''[[:d:Q16223980|Ross Stephens]]''
|
| 1985-05-28
|
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 6392
| ''[[:d:Q16224261|Joe Thomas]]''
| [[File:JoeThomas2014.jpg|center|128px]]
| 1988-01-29
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6393
| ''[[:d:Q16224682|William Griffin]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6394
| ''[[:d:Q16224740|David Lloyd]]''
|
| 1992-05-15
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6395
| ''[[:d:Q16224744|Hannah Lloyd]]''
|
| 1979-08-25
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6396
| ''[[:d:Q16226895|Chris Jenkins]]''
| [[File:Chris Jenkins, Welsh light-Welterweight boxer 2013.jpg|center|128px]]
| 1988-08-14
|
| [[Swansea]]
|-
| style='text-align:right'| 6397
| ''[[:d:Q16228121|Brian Radford]]''
|
|
|
| ''[[:d:Q6389163|Kenfig Hill]]''
|-
| style='text-align:right'| 6398
| ''[[:d:Q16230200|Thomas Chapman]]''
|
| 1871
| 1929
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 6399
| ''[[:d:Q16230676|Howard Giles]]''
|
| 1946-12-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6400
| ''[[:d:Q16231553|Jonathan Spratt]]''
|
| 1986-04-28
|
| [[Wales]]
|-
| style='text-align:right'| 6401
| ''[[:d:Q16231561|Hywel Stoddart]]''
|
| 1986-04-01
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6402
| ''[[:d:Q16231957|Richard Smith]]''
|
| 1987-11-08
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6403
| ''[[:d:Q16231982|Bruce Tasker]]''
|
| 1987-09-02
|
| ''[[:d:Q6504834|Lawrenny]]''
|-
| style='text-align:right'| 6404
| ''[[:d:Q16232132|Jevon Groves]]''
|
| 1988-04-03
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6405
| ''[[:d:Q16232219|Iwan Lewis]]''
|
| 1988-12-28
|
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 6406
| ''[[:d:Q16232794|Darragh Mortell]]''
| [[File:Darragh Mortell Directing.jpg|center|128px]]
| 1989-06-23
|
| [[Newport]]
|-
| style='text-align:right'| 6407
| ''[[:d:Q16232878|Nic Reynolds]]''
|
| 1989-04-07
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6408
| ''[[:d:Q16233083|Gareth Davies]]''
| [[File:Gareth Davies 2022.jpg|center|128px]]
| 1990-08-18
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6409
| ''[[:d:Q16233186|Harri Greville]]''
|
| 1990-11-28
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6410
| ''[[:d:Q16233500|Lloyd Read]]''
|
| 1990-11-29
|
| [[Newport]]
|-
| style='text-align:right'| 6411
| ''[[:d:Q16233638|Josh Tyler]]''
|
| 1990-12-17
|
| [[Wales]]
|-
| style='text-align:right'| 6412
| ''[[:d:Q16234541|Tesni Evans]]''
| [[File:Monte-Carlo Squash Classic 2018 (cropped).jpg|center|128px]]
| 1992-10-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6413
| ''[[:d:Q16234630|Cory Hill]]''
| [[File:Cory Hill 2020.jpg|center|128px]]
| 1992-02-10
|
| ''[[:d:Q6729365|Maesycoed]]''<br/>[[Pontypridd]]
|-
| style='text-align:right'| 6414
| ''[[:d:Q16234640|Andrew Hughes]]''
| [[File:Andrew Hughes 26-04-2014 1.jpg|center|128px]]
| 1992-06-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6415
| ''[[:d:Q16234958|Rob Evans]]''
|
| 1992-04-14
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 6416
| ''[[:d:Q16235000|Matthew Screech]]''
| [[File:Matthew Screech 2015.jpg|center|128px]]
| 1992-10-24
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 6417
| ''[[:d:Q16235144|Joe Walsh]]''
| [[File:Joe Walsh Crawley Town 1 November 2014.jpg|center|128px]]
| 1992-05-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6418
| ''[[:d:Q16235445|Aaron Holloway]]''
|
| 1993-02-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6419
| ''[[:d:Q16235485|Alex Jones]]''
|
| 1993-09-28
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 6420
| ''[[:d:Q16235579|Rhodri Lloyd]]''
| [[File:Rhodri Lloyd.jpg|center|128px]]
| 1993-07-22
|
| ''[[:d:Q7164547|Penpedairheol]]''
|-
| style='text-align:right'| 6421
| ''[[:d:Q16235894|Luke Thomas]]''
|
| 1993-10-02
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 6422
| ''[[:d:Q16235976|Jordan Williams]]''
| [[File:Jordan Williams (2012).jpg|center|128px]]
| 1993-09-20
|
| [[Swansea]]
|-
| style='text-align:right'| 6423
| ''[[:d:Q16236079|Elliot Dee]]''
|
| 1994-03-07
|
| [[Newport]]
|-
| style='text-align:right'| 6424
| ''[[:d:Q16236125|Lee Evans]]''
| [[File:Lee Evans (Wolves).jpg|center|128px]]
| 1994-07-24
|
| [[Newport]]
|-
| style='text-align:right'| 6425
| ''[[:d:Q16236166|Danny Gosset]]''
| [[File:DanielGossetBangorFC2.jpg|center|128px]]
| 1994-09-30
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6426
| ''[[:d:Q16236193|Cameron Herring]]''
|
| 1994-07-15
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6427
| ''[[:d:Q16236232|Luc Jones]]''
|
| 1994-05-12
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6428
| ''[[:d:Q16236289|Tom Lawrence]]''
| [[File:Tom Lawrence.jpg|center|128px]]
| 1994-01-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6429
| ''[[:d:Q16236306|James Loveridge]]''
|
| 1994-05-16
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6430
| ''[[:d:Q16236782|Dafydd Howells]]''
|
| 1995-03-22
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 6431
| ''[[:d:Q16236924|Seb Morris]]''
|
| 1995-11-30
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6432
| ''[[:d:Q16237062|Leona Kate Vaughan]]''
|
| 1995-02-13
|
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 6433
| ''[[:d:Q16237410|Wynford Evans]]''
|
| 1946-04-30
| 2009-09-23
| [[Swansea]]
|-
| style='text-align:right'| 6434
| ''[[:d:Q16239399|Geraint Todd]]''
|
| 1980
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6435
| ''[[:d:Q16239500|Jennifer Evans]]''
|
| 1982-11-26
|
| [[Wales]]
|-
| style='text-align:right'| 6436
| ''[[:d:Q16240285|Chris Lilygreen]]''
|
| 1965-06-09
|
| [[Newport]]
|-
| style='text-align:right'| 6437
| ''[[:d:Q16240303|Oliver Lloyd]]''
|
| 1520s
| 1589
| ''[[:d:Q20600968|Leighton]]''
|-
| style='text-align:right'| 6438
| ''[[:d:Q16255748|Julia Watson]]''
|
| 1953-09-13
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6439
| ''[[:d:Q16258569|Sarah Wesley]]''
| [[File:Sarah Gwynne Wesley.jpg|center|128px]]
| 1726-10-12
| 1822-12-28
| ''[[:d:Q547052|Brecknockshire]]''<br/>''[[:d:Q5524325|Garth]]''
|-
| style='text-align:right'| 6440
| ''[[:d:Q16266578|Ray Henwood]]''
|
| 1937-01-19
| 2019-08-26
| [[Swansea]]
|-
| style='text-align:right'| 6441
| ''[[:d:Q16318727|Carl Sentance]]''
| [[File:2016 Nazareth - Carl Sentance - by 2eight - DSC2639.jpg|center|128px]]
| 1961-06-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6442
| ''[[:d:Q16325363|Frank Spiller Locke]]''
|
| 1866-01-02
| 1949-05-05
| [[Cairdiff]]
|-
| style='text-align:right'| 6443
| ''[[:d:Q16522550|Robert Ernest Smith]]''
|
| 1917-06-23
| 1986
| [[Newport]]
|-
| style='text-align:right'| 6444
| ''[[:d:Q16524116|Isabella Gifford]]''
|
| 1825
| 1891-12-26
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 6445
| ''[[:d:Q16527618|Alex Morgan]]''
|
| 1987-04-16
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6446
| ''[[:d:Q16559378|Edward Maes Llaned Owen]]''
| [[File:Edward Owen's photography 'Arrived at Chubut in 1874' (2).jpg|center|128px]]
| 1846-02-06
| 1931-10-29
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 6447
| ''[[:d:Q16561032|Andrew Matthews]]''
|
| 1948
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6448
| ''[[:d:Q16564560|Ian Thomas]]''
|
| 1963
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6449
| ''[[:d:Q16591980|Owen Roberts]]''
|
| 1939-02-01
| 2012-10-23
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 6450
| ''[[:d:Q16610733|Tim Davies]]''
|
| 1950-08-18
|
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 6451
| ''[[:d:Q16623283|William Peart]]''
|
| 1904
| 1991-02
| [[Newport]]
|-
| style='text-align:right'| 6452
| ''[[:d:Q16658494|Mathonwy Hughes]]''
|
| 1901-02-24
| 1999-05
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 6453
| ''[[:d:Q16658495|Edward Prosser Rhys]]''
|
| 1901-03-04
| 1945-02-06
| [[Wales]]
|-
| style='text-align:right'| 6454
| ''[[:d:Q16658496|John Ellis Williams]]''
|
| 1901-04-19
| 1975-01-07
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 6455
| ''[[:d:Q16707733|Harry Goodwin]]''
|
| 1870-09-30
| 1955-11-13
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6456
| ''[[:d:Q16727629|Cara Braia]]''
|
| 1992-06-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6457
| ''[[:d:Q16728064|Claire Jones]]''
|
| 1985
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6458
| ''[[:d:Q16728146|Rachel K Collier]]''
| [[File:Rachel K Collier General Press Pic.jpg|center|128px]]
| 1989
|
| [[Swansea]]
|-
| style='text-align:right'| 6459
| ''[[:d:Q16729053|John Forrester-Clack]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6460
| ''[[:d:Q16729677|Tom Harrison]]''
|
| 1985-07-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6461
| ''[[:d:Q16729774|Rhiannon Henry]]''
|
| 1987-05-20
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6462
| ''[[:d:Q16731153|Eddie Ladd]]''
|
| 1964-04-18
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 6463
| ''[[:d:Q16731199|Kate Lambert]]''
| [[File:Kate Lambert - Kato (cropped).jpg|center|128px]]
| 1983-09-16
|
| [[Wales]]
|-
| style='text-align:right'| 6464
| ''[[:d:Q16731446|Flex Lewis]]''
|
| 1983-11-15
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6465
| ''[[:d:Q16734442|John Peter]]''
|
| 1938-08-24
| 2020-07-09
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 6466
| ''[[:d:Q16734502|Phlegm]]''
| [[File:Phlegm's interpretation of a character in 'The Triumph of David' by Nicholas Poussin.jpg|center|128px]]
|
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 6467
| ''[[:d:Q16735285|Beth Robert]]''
|
| 1977-04-30
|
| ''[[:d:Q3397975|Pont-rhyd-y-groes]]''
|-
| style='text-align:right'| 6468
| ''[[:d:Q16735288|Aled Roberts]]''
| [[File:Aled Roberts (6324905377).jpg|center|128px]]
| 1962-05-17
| 2022-02-13
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 6469
| ''[[:d:Q16737328|John William Thomas]]''
|
| 1805
| 1840-03-12
| ''[[:d:Q11012111|Pentir]]''
|-
| style='text-align:right'| 6470
| ''[[:d:Q16737330|Robert Thomas]]''
| [[File:Revd Robert Thomas (Ap Vychan, 1809-80) NLW3362405 (cropped).jpg|center|128px]]
| 1809-08-11
| 1880-04-23
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 6471
| ''[[:d:Q16737332|William Williams]]''
| [[File:Revd William Williams (Caledfryn, 1801-69) NLW3362700.jpg|center|128px]]
| 1801-02-06
| 1869-03-23
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 6472
| ''[[:d:Q16737333|John Williams]]''
|
| 1801-03-01
| 1859-11-01
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 6473
| ''[[:d:Q16738650|George Lawrence Davis]]''
| [[File:George-lawrence-en-la-imprenta.jpg|center|128px]]
| 1830
| 1894
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6474
| ''[[:d:Q16740079|Elaine Treharne]]''
| [[File:ProfessorElaineTreharne-4.16.19.jpg|center|128px]]
| 1964
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6475
| ''[[:d:Q16743899|Huw Jenkins]]''
|
| 1963-03-09
|
| ''[[:d:Q6184895|Jersey Marine]]''
|-
| style='text-align:right'| 6476
| ''[[:d:Q16744933|John Bulloch]]''
|
| 1928-04-15
| 2010-11-18
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6477
| ''[[:d:Q16745080|Danny Winter]]''
| [[File:Danny Winter (1947).png|center|128px]]
| 1918-06-14
| 2004-03-22
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 6478
| ''[[:d:Q16745471|Connor Roberts]]''
|
| 1992-12-08
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6479
| ''[[:d:Q16762663|Calum Antell]]''
|
| 1992-06-13
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6480
| ''[[:d:Q16822099|Preston Austin]]''
|
| 1827-12-09
| 1908-07-07
| ''[[:d:Q6662903|Llwydcoed]]''
|-
| style='text-align:right'| 6481
| ''[[:d:Q16839740|Hugh Foulkes]]''
|
| 1909-04-13
| 1981
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 6482
| ''[[:d:Q16840644|Marmaduke Gwynne]]''
|
| 1691
| 1769-04-13
| ''[[:d:Q6661068|Llanafan Fawr]]''
|-
| style='text-align:right'| 6483
| ''[[:d:Q16842663|Henry Devereux, 14th Viscount Hereford]]''
| [[File:The Trial of Queen Caroline 1820 by Sir George Hayter.jpg|center|128px]]
| 1777
| 1843-05-31
| [[Powys]]
|-
| style='text-align:right'| 6484
| ''[[:d:Q16845399|Hugh Hughes]]''
| [[File:Hugh Hughes.jpg|center|128px]]
| 1790
| 1863-03-11
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 6485
| ''[[:d:Q16846411|John Salusbury]]''
| [[File:Sir John Salisbury by Moses Griffith 02197.jpg|center|128px]]
| 1520
| 1578<br/>1578-03-18
| ''[[:d:Q6662131|Lleweni Hall]]''
|-
| style='text-align:right'| 6486
| ''[[:d:Q16848905|Ehud Rogers]]''
|
| 1909-10-15
| 1996-01-25
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 6487
| ''[[:d:Q16849924|John Wynne]]''
| [[File:Bishop John Wynne.jpg|center|128px]]
| 1667
| 1743-07-15
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 6488
| ''[[:d:Q16850823|David Jones]]''
| [[File:Er cof am y diweddar Barch D Jones, Llangan .. NLW3365112.jpg|center|128px]]
| 1736-07-10<br/>1735
| 1810-08-12<br/>1810
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 6489
| ''[[:d:Q16851896|William Jones]]''
|
| 1762-06-17
| 1846-01-21
| ''[[:d:Q3406264|Gresford]]''
|-
| style='text-align:right'| 6490
| ''[[:d:Q16854017|Joshua Parry]]''
|
| 1719-06-17
| 1776-09-06
| ''[[:d:Q6661429|Llangan]]''
|-
| style='text-align:right'| 6491
| ''[[:d:Q16855987|D. Geraint James]]''
|
| 1922-01-02
| 2010-10-20
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 6492
| ''[[:d:Q16856736|Albert Purchas]]''
|
| 1825
| 1909-09-26
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 6493
| ''[[:d:Q16858267|William Jenkins Rees]]''
| [[File:William Jenkins Rees Hughes.jpg|center|128px]]
| 1772-01-10
| 1855-01-18
| ''[[:d:Q20593537|Llandingad]]''
|-
| style='text-align:right'| 6494
| ''[[:d:Q16859200|John Waters]]''
| [[File:Sir John Waters by William Salter.jpg|center|128px]]
| 1774
| 1842
| ''[[:d:Q5057255|Cefn Cribwr]]''
|-
| style='text-align:right'| 6495
| ''[[:d:Q16859745|David Lloyd]]''
|
| 1635-09-28
| 1692-02-16
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 6496
| ''[[:d:Q16859746|Hugh Lloyd]]''
|
| 1546
| 1601-10-17
| ''[[:d:Q1541249|Llŷn Peninsula]]''
|-
| style='text-align:right'| 6497
| ''[[:d:Q16863488|Ellis Price]]''
|
| 1505
| 1594-10-08
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 6498
| ''[[:d:Q16863591|Lauren Price]]''
| [[File:Lauren Price in 2021.png|center|128px]]
| 1994-06-25
|
| [[Newport]]
|-
| style='text-align:right'| 6499
| ''[[:d:Q16863621|Walter Rumsey]]''
|
| 1584
| 1660
| ''[[:d:Q6661701|Llanover]]''
|-
| style='text-align:right'| 6500
| ''[[:d:Q16863901|David Davies]]''
|
| 1906-04-03
| 1974-06
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 6501
| ''[[:d:Q16885562|Richard Price]]''
|
| 1773
| 1861-04-10
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 6502
| ''[[:d:Q16885739|David Smith]]''
| [[File:Dave Smith NRL.jpg|center|128px]]
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 6503
| ''[[:d:Q16931125|Emma Manners]]''
|
| 1963-09
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 6504
| ''[[:d:Q16933947|Martin Lluelyn]]''
|
| 1616-12-12
| 1682-03-17
| [[Wales]]
|-
| style='text-align:right'| 6505
| ''[[:d:Q16937524|Rosemary Dorothy Moravec]]''
| [[File:Rosemary Moravec 1.jpg|center|128px]]
| 1946-07-24
| 2013-01-16
| [[Cairdiff]]
|-
| style='text-align:right'| 6506
| ''[[:d:Q16943691|Edward Alfred Jones]]''
|
| 1872
| 1943-08-23
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 6507
| ''[[:d:Q16943702|Laurence Bedford Potter]]''
|
| 1883
| 1943
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6508
| ''[[:d:Q16973316|David Williams]]''
|
| 1809-07-12
| 1863-02-28
| ''[[:d:Q8059810|Ystradowen]]''
|-
| style='text-align:right'| 6509
| ''[[:d:Q16976371|Benjamin Davies]]''
|
| 1991-01-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6510
| ''[[:d:Q16982750|Griffith George]]''
|
| 1847
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6511
| ''[[:d:Q16985888|Caleb McDuff]]''
| [[File:Caleb McDuff - Deaf Go Kart Racer.jpg|center|128px]]
| 2008-01-20
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6512
| ''[[:d:Q16988006|Christopher Painter]]''
|
| 1962
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6513
| ''[[:d:Q16988285|Jonathan Woodhouse]]''
|
| 1955-03-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6514
| ''[[:d:Q16991664|Evan Edwards]]''
|
| 1898-12-14
| 1958
| ''[[:d:Q3910782|Bedlinog]]''
|-
| style='text-align:right'| 6515
| ''[[:d:Q17002888|Ewart Lewis]]''
|
| 1914-10-09
| 1963-05
| ''[[:d:Q1996667|Whitland]]''
|-
| style='text-align:right'| 6516
| ''[[:d:Q17006607|Frances Williams]]''
|
| 1904
| 1978
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 6517
| ''[[:d:Q17014441|Thomas Price]]''
| [[File:Rev Thomas Price.jpg|center|128px]]
| 1820-04-17
| 1888-02-29
| ''[[:d:Q6661585|Llanhamlach]]''
|-
| style='text-align:right'| 6518
| ''[[:d:Q17016985|Patricia Wiltshire]]''
|
| 1944<br/>1942
|
| ''[[:d:Q1376956|Gwent]]''
|-
| style='text-align:right'| 6519
| ''[[:d:Q17020455|William Henry Skinner]]''
| [[File:Major William Henry Skinner.jpg|center|128px]]
| 1838
| 1915
| [[Newport]]
|-
| style='text-align:right'| 6520
| ''[[:d:Q17020826|Simon Williams]]''
|
| 1973
|
| [[Wales]]
|-
| style='text-align:right'| 6521
| ''[[:d:Q17027823|Chris Williams]]''
|
| 1963-03-09
| 2024-04-04
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 6522
| ''[[:d:Q17029028|Idris Williams]]''
| [[File:Idris Williams.jpg|center|128px]]
| 1836-04-19
| 1894-11-04
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 6523
| ''[[:d:Q17053621|William Morris]]''
| [[File:The Rev. William Morris D.D., Treorchy.jpg|center|128px]]
| 1843-09-12
| 1922-12-21
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 6524
| ''[[:d:Q17058143|Brynmor Evans]]''
| [[File:Brynmor Evans (MDG).jpg|center|128px]]
| 1972-11-24
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 6525
| ''[[:d:Q17130218|Toni Murray]]''
|
| 1992-06-06
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6526
| ''[[:d:Q17141872|Jennette Fothergill]]''
|
| 1821-04-04
| 1921-06-16
| ''[[:d:Q6176372|Jeffreyston]]''
|-
| style='text-align:right'| 6527
| ''[[:d:Q17151106|Georgia Ruth]]''
| [[File:Georgia Ruth.jpg|center|128px]]
| 1988-01-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6528
| ''[[:d:Q17152128|Tom Rees]]''
| [[File:Tom Rees 1915.jpg|center|128px]]
| 1895-05-18
| 1916-09-17
| ''[[:d:Q7450887|Sennybridge]]''
|-
| style='text-align:right'| 6529
| ''[[:d:Q17159675|Celyn Jones]]''
|
| 1979-06-04
|
| [[Anglesey]]
|-
| style='text-align:right'| 6530
| ''[[:d:Q17161194|Anthony Charles]]''
|
| 1936-09
| 2015-02-14
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 6531
| ''[[:d:Q17198217|John Bryan Evans]]''
|
| 1980-05-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6532
| ''[[:d:Q17198796|Kevin Thomas]]''
|
| 1980-05-08
|
| [[Swansea]]
|-
| style='text-align:right'| 6533
| ''[[:d:Q17199130|Tony Orchard]]''
| [[File:Tony Orchard Univ portrait.jpg|center|128px]]
| 1941-04-29
| 2005-11-19
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6534
| ''[[:d:Q17233261|Ray Desmond]]''
|
| 1925-08-10
| 2020
| [[Newport]]
|-
| style='text-align:right'| 6535
| ''[[:d:Q17306402|Michael Price]]''
|
| 1981-01-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6536
| ''[[:d:Q17307366|Robert Hughes]]''
|
| 1744
| 1785-02-27
| ''[[:d:Q3400990|Penmynydd]]''
|-
| style='text-align:right'| 6537
| ''[[:d:Q17308772|John Eldon Bankes]]''
| [[File:Bankes JE Vanity Fair 1906-03-29.jpg|center|128px]]
| 1854-04-17
| 1946-12-31<br/>1947-12-31
| ''[[:d:Q2573736|Northop]]''
|-
| style='text-align:right'| 6538
| ''[[:d:Q17309155|Arthur D. Houghton]]''
| [[File:Arthur D. Houghton, botanist and politician.jpg|center|128px]]
| 1870
| 1938
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 6539
| ''[[:d:Q17309161|John Hughes]]''
|
| 1872
| 1914
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6540
| ''[[:d:Q17309163|John Hughes]]''
|
| 1873-11-22
| 1932-05-14
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 6541
| ''[[:d:Q17318796|Joseph A. Munitiz]]''
| [[File:Joseph Munitiz in Oxford in 2012.jpg|center|128px]]
| 1931-12-23
| 2022-07-16
| [[Cairdiff]]
|-
| style='text-align:right'| 6542
| ''[[:d:Q17353645|Catherine Davies]]''
|
| 1773
| 1841
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 6543
| ''[[:d:Q17377054|St Curig]]''
| [[File:Eglwys y Santes Julitta St Julitta's Church, Capel Curig 32.JPG|center|128px]]
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 6544
| ''[[:d:Q17385896|Jeff Evans]]''
|
| 1954-08-07
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6545
| ''[[:d:Q17386578|Gerwyn Price]]''
| [[File:Gerwyn Price - 2022337222336 2022-12-03 1.Mannheim Darts Gala - Sven - 1D X MK II - 0573 - AK8I7197.jpg (cropped 2).jpg|center|128px]]
| 1985-03-07
|
| ''[[:d:Q6770972|Markham]]''
|-
| style='text-align:right'| 6546
| ''[[:d:Q17402905|Paul Shackerley]]''
| [[File:Deanofbreconshackerley.jpg|center|128px]]
| 1956-08-16
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 6547
| ''[[:d:Q17403332|Scott Davies]]''
| [[File:2019 Tour of Austria – 3rd stage 20190608 (02).jpg|center|128px]]
| 1995-08-05
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6548
| ''[[:d:Q17403531|Jamie Lucas]]''
| [[File:Jamie Lucas at Bristol Rovers in 2015.jpg|center|128px]]
| 1995-12-06
|
| [[Pontypridd]]
|-
| style='text-align:right'| 6549
| ''[[:d:Q17418382|Phil Basey]]''
|
| 1948-08-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6550
| ''[[:d:Q17418759|Calum Jarvis]]''
|
| 1992-05-12
|
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 6551
| ''[[:d:Q17421625|Lumley Jones]]''
|
| 1876-12-01
| 1918-09-14
| ''[[:d:Q6661272|Llandyssil]]''
|-
| style='text-align:right'| 6552
| ''[[:d:Q17421719|William Henry Powell]]''
| [[File:WHPowell.png|center|128px]]
| 1825-05-10
| 1904-12-26
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6553
| ''[[:d:Q17423834|William Williams]]''
|
| 1738-03-01
| 1817-07-17
| ''[[:d:Q7837762|Trefdraeth]]''
|-
| style='text-align:right'| 6554
| ''[[:d:Q17427011|Huw D. Edwards]]''
|
| 1925
| 2003-11-20
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 6555
| ''[[:d:Q17435926|Merfyn Turner]]''
|
| 1915-10-20
| 1991-08-06
| [[Penygraig]]
|-
| style='text-align:right'| 6556
| ''[[:d:Q17442758|Rae Jenkins]]''
|
| 1903-04-19
| 1985-03-29
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 6557
| ''[[:d:Q17449785|Angel Romaeo]]''
|
| 1997-08-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6558
| ''[[:d:Q17449824|Raer Theaker]]''
|
| 1997-04-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6559
| ''[[:d:Q17479540|Cyngar ap Geraint]]''
| [[File:Eglwys Sant Beuno, St Beuno's Church, Penmorfa, Eifionydd, Gwynedd, Cymru Wales 47.JPG|center|128px]]
| 490
| 6th century
| [[Gwynedd]]
|-
| style='text-align:right'| 6560
| ''[[:d:Q17479557|Dogfan]]''
| [[File:Eglwys Sant Dogfan, Church of St Dogfan, Llanrhaeadr-ym-Mochnant, Powys 23.JPG|center|128px]]
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 6561
| ''[[:d:Q17479587|Gwrddelw]]''
|
|
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 6562
| ''[[:d:Q17479637|Jack Austin]]''
|
| 1917-07-16
| 1993-08-15
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 6563
| ''[[:d:Q17484243|Shaun Pickering]]''
|
| 1961-11-14
| 2023-05-11
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 6564
| ''[[:d:Q17492322|Ashley Williams]]''
|
| 1991-06-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6565
| ''[[:d:Q17496545|Dyddgu Hywel]]''
|
| 1989-03-10
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6566
| ''[[:d:Q17509327|Saint Tudglyd]]''
| [[File:Penmachno Parish Church - geograph.org.uk - 756583.jpg|center|128px]]
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 6567
| ''[[:d:Q17517040|Daniel Kyriakides]]''
|
| 1995-03-21
|
| [[Swansea]]
|-
| style='text-align:right'| 6568
| ''[[:d:Q17578075|Maria Leijerstam]]''
| [[File:Maria Leijerstam.jpeg|center|128px]]
| 1978-06-14
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6569
| ''[[:d:Q17591287|Rachel Musson]]''
| [[File:Rachel-musson DSC08626.jpg|center|128px]]
| 20th century
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 6570
| ''[[:d:Q17612657|Sophie Moulds]]''
|
| 1992-11-28
|
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 6571
| ''[[:d:Q17626716|Archie Hughes]]''
|
| 1919-02-02
| 1992
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 6572
| ''[[:d:Q17627000|William Pierce Owen]]''
|
| 1860-11-20
| 1937-12-13
| [[Wales]]
|-
| style='text-align:right'| 6573
| ''[[:d:Q17715103|Lloyd Handley]]''
|
| 1987-01-17
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 6574
| ''[[:d:Q17984369|Saint Aerdeyrn]]''
|
| 6th century
|
| ''[[:d:Q769782|Kingdom of Powys]]''
|-
| style='text-align:right'| 6575
| ''[[:d:Q17984465|Cynidr]]''
| [[File:Well, Ffynnon Gwynydd, Glasbury - geograph.org.uk - 61678.jpg|center|128px]]
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 6576
| ''[[:d:Q17984517|Gerard H. L. Fitzwilliams]]''
|
| 1882
| 1968-04-08
| ''[[:d:Q10989171|Llandyfriog]]''
|-
| style='text-align:right'| 6577
| ''[[:d:Q18003113|Rhisiart Tal-e-bot]]''
|
| 1975
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6578
| ''[[:d:Q18016151|Amelia Womack]]''
| [[File:Amelia Womack, 2014 (cropped).jpg|center|128px]]
| 1985-01-12
|
| [[Newport]]
|-
| style='text-align:right'| 6579
| ''[[:d:Q18043654|James Benjamin]]''
|
| 1994-02-21
|
| [[Newport]]
|-
| style='text-align:right'| 6580
| ''[[:d:Q18044237|Thomas James]]''
| [[File:Thomas James 2014.jpg|center|128px]]
| 1996-04-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6581
| ''[[:d:Q18044286|Dorian Jones]]''
|
| 1992-09-27
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6582
| ''[[:d:Q18044288|Joe Jones]]''
|
| 1944-09-30
|
| [[Wales]]
|-
| style='text-align:right'| 6583
| ''[[:d:Q18044791|Scott Matthews]]''
|
| 1994-02-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6584
| ''[[:d:Q18045036|Tyler Morgan]]''
|
| 1995-09-11
|
| [[Newport]]
|-
| style='text-align:right'| 6585
| ''[[:d:Q18045213|Angus O'Brien]]''
|
| 1994-09-17
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 6586
| ''[[:d:Q18045430|Rhys Pugsley]]''
|
| 1994-10-20
|
| [[Newport]]
|-
| style='text-align:right'| 6587
| ''[[:d:Q18062133|Ashton Hewitt]]''
|
| 1994-11-20
|
| [[Newport]]
|-
| style='text-align:right'| 6588
| ''[[:d:Q18068338|Clifton Penn-Hughes]]''
|
| 1905-02-11
| 1939-07-07
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6589
| ''[[:d:Q18084617|John Jones]]''
| [[File:John Jones (Mathetes).jpg|center|128px]]
| 1821-07-16
| 1878-11-18
| ''[[:d:Q5120035|Cilrhedyn]]''
|-
| style='text-align:right'| 6590
| ''[[:d:Q18087866|T. Marchant Williams]]''
| [[File:T Marchant Williams.jpg|center|128px]]
| 1845
| 1914-10-27
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6591
| ''[[:d:Q18108230|Caryl Parry Jones]]''
| [[File:Caryl Parry Jones.jpg|center|128px]]
| 1958-04-16
|
| ''[[:d:Q5446245|Ffynnongroew]]''
|-
| style='text-align:right'| 6592
| ''[[:d:Q18109251|Jack Thomas]]''
|
| 1995-05-30
|
| [[Swansea]]
|-
| style='text-align:right'| 6593
| ''[[:d:Q18114832|Robert Williams]]''
| [[File:Portrait of Robert Williams (4674647).jpg|center|128px]]
| 1766<br/>1766-12-06
| 1850-07-11
| ''[[:d:Q731669|Sir Gaernarfon]]''<br/>''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 6594
| ''[[:d:Q18122000|Jordan Williams]]''
| [[File:Jordan Williams.jpg|center|128px]]
| 1995-11-06
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6595
| ''[[:d:Q18123555|Griffith John Williams]]''
|
| 1892-07-19
| 1963-01-10
| ''[[:d:Q13126981|Cellan]]''
|-
| style='text-align:right'| 6596
| ''[[:d:Q18125441|Aaron Collins]]''
| [[File:Aaron Collins Bristol Rovers.jpg|center|128px]]
| 1997-05-27
|
| [[Newport]]
|-
| style='text-align:right'| 6597
| ''[[:d:Q18125528|Christian Doidge]]''
| [[File:CHristiandoidge.jpg|center|128px]]
| 1992-08-25
|
| [[Newport]]
|-
| style='text-align:right'| 6598
| ''[[:d:Q18126117|Billy Hough]]''
|
| 1908-03-04
| No/unknown value
| ''[[:d:Q5603927|Maes-glas]]''
|-
| style='text-align:right'| 6599
| ''[[:d:Q18127948|Josh Sheehan]]''
|
| 1995-03-30
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 6600
| ''[[:d:Q18129138|Jim Williams]]''
|
| 1984-07-27
|
| [[Wales]]
|-
| style='text-align:right'| 6601
| ''[[:d:Q18129502|Thomas William Davids]]''
| [[File:Portrait of T. W. Davids, Colchester (4669724).jpg|center|128px]]
| 1816-06-11
| 1884-04-11
| [[Swansea]]
|-
| style='text-align:right'| 6602
| ''[[:d:Q18148391|Richard Edwards]]''
| [[File:RichardEdwards.jpg|center|128px]]
| 1822-12-23
| 1908-03-07
| [[Ceredigion]]
|-
| style='text-align:right'| 6603
| ''[[:d:Q18159992|Isaac Clarke]]''
|
| 1824
| 1875-04-05
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 6604
| ''[[:d:Q18160397|Arthur James Johnes]]''
|
| 1809-02-04
| 1871-07-23
| ''[[:d:Q20596548|Garthmyl]]''
|-
| style='text-align:right'| 6605
| ''[[:d:Q18162074|Edmund Stonelake]]''
|
| 1873-04-05
| 1960-04-05
| ''[[:d:Q7228312|Pontlotyn]]''
|-
| style='text-align:right'| 6606
| ''[[:d:Q18162186|Scott Tancock]]''
|
| 1993-12-29
|
| [[Swansea]]
|-
| style='text-align:right'| 6607
| ''[[:d:Q18162727|Mike Williams]]''
|
| 1979-02-04
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6608
| ''[[:d:Q18164639|Charles Davies]]''
| [[File:Charles Davies MLC.jpeg|center|128px]]
| 1813
| 1888-02-12
| [[Wales]]
|-
| style='text-align:right'| 6609
| ''[[:d:Q18166244|Brenda Wilson]]''
|
| 1959
|
| [[Wales]]
|-
| style='text-align:right'| 6610
| ''[[:d:Q18169400|Regan Poole]]''
|
| 1998-06-18<br/>1998-07-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6611
| ''[[:d:Q18200042|Edward Pugh]]''
|
| 1761
| 1813
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 6612
| ''[[:d:Q18201527|John Gwilym Jones]]''
|
| 1904-09-27
| 1988-10-16
| ''[[:d:Q3402429|Groeslon]]''
|-
| style='text-align:right'| 6613
| ''[[:d:Q18206315|Dan Hanford]]''
| [[File:Dan Hanford 19-09-2015 1.jpg|center|128px]]
| 1991-03-06
|
| [[Swansea]]
|-
| style='text-align:right'| 6614
| ''[[:d:Q18217120|Natalie Powell]]''
|
| 1990-10-16
|
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 6615
| ''[[:d:Q18221060|Robert D. Anderson]]''
|
| 1942
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6616
| ''[[:d:Q18223030|John Callan James Metford]]''
|
| 1916-01-29
| 2007-03-29
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 6617
| ''[[:d:Q18325032|Siôn Dafydd Rhys]]''
|
| 1534
| 1620
| ''[[:d:Q2910205|Llanfaethlu]]''
|-
| style='text-align:right'| 6618
| ''[[:d:Q18325685|James Birch]]''
|
|
| 1800
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6619
| ''[[:d:Q18325718|Robert Davies]]''
| [[File:The home of Robert Davies (Bardd Nantglyn, 1769-1835) NLW3363888.jpg|center|128px]]
| 1769
| 1835-12-01
| ''[[:d:Q13651875|Nantglyn]]''
|-
| style='text-align:right'| 6620
| ''[[:d:Q18327524|William Ellis Jones]]''
| [[File:Portrait of W. E. Jones. Cawrdaf (4671562) (cropped).jpg|center|128px]]
| 1795-10-09
| 1848-03-27
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 6621
| ''[[:d:Q18330912|Joe Cordina]]''
| [[File:Joe Cordina (2016).jpg|center|128px]]
| 1991-12-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6622
| ''[[:d:Q18331849|Nathan Thorley]]''
|
| 1993-04-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6623
| ''[[:d:Q18340098|Leigh Jones]]''
| [[File:Leigh jones hong kong rugby head coach 20170506.jpg|center|128px]]
| 1959-07-23
|
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 6624
| ''[[:d:Q18341833|Kyle Rees]]''
|
| 1988-07-08
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6625
| ''[[:d:Q18346805|Azariah Shadrach]]''
|
| 1774-06-24
| 1844-01-18
| ''[[:d:Q51713201|Llanfair Nant y Gôf]]''
|-
| style='text-align:right'| 6626
| ''[[:d:Q18350944|Aled Richards]]''
|
| 1969
|
| [[Wales]]
|-
| style='text-align:right'| 6627
| ''[[:d:Q18352539|Marc Wyatt]]''
|
| 1977-09-15
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 6628
| ''[[:d:Q18353250|Nicky Smith]]''
| [[File:Nicky Smith 2019.jpg|center|128px]]
| 1994-04-07
|
| [[Swansea]]
|-
| style='text-align:right'| 6629
| ''[[:d:Q18358867|James Thomas]]''
|
| 1918-09-04
|
| [[Wales]]
|-
| style='text-align:right'| 6630
| ''[[:d:Q18385261|Arnold Williams]]''
|
| 1870-01-06
| 1929-08-20
| [[Swansea]]
|-
| style='text-align:right'| 6631
| ''[[:d:Q18385268|Arthur Radclyffe Dugmore]]''
| [[File:Portrait of Arthur Radclyffe Dugmore.jpg|center|128px]]
| 1870-12-25
| 1955-03-21
| [[Wales]]
|-
| style='text-align:right'| 6632
| ''[[:d:Q18385698|Jonathan Tomlinson]]''
|
| 1982-07-01
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6633
| ''[[:d:Q18387151|Paul Taylor]]''
|
| 1988-06-19
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6634
| ''[[:d:Q18391923|Samuel Tomkinson]]''
| [[File:Samuel Tomkinson.jpeg|center|128px]]
| 1816-04-25
| 1900-08-30
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6635
| ''[[:d:Q18440082|Matthew Gough]]''
|
| 1390
| 1450-07-05
| ''[[:d:Q1770499|Maelor]]''
|-
| style='text-align:right'| 6636
| ''[[:d:Q18509163|William Charles Evans]]''
|
| 1911-10-01
| 1988-07-24
| ''[[:d:Q3402550|Bethel]]''
|-
| style='text-align:right'| 6637
| ''[[:d:Q18510202|Alfred Owen Hughes Jarman]]''
|
| 1911-10
| 1998-10-26
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6638
| ''[[:d:Q18524054|Isaac Jones]]''
|
| 1804-05-02
| 1850-12-02
| [[Aberystwyth]]
|-
| style='text-align:right'| 6639
| ''[[:d:Q18526294|Ada Vachell]]''
|
| 1866-12-27
| 1923-12-29
| [[Cairdiff]]
|-
| style='text-align:right'| 6640
| ''[[:d:Q18526331|Agnes Mason]]''
|
| 1849-08-10
| 1941-12-19
| ''[[:d:Q6498065|Laugharne Township]]''
|-
| style='text-align:right'| 6641
| ''[[:d:Q18526437|Alun Oldfield Davies]]''
|
| 1905-04-18
| 1988-12-01
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 6642
| ''[[:d:Q18526570|Arthur Whitford]]''
| [[File:Arthur Whitford (1928).jpg|center|128px]]
| 1908
| 1996
| [[Swansea]]
|-
| style='text-align:right'| 6643
| ''[[:d:Q18526694|Cadwaladr Cesail]]''
|
| 1614
| 1626
| ''[[:d:Q990100|Dolbenmaen]]''
|-
| style='text-align:right'| 6644
| ''[[:d:Q18526703|Caradog ab Iestyn]]''
|
| 11st century
|
| ''[[:d:Q13131807|Kingdom of Morgannwg]]''
|-
| style='text-align:right'| 6645
| ''[[:d:Q18526861|Richard Pendrill Llewelyn]]''
|
| 1813
| 1891-10-22
| ''[[:d:Q3216519|Laleston]]''
|-
| style='text-align:right'| 6646
| ''[[:d:Q18526878|John Evans]]''
| [[File:Portrait of John Evans, Eglwysbach (4674386).jpg|center|128px]]
| 1840-09-28
| 1897-10-23
| ''[[:d:Q3401668|Eglwysbach]]''
|-
| style='text-align:right'| 6647
| ''[[:d:Q18527125|John Jones]]''
|
| 1788
| 1858-06-19
| ''[[:d:Q6661080|Llanasa]]''
|-
| style='text-align:right'| 6648
| ''[[:d:Q18527386|David Jones]]''
|
| 1703-05-04
| 1785-10-20
| ''[[:d:Q12306663|Conwy Valley]]''
|-
| style='text-align:right'| 6649
| ''[[:d:Q18527701|Dinah Williams]]''
|
| 1911-07-23
| 2009-09-03
| ''[[:d:Q17743941|Crugiau]]''
|-
| style='text-align:right'| 6650
| ''[[:d:Q18527726|Ruby Levick]]''
|
| 1871-09-11
| 1940-03-31
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 6651
| ''[[:d:Q18527879|José Deniz]]''
|
| 1913
| 1994
| [[Cairdiff]]
|-
| style='text-align:right'| 6652
| ''[[:d:Q18527918|Samuel Evans]]''
|
| 1829-05-26
| 1904-11-01
| [[Wales]]
|-
| style='text-align:right'| 6653
| ''[[:d:Q18527967|Gruffydd Phylip]]''
|
| 17th century
| 1666
| ''[[:d:Q3404603|Ardudwy]]''
|-
| style='text-align:right'| 6654
| ''[[:d:Q18528236|Sheila Collins]]''
|
| 1921-08-28
| 2009-03-13
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 6655
| ''[[:d:Q18528438|Laurence Deniz]]''
|
| 1924
| 1996
| [[Cairdiff]]
|-
| style='text-align:right'| 6656
| ''[[:d:Q18528453|Eirlys Roberts]]''
|
| 1911
| 2008
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 6657
| ''[[:d:Q18528597|Lewis Probert]]''
| [[File:Lewis Probert.jpg|center|128px]]
| 1837-09-22
| 1908-12-29
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 6658
| ''[[:d:Q18528756|Enid Wyn Jones]]''
|
| 1909-01-17
| 1967-09-15
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6659
| ''[[:d:Q18528939|Evan Walters]]''
|
| 1893-01-06
| 1951-03-14
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 6660
| ''[[:d:Q18529126|Mary Bridges-Adams]]''
|
| 1854-10-19
| 1939-01-14
| ''[[:d:Q6729370|Maesycwmer]]''
|-
| style='text-align:right'| 6661
| ''[[:d:Q18529229|Mary Catherine Pendrill Llewelyn]]''
| [[File:Mary Pendrill Llewelyn.png|center|128px]]
| 1811-03-12
| 1874-11-19
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 6662
| ''[[:d:Q18530096|John ap John]]''
|
| 1625
| 1697-11-16
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 6663
| ''[[:d:Q18530551|Pamela Shepherd]]''
| [[File:Mother aka Pamela Shepherd and brolly.png|center|128px]]
| 1836-03-19
| 1930-02-24
| ''[[:d:Q13131732|Talywain]]''
|-
| style='text-align:right'| 6664
| ''[[:d:Q18530852|Thomas Powell]]''
|
| 1779-01-06
| 1863-03-24
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6665
| ''[[:d:Q18530965|Walter Churchey]]''
|
| 1747-11-07
| 1805-12-03
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 6666
| ''[[:d:Q18531443|William Morgan Kinsey]]''
|
| 1788
| 1851-04-06
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6667
| ''[[:d:Q18534114|Abel Morgan]]''
|
| 1673<br/>1637
| 1722-12-16
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 6668
| ''[[:d:Q18534191|James Hughes]]''
| [[File:Portrait of James Hughes, (Iago Trichrug) Jewin Street, Llundain (4672617) (cropped).jpg|center|128px]]
| 1779-07-03
| 1844-11-02
| ''[[:d:Q5119956|Ciliau Aeron]]''
|-
| style='text-align:right'| 6669
| ''[[:d:Q18534775|Benjamin Phelps Gibbon]]''
|
| 1802
| 1851-07-28
| ''[[:d:Q7162166|Penally]]''
|-
| style='text-align:right'| 6670
| ''[[:d:Q18535410|Aled Islwyn]]''
|
| 1953
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6671
| ''[[:d:Q18535435|Angharad Rhiannon Davies]]''
|
|
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6672
| ''[[:d:Q18535440|Alistair James]]''
|
| 1984
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6673
| ''[[:d:Q18535445|Dafydd Andrews]]''
|
|
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6674
| ''[[:d:Q18535453|Aled ap Dafydd]]''
|
| 1979-03
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6675
| ''[[:d:Q18535458|Menna Baines]]''
|
| 1965-07
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6676
| ''[[:d:Q18535464|R. G. Berry]]''
|
| 1869-05-20
| 1945-01-16
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 6677
| ''[[:d:Q18535474|Roger Boore]]''
|
| 1938-09-28
| 2021-07-30
| [[Cairdiff]]
|-
| style='text-align:right'| 6678
| ''[[:d:Q18535478|Edward Breese]]''
| [[File:Edward Breese.jpg|center|128px]]
| 1835-04-13
| 1881-03-10
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6679
| ''[[:d:Q18535489|Siôn Cadwaladr]]''
|
| 18th century
|
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 6680
| ''[[:d:Q18535497|Toni Caroll]]''
|
| 1949
|
| [[Ystradgynlais]]
|-
| style='text-align:right'| 6681
| ''[[:d:Q18535501|Celynnin]]''
| [[File:Eglwys Llangelynnin Conwy 31.JPG|center|128px]]
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 6682
| ''[[:d:Q18535514|Clydog]]''
|
| 8th century
|
| [[Wales]]
|-
| style='text-align:right'| 6683
| ''[[:d:Q18535527|Ceri Cunnington]]''
|
| 1976
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 6684
| ''[[:d:Q18535538|Cynhafal]]''
| [[File:St Cynhafal's Church - geograph.org.uk - 135338.jpg|center|128px]]
|
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 6685
| ''[[:d:Q18535539|Cynhaiarn]]''
| [[File:Eglwys Sant Cynhaiarn St Cynhaearn's Church, Ynyscynhaearn, Gwynedd North Wales 05.JPG|center|128px]]
| 7th century
|
| ''[[:d:Q19871789|Caereinion]]''<br/>[[Wales]]
|-
| style='text-align:right'| 6686
| ''[[:d:Q18535548|David Thomas]]''
| [[File:Dafydd Ddu.JPG|center|128px]]
| 1759
| 1822-12-22
| ''[[:d:Q17739482|St Michael's Church, Llanrug]]''
|-
| style='text-align:right'| 6687
| ''[[:d:Q18535553|Siân Melangell Dafydd]]''
|
| 1977-04-28
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 6688
| ''[[:d:Q18535558|Nicholas Daniels]]''
|
| 1974
|
| ''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 6689
| ''[[:d:Q18535561|John Davies]]''
|
| 1784
| 1864-06-20
| ''[[:d:Q6661895|Llanwrthwl]]''
|-
| style='text-align:right'| 6690
| ''[[:d:Q18535562|William John Davies]]''
|
| 1888
| 1957
| ''[[:d:Q13130349|Nant Peris]]''
|-
| style='text-align:right'| 6691
| ''[[:d:Q18535563|D. T. Davies]]''
|
| 1876-08-24<br/>1876
| 1962-07-07<br/>1962
| ''[[:d:Q20644361|Llandyfodwg]]''
|-
| style='text-align:right'| 6692
| ''[[:d:Q18535565|Glan Davies]]''
|
| 1942
|
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 6693
| ''[[:d:Q18535567|Jason Walford Davies]]''
|
| 1971
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6694
| ''[[:d:Q18535569|John Davies]]''
|
| 1783
| 1855-09-20
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 6695
| ''[[:d:Q18535570|Jonathan Ceredig Davies]]''
|
| 1859-05-22
| 1932-03-29
| ''[[:d:Q6661564|Llangunllo]]''
|-
| style='text-align:right'| 6696
| ''[[:d:Q18535571|Lewis Davies]]''
|
| 1777
| 1828-05-10
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 6697
| ''[[:d:Q18535572|Rhisiart Morgan Davies]]''
|
| 1903-02-04
| 1958-02-18
| ''[[:d:Q3398830|Corris]]''
|-
| style='text-align:right'| 6698
| ''[[:d:Q18535573|William Davies]]''
|
| 1831
| 1892-10-03
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 6699
| ''[[:d:Q18535575|Huw Derfel]]''
| [[File:Hugh Derfel Hughes.jpg|center|128px]]
| 1816-03-07
| 1890-05-21
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 6700
| ''[[:d:Q18535594|William Thomas Edwards]]''
| [[File:William Thomas Edwards (Gwilym Deudraeth).jpg|center|128px]]
| 1863-11-21
| 1940-03-20
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 6701
| ''[[:d:Q18535596|Alun R. Edwards]]''
|
| 1919
| 1986
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 6702
| ''[[:d:Q18535597|Sonia Edwards]]''
|
| 1961
|
| ''[[:d:Q3405038|Cemaes]]''
|-
| style='text-align:right'| 6703
| ''[[:d:Q18535598|William Edwards]]''
|
| 1790
| 1855
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 6704
| ''[[:d:Q18535602|Eirwen Davies]]''
|
| 1926
| 2014-03-12
| ''[[:d:Q5456119|Five Roads]]''
|-
| style='text-align:right'| 6705
| ''[[:d:Q18535609|John Emyr]]''
|
| 1950
|
| ''[[:d:Q3400157|Llanwnda]]''
|-
| style='text-align:right'| 6706
| ''[[:d:Q18535610|Tony Etoria]]''
|
| 1954
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6707
| ''[[:d:Q18535612|Robert Evans]]''
| [[File:(The poet Robert Evans (Cybi), outside his home, Bryn Eithin, Llangybi) (6347476638).jpg|center|128px]]
| 1871-11-27
| 1956-10-16
| ''[[:d:Q13129646|Llangybi]]''
|-
| style='text-align:right'| 6708
| ''[[:d:Q18535617|Meirion Evans]]''
|
|
|
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 6709
| ''[[:d:Q18535618|Thomas Christopher Evans]]''
| [[File:Iolo Morganwg (Cadrawd) (page 18 crop).jpg|center|128px]]
| 1846-12-28
| 1918-07-24
| ''[[:d:Q6661579|Llangynwyd]]''
|-
| style='text-align:right'| 6710
| ''[[:d:Q18535623|J. O. Francis]]''
|
| 1882-09-07
| 1956-10-01
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 6711
| ''[[:d:Q18535625|Heledd Fychan]]''
| [[File:Heledd Fychan AS-MS.jpg|center|128px]]
| 1980-09-20
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6712
| ''[[:d:Q18535630|Ffion Dafis]]''
|
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6713
| ''[[:d:Q18535631|William Gambold]]''
|
| 1672-08-10
| 1728-09-13
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 6714
| ''[[:d:Q18535635|Beti George]]''
|
| 1939-01-19
|
| ''[[:d:Q15987290|Coed-y-bryn]]''
|-
| style='text-align:right'| 6715
| ''[[:d:Q18535641|Robert Arthur Griffith]]''
| [[File:Robert Arthur Griffith (Elphin).jpg|center|128px]]
| 1860
| 1936-12-26
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 6716
| ''[[:d:Q18535642|Bruce Griffiths]]''
|
| 1924-04-28
| 1999-01-17
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6717
| ''[[:d:Q18535643|Hywel Griffiths]]''
| [[File:Hywel Griffiths.JPG|center|128px]]
| 1983-03-18
|
| ''[[:d:Q18378847|Glangwili General Hospital]]''
|-
| style='text-align:right'| 6718
| ''[[:d:Q18535647|Gruffudd ap Dafydd Goch]]''
| [[File:Eglwys Fihangel Sant Saint Michaels Church Betws-y-Coed Conwy Gwynedd Cymru Wales 42.JPG|center|128px]]
| 14th century
|
| [[Gwynedd]]
|-
| style='text-align:right'| 6719
| ''[[:d:Q18535652|Gruffudd de la Pole]]''
|
|
| 1309
| ''[[:d:Q769782|Kingdom of Powys]]''
|-
| style='text-align:right'| 6720
| ''[[:d:Q18535656|Robat Gruffudd]]''
|
| 1943-02-27
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 6721
| ''[[:d:Q18535657|Ifan Gruffydd]]''
|
| 1896-02-01
| 1971-03-04
| ''[[:d:Q3400997|Llangristiolus]]''
|-
| style='text-align:right'| 6722
| ''[[:d:Q18535665|Gwenfaen]]''
|
| 6th century
|
| [[Anglesey]]
|-
| style='text-align:right'| 6723
| ''[[:d:Q18535672|Gwyddelan]]''
|
|
|
| [[Gwynedd]]
|-
| style='text-align:right'| 6724
| ''[[:d:Q18535686|Helen Aileen Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6725
| ''[[:d:Q18535692|Hywel Hughes]]''
| [[File:Hywel Hughes, Bogota (1452212).jpg|center|128px]]
| 1886-04-24
| 1970-03-19
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 6726
| ''[[:d:Q18535694|William Hughes]]''
|
|
| 1794
| [[Wales]]
|-
| style='text-align:right'| 6727
| ''[[:d:Q18535697|Huw Cae Llwyd]]''
|
| 1431
| 1500s
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 6728
| ''[[:d:Q18535713|Ifan Huw Dafydd]]''
|
| 1954
|
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 6729
| ''[[:d:Q18535714|Ifor Rees]]''
|
| 1921-03-01
| 2004-02-27
| ''[[:d:Q15987532|Mynydd Bach]]''
|-
| style='text-align:right'| 6730
| ''[[:d:Q18535719|Eldra Jarman]]''
|
| 1917-09-04
| 2000-09-24
| [[Aberystwyth]]
|-
| style='text-align:right'| 6731
| ''[[:d:Q18535726|Robert Isaac Jones]]''
| [[File:Robert Isaac Jones (1813 - 1905), Dictionary of Welsh Biography.jpg|center|128px]]
| 1813
| 1905-03-07
| ''[[:d:Q13130719|Pentrefelin]]''
|-
| style='text-align:right'| 6732
| ''[[:d:Q18535727|Rees Jones]]''
|
| 1797-10-08
| 1844-02-15
| ''[[:d:Q7679437|Talgarreg]]''
|-
| style='text-align:right'| 6733
| ''[[:d:Q18535728|Edward Jones]]''
| [[File:Edward Jones, Bathafarn.jpg|center|128px]]
| 1778-05-09
| 1837-08-26
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 6734
| ''[[:d:Q18535730|David Watkin Jones]]''
| [[File:Portrait of David Watkin Jones, 'Dafydd Morganwg' (4670538) (cropped).jpg|center|128px]]
| 1832-02-14
| 1905-04-25
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6735
| ''[[:d:Q18535731|William Jones]]''
| [[File:Ehedydd Iâl.jpg|center|128px]]
| 1815-08-15
| 1899-02-15
| ''[[:d:Q5263315|Derwen]]''
|-
| style='text-align:right'| 6736
| ''[[:d:Q18535732|Thomas Lloyd Jones]]''
|
| 1810
| 1834-08-16
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 6737
| ''[[:d:Q18535733|Dafydd Jones]]''
|
| 1881
| 1968
| ''[[:d:Q927739|Llangrannog]]''
|-
| style='text-align:right'| 6738
| ''[[:d:Q18535734|Robert Jones]]''
| [[File:RJRhoslan.JPG|center|128px]]
| 1745-01-13
| 1829-04-18
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 6739
| ''[[:d:Q18535735|Abel Jones]]''
| [[File:Abel Jones (Y Bardd Crwst).jpg|center|128px]]
| 1829<br/>1830
| 1901
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 6740
| ''[[:d:Q18535736|Aneurin Jones]]''
|
| 1930
| 2017-09-25
| [[Wales]]
|-
| style='text-align:right'| 6741
| ''[[:d:Q18535738|Dafydd Jones]]''
|
| 1711
| 1777-08-30
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 6742
| ''[[:d:Q18535739|Edward Jones]]''
|
| 1761-03-19
| 1836-12-27
| ''[[:d:Q13130874|Prion]]''
|-
| style='text-align:right'| 6743
| ''[[:d:Q18535741|Evan Pan Jones]]''
| [[File:Evan Pan Jones.jpg|center|128px]]
| 1834-06-12
| 1922-05-08
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 6744
| ''[[:d:Q18535743|Gerallt Jones]]''
|
| 1907
| 1984
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 6745
| ''[[:d:Q18535746|Hefin Jones]]''
|
| 1961
|
| ''[[:d:Q7162285|Pencader]]''
|-
| style='text-align:right'| 6746
| ''[[:d:Q18535747|J. Tywi Jones]]''
|
| 1870-01-07
| 1948
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 6747
| ''[[:d:Q18535748|John Puleston Jones]]''
|
| 1862-02-26
| 1925-01-21
| ''[[:d:Q6661101|Llanbedr-Dyffryn-Clwyd]]''
|-
| style='text-align:right'| 6748
| ''[[:d:Q18535749|John Richard Jones]]''
|
| 1765-10-13
| 1822-06-27
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 6749
| ''[[:d:Q18535752|John William Jones]]''
| [[File:John Williams Jones (Andronicus).jpg|center|128px]]
| 1842-06-30
| 1895-06-15
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 6750
| ''[[:d:Q18535753|Kenneth Glyn Jones]]''
|
| 1915-11-13
| 1995-07-26
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 6751
| ''[[:d:Q18535754|Mei Jones]]''
|
| 1953-02
| 2021-11-05
| ''[[:d:Q3402690|Llanddona]]''
|-
| style='text-align:right'| 6752
| ''[[:d:Q18535757|Rhydderch Jones]]''
|
| 1935
| 1987-11-04
| ''[[:d:Q3398817|Aberllefenni]]''
|-
| style='text-align:right'| 6753
| ''[[:d:Q18535758|Thomas Jones]]''
|
| 1910
| 1972-08-17<br/>1972
| ''[[:d:Q4733322|Alltwen]]''
|-
| style='text-align:right'| 6754
| ''[[:d:Q18535760|Aneirin Karadog]]''
|
| 1982-05-11
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6755
| ''[[:d:Q18535763|Lee Haven-Jones]]''
|
| 1976-06-10
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 6756
| ''[[:d:Q18535765|Thomas Levi]]''
| [[File:Portrait of Thomas Levi (4670546) (cropped).jpg|center|128px]]
| 1825-10-12
| 1916-06-16
| [[Ystradgynlais]]
|-
| style='text-align:right'| 6757
| ''[[:d:Q18535769|Doreen Lewis]]''
|
| 1953-04-04
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6758
| ''[[:d:Q18535771|Lewis Haydn Lewis]]''
|
| 1903
| 1985
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 6759
| ''[[:d:Q18535773|Roger Lort]]''
|
| 1608
| 1664
| ''[[:d:Q7595986|Stackpole Estate]]''
|-
| style='text-align:right'| 6760
| ''[[:d:Q18535782|Robert Lloyd]]''
|
| 1888-02-29
| 1961-12-28
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 6761
| ''[[:d:Q18535784|John Selwyn Lloyd]]''
|
| 1931
| 2023-03-22
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 6762
| ''[[:d:Q18535785|Dewi Llwyd]]''
| [[File:Dewi Llwyd.jpg|center|128px]]
| 1954-03-26
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6763
| ''[[:d:Q18535794|John-Paul Macleod]]''
|
| 1986
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6764
| ''[[:d:Q18535799|Mari'r Fantell Wen]]''
|
| 1735
| 1789
| [[Anglesey]]
|-
| style='text-align:right'| 6765
| ''[[:d:Q18535807|Dyl Mei]]''
|
|
|
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 6766
| ''[[:d:Q18535808|Meinir Jones]]''
|
| 1985-12-26
|
| ''[[:d:Q13126547|Capel Isaac]]''
|-
| style='text-align:right'| 6767
| ''[[:d:Q18535817|Elin Llwyd Morgan]]''
|
|
|
| ''[[:d:Q17323496|Cefn-bryn-brain]]''
|-
| style='text-align:right'| 6768
| ''[[:d:Q18535819|Lowri Morgan]]''
|
| 1975
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 6769
| ''[[:d:Q18535821|Dafydd Morris]]''
|
| 1744
| 1791-09-17
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 6770
| ''[[:d:Q18535845|Bob Owen, Croesor]]''
| [[File:Bob Owen, Croesor, with his wife and some of his books (8469901287).jpg|center|128px]]
| 1885-05-08
| 1962-04-30
| ''[[:d:Q10989811|Llanfrothen]]''
|-
| style='text-align:right'| 6771
| ''[[:d:Q18535853|John Parry]]''
| [[File:Er cof am y diweddar Barch John Parry (Caer) .. NLW3364386.jpg|center|128px]]
| 1775-05-17
| 1846-04-28
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 6772
| ''[[:d:Q18535858|Gerallt Pennant]]''
|
| 1960-01-22
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6773
| ''[[:d:Q18535866|Arwel Gruffydd]]''
|
| 1967-08
|
| ''[[:d:Q3398814|Tanygrisiau]]''
|-
| style='text-align:right'| 6774
| ''[[:d:Q18535874|Stafford Prys]]''
|
| 1732
| 1784
| ''[[:d:Q6661879|Llanwnnog]]''
|-
| style='text-align:right'| 6775
| ''[[:d:Q18535875|Dewi Prysor]]''
|
| 1967-11-27
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 6776
| ''[[:d:Q18535877|Pwyll ap Siôn]]''
| [[File:Golygathon Wicipop Prifysgol Bangor Wicipop Editathon 2017 04.jpg|center|128px]]
| 1968
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6777
| ''[[:d:Q18535878|John Phillips]]''
| [[File:Revd. John Phillips, Bangor (1810-67) NLW3362029.jpg|center|128px]]
| 1810
| 1867-10-09
| ''[[:d:Q3401544|Pontrhydfendigaid]]''
|-
| style='text-align:right'| 6778
| ''[[:d:Q18535888|Thomas Rees]]''
| [[File:Thomas Rees Bala-Bangor.jpg|center|128px]]
| 1869-05-30
| 1926-05-20
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 6779
| ''[[:d:Q18535889|Henry Rees]]''
| [[File:Parch. Henry Rees, Lerpwl, 1798-1869.jpg|center|128px]]
| 1798-02-15
| 1869-02-18
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 6780
| ''[[:d:Q18535890|Thomas Mardy Rees]]''
| [[File:T-Mardy-Rees.jpg|center|128px]]
| 1871
| 1953-05-02
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6781
| ''[[:d:Q18535894|Melville Richards]]''
|
| 1910-11
| 1973-11-03
| ''[[:d:Q5446198|Ffairfach]]''
|-
| style='text-align:right'| 6782
| ''[[:d:Q18535896|Ellis Roberts]]''
| [[File:Portrait of 'Ellis Wyn o Wyrfai' (4670499) (cropped).jpg|center|128px]]
| 1827-02-13
| 1895-04-23
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 6783
| ''[[:d:Q18535898|Absalom Roberts]]''
|
| 1780
| 1864
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 6784
| ''[[:d:Q18535900|Bethan Rhys Roberts]]''
|
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6785
| ''[[:d:Q18535901|Cefin Roberts]]''
|
| 1953-10-28
|
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 6786
| ''[[:d:Q18535906|Lleucu Roberts]]''
|
| 1964-09-27
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 6787
| ''[[:d:Q18535914|Manon Steffan Ros]]''
| [[File:Manon Steffan Ros (33218890640).jpg|center|128px]]
| 1983-01-19
|
| ''[[:d:Q20593646|Llanddeiniol]]''
|-
| style='text-align:right'| 6788
| ''[[:d:Q18535916|Robert John Rowlands]]''
|
| 1880-05-20
| 1967-11-02
| ''[[:d:Q3396898|Abergwyngregyn]]''
|-
| style='text-align:right'| 6789
| ''[[:d:Q18535925|Rhuddlad]]''
|
| 5th century
|
| ''[[:d:Q4657278|Llanrhuddlad]]''
|-
| style='text-align:right'| 6790
| ''[[:d:Q18535939|Edward Samuel]]''
| [[File:Portrait of Edward Samuel (4670191) (cropped).jpg|center|128px]]
| 1674
| 1748-04-08
| ''[[:d:Q15987287|Penmorfa]]''
|-
| style='text-align:right'| 6791
| ''[[:d:Q18535942|Thomas Shankland]]''
|
| 1858-10-14
| 1927-02-20
| ''[[:d:Q6661566|Llangynin]]''
|-
| style='text-align:right'| 6792
| ''[[:d:Q18535948|John Davies]]''
|
| 17th century
| 1694
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 6793
| ''[[:d:Q18535979|Emily Tucker]]''
|
| 1991-09-02
|
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 6794
| ''[[:d:Q18535993|William Thomas]]''
|
| 1843-03-17
| 1890-10-03
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 6795
| ''[[:d:Q18535994|Ernest Lewis Thomas]]''
|
| 1904
| 1983
| ''[[:d:Q6661154|Llanddeusant]]''
|-
| style='text-align:right'| 6796
| ''[[:d:Q18536007|Gareth F. Williams]]''
|
| 1955-02-09
| 2016-09-14
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 6797
| ''[[:d:Q18536008|Hugh Williams]]''
|
|
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 6798
| ''[[:d:Q18536009|Ifor Wyn Williams]]''
|
| 1923-08-31
| 1999
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6799
| ''[[:d:Q18536012|John Ellis Williams]]''
|
| 1872
|
| ''[[:d:Q3400141|Morfa Nefyn]]''
|-
| style='text-align:right'| 6800
| ''[[:d:Q18536013|John Roberts Williams]]''
|
| 1914-03-24
| 2004-10-27
| ''[[:d:Q3401686|Llangybi]]''
|-
| style='text-align:right'| 6801
| ''[[:d:Q18536016|William Morgan Williams]]''
|
| 1832-06-03
| 1877-03-09
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 6802
| ''[[:d:Q18536031|Tom Beynon]]''
|
| 1886-06-03
| 1961-02-10
| ''[[:d:Q3395358|Kidwelly]]''<br/>''[[:d:Q6947838|Mynyddygarreg]]''
|-
| style='text-align:right'| 6803
| ''[[:d:Q18536056|Ben Bowen]]''
| [[File:Ben Bowen.jpg|center|128px]]
| 1878
| 1903-08-16
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 6804
| ''[[:d:Q18536058|Cadfarch]]''
|
|
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 6805
| ''[[:d:Q18536061|Griffith Evans]]''
| [[File:Portrait of Griffith Evans (1835-1935) Wellcome L0002989.jpg|center|128px]]
| 1835-08-07
| 1935-12-07
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 6806
| ''[[:d:Q18545621|Laura McAllister]]''
| [[File:Professor Laura McAllister (8552094408).jpg|center|128px]]
| 1964-12-10
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6807
| ''[[:d:Q18546110|Arthur Roberts]]''
|
| 1897-04-07
| 1964
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 6808
| ''[[:d:Q18546445|David Emlyn Evans]]''
| [[File:Portrait of D. Emlyn Evans (4673959).jpg|center|128px]]
| 1843-09-21
| 1913-04-19
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 6809
| ''[[:d:Q18546621|John Roland Phillips]]''
|
| 1844-06
| 1887-06-03
| ''[[:d:Q5119942|Cilgerran]]''
|-
| style='text-align:right'| 6810
| ''[[:d:Q18546647|John Williams]]''
|
| 1727-03-25
| 1798-04-15
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 6811
| ''[[:d:Q18559339|Valerie Gearon]]''
|
| 1937-09-27
| 2003-07-09
| [[Newport]]
|-
| style='text-align:right'| 6812
| ''[[:d:Q18559698|Benjamin Davies]]''
|
| 1814
| 1875-07-19
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 6813
| ''[[:d:Q18559723|Edward Le Davis]]''
|
| 1640
| 1684
| [[Wales]]
|-
| style='text-align:right'| 6814
| ''[[:d:Q18559733|Frederick Brundrett]]''
|
| 1894
| 1974
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 6815
| ''[[:d:Q18559825|Marmaduke Matthews]]''
|
| 1606
| 1683
| [[Swansea]]
|-
| style='text-align:right'| 6816
| ''[[:d:Q18559856|Robert Davies]]''
|
| 1816-04-01
| 1905-12-29
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 6817
| ''[[:d:Q18559864|Sarah Matthews]]''
|
| 1846-01
| 1929
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 6818
| ''[[:d:Q18559909|William Davis]]''
|
| 1627
| 1690
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6819
| ''[[:d:Q18572211|Alice Williams]]''
|
| 1863-03-12
| 1957-08-15
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 6820
| ''[[:d:Q18572230|Ann Davies]]''
|
| 1914-10-02
| 1954-01-09
| [[Cairdiff]]
|-
| style='text-align:right'| 6821
| ''[[:d:Q18572258|Anne Penny]]''
|
| 1729-01-06
| 1784-03-17<br/>1776
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6822
| ''[[:d:Q18576042|Dorcas Erbery]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6823
| ''[[:d:Q18576619|Kathleen Lloyd Jones]]''
| [[File:Kathleen Lloyd Jones by unknown in 1920s.jpg|center|128px]]
| 1898-06-04
| 1978-07-09
| ''[[:d:Q13656930|Oystermouth]]''
|-
| style='text-align:right'| 6824
| ''[[:d:Q18576682|Margaret Davies]]''
|
| 1700
| 1785
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 6825
| ''[[:d:Q18576757|Michael Williams]]''
|
| 1935-06-24
| 2009-10-26
| [[Swansea]]
|-
| style='text-align:right'| 6826
| ''[[:d:Q18576797|Nun Morgan Harry]]''
|
| 1800-06-09
| 1842-10-22
| [[Lampeter Velfrey]]
|-
| style='text-align:right'| 6827
| ''[[:d:Q18577073|Thomas Gruffydd]]''
|
| 1815
| 1887-08-30
| ''[[:d:Q6661562|Llangynidr]]''
|-
| style='text-align:right'| 6828
| ''[[:d:Q18588247|Bryan Parry]]''
|
| 1992-07-13
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6829
| ''[[:d:Q18588991|Henry Stanhope Sloman]]''
|
| 1861
| 1945-12-29
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 6830
| ''[[:d:Q18593184|Jenkin Jones]]''
|
| 1700
| 1742-06-20
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 6831
| ''[[:d:Q18593818|Aelhaearn]]''
| [[File:Saint Aelhaiarn.png|center|128px]]
| 6th century
|
| ''[[:d:Q769782|Kingdom of Powys]]''<br/>[[Wales]]
|-
| style='text-align:right'| 6832
| ''[[:d:Q18601440|Merlin James]]''
|
| 1960
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6833
| ''[[:d:Q18603715|Bedo Hafesb]]''
|
| 1568
| 1585
| [[Powys]]
|-
| style='text-align:right'| 6834
| ''[[:d:Q18612371|Judith Phillips]]''
|
| 1959-02-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6835
| ''[[:d:Q18624411|Gavin Jones]]''
|
| 1980-02-01
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6836
| ''[[:d:Q18627269|Tudor Owen]]''
| [[File:Tudor Owen in Perils of the Jungle.jpg|center|128px]]
| 1898-01-20
| 1979-03-13
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 6837
| ''[[:d:Q18630239|Robert Jones]]''
| [[File:Robert Jones (Welsh composer).jpg|center|128px]]
| 1945-03-11
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6838
| ''[[:d:Q18637292|Joe Davies]]''
|
| 1995-11-13
|
| [[Newport]]
|-
| style='text-align:right'| 6839
| ''[[:d:Q18637509|Emily Kagan]]''
|
| 1981-07-14
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6840
| ''[[:d:Q18637863|Dewi Penrhyn Jones]]''
|
| 1994
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6841
| ''[[:d:Q18638518|David Morrell]]''
|
| 1926-10-27
| 1974-12-05
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 6842
| ''[[:d:Q18638752|Gwyn Parry]]''
|
| 1946
| 2014-03-19
| ''[[:d:Q3396843|Rachub]]''
|-
| style='text-align:right'| 6843
| ''[[:d:Q18640326|Les Boulter]]''
|
| 1913-08-31
| 1974-11-30
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 6844
| ''[[:d:Q18640327|Gerry Humphreys]]''
|
| 1946-01-14
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 6845
| ''[[:d:Q18640419|T. H. Thomas]]''
| [[File:TH Thomas.jpg|center|128px]]
| 1839-03-31
| 1915-07-05
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6846
| ''[[:d:Q18641449|Dick Hall]]''
|
| 1872-11-20
| 1906-12-14
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 6847
| ''[[:d:Q18641986|Edward Abel]]''
|
| 1931-12-03
| 2021-04-19
| ''[[:d:Q1191288|Mid Glamorgan]]''
|-
| style='text-align:right'| 6848
| ''[[:d:Q18645677|Edwin Bickerstaff]]''
|
| 1920-11-20
| 2007-11-23
| [[Aberystwyth]]
|-
| style='text-align:right'| 6849
| ''[[:d:Q18646016|Herbert Buckler]]''
|
| 1878-01-03
| 1957-01-23
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6850
| ''[[:d:Q18646602|Wendell Morgan]]''
|
| 1935-04-22
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 6851
| ''[[:d:Q18657319|Daniel Hickey]]''
| [[File:Daniel Hickey.png|center|128px]]
| 1869-10-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6852
| ''[[:d:Q18658485|David Erwyd Jenkins]]''
|
| 1864
| 1937-09-06
| ''[[:d:Q7228391|Pontyates]]''
|-
| style='text-align:right'| 6853
| ''[[:d:Q18670941|Dafydd William]]''
|
| 1720
| 1794-10-01
| ''[[:d:Q6661277|Llanedi]]''
|-
| style='text-align:right'| 6854
| ''[[:d:Q18670974|David Hughes]]''
| [[File:Portrait of D. Hughes, B.A., Tredegar (4672914).jpg|center|128px]]
| 1813-06-21
| 1872-06-03
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 6855
| ''[[:d:Q18670980|David Johns]]''
|
| 1794
| 1843-08-06
| ''[[:d:Q27056347|Llanina]]''
|-
| style='text-align:right'| 6856
| ''[[:d:Q18670987|David Lloyd]]''
|
| 1597
| 1663<br/>1663-09-07
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 6857
| ''[[:d:Q18670989|David Lloyd]]''
|
| 1752-05-12
| 1838-03-03
| ''[[:d:Q13129609|Llanbister]]''
|-
| style='text-align:right'| 6858
| ''[[:d:Q18671020|Edmund Jones]]''
|
| 1702-04-01
| 1793
| ''[[:d:Q4667220|Aberystruth]]''
|-
| style='text-align:right'| 6859
| ''[[:d:Q18671495|Hugh Owen]]''
|
| 1784-05-23
| 1861-12-16
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 6860
| ''[[:d:Q18671555|James Gooden]]''
|
| 1670
| 1730-10-11
| ''[[:d:Q5256625|Denbighshire]]''
|-
| style='text-align:right'| 6861
| ''[[:d:Q18671762|John Griffiths]]''
|
| 1731
| 1811-11-12
| ''[[:d:Q17487513|Llanglydwen]]''
|-
| style='text-align:right'| 6862
| ''[[:d:Q18671795|John Harris]]''
|
| 1802-12-12
| 1823-12-04
| [[Swansea]]
|-
| style='text-align:right'| 6863
| ''[[:d:Q18671846|John Howell]]''
|
| 1774
| 1830<br/>1830-11-18
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 6864
| ''[[:d:Q18671850|John Hughes]]''
|
| 1776-05-18
| 1843-05-15
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 6865
| ''[[:d:Q18671851|John Hughes]]''
| [[File:Venble John Hughes, Archdeacon of Cardigan.jpg|center|128px]]
| 1787
| 1860-11-01
| ''[[:d:Q3401728|Llandre]]''
|-
| style='text-align:right'| 6866
| ''[[:d:Q18671852|John Hughes]]''
| [[File:Rev. John Hughes.jpg|center|128px]]
| 1796-02-11
| 1860-08-08
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6867
| ''[[:d:Q18671893|John Jones]]''
|
| 1575
| 1635<br/>1635-12-17
| ''[[:d:Q6661382|LlanfrynachLlanfrynach]]''
|-
| style='text-align:right'| 6868
| ''[[:d:Q18671895|John Jones]]''
|
| 1772-08-17
| 1837-09-28
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 6869
| ''[[:d:Q18671898|John Jones]]''
|
| 1804-01-20
| 1887-08-17
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 6870
| ''[[:d:Q18671990|John Lloyd]]''
|
| 1475
| 1523<br/>1523-04-03
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 6871
| ''[[:d:Q18671991|John Lloyd]]''
|
| 1558
| 1603
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 6872
| ''[[:d:Q18672119|Richard Lloyd]]''
| [[File:Portrait of Dr. Richardi Lloyd (4673366).jpg|center|128px]]
| 1595
| 1659
| ''[[:d:Q17742315|Henblas]]''
|-
| style='text-align:right'| 6873
| ''[[:d:Q18672131|Richard Mills]]''
|
| 1809
| 1844-12-24
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 6874
| ''[[:d:Q18672164|Robert Griffiths]]''
|
| 1805-12-13
| 1883-06-16
| ''[[:d:Q6662131|Lleweni Hall]]''
|-
| style='text-align:right'| 6875
| ''[[:d:Q18672183|Robert Holland]]''
|
| 1557<br/>1556<br/>1557-01-18
| 1622-11-15
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 6876
| ''[[:d:Q18672266|Roger Pocock]]''
| [[File:Henry Roger Ashwell Pocock (1865–1941).png|center|128px]]
| 1865-11-09
| 1941-11-12
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 6877
| ''[[:d:Q18672558|Thomas Jones]]''
|
| 1768-05-15
| 1828-02-19
| ''[[:d:Q6661823|Llantysilio]]''
|-
| style='text-align:right'| 6878
| ''[[:d:Q18672598|Thomas Llewelyn]]''
|
| 1720
| 1783-08-07
| ''[[:d:Q3401140|Gelligaer]]''
|-
| style='text-align:right'| 6879
| ''[[:d:Q18672685|Trevor Evans]]''
|
| 1902
| 1981
| ''[[:d:Q4667208|Abertridwr]]''
|-
| style='text-align:right'| 6880
| ''[[:d:Q18672826|William Holland]]''
|
| 1711
| 1761-02-23
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 6881
| ''[[:d:Q18672832|William Hopkins]]''
|
| 1706
| 1786
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 6882
| ''[[:d:Q18672840|William Howels]]''
| [[File:Portrait of The Revd. William Howels (4670914).jpg|center|128px]]
| 1778-09
| 1832<br/>1832-11-18
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 6883
| ''[[:d:Q18672847|William Hughes]]''
|
| 1856
| 1924-01-28
| [[Wales]]
|-
| style='text-align:right'| 6884
| ''[[:d:Q18672856|William Johns]]''
|
| 1771
| 1845<br/>1845-11-27
| ''[[:d:Q5120043|Cilymaenllwyd]]''
|-
| style='text-align:right'| 6885
| ''[[:d:Q18674052|Julines Herring]]''
|
| 1582
| 1644
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 6886
| ''[[:d:Q18674094|Lewis Lewis]]''
|
| 1793-03-21
|
| ''[[:d:Q13130671|Penderyn]]''
|-
| style='text-align:right'| 6887
| ''[[:d:Q18674333|Peter Williams]]''
|
| 1756-10-09
| 1837-02-20
| ''[[:d:Q2573736|Northop]]''
|-
| style='text-align:right'| 6888
| ''[[:d:Q18674355|Rachel Barrett]]''
| [[File:Rachel Barrett - Suffragette.png|center|128px]]
| 1874-11-12
| 1953-08-26
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6889
| ''[[:d:Q18674374|Rhys Jones]]''
|
| 1713
| 1801-02-14
| [[Wales]]
|-
| style='text-align:right'| 6890
| ''[[:d:Q18683953|Alize Lily Mounter]]''
| [[File:Alize Mounter (cropped).jpg|center|128px]]
| 1988-09-29
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 6891
| ''[[:d:Q18688008|Iori Jenkins]]''
|
| 1959-12-11
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6892
| ''[[:d:Q18691847|Ilar]]''
| [[File:Sant Ilar (st ilar) ('St Hilary's Church' is NEVER used), Llanilar, Aberystwyth, Ceredigion, Cymru 68.JPG|center|128px]]
| 6th century
|
| ''[[:d:Q2578706|Kingdom of Ceredigion]]''
|-
| style='text-align:right'| 6893
| ''[[:d:Q18715771|Enoch Jenkins]]''
|
| 1892-11-06
| 1984-01-04
| [[Pontypridd]]
|-
| style='text-align:right'| 6894
| ''[[:d:Q18715898|William Davies]]''
|
| 1881-03-19
| 1942-06-22
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6895
| ''[[:d:Q18716154|David Griffiths]]''
|
| 1874-03-31
| 1931-09-05
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 6896
| ''[[:d:Q18719315|Michael Brown]]''
|
| 1951-09-27
|
| [[Swansea]]
|-
| style='text-align:right'| 6897
| ''[[:d:Q18719387|Jonathan Edwards]]''
|
| 1979-10-16
|
| [[Newport]]
|-
| style='text-align:right'| 6898
| ''[[:d:Q18719690|Mark James Elgar Coode]]''
|
| 1937
|
| [[Wales]]
|-
| style='text-align:right'| 6899
| ''[[:d:Q18729823|Trystan Edwards]]''
|
| 1884-11-10
| 1973-01-30
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6900
| ''[[:d:Q18729849|E. M. Bruce Vaughan]]''
|
| 1856-03-06
| 1919-06-13
| [[Cairdiff]]
|-
| style='text-align:right'| 6901
| ''[[:d:Q18730079|Charles Morgan]]''
| [[File:Sint Gertrudiskerk grafmonument Morgan.jpg|center|128px]]
| 1576
| 1643
| [[Monmouthshire]]
|-
| style='text-align:right'| 6902
| ''[[:d:Q18730245|Efa ferch Maredudd]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 6903
| ''[[:d:Q18730434|Henry Salesbury]]''
|
| 1561
| 1637-10-06
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 6904
| ''[[:d:Q18734926|Thomas Peter Ellis]]''
|
| 1873-06-04
| 1936-07-07
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6905
| ''[[:d:Q18735322|Thomas Nicholas]]''
|
| 1816-02-17
| 1879-05-14
| ''[[:d:Q7837772|Treffgarne]]''
|-
| style='text-align:right'| 6906
| ''[[:d:Q18736094|William Morgan]]''
|
| 1623
| 1689-09-28
| ''[[:d:Q5119934|Cilcain]]''
|-
| style='text-align:right'| 6907
| ''[[:d:Q18737039|Jack Phillips]]''
|
| 1903
| 1985
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 6908
| ''[[:d:Q18737042|David Pugh]]''
|
| 1947-01-22
|
| ''[[:d:Q6770972|Markham]]''
|-
| style='text-align:right'| 6909
| ''[[:d:Q18737121|David Eastwood]]''
|
| 1919-01-27
| 2010-10-29
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 6910
| ''[[:d:Q18737198|Mair Russell-Jones]]''
|
| 1917-10-17
| 2013-12-28
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 6911
| ''[[:d:Q18756580|Alice Jones]]''
| [[File:Ceridwen Peris.jpg|center|128px]]
| 1852-12
| 1943-04-17
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 6912
| ''[[:d:Q18756644|David Peter]]''
| [[File:Portrait of Revd. David Peter, Carmarthen (4671774).jpg|center|128px]]
| 1765-08-05
| 1837-05-04
| [[Aberystwyth]]
|-
| style='text-align:right'| 6913
| ''[[:d:Q18756688|Emma Maitland]]''
|
| 1844-05-17
| 1923-06-13
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 6914
| ''[[:d:Q18756705|Francisco Antonio Deniz]]''
|
| 1912
| 2005
| [[Cairdiff]]
|-
| style='text-align:right'| 6915
| ''[[:d:Q18756798|James Owen]]''
|
| 1654-11-01
| 1706-04-08
| ''[[:d:Q4667135|Abernant]]''
|-
| style='text-align:right'| 6916
| ''[[:d:Q18756803|James Parke]]''
|
| 1636
| 1696-11
| [[Welshpool]]
|-
| style='text-align:right'| 6917
| ''[[:d:Q18756845|John Oliver]]''
|
| 1838-11-07
| 1866<br/>1866-06-24
| ''[[:d:Q770818|Llanfynydd]]''
|-
| style='text-align:right'| 6918
| ''[[:d:Q18756964|Mary Nicol]]''
|
| 1747
| 1820
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 6919
| ''[[:d:Q18757104|Robert Wycherley]]''
|
| 1894
| 1965
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 6920
| ''[[:d:Q18757146|Thomas Owen]]''
|
| 1764-12-05
| 1814-12-01
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 6921
| ''[[:d:Q18757228|William Parry]]''
|
| 1754-11-25
| 1819<br/>1819-01-09
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 6922
| ''[[:d:Q18759414|Thomas Powell]]''
|
| 1572
| 1635
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 6923
| ''[[:d:Q18761925|Clifford Darby]]''
|
| 1909-02-07
| 1992
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 6924
| ''[[:d:Q18761942|Ellis Pugh]]''
|
| 1656-06
| 1718
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 6925
| ''[[:d:Q18762054|Philip Pugh]]''
|
| 1679
| 1760-07-12
| ''[[:d:Q14508467|Blaenpennal]]''
|-
| style='text-align:right'| 6926
| ''[[:d:Q18762129|William Price]]''
|
|
| 1596
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 6927
| ''[[:d:Q18762132|William Probert]]''
|
| 1790-08-11
| 1870-04-01
| ''[[:d:Q7124909|Painscastle]]''
|-
| style='text-align:right'| 6928
| ''[[:d:Q18763709|Peter Davies]]''
|
| 1924-12-30
| 2014-02-18
| [[Newport]]
|-
| style='text-align:right'| 6929
| ''[[:d:Q18763812|Mark Andrews]]''
| [[File:Mark Andrews at Smash Nov 2015.jpg|center|128px]]
| 1992-01-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6930
| ''[[:d:Q18763900|Kieran Bull]]''
|
| 1995-04-25
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 6931
| ''[[:d:Q18764018|Aneurin Donald]]''
| [[File:1 19 Aneurin Donald.jpg|center|128px]]
| 1996-12-20
|
| [[Swansea]]
|-
| style='text-align:right'| 6932
| ''[[:d:Q18764163|John Price]]''
|
| 1960-09-14
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 6933
| ''[[:d:Q18783770|John Rhydderch]]''
|
| 1673
| 1735
| ''[[:d:Q3405038|Cemaes]]''
|-
| style='text-align:right'| 6934
| ''[[:d:Q18783788|John Roberts]]''
|
| 1767
| 1834-07-21
| ''[[:d:Q13130168|Mochdre]]''
|-
| style='text-align:right'| 6935
| ''[[:d:Q18783790|John Roberts]]''
| [[File:Revd John Roberts (J.R., 1804-84) NLW3365386.jpg|center|128px]]
| 1804-11-05
| 1884-09-07
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 6936
| ''[[:d:Q18783892|Peter Roberts]]''
| [[File:Portrait of Revd. Peter Roberts, M.A (4671108).jpg|center|128px]]
| 1760
| 1819-05-30
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 6937
| ''[[:d:Q18783922|Richard Roberts]]''
|
| 1809-11-05
| 1883-07-25
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 6938
| ''[[:d:Q18783951|Robert of Shrewsbury]]''
|
|
| 1168
| [[Flintshire]]
|-
| style='text-align:right'| 6939
| ''[[:d:Q18784000|Thomas Redmond]]''
|
| 1745
| 1785
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 6940
| ''[[:d:Q18808855|Len Newcombe]]''
|
| 1931-02-28
| 1996-08
| [[Swansea]]
|-
| style='text-align:right'| 6941
| ''[[:d:Q18810707|Ernest Tristram]]''
| [[File:Medieval wall paintings and Norman window in the church of St. Thomas a Becket - geograph.org.uk - 1795359.jpg|center|128px]]
| 1882
| 1952
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6942
| ''[[:d:Q18810922|John Salisbury]]''
|
| 1575
| 1626
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 6943
| ''[[:d:Q18811029|Lucy Thomas]]''
|
| 1781
| 1847-09-27
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 6944
| ''[[:d:Q18811065|Evan Evans]]''
|
| 1903-07-25
| 1982
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 6945
| ''[[:d:Q18811222|Rose Davies]]''
|
| 1882-09-16
| 1958-12-13
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6946
| ''[[:d:Q18813249|John Roberts]]''
|
| 1749
| 1817-05-07
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 6947
| ''[[:d:Q18815948|Arthur Isaac]]''
|
| 1902
|
| [[Swansea]]
|-
| style='text-align:right'| 6948
| ''[[:d:Q18819465|Guildhaume Myrddin-Evans]]''
|
| 1894-12-17
| 1964-02-15
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 6949
| ''[[:d:Q18875883|Evan Daniel]]''
|
| 1837-09-04
| 1904-05-27
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6950
| ''[[:d:Q18879144|John Thomas]]''
|
| 1795
| 1871-06-30
| ''[[:d:Q29488481|Pibwr Lwyd Farmhouse]]''
|-
| style='text-align:right'| 6951
| ''[[:d:Q18879165|John Thomas]]''
| [[File:Revd Dr John Thomas, Liverpool (1821-92) (1882) NLW3362411.jpg|center|128px]]
| 1821-02-03
| 1892-07-14
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 6952
| ''[[:d:Q18880142|Mildred Riddelsdell]]''
|
| 1913
| 2006
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 6953
| ''[[:d:Q18880149|Noah Thomas]]''
| [[File:Sir Noah Thomas (1720-92).jpg|center|128px]]
| 1720
| 1792<br/>1792-05-17
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 6954
| ''[[:d:Q18880154|Owen Thomas]]''
| [[File:Dr Owen Thomas (1812-91) NLW3362711.jpg|center|128px]]
| 1812-12-16
| 1891<br/>1891-08-02
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 6955
| ''[[:d:Q18880164|Pendrill Charles Jones-Varrier]]''
|
| 1883-02-24
| 1941-01-30
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 6956
| ''[[:d:Q18910300|Edith Sophia Hooper]]''
|
| 1868-03-04
| 1926-04-21
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 6957
| ''[[:d:Q18910435|Edward Edwards]]''
|
| 1870-05-05
| 1944
| ''[[:d:Q12061339|Llangedwyn]]''
|-
| style='text-align:right'| 6958
| ''[[:d:Q18911657|Robert Warden Lee]]''
|
| 1868-12-14
| 1958-01-06
| ''[[:d:Q5648626|Hanmer]]''
|-
| style='text-align:right'| 6959
| ''[[:d:Q18911858|William Williams]]''
| [[File:Revd William Williams, Swansea (1817-1900) NLW3365189.jpg|center|128px]]
| 1815<br/>1817-12-30
| 1900<br/>1900-11-10
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 6960
| ''[[:d:Q18912095|Herbert Millingchamp Vaughan]]''
|
| 1870-07-27
| 1948-07-31
| ''[[:d:Q15987287|Penmorfa]]''
|-
| style='text-align:right'| 6961
| ''[[:d:Q18913039|John Howard Purnell]]''
|
| 1925-08-17
| 1996-01-12
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 6962
| ''[[:d:Q18913097|Elis Roberts]]''
|
| 1712
| 1789-11-27
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 6963
| ''[[:d:Q18913337|John William Watson Stephens]]''
| [[File:John William Watson Stephens. Photograph. Wellcome V0027757.jpg|center|128px]]
| 1865-03-02
| 1946-05-17
| ''[[:d:Q5445551|Glan-y-fferi]]''
|-
| style='text-align:right'| 6964
| ''[[:d:Q18914801|Alis Wen]]''
|
| 1520
| 16th century
| [[Wales]]<br/>''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 6965
| ''[[:d:Q18914804|Gwen ferch Ellis]]''
|
| 1550s
| 1594
| ''[[:d:Q2796209|Llandyrnog]]''
|-
| style='text-align:right'| 6966
| ''[[:d:Q18917139|Abram Wood]]''
|
| 1699
| 1799
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 6967
| ''[[:d:Q18917172|Norman Percy Allen]]''
|
| 1903-06-05
| 1972-02-23
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6968
| ''[[:d:Q18917233|Peter Williams]]''
| [[File:Y Parch Peter Williams o Gaerfyrddin.jpg|center|128px]]
| 1723-01-15
| 1796-08-08
| ''[[:d:Q13129668|Llansadyrnin]]''
|-
| style='text-align:right'| 6969
| ''[[:d:Q18917385|John Harris]]''
|
| 1932-06-02
| 2009-02-03
| ''[[:d:Q7162831|Penhow]]''
|-
| style='text-align:right'| 6970
| ''[[:d:Q18917541|Emlyn Williams]]''
|
| 1921
| 1995
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 6971
| ''[[:d:Q18917654|Lawrence Hugh Jenkins]]''
|
| 1857
| 1928<br/>1928-10-01
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 6972
| ''[[:d:Q18917778|Zachariah Williams]]''
|
| 1673
| 1755-07-12
| ''[[:d:Q7368291|Rosemarket]]''
|-
| style='text-align:right'| 6973
| ''[[:d:Q18920464|Roscoe Howells]]''
|
| 1919-10-27
| 2014-01-13
| ''[[:d:Q3405190|Saundersfoot]]''
|-
| style='text-align:right'| 6974
| ''[[:d:Q18921907|Gavin Hitchings]]''
|
| 1937
|
| [[Wales]]
|-
| style='text-align:right'| 6975
| ''[[:d:Q18922056|Anne Griffith]]''
|
| 1734
| 1821-10-25
| ''[[:d:Q2556821|Aberdaron]]''
|-
| style='text-align:right'| 6976
| ''[[:d:Q18922147|Daniel Davies]]''
| [[File:Dan Davies, Merthyr.jpg|center|128px]]
| 1859-05-27
| 1930-02-15
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 6977
| ''[[:d:Q18922178|Percy Watkins]]''
|
| 1871-12-03
| 1946-05-05
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 6978
| ''[[:d:Q18922208|Richard Davis]]''
|
| 1658
| 1714<br/>1714-09-10
| ''[[:d:Q6661964|Llechryd]]''
|-
| style='text-align:right'| 6979
| ''[[:d:Q18922225|Evan Evans]]''
|
| 1882-11-08
| 1965-07-24
| ''[[:d:Q14508465|Betws Lleucu]]''
|-
| style='text-align:right'| 6980
| ''[[:d:Q18934912|Donald Emrys Strong]]''
|
| 1927
| 1973
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 6981
| ''[[:d:Q18936277|Thomas Jones]]''
| [[File:Portrait of Tho. Jones (4674170) (cropped).jpg|center|128px]]
| 1648-05-01
| 1713-08-08
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 6982
| ''[[:d:Q18954073|Arthur Lloyd James]]''
|
| 1884-06-21
| 1943-03-24
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 6983
| ''[[:d:Q18954136|David Oliver]]''
|
| 1863-02-08
| 1947
| [[Pontypridd]]
|-
| style='text-align:right'| 6984
| ''[[:d:Q18954309|Jack Bailey]]''
|
| 1898-01-01
| 1969-01-18
| ''[[:d:Q25169445|Miskin]]''
|-
| style='text-align:right'| 6985
| ''[[:d:Q18954350|John Hughes]]''
| [[File:Portrait of Rev. John Hughes (4670920).jpg|center|128px]]
| 1842-04-15
| 1902-02-24
| ''[[:d:Q13127175|Cnwch Coch]]''
|-
| style='text-align:right'| 6986
| ''[[:d:Q18962084|William Ick]]''
| [[File:Photograph of William Ick.jpg|center|128px]]
| 1800
| 1844
| [[Newport]]
|-
| style='text-align:right'| 6987
| ''[[:d:Q19039146|David Owen]]''
|
| 1904-11-26
| 1970-06-29
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 6988
| ''[[:d:Q19040140|Ezekiel Hughes]]''
|
| 1766-08-22
| 1849-09-02
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 6989
| ''[[:d:Q19040262|Frances Hughes]]''
|
| 1855-04-14
| 1927-02-12
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6990
| ''[[:d:Q19042104|Ivor Broom]]''
|
| 1920-06-02
| 2003-01-24
| [[Cairdiff]]
|-
| style='text-align:right'| 6991
| ''[[:d:Q19043535|Robert Jones]]''
|
| 1560
| 1615-08-20
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 6992
| ''[[:d:Q19202498|Bob Shaw]]''
|
| 1932-12-27
|
| ''[[:d:Q1401784|Ffynnon Taf]]''
|-
| style='text-align:right'| 6993
| ''[[:d:Q19276832|Keith Palmer]]''
|
| 1947-07-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 6994
| ''[[:d:Q19281946|Danny Ward]]''
| [[File:Danny Ward 2014 (cropped).jpg|center|128px]]
| 1993-06-22
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 6995
| ''[[:d:Q19282249|Catherine Hare Willianson]]''
|
| 1982-03-13
|
| [[Great Breetain]]<br/>[[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 6996
| ''[[:d:Q19324971|Morland Lewis]]''
|
| 1903-05-03
| 1943-08-04
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 6997
| ''[[:d:Q19324995|Amy Bulley]]''
| [[File:Mrs Amy Brook (born Bulley) by Mary Florence Monkhouse.jpg|center|128px]]
| 1852-04-20
| 1939-11-16
| ''[[:d:Q15261963|New Brighton]]''
|-
| style='text-align:right'| 6998
| ''[[:d:Q19325030|Oliver Thomas]]''
|
| 1598
| 1653
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 6999
| ''[[:d:Q19325183|Rhondda Williams]]''
|
| 1860-06-19
| 1945-11-21
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 7000
| ''[[:d:Q19325185|Betty Johnston]]''
|
| 1916-05-18
| 1994-11-28
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 7001
| ''[[:d:Q19325211|Richard Hughes]]''
|
| 1565
| 1619
| ''[[:d:Q1024924|Llanbedrog]]''
|-
| style='text-align:right'| 7002
| ''[[:d:Q19325318|Clara Deniz]]''
|
| 1911-09-30
| 2002-12-07
| [[Cairdiff]]
|-
| style='text-align:right'| 7003
| ''[[:d:Q19325414|Rosina Davies]]''
| [[File:Rosina Davies (1863–1949) (gcf02725).jpg|center|128px]]
| 1863-09-02
| 1949-10-21
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 7004
| ''[[:d:Q19325608|Thomas Hughes]]''
|
| 1853
| 1927-10-24
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 7005
| ''[[:d:Q19325627|Ethel Trew]]''
|
| 1869-04-24
| 1948-12-07
| ''[[:d:Q13656930|Oystermouth]]''
|-
| style='text-align:right'| 7006
| ''[[:d:Q19325687|Thomas Williams]]''
| [[File:Cofeb Tom Nefyn Williams.jpg|center|128px]]
| 1895
| 1958
| ''[[:d:Q4936754|Boduan]]''
|-
| style='text-align:right'| 7007
| ''[[:d:Q19326557|Samuel Evans]]''
|
| 1762
| 1835
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 7008
| ''[[:d:Q19335498|John Aneurin Grey Griffith]]''
| [[File:John Aneurin Grey Griffith, c1980 (4322172360).jpg|center|128px]]
| 1918
| 2010
| [[Cairdiff]]
|-
| style='text-align:right'| 7009
| ''[[:d:Q19360550|John D. Jones]]''
| [[File:Representative John D. Jones, 1971.jpg|center|128px]]
| 1923-06-26
| 2014-10-07
| [[Wales]]
|-
| style='text-align:right'| 7010
| ''[[:d:Q19360836|Roger Cecil]]''
|
| 1942-07-18<br/>1942
| 2015-02-22
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 7011
| ''[[:d:Q19364441|Gwynne Edwards]]''
|
| 1909
| 2000-06-09
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 7012
| ''[[:d:Q19367438|John Williams]]''
| [[File:Revd John Williams, 'Yr Hen Syr'.jpg|center|128px]]
| 1745
| 1818-03-20
| ''[[:d:Q15963881|Swyddffynnon]]''
|-
| style='text-align:right'| 7013
| ''[[:d:Q19368760|William Davies]]''
|
| 1826-01-26
| 1901-09-22
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 7014
| ''[[:d:Q19396015|Paul Brown]]''
|
| 1960-05-13
| 2017-11-13
| [[Wales]]
|-
| style='text-align:right'| 7015
| ''[[:d:Q19407331|Maureen Guy]]''
|
| 1932-07-10
| 2015-02-14
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 7016
| ''[[:d:Q19513574|Owain Dwnn]]''
|
| 1400
| 1460
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 7017
| ''[[:d:Q19518803|Bethan Witcomb]]''
|
|
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 7018
| ''[[:d:Q19518932|John Goodwin]]''
|
| 1859-03-14
| 1938-02-15
| ''[[:d:Q6394440|Kerry]]''
|-
| style='text-align:right'| 7019
| ''[[:d:Q19519776|Nigel Williams]]''
|
| 1963-09
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 7020
| ''[[:d:Q19519831|Max Clark]]''
|
| 1995-10-03
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 7021
| ''[[:d:Q19519921|Jenny Hawkins]]''
|
| 1990-04-03
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7022
| ''[[:d:Q19560432|Glyn England]]''
|
| 1921-04-19
| 2013-06-19
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 7023
| ''[[:d:Q19560780|Harold Hughes]]''
|
| 1902
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 7024
| ''[[:d:Q19560889|David Bevan Jones]]''
|
| 1807
| 1863-07-18
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7025
| ''[[:d:Q19560894|Mary Jones]]''
|
| 1915-02-20
| 1990-03-26
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 7026
| ''[[:d:Q19578070|Laura Thomas]]''
|
| 1985-05-31
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 7027
| ''[[:d:Q19578248|Les Wilkins]]''
|
| 1907-07-21
| 1979
| [[Swansea]]
|-
| style='text-align:right'| 7028
| ''[[:d:Q19578254|Liam Williams]]''
|
| 1992-05-26
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 7029
| ''[[:d:Q19578256|Ralph Williams]]''
|
| 1905-10-02
| 1985-03-01
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 7030
| ''[[:d:Q19578296|Viv Woodward]]''
|
| 1914-05-25
|
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 7031
| ''[[:d:Q19585743|Nigel Haworth]]''
| [[File:Nigel Haworth.jpg|center|128px]]
| 1951
|
| [[Wales]]
|-
| style='text-align:right'| 7032
| ''[[:d:Q19594785|Ray Williams]]''
|
| 1927-08-25
| 2014-12-03
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7033
| ''[[:d:Q19599159|John Jones]]''
| [[File:Portrait of John Jones (4672935).jpg|center|128px]]
| 1786-05-07
| 1865-03-19
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 7034
| ''[[:d:Q19599359|Thomas Rees]]''
| [[File:Thomas Rees, 1904.JPG|center|128px]]
| 1844-09-09
| 1921
| ''[[:d:Q6707738|Lydstep Haven]]''
|-
| style='text-align:right'| 7035
| ''[[:d:Q19600732|Clydai ach Brychan]]''
|
| 5th century
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 7036
| ''[[:d:Q19605143|Owen Thomas]]''
|
| 1858-12-18
| 1923-03-06
| ''[[:d:Q16246155|Carrog]]''
|-
| style='text-align:right'| 7037
| ''[[:d:Q19613712|Winifred Phillips Hathaway]]''
| [[File:Winifred Phillips Hathaway (1870?-1954) (5494411890).jpg|center|128px]]
| 1870<br/>1871-11-23
| 1954-12-01
| [[Wales]]
|-
| style='text-align:right'| 7038
| ''[[:d:Q19628748|Cledwyn Hughes]]''
|
| 1920-05
| 1978
| [[Powys]]
|-
| style='text-align:right'| 7039
| ''[[:d:Q19629034|Simon Armstrong]]''
|
| 20th century
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7040
| ''[[:d:Q19630379|Glynn Croudace]]''
|
| 1917-04-22
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 7041
| ''[[:d:Q19635477|Edward Davies]]''
| [[File:Edward Davies (Iolo Trefaldwyn, 1819-87) NLW3364542.jpg|center|128px]]
| 1819
| 1887-01-04
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 7042
| ''[[:d:Q19650365|Frances Donovan]]''
| [[File:Frances Donovan 2011.jpg|center|128px]]
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7043
| ''[[:d:Q19650439|Angus McDermid]]''
|
| 1921-12-14
| 1988-10-13
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7044
| ''[[:d:Q19661146|Wynne Richards]]''
|
| 1950-06-10
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 7045
| ''[[:d:Q19661342|Jeffery Rowthorn]]''
|
| 1934-04-09
|
| [[Newport]]
|-
| style='text-align:right'| 7046
| ''[[:d:Q19662041|Saint Austell]]''
|
| 5th century
| 6th century
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 7047
| ''[[:d:Q19662539|Sue Jones]]''
|
| 1960
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 7048
| ''[[:d:Q19663103|Greg Hill]]''
|
| 1949
|
| [[Wales]]
|-
| style='text-align:right'| 7049
| ''[[:d:Q19664267|Rachel Johncock]]''
|
| 1993-10-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7050
| ''[[:d:Q19664611|Howel Gwyn]]''
| [[File:Howel-Gwyn-AS.jpg|center|128px]]
| 1806-06-24
| 1888-01-25
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 7051
| ''[[:d:Q19665319|Edward Wienholt]]''
| [[File:Edward Wienholt - Queensland politician.png|center|128px]]
| 1833-03-28
| 1904-01-15
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 7052
| ''[[:d:Q19665598|Alex Jeffries]]''
|
| 1995-04-27
|
| [[Newport]]
|-
| style='text-align:right'| 7053
| ''[[:d:Q19665984|Gyllian Raby]]''
|
| 1959-03-07
|
| [[Wales]]
|-
| style='text-align:right'| 7054
| ''[[:d:Q19666293|Rory Sutherland]]''
| [[File:Business of Software - Rory Sutherland.jpg|center|128px]]
| 1965-11-12
|
| ''[[:d:Q6661096|Llanbadoc]]''
|-
| style='text-align:right'| 7055
| ''[[:d:Q19666470|Nicky Thomas]]''
|
| 1994-08-26
|
| [[Swansea]]
|-
| style='text-align:right'| 7056
| ''[[:d:Q19666871|Kevin Moseley]]''
|
| 1963-07-02
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 7057
| ''[[:d:Q19667602|Edward David Miles]]''
| [[File:Edward David Miles - Queensland politician.jpg|center|128px]]
| 1845-01-27
| 1922-03-03
| [[Pontypridd]]
|-
| style='text-align:right'| 7058
| ''[[:d:Q19667907|Elias Wynne Cemlyn-Jones]]''
|
| 1888-05-16
| 1966-06-06
| [[Anglesey]]
|-
| style='text-align:right'| 7059
| ''[[:d:Q19668085|Liam Shephard]]''
|
| 1994-11-22
|
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 7060
| ''[[:d:Q19668376|Nick Salapatas]]''
| [[File:Nick Salapatas.jpg|center|128px]]
| 1989-11-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7061
| ''[[:d:Q19668413|Glyn Owen]]''
|
| 1909-01-23
| 1978-02-17
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7062
| ''[[:d:Q19694162|Anthony Sweeting]]''
|
| 1938-04-20
| 2008-07-30
| [[Newport]]
|-
| style='text-align:right'| 7063
| ''[[:d:Q19760229|Leofric Temple]]''
|
| 1819
| 1891
| ''[[:d:Q13644930|Llandrinio]]''
|-
| style='text-align:right'| 7064
| ''[[:d:Q19790482|John James Hughes]]''
|
| 1842
| 1875-01-08
| ''[[:d:Q5046060|Carreglefn]]''
|-
| style='text-align:right'| 7065
| ''[[:d:Q19799260|Hugh James]]''
|
| 1922-10-03
| 2015-01-07
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 7066
| ''[[:d:Q19801208|Mari Ellis]]''
|
| 1913-07-21
| 2015-01-25
| ''[[:d:Q5318814|Dylife]]''
|-
| style='text-align:right'| 7067
| ''[[:d:Q19819921|David Randell]]''
|
| 1854
| 1912-06-05
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7068
| ''[[:d:Q19819945|William Tudor Howell]]''
| [[File:William Tudor Howell.jpg|center|128px]]
| 1862-10-19
| 1911-10-03
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 7069
| ''[[:d:Q19819955|P. Ellis Eyton]]''
|
| 1827
| 1878-06-19
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 7070
| ''[[:d:Q19820213|Mia Arnesby Brown]]''
|
| 1867
| 1931
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 7071
| ''[[:d:Q19822503|Amy Parry-Williams]]''
|
| 1910-12-18
| 1988-01-28
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 7072
| ''[[:d:Q19829084|Arthur Lewis]]''
|
| 1885-02-23
| 1952-01-08
| [[Aberystwyth]]
|-
| style='text-align:right'| 7073
| ''[[:d:Q19829092|Gwyn Martin]]''
| [[File:Gwyn Martin.jpg|center|128px]]
| 1921
| 2001
| [[Penygraig]]
|-
| style='text-align:right'| 7074
| ''[[:d:Q19831778|Robert Lambert Gapper]]''
|
| 1897
| 1984
| ''[[:d:Q3398834|Llanaelhaearn]]''
|-
| style='text-align:right'| 7075
| ''[[:d:Q19840274|Rhodri Jones]]''
|
| 1963
|
| ''[[:d:Q3398942|Tregarth]]''
|-
| style='text-align:right'| 7076
| ''[[:d:Q19842165|John Deffett Francis]]''
| [[File:Portrait of J. Deffett Francis as 'Lord of the Isles' (4670730).jpg|center|128px]]
| 1815-06-02
| 1901-02-21
| [[Swansea]]
|-
| style='text-align:right'| 7077
| ''[[:d:Q19843134|Ray Elton]]''
|
| 1914-01-28
| 1994-05-07
| [[Cairdiff]]
|-
| style='text-align:right'| 7078
| ''[[:d:Q19844389|Fred Perry]]''
|
| 1904-01-02
| 1981
| [[Cairdiff]]
|-
| style='text-align:right'| 7079
| ''[[:d:Q19845132|Glyn Davies]]''
|
| 1932-05-31
| 2013-02-07
| [[Swansea]]
|-
| style='text-align:right'| 7080
| ''[[:d:Q19848670|Chalkie Davies]]''
|
| 1955-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7081
| ''[[:d:Q19870710|Alun Anderson]]''
|
| 1948-05-27
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 7082
| ''[[:d:Q19872799|Rod Duncan]]''
|
| 1962
|
| [[Wales]]
|-
| style='text-align:right'| 7083
| ''[[:d:Q19873079|Gwyn Evans]]''
|
| 1935-02-24
| 2000-06
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 7084
| ''[[:d:Q19873847|Ian Hamer]]''
|
| 1965-07-18<br/>1965-04-18
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 7085
| ''[[:d:Q19874433|Mike Hughes]]''
|
| 1940-09-03
| 2018-12-20
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7086
| ''[[:d:Q19874739|Owain Jones]]''
| [[File:Owain Jones footballer.jpg|center|128px]]
| 1996-10-01
|
| [[Swansea]]
|-
| style='text-align:right'| 7087
| ''[[:d:Q19874741|Thomas Llewellyn Jones]]''
| [[File:Thomas Llewellyn Jones, 1941.JPG|center|128px]]
| 1872-03-08
| 1946-06-18
| [[Welshpool]]
|-
| style='text-align:right'| 7088
| ''[[:d:Q19875292|Henry Llewelyn]]''
| [[File:Henry Llewelyn - Queensland Politician.png|center|128px]]
| 1855-09-12
| 1933-08-06
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 7089
| ''[[:d:Q19877328|Ernest Purnell]]''
| [[File:Ernest Purnell, 1938.JPG|center|128px]]
| 1866-09-27
| 1954-07-25
| [[Swansea]]
|-
| style='text-align:right'| 7090
| ''[[:d:Q19880007|H. H. Tilbrook]]''
| [[File:H. H. Tilbrook.jpg|center|128px]]
| 1848
| 1937
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 7091
| ''[[:d:Q19888021|John Murray Thomas]]''
| [[File:John Murray Thomas, Y Wladfa, 1894.jpg|center|128px]]
| 1847-09-06
| 1924
| [[Bridgend Coonty Burgh]]
|-
| style='text-align:right'| 7092
| ''[[:d:Q19894339|Ralph Bingley]]''
|
| 1570
| 1627
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 7093
| ''[[:d:Q19895893|Betsan Llwyd]]''
|
| 1959-09
|
| ''[[:d:Q7605133|Staylittle]]''
|-
| style='text-align:right'| 7094
| ''[[:d:Q19899726|Ross O'Hennessy]]''
| [[File:Ross at Wakles Comic Con 2015.jpeg|center|128px]]
| 1974
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 7095
| ''[[:d:Q19903914|Cynan Jones]]''
|
| 1975-02-27
|
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 7096
| ''[[:d:Q19904075|Sian Gibson]]''
| [[File:Sian Gibson.jpg|center|128px]]
| 1976-07-30
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 7097
| ''[[:d:Q19904139|Jason Greenslade]]''
|
| 1970-03-06
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 7098
| ''[[:d:Q19904222|Bert Hodson]]''
|
| 1905
| 1971
| ''[[:d:Q7359368|Rogerstone]]''
|-
| style='text-align:right'| 7099
| ''[[:d:Q19915198|David Thomas Gwynne-Vaughan]]''
|
| 1871-03-03
| 1915-09-04
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 7100
| ''[[:d:Q19921507|John Wheatley]]''
|
| 1892<br/>1892-01-23
| 1955<br/>1955-11-18
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 7101
| ''[[:d:Q19945904|Bryn Markham-Jones]]''
|
| 1986-11-02
|
| [[Swansea]]
|-
| style='text-align:right'| 7102
| ''[[:d:Q19957299|Chris Davies]]''
| [[File:Official portrait of Chris Davies crop 2.jpg|center|128px]]
| 1967-08-18
|
| ''[[:d:Q7653726|Cwm Tawe]]''
|-
| style='text-align:right'| 7103
| ''[[:d:Q19957303|James Davies]]''
| [[File:Official portrait of Dr James Davies MP crop 2.jpg|center|128px]]
| 1980-02-27
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 7104
| ''[[:d:Q19958026|Carolyn Harris]]''
| [[File:Official portrait of Carolyn Harris MP crop 2, 2024.jpg|center|128px]]
| 1960-09-18
|
| [[Swansea]]
|-
| style='text-align:right'| 7105
| ''[[:d:Q19958045|Janet Haworth]]''
| [[File:Janet Owart.jpg|center|128px]]
|
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 7106
| ''[[:d:Q19958093|Simon Hoare]]''
| [[File:Official portrait of Simon Hoare (cropped).jpg|center|128px]]
| 1969-06-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7107
| ''[[:d:Q19959822|Henry Dwnn]]''
|
| 1340
| 1416-11
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 7108
| ''[[:d:Q19959987|Thomas Jones]]''
|
| 1554
| 1604
| ''[[:d:Q20170606|Abermarlais]]''
|-
| style='text-align:right'| 7109
| ''[[:d:Q19968719|Lateysha Grace]]''
| [[File:Lateysha Grace at the National Television Awards.jpg|center|128px]]
| 1992-11-25
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 7110
| ''[[:d:Q19974211|John Parry]]''
| [[File:John parry portrait arms.jpg|center|128px]]
| 1724-09-22<br/>1724
| 1797-10-26
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 7111
| ''[[:d:Q19974372|Benjamin Price]]''
| [[File:The Right Reverend Benjamin Price .jpg|center|128px]]
| 1804
| 1896-01
| ''[[:d:Q24360208|Builth]]''
|-
| style='text-align:right'| 7112
| ''[[:d:Q19974769|Thomas Hughes Jones]]''
| [[File:Thomas Hughes Jones (of Blaenpennal) (5292090).jpg|center|128px]]
| 1895-01-23
| 1966-05-11
| ''[[:d:Q14508467|Blaenpennal]]''
|-
| style='text-align:right'| 7113
| ''[[:d:Q19975142|Fred Robson]]''
|
| 1885-04-25
| 1952-11-03
| ''[[:d:Q2355142|Shotton]]''
|-
| style='text-align:right'| 7114
| ''[[:d:Q19975438|William Napier Bruce]]''
|
| 1858-01-18<br/>1858-01-15
| 1936-03-20
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 7115
| ''[[:d:Q19997515|Frederick Norman Pryce]]''
|
| 1888-08-19
| 1953-10-14
| [[Welshpool]]
|-
| style='text-align:right'| 7116
| ''[[:d:Q20007832|Leondre Devries]]''
|
| 2000-10-06
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 7117
| ''[[:d:Q20022443|Mark Bennett]]''
|
| 1969-01-26
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 7118
| ''[[:d:Q20022497|Simon Hill]]''
|
| 1968-05-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7119
| ''[[:d:Q20031104|Charles Woolley]]''
|
| 1893-01-01
| 1981-08-20
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 7120
| ''[[:d:Q20051236|Albert de Belleroche]]''
| [[File:Albert de Belleroche by Sargent.jpg|center|128px]]
| 1864-10-22
| 1944-07-14
| [[Swansea]]
|-
| style='text-align:right'| 7121
| ''[[:d:Q20054436|Gwilym Prichard]]''
|
| 1931-03-04
| 2015-06-07<br/>2015
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 7122
| ''[[:d:Q20055587|Sioned Wiliam]]''
|
| 1961-06-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7123
| ''[[:d:Q20089033|David Braid]]''
|
| 1970-06-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 7124
| ''[[:d:Q20090102|Gareth Allen]]''
| [[File:Gareth Allen PHC 2015-1.jpg|center|128px]]
| 1988-09-09
|
| ''[[:d:Q2364012|Mynydd Isa]]''
|-
| style='text-align:right'| 7125
| ''[[:d:Q20090668|Chris Tally Evans]]''
| [[File:Shift Exhibition pic.JPG|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 7126
| ''[[:d:Q20090820|Ollie Griffiths]]''
|
| 1995-03-23
|
| [[Newport]]
|-
| style='text-align:right'| 7127
| ''[[:d:Q20109574|Sarah Edwards]]''
| [[File:Sarah Edwards (1947).jpg|center|128px]]
| 1881-10-11
| 1965-01-07
| ''[[:d:Q5573009|Glyntraian]]''
|-
| style='text-align:right'| 7128
| ''[[:d:Q20109582|Penelope Evans]]''
|
| 1959
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 7129
| ''[[:d:Q20109704|Oscar Arthur Rackham]]''
|
| 1912-05-18
| 1997-02-02
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 7130
| ''[[:d:Q20127986|Kyle Patten]]''
|
| 1994-07-21
|
| [[Wales]]
|-
| style='text-align:right'| 7131
| ''[[:d:Q20128115|Jo Stevens]]''
| [[File:Official portrait of Jo Stevens MP crop 2, 2024.jpg|center|128px]]
| 1966-09-06
|
| [[Swansea]]
|-
| style='text-align:right'| 7132
| ''[[:d:Q20128816|Jack Whitford]]''
|
| 1924-01-03
| 2023-06-05
| [[Swansea]]
|-
| style='text-align:right'| 7133
| ''[[:d:Q20160474|Hefina Headon]]''
|
| 1930-06-08
| 2013-10-05
| ''[[:d:Q5277964|Dinas Cross]]''
|-
| style='text-align:right'| 7134
| ''[[:d:Q20201367|Hawys Gadarn]]''
|
| 1291
| 1353
| [[Powys]]
|-
| style='text-align:right'| 7135
| ''[[:d:Q20202170|Robert Everett]]''
| [[File:Robert Everett.jpg|center|128px]]
| 1791-01-02
| 1875-02-25
| ''[[:d:Q5610201|Gronant]]''
|-
| style='text-align:right'| 7136
| ''[[:d:Q20252475|Edgar Chappell]]''
| [[File:Edgar L Chappell.tif|center|128px]]
| 1879-04-08
| 1949-08-26<br/>1949
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 7137
| ''[[:d:Q20256068|John Jones]]''
| [[File:John Jones (Idris Vychan, 1825-87) NLW3364537 (cropped).jpg|center|128px]]
| 1825
| 1887-11-03
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7138
| ''[[:d:Q20263530|Gwilym Williams]]''
| [[File:Castle - Statue of Judge Gwilym Williams of Miskin - 20230926170326.jpg|center|128px]]
| 1839-05-02
| 1906-03-25
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 7139
| ''[[:d:Q20266669|Moc Morgan]]''
|
| 1928-11-07
| 2015-05-26
| ''[[:d:Q3401544|Pontrhydfendigaid]]''
|-
| style='text-align:right'| 7140
| ''[[:d:Q20277834|Hafina Clwyd]]''
|
| 1936-07-01
| 2011-03-14
| ''[[:d:Q2599085|Gwyddelwern]]''
|-
| style='text-align:right'| 7141
| ''[[:d:Q20354071|John Langford]]''
|
| 1640
| 1715
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 7142
| ''[[:d:Q20476511|Evan Tom Davies]]''
|
| 1904-09-24
| 1973-10-08
| ''[[:d:Q7162285|Pencader]]''
|-
| style='text-align:right'| 7143
| ''[[:d:Q20497707|Emlyn Rees]]''
|
| 1971
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7144
| ''[[:d:Q20534916|Elinor Crawley]]''
| [[File:Elinor Crawley.jpg|center|128px]]
| 1991-11-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7145
| ''[[:d:Q20555787|Siôn Llewelyn]]''
|
| 1690-11-30
| 1776-01-01
| ''[[:d:Q5057243|Cefn Coed y Cymer]]''
|-
| style='text-align:right'| 7146
| ''[[:d:Q20557508|Abiah Roderick]]''
|
| 1898
| 1977
| ''[[:d:Q7653726|Cwm Tawe]]''
|-
| style='text-align:right'| 7147
| ''[[:d:Q20558076|Angharad Llwyd-Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7148
| ''[[:d:Q20558096|Angharad Puw Davies]]''
|
|
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 7149
| ''[[:d:Q20558265|Aled Lloyd Davies]]''
|
| 1930-01-26
| 2021-01-24
| ''[[:d:Q15056704|Brithdir]]''
|-
| style='text-align:right'| 7150
| ''[[:d:Q20558342|Alice E. Williams]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7151
| ''[[:d:Q20558361|Alun 'Sbardun' Huws]]''
|
| 1948-09-26
| 2014-12-15
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7152
| ''[[:d:Q20558419|Alun Guy]]''
|
| 1939
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7153
| ''[[:d:Q20558530|Alwyn Humphreys]]''
|
| 1944-05-14
|
| ''[[:d:Q3402654|Bodffordd]]''
|-
| style='text-align:right'| 7154
| ''[[:d:Q20558584|Allgo]]''
| [[File:St Gallgo's Church, Llanallgo - geograph.org.uk - 38557.jpg|center|128px]]
| 600
| 660
| ''[[:d:Q6661065|Llanallgo]]''
|-
| style='text-align:right'| 7155
| ''[[:d:Q20558676|Andras Millward]]''
|
| 1966
| 2016-10-16
| [[Aberystwyth]]
|-
| style='text-align:right'| 7156
| ''[[:d:Q20558732|Aneurin Jenkins Jones]]''
|
| 1925
| 1981
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 7157
| ''[[:d:Q20559469|Dyfnwal ap Arthwyr]]''
|
|
| 807
| ''[[:d:Q2578706|Kingdom of Ceredigion]]''
|-
| style='text-align:right'| 7158
| ''[[:d:Q20559798|William Griffith]]''
|
| 1849
| 1890-03-12
| ''[[:d:Q7165424|Penysarn]]''<br/>[[Anglesey]]
|-
| style='text-align:right'| 7159
| ''[[:d:Q20559811|William Milton Aubrey]]''
|
| 1861
| 1889
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 7160
| ''[[:d:Q20560367|Androw Bennett]]''
|
| 1946-05-19
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7161
| ''[[:d:Q20560416|Beti Rhys]]''
|
| 1907-04-02
| 2003-04-05
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 7162
| ''[[:d:Q20560502|Bethan Phillips]]''
|
| 1934
| 2019-11
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 7163
| ''[[:d:Q20560688|Bleddyn Owen Huws]]''
|
|
|
| ''[[:d:Q1964775|Nantlle Valley]]''
|-
| style='text-align:right'| 7164
| ''[[:d:Q20561073|Andrew Jones Brereton]]''
| [[File:Portrait of Andreas o Vôn (4674316) (cropped).jpg|center|128px]]
| 1827
| 1885
| [[Anglesey]]
|-
| style='text-align:right'| 7165
| ''[[:d:Q20562825|Eurig Salisbury]]''
|
| 1983
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7166
| ''[[:d:Q20562948|Lleuwen Steffan]]''
|
| 1979
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7167
| ''[[:d:Q20564443|John Davies]]''
| [[File:John Davies (Ossian Gwent).jpg|center|128px]]
| 1839-01-30
| 1892-04-24<br/>1892
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 7168
| ''[[:d:Q20564458|Richard Owen Davies]]''
|
| 1894-05-25
| 1962-02-25
| ''[[:d:Q3398868|Ganllwyd]]''
|-
| style='text-align:right'| 7169
| ''[[:d:Q20564992|Ceri Dupree]]''
|
| 1964-01-30
|
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 7170
| ''[[:d:Q20565356|John Edwards]]''
| [[File:Meiriadog at the Powys Eisteddfod (1892) NLW3362573.jpg|center|128px]]
| 1813
| 1906-07-24<br/>1906
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 7171
| ''[[:d:Q20566517|Hugh Hughes]]''
|
| 1830
| 1904-01-24
| ''[[:d:Q20593558|Llandrygarn]]''
|-
| style='text-align:right'| 7172
| ''[[:d:Q20566554|Richard Huws]]''
|
| 1902-06-10
| 1980-02-27
| ''[[:d:Q7680421|Talwrn]]''
|-
| style='text-align:right'| 7173
| ''[[:d:Q20566881|Edith Nepean]]''
|
| 1876
| 1960-03-23
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 7174
| ''[[:d:Q20567154|John Rowlands]]''
|
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 7175
| ''[[:d:Q20567187|John Tudor Jones]]''
| [[File:John Tudor Jones (John Eilien).png|center|128px]]
| 1903-12-29
| 1985-03-09
| ''[[:d:Q6661279|Llaneilian]]''
|-
| style='text-align:right'| 7176
| ''[[:d:Q20567225|Ann Pierce Jones]]''
|
|
|
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 7177
| ''[[:d:Q20567253|Emyr Jones]]''
|
| 1914
| 1999
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 7178
| ''[[:d:Q20567274|Owen Gethin Jones]]''
| [[File:Owen Gethin Jones (Gethin, 1816-83) NLW3364544.jpg|center|128px]]
| 1816-05-01
| 1883-01-29
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 7179
| ''[[:d:Q20567285|Robert Lloyd Jones]]''
|
| 1878-12-07
| 1959-02-03
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 7180
| ''[[:d:Q20567331|Joseph Seth Jones]]''
|
| 1845
| 1912
| ''[[:d:Q3404936|Llanfair Talhaiarn]]''
|-
| style='text-align:right'| 7181
| ''[[:d:Q20567576|Timothy Lewis]]''
|
| 1877-02-17
| 1958-12-30
| ''[[:d:Q13128090|Efail-wen]]''
|-
| style='text-align:right'| 7182
| ''[[:d:Q20567614|Wyn Lodwick]]''
|
| 1927-03-15
| 2024-04-25
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7183
| ''[[:d:Q20567671|David Lyn]]''
| [[File:David Lyn young man.jpg|center|128px]]
| 1927
| 2012-08-04
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 7184
| ''[[:d:Q20567936|Hugh Owen]]''
|
| 1835
| 1892-09-21
| ''[[:d:Q3405038|Cemaes]]''
|-
| style='text-align:right'| 7185
| ''[[:d:Q20568221|William Theophilus Thomas]]''
| [[File:Parchg William Theophilus Thomas (Gwilym Gwenffrwd, 1824-99) NLW3364216 (cropped).jpg|center|128px]]
| 1824
| 1899-05-11
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 7186
| ''[[:d:Q20568247|Richard Parry]]''
| [[File:Revd. Richard Parry (Gwalchmai, 1803-97) NLW3364065.jpg|center|128px]]
| 1803-01-19
| 1897-02-07
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 7187
| ''[[:d:Q20568728|Jac Lewis Williams]]''
|
| 1918-07-20
| 1977-05-27
| ''[[:d:Q3399358|Aberarth]]''
|-
| style='text-align:right'| 7188
| ''[[:d:Q20568736|William Williams]]''
| [[File:William Williams (Creuddynfab, 1814-69) NLW3364533.jpg|center|128px]]
| 1814-08-20
| 1869-08-26
| ''[[:d:Q5184753|Creuddyn peninsula]]''
|-
| style='text-align:right'| 7189
| ''[[:d:Q20568757|John Prydderch Williams]]''
| [[File:John Prydderch Williams (Rhydderch o Fcircon, 1830-68) NLW3364196 (cropped).jpg|center|128px]]
| 1830
| 1868
| ''[[:d:Q6661152|Llanddeusant]]''
|-
| style='text-align:right'| 7190
| ''[[:d:Q20568764|Beryl Stafford Williams]]''
|
|
|
| ''[[:d:Q2653611|Penmaenmawr]]''
|-
| style='text-align:right'| 7191
| ''[[:d:Q20568941|John Pritchard]]''
|
| 1837-04
| 1898-12-31
| ''[[:d:Q3402685|Gaerwen]]''
|-
| style='text-align:right'| 7192
| ''[[:d:Q20569280|Rees Arthur Rees]]''
| [[File:Rees Arthur Rees (Rhys Dyfed, 1837-66) (ambrotype) NLW3364105.jpg|center|128px]]
| 1837
| 1866-07-08
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 7193
| ''[[:d:Q20569630|Gareth Morlais]]''
| [[File:Celtic Knot Conference, July 2017 (14) (cropped).jpg|center|128px]]
|
|
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 7194
| ''[[:d:Q20570139|Sian Gwenllian]]''
| [[File:Siân Gwenllian AM (28092344141).jpg|center|128px]]
| 1956
|
| [[Wales]]
|-
| style='text-align:right'| 7195
| ''[[:d:Q20603878|Hugh Abercrombie]]''
|
| 1872-05-07
| 1955-07-12
| [[Cairdiff]]
|-
| style='text-align:right'| 7196
| ''[[:d:Q20627091|Morris ap Rhisiart]]''
|
| 1674
| 1763-11-25
| ''[[:d:Q13129642|Llanfihangel Tre'r Beirdd]]''
|-
| style='text-align:right'| 7197
| ''[[:d:Q20630509|Anthony Lyn]]''
|
| 1965
|
| [[Swansea]]
|-
| style='text-align:right'| 7198
| ''[[:d:Q20631120|Denise Goddard]]''
| [[File:Denise Goddard 1964.jpg|center|128px]]
| 1945-04-20
| 2023-03-07
| [[Cairdiff]]
|-
| style='text-align:right'| 7199
| ''[[:d:Q20631337|Gwenllian Elizabeth Fanny Morgan]]''
| [[File:Gwenllian Morgan Mayor of Brecon.jpg|center|128px]]
| 1852-04-09
| 1939-11-07
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 7200
| ''[[:d:Q20631844|R. K. Penson]]''
|
| 1815-06-19
| 1885-05-22
| ''[[:d:Q7114024|Owrtyn]]''
|-
| style='text-align:right'| 7201
| ''[[:d:Q20638115|Huw Evans]]''
| [[File:H. Hawkline.jpg|center|128px]]
| 1985-03-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7202
| ''[[:d:Q20638154|Rhisiart Iorwerth]]''
|
|
|
| ''[[:d:Q6661579|Llangynwyd]]''
|-
| style='text-align:right'| 7203
| ''[[:d:Q20639681|Bert Williams]]''
|
| 1905-05-01
| 1974-05-14
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 7204
| ''[[:d:Q20641048|Nia Jones]]''
| [[File:20150922 1810 W AUT WAL 3848.jpg|center|128px]]
| 1992-04-06
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 7205
| ''[[:d:Q20641049|Tecwyn Jones]]''
|
| 1930-01-03
| 2008-12-29
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 7206
| ''[[:d:Q20641305|Bill Pendergast]]''
|
| 1915-04-13
| 2001-05
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 7207
| ''[[:d:Q20641359|Arthur Pritchard]]''
|
| 1917-10-22
| 2005-12
| [[Newport]]
|-
| style='text-align:right'| 7208
| ''[[:d:Q20641505|George Smith]]''
|
| 1910
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 7209
| ''[[:d:Q20641646|Laurence Woodward]]''
|
| 1918-07-05
| 1997
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 7210
| ''[[:d:Q20647531|Gerald Jones]]''
| [[File:Official portrait of Gerald Jones MP crop 2.jpg|center|128px]]
| 1970-08-21
|
| ''[[:d:Q3402398|New Tredegar]]''
|-
| style='text-align:right'| 7211
| ''[[:d:Q20647978|Craig Williams]]''
| [[File:Official portrait of Craig Williams MP crop 2.jpg|center|128px]]
| 1985-06-07
|
| [[Welshpool]]
|-
| style='text-align:right'| 7212
| ''[[:d:Q20648332|Christina Rees]]''
| [[File:Official portrait of Christina Rees crop 2.jpg|center|128px]]
| 1954-02-21
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 7213
| ''[[:d:Q20648913|Nick Thomas-Symonds]]''
| [[File:Official portrait of Nick Thomas-Symonds MP (cropped).jpg|center|128px]]
| 1980-05-26
|
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 7214
| ''[[:d:Q20651182|David Morris]]''
|
| 1957-09-20
|
| [[Swansea]]
|-
| style='text-align:right'| 7215
| ''[[:d:Q20656901|Evan William Evans]]''
| [[File:Evan William Evans.jpg|center|128px]]
| 1827-01-06
| 1874-05-22<br/>1874
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 7216
| ''[[:d:Q20684269|Terry Jones]]''
|
| 1945-09-02
|
| ''[[:d:Q192240|Northampton]]''<br/>''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 7217
| ''[[:d:Q20685042|Charles Orme]]''
| [[File:Charles Orme.jpg|center|128px]]
| 1918-08-13
| 2007-05-09
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 7218
| ''[[:d:Q20685186|Lot Hughes]]''
| [[File:Revd Lot Hughes (W) NLW3362907.jpg|center|128px]]
| 1787-05-20
| 1873-07-13
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 7219
| ''[[:d:Q20685424|Robert Llugwy Owen]]''
| [[File:Revd Robert Llugwy Owen (1836-1906) (1867) NLW3362143.jpg|center|128px]]
| 1836-10
| 1906-09-16
| ''[[:d:Q203387|Betws-y-Coed]]''
|-
| style='text-align:right'| 7220
| ''[[:d:Q20687891|D. H. Jones]]''
| [[File:David Jones (Dewi Arfon, 1833-1869) NLW3365388.jpg|center|128px]]
| 1833-07-06
| 1869-12-25
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7221
| ''[[:d:Q20688633|John Hugh Evans]]''
| [[File:Revd John Hugh Evans (Cynfaen, 1833-86) NLW3364076.jpg|center|128px]]
| 1833-07-12
| 1886-06-24
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 7222
| ''[[:d:Q20707550|Jack Murphy]]''
|
| 1995-07-15
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 7223
| ''[[:d:Q20707929|Jeremy Lawlor]]''
|
| 1995-11-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7224
| ''[[:d:Q20712662|John Rae]]''
|
| 1912
| 2007
| ''[[:d:Q4923162|Blackmill]]''
|-
| style='text-align:right'| 7225
| ''[[:d:Q20713162|Duane Jones]]''
| [[File:Duane Jones PHC 2015-1.jpg|center|128px]]
| 1993-04-30
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 7226
| ''[[:d:Q20713538|P. D. G. Thomas]]''
|
| 1930-05-01
| 2020-07-07<br/>2020
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7227
| ''[[:d:Q20713565|Rory Thornton]]''
|
| 1995-03-16
|
| [[Swansea]]
|-
| style='text-align:right'| 7228
| ''[[:d:Q20713729|Philip Rodgers]]''
|
| 1891
| 1966
| ''[[:d:Q13131201|Sandycroft]]''
|-
| style='text-align:right'| 7229
| ''[[:d:Q20714025|Javan Sebastian]]''
|
| 1994-09-27
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7230
| ''[[:d:Q20724707|Sydney Chappell]]''
|
| 1915-11-13
| 1987-06
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 7231
| ''[[:d:Q20732606|Lemuel John Hopkin James]]''
|
| 1874-09-02
| 1937-04-11
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 7232
| ''[[:d:Q20732611|Abel Jones Parry]]''
|
| 1833-11-21
| 1911-07-26
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 7233
| ''[[:d:Q20732612|Frederick John Alban]]''
|
| 1882-01-11
| 1965-05-02
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 7234
| ''[[:d:Q20732613|Albert Owen Evans]]''
|
| 1864-02-20
| 1937<br/>1937-09-22
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 7235
| ''[[:d:Q20732615|Alcwyn Caryni Evans]]''
|
| 1828-05-14<br/>1828
| 1902-03-11<br/>1902
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7236
| ''[[:d:Q20732617|Alfred William Hughes]]''
| [[File:Professor Alfred W. Hughes, 1895.png|center|128px]]
| 1861-07-31
| 1900-11-03
| ''[[:d:Q3398817|Aberllefenni]]''
|-
| style='text-align:right'| 7237
| ''[[:d:Q20732620|Alun Herbert Davies]]''
|
| 1927-05-31
| 2005-10-26
| ''[[:d:Q6661745|Llansamlet]]''
|-
| style='text-align:right'| 7238
| ''[[:d:Q20732623|Aneurin Jones]]''
|
| 1822-10-27
| 1904-09-05
| ''[[:d:Q3401157|Bedwas]]''
|-
| style='text-align:right'| 7239
| ''[[:d:Q20732625|Annie Davies]]''
|
| 1910-06-16
| 1970-05-07
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 7240
| ''[[:d:Q20732626|Annie Foulkes]]''
|
| 1877-03-24
| 1962-11-12
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7241
| ''[[:d:Q20732628|Arthur ap Gwynn]]''
|
| 1902-11-04
| 1987-12-10
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 7242
| ''[[:d:Q20732629|Arthur Evans]]''
|
| 1755-09-02
| 1837-04-20
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 7243
| ''[[:d:Q20732632|Arthur Jones]]''
|
|
|
| ''[[:d:Q6661405|Llangadwaladr]]''
|-
| style='text-align:right'| 7244
| ''[[:d:Q20732633|Arthur Jones]]''
| [[File:Arthur Jones, Congregationalist minister, Bangor 1776-1860.jpg|center|128px]]
| 1776-02-12
| 1860-02
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 7245
| ''[[:d:Q20732634|Arthur Leonard Leach]]''
|
| 1869-11-12
| 1957-12-23
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 7246
| ''[[:d:Q20732635|Arthur Tudor Edwards]]''
|
| 1890-03-07
| 1946-08-25
| [[Swansea]]
|-
| style='text-align:right'| 7247
| ''[[:d:Q20732636|Athelstan Owen]]''
|
| 1676
| 1731-08-14
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 7248
| ''[[:d:Q20732643|Ben Davies]]''
| [[File:Ben Davies (Capel Iwan).jpg|center|128px]]
| 1840-09-28
| 1930-08-27
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 7249
| ''[[:d:Q20732645|Ben Davies]]''
|
| 1878-04-12
| 1958-09-17
| ''[[:d:Q6661117|Llanboidy]]''
|-
| style='text-align:right'| 7250
| ''[[:d:Q20732649|Benjamin Davies]]''
|
| 1826-09
| 1905-06-05
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 7251
| ''[[:d:Q20732650|Benjamin Evans]]''
|
| 1816-11-02
| 1886-11-04
| ''[[:d:Q5306194|Dre-fach Felindre]]''
|-
| style='text-align:right'| 7252
| ''[[:d:Q20732651|Benjamin Humphreys]]''
|
| 1856-02-18
| 1934-09-19
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 7253
| ''[[:d:Q20732652|Benjamin Jones]]''
|
| 1756-09-29
| 1823-02-17
| ''[[:d:Q6661877|Llanwinio]]''
|-
| style='text-align:right'| 7254
| ''[[:d:Q20732653|Benjamin Jones]]''
|
| 1788
| 1841-02-19
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 7255
| ''[[:d:Q20732655|Benjamin Maelor Jones]]''
|
| 1894-07-06
| 1982-01-13
| ''[[:d:Q6268758|Johnstown]]''
|-
| style='text-align:right'| 7256
| ''[[:d:Q20732656|Benjamin Meredith]]''
|
| 1700
| 1749
| ''[[:d:Q6661860|Llanwenarth]]''
|-
| style='text-align:right'| 7257
| ''[[:d:Q20732657|Benjamin Millingchamp]]''
|
| 1756
| 1829-01-06
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 7258
| ''[[:d:Q20732658|Benjamin Morris Williams]]''
|
| 1832-12-28
| 1903-01-24
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 7259
| ''[[:d:Q20732661|Benjamin William Chidlaw]]''
| [[File:Benjamin William Chidlaw (cropped).jpg|center|128px]]
| 1811-07-14
| 1892-07-14
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7260
| ''[[:d:Q20732663|William Birchinshaw]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7261
| ''[[:d:Q20732671|Evan Breeze]]''
|
| 1798
| 1855-04-03
| ''[[:d:Q29504090|Dol-Hywel]]''
|-
| style='text-align:right'| 7262
| ''[[:d:Q20732676|Fanny Mary Katherine Bulkeley-Owen]]''
|
| 1845
| 1927-11-25
| [[Flintshire]]
|-
| style='text-align:right'| 7263
| ''[[:d:Q20732678|Cadwaladr Davies]]''
|
| 1704
|
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 7264
| ''[[:d:Q20732679|Cadwaladr Evans]]''
|
| 1664
| 1745
| ''[[:d:Q3359368|Frongoch]]''
|-
| style='text-align:right'| 7265
| ''[[:d:Q20732680|Cadwaladr Jones]]''
| [[File:Portrait of Cadwaladr Jones (4671525).jpg|center|128px]]
| 1783-05
| 1867
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7266
| ''[[:d:Q20732681|Cadwaladr Jones]]''
|
| 1794
| 1883-01-03
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 7267
| ''[[:d:Q20732683|Cadwgan Delynor]]''
|
| 14th century
|
| [[Wales]]
|-
| style='text-align:right'| 7268
| ''[[:d:Q20732684|Cadwgan Ffôl]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7269
| ''[[:d:Q20732685|Caleb Morris]]''
| [[File:Portrait of Caleb Morris (4672653) (cropped).jpg|center|128px]]
| 1800-08-12
| 1865-07-26
| ''[[:d:Q3402206|Whitchurch]]''
|-
| style='text-align:right'| 7270
| ''[[:d:Q20732686|Caleb Rees]]''
|
| 1883
| 1970-01-09
| ''[[:d:Q3402206|Whitchurch]]''
|-
| style='text-align:right'| 7271
| ''[[:d:Q20732689|Caradog Fynach]]''
|
| 11st century
| 1124-04-13
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 7272
| ''[[:d:Q20732690|Ceinwen Rowlands]]''
|
| 1905-01-15
| 1983-06-12
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 7273
| ''[[:d:Q20732691|Charles Conway]]''
|
| 1820-02-08
| 1884-06-11
| ''[[:d:Q7228313|Pontnewydd]]''
|-
| style='text-align:right'| 7274
| ''[[:d:Q20732692|Charles Davies]]''
| [[File:Portrait of Charles Davies (4673058).jpg|center|128px]]
| 1849-11-03
| 1927-01-11
| ''[[:d:Q6662916|Llwynhendy]]''
|-
| style='text-align:right'| 7275
| ''[[:d:Q20732695|Charles Hassall]]''
|
| 1754
| 1814-05-16
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 7276
| ''[[:d:Q20732696|Charles Hughes]]''
|
| 1823-03-03
| 1886-03-24
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 7277
| ''[[:d:Q20732697|Charles James]]''
|
| 1820-07-11
| 1890
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 7278
| ''[[:d:Q20732703|Charles Thomas Edward Hinde]]''
|
| 1820-05-30
| 1870-05-15
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 7279
| ''[[:d:Q20732705|Charles Winter]]''
|
| 1700
| 1773-04-23
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 7280
| ''[[:d:Q20732707|Christopher Mends]]''
|
| 1724-02-22
| 1799-04-05
| ''[[:d:Q5678821|Hasguard]]''
|-
| style='text-align:right'| 7281
| ''[[:d:Q20732712|Coslett Coslett]]''
| [[File:Cosslett Cosslett (Carnelian).jpg|center|128px]]
| 1834-04-15
| 1910-04-25
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 7282
| ''[[:d:Q20732714|Cradock Glascott]]''
|
| 1743<br/>1742
| 1831-08-11
| [[Cairdiff]]
|-
| style='text-align:right'| 7283
| ''[[:d:Q20732732|Dafydd ap Maredudd ap Tudur]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7284
| ''[[:d:Q20732734|Dafydd ap Phylip ap Rhys]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7285
| ''[[:d:Q20732737|Dafydd Cadwaladr]]''
|
| 1752
| 1834-07-09
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 7286
| ''[[:d:Q20732746|Dafydd Jones]]''
|
| 1743-05-05
| 1831-03-30
| ''[[:d:Q3396822|Llandanwg]]''
|-
| style='text-align:right'| 7287
| ''[[:d:Q20732748|Dafydd Llwyd]]''
|
|
| 1469
| [[Wales]]
|-
| style='text-align:right'| 7288
| ''[[:d:Q20732759|Dafydd Rhys ap Thomas]]''
|
| 1912-05-02
| 2011-05-19
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 7289
| ''[[:d:Q20732760|Dafydd Siencyn Morgan]]''
|
| 1752
| 1844-11-18
| ''[[:d:Q927739|Llangrannog]]''
|-
| style='text-align:right'| 7290
| ''[[:d:Q20732767|Daniel Davies]]''
|
| 1756-04-24
| 1837-04-16
| ''[[:d:Q5058788|Cenarth]]''
|-
| style='text-align:right'| 7291
| ''[[:d:Q20732768|Daniel Davies]]''
| [[File:Dr Daniel Davies, Swansea (1797-1876) NLW3361967.jpg|center|128px]]
| 1797-11-15
| 1876-02-19
| ''[[:d:Q3403140|Llanfair-ar-y-bryn]]''
|-
| style='text-align:right'| 7292
| ''[[:d:Q20732770|Daniel Evans]]''
| [[File:Portrait of Daniel Evans 'Eos Dâr' (4673945).jpg|center|128px]]
| 1846
| 1915-03-17
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7293
| ''[[:d:Q20732772|Daniel Jones]]''
|
| 1725
| 1806-03-10
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 7294
| ''[[:d:Q20732773|Daniel Jones]]''
|
| 1757
| 1821-01-20
| ''[[:d:Q6661117|Llanboidy]]''
|-
| style='text-align:right'| 7295
| ''[[:d:Q20732774|Daniel Jones]]''
|
| 1771
| 1810-03-14
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 7296
| ''[[:d:Q20732775|Daniel Jones]]''
|
| 1788-02-24
| 1862-12-31
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 7297
| ''[[:d:Q20732776|Daniel Jones]]''
| [[File:Dan Jones (Mormon).jpg|center|128px]]
| 1811-08-04
| 1861-01-03
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 7298
| ''[[:d:Q20732777|Daniel Jones]]''
|
| 1813-09-12
| 1846
| ''[[:d:Q13129669|Llanrhaeadr-yng-Nghinmeirch]]''
|-
| style='text-align:right'| 7299
| ''[[:d:Q20732778|Daniel Lewis Moses]]''
|
| 1822-05-01
| 1893
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 7300
| ''[[:d:Q20732780|Daniel Owen Jones]]''
|
| 1880-02-23
| 1951-06-17
| ''[[:d:Q20598147|Cwm-cou]]''
|-
| style='text-align:right'| 7301
| ''[[:d:Q20732782|Daniel Rowlands]]''
| [[File:D Rowlands NLW3361839.jpg|center|128px]]
| 1827-02-21
| 1917-02-24
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 7302
| ''[[:d:Q20732783|Daniel Williams]]''
|
| 1878-06-17
| 1968-03-17
| ''[[:d:Q787395|Llanfairfechan]]''
|-
| style='text-align:right'| 7303
| ''[[:d:Q20732785|David Adams]]''
| [[File:Parch. D. Adams, B.A., Lerpwl (5349031).jpg|center|128px]]
| 1845-08-28
| 1922-07-05
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 7304
| ''[[:d:Q20732786|David Alban Davies]]''
|
| 1873-04-13
| 1951-12-02
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 7305
| ''[[:d:Q20732787|David Bowen]]''
|
| 1874-07-20
| 1955-04-22
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 7306
| ''[[:d:Q20732788|David David Williams]]''
|
| 1862
| 1938-07-20<br/>1938
| ''[[:d:Q3398987|Croesor]]''
|-
| style='text-align:right'| 7307
| ''[[:d:Q20732790|David Davies]]''
|
| 1764
| 1828-11-27
| ''[[:d:Q3406111|Llansawel]]''
|-
| style='text-align:right'| 7308
| ''[[:d:Q20732793|David Davies]]''
| [[File:Portrait of David Davies, Swansea (4669729).jpg|center|128px]]
| 1763-06-12
| 1816-12-26
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 7309
| ''[[:d:Q20732794|David Davies]]''
|
| 1791-02
| 1864-07-31
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 7310
| ''[[:d:Q20732795|David Davies]]''
|
| 1810
| 1875
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 7311
| ''[[:d:Q20732796|David Davies]]''
|
| 1817-01-27
| 1855-11-01
| ''[[:d:Q3401140|Gelligaer]]''
|-
| style='text-align:right'| 7312
| ''[[:d:Q20732797|David Davies]]''
|
| 1849-06-16
| 1926-11-13
| ''[[:d:Q7321597|Rhydargaeau]]''
|-
| style='text-align:right'| 7313
| ''[[:d:Q20732798|David Davies]]''
|
| 1814-08-24
| 1891-01-02
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 7314
| ''[[:d:Q20732799|David Davies Evans]]''
|
| 1787-03-27
| 1858-08-29
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 7315
| ''[[:d:Q20732805|David Eirwyn Morgan]]''
|
| 1918-04-23
| 1982<br/>1982-08-30
| ''[[:d:Q7162078|Pen-y-groes]]''
|-
| style='text-align:right'| 7316
| ''[[:d:Q20732809|David Evans]]''
|
| 1740
| 1790-10-14
| ''[[:d:Q6751430|Manordeifi]]''
|-
| style='text-align:right'| 7317
| ''[[:d:Q20732811|David Evans]]''
|
| 1793-04-21
| 1861-11-17
| ''[[:d:Q13129664|Llanllwchaiarn]]''
|-
| style='text-align:right'| 7318
| ''[[:d:Q20732812|David Evans]]''
|
| 1814-06-02
| 1847-09-12
| ''[[:d:Q4666801|Abercegir]]''
|-
| style='text-align:right'| 7319
| ''[[:d:Q20732815|David Evans]]''
| [[File:David Evans, Caerfyrddin.jpg|center|128px]]
| 1842-01-15
| 1914-03-22
| ''[[:d:Q20589424|Pen-y-bont-fawr]]''
|-
| style='text-align:right'| 7320
| ''[[:d:Q20732816|David Evans]]''
|
| 1879-09-26
| 1965-08-20
| ''[[:d:Q14508467|Blaenpennal]]''
|-
| style='text-align:right'| 7321
| ''[[:d:Q20732817|David Evans]]''
|
| 1778
| 1866-03-05
| ''[[:d:Q5200192|Cynwyl Elfed]]''
|-
| style='text-align:right'| 7322
| ''[[:d:Q20732818|David Evans]]''
| [[File:Dewi Haran (David Evans) (1812–1885) (gcf10113).jpg|center|128px]]
| 1812
| 1885-07-06<br/>1885
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 7323
| ''[[:d:Q20732819|David Evans]]''
| [[File:Portrait of David Evans 'Dewi Dawel' (4674375).jpg|center|128px]]
| 1814-09-16
| 1891-12-20
| ''[[:d:Q770818|Llanfynydd]]''
|-
| style='text-align:right'| 7324
| ''[[:d:Q20732820|David Gravell]]''
|
| 1787-06-03
| 1872-08-15
| ''[[:d:Q6661270|Llandyfaelog]]''
|-
| style='text-align:right'| 7325
| ''[[:d:Q20732821|David Griffith]]''
|
| 1792
| 1873-02-27
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 7326
| ''[[:d:Q20732822|David Griffiths]]''
|
| 1756
| 1834-09-18
| [[Lampeter Velfrey]]
|-
| style='text-align:right'| 7327
| ''[[:d:Q20732824|David Harries]]''
|
| 1747-09-16
| 1834-01-06
| ''[[:d:Q5197239|Cwmdauddwr]]''
|-
| style='text-align:right'| 7328
| ''[[:d:Q20732826|David Herbert]]''
|
| 1762
| 1835
| ''[[:d:Q29495299|Rhiwbren Fawr]]''
|-
| style='text-align:right'| 7329
| ''[[:d:Q20732827|David Howell]]''
| [[File:D Howells (print) NLW3361223.jpg|center|128px]]
| 1797-03-31
| 1873-08-04
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 7330
| ''[[:d:Q20732830|David James]]''
|
| 1787
| 1862
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 7331
| ''[[:d:Q20732833|David James Williams]]''
| [[File:David James Williams.jpg|center|128px]]
| 1870-02-18
| 1951-10-01
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 7332
| ''[[:d:Q20732835|David Jehu]]''
|
| 1812
| 1840-07-01
| ''[[:d:Q3363693|Meifod]]''
|-
| style='text-align:right'| 7333
| ''[[:d:Q20732838|David John Tawe Jones]]''
|
| 1885
| 1949-05-03
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 7334
| ''[[:d:Q20732839|David John Williams]]''
|
| 1886-08-22
| 1950-02-01
| ''[[:d:Q3398830|Corris]]''
|-
| style='text-align:right'| 7335
| ''[[:d:Q20732842|David Jones]]''
|
| 1789
| 1841-07-26
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7336
| ''[[:d:Q20732844|David Jones]]''
|
| 1741
| 1792-01-24
| ''[[:d:Q5197221|Cwmamman]]''
|-
| style='text-align:right'| 7337
| ''[[:d:Q20732845|David Jones]]''
| [[File:Portrait of David Jones, Holywell, Flintshire (4673329) (cropped).jpg|center|128px]]
| 1770-10
| 1831-08-25
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7338
| ''[[:d:Q20732847|David Jones]]''
|
| 1788
| 1859-04-29
| ''[[:d:Q50811580|Llanfihangel-Cilfargan]]''
|-
| style='text-align:right'| 7339
| ''[[:d:Q20732848|David Jones]]''
|
| 1793
| 1825-09-01
| ''[[:d:Q3404590|Llanfihangel-ar-Arth]]''
|-
| style='text-align:right'| 7340
| ''[[:d:Q20732849|David Jones]]''
| [[File:Portrait of Rev. David Jones, Treborth (4670294).jpg|center|128px]]
| 1805-06-02
| 1868-06-23
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 7341
| ''[[:d:Q20732850|David Jones]]''
|
| 1732-10-29
| 1782
| ''[[:d:Q3404936|Llanfair Talhaiarn]]''
|-
| style='text-align:right'| 7342
| ''[[:d:Q20732851|David Joshua Davies]]''
|
| 1877-12-26
| 1945-01-08
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 7343
| ''[[:d:Q20732852|David Lewis]]''
|
| 1828-11-12
| 1908-10-06
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 7344
| ''[[:d:Q20732853|David Lewis]]''
| [[File:Barnwr (Judge) David Lewis.jpg|center|128px]]
| 1848-11-22
| 1897-09-09
| [[Swansea]]
|-
| style='text-align:right'| 7345
| ''[[:d:Q20732854|David Lewis Evans]]''
|
| 1813-07-24
| 1902-10-29
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 7346
| ''[[:d:Q20732855|David Lewis Jones]]''
|
| 1788-04-08
| 1830-09-08
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 7347
| ''[[:d:Q20732856|David Lewis Jones]]''
|
| 1945-01-04
| 2010-10-15
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 7348
| ''[[:d:Q20732857|David Lewis Wooding]]''
|
| 1828-12-13
| 1891-05-02
| ''[[:d:Q4667105|Abergwesyn]]''
|-
| style='text-align:right'| 7349
| ''[[:d:Q20732859|David Lloyd]]''
|
| 1724
| 1779-02-04<br/>1779
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 7350
| ''[[:d:Q20732860|David Lloyd Davies]]''
|
| 1832
| 1881-01-23
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7351
| ''[[:d:Q20732861|David Lloyd Evans]]''
|
| 1861-12-29
| 1912-12-13
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 7352
| ''[[:d:Q20732862|David Lloyd Isaac]]''
|
| 1818-02-10
| 1876-01-31
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 7353
| ''[[:d:Q20732863|David Lloyd Jenkins]]''
|
| 1896-11-20
| 1966-08-05
| ''[[:d:Q922270|Llanddewi Brefi]]''
|-
| style='text-align:right'| 7354
| ''[[:d:Q20732866|David Manuel]]''
|
| 1625
| 1726
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 7355
| ''[[:d:Q20732867|David Marks]]''
|
| 1788
| 1871-10-03
| ''[[:d:Q5120035|Cilrhedyn]]''
|-
| style='text-align:right'| 7356
| ''[[:d:Q20732868|David Mervyn Himbury]]''
|
| 1922-07-22
| 2008-10-31
| ''[[:d:Q1774850|Ystrad Mynach]]''
|-
| style='text-align:right'| 7357
| ''[[:d:Q20732870|David Morgan]]''
| [[File:Portrait of D. Morgan, Machynlleth (4669852).jpg|center|128px]]
| 1779-12
| 1858-07-14
| ''[[:d:Q6661372|Llanfihangel y Creuddyn]]''
|-
| style='text-align:right'| 7358
| ''[[:d:Q20732872|David Morgan Lewis]]''
|
| 1851-09-27
| 1937-07-28
| ''[[:d:Q5348103|Eglwyswrw]]''
|-
| style='text-align:right'| 7359
| ''[[:d:Q20732874|David Morris]]''
|
| 1787
| 1858-06-19
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 7360
| ''[[:d:Q20732876|David Onllwyn Brace]]''
| [[File:Parch D Onllwyn Brace.jpg|center|128px]]
| 1848-11-11
| 1891-06-28
| ''[[:d:Q7094142|Onllwyn]]''
|-
| style='text-align:right'| 7361
| ''[[:d:Q20732878|David Parry]]''
|
| 1760-02-13
| 1821-04-27
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 7362
| ''[[:d:Q20732880|David Philips]]''
|
| 1751
| 1825
| ''[[:d:Q1996667|Whitland]]''
|-
| style='text-align:right'| 7363
| ''[[:d:Q20732881|David Phillips]]''
| [[File:Reverend David Phillips.jpg|center|128px]]
| 1812-12-14
| 1904-06-05
| ''[[:d:Q4854175|Bancyfelin]]''
|-
| style='text-align:right'| 7364
| ''[[:d:Q20732882|David Pugh Evans]]''
|
| 1866
| 1897-02-03
| ''[[:d:Q5200192|Cynwyl Elfed]]''
|-
| style='text-align:right'| 7365
| ''[[:d:Q20732884|David Rhys Phillips]]''
|
| 1862-03-20
| 1952-03-22
| ''[[:d:Q107032888|Pontwalby]]''
|-
| style='text-align:right'| 7366
| ''[[:d:Q20732886|David Richards]]''
|
| 1822
| 1900-01-02
| ''[[:d:Q20585238|Brynberian]]''
|-
| style='text-align:right'| 7367
| ''[[:d:Q20732887|David Robert Daniel]]''
| [[File:D R Daniel.jpg|center|128px]]
| 1859-05-06
| 1931-09-14
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 7368
| ''[[:d:Q20732888|David Stephen Davies]]''
|
| 1841-02-14
| 1898-10-29
| ''[[:d:Q7201803|Plasmarl]]''
|-
| style='text-align:right'| 7369
| ''[[:d:Q20732889|David Tecwyn Evans]]''
|
| 1876-12-05
| 1957-10-27
| ''[[:d:Q6661176|Llandecwyn]]''
|-
| style='text-align:right'| 7370
| ''[[:d:Q20732891|David Thomas]]''
|
| 1739
| 1788-05-25
| ''[[:d:Q7161927|Pembrey]]''
|-
| style='text-align:right'| 7371
| ''[[:d:Q20732893|David Tudor Evans]]''
| [[File:D Tudor Evans (ap Tudor).jpg|center|128px]]
| 1822-02-03
| 1896-10-02
| ''[[:d:Q29502578|Cilgynydd]]''
|-
| style='text-align:right'| 7372
| ''[[:d:Q20732894|David Tyssil Evans]]''
|
| 1853-11-06
| 1918-09-29
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 7373
| ''[[:d:Q20732896|David William Lewis]]''
|
| 1845-04-15
| 1920-01-20
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 7374
| ''[[:d:Q20732898|David Williams]]''
| [[File:Portrait of David Williams, Troedwhiwdalar (4672170).jpg|center|128px]]
| 1779-01-27
| 1874-08-20
| ''[[:d:Q15242569|Llanwrtyd]]''
|-
| style='text-align:right'| 7375
| ''[[:d:Q20732899|David Wyre Lewis]]''
|
| 1872-05-13
| 1966-05-09
| ''[[:d:Q29488538|Felin Ganol]]''
|-
| style='text-align:right'| 7376
| ''[[:d:Q20732900|David Charles]]''
|
| 1803
| 1880-05-10
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7377
| ''[[:d:Q20732903|William Davies]]''
| [[File:William Davies (Western Mail).jpg|center|128px]]
| 1863-10-07
| 1935-03-17
| ''[[:d:Q7680110|Talyllychau]]''
|-
| style='text-align:right'| 7378
| ''[[:d:Q20732911|Ebenezer Gwyn Evans]]''
|
| 1898-05-31
| 1958-07-23
| ''[[:d:Q6661579|Llangynwyd]]''
|-
| style='text-align:right'| 7379
| ''[[:d:Q20732914|Ebenezer Morris]]''
| [[File:Portrait of Ebenzr. Morris late of Cardiganshire (4669857).jpg|center|128px]]
| 1790
| 1867-04-18
| ''[[:d:Q10989171|Llandyfriog]]''
|-
| style='text-align:right'| 7380
| ''[[:d:Q20732915|Ebenezer Rees]]''
| [[File:Ebenezer Rees (1848-1908).jpg|center|128px]]
| 1848
| 1908-09-30
| ''[[:d:Q7530204|Sirhowy Valley]]''
|-
| style='text-align:right'| 7381
| ''[[:d:Q20732916|Edgar Jones]]''
|
| 1912-03-11
| 1991-05-31
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 7382
| ''[[:d:Q20732917|Edgar William Jones]]''
|
| 1868-12-13
| 1953-05-01
| [[Llanrhaeadr-ym-Mochnant]]
|-
| style='text-align:right'| 7383
| ''[[:d:Q20732919|Edmund David Jones]]''
| [[File:Edmund David Jones.jpg|center|128px]]
| 1869-09-09
| 1941-02-13
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 7384
| ''[[:d:Q20732922|Edmund Osborne Jones]]''
|
| 1858-09-24
| 1931-03-11
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 7385
| ''[[:d:Q20732925|Edward Anwyl]]''
|
| 1786<br/>1786-04
| 1857-01-23
| ''[[:d:Q13129617|Llanegryn]]''
|-
| style='text-align:right'| 7386
| ''[[:d:Q20732926|Edward Barnes]]''
|
|
| 1795
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 7387
| ''[[:d:Q20732927|Edward Cadwaladr]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7388
| ''[[:d:Q20732928|Edward Carnes]]''
|
| 1772
| 1828-05-25
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 7389
| ''[[:d:Q20732930|Edward Cynolwyn Pugh]]''
|
| 1883-06-21
| 1962-03-22
| ''[[:d:Q3398874|Abergynolwyn]]''
|-
| style='text-align:right'| 7390
| ''[[:d:Q20732931|Edward David Rowlands]]''
|
| 1880-11-25
| 1969-04-26
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7391
| ''[[:d:Q20732934|Edward Eddie Thomas]]''
|
| 1925-07-27
| 1997-06-02
| ''[[:d:Q5731588|Heolgerrig]]''
|-
| style='text-align:right'| 7392
| ''[[:d:Q20732935|Edward Edwards]]''
|
| 1741
| 1820-08-07
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 7393
| ''[[:d:Q20732936|Edward Edwards]]''
| [[File:Edward Edwards (Pencerdd Ceredigion, 1816-97) NLW3364548.jpg|center|128px]]
| 1816
| 1897-09-16
| [[Aberystwyth]]
|-
| style='text-align:right'| 7394
| ''[[:d:Q20732937|Edward Ellis]]''
|
| 1842
| 1892-10
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7395
| ''[[:d:Q20732939|Edward Gittins]]''
|
| 1843
| 1884-03
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 7396
| ''[[:d:Q20732940|Edward Griffith]]''
| [[File:Edward Griffith, Dolgellau.jpg|center|128px]]
| 1832-01-02
| 1918-04-12
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 7397
| ''[[:d:Q20732942|Edward Hamer]]''
|
| 1840-02-06
| 1911-11-24
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7398
| ''[[:d:Q20732943|Edward Harker]]''
|
| 1866-07-09
| 1969-03-15
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 7399
| ''[[:d:Q20732944|Edward Harri]]''
|
| 1752
| 1837-08-20
| ''[[:d:Q13130671|Penderyn]]''
|-
| style='text-align:right'| 7400
| ''[[:d:Q20732950|Edward Jones]]''
|
| 1741-04-01
| 1806
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 7401
| ''[[:d:Q20732952|Edward Jones]]''
|
| 1768
| 1813-12-17
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 7402
| ''[[:d:Q20732955|Edward Jones]]''
|
| 1790-09-11
| 1860-08-29
| ''[[:d:Q3401728|Llandre]]''
|-
| style='text-align:right'| 7403
| ''[[:d:Q20732959|Edward Jones]]''
|
| 1782
| 1855-07-22
| ''[[:d:Q6661823|Llantysilio]]''
|-
| style='text-align:right'| 7404
| ''[[:d:Q20732960|Edward Jones]]''
|
| 1824
| 1880-04-14
| ''[[:d:Q3404631|Carrog]]''
|-
| style='text-align:right'| 7405
| ''[[:d:Q20732961|Edward Laws]]''
|
| 1837
| 1913-07-25
| ''[[:d:Q6482424|Lamphey]]''
|-
| style='text-align:right'| 7406
| ''[[:d:Q20732962|Edward Matthews]]''
| [[File:Revd Edward Matthews (1813-92) NLW3365363.jpg|center|128px]]
| 1813-05-13
| 1892-11-26
| ''[[:d:Q3400328|St Athan]]''
|-
| style='text-align:right'| 7407
| ''[[:d:Q20732963|Edward Meredith Price]]''
|
| 1816
| 1898-03-05
| ''[[:d:Q20602447|Pant-y-dŵr]]''
|-
| style='text-align:right'| 7408
| ''[[:d:Q20732965|Edward Mills]]''
|
| 1802
| 1865
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7409
| ''[[:d:Q20732966|Edward Morgan]]''
|
| 1783-11-07
| 1869-06
| ''[[:d:Q3400823|Pîl]]''
|-
| style='text-align:right'| 7410
| ''[[:d:Q20732967|Edward Morgan]]''
| [[File:Rev. Edward Morgan, Dyffryn Ardudwy.jpg|center|128px]]
| 1817-09-20
| 1871-05-09
| ''[[:d:Q20598267|Cwmbelan]]''
|-
| style='text-align:right'| 7411
| ''[[:d:Q20732968|Edward Oliver]]''
|
| 1720-04-15
| 1777-06-03
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 7412
| ''[[:d:Q20732969|Edward Owen Davies]]''
|
| 1864-06-08
| 1936-12-14
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 7413
| ''[[:d:Q20732970|Edward Parry]]''
|
| 1723
| 1786-09-16
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 7414
| ''[[:d:Q20732971|Edward Parry]]''
|
| 1798
| 1854-03-25
| ''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 7415
| ''[[:d:Q20732972|Edward Randles]]''
|
| 1763
| 1820-08-23
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 7416
| ''[[:d:Q20732973|Edward Roberts]]''
|
| 1886-03-20
| 1975-07-20
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7417
| ''[[:d:Q20732975|Edward Stanton Roberts]]''
|
| 1878-03-11
| 1938-08-26
| ''[[:d:Q5200185|Cynwyd]]''
|-
| style='text-align:right'| 7418
| ''[[:d:Q20732979|William Rice Edwards]]''
|
| 1862-05-17
| 1923-10-13
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 7419
| ''[[:d:Q20732982|Edwin Davies]]''
| [[File:Edwin Davies.jpg|center|128px]]
| 1859-03
| 1919-02-07
| [[Welshpool]]
|-
| style='text-align:right'| 7420
| ''[[:d:Q20732990|Elizabeth Jane Louis Jones]]''
|
| 1889-04-28
| 1952-05-14
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 7421
| ''[[:d:Q20732994|Ellis Cadwaladr]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7422
| ''[[:d:Q20732996|Ellis Edwards]]''
| [[File:Portrait of Ellis Edwards (4674351) (cropped).jpg|center|128px]]
| 1844-06-09
| 1915-02-02
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 7423
| ''[[:d:Q20732998|Ellis Evans]]''
| [[File:Portrait of Ellis Evans, D.D., Cefnmawr (4673713) (cropped).jpg|center|128px]]
| 1786-06-22
| 1864-03-28
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7424
| ''[[:d:Q20732999|Ellis Lewis]]''
|
|
|
| ''[[:d:Q20595287|Llwyn-Gwern]]''
|-
| style='text-align:right'| 7425
| ''[[:d:Q20733000|Ellis Owen Ellis]]''
| [[File:Ellis Owen Ellis (Ellis Bryn Coch) (print) NLW3363652.jpg|center|128px]]
| 1813
| 1861-05-17
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 7426
| ''[[:d:Q20733002|Ellis Thomas Davies]]''
|
| 1822
| 1895-04-02<br/>1895
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7427
| ''[[:d:Q20733006|Lewis Evan]]''
|
| 1720-02-18
| 1792-09-05
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 7428
| ''[[:d:Q20733007|Evan Bevan]]''
|
| 1803
| 1866-10
| ''[[:d:Q6661579|Llangynwyd]]''
|-
| style='text-align:right'| 7429
| ''[[:d:Q20733011|Evan Davies]]''
|
| 1694
| 1770-10-16
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 7430
| ''[[:d:Q20733013|Evan Davies]]''
|
| 1826-06-26
| 1872-08-22
| ''[[:d:Q6661911|Llanycrwys]]''
|-
| style='text-align:right'| 7431
| ''[[:d:Q20733016|Evan Davies]]''
|
| 1794
| 1855-03-01
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 7432
| ''[[:d:Q20733018|Evan Edward Morgan]]''
|
| 1855
| 1927-04-21
| ''[[:d:Q3309494|Bronllys]]''
|-
| style='text-align:right'| 7433
| ''[[:d:Q20733019|Evan Edwards]]''
|
| 1734
| 1766-06
| ''[[:d:Q5064823|Cerrigydrudion]]''
|-
| style='text-align:right'| 7434
| ''[[:d:Q20733021|Evan Evans]]''
|
| 1758
| 1828-08-22
| ''[[:d:Q15242569|Llanwrtyd]]''
|-
| style='text-align:right'| 7435
| ''[[:d:Q20733022|Evan Evans]]''
|
| 1773-06-03
| 1827-02-02
| ''[[:d:Q6661066|Llanarmon]]''
|-
| style='text-align:right'| 7436
| ''[[:d:Q20733023|Evan Griffiths]]''
|
| 1778
| 1839-09-06
| ''[[:d:Q3363693|Meifod]]''
|-
| style='text-align:right'| 7437
| ''[[:d:Q20733026|Evan Jenkins]]''
|
| 1799-01-12
| 1877-02-02
| [[Aberystwyth]]
|-
| style='text-align:right'| 7438
| ''[[:d:Q20733027|Evan John Evans]]''
|
| 1827
| 1891-01-14
| ''[[:d:Q5184878|Cribarth]]''
|-
| style='text-align:right'| 7439
| ''[[:d:Q20733028|Evan Jones]]''
|
| 1777
| 1819-12-10
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7440
| ''[[:d:Q20733030|Evan Jones]]''
| [[File:Portrait of Y Parch. Evan Jones (Caernarfon) (4670300) (cropped).jpg|center|128px]]
| 1836-10-27
| 1915-09-29
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 7441
| ''[[:d:Q20733031|Evan Jones]]''
|
| 1857-05-26
| 1935-07-06
| ''[[:d:Q39006543|Moel-y-crio]]''
|-
| style='text-align:right'| 7442
| ''[[:d:Q20733032|Evan Jones]]''
|
| 1793-08-26
| 1855-12-01
| ''[[:d:Q6661167|Llanddoged]]''
|-
| style='text-align:right'| 7443
| ''[[:d:Q20733033|Evan Gurnos Jones]]''
| [[File:Evan Gurnos Jones.jpg|center|128px]]
| 1840-04-14
| 1903-12-16
| ''[[:d:Q13128837|Gwernogle]]''
|-
| style='text-align:right'| 7444
| ''[[:d:Q20733034|Evan Jones]]''
|
| 1850-02-06
| 1928-02-03
| ''[[:d:Q15242569|Llanwrtyd]]''
|-
| style='text-align:right'| 7445
| ''[[:d:Q20733036|Evan Lloyd]]''
|
| 1728-05-26
| 1801
| ''[[:d:Q13129635|Llangeinwen]]''
|-
| style='text-align:right'| 7446
| ''[[:d:Q20733037|Evan Lloyd]]''
|
| 1764-03-21
| 1847-07-30
| ''[[:d:Q1936328|Nevern]]''
|-
| style='text-align:right'| 7447
| ''[[:d:Q20733038|Evan Morgan]]''
|
| 1809
| 1853-08-10
| [[Cairdiff]]
|-
| style='text-align:right'| 7448
| ''[[:d:Q20733039|Evan Robert Thomas]]''
|
| 1891-01-08
| 1964-09-06
| ''[[:d:Q3406271|Ysbyty Ifan]]''
|-
| style='text-align:right'| 7449
| ''[[:d:Q20733044|Evan Thomas Davies]]''
| [[File:Revd Canon Evan Thomas Davies, Saint David's Church, Liverpool (Dyfrig, 1847-1927) NLW3363074.jpg|center|128px]]
| 1847-06-20
| 1927
| ''[[:d:Q6661375|Llanfihangel Ystrad]]''
|-
| style='text-align:right'| 7450
| ''[[:d:Q20733046|Evan William Evans]]''
| [[File:Evan-William-Evans.jpg|center|128px]]
| 1860-10-07
| 1925-10-28
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7451
| ''[[:d:Q20733047|Evan William Pearce]]''
|
| 1870-10-02
| 1957-08-30
| ''[[:d:Q3406126|Llanilltud Faerdref]]''
|-
| style='text-align:right'| 7452
| ''[[:d:Q20733048|Evan Williams]]''
|
| 1719-01-06
| 1748-08-20
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 7453
| ''[[:d:Q20733049|David Treharne Evans]]''
|
| 1849-04-21
| 1907-08-14
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 7454
| ''[[:d:Q20733050|Griffith Humphrey Pugh Evans]]''
|
| 1840-01-13
| 1902-02-06
| ''[[:d:Q29503858|Lovesgrove]]''
|-
| style='text-align:right'| 7455
| ''[[:d:Q20733052|Fanny Winifred Edwards]]''
|
| 1876-02-21
| 1959-11-16
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 7456
| ''[[:d:Q20733055|Thomas Foulkes]]''
|
| 1731
| 1802-05-15
| ''[[:d:Q772694|Llandrillo]]''
|-
| style='text-align:right'| 7457
| ''[[:d:Q20733057|Francis Hiley]]''
| [[File:Portrait of Revd. Francis Hiley, Llanwenarth (4674791).jpg|center|128px]]
| 1781
| 1860-10-14
| ''[[:d:Q6661860|Llanwenarth]]''
|-
| style='text-align:right'| 7458
| ''[[:d:Q20733058|Francis Pugh]]''
|
| 1720-09-10
| 1811-11-22
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 7459
| ''[[:d:Q20733059|Frank Vivian Emery]]''
|
| 1930-06-15
| 1987-06-10<br/>1987-10-06
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 7460
| ''[[:d:Q20733060|Thomas Mansel Franklen]]''
|
| 1840
| 1928-09-29
| [[Swansea]]
|-
| style='text-align:right'| 7461
| ''[[:d:Q20733061|Frederick Evans]]''
| [[File:Fred Evans (Ednyfed) Gweinidog y Bedyddwyr Cymreig yn yr Unol Daleithiau.jpg|center|128px]]
| 1840-04-21
| 1897-07-21
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 7462
| ''[[:d:Q20733063|Gabriel Rees]]''
|
| 1757
| 1807-05-21
| ''[[:d:Q17487513|Llanglydwen]]''
|-
| style='text-align:right'| 7463
| ''[[:d:Q20733064|George Ethelbert Sayce]]''
|
| 1875-12-25
| 1953-10-07
| ''[[:d:Q6661521|Llangua]]''
|-
| style='text-align:right'| 7464
| ''[[:d:Q20733066|George Humphreys]]''
|
| 1747
| 1813
| [[Llanrhaeadr-ym-Mochnant]]
|-
| style='text-align:right'| 7465
| ''[[:d:Q20733068|George Lewis]]''
|
| 1640
| 1709
| ''[[:d:Q6661117|Llanboidy]]''
|-
| style='text-align:right'| 7466
| ''[[:d:Q20733069|George Lewis]]''
|
| 1826
| 1858-02
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 7467
| ''[[:d:Q20733072|George Prichard Evans]]''
|
| 1820-11-13
| 1874-11-22
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7468
| ''[[:d:Q20733074|George Rees]]''
|
| 1873-01-20
| 1950-09-01
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 7469
| ''[[:d:Q20733075|Gethin Davies]]''
| [[File:Gethin Davies, Bangor.jpg|center|128px]]
| 1846-09-18
| 1896-03-17
| ''[[:d:Q4667051|Aberdulais]]''
|-
| style='text-align:right'| 7470
| ''[[:d:Q20733078|Gomer Morgan Roberts]]''
|
| 1904-01-03
| 1993-03-16
| ''[[:d:Q3402396|Llanfihangel Aberbythych]]''
|-
| style='text-align:right'| 7471
| ''[[:d:Q20733079|Grace Wynne Griffith]]''
|
| 1888-02
| 1963-05-01
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 7472
| ''[[:d:Q20733084|Griffith Anthony]]''
|
| 1846
| 1897-06-13
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7473
| ''[[:d:Q20733085|Griffith Edwards]]''
| [[File:Griffith Edwards (Gutyn Padarn).jpg|center|128px]]
| 1812-09-01
| 1893-01-29
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7474
| ''[[:d:Q20733087|Griffith Ellis]]''
| [[File:Revd Griffith Ellis, Bootle (CM) NLW3365255 (cropped).jpg|center|128px]]
| 1844-09-24
| 1913-07-14
| ''[[:d:Q3398830|Corris]]''
|-
| style='text-align:right'| 7475
| ''[[:d:Q20733088|Griffith Francis]]''
|
| 1876-12
| 1936-06-15
| ''[[:d:Q20598098|Cwm Pennant]]''
|-
| style='text-align:right'| 7476
| ''[[:d:Q20733090|Griffith Griffiths]]''
|
| 1799-12-24
| 1845-12-08
| ''[[:d:Q3401728|Llandre]]''
|-
| style='text-align:right'| 7477
| ''[[:d:Q20733091|Griffith Hugh Jones]]''
|
| 1849
| 1919-07-26
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7478
| ''[[:d:Q20733092|Griffith Hughes]]''
| [[File:Griffith Hughes (Diwygwyr Cymru) (crop).jpg|center|128px]]
| 1775
| 1839-07-20
| ''[[:d:Q20598309|Cwmifor]]''
|-
| style='text-align:right'| 7479
| ''[[:d:Q20733094|Griffith John Roberts]]''
|
| 1912-03-02
| 1969-02-13
| ''[[:d:Q4689301|Afonwen]]''
|-
| style='text-align:right'| 7480
| ''[[:d:Q20733095|Griffith John Williams]]''
| [[File:Griffith John Williams (5254831).jpg|center|128px]]
| 1854-12-16
| 1933-02-03
| ''[[:d:Q13131033|Rhiwbryfdir]]''
|-
| style='text-align:right'| 7481
| ''[[:d:Q20733097|Griffith Jones]]''
|
| 1836-03-15
| 1906-10-21
| ''[[:d:Q787395|Llanfairfechan]]''
|-
| style='text-align:right'| 7482
| ''[[:d:Q20733098|Griffith Parry]]''
| [[File:Revd Griffith Parry (1827-1901) NLW3361807 (cropped).jpg|center|128px]]
| 1827-12
| 1901-08-22
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 7483
| ''[[:d:Q20733099|Griffith Pennar Griffiths]]''
| [[File:Griffith Pennar Griffiths.jpg|center|128px]]
| 1860
| 1918-12-29
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 7484
| ''[[:d:Q20733100|Griffith Wynn]]''
|
| 1669
| 1736
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 7485
| ''[[:d:Q20733114|Gruffydd Evans]]''
|
| 1866-09-18
| 1930
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 7486
| ''[[:d:Q20733115|Gruffydd Thomas Lewis]]''
|
| 1873-02-03
| 1964-07-20
| ''[[:d:Q6661421|Llangain]]''
|-
| style='text-align:right'| 7487
| ''[[:d:Q20733119|Gwenfron Moss]]''
|
| 1898-07-27
| 1991-08-10
| ''[[:d:Q5140559|Coedpoeth]]''
|-
| style='text-align:right'| 7488
| ''[[:d:Q20733120|Gwilym Bowyer]]''
|
| 1906-02-07
| 1965-10-05
| ''[[:d:Q7227631|Ponciau]]''
|-
| style='text-align:right'| 7489
| ''[[:d:Q20733121|Gwilym Eirwyn Jones]]''
|
| 1922-08-31
| 1994-02-12
| ''[[:d:Q7679437|Talgarreg]]''
|-
| style='text-align:right'| 7490
| ''[[:d:Q20733122|Gwilym Howell]]''
|
| 1705
| 1775-03-04
| ''[[:d:Q6661527|Llangurig]]''
|-
| style='text-align:right'| 7491
| ''[[:d:Q20733123|Gwilym Ieuan Williams]]''
|
| 1879-10-03
| 1968-02-01
| [[Cairdiff]]
|-
| style='text-align:right'| 7492
| ''[[:d:Q20733124|John Gwyn]]''
|
|
| 1574-06-01
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 7493
| ''[[:d:Q20733128|Gwynne Henton Davies]]''
|
| 1906
| 1998-10-22
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 7494
| ''[[:d:Q20733129|George Frederick Hamer]]''
|
| 1885
| 1965-02-03
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7495
| ''[[:d:Q20733132|John Dorney Harding]]''
|
| 1809
| 1868-11-24
| ''[[:d:Q6470937|Rockfield]]''
|-
| style='text-align:right'| 7496
| ''[[:d:Q20733135|John Harries]]''
|
| 1722
| 1788-03-07
| ''[[:d:Q4741541|Ambleston]]''
|-
| style='text-align:right'| 7497
| ''[[:d:Q20733137|Henry Bailey Hughes]]''
|
| 1833
| 1887-12-16
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 7498
| ''[[:d:Q20733139|Henry Charles]]''
|
| 1778
| 1840-12-26
| ''[[:d:Q4958467|Brawdy]]''
|-
| style='text-align:right'| 7499
| ''[[:d:Q20733141|Henry Davies]]''
|
| 1753
| 1825-05-09
| ''[[:d:Q6533801|Letterston]]''
|-
| style='text-align:right'| 7500
| ''[[:d:Q20733146|Henry Griffiths]]''
| [[File:Portrait of Henry Griffiths (4669768).jpg|center|128px]]
| 1812
| 1891-08-14
| [[St Davids]]
|-
| style='text-align:right'| 7501
| ''[[:d:Q20733149|Henry Hughes]]''
| [[File:Capel Soar Bryncir - geograph.org.uk - 603091.jpg|center|128px]]
| 1841-04-23
| 1924-08-13
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 7502
| ''[[:d:Q20733151|Henry Lloyd]]''
| [[File:ApHefin.jpg|center|128px]]
| 1870-06-23
| 1946-09-14
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7503
| ''[[:d:Q20733154|Henry Owen]]''
| [[File:Henry Owen (5449771).jpg|center|128px]]
| 1844-03-12
| 1919-04-14
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 7504
| ''[[:d:Q20733156|Henry Phillips]]''
|
| 1703
| 1783
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 7505
| ''[[:d:Q20733158|Henry Rees Davies]]''
|
| 1861-12-05
| 1940
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 7506
| ''[[:d:Q20733159|Henry Samuel Hayden]]''
|
| 1805
| 1860-07-25
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 7507
| ''[[:d:Q20733161|Henry Tobit Evans]]''
| [[File:Henry Tobit Evans.jpg|center|128px]]
| 1844
| 1908-05-09<br/>1908
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 7508
| ''[[:d:Q20733163|Henry, Or Harri Sion John]]''
|
| 1664
| 1754-09-20
| [[Blaenau Gwent]]
|-
| style='text-align:right'| 7509
| ''[[:d:Q20733167|Herbert Benjamin Winfield]]''
|
| 1879
| 1919-09-21
| [[Cairdiff]]
|-
| style='text-align:right'| 7510
| ''[[:d:Q20733168|Herbert Jenkins]]''
|
| 1721
| 1772-12-11
| ''[[:d:Q6947883|Mynyddislwyn]]''
|-
| style='text-align:right'| 7511
| ''[[:d:Q20733169|Herbert Morgan]]''
| [[File:The Rev. Herbert Morgan M.A (5349013).jpg|center|128px]]
| 1875-09-15
| 1946-09-22
| ''[[:d:Q7094142|Onllwyn]]''
|-
| style='text-align:right'| 7512
| ''[[:d:Q20733170|Herman Jones]]''
|
| 1915-01-24
| 1964-06-03
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 7513
| ''[[:d:Q20733178|Hopkin Bevan]]''
|
| 1765-05-04
| 1839-12-29
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 7514
| ''[[:d:Q20733179|Howel Davies]]''
|
| 1716
| 1770-01-13
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 7515
| ''[[:d:Q20733181|Howell Howells]]''
|
| 1750-05-12
| 1842-01-19
| [[Ystradgynlais]]
|-
| style='text-align:right'| 7516
| ''[[:d:Q20733182|Howell Powell]]''
|
|
| 1716
| ''[[:d:Q13129883|Maescar]]''
|-
| style='text-align:right'| 7517
| ''[[:d:Q20733184|Hugh Bulkeley]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7518
| ''[[:d:Q20733185|Hugh Carter]]''
|
| 1784-06-15
| 1855-09-08
| [[Wales]]
|-
| style='text-align:right'| 7519
| ''[[:d:Q20733186|Hugh Davies]]''
|
| 1844-09-01
| 1907
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 7520
| ''[[:d:Q20733189|Hugh Evans]]''
|
| 1790
| 1853-01-20
| ''[[:d:Q4899221|Betws Gwerfil Goch]]''
|-
| style='text-align:right'| 7521
| ''[[:d:Q20733192|Hugh Hughes]]''
|
| 1778
| 1855-12-17
| ''[[:d:Q1002782|Llannor]]''
|-
| style='text-align:right'| 7522
| ''[[:d:Q20733195|Hugh Jones]]''
| [[File:Parch Hugh Jones (EF).jpg|center|128px]]
| 1837-01-20
| 1919-05-23
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 7523
| ''[[:d:Q20733196|Hugh Jones]]''
| [[File:Portrait of Hugh Jones ('Erfyl') (4670306).jpg|center|128px]]
| 1789
| 1858-05-25
| ''[[:d:Q6661318|Llanerfyl]]''
|-
| style='text-align:right'| 7524
| ''[[:d:Q20733197|Hugh Jones]]''
|
| 1800
| 1872-03-05
| ''[[:d:Q5058745|Cemmaes]]''
|-
| style='text-align:right'| 7525
| ''[[:d:Q20733198|Hugh Maurice]]''
|
| 1775
| 1825-03-18
| ''[[:d:Q13129629|Llanfihangel Glyn Myfyr]]''
|-
| style='text-align:right'| 7526
| ''[[:d:Q20733199|Hugh Michael Hughes]]''
| [[File:Hugh Michael Hughes.tif|center|128px]]
| 1858-08-13
| 1933-01-15
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 7527
| ''[[:d:Q20733201|Hugh Owen of Gwenynog]]''
|
| 1575
| 1642
| ''[[:d:Q16033793|Llanfflewyn]]''
|-
| style='text-align:right'| 7528
| ''[[:d:Q20733203|Hugh Owen]]''
|
| 1832-01-15
| 1897-06-04
| ''[[:d:Q3398878|Botwnnog]]''
|-
| style='text-align:right'| 7529
| ''[[:d:Q20733204|Hugh Owen]]''
|
| 1880-05-08
| 1953-03-18
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 7530
| ''[[:d:Q20733205|Hugh Robert Hughes]]''
| [[File:Portrait of Hugh Robert Hughes (of Kinmel and Dinorben, Denbighshire) (4674698).jpg|center|128px]]
| 1827-06-06
| 1911-04-29
| ''[[:d:Q6413987|Kinmel Hall]]''
|-
| style='text-align:right'| 7531
| ''[[:d:Q20733206|Hugh Roberts]]''
|
| 1644
| 1702
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7532
| ''[[:d:Q20733208|Hugh Tudwal Davies]]''
| [[File:Hugh Tudwal Davies.jpg|center|128px]]
| 1847
| 1915
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 7533
| ''[[:d:Q20733209|Hugh William Jones]]''
|
| 1802-04-09
| 1873-06-01
| ''[[:d:Q7164577|Penrhyn-coch]]''
|-
| style='text-align:right'| 7534
| ''[[:d:Q20733211|Humphrey Bromley]]''
|
| 1796-05-17
| 1876-12-13
| [[Llanrhaeadr-ym-Mochnant]]
|-
| style='text-align:right'| 7535
| ''[[:d:Q20733213|Humphrey Edwards]]''
|
| 1730
| 1788-11-26
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 7536
| ''[[:d:Q20733214|Humphrey Gwalchmai]]''
|
| 1788
| 1847-03-29
| ''[[:d:Q29495708|Dolgar]]''
|-
| style='text-align:right'| 7537
| ''[[:d:Q20733215|Humphrey Jones]]''
| [[File:Humphrey Jones (Bryfdir).jpg|center|128px]]
| 1867-12-13
| 1947-01-22
| ''[[:d:Q3398987|Croesor]]''
|-
| style='text-align:right'| 7538
| ''[[:d:Q20733216|Humphrey Parry]]''
|
| 1772
| 1809-04
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 7539
| ''[[:d:Q20733217|Huw ap Dafydd]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7540
| ''[[:d:Q20733219|Huw ap Morus]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7541
| ''[[:d:Q20733220|Huw ap Rhisiart ap Dafydd]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 7542
| ''[[:d:Q20733222|Huw Arwystli]]''
|
| 1542
| 1578
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 7543
| ''[[:d:Q20733227|Huw Ellis]]''
|
| 1714
| 1774-08-05
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 7544
| ''[[:d:Q20733248|Hywel David Emanuel]]''
|
| 1921-05-14
| 1970
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 7545
| ''[[:d:Q20733249|Hywel Davies]]''
|
| 1919-02-02
| 1965-10-16
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7546
| ''[[:d:Q20733253|Idris Thomas]]''
|
| 1889
| 1962-06-14
| ''[[:d:Q5119940|Cilfynydd]]''
|-
| style='text-align:right'| 7547
| ''[[:d:Q20733254|Idwal Jones]]''
|
| 1899-12-31
| 1966-01-03
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 7548
| ''[[:d:Q20733255|Iestyn Rhys Williams]]''
|
| 1892
| 1955-08-26
| [[Cairdiff]]
|-
| style='text-align:right'| 7549
| ''[[:d:Q20733268|Ieuan Brechfa]]''
|
| 1430
| 1500
| ''[[:d:Q4959999|Brechfa]]''
|-
| style='text-align:right'| 7550
| ''[[:d:Q20733278|Ieuan Samuel Jones]]''
|
| 1918-09-16
| 2004-10-23
| ''[[:d:Q17743639|Felin Geri]]''
|-
| style='text-align:right'| 7551
| ''[[:d:Q20733282|Ifan Gruffudd]]''
|
| 1655
| 1734
| ''[[:d:Q13132036|Troedyraur]]''
|-
| style='text-align:right'| 7552
| ''[[:d:Q20733286|Ifor Thomas]]''
|
| 1877-11-24
| 1918-03-30
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 7553
| ''[[:d:Q20733290|Isaac James]]''
|
| 1766
| 1840-04-14
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 7554
| ''[[:d:Q20733291|Isaac Jenkins]]''
| [[File:Portrait of Isaac Jenkins (4672921).jpg|center|128px]]
| 1812-02-25
| 1877-08-25
| ''[[:d:Q3398476|Aberffrwd]]''
|-
| style='text-align:right'| 7555
| ''[[:d:Q20733293|Isaac Samuel Lloyd]]''
|
| 1875-06-29
| 1961-07-07
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7556
| ''[[:d:Q20733294|Ishmael Jones]]''
| [[File:Portrait of Revd. Ishmael Jones (4672932).jpg|center|128px]]
| 1794
| 1876-09-09
| ''[[:d:Q7227631|Ponciau]]''
|-
| style='text-align:right'| 7557
| ''[[:d:Q20733295|Ivor Bowen]]''
|
| 1862
| 1934-01-08<br/>1934
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 7558
| ''[[:d:Q20733296|Ivor James]]''
|
| 1840
| 1909-04-13
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 7559
| ''[[:d:Q20733297|Jabez Edmund Jenkins]]''
|
| 1840-12-24
| 1903-06-04
| ''[[:d:Q6947883|Mynyddislwyn]]''
|-
| style='text-align:right'| 7560
| ''[[:d:Q20733303|James Bilsland Hughes]]''
|
| 1831-02-23
| 1878
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 7561
| ''[[:d:Q20733306|James Conway Brown]]''
|
| 1838-12-27
| 1908-04-26
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 7562
| ''[[:d:Q20733309|James Davies]]''
| [[File:Portrait of James Davies (4674063).jpg|center|128px]]
| 1765-08-23
| 1849-10-02
| ''[[:d:Q731439|Grosmont]]''
|-
| style='text-align:right'| 7563
| ''[[:d:Q20733310|James Davies]]''
|
| 1648
| 1722-09-24
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7564
| ''[[:d:Q20733311|James Davies]]''
|
| 1800
| 1869-04-16
| ''[[:d:Q7162285|Pencader]]''<br/>[[Wales]]
|-
| style='text-align:right'| 7565
| ''[[:d:Q20733314|James Evan]]''
|
| 1814-06-28
| 1842-06-05
| ''[[:d:Q4958467|Brawdy]]''
|-
| style='text-align:right'| 7566
| ''[[:d:Q20733315|James Evans]]''
|
| 1866-04-16
| 1931-08-01
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 7567
| ''[[:d:Q20733316|James Griffiths]]''
|
| 1782-08-02
| 1858-04-11
| ''[[:d:Q6809972|Meidrim]]''
|-
| style='text-align:right'| 7568
| ''[[:d:Q20733318|James Henry Howard]]''
|
| 1876-11-03
| 1947-07-07
| [[Swansea]]
|-
| style='text-align:right'| 7569
| ''[[:d:Q20733319|James Ifano Jones]]''
| [[File:Ifano Jones.jpg|center|128px]]
| 1865-05-15
| 1955-03-07
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 7570
| ''[[:d:Q20733321|James James]]''
|
| 1760-11-24
| 1831-04-10
| ''[[:d:Q4667057|Aberedw]]''
|-
| style='text-align:right'| 7571
| ''[[:d:Q20733322|James Jardine]]''
|
|
| 1737
| ''[[:d:Q6661117|Llanboidy]]''
|-
| style='text-align:right'| 7572
| ''[[:d:Q20733325|James Lewis]]''
|
| 1674
| 1747-05-31
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7573
| ''[[:d:Q20733326|James Mansel John]]''
|
| 1910-04-22
| 1975-01-19
| ''[[:d:Q7837453|Trecynon]]''
|-
| style='text-align:right'| 7574
| ''[[:d:Q20733328|James Morgan Gibbon]]''
|
| 1855
| 1932-04-01<br/>1932-03-14
| ''[[:d:Q4666839|Abercych]]''
|-
| style='text-align:right'| 7575
| ''[[:d:Q20733329|James Morris]]''
|
| 1853
| 1914-11-08
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 7576
| ''[[:d:Q20733330|James Nicholas]]''
|
| 1877-01-12
| 1963-07-10
| ''[[:d:Q264304|Cwmfelin Mynach]]''
|-
| style='text-align:right'| 7577
| ''[[:d:Q20733334|James Rees]]''
|
| 1803
| 1880-06-21
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7578
| ''[[:d:Q20733335|James Thomas Evans]]''
|
| 1878-03-01
| 1950-02-28
| ''[[:d:Q4666838|Abercwmboi]]''
|-
| style='text-align:right'| 7579
| ''[[:d:Q20733338|Jehoiada Hodges]]''
|
| 1877
| 1930-09-13
| [[Newport]]
|-
| style='text-align:right'| 7580
| ''[[:d:Q20733339|Jenkin Davies]]''
|
| 1798-06-24
| 1842-08-10
| ''[[:d:Q13129613|Llandysiliogogo]]''
|-
| style='text-align:right'| 7581
| ''[[:d:Q20733340|Jenkin Evans]]''
|
| 1674
| 1709-08-19
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 7582
| ''[[:d:Q20733341|Jenkin Howell]]''
|
| 1836
| 1902-06-14
| ''[[:d:Q13130671|Penderyn]]''
|-
| style='text-align:right'| 7583
| ''[[:d:Q20733342|Jenkin Lewis]]''
|
| 1760-08-12
| 1831-08-11
| ''[[:d:Q3401140|Gelligaer]]''
|-
| style='text-align:right'| 7584
| ''[[:d:Q20733346|Jethro Gough]]''
|
| 1903-12-29
| 1979-02-16
| ''[[:d:Q17715131|Llanwonno]]''
|-
| style='text-align:right'| 7585
| ''[[:d:Q20733347|Job David]]''
|
| 1746
| 1812-10-11
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 7586
| ''[[:d:Q20733348|John Emlyn Jones]]''
| [[File:Revd John Emlyn Jones (Ioan Emlyn, 1820-73) NLW3364395.jpg|center|128px]]
| 1818
| 1873-01
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 7587
| ''[[:d:Q20733349|John Abel]]''
|
| 1770
| 1819-06-25
| ''[[:d:Q13129595|Llan-y-bri]]''
|-
| style='text-align:right'| 7588
| ''[[:d:Q20733350|John Arthur Sandbrook]]''
|
| 1876-05-03
| 1942-02-13
| [[Swansea]]
|-
| style='text-align:right'| 7589
| ''[[:d:Q20733351|John Ashton]]''
|
| 1830
| 1896-12-24
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 7590
| ''[[:d:Q20733353|John Bancroft Willans]]''
|
| 1881-05-27
| 1957-04-12
| ''[[:d:Q17738677|Dolforgan Hall]]''
|-
| style='text-align:right'| 7591
| ''[[:d:Q20733355|John Bickerton Morgan]]''
|
| 1859-06-26
| 1894-03-08
| [[Welshpool]]
|-
| style='text-align:right'| 7592
| ''[[:d:Q20733356|John Bird]]''
|
| 1768
| 1829<br/>1829-02-05
| [[Cairdiff]]
|-
| style='text-align:right'| 7593
| ''[[:d:Q20733357|John Breese]]''
|
| 1789-09
| 1842-08-08
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 7594
| ''[[:d:Q20733358|John Bryan]]''
| [[File:Portrait of John Bryan (4671299) (cropped).jpg|center|128px]]
| 1775
| 1856-05-28
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 7595
| ''[[:d:Q20733359|John Bryant]]''
|
| 1832-02-01
| 1926
| ''[[:d:Q5049689|Castellau]]''
|-
| style='text-align:right'| 7596
| ''[[:d:Q20733361|John Ceredig Evans]]''
|
| 1855-03
| 1936-05-22
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 7597
| ''[[:d:Q20733362|John Daniel]]''
|
| 1755
| 1823-01-10
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 7598
| ''[[:d:Q20733363|John David]]''
|
| 1701
| 1756-07-22
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 7599
| ''[[:d:Q20733364|John David Davies]]''
|
| 1831-01-14
| 1911-09-30
| ''[[:d:Q645198|Oxwich]]''
|-
| style='text-align:right'| 7600
| ''[[:d:Q20733365|John David Rheinallt Jones]]''
|
| 1884-07-05
| 1953-12-05
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 7601
| ''[[:d:Q20733367|John Davies]]''
|
| 1750
| 1821-12-24
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 7602
| ''[[:d:Q20733368|John Davies]]''
|
| 1652
| 1716
| ''[[:d:Q13131036|Rhiwlas]]''
|-
| style='text-align:right'| 7603
| ''[[:d:Q20733370|John Davies]]''
|
| 1737
| 1821-12-04
| ''[[:d:Q6661636|Llanllawddog]]''
|-
| style='text-align:right'| 7604
| ''[[:d:Q20733371|John Davies]]''
| [[File:Rev. John Davies.jpg|center|128px]]
| 1760
| 1843-06-10
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 7605
| ''[[:d:Q20733372|John Davies]]''
|
| 1772-07-11
| 1855-08-19
| ''[[:d:Q10989923|Llanfihangel-yng-Ngwynfa]]''
|-
| style='text-align:right'| 7606
| ''[[:d:Q20733374|John Davies]]''
|
| 1787-11-13
| 1855-04-27
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 7607
| ''[[:d:Q20733377|John Davies]]''
|
| 1795-12
| 1861-10-21
| ''[[:d:Q922270|Llanddewi Brefi]]''
|-
| style='text-align:right'| 7608
| ''[[:d:Q20733378|John Davies]]''
|
| 1803-05-10
| 1854-09-06
| ''[[:d:Q7837402|Treboeth]]''
|-
| style='text-align:right'| 7609
| ''[[:d:Q20733379|John Davies]]''
| [[File:Reverend John Davies, Cardiff, 1823-1874.jpg|center|128px]]
| 1823-05-01
| 1874-05-08
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 7610
| ''[[:d:Q20733380|John Davies]]''
|
| 1843
| 1917-02-06
| ''[[:d:Q6947263|Myddfai]]''
|-
| style='text-align:right'| 7611
| ''[[:d:Q20733381|John Davies]]''
|
| 1860-08-07
| 1939-06-23
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7612
| ''[[:d:Q20733382|John Davies]]''
|
| 1868-10-23
| 1940-03-15
| ''[[:d:Q4899223|Betws yn Rhos]]''
|-
| style='text-align:right'| 7613
| ''[[:d:Q20733386|John Davies]]''
| [[File:John Davies (Gwyneddon).jpg|center|128px]]
| 1832
| 1904-01-30
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7614
| ''[[:d:Q20733388|John Davies]]''
| [[File:John Davies (Taliesin Hiraethog, 1841-94) NLW3364595.jpg|center|128px]]
| 1841-10-02
| 1894-03-20
| ''[[:d:Q5064823|Cerrigydrudion]]''
|-
| style='text-align:right'| 7615
| ''[[:d:Q20733390|John Edward Jones]]''
|
| 1801-07-07
| 1866-02-25
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7616
| ''[[:d:Q20733394|John Edward Tomley]]''
|
| 1874-02-03
| 1951-06-14
| ''[[:d:Q1311946|Trefaldwyn]]''
|-
| style='text-align:right'| 7617
| ''[[:d:Q20733395|John Edwards]]''
|
| 1755-09-08
| 1823-11-19
| ''[[:d:Q29483994|Ereiniog]]''
|-
| style='text-align:right'| 7618
| ''[[:d:Q20733398|John Edwards]]''
|
| 1799
| 1873
| ''[[:d:Q6661743|Llansadwrn]]''
|-
| style='text-align:right'| 7619
| ''[[:d:Q20733402|John Edwards Griffith]]''
|
| 1843-06-18
| 1933-07-04
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7620
| ''[[:d:Q20733403|John Elias Davies]]''
|
| 1847-03-20
| 1883-01-25
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 7621
| ''[[:d:Q20733404|John Ellis]]''
|
| 1760
| 1839-01-31
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 7622
| ''[[:d:Q20733405|John Ellis Meredith]]''
|
| 1904-08-07
| 1981-04-16
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 7623
| ''[[:d:Q20733406|John Emrys Evans]]''
|
| 1853-08-18
| 1931-11-26
| ''[[:d:Q82523917|Bron-y-Berllan]]''
|-
| style='text-align:right'| 7624
| ''[[:d:Q20733407|John Evan Davies]]''
|
| 1850
| 1929-10-19
| [[Wales]]
|-
| style='text-align:right'| 7625
| ''[[:d:Q20733408|John Evan Hughes]]''
|
| 1865
| 1932
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 7626
| ''[[:d:Q20733410|John Evans]]''
|
| 1737
| 1784-03
| ''[[:d:Q13127117|Cil-y-cwm]]''
|-
| style='text-align:right'| 7627
| ''[[:d:Q20733414|John Evans]]''
| [[File:Mr John Evans, Bala.jpg|center|128px]]
| 1723-10-30
| 1817-08-12
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 7628
| ''[[:d:Q20733416|John Evans]]''
|
| 1770
| 1851-03-31
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 7629
| ''[[:d:Q20733417|John Evans]]''
| [[File:John Evans, Aberystwyth (5348990).jpg|center|128px]]
| 1796-02-07
| 1861-04-02
| ''[[:d:Q10963324|Blaenplwyf]]''
|-
| style='text-align:right'| 7630
| ''[[:d:Q20733418|John Evans]]''
| [[File:John Evans, Abermeurig.jpg|center|128px]]
| 1830-11-20
| 1917-01-24
| ''[[:d:Q15987294|Pennant]]''
|-
| style='text-align:right'| 7631
| ''[[:d:Q20733419|John Evans Jones]]''
| [[File:Evans Jones, Yr Herald.jpg|center|128px]]
| 1839
| 1893-06
| ''[[:d:Q3401133|Bagillt]]''
|-
| style='text-align:right'| 7632
| ''[[:d:Q20733420|John Fisher]]''
|
| 1862-01-05
| 1930-05-09
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 7633
| ''[[:d:Q20733421|John Foulkes Jones]]''
|
| 1826-06-06
| 1880-04-14
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 7634
| ''[[:d:Q20733422|John Francis]]''
|
| 1789-03-20
| 1843-08-19
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 7635
| ''[[:d:Q20733426|John Griffith]]''
|
| 1863-04-18
| 1933-11-06
| ''[[:d:Q3395308|Y Rhiw]]''
|-
| style='text-align:right'| 7636
| ''[[:d:Q20733427|John Griffith Davies]]''
|
| 1836
| 1861-03-14
| ''[[:d:Q1996667|Whitland]]''
|-
| style='text-align:right'| 7637
| ''[[:d:Q20733430|John Gwynoro Davies]]''
| [[File:John Gwynoro Davies.jpg|center|128px]]
| 1855-02-28
| 1935-03-23
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 7638
| ''[[:d:Q20733434|John Harris Jones]]''
| [[File:Portrait of Y Parchedig John Harris Jones, M.A., Ph.D (4670334).jpg|center|128px]]
| 1827-08-28
| 1885
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 7639
| ''[[:d:Q20733437|John Henry]]''
|
| 1859
| 1914-01-14
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 7640
| ''[[:d:Q20733439|John Henry Hughes]]''
|
| 1814-10-11
| 1893-03-07
| ''[[:d:Q3402021|Llaniestyn]]''
|-
| style='text-align:right'| 7641
| ''[[:d:Q20733441|John Herbert Jones]]''
|
| 1860-05-29
| 1943-03-23
| ''[[:d:Q7680325|Talsarnau]]''
|-
| style='text-align:right'| 7642
| ''[[:d:Q20733444|John Herring]]''
|
| 1789-02-08
| 1832-04-02
| ''[[:d:Q11138230|Trallwn]]''
|-
| style='text-align:right'| 7643
| ''[[:d:Q20733450|John Hughes]]''
| [[File:Portrait of Y Parchg. John Hughes, Pont Robert (4670916).jpg|center|128px]]
| 1775-02-22
| 1854-08-03
| ''[[:d:Q10989923|Llanfihangel-yng-Ngwynfa]]''
|-
| style='text-align:right'| 7644
| ''[[:d:Q20733455|John Hughes]]''
| [[File:Portrait of John Hughes (4670278) (cropped).jpg|center|128px]]
| 1827-09-27
| 1893-10-22
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 7645
| ''[[:d:Q20733459|John Humphreys]]''
|
| 1767
| 1829-04
| ''[[:d:Q11008013|Bodfari]]''
|-
| style='text-align:right'| 7646
| ''[[:d:Q20733461|John Idris Davies]]''
|
| 1821
| 1889-01-13
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7647
| ''[[:d:Q20733465|John James]]''
| [[File:Portrait of John James (4673313).jpg|center|128px]]
| 1777-08-29
| 1848-01-30
| [[Aberystwyth]]
|-
| style='text-align:right'| 7648
| ''[[:d:Q20733467|John James]]''
|
| 1779-02-17
| 1864-09-01
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 7649
| ''[[:d:Q20733473|John Jeffreys]]''
|
| 1718
| 1798
| ''[[:d:Q13129677|Llanynys]]''
|-
| style='text-align:right'| 7650
| ''[[:d:Q20733475|John Jenkins]]''
|
| 1656
| 1733-07-03
| ''[[:d:Q5120043|Cilymaenllwyd]]''
|-
| style='text-align:right'| 7651
| ''[[:d:Q20733478|John Jenkins]]''
|
| 1779-11-28
| 1853-06-05
| ''[[:d:Q6661562|Llangynidr]]''
|-
| style='text-align:right'| 7652
| ''[[:d:Q20733480|John Jenkins]]''
|
| 1808-08-21
| 1884-10-14
| [[Swansea]]
|-
| style='text-align:right'| 7653
| ''[[:d:Q20733482|John Jenkins]]''
|
| 1821-11-21
| 1896-02-22
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7654
| ''[[:d:Q20733484|John Jeremy]]''
|
| 1782-10-28
| 1860-11-15
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7655
| ''[[:d:Q20733486|John John Evans]]''
|
| 1862-12-09
| 1942-04-22
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7656
| ''[[:d:Q20733488|John Johnes]]''
| [[File:Portrait of John Johnes (4673754).jpg|center|128px]]
| 1800-04-06
| 1876-08-19
| ''[[:d:Q5288871|Dolaucothi Estate]]''
|-
| style='text-align:right'| 7657
| ''[[:d:Q20733492|John Jones]]''
|
| 1650-06-02
| 1727-10-27
| ''[[:d:Q17742605|Plas Gwyn]]''
|-
| style='text-align:right'| 7658
| ''[[:d:Q20733494|John Jones]]''
|
| 1731-08-21
| 1813-02-04
| ''[[:d:Q20593921|Llanfaredd]]''
|-
| style='text-align:right'| 7659
| ''[[:d:Q20733496|John Jones]]''
|
| 1761
| 1822-08-09
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 7660
| ''[[:d:Q20733498|John Jones]]''
|
| 1776-09
| 1857-01-30
| ''[[:d:Q13130691|Penmorfa]]''
|-
| style='text-align:right'| 7661
| ''[[:d:Q20733500|John Jones]]''
| [[File:Mr John Jones, L'pool. printer, preacher.jpg|center|128px]]
| 1790-09-29
| 1855-01-08
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 7662
| ''[[:d:Q20733502|John Jones]]''
|
| 1801-04-10
| 1856-11-19
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 7663
| ''[[:d:Q20733504|John Jones]]''
|
| 1802-07-20
| 1863-12-19
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 7664
| ''[[:d:Q20733506|John Jones]]''
|
| 1807-08-13
| 1875-12-20
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 7665
| ''[[:d:Q20733508|John Jones]]''
| [[File:Revd. John Jones, Blaenannerch (1807-1875) NLW3362409.jpg|center|128px]]
| 1807-10-04
| 1875-01-14
| ''[[:d:Q3401679|Llangoedmor]]''
|-
| style='text-align:right'| 7666
| ''[[:d:Q20733510|John Jones]]''
|
| 1820-05-10
| 1907-03-01
| ''[[:d:Q29488174|Lower Trelowgoed]]''
|-
| style='text-align:right'| 7667
| ''[[:d:Q20733513|John Jones]]''
| [[File:Reverend Dr John Cynddylan Jones (1841–1930) (gcf10082).jpg|center|128px]]
| 1840-02-26
| 1930-06-15
| ''[[:d:Q5035231|Capel Dewi]]''
|-
| style='text-align:right'| 7668
| ''[[:d:Q20733516|John Jones]]''
|
| 1800
| 1826-07-09
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 7669
| ''[[:d:Q20733518|John Jones]]''
| [[File:Revd John Jones (Humilis, 1818-69) NLW3361063.jpg|center|128px]]
| 1818
| 1869-03-13
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 7670
| ''[[:d:Q20733520|John Jones]]''
|
| 1820-05-10
| 1898-09-06
| ''[[:d:Q15987532|Mynydd Bach]]''
|-
| style='text-align:right'| 7671
| ''[[:d:Q20733522|John Jones]]''
| [[File:Revd John Jones (Vulcan, 1825-89) NLW3363082.jpg|center|128px]]
| 1825-12-26
| 1889-12-17
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 7672
| ''[[:d:Q20733525|John Jones]]''
|
| 1831-10-16
| 1899-05-29
| ''[[:d:Q7678684|Tal-y-llyn]]''
|-
| style='text-align:right'| 7673
| ''[[:d:Q20733527|John Jones]]''
|
| 1850-04-07
| 1926-10-24
| ''[[:d:Q3404757|Llangoed]]''
|-
| style='text-align:right'| 7674
| ''[[:d:Q20733529|John Jones]]''
|
| 1868-06-10
| 1940-11-16
| ''[[:d:Q10989811|Llanfrothen]]''
|-
| style='text-align:right'| 7675
| ''[[:d:Q20733539|John Lewis]]''
|
| 1793-01-23
| 1816-07-17
| ''[[:d:Q15987581|Talsarn]]''
|-
| style='text-align:right'| 7676
| ''[[:d:Q20733541|John Lewis]]''
|
| 1844
| 1914-07-11
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7677
| ''[[:d:Q20733543|John Lewis]]''
|
| 1836-04-06
| 1892-11-02
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 7678
| ''[[:d:Q20733549|John Lloyd]]''
|
| 1792
| 1834-08-03
| ''[[:d:Q5057359|Ceidio]]''
|-
| style='text-align:right'| 7679
| ''[[:d:Q20733551|John Lloyd Davies]]''
|
| 1801-11-01
| 1860-03-21
| [[Aberystwyth]]
|-
| style='text-align:right'| 7680
| ''[[:d:Q20733553|John Lloyd James]]''
|
| 1835
| 1919-04-17
| ''[[:d:Q6661429|Llangan]]''
|-
| style='text-align:right'| 7681
| ''[[:d:Q20733555|John Luther Thomas]]''
|
| 1881-04-23
| 1970-02-04
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7682
| ''[[:d:Q20733557|John Matthews]]''
| [[File:Portrait of John Matthews Esq. (4670402).jpg|center|128px]]
| 1773-01-01
| 1848-01-09
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 7683
| ''[[:d:Q20733561|John Morgan]]''
|
| 1743
| 1801
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 7684
| ''[[:d:Q20733563|John Morgan]]''
|
| 1827-03-22
| 1903-05-23
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 7685
| ''[[:d:Q20733565|John Morgan Jones]]''
| [[File:Parchedig John Morgan Jones (1838–1921), Caerdydd (gcf06911).jpg|center|128px]]
| 1838-07-15
| 1921-05-22
| ''[[:d:Q922270|Llanddewi Brefi]]''
|-
| style='text-align:right'| 7686
| ''[[:d:Q20733566|John Morgan Jones]]''
|
| 1861-03-26
| 1935-07-22
| ''[[:d:Q6759079|Margam]]''
|-
| style='text-align:right'| 7687
| ''[[:d:Q20733569|John Morgan Jones]]''
|
| 1873-10-23
| 1946-03-07
| ''[[:d:Q5197221|Cwmamman]]''
|-
| style='text-align:right'| 7688
| ''[[:d:Q20733571|John Morris]]''
| [[File:Rev John Morris, DD, 1813-96.jpg|center|128px]]
| 1813
| 1896-11-27
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7689
| ''[[:d:Q20733577|John Oliver Stephens]]''
|
| 1880-05-12
| 1957-03-10
| ''[[:d:Q13131775|Tegryn]]''
|-
| style='text-align:right'| 7690
| ''[[:d:Q20733579|John Ossian Davies]]''
| [[File:J Ossian Davies.jpg|center|128px]]
| 1851-11-10
| 1916-09-24
| ''[[:d:Q15987524|Pen-dre]]''
|-
| style='text-align:right'| 7691
| ''[[:d:Q20733581|John Owen]]''
|
|
| 1759-07<br/>1759
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 7692
| ''[[:d:Q20733584|John Owen]]''
|
| 1733
| 1776-08-08
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 7693
| ''[[:d:Q20733586|John Owen]]''
|
| 1757
| 1829
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 7694
| ''[[:d:Q20733588|John Owen]]''
|
| 1788
| 1867-07-31
| ''[[:d:Q6661375|Llanfihangel Ystrad]]''
|-
| style='text-align:right'| 7695
| ''[[:d:Q20733590|John Owen]]''
|
| 1833
| 1896-02-06
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 7696
| ''[[:d:Q20733593|John Owen]]''
|
| 1836-04-01
| 1915-10-01
| ''[[:d:Q5348103|Eglwyswrw]]''
|-
| style='text-align:right'| 7697
| ''[[:d:Q20733596|John Owen Jones]]''
|
| 1857-01-11
| 1917-03-06
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 7698
| ''[[:d:Q20733598|John Owen Jones]]''
|
| 1884-02-07
| 1972-03-24
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 7699
| ''[[:d:Q20733602|John Park Davies]]''
|
| 1879-05-28
| 1937-05-21
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7700
| ''[[:d:Q20733605|John Parry]]''
|
| 1835-07-24
| 1897-06-03
| ''[[:d:Q6661071|Llanarmon-yn-Iâl]]''
|-
| style='text-align:right'| 7701
| ''[[:d:Q20733613|John Prichard]]''
| [[File:Portrait of John Prichard (4672994) (cropped).jpg|center|128px]]
| 1821
| 1889-10-18
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 7702
| ''[[:d:Q20733615|John Propert]]''
| [[File:John Propert. Photograph, 1855 (?). Wellcome V0027046.jpg|center|128px]]
| 1793-07-19
| 1867-09-08
| ''[[:d:Q3401679|Llangoedmor]]''
|-
| style='text-align:right'| 7703
| ''[[:d:Q20733619|John Pryse]]''
|
| 1826
| 1883-10-19
| ''[[:d:Q6661212|Llandinam]]''
|-
| style='text-align:right'| 7704
| ''[[:d:Q20733624|John Rees]]''
| [[File:Portrait of The Revd. John Rees (4669902).jpg|center|128px]]
| 1770-04-20
| 1833-01-06
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7705
| ''[[:d:Q20733630|John Richard Hughes]]''
|
| 1828
| 1893
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 7706
| ''[[:d:Q20733636|John Richards Evans]]''
|
| 1882-01-10
| 1969-02-10
| [[Penygraig]]
|-
| style='text-align:right'| 7707
| ''[[:d:Q20733640|John Robert Jones]]''
|
| 1800
| 1881-05-11
| ''[[:d:Q6661071|Llanarmon-yn-Iâl]]''
|-
| style='text-align:right'| 7708
| ''[[:d:Q20733645|John Roberts]]''
| [[File:Portrait of John Roberts (4671886).jpg|center|128px]]
| 1806
| 1879-11-18
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7709
| ''[[:d:Q20733649|John Roberts]]''
| [[File:John Roberts (1842 - 1908).jpg|center|128px]]
| 1842-02-16
| 1908
| ''[[:d:Q5173016|Corris Uchaf]]''
|-
| style='text-align:right'| 7710
| ''[[:d:Q20733655|John Rowland Thomas]]''
|
| 1881-03-02
| 1965-04-16
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 7711
| ''[[:d:Q20733659|John Stuart Corbett]]''
|
| 1845-05-16
| 1921-03-09
| ''[[:d:Q3398355|Llanbradach]]''
|-
| style='text-align:right'| 7712
| ''[[:d:Q20733661|John Thomas]]''
|
| 1646
| 1695-11-04
| ''[[:d:Q13130689|Pennant Melangell]]''
|-
| style='text-align:right'| 7713
| ''[[:d:Q20733665|John Thomas]]''
|
| 1730
| 1804
| ''[[:d:Q6947263|Myddfai]]''
|-
| style='text-align:right'| 7714
| ''[[:d:Q20733667|John Thomas]]''
|
| 1757
| 1835-01-02
| ''[[:d:Q1002782|Llannor]]''
|-
| style='text-align:right'| 7715
| ''[[:d:Q20733671|John Thomas]]''
|
| 1857-06-25
| 1944-09-20
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 7716
| ''[[:d:Q20733675|John Thomas Griffiths]]''
|
| 1824-12-25
| 1895-02-18
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 7717
| ''[[:d:Q20733678|John William Hughes]]''
|
| 1817
| 1849-04
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 7718
| ''[[:d:Q20733679|John William Jones]]''
|
| 1827-01-11
| 1884-10-08
| ''[[:d:Q3398834|Llanaelhaearn]]''
|-
| style='text-align:right'| 7719
| ''[[:d:Q20733681|John Williams]]''
|
| 1762
| 1823-12-28
| ''[[:d:Q6809972|Meidrim]]''
|-
| style='text-align:right'| 7720
| ''[[:d:Q20733691|Jonathan Jones]]''
|
| 1745
| 1832-02-18
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 7721
| ''[[:d:Q20733693|Jonathan Powell]]''
|
| 1764
| 1823
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 7722
| ''[[:d:Q20733709|Joseph E. Davies]]''
|
| 1810-12-12
| 1881-01-01
| ''[[:d:Q6661077|Llanarthney]]''
|-
| style='text-align:right'| 7723
| ''[[:d:Q20733716|Joseph Evans]]''
|
| 1832-07-31
| 1909-05-09
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 7724
| ''[[:d:Q20733718|Joseph Hughes]]''
|
| 1803-04-10
| 1863-11-08
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 7725
| ''[[:d:Q20733722|Joseph Jenkins]]''
|
| 1859
| 1929-04-27
| ''[[:d:Q5197262|Cwmystwyth]]''
|-
| style='text-align:right'| 7726
| ''[[:d:Q20733724|Joseph Jenkins]]''
|
| 1886-11-04
| 1962-04-21
| ''[[:d:Q3397975|Pont-rhyd-y-groes]]''
|-
| style='text-align:right'| 7727
| ''[[:d:Q20733726|Joseph Jones]]''
|
| 1787
| 1856-03-23
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 7728
| ''[[:d:Q20733728|Joseph Jones]]''
|
| 1877-08-07
| 1950-04-28
| ''[[:d:Q7321606|Rhydlewis]]''
|-
| style='text-align:right'| 7729
| ''[[:d:Q20733730|Joseph Rhys Lewis]]''
|
| 1860-06-15
| 1920
| ''[[:d:Q13130671|Penderyn]]''
|-
| style='text-align:right'| 7730
| ''[[:d:Q20733737|Joseph Tudor Hughes]]''
| [[File:Portrait of Master Hughes and his brothers (4672622).jpg|center|128px]]
| 1827-10-27
| 1841-05-12
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7731
| ''[[:d:Q20733739|Joseph William Thomas]]''
|
| 1846-03-09
| 1914-03-03
| ''[[:d:Q7165413|Penylan]]''
|-
| style='text-align:right'| 7732
| ''[[:d:Q20733750|Josiah Jones]]''
| [[File:Josiah Jones.jpg|center|128px]]
| 1830-07-02
| 1915-04-27
| ''[[:d:Q20598147|Cwm-cou]]''
|-
| style='text-align:right'| 7733
| ''[[:d:Q20733752|Judith Godwin]]''
|
|
| 1746-01-25
| [[Wales]]
|-
| style='text-align:right'| 7734
| ''[[:d:Q20733758|Leonard Owen]]''
|
| 1890-10-01
| 1965-11-04
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7735
| ''[[:d:Q20733766|Henry Lewis]]''
|
| 1847
| 1923-11-16
| ''[[:d:Q20594352|Llanwenllwyfo]]''
|-
| style='text-align:right'| 7736
| ''[[:d:Q20733774|Lewis Davies Jones]]''
| [[File:Llew Tegid.jpg|center|128px]]
| 1851-11-03
| 1928-08-04
| ''[[:d:Q13129650|Llangywer]]''
|-
| style='text-align:right'| 7737
| ''[[:d:Q20733776|Lewis Ellis]]''
|
| 1761
| 1823-03-25
| ''[[:d:Q6661743|Llansadwrn]]''
|-
| style='text-align:right'| 7738
| ''[[:d:Q20733785|Lewis Jones]]''
|
| 1702
| 1772-01-08
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 7739
| ''[[:d:Q20733789|Lewis Jones]]''
|
| 1808
| 1854-03-29
| ''[[:d:Q3400119|Llanfihangel-y-Pennant]]''
|-
| style='text-align:right'| 7740
| ''[[:d:Q20733791|Lewis Jones]]''
|
| 1835-06-15
| 1915-04-19
| [[Llanfwrog, Denbighshire|Llanfwrog]]
|-
| style='text-align:right'| 7741
| ''[[:d:Q20733795|Lewis Loyd]]''
| [[File:Eden Upton Eddis (1812-1901) - Lewis Lloyd (1767–1858) - No.5 - Harris Manchester College.jpg|center|128px]]
| 1767-01-01
| 1858-05-13
| ''[[:d:Q6661893|Llanwrda]]''
|-
| style='text-align:right'| 7742
| ''[[:d:Q20733797|Lewis Morris]]''
|
| 1760-06-02
| 1855-03-11
| ''[[:d:Q6661464|Llangelynnin]]''
|-
| style='text-align:right'| 7743
| ''[[:d:Q20733801|Lewis Rees]]''
|
| 1710-03-02
| 1800-03-21
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 7744
| ''[[:d:Q20733807|Lewis Thomas]]''
|
| 1877-05-30
| 1955-05-16
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 7745
| ''[[:d:Q20733815|Lleision ap Thomas]]''
|
| 1513
| 1541
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 7746
| ''[[:d:Q20733819|Llewelyn David Howell]]''
|
| 1812
| 1864-07-13
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7747
| ''[[:d:Q20733821|Llewelyn Jenkins]]''
|
| 1810
| 1878-09-19
| No/unknown value<br/>''[[:d:Q3401108|Hengoed]]''
|-
| style='text-align:right'| 7748
| ''[[:d:Q20733837|Margaret Lloyd]]''
|
| 1709-05-27
| 1762-09-08
| ''[[:d:Q6661592|Llangystennin]]''
|-
| style='text-align:right'| 7749
| ''[[:d:Q20733839|Robert Lloyd]]''
|
| 1716
| 1792-09-12
| ''[[:d:Q5119934|Cilcain]]''
|-
| style='text-align:right'| 7750
| ''[[:d:Q20733843|William Lloyd]]''
|
| 1741
| 1808-04-17
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 7751
| ''[[:d:Q20733869|John Lynn-Thomas]]''
|
| 1861-09-10
| 1939-09-21
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7752
| ''[[:d:Q20733879|Mary Anne Edmunds]]''
| [[File:Yr athrawes o ddifrif (page 6 crop).jpg|center|128px]]
| 1813-04-25
| 1858-03-22
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7753
| ''[[:d:Q20733881|Mary Davies]]''
| [[File:Mair-Eifion.jpg|center|128px]]
| 1846-10-17
| 1882-10-08
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 7754
| ''[[:d:Q20733889|Mathew Lewis]]''
|
| 1817
| 1860
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7755
| ''[[:d:Q20733895|Mathias Maurice]]''
|
| 1684
| 1738
| ''[[:d:Q6661158|Llanddewi Velfrey]]''
|-
| style='text-align:right'| 7756
| ''[[:d:Q20733899|Matthew Williams]]''
|
| 1760
| 1801
| [[Welshpool]]
|-
| style='text-align:right'| 7757
| ''[[:d:Q20733901|Maurice Evans]]''
|
| 1765
| 1831-12-24
| ''[[:d:Q6661551|Llangwyryfon]]''
|-
| style='text-align:right'| 7758
| ''[[:d:Q20733903|Megan Watts Hughes]]''
|
| 1842-02-12
| 1907-10-29
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 7759
| ''[[:d:Q20733905|Meirion Williams]]''
|
| 1901-07-19
| 1976-10-12
| ''[[:d:Q922365|Dyffryn Ardudwy]]''<br/>''[[:d:Q29507069|Glanywern]]''
|-
| style='text-align:right'| 7760
| ''[[:d:Q20733911|Herbert Henry Merrett]]''
|
| 1886-12-18
| 1959-10-03
| ''[[:d:Q5033865|Canton]]''
|-
| style='text-align:right'| 7761
| ''[[:d:Q20733915|Meurig Dafydd]]''
|
| 1510
| 1595
| ''[[:d:Q3397990|Llanishen]]''
|-
| style='text-align:right'| 7762
| ''[[:d:Q20733921|Michael Jones]]''
| [[File:Michael Jones.jpg|center|128px]]
| 1787
| 1853-10-27
| ''[[:d:Q55868756|Neuadd-Lwyd]]''
|-
| style='text-align:right'| 7763
| ''[[:d:Q20733923|Michael Pritchard]]''
|
| 1709
| 1733-07-03
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 7764
| ''[[:d:Q20733927|Miles Edwards]]''
|
| 1743
| 1808-09-25
| ''[[:d:Q5590210|Goytre]]''
|-
| style='text-align:right'| 7765
| ''[[:d:Q20733929|Miles Harry]]''
|
| 1700-01-01
| 1776-11-01
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 7766
| ''[[:d:Q20733935|Morgan Albert Ellis]]''
|
| 1832-09-19
| 1901-06-01
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 7767
| ''[[:d:Q20733939|Morgan Evans]]''
|
| 1777
| 1843
| ''[[:d:Q13644939|Llanrhystud]]''
|-
| style='text-align:right'| 7768
| ''[[:d:Q20733946|Morgan Hugh Jones]]''
|
| 1873-04-26
| 1930
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 7769
| ''[[:d:Q20733948|Morgan Jones]]''
|
| 1717
| 1780-04-01
| ''[[:d:Q3403140|Llanfair-ar-y-bryn]]''
|-
| style='text-align:right'| 7770
| ''[[:d:Q20733949|Morgan Parry Morgan]]''
|
| 1876-07-08
| 1964-12-27
| ''[[:d:Q3400083|Llanafan]]''
|-
| style='text-align:right'| 7771
| ''[[:d:Q20733955|Morien Mon Huws]]''
|
| 1856-08-10
| 1932-11-27
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 7772
| ''[[:d:Q20733957|Daniel Morris]]''
|
| 1844-05-26
| 1933-02-09
| ''[[:d:Q3359375|Loughor]]''
|-
| style='text-align:right'| 7773
| ''[[:d:Q20733963|Morris Charles Jones]]''
|
| 1819-05-09
| 1893-01-27
| [[Welshpool]]
|-
| style='text-align:right'| 7774
| ''[[:d:Q20733965|Morris Davies]]''
| [[File:Portrait of Morris Davies (4672735) (cropped).jpg|center|128px]]
| 1796-10
| 1876-09-10
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 7775
| ''[[:d:Q20733967|Morris Davies]]''
| [[File:Morris Davies (Meurig Ebrill).jpg|center|128px]]
| 1780-04
| 1861-09-26
| ''[[:d:Q3402212|Llanfachreth]]''
|-
| style='text-align:right'| 7776
| ''[[:d:Q20733969|Eddie Evans Morris]]''
|
| 1890-10-05
| 1984-05-30
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 7777
| ''[[:d:Q20733975|Morris Griffiths]]''
|
| 1721
| 1769-10-17
| ''[[:d:Q1866840|Llangybi]]''
|-
| style='text-align:right'| 7778
| ''[[:d:Q20733983|Morris Roberts]]''
| [[File:Portrait of Morris Roberts (4669920) (cropped).jpg|center|128px]]
| 1799-05
| 1878-06-30
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7779
| ''[[:d:Q20733996|Moses Davies]]''
|
| 1799
| 1866-01-06
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 7780
| ''[[:d:Q20734002|Moses Owen Jones]]''
| [[File:Moses Owen Jones.jpg|center|128px]]
| 1842-10-31
| 1908-07-27
| ''[[:d:Q5278615|Dinorwig]]''
|-
| style='text-align:right'| 7781
| ''[[:d:Q20734008|David Ellis Nanney]]''
|
| 1759
| 1819-06-05
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 7782
| ''[[:d:Q20734018|Nicholas Bennett]]''
| [[File:Nicholas Bennett.jpg|center|128px]]
| 1823-05-08
| 1899-08-18
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 7783
| ''[[:d:Q20734028|Harri William]]''
|
| 1763-12-18
| 1844-07-11
| ''[[:d:Q13130671|Penderyn]]''
|-
| style='text-align:right'| 7784
| ''[[:d:Q20734044|Owen Davies]]''
|
| 1719
| 1792-07-06
| ''[[:d:Q6661893|Llanwrda]]''
|-
| style='text-align:right'| 7785
| ''[[:d:Q20734050|Owen Davies]]''
| [[File:Owen Davies (Caernarfon).jpg|center|128px]]
| 1840-10-08
| 1929-05-30
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 7786
| ''[[:d:Q20734054|Owen Evans]]''
|
| 1808-04-25
| 1865-01-09
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7787
| ''[[:d:Q20734057|Owen Evans]]''
| [[File:Parch Dr Owen Evans DD, Fetter Lane.jpg|center|128px]]
| 1829-11-19
| 1920-06-01
| ''[[:d:Q20589424|Pen-y-bont-fawr]]''
|-
| style='text-align:right'| 7788
| ''[[:d:Q20734066|Owen Griffith]]''
| [[File:Owen Griffith (Giraldus 1832 - 1896).jpg|center|128px]]
| 1832-02-01
| 1896-05-14
| ''[[:d:Q3398962|Garndolbenmaen]]''
|-
| style='text-align:right'| 7789
| ''[[:d:Q20734070|Owen Griffith]]''
| [[File:Eryr Eryri.jpg|center|128px]]
| 1839-08-12
| 1903-01-04
| ''[[:d:Q3402521|Cwm y Glo]]''
|-
| style='text-align:right'| 7790
| ''[[:d:Q20734076|Owen Hughes]]''
|
| 1879
| 1947-08-29
| ''[[:d:Q13127599|Cwm Prysor]]''
|-
| style='text-align:right'| 7791
| ''[[:d:Q20734079|Owen Humphrey Davies]]''
|
| 1828-09
| 1898-08-11
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 7792
| ''[[:d:Q20734082|Owen Jones]]''
| [[File:Revd Owen Jones, Llanfair Caereinion.jpg|center|128px]]
| 1787-02-16
| 1828-12-04
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 7793
| ''[[:d:Q20734086|Owen Jones]]''
|
| 1825
| 1900
| ''[[:d:Q26270901|Pontruffydd Hall]]''
|-
| style='text-align:right'| 7794
| ''[[:d:Q20734088|Owen Jones]]''
| [[File:Owen Jones, Chatham Street, Lerpwl.jpg|center|128px]]
| 1833-10-12
| 1899-01-13
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 7795
| ''[[:d:Q20734093|Owen Jones]]''
|
| 1838-06-04
| 1866-02-07
| ''[[:d:Q3404510|Llangian]]''
|-
| style='text-align:right'| 7796
| ''[[:d:Q20734096|Owen Madoc Roberts]]''
|
| 1867
| 1948-10-25
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 7797
| ''[[:d:Q20734099|Owen Owen]]''
|
| 1806
| 1874
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 7798
| ''[[:d:Q20734102|Owen Owen Roberts]]''
|
| 1793-01-17
| 1866-01-31
| ''[[:d:Q3401668|Eglwysbach]]''
|-
| style='text-align:right'| 7799
| ''[[:d:Q20734105|Owen Owens]]''
|
| 1792-08-21
| 1862-10-13
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7800
| ''[[:d:Q20734112|Owen Rice]]''
|
| 1719
| 1788
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 7801
| ''[[:d:Q20734127|D. E. Parry-Williams]]''
|
| 1900-06-25
| 1996-09-10
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 7802
| ''[[:d:Q20734133|Peter Hughes Griffiths]]''
| [[File:Peter Hughes Griffiths.jpg|center|128px]]
| 1871-08-06
| 1937-01-01
| ''[[:d:Q5445551|Glan-y-fferi]]''
|-
| style='text-align:right'| 7803
| ''[[:d:Q20734137|Peter Maelor Evans]]''
| [[File:Portrait of diweddar Mr. Peter Maelor Evans (4673285).jpg|center|128px]]
| 1817-04-10
| 1878-05-29
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 7804
| ''[[:d:Q20734153|Philip Esmonde Phillips]]''
|
| 1888-06-16
| 1960-02-27
| ''[[:d:Q3404679|Crumlin]]''
|-
| style='text-align:right'| 7805
| ''[[:d:Q20734156|Philip James]]''
|
| 1664
| 1748
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 7806
| ''[[:d:Q20734166|Grismond Picton Phillips]]''
|
| 1898-05-20<br/>1898-05-29
| 1967-08-05
| ''[[:d:Q13127604|Cwmgwili]]''
|-
| style='text-align:right'| 7807
| ''[[:d:Q20734182|Ieuan Rees-Davies]]''
|
| 1894-07-15
| 1967-11-28
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 7808
| ''[[:d:Q20734189|Rees Cribin Jones]]''
|
| 1841-09-09
| 1927-08-11
| ''[[:d:Q7679437|Talgarreg]]''
|-
| style='text-align:right'| 7809
| ''[[:d:Q20734206|Rees Lewis]]''
|
| 1828
| 1880-12-14
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 7810
| ''[[:d:Q20734208|Rees Morgan]]''
|
| 1764
| 1847-04-06
| ''[[:d:Q7680110|Talyllychau]]''
|-
| style='text-align:right'| 7811
| ''[[:d:Q20734218|Reuben Davies]]''
|
| 1808
| 1833-01-08
| ''[[:d:Q5184909|Cribyn]]''
|-
| style='text-align:right'| 7812
| ''[[:d:Q20734229|Rhisiart Parry]]''
|
| 1665
| 1749
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 7813
| ''[[:d:Q20734240|Rhys Davies]]''
|
| 1772
| 1847-01-06
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 7814
| ''[[:d:Q20734248|Rhys Gwesyn Jones]]''
|
| 1826-05-04
| 1901-09-05
| ''[[:d:Q4667105|Abergwesyn]]''
|-
| style='text-align:right'| 7815
| ''[[:d:Q20734250|Rhys Jones Huws]]''
| [[File:Rhys Jones Huws.jpg|center|128px]]
| 1862-06-13
| 1917-11-21
| [[Penegoes]]
|-
| style='text-align:right'| 7816
| ''[[:d:Q20734255|Rhys Price]]''
|
| 1807-02-27
| 1869-07-06
| ''[[:d:Q6661425|Llangammarch Wells]]''
|-
| style='text-align:right'| 7817
| ''[[:d:Q20734256|Rhys Prydderch]]''
|
| 1620
| 1699-01-25
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 7818
| ''[[:d:Q20734261|Rice Pryce Buckley Williames]]''
|
| 1802
| 1871-03-23
| ''[[:d:Q3309484|Aberriw]]''
|-
| style='text-align:right'| 7819
| ''[[:d:Q20734263|Richard Bennett]]''
|
| 1860-09-21
| 1937-08-13
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 7820
| ''[[:d:Q20734269|Richard Davies]]''
| [[File:Portrait of Richard (Tafolog) Davies (4673089).jpg|center|128px]]
| 1830
| 1904-02-05
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 7821
| ''[[:d:Q20734270|Richard Davies Griffith]]''
|
| 1813
| 1856-06-29
| [[Swansea]]
|-
| style='text-align:right'| 7822
| ''[[:d:Q20734273|Richard Ellis]]''
|
| 1775
| 1855-02-11
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7823
| ''[[:d:Q20734274|Richard Ellis]]''
|
| 1784-01-24
| 1824-12-10
| ''[[:d:Q6661743|Llansadwrn]]''
|-
| style='text-align:right'| 7824
| ''[[:d:Q20734275|Richard Foulkes Edwards]]''
| [[File:Risiart Ddu o Wynedd.jpg|center|128px]]
| 1836-01-14
| 1870-03-08
| ''[[:d:Q6661345|Llanfair Dyffryn Clwyd]]''
|-
| style='text-align:right'| 7825
| ''[[:d:Q20734280|Richard Hughes]]''
|
| 1794
| 1871-01-12
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 7826
| ''[[:d:Q20734281|Richard Humphreys]]''
| [[File:Richd. Humphreys, Dyffryn.jpg|center|128px]]
| 1790-06
| 1863-02-15
| ''[[:d:Q922365|Dyffryn Ardudwy]]''
|-
| style='text-align:right'| 7827
| ''[[:d:Q20734282|Richard Humphreys Morgan]]''
|
| 1850-08-14
| 1899-03-31
| ''[[:d:Q922365|Dyffryn Ardudwy]]''
|-
| style='text-align:right'| 7828
| ''[[:d:Q20734283|Richard Jones]]''
| [[File:Portrait of Richard Jones, Llwyngwril (4673766) (cropped).jpg|center|128px]]
| 1780
| 1853-02-18
| ''[[:d:Q6662914|Llwyngwril]]''
|-
| style='text-align:right'| 7829
| ''[[:d:Q20734284|Richard Jones]]''
|
| 1787-05-26
| 1855
| ''[[:d:Q3402560|Bontddu]]''
|-
| style='text-align:right'| 7830
| ''[[:d:Q20734288|Richard Lewis]]''
|
| 1817-06-21
| 1865-03-02
| ''[[:d:Q3402761|Llandegfan]]''
|-
| style='text-align:right'| 7831
| ''[[:d:Q20734290|Richard Lloyd]]''
| [[File:Rhamant Bywyd Lloyd George (page 70 crop).jpg|center|128px]]
| 1834-07-12
| 1917-02-28
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 7832
| ''[[:d:Q20734291|Richard Lowe]]''
|
| 1810
| 1853
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 7833
| ''[[:d:Q20734292|Richard Lumley]]''
| [[File:Portrait of R Lumley (4673791).jpg|center|128px]]
| 1810-10-23
| 1884-07-23
| [[Aberystwyth]]
|-
| style='text-align:right'| 7834
| ''[[:d:Q20734296|Richard Morgan]]''
|
| 1743
| 1805-02-10
| [[Ystradgynlais]]
|-
| style='text-align:right'| 7835
| ''[[:d:Q20734297|Richard Morgan]]''
|
| 1854
| 1939-09-01
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 7836
| ''[[:d:Q20734298|Richard Morris Lewis]]''
|
| 1847
| 1918-09-20
| ''[[:d:Q4959999|Brechfa]]''
|-
| style='text-align:right'| 7837
| ''[[:d:Q20734299|Richard Newcome]]''
| [[File:Portrait of Richard Newcome (4674540).jpg|center|128px]]
| 1779-03-08
| 1857-08-07
| ''[[:d:Q3406264|Gresford]]''
|-
| style='text-align:right'| 7838
| ''[[:d:Q20734303|Richard Rees]]''
|
| 1707
| 1749-08
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 7839
| ''[[:d:Q20734304|Richard Roberts]]''
|
| 1874-05-31
| 1945-04-10
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 7840
| ''[[:d:Q20734305|Richard Samuel Hughes]]''
|
| 1855-07-14
| 1893-03-03
| [[Aberystwyth]]
|-
| style='text-align:right'| 7841
| ''[[:d:Q20734308|Richard Williams]]''
| [[File:Richard Williams, 'Celynog' (5254841).jpg|center|128px]]
| 1835
| 1906-06-15
| ''[[:d:Q4942605|Bont Dolgadfan]]''
|-
| style='text-align:right'| 7842
| ''[[:d:Q20734311|Robert Albert Jones]]''
|
| 1851-09-16
| 1892-10-19
| ''[[:d:Q7165394|Penybryn]]''
|-
| style='text-align:right'| 7843
| ''[[:d:Q20734313|Robert Baugh]]''
|
| 1748
| 1832-12-27
| ''[[:d:Q6661275|Llandysilio]]''
|-
| style='text-align:right'| 7844
| ''[[:d:Q20734314|Robert Dafydd]]''
|
| 1747
| 1834-04-17
| ''[[:d:Q3401919|Nantmor]]''
|-
| style='text-align:right'| 7845
| ''[[:d:Q20734316|Robert David Roberts]]''
| [[File:Revd Robert David Roberts, Llwynhendy (1820-93) NLW3364306.jpg|center|128px]]
| 1820-10-03
| 1893-05-15
| ''[[:d:Q5278615|Dinorwig]]''
|-
| style='text-align:right'| 7846
| ''[[:d:Q20734318|Robert Davies]]''
|
| 1790
| 1841-05-17
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 7847
| ''[[:d:Q20734320|Robert Davies]]''
|
| 1814-06-16
| 1867-10
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 7848
| ''[[:d:Q20734321|Robert Davies]]''
|
| 1834-06-29
| 1858-08-29
| ''[[:d:Q13126857|Carneddi]]''
|-
| style='text-align:right'| 7849
| ''[[:d:Q20734325|Robert Edwards]]''
|
| 1775
| 1805-02-18
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 7850
| ''[[:d:Q20734326|Robert Ellis]]''
| [[File:Robert Ellis, Ysgoldy.jpg|center|128px]]
| 1808-12-12
| 1881-09-24
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 7851
| ''[[:d:Q20734331|Robert Foulkes]]''
|
| 1743
| 1841-12-24
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 7852
| ''[[:d:Q20734332|Robert Griffith]]''
| [[File:Robert Griffith.jpg|center|128px]]
| 1847-03-01
| 1909-10-08
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 7853
| ''[[:d:Q20734333|Robert Griffith Roberts]]''
|
| 1866-12-13
| 1930-01-03
| ''[[:d:Q922365|Dyffryn Ardudwy]]''
|-
| style='text-align:right'| 7854
| ''[[:d:Q20734334|Robert Griffiths]]''
| [[File:Portrait of Robert Griffiths (4670251).jpg|center|128px]]
| 1824-05-21
| 1903-01-01
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7855
| ''[[:d:Q20734335|Robert Gruffydd]]''
|
| 1753
| 1820-08-17
| ''[[:d:Q13129604|Llanbeblig]]''
|-
| style='text-align:right'| 7856
| ''[[:d:Q20734336|Robert Hughes]]''
| [[File:Self portrait (4703026).jpg|center|128px]]
| 1811-03-25
| 1892-05-03
| ''[[:d:Q29499117|Bodgarad]]''
|-
| style='text-align:right'| 7857
| ''[[:d:Q20734337|Robert Humphreys]]''
|
| 1779
| 1832-08-31
| ''[[:d:Q6661284|Llanelidan]]''
|-
| style='text-align:right'| 7858
| ''[[:d:Q20734338|Robert Humphreys]]''
|
| No/unknown value
| No/unknown value
| ''[[:d:Q25556302|Rhagatt Hall]]''
|-
| style='text-align:right'| 7859
| ''[[:d:Q20734339|Robert James]]''
|
| 1825-03-07
| 1879-10-06
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 7860
| ''[[:d:Q20734341|Robert Jones]]''
| [[File:Portrait of Revd. Robert G. Jones (4672941).jpg|center|128px]]
| 1769-11
| 1835-04-05
| ''[[:d:Q16540181|Llangynhafal]]''
|-
| style='text-align:right'| 7861
| ''[[:d:Q20734342|Robert Jones]]''
| [[File:Robert Jones, Llanllyfni.jpg|center|128px]]
| 1806-11-14
| 1896-03-03
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 7862
| ''[[:d:Q20734343|Robert Jones]]''
|
| 1891-11-07
| 1962-03-17
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 7863
| ''[[:d:Q20734344|Robert Jones]]''
|
| 1862-07-05
| 1929-02-03
| ''[[:d:Q3396790|Arthog]]''
|-
| style='text-align:right'| 7864
| ''[[:d:Q20734346|Robert Llwyd]]''
|
| 1565
| 1655
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 7865
| ''[[:d:Q20734348|Robert Meredith]]''
|
| 1823-09-23
| 1893-07-20
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 7866
| ''[[:d:Q20734349|Robert Morgan]]''
|
| 1621
| 1710-04-05
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 7867
| ''[[:d:Q20734352|Robert Oliver Rees]]''
|
| 1818
| 1881-02-12
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7868
| ''[[:d:Q20734354|Robert Owen]]''
| [[File:Robert Owen, Pennal.jpg|center|128px]]
| 1834-03-15
| 1899-11-08
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 7869
| ''[[:d:Q20734355|Robert Owen]]''
| [[File:Robert Owen (Bardd y Môr).jpg|center|128px]]
| 1858-03-30
| 1885-10-23
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 7870
| ''[[:d:Q20734360|Robert Pugh Rowlands]]''
| [[File:Robert Pugh Rowlands. Photograph by Lafayette Ltd. Wellcome V0027109.jpg|center|128px]]
| 1874-09-27
| 1933-12-06
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 7871
| ''[[:d:Q20734361|Robert Richard Hughes]]''
|
| 1871-01-02
| 1957-09-23
| ''[[:d:Q16103637|Brynsiencyn]]''
|-
| style='text-align:right'| 7872
| ''[[:d:Q20734362|Robert Roberts]]''
|
| 1762-09-12
| 1802-11-28
| ''[[:d:Q3404501|Nantlle]]''
|-
| style='text-align:right'| 7873
| ''[[:d:Q20734363|Robert Roberts]]''
|
| 1800
| 1878-07-15
| ''[[:d:Q13131979|Tre'r-ddôl]]''
|-
| style='text-align:right'| 7874
| ''[[:d:Q20734365|Robert Roberts]]''
| [[File:Portrait of Robert Roberts, Y Sgolor Mawr (4671120).jpg|center|128px]]
| 1834-11-12
| 1885-04-15
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 7875
| ''[[:d:Q20734368|Robert Williams]]''
|
| 1782
| 1818-07-15
| ''[[:d:Q13129631|Llanfechell]]''
|-
| style='text-align:right'| 7876
| ''[[:d:Q20734374|Rolant Huw]]''
|
| 1714
| 1802-12-16
| ''[[:d:Q13129650|Llangywer]]''
|-
| style='text-align:right'| 7877
| ''[[:d:Q20734375|Ronald James Tree]]''
|
| 1914-03-30
| 1970-11-28
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 7878
| ''[[:d:Q20734376|Rosser Beynon]]''
|
| 1810
| 1876-01-03
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 7879
| ''[[:d:Q20734378|Rowland Hughes]]''
| [[File:Portrait of Rev. Rowland Hughes, Wesleyan Minister (4670927) (cropped).jpg|center|128px]]
| 1811-03-06
| 1861-12-24
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7880
| ''[[:d:Q20734383|Samuel Davies]]''
|
| 1788-06-09
| 1854-05-07
| ''[[:d:Q5119934|Cilcain]]''
|-
| style='text-align:right'| 7881
| ''[[:d:Q20734384|Samuel Davies]]''
| [[File:Portrait of Samuel Davies (4673074).jpg|center|128px]]
| 1818
| 1891-06-07
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 7882
| ''[[:d:Q20734385|Samuel Ellis]]''
|
| 1803
| 1852-04-06
| ''[[:d:Q20598999|Cyfronydd]]''
|-
| style='text-align:right'| 7883
| ''[[:d:Q20734386|Samuel Evans]]''
| [[File:Portrait of Samuel Evans, Zoar, Merthyr Tydfil, South Wales (4674125).jpg|center|128px]]
| 1777-06
| 1833-06-27
| ''[[:d:Q5136816|Clydach]]''
|-
| style='text-align:right'| 7884
| ''[[:d:Q20734387|Samuel Evans]]''
| [[File:Dr. Samuel Evans (5349058) (cropped).jpg|center|128px]]
| 1859-02-10
| 1935-10-10
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 7885
| ''[[:d:Q20734388|Samuel Evans]]''
|
| 1793
| 1856-08-30
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 7886
| ''[[:d:Q20734389|Samuel Griffiths]]''
| [[File:Portrait of Parchedig Samuel Griffiths, Horeb Llandysul 1855 (4670806).jpg|center|128px]]
| 1783
| 1860-07-04
| ''[[:d:Q5136827|Clydau]]''
|-
| style='text-align:right'| 7887
| ''[[:d:Q20734390|Samuel James Evans]]''
|
| 1870-08-04
| 1938-04-02
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7888
| ''[[:d:Q20734392|Samuel Maurice Jones]]''
| [[File:Portrait of Samuel Morris Jones (4674452).jpg|center|128px]]
| 1853
| 1932-12-30
| ''[[:d:Q6887543|Mochdre]]''
|-
| style='text-align:right'| 7889
| ''[[:d:Q20734393|Sarah Winifred Parry]]''
| [[File:Winnie Parry.jpg|center|128px]]
| 1870-05-20<br/>1870
| 1953-02-12<br/>1953
| [[Welshpool]]
|-
| style='text-align:right'| 7890
| ''[[:d:Q20734396|Siencyn Thomas]]''
|
| 1690
| 1762
| ''[[:d:Q15987464|Brongwyn]]''
|-
| style='text-align:right'| 7891
| ''[[:d:Q20734397|Silas Morris]]''
| [[File:Prifathro Silas Morris, Coleg y Bedyddwyr, Bangor (5254799).jpg|center|128px]]
| 1862-01-09
| 1923-07-25
| ''[[:d:Q5208304|Dafen]]''
|-
| style='text-align:right'| 7892
| ''[[:d:Q20734403|Thomas David Slingsby-Jenkins]]''
|
| 1872-12-25
| 1955-04-05
| [[Aberystwyth]]
|-
| style='text-align:right'| 7893
| ''[[:d:Q20734404|Solomon Harris]]''
|
| 1726-02-21
| 1785-08-15
| ''[[:d:Q3401686|Llangybi]]''
|-
| style='text-align:right'| 7894
| ''[[:d:Q20734405|Sorobabel Davies]]''
|
| 1806
| 1877-07-27
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 7895
| ''[[:d:Q20734407|Stanley Howard Hedley Perry]]''
|
| 1911
| 1995-11-30
| [[Newport]]
|-
| style='text-align:right'| 7896
| ''[[:d:Q20734408|Stanley Bligh]]''
|
| 1870-02-15
| 1949-01-15
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 7897
| ''[[:d:Q20734410|Stephen Davies]]''
|
| 1790-11-08
| 1858-04-06
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 7898
| ''[[:d:Q20734411|Stephen Evans]]''
|
| 1818
| 1905-08-21
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 7899
| ''[[:d:Q20734412|Stephen Llwyd]]''
|
| 1794
| 1854-04
| ''[[:d:Q1936328|Nevern]]''
|-
| style='text-align:right'| 7900
| ''[[:d:Q20734414|Thomas (Jeremy) Griffiths]]''
|
| 1797
| 1871-01-19
| ''[[:d:Q6661964|Llechryd]]''
|-
| style='text-align:right'| 7901
| ''[[:d:Q20734417|Thomas Aubrey]]''
| [[File:Portrait of Thomas Aubrey (4674307).jpg|center|128px]]
| 1808-05-13
| 1867-11-16
| ''[[:d:Q5057243|Cefn Coed y Cymer]]''
|-
| style='text-align:right'| 7902
| ''[[:d:Q20734420|Thomas Beynon]]''
|
| 1745-08-26
| 1833
| ''[[:d:Q6661743|Llansadwrn]]''
|-
| style='text-align:right'| 7903
| ''[[:d:Q20734421|Thomas Blayney]]''
|
| 1785
|
| ''[[:d:Q13129664|Llanllwchaiarn]]''
|-
| style='text-align:right'| 7904
| ''[[:d:Q20734427|Thomas David Llewelyn]]''
|
| 1828-06-25
| 1879-08-13
| ''[[:d:Q6662903|Llwydcoed]]''
|-
| style='text-align:right'| 7905
| ''[[:d:Q20734429|Thomas Davies]]''
|
| 1812-11-13
| 1895-03-10
| ''[[:d:Q7594726|St Mellons]]''
|-
| style='text-align:right'| 7906
| ''[[:d:Q20734430|Thomas Davies]]''
|
| 1820-04-03
| 1873-10-28
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 7907
| ''[[:d:Q20734431|Thomas Davies]]''
| [[File:Revd Thomas Davies, Llanelli (1823-98) (Cong) NLW3364508.jpg|center|128px]]
| 1823-12-17
| 1898-02-29
| ''[[:d:Q7162296|Pencarreg]]''
|-
| style='text-align:right'| 7908
| ''[[:d:Q20734432|Thomas Davies]]''
|
| 1851
| 1892-12-20
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 7909
| ''[[:d:Q20734433|Thomas Davies]]''
|
| 1810
| 1873
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 7910
| ''[[:d:Q20734438|Thomas Edwards]]''
|
| 1844-04-08
| 1924-12-10
| ''[[:d:Q5566992|Glasinfryn]]''
|-
| style='text-align:right'| 7911
| ''[[:d:Q20734439|Thomas Edwards]]''
| [[File:Portrait of Cynonfardd (4673939).jpg|center|128px]]
| 1848-12-06
| 1927-03-13
| ''[[:d:Q6484919|Landore]]''
|-
| style='text-align:right'| 7912
| ''[[:d:Q20734446|Thomas Evans]]''
|
| 1714
| 1779-05-25
| ''[[:d:Q6947883|Mynyddislwyn]]''
|-
| style='text-align:right'| 7913
| ''[[:d:Q20734447|Thomas Evans]]''
|
| 1625
| 1688
| ''[[:d:Q6661068|Llanafan Fawr]]''
|-
| style='text-align:right'| 7914
| ''[[:d:Q20734449|Thomas Evans]]''
|
| 1897-09-09
| 1963-01-14
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 7915
| ''[[:d:Q20734450|Thomas Frimston]]''
|
| 1854-07-28
| 1930-05-12
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 7916
| ''[[:d:Q20734453|Thomas Grey]]''
|
| 1733-12-26
| 1810-06-02
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 7917
| ''[[:d:Q20734455|Thomas Griffiths]]''
|
| 1645
| 1725-07-25
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 7918
| ''[[:d:Q20734456|Thomas Gruffydd Jones]]''
|
| 1832-01-06
| 1898-03-17
| ''[[:d:Q7162069|Pen-y-cae-mawr]]''
|-
| style='text-align:right'| 7919
| ''[[:d:Q20734457|Thomas Harris]]''
|
| 1705-01-06
| 1782-09-23
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 7920
| ''[[:d:Q20734458|Thomas Hughes]]''
|
| 1758
| 1828-11-02
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 7921
| ''[[:d:Q20734459|Thomas Hughes]]''
|
| 1814
| 1884-01-31
| ''[[:d:Q13129653|Llangynog]]''
|-
| style='text-align:right'| 7922
| ''[[:d:Q20734460|Thomas Hughes]]''
|
| 1854-10-25
| 1928-12-15<br/>1928-01-10
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 7923
| ''[[:d:Q20734461|Thomas Hughes]]''
|
| 1803-05-08
| 1898-08-05
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 7924
| ''[[:d:Q20734464|Thomas Huws Davies]]''
|
| 1882-04-20
| 1940-03
| ''[[:d:Q7165358|Penuwch]]''
|-
| style='text-align:right'| 7925
| ''[[:d:Q20734465|Thomas Huxley]]''
|
| 1738
| 1792
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 7926
| ''[[:d:Q20734466|Thomas Hywel Hughes]]''
|
| 1875-07-10
| 1945-08-14
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 7927
| ''[[:d:Q20734467|Thomas Isfryn Hughes]]''
|
| 1865-10-16
| 1942-12-27
| ''[[:d:Q16071047|Clocaenog]]''
|-
| style='text-align:right'| 7928
| ''[[:d:Q20734470|Thomas James]]''
| [[File:Portrait of Thomas James M.A (4673953).jpg|center|128px]]
| 1834
| 1915-09-06
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 7929
| ''[[:d:Q20734471|Thomas James]]''
|
| 1817-08-21
| 1879-08-03
| ''[[:d:Q6751430|Manordeifi]]''
|-
| style='text-align:right'| 7930
| ''[[:d:Q20734472|Thomas Jerman Jones]]''
| [[File:Portrait of Thomas Jerman Jones and his family (4670364).jpg|center|128px]]
| 1833-08-10
| 1890-04-18
| ''[[:d:Q3400997|Llangristiolus]]''
|-
| style='text-align:right'| 7931
| ''[[:d:Q20734473|Thomas John]]''
|
| 1816-09-29
| 1862-11-27
| ''[[:d:Q5119942|Cilgerran]]''
|-
| style='text-align:right'| 7932
| ''[[:d:Q20734475|Thomas John Evans]]''
|
| 1894-03-30
| 1965-03-09
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7933
| ''[[:d:Q20734480|Thomas Jones]]''
|
| 1761
| 1831-01
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 7934
| ''[[:d:Q20734482|Thomas Jones]]''
|
| 1777
| 1847-07-06
| [[Llanfwrog, Denbighshire|Llanfwrog]]
|-
| style='text-align:right'| 7935
| ''[[:d:Q20734486|Thomas Jones]]''
|
| 1860-06-10
| 1932-10-31
| ''[[:d:Q13651875|Nantglyn]]''
|-
| style='text-align:right'| 7936
| ''[[:d:Q20734487|Thomas Jones]]''
|
| 1871-10-10
| 1938-01-21
| ''[[:d:Q3401544|Pontrhydfendigaid]]''
|-
| style='text-align:right'| 7937
| ''[[:d:Q20734488|Thomas Jones]]''
| [[File:Taliesin o Eifion NLW3371052.jpg|center|128px]]
| 1820-09-13
| 1876-06-01
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 7938
| ''[[:d:Q20734489|Thomas Jones]]''
|
| 1822
| 1854
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7939
| ''[[:d:Q20734490|Thomas Jones]]''
|
| 1823-07-02
| 1904-10-26
| ''[[:d:Q6963824|Nannerch]]''
|-
| style='text-align:right'| 7940
| ''[[:d:Q20734491|Thomas Jones Hughes]]''
|
| 1822-06-11
| 1891-02-05
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7941
| ''[[:d:Q20734492|Thomas Jones Humphreys]]''
| [[File:Thomas Jones Humphreys.jpg|center|128px]]
| 1841-05-16
| 1934-02-16
| ''[[:d:Q20589268|Darowen]]''
|-
| style='text-align:right'| 7942
| ''[[:d:Q20734496|Thomas Lewis]]''
|
| 1759
| 1842-09-14
| ''[[:d:Q6661893|Llanwrda]]''
|-
| style='text-align:right'| 7943
| ''[[:d:Q20734497|Thomas Lewis]]''
|
| 1823-08-03
| 1900-12-02
| ''[[:d:Q20593513|Llandeilo'r-fân]]''
|-
| style='text-align:right'| 7944
| ''[[:d:Q20734498|Thomas Lewis]]''
|
| 1837
| 1892-02-11
| ''[[:d:Q13130294|Mydroilyn]]''
|-
| style='text-align:right'| 7945
| ''[[:d:Q20734499|Thomas Lewis]]''
|
| 1859-10-13
| 1929-12-05
| ''[[:d:Q1996667|Whitland]]''
|-
| style='text-align:right'| 7946
| ''[[:d:Q20734501|Thomas Lloyd]]''
|
| 1765
| 1789-04
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 7947
| ''[[:d:Q20734503|Thomas Lloyd Williams]]''
|
| 1830-11-25
| 1910-11-24
| ''[[:d:Q922365|Dyffryn Ardudwy]]''
|-
| style='text-align:right'| 7948
| ''[[:d:Q20734505|Thomas Meredith]]''
|
|
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 7949
| ''[[:d:Q20734506|Thomas Morgan]]''
|
|
| 1833-07
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 7950
| ''[[:d:Q20734507|Thomas Morgan]]''
|
| 1720-01-07
| 1799
| ''[[:d:Q5348100|Eglwys Ilan]]''
|-
| style='text-align:right'| 7951
| ''[[:d:Q20734508|Thomas Morgan]]''
|
| 1737-11-02
| 1813-10-17
| ''[[:d:Q6661651|Llannon]]''
|-
| style='text-align:right'| 7952
| ''[[:d:Q20734509|Thomas Morris]]''
|
| 1786-02-10
| 1846-11-04
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 7953
| ''[[:d:Q20734516|Thomas Phillips]]''
| [[File:Portrait of Parch Thos. Phillips D. D (4673602).jpg|center|128px]]
| 1806-03-15
| 1870-11-28
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 7954
| ''[[:d:Q20734518|Thomas Powell]]''
|
| 1781
| 1842-02-04
| ''[[:d:Q7837433|Trecastle]]''
|-
| style='text-align:right'| 7955
| ''[[:d:Q20734519|Thomas Price]]''
|
| 1809-05-17
| 1892-03-07
| ''[[:d:Q24360208|Builth]]''
|-
| style='text-align:right'| 7956
| ''[[:d:Q20734520|Thomas Prichard]]''
|
| 1764
| 1843-08-21
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 7957
| ''[[:d:Q20734521|Thomas Pryce]]''
|
| 1833-09-05
| 1904-06-23
| ''[[:d:Q13644930|Llandrinio]]''
|-
| style='text-align:right'| 7958
| ''[[:d:Q20734523|Thomas Rees]]''
| [[File:Reverend Thomas Rees (1825–1908) (gcf10118).jpg|center|128px]]
| 1825-08-02
| 1908-06-08
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 7959
| ''[[:d:Q20734524|Thomas Rees Morgan]]''
|
| 1834-03-31
| 1897-09-06
| ''[[:d:Q3406657|Penydarren]]''
|-
| style='text-align:right'| 7960
| ''[[:d:Q20734525|Thomas Rhys Davies]]''
|
| 1790-05-19
| 1859-06-26
| ''[[:d:Q5119942|Cilgerran]]''
|-
| style='text-align:right'| 7961
| ''[[:d:Q20734526|Thomas Richard]]''
|
| 1783-02-11
| 1856-01-03
| ''[[:d:Q7837785|Trefin]]''
|-
| style='text-align:right'| 7962
| ''[[:d:Q20734527|Thomas Rocyn Jones]]''
|
| 1822
| 1877-04-02
| ''[[:d:Q6751430|Manordeifi]]''
|-
| style='text-align:right'| 7963
| ''[[:d:Q20734528|Thomas Saunders]]''
|
| 1732
| 1790-01-09
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 7964
| ''[[:d:Q20734529|Thomas Sheen]]''
|
| 1718-11-08
| 1790-02-28
| ''[[:d:Q13128654|Glascwm]]''
|-
| style='text-align:right'| 7965
| ''[[:d:Q20734533|Thomas Thomas]]''
|
| 1776
| 1847-02-28
| ''[[:d:Q16248463|Tre-Wen]]''
|-
| style='text-align:right'| 7966
| ''[[:d:Q20734535|Thomas Twynog Jeffries]]''
|
| 1844-02-25
| 1911
| ''[[:d:Q6661154|Llanddeusant]]''
|-
| style='text-align:right'| 7967
| ''[[:d:Q20734536|Thomas Wallace Fagan]]''
|
| 1874-02-04
| 1951-02-10
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 7968
| ''[[:d:Q20734537|Thomas Waterhouse]]''
|
| 1878-03-21
| 1961-07-03
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 7969
| ''[[:d:Q20734539|Thomas William Barker]]''
|
| 1861-05-12
| 1912-07-07
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 7970
| ''[[:d:Q20734540|Thomas William Jenkyn]]''
| [[File:Portrait of T. W. Jenkyn, D.D (4673322) (cropped 3).jpg|center|128px]]
| 1794
| 1858-05-26
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 7971
| ''[[:d:Q20734544|Timothy Eynon Davies]]''
| [[File:Timothy Eynon Davies.jpg|center|128px]]
| 1854
| 1935-08-20
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 7972
| ''[[:d:Q20734545|Titus Evans]]''
|
| 1809
| 1864-02-29
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 7973
| ''[[:d:Q20734547|Tom Eirug Davies]]''
|
| 1892-02-23
| 1951-09-27
| ''[[:d:Q13128837|Gwernogle]]''
|-
| style='text-align:right'| 7974
| ''[[:d:Q20734548|Tom Pugh Williams]]''
|
| 1912
| 1985-07
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 7975
| ''[[:d:Q20734550|Trefor Richard Morgan]]''
|
| 1914-01-28
| 1970-01-03
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 7976
| ''[[:d:Q20734552|Vaughan Lloyd]]''
|
| 1736-01-17
| 1817-01-16
| ''[[:d:Q3402138|Ystrad Meurig]]''
|-
| style='text-align:right'| 7977
| ''[[:d:Q20734556|Walter David Jeremy]]''
|
| 1825-05-05
| 1893-09-18
| ''[[:d:Q7162296|Pencarreg]]''
|-
| style='text-align:right'| 7978
| ''[[:d:Q20734561|Walter Phillips John]]''
|
| 1910-01-31
| 1967-03-15
| ''[[:d:Q5561755|Gilfach]]''
|-
| style='text-align:right'| 7979
| ''[[:d:Q20734562|Watcyn Clywedog]]''
|
|
| 1650-02-19
| [[Wales]]
|-
| style='text-align:right'| 7980
| ''[[:d:Q20734563|Watkin Jones]]''
|
| 1882-06-12
| 1967-02-14
| ''[[:d:Q3402628|Capel Celyn]]''
|-
| style='text-align:right'| 7981
| ''[[:d:Q20734564|Watkin William Price]]''
|
| 1873-09-04
| 1967-12-31
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 7982
| ''[[:d:Q20734565|John Webber]]''
|
| 1884-11-14
| 1962-12-18
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 7983
| ''[[:d:Q20734570|Robert William]]''
|
| 1744
| 1815-08
| [[Wales]]
|-
| style='text-align:right'| 7984
| ''[[:d:Q20734571|William Adams]]''
| [[File:Bust of William Adams, National Museum Cardiff 02.jpg|center|128px]]
| 1813-10-10
| 1886-08-17
| ''[[:d:Q7165398|Pen-y-cae]]''
|-
| style='text-align:right'| 7985
| ''[[:d:Q20734572|William Alonzo Griffiths]]''
| [[File:William Alonzo Griffiths.jpg|center|128px]]
| 1842
| 1893-12-07
| ''[[:d:Q7227989|Pont-ar-Gothi]]''
|-
| style='text-align:right'| 7986
| ''[[:d:Q20734575|William Beynon]]''
|
| 1884
| 1932-07-20
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 7987
| ''[[:d:Q20734579|William Cadwaladr Davies]]''
| [[File:William Cadwaladr Davies (1849-1905) NLW3364074.jpg|center|128px]]
| 1849-05-02
| 1905-11-25
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 7988
| ''[[:d:Q20734583|William Daniel Davies]]''
|
| 1838-06-15
| 1900-03-22
| ''[[:d:Q7162279|Pen-boyr]]''
|-
| style='text-align:right'| 7989
| ''[[:d:Q20734584|William Davies]]''
|
| 1729
| 1787-08-17
| ''[[:d:Q770818|Llanfynydd]]''
|-
| style='text-align:right'| 7990
| ''[[:d:Q20734586|William Davies]]''
| [[File:Portrait of William Davies (4674071).jpg|center|128px]]
| 1785-10-12
| 1851-02-09
| ''[[:d:Q2796209|Llandyrnog]]''
|-
| style='text-align:right'| 7991
| ''[[:d:Q20734587|William Davies]]''
|
| 1805-03-20
| 1859-12-11
| ''[[:d:Q6661911|Llanycrwys]]''
|-
| style='text-align:right'| 7992
| ''[[:d:Q20734588|William Davies]]''
|
| 1820-10-16
| 1875-08-13
| [[Aberystwyth]]
|-
| style='text-align:right'| 7993
| ''[[:d:Q20734591|William Dykins]]''
|
| 1831-12-08
| 1872-12-25
| ''[[:d:Q5603927|Maes-glas]]''
|-
| style='text-align:right'| 7994
| ''[[:d:Q20734593|William Edmunds]]''
|
| 1827-12-27
| 1875-01-21
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 7995
| ''[[:d:Q20734595|William Edward Cecil Tregoning]]''
|
| 1871-02-17
| 1957-03-09
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 7996
| ''[[:d:Q20734598|William Edwards]]''
|
| 1786
| 1857-10-03
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 7997
| ''[[:d:Q20734600|William Edwards Davies]]''
|
| 1851-08-08
| 1927-01-21
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 7998
| ''[[:d:Q20734601|William Eilir Evans]]''
|
| 1852-04-26
| 1910-12-07
| ''[[:d:Q5058788|Cenarth]]''
|-
| style='text-align:right'| 7999
| ''[[:d:Q20734603|William Elias]]''
|
| 1708
| 1787
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 8000
| ''[[:d:Q20734604|William Ellis]]''
|
| 1752
| 1810
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 8001
| ''[[:d:Q20734607|William Evans]]''
|
| 1716
| 1770-04-24
| [[Ystradgynlais]]
|-
| style='text-align:right'| 8002
| ''[[:d:Q20734608|William Evans]]''
|
| 1734-11-30
| 1805-04-02
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 8003
| ''[[:d:Q20734609|William Evans]]''
|
| 1779-10-25
| 1854-07-30
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8004
| ''[[:d:Q20734610|William Evans]]''
| [[File:William Evans, Tonyrefail.jpg|center|128px]]
| 1795-06-30
| 1891-02-14
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 8005
| ''[[:d:Q20734611|William Evans]]''
|
| 1823
| 1900-08-08
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 8006
| ''[[:d:Q20734613|William Evans]]''
|
| 1869-10-31
| 1948-07-01
| ''[[:d:Q6484919|Landore]]''
|-
| style='text-align:right'| 8007
| ''[[:d:Q20734614|William Evans]]''
|
| 1808
| 1860-11-15
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8008
| ''[[:d:Q20734615|William Evans]]''
|
| 1836
| 1900-06-16
| ''[[:d:Q3400083|Llanafan]]''
|-
| style='text-align:right'| 8009
| ''[[:d:Q20734616|William Frederick Frost]]''
|
| 1846-12-28
| 1891-02-25
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8010
| ''[[:d:Q20734620|William Griffith]]''
|
| 1719
| 1782-04-20
| ''[[:d:Q1964775|Nantlle Valley]]''
|-
| style='text-align:right'| 8011
| ''[[:d:Q20734621|William Griffith]]''
| [[File:Portrait of W. Griffith, Caergybi (4672889).jpg|center|128px]]
| 1801
| 1881
| ''[[:d:Q3100159|Llanfaglan]]''
|-
| style='text-align:right'| 8012
| ''[[:d:Q20734624|William Griffiths]]''
|
| 1777
| 1825-01-05
| ''[[:d:Q1996667|Whitland]]''
|-
| style='text-align:right'| 8013
| ''[[:d:Q20734625|William Griffiths]]''
| [[File:Portrait of William Griffiths (4672537).jpg|center|128px]]
| 1788-12-21
| 1861-07-21
| ''[[:d:Q5136827|Clydau]]''
|-
| style='text-align:right'| 8014
| ''[[:d:Q20734626|William Griffiths]]''
| [[File:William Griffiths, Pontypridd.jpg|center|128px]]
| 1859
| 1940
| ''[[:d:Q268367|Cwmllynfell]]''
|-
| style='text-align:right'| 8015
| ''[[:d:Q20734627|William Griffiths]]''
|
| 1830
| 1910
| ''[[:d:Q2588227|Aberavon]]''
|-
| style='text-align:right'| 8016
| ''[[:d:Q20734628|William Haines]]''
|
| 1853-05-24
| 1922-01-12
| ''[[:d:Q20713979|Penpergwm]]''
|-
| style='text-align:right'| 8017
| ''[[:d:Q20734630|William Henry Roberts]]''
|
| 1907-02-21
| 1982-04-06
| ''[[:d:Q2910205|Llanfaethlu]]''
|-
| style='text-align:right'| 8018
| ''[[:d:Q20734631|William Hobley]]''
| [[File:Parch William Hobley.jpg|center|128px]]
| 1858
| 1933-04-09
| ''[[:d:Q3404501|Nantlle]]''
|-
| style='text-align:right'| 8019
| ''[[:d:Q20734633|William Hope]]''
|
| No/unknown value
| No/unknown value
| ''[[:d:Q2424760|Mostyn]]''
|-
| style='text-align:right'| 8020
| ''[[:d:Q20734634|William Hopkyn Rees]]''
|
| 1859-04-24
| 1924-08-04
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 8021
| ''[[:d:Q20734636|William Howells]]''
|
| 1818-10
| 1888-11-15
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 8022
| ''[[:d:Q20734637|William Hubert Davies]]''
|
| 1893-05-24
| 1965-10-27
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 8023
| ''[[:d:Q20734638|William Hugh Evans]]''
| [[File:Gwyllt y Mynydd.jpg|center|128px]]
| 1831
| 1909-06-28
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 8024
| ''[[:d:Q20734639|William Hughes]]''
|
| 1757-06-25
| 1846-03-09
| ''[[:d:Q3400157|Llanwnda]]''
|-
| style='text-align:right'| 8025
| ''[[:d:Q20734640|William Hughes]]''
|
| 1798
| 1866
| [[Llansantffraid-ym-Mechain]]
|-
| style='text-align:right'| 8026
| ''[[:d:Q20734641|William Hughes]]''
| [[File:William Hughes, Dolgellau.jpg|center|128px]]
| 1838-01-27
| 1921-02-23
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 8027
| ''[[:d:Q20734642|William Hughes]]''
|
| 1849-02-11
| 1920-03-29
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8028
| ''[[:d:Q20734643|William Jacob]]''
|
| 1777
| 1845-10-27
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8029
| ''[[:d:Q20734645|William James]]''
| [[File:Revd William James, Manchester (1833-1905) NLW3361817.jpg|center|128px]]
| 1833-03-15
| 1905-10-19
| ''[[:d:Q29496512|Ty'n Rhos]]''
|-
| style='text-align:right'| 8030
| ''[[:d:Q20734646|William James]]''
|
| 1836
| 1908-07-23
| ''[[:d:Q6787320|Mathry]]''
|-
| style='text-align:right'| 8031
| ''[[:d:Q20734647|William James]]''
| [[File:Revd William James, Aberdar (1848-1907) (U) NLW3365166.jpg|center|128px]]
| 1848-04-13
| 1907-10-26
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 8032
| ''[[:d:Q20734648|William Jenkin Davies]]''
| [[File:Parch William Jenkin Davies.jpg|center|128px]]
| 1858-01-30
| 1919-03-28
| ''[[:d:Q7837453|Trecynon]]''
|-
| style='text-align:right'| 8033
| ''[[:d:Q20734649|William John Evans]]''
|
| 1866-11-29
| 1947-12-12
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8034
| ''[[:d:Q20734650|William John Hughes]]''
|
| 1833-12
| 1879-06
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 8035
| ''[[:d:Q20734651|William John Hughes]]''
|
| 1891-09-10
| 1945-04-24
| ''[[:d:Q3402429|Groeslon]]''
|-
| style='text-align:right'| 8036
| ''[[:d:Q20734652|William John Nicholson]]''
| [[File:William John Nicholson.jpg|center|128px]]
| 1866-12-23
| 1943-11-25
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8037
| ''[[:d:Q20734654|William John Roberts]]''
|
| 1904
| 1967-04-22
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 8038
| ''[[:d:Q20734657|William Jones]]''
|
| 1814
| 1895-09-07
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 8039
| ''[[:d:Q20734661|William Jones]]''
|
| 1784
| 1847-06-05
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 8040
| ''[[:d:Q20734662|William Jones]]''
|
| 1790-08-01
| 1855-05-17
| ''[[:d:Q3401549|Llangadog]]''
|-
| style='text-align:right'| 8041
| ''[[:d:Q20734663|William Jones]]''
|
| 1806
| 1873-06-03
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 8042
| ''[[:d:Q20734665|William Jones]]''
| [[File:William Jones, Abergwaun.jpg|center|128px]]
| 1834-08-10
| 1895-03-24
| ''[[:d:Q4980803|Brymbo]]''
|-
| style='text-align:right'| 8043
| ''[[:d:Q20734666|William Jones]]''
|
| 1851-07-27
| 1931-07-26
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 8044
| ''[[:d:Q20734667|William Jones]]''
| [[File:William Jones (Bleddyn, 1829?-1903) (1876) NLW3362448.jpg|center|128px]]
| 1829
| 1903-01-30
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 8045
| ''[[:d:Q20734669|William Joseph Rhys]]''
|
| 1880-02-12
| 1967-10-22
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 8046
| ''[[:d:Q20734674|William Llewelyn]]''
|
| 1735
| 1803-01-30
| ''[[:d:Q5141668|Coity]]''
|-
| style='text-align:right'| 8047
| ''[[:d:Q20734675|William Lloyd]]''
|
| 1717
| 1777-12-18
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 8048
| ''[[:d:Q20734676|William Lloyd]]''
|
| 1901-02-14
| 1967-10-20
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 8049
| ''[[:d:Q20734677|William Matthews Williams]]''
|
| 1885-12-09
| 1972-11-11
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 8050
| ''[[:d:Q20734678|William Meirion Evans]]''
| [[File:Portrait of Rev. William Meirion Evans (4670715).jpg|center|128px]]
| 1826-08-12
| 1883-08-04
| ''[[:d:Q29483949|Isallt-fawr]]''
|-
| style='text-align:right'| 8051
| ''[[:d:Q20734680|William Morgan]]''
| [[File:Parch. William Morgan D.D. (1801-1872).jpg|center|128px]]
| 1801
| 1872-09-15
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 8052
| ''[[:d:Q20734681|William Morgan]]''
|
| 1818
| 1884-05-06
| ''[[:d:Q5714715|Henllan Amgoed]]''
|-
| style='text-align:right'| 8053
| ''[[:d:Q20734682|William Mortimer Lewis]]''
| [[File:Portrait of W. Mortimer Lewis (4670575).jpg|center|128px]]
| 1840
| 1880-10-18
| ''[[:d:Q6809972|Meidrim]]''
|-
| style='text-align:right'| 8054
| ''[[:d:Q20734684|William Nicholson]]''
| [[File:William Nicholson (Diwygwyr Cymru) (crop).jpg|center|128px]]
| 1844-04
| 1885-07-29
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8055
| ''[[:d:Q20734685|William Ogwen Williams]]''
|
| 1924-12-12
| 1969-05-03
| ''[[:d:Q787395|Llanfairfechan]]''
|-
| style='text-align:right'| 8056
| ''[[:d:Q20734688|William Owen]]''
|
| 1785
| 1864-02-15
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 8057
| ''[[:d:Q20734691|William Owen Jones]]''
|
| 1861-04-07
| 1937-05-14
| ''[[:d:Q3405649|Chwilog]]''
|-
| style='text-align:right'| 8058
| ''[[:d:Q20734692|William Owen Jones]]''
|
| 1868-12-29
| 1928-02-10
| ''[[:d:Q3395863|Llanbedr]]''
|-
| style='text-align:right'| 8059
| ''[[:d:Q20734694|William Pari Huws]]''
| [[File:William Pari Huws.jpg|center|128px]]
| 1853-09-27
| 1936-02-10
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 8060
| ''[[:d:Q20734695|William Philip Jones]]''
|
| 1878-11-21
| 1955-07-03
| ''[[:d:Q7837785|Trefin]]''
|-
| style='text-align:right'| 8061
| ''[[:d:Q20734699|William Prytherch]]''
| [[File:Portrait of Wm. Pryderch, Nantcaredig (4670464).jpg|center|128px]]
| 1804-04-25
| 1888-11-20
| ''[[:d:Q5200191|Cynwyl Gaeo]]''
|-
| style='text-align:right'| 8062
| ''[[:d:Q20734700|William Pugh]]''
| [[File:William Pugh of Brynllywarch, Kerry, D.L., M.A., J.P born 1783 and died 1842 (5236498).jpg|center|128px]]
| 1783-12-26<br/>1783
| 1842-03-04
| ''[[:d:Q3309484|Aberriw]]''
|-
| style='text-align:right'| 8063
| ''[[:d:Q20734701|William Reginald Herbert]]''
|
| 1841-02-14
| 1929-10-16
| ''[[:d:Q5137178|Clytha]]''
|-
| style='text-align:right'| 8064
| ''[[:d:Q20734702|William Richard Jones]]''
| [[File:William Richard Jones (Goleufryn 1840-1898).jpg|center|128px]]
| 1840
| 1898-07-11
| ''[[:d:Q10989811|Llanfrothen]]''
|-
| style='text-align:right'| 8065
| ''[[:d:Q20734704|William Robert Ambrose]]''
|
| 1832-01-19
| 1878-12-21
| ''[[:d:Q3398974|Bryncroes]]''
|-
| style='text-align:right'| 8066
| ''[[:d:Q20734705|William Robert Edwards]]''
|
| 1858-09-19
| 1921-02-23
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 8067
| ''[[:d:Q20734706|William Roger Hughes]]''
|
| 1898-05-27
| 1958-04-05
| ''[[:d:Q3400997|Llangristiolus]]''
|-
| style='text-align:right'| 8068
| ''[[:d:Q20734708|William Thomas]]''
| [[File:William Thomas, Hendy-Gwyn.jpg|center|128px]]
| 1832-03-26
| 1911-03-26
| ''[[:d:Q11157973|Llan-giwg]]''
|-
| style='text-align:right'| 8069
| ''[[:d:Q20734709|William Thomas Samuel]]''
| [[File:Portrait of William Thomas Samuel (4670518).jpg|center|128px]]
| 1852-10-17
| 1917-02-23
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8070
| ''[[:d:Q20734716|John Clough Williams-Ellis]]''
|
| 1833-03-11
| 1913-05-27
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8071
| ''[[:d:Q20737453|Bill Bower]]''
|
| 1911-11-17
| 1998-12
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8072
| ''[[:d:Q20737482|Eric Corbett]]''
|
| 1917-10-06
| 2002-04-06
| ''[[:d:Q6864241|Minera]]''
|-
| style='text-align:right'| 8073
| ''[[:d:Q20737583|Ingy Norman]]''
|
| 1911-04-02
| 1990-07-07
| [[Newport]]
|-
| style='text-align:right'| 8074
| ''[[:d:Q20738016|Alun Davies]]''
|
| 1924-01-06
| 1988-06-12
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 8075
| ''[[:d:Q20738017|Anthony Powel]]''
|
| 1560
| 1618
| ''[[:d:Q17738583|Llwydarth]]''
|-
| style='text-align:right'| 8076
| ''[[:d:Q20738023|Dafydd Roberts]]''
|
| 1892-08-18
| 1965-10-11
| ''[[:d:Q3402628|Capel Celyn]]''
|-
| style='text-align:right'| 8077
| ''[[:d:Q20738024|David Bowen]]''
|
| 1774-12-11
| 1853-11-18
| ''[[:d:Q5441920|Felinfoel]]''
|-
| style='text-align:right'| 8078
| ''[[:d:Q20738026|David Brazell]]''
| [[File:David Brazell (5294002) (cropped).jpg|center|128px]]
| 1875-02-23
| 1959-12-28
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8079
| ''[[:d:Q20738028|David Caxton Davies]]''
|
| 1873-08-08
| 1955-11-05
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 8080
| ''[[:d:Q20738031|David Emrys Lewis]]''
|
| 1887
| 1954-03-12
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 8081
| ''[[:d:Q20738033|David Francis Roberts]]''
|
| 1882-11-15
| 1945-09-09
| ''[[:d:Q3396864|Bontnewydd]]''
|-
| style='text-align:right'| 8082
| ''[[:d:Q20738035|David Jones]]''
|
| 1803
| 1868
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 8083
| ''[[:d:Q20738036|David Jones]]''
|
| 1808
| 1854-11-08
| ''[[:d:Q3272480|Llanpumsaint]]''
|-
| style='text-align:right'| 8084
| ''[[:d:Q20738041|David Samuel Owen]]''
|
| 1887-03-12
| 1959-03-26
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 8085
| ''[[:d:Q20738043|Daniel Thomas Davies]]''
|
| 1899<br/>1899-11
| 1966-05-19
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 8086
| ''[[:d:Q20738051|Edward Jones]]''
|
| 1838
| 1930-11-02
| ''[[:d:Q5276401|Dihewyd]]''
|-
| style='text-align:right'| 8087
| ''[[:d:Q20738055|Edward Pritchard]]''
|
| 1839-09
| 1900-05-11
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8088
| ''[[:d:Q20738063|Evan Williams]]''
|
| 1724-03-27
| 1758-05-02
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 8089
| ''[[:d:Q20738070|George Williams]]''
|
| 1879-12-02
| 1951-10-07
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 8090
| ''[[:d:Q20738071|Griffith Harris]]''
|
| 1811
| 1892-11-01
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8091
| ''[[:d:Q20738076|Gwilym Richard Jones]]''
|
| 1874-04-12
| 1953-02-03
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 8092
| ''[[:d:Q20738079|Harry Farr]]''
|
| 1874-06-11
| 1968-01-19
| [[Cairdiff]]
|-
| style='text-align:right'| 8093
| ''[[:d:Q20738081|Hugh Gordon Roberts]]''
|
| 1885-07-16
| 1961-12-20
| ''[[:d:Q29487242|Dolenog]]''
|-
| style='text-align:right'| 8094
| ''[[:d:Q20738082|Hugh Humphreys]]''
|
| 1817-09-17
| 1896-05-02
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8095
| ''[[:d:Q20738092|John Bowen Jones]]''
| [[File:John Bowen Jones.jpg|center|128px]]
| 1829-02-10
| 1905-12-10
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 8096
| ''[[:d:Q20738093|John Davies]]''
| [[File:John Davies (Siôn Gymro).jpg|center|128px]]
| 1804-03-05
| 1884-12-16
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 8097
| ''[[:d:Q20738095|John Davies]]''
| [[File:John Taihirion Davies (5348979).jpg|center|128px]]
| 1825
| 1904-09-16
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 8098
| ''[[:d:Q20738096|John Edwards]]''
|
| 1606
| 1660
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 8099
| ''[[:d:Q20738098|John Edwards]]''
|
| 1806-04-15
| 1887-01-20
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 8100
| ''[[:d:Q20738102|John Evans]]''
|
| 1790-11-22
| 1856-05-02
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 8101
| ''[[:d:Q20738105|John James]]''
|
| 1815
| 1869-03
| ''[[:d:Q3403327|Colwinston]]''
|-
| style='text-align:right'| 8102
| ''[[:d:Q20738110|John Parry]]''
|
| 1770-06-29
| 1820-06-25
| ''[[:d:Q13129619|Llanelian-yn-Rhos]]''
|-
| style='text-align:right'| 8103
| ''[[:d:Q20738116|John Rowland]]''
|
| 1816
| 1888-01-12
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 8104
| ''[[:d:Q20738118|John Thomas Pritchard]]''
|
| 1859-07-10
| 1890-08-21
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 8105
| ''[[:d:Q20738119|John Williams]]''
|
| 1806-06-20
| 1856-11-15
| ''[[:d:Q3404757|Llangoed]]''
|-
| style='text-align:right'| 8106
| ''[[:d:Q20738132|Margaret Jones]]''
| [[File:Miss Margaret Jones (Y Gymraes o Gaanan, -1902) NLW3364267.jpg|center|128px]]
| 1842
| 1902-10-18
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 8107
| ''[[:d:Q20738134|Michael Roberts]]''
|
| 1780
| 1849-01-29
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 8108
| ''[[:d:Q20738135|Morgan John Lewis]]''
|
| 1711
| 1771
| ''[[:d:Q4667220|Aberystruth]]''
|-
| style='text-align:right'| 8109
| ''[[:d:Q20738137|Morgan Jones]]''
| [[File:Portrait of Morgan Jones, Treluach i.e. Trelech, Carmarthenshire (4674166).jpg|center|128px]]
| 1768
| 1835-12-23
| ''[[:d:Q6662982|Llywel]]''
|-
| style='text-align:right'| 8110
| ''[[:d:Q20738141|Richard Humphreys Evans]]''
|
| 1904-04-08
| 1995-04-21
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8111
| ''[[:d:Q20738143|Richard Lloyd]]''
|
| 1771
| 1834-05-25
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 8112
| ''[[:d:Q20738145|Richard Newell]]''
|
| 1785-03-23
| 1852-06-22
| ''[[:d:Q4667113|Aberhafesp]]''
|-
| style='text-align:right'| 8113
| ''[[:d:Q20738146|Richard Prichard]]''
|
| 1811-03-31
| 1882-05-12
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8114
| ''[[:d:Q20738148|Richard Roberts Morris]]''
|
| 1852-06-20
| 1935-08-24
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 8115
| ''[[:d:Q20738149|Richard Thomas Evans]]''
|
| 1892-10-08
| 1962-06-13
| [[Penygraig]]
|-
| style='text-align:right'| 8116
| ''[[:d:Q20738151|Robert Gruffydd]]''
|
| 1832
| 1863-04
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 8117
| ''[[:d:Q20738153|Robert Jones]]''
| [[File:Y Parch. R. Jones, (Trebor Aled), Llansannan (5349003).jpg|center|128px]]
| 1866-10-04
| 1917-01-07
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 8118
| ''[[:d:Q20738154|Robert Owen Hughes]]''
| [[File:Robert Oliver Hughes (Elfyn).jpg|center|128px]]
| 1858-10-08
| 1919-06-14
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 8119
| ''[[:d:Q20738159|Ronald Cavill Mathias]]''
|
| 1912-09-21
| 1968-04-15
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 8120
| ''[[:d:Q20738162|Thomas Howells]]''
|
| 1839-10-12
| 1905-10-15
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 8121
| ''[[:d:Q20738164|Thomas Jesse Jones]]''
|
| 1873-08-04
| 1950-01-17
| ''[[:d:Q3402212|Llanfachreth]]''
|-
| style='text-align:right'| 8122
| ''[[:d:Q20738170|Thomas Stephen]]''
|
| 1856-02-24
| 1906-01-24
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 8123
| ''[[:d:Q20738174|Watcyn Samuel Jones]]''
|
| 1877-02-16
| 1964-10-17
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 8124
| ''[[:d:Q20738175|William Anthony Davies]]''
|
| 1886-03-01
| 1962-11-04
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 8125
| ''[[:d:Q20738177|William Bevan Lewis]]''
| [[File:Dr. William Bevan-Lewis Medical Director West Riding Asylum, Wakefield 1884-1910 (5294030).jpg|center|128px]]
| 1847-05-21
| 1929-10-14
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 8126
| ''[[:d:Q20738178|Willam Howell Lewis]]''
|
| 1793
| 1868
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8127
| ''[[:d:Q20738180|William James]]''
|
| 1761-03-15
| 1845-02-26
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 8128
| ''[[:d:Q20738183|William Lewes]]''
|
| 1652
| 1722-12
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8129
| ''[[:d:Q20738190|William Rees]]''
|
| 1808-07-08
| 1873-07-13
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 8130
| ''[[:d:Q20738194|William Thomas]]''
|
| 1891-11-27
| 1958-04-20
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 8131
| ''[[:d:Q20738195|William Williams]]''
|
| 1625
| 1684
| ''[[:d:Q13129615|Llannefydd]]''
|-
| style='text-align:right'| 8132
| ''[[:d:Q20738197|Zecharias Thomas]]''
|
| 1727-08-13
| 1816-01-16
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 8133
| ''[[:d:Q20738563|John Evan Thomas]]''
|
| 1884-07
| 1941-01-01<br/>1941-01-21
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 8134
| ''[[:d:Q20740720|Jamie Clarke]]''
|
| 1994-10-05
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8135
| ''[[:d:Q20741167|William Lewis]]''
|
| 1818-04-23
| 1895-04-12
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 8136
| ''[[:d:Q20744651|Julian Philips]]''
| [[File:Composer Julian Philips.jpg|center|128px]]
| 1969
|
| [[Wales]]
|-
| style='text-align:right'| 8137
| ''[[:d:Q20746350|Sarah Vine]]''
|
| 1967-04
|
| [[Wales]]
|-
| style='text-align:right'| 8138
| ''[[:d:Q20746754|Alfred William Sheen]]''
|
| 1869-04-30
| 1945
| [[Cairdiff]]
|-
| style='text-align:right'| 8139
| ''[[:d:Q20746755|Alun Ogwen Williams]]''
|
| 1904-10-02
| 1970-08-04
| ''[[:d:Q52083626|Gerlan]]''
|-
| style='text-align:right'| 8140
| ''[[:d:Q20746756|Arthur Wynn Williams]]''
|
| 1819
| 1886-11-15
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 8141
| ''[[:d:Q20746759|Benjamin Waldo Lewis]]''
|
| 1877-09-07
| 1953-12-31
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8142
| ''[[:d:Q20746761|Cliff Prothero]]''
|
| 1898-09-23
| 1990-10-24
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 8143
| ''[[:d:Q20746764|Daniel Jenkins]]''
|
| 1856-11-07
| 1946-11-18
| ''[[:d:Q16542738|Nantcwnlle]]''
|-
| style='text-align:right'| 8144
| ''[[:d:Q20746767|David Pugh]]''
|
| 1739
| 1816
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 8145
| ''[[:d:Q20746769|David Salmon]]''
|
| 1852-01-30
| 1944-12-14
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 8146
| ''[[:d:Q20746770|Ebenezer Richard]]''
| [[File:Portrait of Revd. Ebenezer Richard, Tregaron, Cardiganshire (4671915).jpg|center|128px]]
| 1781-12-05
| 1837-03-09
| ''[[:d:Q7837785|Trefin]]''
|-
| style='text-align:right'| 8147
| ''[[:d:Q20746775|Eliseus Howells]]''
|
| 1893-08
| 1969-08-16
| ''[[:d:Q5057255|Cefn Cribwr]]''
|-
| style='text-align:right'| 8148
| ''[[:d:Q20746777|Evan Hopkins]]''
|
| 1801
| 1884
| [[Swansea]]
|-
| style='text-align:right'| 8149
| ''[[:d:Q20746779|Evan Phillips]]''
|
| 1829-10-22
| 1912-09-29
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 8150
| ''[[:d:Q20746780|Laura Evans-Williams]]''
|
| 1883-09-07
| 1944-10-05
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 8151
| ''[[:d:Q20746781|Francis Green]]''
|
| 1854-12-15
| 1942-08-06
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8152
| ''[[:d:Q20746782|Francis Wynn Jones]]''
|
| 1898-01-15
| 1970-12-21
| ''[[:d:Q29481220|Branas Lodge]]''
|-
| style='text-align:right'| 8153
| ''[[:d:Q20746783|George Daniel Jones]]''
|
| 1877
| 1955-09-02
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 8154
| ''[[:d:Q20746785|George Henry Parcell]]''
|
| 1895-11-18
| 1967-03-08
| ''[[:d:Q5446227|Fforestfach]]''
|-
| style='text-align:right'| 8155
| ''[[:d:Q20746788|Ebenezer Griffith-Jones]]''
|
| 1860-02-05
| 1942-03-22
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8156
| ''[[:d:Q20746789|William Griffith-Jones]]''
|
| 1895-11-02
| 1961-07-10
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 8157
| ''[[:d:Q20746792|Howell Powell]]''
|
| 1819-10-26
| 1875-03-23
| [[Ystradgynlais]]
|-
| style='text-align:right'| 8158
| ''[[:d:Q20746794|Hugh Jerman]]''
| [[File:Self portrait by Hugh Jerman.jpg|center|128px]]
| 1836-09-28
| 1895-05-08
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 8159
| ''[[:d:Q20746795|Hugh Pugh]]''
|
| 1779-11-22
| 1809-10-28
| ''[[:d:Q15056704|Brithdir]]''
|-
| style='text-align:right'| 8160
| ''[[:d:Q20746796|Hugh Pugh]]''
| [[File:Revd Hugh Pugh (1803-68) NLW3365418.jpg|center|128px]]
| 1803-05
| 1868-12-23
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 8161
| ''[[:d:Q20746800|Idris Lewis]]''
|
| 1889-11-21
| 1952-04-05
| ''[[:d:Q4915735|Birchgrove]]''
|-
| style='text-align:right'| 8162
| ''[[:d:Q20746802|Isaac Price]]''
|
| 1735
| 1805-02-26
| ''[[:d:Q15242569|Llanwrtyd]]''
|-
| style='text-align:right'| 8163
| ''[[:d:Q20746803|Isaac Thomas]]''
|
| 1911-02-15
| 2004-05-23
| ''[[:d:Q7852544|Tumble]]''
|-
| style='text-align:right'| 8164
| ''[[:d:Q20746804|Ivor Llewelyn Foster]]''
| [[File:Ivor Llewelyn Foster (1870–1959).png|center|128px]]
| 1870-03-01
| 1959-03-29
| [[Pontypridd]]
|-
| style='text-align:right'| 8165
| ''[[:d:Q20746806|James Meyler]]''
|
| 1761
| 1825
| ''[[:d:Q29491175|Penysgwarne]]''
|-
| style='text-align:right'| 8166
| ''[[:d:Q20746812|John Evans]]''
|
| 1858-05-12
| 1963-01-01
| ''[[:d:Q927739|Llangrannog]]''
|-
| style='text-align:right'| 8167
| ''[[:d:Q20746814|John Penry]]''
|
| 1854-04-07
| 1883-04-21
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 8168
| ''[[:d:Q20746818|Henry Jones-Davies]]''
|
| 1870-01-02
| 1955-06-16
| ''[[:d:Q6661077|Llanarthney]]''
|-
| style='text-align:right'| 8169
| ''[[:d:Q20746821|Kathryn Jenkins]]''
|
| 1961-06-09
| 2009-05-03
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 8170
| ''[[:d:Q20746823|Leslie Alun Page]]''
|
| 1920
| 1990-07-13
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 8171
| ''[[:d:Q20746824|Lewis Powell]]''
| [[File:Portrait of Lewis Powell, Caerdydd (4673160).jpg|center|128px]]
| 1788-12-27
| 1869-09-16
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 8172
| ''[[:d:Q20746826|Ieuan Maddock]]''
| [[File:Ieuan Maddock.jpg|center|128px]]
| 1917-03-29
| 1988-12-29
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 8173
| ''[[:d:Q20746827|Maria James]]''
|
| 1793-10-11
| 1868-09-11
| [[Wales]]
|-
| style='text-align:right'| 8174
| ''[[:d:Q20746829|Meirion Jones]]''
|
| 1907-07-30
| 1970-03-11
| ''[[:d:Q285412|Llithfaen]]''
|-
| style='text-align:right'| 8175
| ''[[:d:Q20746831|Morgan Watkin]]''
|
| 1878-06-23
| 1970-09-07
| [[Swansea]]
|-
| style='text-align:right'| 8176
| ''[[:d:Q20746834|Owen Prys]]''
|
| 1857-09-25
| 1934-12-12
| ''[[:d:Q15987594|Pen-llwyn]]''
|-
| style='text-align:right'| 8177
| ''[[:d:Q20746839|Robert Piercy]]''
|
| 1825-01-25
| 1894-01-29
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 8178
| ''[[:d:Q20746840|Roger Price]]''
|
| 1834-02-24
| 1900-01-21
| ''[[:d:Q3404562|Merthyr Cynog]]''
|-
| style='text-align:right'| 8179
| ''[[:d:Q20746841|Rolant Eames]]''
|
| 1750
| 1825
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 8180
| ''[[:d:Q20746842|Sampson Thomas]]''
|
| 1739
| 1807
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 8181
| ''[[:d:Q20746843|Llewellyn Thomas Gordon Soulsby]]''
|
| 1885-01-24
| 1966-01-09
| [[Swansea]]
|-
| style='text-align:right'| 8182
| ''[[:d:Q20746844|Thomas John Jehu]]''
|
| 1871-02-19
| 1943-07-18
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 8183
| ''[[:d:Q20746845|Thomas Price]]''
|
| 1860-03-19
| 1933-12-13
| ''[[:d:Q7679221|Talerddig]]''
|-
| style='text-align:right'| 8184
| ''[[:d:Q20746846|Thomas William]]''
|
| 1697
| 1778-06-12
| ''[[:d:Q15987532|Mynydd Bach]]''
|-
| style='text-align:right'| 8185
| ''[[:d:Q20748812|Abraham Williams]]''
|
| 1720
| 1783
| ''[[:d:Q7131674|Panteg]]''
|-
| style='text-align:right'| 8186
| ''[[:d:Q20748813|Bleddyn Jones Roberts]]''
|
| 1906-04-21
| 1977-08-11
| ''[[:d:Q7165398|Pen-y-cae]]''
|-
| style='text-align:right'| 8187
| ''[[:d:Q20748814|Daniel Thomas Phillips]]''
|
| 1842-12-19
| 1905-01-03
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 8188
| ''[[:d:Q20748815|David James]]''
|
| 1865-08-17
| 1928-12-01
| ''[[:d:Q6540364|Libanus]]''
|-
| style='text-align:right'| 8189
| ''[[:d:Q20748816|David John Snell]]''
|
| 1880-08-01
| 1957-01-13
| [[Swansea]]
|-
| style='text-align:right'| 8190
| ''[[:d:Q20748822|Ellen Evans]]''
| [[File:Ellen Evans.jpg|center|128px]]
| 1891-03-10
| 1953-09-26
| ''[[:d:Q5530463|Gelli]]''
|-
| style='text-align:right'| 8191
| ''[[:d:Q20748824|Evan Moses]]''
|
| 1726
| 1805
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8192
| ''[[:d:Q20748826|Evan Richardson]]''
| [[File:Y Parch Evan Richardson.jpg|center|128px]]
| 1759
| 1824-03-29
| ''[[:d:Q3401728|Llandre]]''
|-
| style='text-align:right'| 8193
| ''[[:d:Q20748828|Evan Williams]]''
|
| 1749
| 1835-08-25
| ''[[:d:Q15963881|Swyddffynnon]]''
|-
| style='text-align:right'| 8194
| ''[[:d:Q20748831|Griffith William Hughes]]''
| [[File:Griffith William Hughes.jpg|center|128px]]
| 1861-02-22
| 1941-09-27
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 8195
| ''[[:d:Q20748832|Gwilym Cleaton Jones]]''
|
| 1875-03-25
| 1961-09-30
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 8196
| ''[[:d:Q20748833|Gwilym Gwalchmai Jones]]''
|
| 1921-01-04
| 1970-01-12
| ''[[:d:Q6661318|Llanerfyl]]''
|-
| style='text-align:right'| 8197
| ''[[:d:Q20748835|Henry Thomas Payne]]''
|
| 1759-11-30<br/>No/unknown value
| 1832-04-22<br/>1832
| ''[[:d:Q13129643|Llangattock]]''
|-
| style='text-align:right'| 8198
| ''[[:d:Q20748838|Idris Frederick Parry]]''
|
| 1916-12-05
| 2008-01-25
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8199
| ''[[:d:Q20748839|Isaac John Williams]]''
|
| 1874-04-10<br/>1876
| 1939-12-25<br/>1939
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8200
| ''[[:d:Q20748841|Iwan James Morgan]]''
|
| 1904
| 1966-04-01
| ''[[:d:Q3404696|Tondu]]''
|-
| style='text-align:right'| 8201
| ''[[:d:Q20748843|James Phillips]]''
|
| 1810
| 1877-11-20
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 8202
| ''[[:d:Q20748845|John Alwyn Charles]]''
|
| 1924-12-18
| 1977-03-31
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8203
| ''[[:d:Q20748847|John Breese Davies]]''
|
| 1893-02-22
| 1940-10-04
| ''[[:d:Q5277968|Dinas Mawddwy]]''
|-
| style='text-align:right'| 8204
| ''[[:d:Q20748848|John Daniel Vernon Lewis]]''
|
| 1879-06-13
| 1970-12-28
| [[Swansea]]
|-
| style='text-align:right'| 8205
| ''[[:d:Q20748849|John David Lewis]]''
|
| 1859-01-22
| 1914-09-30
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 8206
| ''[[:d:Q20748854|Joshua Watkins]]''
|
| 1769
| 1841-06-22
| ''[[:d:Q6661562|Llangynidr]]''
|-
| style='text-align:right'| 8207
| ''[[:d:Q20748859|Margaret Thomas]]''
|
| 1779
|
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 8208
| ''[[:d:Q20748860|Micah Thomas]]''
|
| 1778-02-19
| 1853-11-28
| ''[[:d:Q7996795|Whitson]]''
|-
| style='text-align:right'| 8209
| ''[[:d:Q20748862|Morgan Williams]]''
|
| 1808
| 1883-10-17
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8210
| ''[[:d:Q20748864|Owen Davies Tudor]]''
|
| 1818-07-19
| 1887-11-14
| ''[[:d:Q17738143|Garth Isaf]]''
|-
| style='text-align:right'| 8211
| ''[[:d:Q20748865|Owen Herbert Williams]]''
|
| 1884-01-02
| 1962-03-10
| ''[[:d:Q6661329|Llanfaelog]]''
|-
| style='text-align:right'| 8212
| ''[[:d:Q20748866|Owen Rees]]''
|
| 1717
| 1768-03-14
| ''[[:d:Q3403140|Llanfair-ar-y-bryn]]''
|-
| style='text-align:right'| 8213
| ''[[:d:Q20748868|Richard Powel]]''
|
| 1769
| 1795-10
| ''[[:d:Q13129617|Llanegryn]]''
|-
| style='text-align:right'| 8214
| ''[[:d:Q20748879|Thomas Jones Wheldon]]''
| [[File:Thomas J Wheldon.jpg|center|128px]]
| 1841-03-10
| 1916-10-28
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 8215
| ''[[:d:Q20748881|Thomas Mordaf Pierce]]''
|
| 1867-12-23
| 1919-05-13
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 8216
| ''[[:d:Q20748882|Thomas Phillips]]''
|
| 1772-03-29
| 1842-12-22
| ''[[:d:Q3404590|Llanfihangel-ar-Arth]]''
|-
| style='text-align:right'| 8217
| ''[[:d:Q20748883|Thomas Phillips]]''
| [[File:Thomas Phillips.jpg|center|128px]]
| 1868-01-05
| 1936-04-21
| ''[[:d:Q20594376|Llanycefn]]''
|-
| style='text-align:right'| 8218
| ''[[:d:Q20748896|William Charles Roberts]]''
| [[File:William Charles Roberts (1832–1903).png|center|128px]]
| 1832-09-23
| 1903-11-28<br/>1903-11-27
| ''[[:d:Q13129659|Llanllwchhaearn]]''
|-
| style='text-align:right'| 8219
| ''[[:d:Q20748897|William Craven Llewelyn]]''
|
| 1892-06-04
| 1966-01-04
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 8220
| ''[[:d:Q20748898|William Eifion Powell]]''
|
| 1934-11-07
| 2009-06-24
| ''[[:d:Q5197248|Cwmgors]]''
|-
| style='text-align:right'| 8221
| ''[[:d:Q20748899|William Emrys Evans]]''
|
| 1924-04-04
| 2004-07-18
| ''[[:d:Q20594649|Y Foel]]''
|-
| style='text-align:right'| 8222
| ''[[:d:Q20748900|William Evans]]''
|
| 1800-10-01
| 1880-04-02
| ''[[:d:Q7837772|Treffgarne]]''
|-
| style='text-align:right'| 8223
| ''[[:d:Q20748901|William Lewis Davies]]''
|
| 1896-02-23
| 1941-05-15
| ''[[:d:Q3406111|Llansawel]]''
|-
| style='text-align:right'| 8224
| ''[[:d:Q20748902|William Meloch Hughes]]''
| [[File:William Meloch Hughes (1860-1926).jpg|center|128px]]
| 1860-04-09
| 1926-03-28
| ''[[:d:Q4899221|Betws Gwerfil Goch]]''
|-
| style='text-align:right'| 8225
| ''[[:d:Q20748903|William Morris]]''
| [[File:Revd. William Morris.jpg|center|128px]]
| 1783
| 1861-12-08
| ''[[:d:Q5119942|Cilgerran]]''
|-
| style='text-align:right'| 8226
| ''[[:d:Q20748906|William Roberts]]''
|
| 1773
| 1857-10-14
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 8227
| ''[[:d:Q20748908|William Thomas]]''
|
| 1723
| 1811-08-22
| ''[[:d:Q6759079|Margam]]''
|-
| style='text-align:right'| 8228
| ''[[:d:Q20748909|William Thomas]]''
|
| 1727-07-29
| 1795-07-11
| ''[[:d:Q390036|Sain Ffagan]]''
|-
| style='text-align:right'| 8229
| ''[[:d:Q20748912|William Tudor Jones]]''
|
| 1865-09-08
| 1946-06-12
| ''[[:d:Q3401544|Pontrhydfendigaid]]''
|-
| style='text-align:right'| 8230
| ''[[:d:Q20751795|Alan Trevor Jones]]''
|
| 1901-02-24
| 1979-06-10
| ''[[:d:Q7162698|Pengam]]''
|-
| style='text-align:right'| 8231
| ''[[:d:Q20751796|Benjamin Haydn Williams]]''
|
| 1902-10-09
| 1965-05-29
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 8232
| ''[[:d:Q20751797|David Glyn Bowen]]''
|
| 1933-11-29
| 2000-05-15
| [[Swansea]]
|-
| style='text-align:right'| 8233
| ''[[:d:Q20751798|David Tegan Davies]]''
|
| 1883-02-27
| 1968-08-10
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 8234
| ''[[:d:Q20751801|Edward Evans]]''
|
| 1582
|
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 8235
| ''[[:d:Q20751802|Edwin Stephen Griffiths]]''
|
| 1869-08-26
| 1930-01-25
| ''[[:d:Q7162698|Pengam]]''
|-
| style='text-align:right'| 8236
| ''[[:d:Q20751803|Ewart Stanley John]]''
|
| 1924-05-20
| 2007-08-24
| ''[[:d:Q1770495|Goodwick]]''
|-
| style='text-align:right'| 8237
| ''[[:d:Q20751807|James Jubilee Young]]''
|
| 1887-05-15
| 1962-01-23
| ''[[:d:Q6729228|Maenclochog]]''
|-
| style='text-align:right'| 8238
| ''[[:d:Q20751809|John Daniel Davies]]''
|
| 1874-01-12
| 1948-04-09
| ''[[:d:Q5623864|Gwynfryn]]''
|-
| style='text-align:right'| 8239
| ''[[:d:Q20751810|John Emrys Jones]]''
|
| 1914
| 1991-12-24
| ''[[:d:Q1077377|Cynon Valley]]''
|-
| style='text-align:right'| 8240
| ''[[:d:Q20751811|John Hugh Michael]]''
|
| 1878-08-09
| 1959-01-06
| ''[[:d:Q3398922|Y Felinheli]]''
|-
| style='text-align:right'| 8241
| ''[[:d:Q20751812|John James Morgan]]''
|
| 1870-03
| 1954-01-23
| ''[[:d:Q3406117|Ysbyty Ystwyth]]''
|-
| style='text-align:right'| 8242
| ''[[:d:Q20751813|John Owen]]''
|
| 1864-04-17
| 1953-03-01
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 8243
| ''[[:d:Q20751817|Morris Thomas]]''
|
| 1874-07-08
| 1959-10-07
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 8244
| ''[[:d:Q20751820|Owain Llewelyn Owain]]''
| [[File:Owain Llew Owain.tif|center|128px]]
| 1877-07-03
| 1956-01-08
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 8245
| ''[[:d:Q20751821|Thomas Perrot]]''
|
|
| 1733-12-26
| ''[[:d:Q13129595|Llan-y-bri]]''
|-
| style='text-align:right'| 8246
| ''[[:d:Q20751823|William Rowland]]''
|
| 1887-07-16
| 1979-12-29
| ''[[:d:Q6661331|Llanfaelrhys]]''
|-
| style='text-align:right'| 8247
| ''[[:d:Q20751826|Stephen Owen Tudor]]''
|
| 1893-10-05
| 1967-06-30
| ''[[:d:Q7605133|Staylittle]]''
|-
| style='text-align:right'| 8248
| ''[[:d:Q20751827|Susannah Jane Rankin]]''
|
| 1897-11-26
| 1989-07-24
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 8249
| ''[[:d:Q20751828|Thomas Arwyn Watkins]]''
|
| 1924-06-20
| 2003-08-04
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 8250
| ''[[:d:Q20751829|Thomas Richards]]''
|
| 1800
| 1877-07-18
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 8251
| ''[[:d:Q20751832|Trevor Owen Davies]]''
|
| 1895-11-20
| 1966-04-10
| ''[[:d:Q13644946|Llanwrin]]''
|-
| style='text-align:right'| 8252
| ''[[:d:Q20751834|William Jones]]''
|
| 1863-04-12
| 1946-01-10
| ''[[:d:Q13127117|Cil-y-cwm]]''
|-
| style='text-align:right'| 8253
| ''[[:d:Q20751835|William Leslie Richards]]''
|
| 1916
| 1989-03-10
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 8254
| ''[[:d:Q20751837|William Roberts]]''
|
| 1828-07-01
| 1872
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 8255
| ''[[:d:Q20751841|William Thomas Edwards]]''
|
| 1821-12-06
| 1915-04-11
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 8256
| ''[[:d:Q20755087|Helen Thomas]]''
|
| 1966-08-16
| 1989-08-05
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 8257
| ''[[:d:Q20758210|Thomas Williams]]''
|
| 1761
| 1844-11-23
| ''[[:d:Q7162500|Pendoylan]]''
|-
| style='text-align:right'| 8258
| ''[[:d:Q20796502|John Doyle]]''
|
| 1968
|
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 8259
| ''[[:d:Q20804657|Mary Jane Evans]]''
|
| 1888-02-03
| 1922-02-25
| ''[[:d:Q7653726|Cwm Tawe]]''
|-
| style='text-align:right'| 8260
| ''[[:d:Q20804660|Alfred Phillips Morgan]]''
|
| 1857-05-21
| 1942-02-08
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 8261
| ''[[:d:Q20804661|Benjamin Jones]]''
|
| 1865-05-17
| 1953-12-16
| ''[[:d:Q6864597|Minffordd]]''
|-
| style='text-align:right'| 8262
| ''[[:d:Q20804668|Daniel Evan Jones]]''
|
| 1860-09-22
| 1941-08-18
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 8263
| ''[[:d:Q20804669|Daniel Phillips]]''
|
| 1826
| 1905
| [[Swansea]]
|-
| style='text-align:right'| 8264
| ''[[:d:Q20804670|David Christmas Williams]]''
| [[File:David Christmas Williams.jpg|center|128px]]
| 1871-09-12
| 1926-03-21
| ''[[:d:Q15242569|Llanwrtyd]]''
|-
| style='text-align:right'| 8265
| ''[[:d:Q20804671|David Ffrangcon Thomas]]''
|
| 1910-09-19
| 1963-12-10
| ''[[:d:Q7201803|Plasmarl]]''
|-
| style='text-align:right'| 8266
| ''[[:d:Q20804673|David John Lewis]]''
|
| 1879-12-28
| 1947-03-10
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 8267
| ''[[:d:Q20804675|David Morgan Richards]]''
|
| 1853-07-25
| 1913-06-02
| ''[[:d:Q6661685|Llanon]]''
|-
| style='text-align:right'| 8268
| ''[[:d:Q20804676|David Morris Jones]]''
|
| 1887-03-14
| 1957-10-08
| ''[[:d:Q1883614|Maenan]]''
|-
| style='text-align:right'| 8269
| ''[[:d:Q20804678|David Rees]]''
|
| 1751
| 1818-09-10
| ''[[:d:Q770818|Llanfynydd]]''
|-
| style='text-align:right'| 8270
| ''[[:d:Q20804679|David Robert Griffiths]]''
|
| 1915
| 1990-05-16
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 8271
| ''[[:d:Q20804680|David Rogers]]''
| [[File:David Rogers.jpg|center|128px]]
| 1783
| 1824-01
| ''[[:d:Q6661345|Llanfair Dyffryn Clwyd]]''
|-
| style='text-align:right'| 8272
| ''[[:d:Q20804681|David Rowland]]''
|
| 1795
| 1862-02-24
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 8273
| ''[[:d:Q20804682|David Saunders]]''
| [[File:Portrait of David Saunders (4670522).jpg|center|128px]]
| 1831-05-20
| 1892-10-14
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 8274
| ''[[:d:Q20804683|David Stanley Jones]]''
| [[File:David Stanley Jones.jpg|center|128px]]
| 1860-06-28
| 1919-02-07
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 8275
| ''[[:d:Q20804684|David Thomas]]''
|
| 1880-07-16
| 1967-06-27
| ''[[:d:Q6661359|Llanfechain]]''
|-
| style='text-align:right'| 8276
| ''[[:d:Q20804685|David Vaughan Thomas]]''
|
| 1873-03-15
| 1934-09-15
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 8277
| ''[[:d:Q20804686|David Williams]]''
|
| 1793
| 1845-05-01
| ''[[:d:Q6484919|Landore]]''
|-
| style='text-align:right'| 8278
| ''[[:d:Q20804688|David Young]]''
| [[File:Portrait of Revd. David Young (4671085).jpg|center|128px]]
| 1844-11-03
| 1913-08-04
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 8279
| ''[[:d:Q20804691|Dewi Aled Eirug Davies]]''
|
| 1922-02-05
| 1997-08-08
| ''[[:d:Q268367|Cwmllynfell]]''
|-
| style='text-align:right'| 8280
| ''[[:d:Q20804693|Edward Price]]''
| [[File:Portrait of Edward Price, Bangor (4670450).jpg|center|128px]]
| 1797-04-01
| 1887-01-30
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 8281
| ''[[:d:Q20804696|Edward William Thomas]]''
|
| 1814-01-29
| 1892-10-04
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 8282
| ''[[:d:Q20804698|Evan Evans]]''
|
| 1671
| 1721-10-11<br/>1721
| ''[[:d:Q3402958|Carno]]''
|-
| style='text-align:right'| 8283
| ''[[:d:Q20804699|Evan Owen Allen]]''
|
| 1805
| 1852-12-18
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 8284
| ''[[:d:Q20804701|Evan Williams]]''
|
| 1816
| 1878-10-02
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 8285
| ''[[:d:Q20804702|Evan Williams]]''
|
| 1706
|
| ''[[:d:Q1866840|Llangybi]]''
|-
| style='text-align:right'| 8286
| ''[[:d:Q20804703|George Roberts]]''
|
| 1769-02-11
| 1853-11
| ''[[:d:Q13130168|Mochdre]]''
|-
| style='text-align:right'| 8287
| ''[[:d:Q20804706|Glanville Rees Jeffreys Jones]]''
|
| 1923-12-12
| 1996-07-23
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 8288
| ''[[:d:Q20804707|Griffith Davies]]''
|
| 1868-02-05
| 1962-02-04
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 8289
| ''[[:d:Q20804709|Griffith Williams]]''
| [[File:Revd Griffith Williams, Talsarnau (1824-81) NLW3360979.jpg|center|128px]]
| 1824
| 1881-10-23
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 8290
| ''[[:d:Q20804712|Henry Thomas Jacob]]''
|
| 1864-12-14
| 1957-05-18
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 8291
| ''[[:d:Q20804713|James James]]''
|
| 1818-03-14
| 1843-07-30
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 8292
| ''[[:d:Q20804714|Jenkin James]]''
|
| 1875-12-28
| 1949-10-31
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 8293
| ''[[:d:Q20804715|John Cox]]''
| [[File:John Cox, died 1870.jpg|center|128px]]
| 1800-11
| 1870-02
| [[Aberystwyth]]
|-
| style='text-align:right'| 8294
| ''[[:d:Q20804716|John Davies]]''
| [[File:John Davies, Fronheulog, Llandderfel.jpg|center|128px]]
| 1781
| 1848-06-12
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 8295
| ''[[:d:Q20804717|John Edward Hughes]]''
|
| 1879-06-08
| 1959-04-10
| ''[[:d:Q5064823|Cerrigydrudion]]''
|-
| style='text-align:right'| 8296
| ''[[:d:Q20804720|John Powell]]''
|
| 1708
| 1795-03-25
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 8297
| ''[[:d:Q20804722|John Price]]''
|
| 1857-03-05
| 1930-04-21
| ''[[:d:Q6661425|Llangammarch Wells]]''
|-
| style='text-align:right'| 8298
| ''[[:d:Q20804723|John Price Roberts]]''
|
| 1854-02-07
| 1905-11-08
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 8299
| ''[[:d:Q20804724|John Pugh]]''
|
| 1744
| 1799-04-26
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 8300
| ''[[:d:Q20804725|John Pugh]]''
| [[File:John Pugh.jpg|center|128px]]
| 1846-01-29
| 1907-03-24
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 8301
| ''[[:d:Q20804726|John Roberts]]''
| [[File:John Roberts Llangwm.jpg|center|128px]]
| 1753-08-08
| 1834-11-03
| ''[[:d:Q3404501|Nantlle]]''
|-
| style='text-align:right'| 8302
| ''[[:d:Q20804728|John Roberts]]''
| [[File:Portrait of John Roberts (4670509).jpg|center|128px]]
| 1807-03-30
| 1876-04-04
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 8303
| ''[[:d:Q20804731|John Sparks]]''
|
| 1726
| 1769
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 8304
| ''[[:d:Q20804733|John Williams Hughes]]''
|
| 1888-01-06
| 1979-10-02
| ''[[:d:Q4980972|Brynhyfryd]]''
|-
| style='text-align:right'| 8305
| ''[[:d:Q20804734|John Young Evans]]''
|
| 1865-11-16
| 1941-12-26
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 8306
| ''[[:d:Q20804735|Joseph Jones]]''
|
| 1799
| 1871-12-02
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 8307
| ''[[:d:Q20804737|Lewis Jones Roberts]]''
| [[File:L. J. Roberts, Esq., M.A. (Oxon) (5236459) (cropped).jpg|center|128px]]
| 1866-05-29
| 1931-12-20
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 8308
| ''[[:d:Q20804739|Mary Owen]]''
| [[File:Portrait of Mary Owen (4670421) (cropped).jpg|center|128px]]
| 1796
| 1875-05-26
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 8309
| ''[[:d:Q20804742|Owen Owens Roberts]]''
|
| 1847-01-27
| 1926-11-26
| ''[[:d:Q7680325|Talsarnau]]''
|-
| style='text-align:right'| 8310
| ''[[:d:Q20804743|Owen Picton Davies]]''
|
| 1882-06-06
| 1970-10-10
| ''[[:d:Q7842265|Trimsaran]]''
|-
| style='text-align:right'| 8311
| ''[[:d:Q20804748|Rhys Thomas]]''
|
| 1720
| 1790-07-11
| No/unknown value<br/>''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8312
| ''[[:d:Q20804749|John Richard]]''
|
| 1720
| 1764
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 8313
| ''[[:d:Q20804750|Richard Davies (Isgarn)]]''
|
| 1887-08-29
| 1947-06-08
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 8314
| ''[[:d:Q20804751|Richard Roberts]]''
|
| 1796
| 1855-06-28
| ''[[:d:Q3404603|Ardudwy]]''
|-
| style='text-align:right'| 8315
| ''[[:d:Q20804752|Richard Samuel Hughes]]''
|
| 1888-06-18
| 1952-04-16
| ''[[:d:Q11015816|Rhostryfan]]''
|-
| style='text-align:right'| 8316
| ''[[:d:Q20804753|Richard Thomas]]''
|
| 1718-07-31
| 1807-01-29
| ''[[:d:Q13129631|Llanfechell]]''
|-
| style='text-align:right'| 8317
| ''[[:d:Q20804754|Richard Williams]]''
|
| 1802-01-31
| 1842-08-30
| ''[[:d:Q20601420|Winllan]]''
|-
| style='text-align:right'| 8318
| ''[[:d:Q20804755|Robert Ellis Vaughan Roberts]]''
|
| 1888-03-24
| 1962-03-03
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 8319
| ''[[:d:Q20804756|Robert Gwilym Hughes]]''
|
| 1910-08-17
| 1997-07-20
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 8320
| ''[[:d:Q20804757|Robert Henry Roberts]]''
| [[File:Robert Henry Roberts.jpg|center|128px]]
| 1838
| 1900-04-16
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8321
| ''[[:d:Q20804759|Robert Roberts]]''
| [[File:Portrait of Yr eiddoch yn diffuant Robert Roberts (4673015).jpg|center|128px]]
| 1774
| 1849-08-14
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 8322
| ''[[:d:Q20804760|Robert Roberts]]''
|
| 1777
| 1836-08-02
| No/unknown value<br/>''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8323
| ''[[:d:Q20804761|Robert Roberts]]''
|
| 1840-05-24
| 1871-02
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 8324
| ''[[:d:Q20804764|Robert Thomas]]''
| [[File:Robert Thomas, Llidiardau (1796-1866) NLW3365202.jpg|center|128px]]
| 1796-08-28
| 1866-12-16
| ''[[:d:Q203387|Betws-y-Coed]]''
|-
| style='text-align:right'| 8325
| ''[[:d:Q20804765|Robert William Jones]]''
|
| 1899
| 1968-01-07
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 8326
| ''[[:d:Q20804768|Benjamin Rowland]]''
|
| 1722
| 1763
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 8327
| ''[[:d:Q20804769|Ellis Rowland]]''
|
| 1621
| 1691
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 8328
| ''[[:d:Q20804771|Samuel Thomas]]''
|
| 1692
| 1766-09-07
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8329
| ''[[:d:Q20804775|Joseph Simmons]]''
|
| 1694
| 1774-05-12
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 8330
| ''[[:d:Q20804788|Thomas Bevan Phillips]]''
|
| 1898-04-11
| 1991-10-07
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 8331
| ''[[:d:Q20804790|Thomas Griffiths Jones]]''
|
| 1834-01-12
| 1884-09-10
| ''[[:d:Q3399417|Ponterwyd]]''
|-
| style='text-align:right'| 8332
| ''[[:d:Q20804792|Thomas James Rees]]''
|
| 1875-03-19
| 1957-12-24
| [[Swansea]]
|-
| style='text-align:right'| 8333
| ''[[:d:Q20804794|Thomas Jones]]''
|
| 1839-02-10
| 1916-10-22
| ''[[:d:Q16033773|Pen-Lôn]]''
|-
| style='text-align:right'| 8334
| ''[[:d:Q20804795|Thomas Michaeliones]]''
|
| 1880-05-01
| 1960-04-24
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 8335
| ''[[:d:Q20804796|Thomas Morgan Thomas]]''
|
| 1828-03-13
| 1884-01-08
| ''[[:d:Q6661593|Llanharan]]''
|-
| style='text-align:right'| 8336
| ''[[:d:Q20804797|Thomas Price]]''
| [[File:Tom Price, Merthyr.jpg|center|128px]]
| 1857
| 1925-07-08
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 8337
| ''[[:d:Q20804801|Thomas Roberts]]''
|
| 1735-03-31
| 1804
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 8338
| ''[[:d:Q20804804|Thomas Rowland]]''
|
| 1824-06-05
| 1884-04-17
| ''[[:d:Q10990404|Llanfor]]''
|-
| style='text-align:right'| 8339
| ''[[:d:Q20804806|Thomas Thomas]]''
|
| 1839
| 1888
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8340
| ''[[:d:Q20804807|Thomas Walters]]''
|
| 1729
| 1794-05-25
| ''[[:d:Q6947883|Mynyddislwyn]]''
|-
| style='text-align:right'| 8341
| ''[[:d:Q20804808|Timothy Thomas]]''
|
| 1694
| 1751-04-17
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 8342
| ''[[:d:Q20804809|Timothy Thomas]]''
|
| 1721-03-02
| 1768-11-12
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 8343
| ''[[:d:Q20804810|Tom Bryant]]''
|
| 1882-07-22
| 1946-01-13
| [[Pontypridd]]
|-
| style='text-align:right'| 8344
| ''[[:d:Q20804819|William Arthur Jones]]''
|
| 1892-04-05
| 1970-12-03
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8345
| ''[[:d:Q20804822|William Emyr Williams]]''
|
| 1889-05-24
| 1958-07-11
| ''[[:d:Q3405667|Llan Ffestiniog]]''
|-
| style='text-align:right'| 8346
| ''[[:d:Q20804824|William George]]''
| [[File:William George-brawd DLlG.jpg|center|128px]]
| 1865-02-23
| 1967-01-25
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 8347
| ''[[:d:Q20804826|William Gilbert Williams]]''
|
| 1874-01-20
| 1966-10-10
| ''[[:d:Q11015816|Rhostryfan]]''
|-
| style='text-align:right'| 8348
| ''[[:d:Q20804828|William Griffiths]]''
|
| 1898-06-06
| 1962-10-08
| ''[[:d:Q3401786|Gilfach Goch]]''
|-
| style='text-align:right'| 8349
| ''[[:d:Q20804830|William Morgan Roberts]]''
|
| 1853-10
| 1923-05-26
| ''[[:d:Q13129653|Llangynog]]''
|-
| style='text-align:right'| 8350
| ''[[:d:Q20804831|William Morris Lewis]]''
| [[File:William Morris Lewis.jpg|center|128px]]
| 1839-05-09
| 1917-05-26
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 8351
| ''[[:d:Q20804832|William Rhys Watkin]]''
|
| 1875-12-10
| 1947-12-16<br/>1947
| ''[[:d:Q8054082|Ynystawe]]''
|-
| style='text-align:right'| 8352
| ''[[:d:Q20804833|William Roberts]]''
| [[File:Revd William Roberts, Utica (1809-87) NLW3361775.jpg|center|128px]]
| 1809-09-25
| 1887
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 8353
| ''[[:d:Q20804834|William Saunders]]''
|
| 1871-05-24
| 1950-05-02
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8354
| ''[[:d:Q20804835|William Richard Williams]]''
|
| 1879-03-18
| 1961
| [[Pontypridd]]
|-
| style='text-align:right'| 8355
| ''[[:d:Q20804838|Winifred Mair Griffiths]]''
|
| 1916-06-06
| 1996-10-13
| [[Cairdiff]]
|-
| style='text-align:right'| 8356
| ''[[:d:Q20806930|Scott Barrow]]''
| [[File:Scott barrow york city 2021-22.jpg|center|128px]]
| 1988-10-19
|
| [[Swansea]]
|-
| style='text-align:right'| 8357
| ''[[:d:Q20807044|Sammy Brett]]''
|
| 1879-12-25
| 1939
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 8358
| ''[[:d:Q20810495|Silvanus Bevan]]''
|
| 1661
| 1725
| [[Swansea]]
|-
| style='text-align:right'| 8359
| ''[[:d:Q20811066|Richard Lewis Jenkins]]''
|
| 1815
| 1883-08-13
| [[Newport]]
|-
| style='text-align:right'| 8360
| ''[[:d:Q20811173|Thomas Lewis]]''
|
| 1821
| 1897-04-16
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8361
| ''[[:d:Q20811188|Lewis Lloyd]]''
|
| 1842-09-27
| 1902-02-12
| [[Sooth Wales]]
|-
| style='text-align:right'| 8362
| ''[[:d:Q20821089|Arthur Hughes]]''
|
| 1878-01-02
| 1965-06-25
| [[Gwynedd]]
|-
| style='text-align:right'| 8363
| ''[[:d:Q20821090|Bertie George Charles]]''
|
| 1908-02-13<br/>1908
| 2000-08-19
| ''[[:d:Q7837785|Trefin]]''
|-
| style='text-align:right'| 8364
| ''[[:d:Q20821092|Bowen Rees]]''
|
| 1857-03-16
| 1929-03-07
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 8365
| ''[[:d:Q20821093|Clifford Phillips]]''
|
| 1914-09-17
| 1984-08-09
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 8366
| ''[[:d:Q20821095|Daniel Howell Williams]]''
|
| 1894-06-27
| 1963-01-27
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 8367
| ''[[:d:Q20821097|David Brynmor Anthony]]''
|
| 1886-10-28
| 1966-01-24
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 8368
| ''[[:d:Q20821098|David Christopher Davies]]''
|
| 1878-07-16
| 1958-05-04
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 8369
| ''[[:d:Q20821099|David Cledlyn Evans]]''
|
| 1858
| 1940-06-21
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 8370
| ''[[:d:Q20821100|David Delta Evans]]''
| [[File:Rev. D. Delta Evans editor of The christian life. (5449744) (cropped).jpg|center|128px]]
| 1866
| 1948-05-22
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 8371
| ''[[:d:Q20821101|David Evans]]''
|
| 1886-11-18
| 1968-10-26
| ''[[:d:Q4923809|Blaenffos]]''
|-
| style='text-align:right'| 8372
| ''[[:d:Q20821102|David Griffith]]''
|
| 1841
| 1910-01-12
| ''[[:d:Q3396864|Bontnewydd]]''
|-
| style='text-align:right'| 8373
| ''[[:d:Q20821103|David Hughes]]''
|
| 1794
| 1862
| ''[[:d:Q12834837|Bryneglwys]]''
|-
| style='text-align:right'| 8374
| ''[[:d:Q20821104|David Hughes]]''
|
| 1800
| 1849-02-20
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 8375
| ''[[:d:Q20821105|David Jones]]''
|
| 1834-05-28
| 1890-07-11
| ''[[:d:Q13129633|Llanblethian]]''
|-
| style='text-align:right'| 8376
| ''[[:d:Q20821106|David Owen Jones]]''
|
| 1856-02-18
| 1903-08-07
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 8377
| ''[[:d:Q20821107|David Owen Roberts]]''
|
| 1888-10-06
| 1958-08-29
| ''[[:d:Q7837453|Trecynon]]''
|-
| style='text-align:right'| 8378
| ''[[:d:Q20821109|David Phillips]]''
|
| 1874
| 1951-08-06
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8379
| ''[[:d:Q20821110|David Rowland Hughes]]''
|
| 1874-09-09
| 1953-08-29<br/>1953
| ''[[:d:Q6729299|Maesglas]]''
|-
| style='text-align:right'| 8380
| ''[[:d:Q20821112|David Thomas Glyndŵr Richards]]''
|
| 1879-06-06
| 1956-07-17
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 8381
| ''[[:d:Q20821113|David Williams]]''
|
| 1702-08-02
| 1779
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 8382
| ''[[:d:Q20821117|Edmund Evans]]''
|
| 1791-07-09
| 1864-10-09
| ''[[:d:Q6661176|Llandecwyn]]''
|-
| style='text-align:right'| 8383
| ''[[:d:Q20821119|Edward Jones]]''
| [[File:Dr Edward Jones Dolgellau.jpg|center|128px]]
| 1834-01-21
| 1900-02-05
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 8384
| ''[[:d:Q20821120|Edward Lewis Ellis]]''
|
| 1922-03-21
| 2008-03-02
| [[Aberystwyth]]
|-
| style='text-align:right'| 8385
| ''[[:d:Q20821121|Edward Owen]]''
|
| 1853-03-09
| 1943-11-08
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 8386
| ''[[:d:Q20821122|Edward Owen Humphreys]]''
|
| 1899-11-02
| 1959-05-11
| ''[[:d:Q5057281|Cefnddwysarn]]''
|-
| style='text-align:right'| 8387
| ''[[:d:Q20821123|Edward Williams]]''
|
| 1818-12-29
| 1880-04-08
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 8388
| ''[[:d:Q20821124|Edward Williams]]''
|
| 1826-02-10
| 1886-06-09
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8389
| ''[[:d:Q20821127|Eurys Ionor Rowlands]]''
|
| 1926
| 2006-04-18
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8390
| ''[[:d:Q20821129|Evan Jenkins]]''
|
| 1781
| 1863-04-04
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 8391
| ''[[:d:Q20821130|Evan Lewis]]''
|
| 1788
| 1864-07-28
| ''[[:d:Q55869864|Cwm Gwanas]]''
|-
| style='text-align:right'| 8392
| ''[[:d:Q20821131|Evan Lloyd]]''
|
| 1800
| 1879-05-02
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 8393
| ''[[:d:Q20821132|Evan Roberts]]''
|
| 1836-12-18
| 1918-11-28
| ''[[:d:Q2599085|Gwyddelwern]]''
|-
| style='text-align:right'| 8394
| ''[[:d:Q20821135|Frank Treharne James]]''
|
| 1861
| 1942-02-15
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8395
| ''[[:d:Q20821136|Garfield Hopkin Hughes]]''
|
| 1912-12-13
| 1969-09-16
| ''[[:d:Q5714075|Hendy]]''
|-
| style='text-align:right'| 8396
| ''[[:d:Q20821138|Griffith Rowlands]]''
| [[File:Portrait of Griffith Rowlands Esqr (4669928) (cropped).jpg|center|128px]]
| 1761-04-09
| 1828-03-29
| ''[[:d:Q1024935|Harlech]]''
|-
| style='text-align:right'| 8397
| ''[[:d:Q20821141|Henry Gethin Lewis]]''
|
| 1872-04-05
| 1945-02-09
| ''[[:d:Q7228312|Pontlotyn]]''
|-
| style='text-align:right'| 8398
| ''[[:d:Q20821142|Henry Morgan Stafford Thomas]]''
|
| 1896-07-13
| 1968-12-06
| ''[[:d:Q4923162|Blackmill]]''
|-
| style='text-align:right'| 8399
| ''[[:d:Q20821143|Howel Harris Hughes]]''
|
| 1873-09-07
| 1956-11-23
| ''[[:d:Q13129624|Llanfair-Mathafarn-Eithaf]]''
|-
| style='text-align:right'| 8400
| ''[[:d:Q20821144|Howell Thomas Evans]]''
| [[File:Howell T. Evans fishing in the Aeron river (5449712).jpg|center|128px]]
| 1877-11-06<br/>1877
| 1950-04-30<br/>1950
| ''[[:d:Q5197236|Cwmbwrla]]''
|-
| style='text-align:right'| 8401
| ''[[:d:Q20821145|Hugh John Owen]]''
|
| 1880-02-05
| 1961-06-29
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 8402
| ''[[:d:Q20821146|Hugh Jones]]''
| [[File:Revd Hugh Jones, Liverpool (1830-1911) NLW3361796.jpg|center|128px]]
| 1830-01-13
| 1911-05-26
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 8403
| ''[[:d:Q20821147|Hugh Jones]]''
| [[File:Portrait of Dr. Hugh Jones (of Llangollen) (4670596).jpg|center|128px]]
| 1831-07-10
| 1883-05-28
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 8404
| ''[[:d:Q20821148|Hugh Jones]]''
|
| 1845
| 1891-12-09
| ''[[:d:Q13129629|Llanfihangel Glyn Myfyr]]''
|-
| style='text-align:right'| 8405
| ''[[:d:Q20821149|Hugh Thomas Davies]]''
|
| 1881-04-05
| 1969-03-14
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 8406
| ''[[:d:Q20821150|Hugh Williams]]''
|
| 1796-02-18
| 1874-10-19
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 8407
| ''[[:d:Q20821151|Hugh Williams]]''
|
| 1862
| 1953-08-25
| ''[[:d:Q15272454|Rhosybol]]''
|-
| style='text-align:right'| 8408
| ''[[:d:Q20821152|Humphrey Rowland Jones]]''
|
| 1832-10-11
| 1895-05-08
| ''[[:d:Q6661559|Llangynfelyn]]''
|-
| style='text-align:right'| 8409
| ''[[:d:Q20821153|Irwyn Ranald Walters]]''
|
| 1902-12-06
| 1992-11-21
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 8410
| ''[[:d:Q20821154|James Cornelius Morrice]]''
|
| 1874-12-10
| 1953-01-22
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 8411
| ''[[:d:Q20821155|T. I. Jeffreys Jones]]''
|
| 1909-06-27
| 1967-01-14
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 8412
| ''[[:d:Q20821156|John Davies]]''
|
| 1882-05-05
| 1937-12-05
| ''[[:d:Q14508467|Blaenpennal]]''
|-
| style='text-align:right'| 8413
| ''[[:d:Q20821157|John Edward Jones]]''
|
| 1886-05-12
| 1934-08-13
| ''[[:d:Q6729249|Maentwrog]]''
|-
| style='text-align:right'| 8414
| ''[[:d:Q20821158|John Eiddon Jones]]''
|
| 1841-05-08
| 1903-10-15
| ''[[:d:Q13131064|Rhydymain]]''
|-
| style='text-align:right'| 8415
| ''[[:d:Q20821159|John Evans]]''
| [[File:John Evans, Archddiacon Meirionnydd.jpg|center|128px]]
| 1815-03-04
| 1891-05-24
| ''[[:d:Q3402179|Llanfair]]''
|-
| style='text-align:right'| 8416
| ''[[:d:Q20821161|John Ithel Jones]]''
|
| 1911<br/>1911-01-01
| 1980-12-30
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 8417
| ''[[:d:Q20821163|John James]]''
|
| 1815
| 1851-03
| ''[[:d:Q3403327|Colwinston]]''
|-
| style='text-align:right'| 8418
| ''[[:d:Q20821164|John James Jones]]''
|
| 1892-03-12
| 1957-02-20
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 8419
| ''[[:d:Q20821165|John John Williams]]''
|
| 1884-07-12
| 1950-12-29
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8420
| ''[[:d:Q20821166|John Jones Owen]]''
|
| 1876-05-02
| 1947-04-21
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 8421
| ''[[:d:Q20821167|John Lloyd]]''
|
| 1885-07-11
| 1964-01-17
| ''[[:d:Q7680325|Talsarnau]]''
|-
| style='text-align:right'| 8422
| ''[[:d:Q20821168|John Mather Jones]]''
|
| 1826-06-09
| 1874-12-21
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8423
| ''[[:d:Q20821169|John Pierce]]''
|
| 1889-08-10
| 1955-01-19
| ''[[:d:Q3402761|Llandegfan]]''
|-
| style='text-align:right'| 8424
| ''[[:d:Q20821170|John Rhaiadore Evans]]''
|
| 1790
| 1850
| [[Llanrhaeadr-ym-Mochnant]]
|-
| style='text-align:right'| 8425
| ''[[:d:Q20821171|John Roberts]]''
|
| 1910<br/>1910-06-02
| 1984-11-22
| ''[[:d:Q3402312|Llanfachraeth]]''
|-
| style='text-align:right'| 8426
| ''[[:d:Q20821177|John Thomas]]''
|
| 1886-04-02
| 1933-01-18
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 8427
| ''[[:d:Q20821178|John Victor Evans]]''
|
| 1895-10-07
| 1957-05-15
| ''[[:d:Q5197238|Cwmdare]]''
|-
| style='text-align:right'| 8428
| ''[[:d:Q20821180|John William Jones]]''
|
| 1883-03-05
| 1954-01-06
| ''[[:d:Q3398814|Tanygrisiau]]''
|-
| style='text-align:right'| 8429
| ''[[:d:Q20821182|John Williams]]''
|
| 1747
| 1831-08-29
| ''[[:d:Q3401544|Pontrhydfendigaid]]''
|-
| style='text-align:right'| 8430
| ''[[:d:Q20821183|John Williams]]''
|
| 1768-03-08
| 1825-05-22
| ''[[:d:Q990100|Dolbenmaen]]''
|-
| style='text-align:right'| 8431
| ''[[:d:Q20821185|John Williams]]''
|
| 1856-10-26
| 1917-11-25
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8432
| ''[[:d:Q20821186|William Jones]]''
|
| 1888-06-27
| 1961-06-07
| ''[[:d:Q5530467|Gellifor]]''
|-
| style='text-align:right'| 8433
| ''[[:d:Q20821189|Lewis John Thomas]]''
|
| 1883-02-02
| 1970-04-17
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 8434
| ''[[:d:Q20821191|Richard Martin]]''
|
| 1843<br/>1843-08
| 1922-09-11
| [[Swansea]]
|-
| style='text-align:right'| 8435
| ''[[:d:Q20821192|Morris Davies]]''
|
| 1891-06-24
| 1961-04-16
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 8436
| ''[[:d:Q20821194|Owen Williams]]''
|
| 1774-07
| 1839
| ''[[:d:Q6661266|Llandyfrydog]]''
|-
| style='text-align:right'| 8437
| ''[[:d:Q20821195|Owen Williams]]''
|
| 1865-10-08
| 1928-11-11
| ''[[:d:Q6661549|Llangwyllog]]''
|-
| style='text-align:right'| 8438
| ''[[:d:Q20821199|Peter Edwards]]''
|
| 1854
| 1934-07-23
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 8439
| ''[[:d:Q20821200|Peter Price]]''
|
| 1864-07-11
| 1940-07-01
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 8440
| ''[[:d:Q20821201|Philip Scott Yorke]]''
|
| 1905<br/>1905-03-23
| 1976
| ''[[:d:Q5385260|Erddig]]''
|-
| style='text-align:right'| 8441
| ''[[:d:Q20821204|Richard Jenkin Rees]]''
|
| 1868-09-10
| 1963-04-30
| ''[[:d:Q7162075|Pen-y-garn]]''
|-
| style='text-align:right'| 8442
| ''[[:d:Q20821206|Richard Jones]]''
|
| 1838-06-03
| 1925-02-04
| ''[[:d:Q3402312|Llanfachraeth]]''
|-
| style='text-align:right'| 8443
| ''[[:d:Q20821208|Richard Roberts]]''
| [[File:Portrait of Rev. Richard Roberts (London) (4670533) (cropped).jpg|center|128px]]
| 1823-05-30
| 1909-11-28
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 8444
| ''[[:d:Q20821209|Richard Samuel Rogers]]''
|
| 1882-08-12
| 1950-02-21
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8445
| ''[[:d:Q20821212|Robert Meirion Roberts]]''
|
| 1906-11-28
| 1967-01-11
| ''[[:d:Q772694|Llandrillo]]''
|-
| style='text-align:right'| 8446
| ''[[:d:Q20821213|Robert Rolfe Williams]]''
|
| 1870
| 1948-07-26
| ''[[:d:Q6661651|Llannon]]''
|-
| style='text-align:right'| 8447
| ''[[:d:Q20821214|Robert Stephen]]''
|
| 1878-09-30
| 1966-01-02
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 8448
| ''[[:d:Q20821215|George Fossett Roberts]]''
|
| 1870-11-01
| 1954-04-08
| [[Aberystwyth]]
|-
| style='text-align:right'| 8449
| ''[[:d:Q20821216|John Rowland]]''
|
| 1877-06-01
| 1941-01-02
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 8450
| ''[[:d:Q20821217|Samuel James Leeke]]''
|
| 1888-03-28
| 1966-12-31
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 8451
| ''[[:d:Q20821218|Roger Thomas]]''
|
| 1886-05-04
| 1960-09-19
| ''[[:d:Q5137116|Clynderwen]]''
|-
| style='text-align:right'| 8452
| ''[[:d:Q20821219|Thomas Carrington]]''
|
| 1881-11-24
| 1961-05-06
| ''[[:d:Q5623864|Gwynfryn]]''
|-
| style='text-align:right'| 8453
| ''[[:d:Q20821221|Thomas Arthur Levi]]''
|
| 1874-12-18
| 1954-01-24
| [[Swansea]]
|-
| style='text-align:right'| 8454
| ''[[:d:Q20821222|Thomas Davies James]]''
|
| 1862-08-13
| 1927-07-30
| ''[[:d:Q3285155|Manafon]]''
|-
| style='text-align:right'| 8455
| ''[[:d:Q20821223|Thomas Ivor Jones]]''
|
| 1896-06-13
| 1969-03-29
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 8456
| ''[[:d:Q20821225|Thomas Lewis]]''
|
| 1868-12-14
| 1953-05-22
| ''[[:d:Q4923824|Blaenycoed]]''
|-
| style='text-align:right'| 8457
| ''[[:d:Q20821229|Thomas Williams Chance]]''
|
| 1872-08-23
| 1954-12-22
| ''[[:d:Q5396240|Erwood]]''
|-
| style='text-align:right'| 8458
| ''[[:d:Q20821230|Tom Ellis Jones]]''
|
| 1900-08-04
| 1975-11-16
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 8459
| ''[[:d:Q20821233|William Davies]]''
|
| 1874-06-06
| 1949-06-19
| ''[[:d:Q13129617|Llanegryn]]''
|-
| style='text-align:right'| 8460
| ''[[:d:Q20821234|William Ewart Williams]]''
|
| 1894-03-03
| 1966-04-29
| ''[[:d:Q29499117|Bodgarad]]''
|-
| style='text-align:right'| 8461
| ''[[:d:Q20821235|William Gareth Evans]]''
|
| 1941-12-14
| 2000-03-28
| ''[[:d:Q5200185|Cynwyd]]''
|-
| style='text-align:right'| 8462
| ''[[:d:Q20821237|William Hubert Vaughan]]''
|
| 1894-03-21
| 1959-04-17
| ''[[:d:Q7359368|Rogerstone]]''
|-
| style='text-align:right'| 8463
| ''[[:d:Q20821238|William Hugh Owen]]''
|
| 1886-02-16
| 1957-02-21
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8464
| ''[[:d:Q20821239|William Hughes]]''
|
| 1779
| 1836
| ''[[:d:Q7162070|Pen-y-clawdd]]''
|-
| style='text-align:right'| 8465
| ''[[:d:Q20821241|William Jones Williams]]''
|
| 1891-05-09
| 1945-04-15
| ''[[:d:Q7162078|Pen-y-groes]]''
|-
| style='text-align:right'| 8466
| ''[[:d:Q20821242|William Lloyd]]''
|
| 1786
| 1852-06-07
| ''[[:d:Q3402021|Llaniestyn]]''
|-
| style='text-align:right'| 8467
| ''[[:d:Q20821243|William Morris Williams]]''
|
| 1883-01-17
| 1954-12-30
| ''[[:d:Q3398814|Tanygrisiau]]''
|-
| style='text-align:right'| 8468
| ''[[:d:Q20821244|William Prichard Williams]]''
|
| 1848
| 1916-07-31<br/>1916
| ''[[:d:Q3405667|Llan Ffestiniog]]''
|-
| style='text-align:right'| 8469
| ''[[:d:Q20821245|William Richard Owen]]''
|
| 1906-07-22
| 1982-08-31
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8470
| ''[[:d:Q20821246|William Robert Hughes]]''
|
| 1798
| 1879-03-15
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 8471
| ''[[:d:Q20821248|William Thomas]]''
|
| 1856-09-25
| 1932-08-05
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8472
| ''[[:d:Q20821249|William Williams]]''
|
| 1732-12
| 1799-08-13
| ''[[:d:Q20007214|Llanfair-Nant-Gwyn]]''
|-
| style='text-align:right'| 8473
| ''[[:d:Q20821250|William Williams]]''
|
| 1748
| 1820-05-12
| ''[[:d:Q13127117|Cil-y-cwm]]''
|-
| style='text-align:right'| 8474
| ''[[:d:Q20821251|William Wyn Williams]]''
|
| 1876-07-12
| 1936-11-12
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 8475
| ''[[:d:Q20821415|David Jenkins Morgan]]''
|
| 1884-09-23
| 1949-05-18
| ''[[:d:Q922270|Llanddewi Brefi]]''
|-
| style='text-align:right'| 8476
| ''[[:d:Q20821416|David John Evans]]''
|
| 1884-07-01
| 1965-05-01
| ''[[:d:Q14508473|Capel Seion]]''
|-
| style='text-align:right'| 8477
| ''[[:d:Q20821417|David John Lloyd]]''
|
| 1886-03-06
| 1951-11-02
| [[Swansea]]
|-
| style='text-align:right'| 8478
| ''[[:d:Q20821418|David Jones]]''
|
| 1836
| 1878
| ''[[:d:Q6744334|Mallwyd]]''
|-
| style='text-align:right'| 8479
| ''[[:d:Q20821420|David Lloyd]]''
| [[File:Revd. Principal David Lloyd M.A., Ll.D.jpg|center|128px]]
| 1805
| 1863-09-03
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 8480
| ''[[:d:Q20821421|David William Richards]]''
|
| 1893-05-16
| 1949-04-24
| ''[[:d:Q6661278|Llanegwad]]''
|-
| style='text-align:right'| 8481
| ''[[:d:Q20821422|Edward Arthur Lewis]]''
|
| 1880-01-06
| 1942-01-07
| ''[[:d:Q6661527|Llangurig]]''
|-
| style='text-align:right'| 8482
| ''[[:d:Q20821423|Evan Thomas]]''
|
| 1733
| 1814-03-12
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 8483
| ''[[:d:Q20821424|Evan Thomas Griffiths]]''
|
| 1886-02-20
| 1967-11-06
| ''[[:d:Q3400083|Llanafan]]''
|-
| style='text-align:right'| 8484
| ''[[:d:Q20821425|George John]]''
|
| 1918-11-08
| 1994-01-06
| ''[[:d:Q5348102|Eglwyswen]]''
|-
| style='text-align:right'| 8485
| ''[[:d:Q20821426|Griffith Richard Maethlu Lloyd]]''
|
| 1902-01-25
| 1995-03-06
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8486
| ''[[:d:Q20821428|John Castell Evans]]''
|
| 1844-07-20
| 1909-05-13
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 8487
| ''[[:d:Q20821434|John Morgan Lloyd]]''
|
| 1880-08-19
| 1960-06-30
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 8488
| ''[[:d:Q20821435|John Powell Griffiths]]''
|
| 1875
| 1944-03-05
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 8489
| ''[[:d:Q20821437|John Williams]]''
|
| 1754-05-23
| 1828-06-05
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 8490
| ''[[:d:Q20821438|John Williams]]''
|
| 1825
| 1904
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 8491
| ''[[:d:Q20821439|Matthew W. Davies]]''
|
| 1882-08
| 1947-11-23
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8492
| ''[[:d:Q20821440|Richard Arthur Roberts]]''
|
| 1851-05-13
| 1943-04-02
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8493
| ''[[:d:Q20821441|Richard Thomas]]''
|
| 1871-09-08
| 1950-04-05
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 8494
| ''[[:d:Q20821443|Robert Evan Jones]]''
|
| 1869-05-22
| 1956-03-27
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 8495
| ''[[:d:Q20821446|William James Thomas]]''
|
| 1867-03-10
| 1945-01-03
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 8496
| ''[[:d:Q20821447|Thomas Hopkin Evans]]''
|
| 1879-03-06
| 1940-03-23
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 8497
| ''[[:d:Q20821448|Thomas Llechid Jones]]''
| [[File:T. Llechid Jones (5236454).jpg|center|128px]]
| 1867-12-04
| 1946-08-12
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 8498
| ''[[:d:Q20821449|Thomas Robert Jones]]''
|
| 1802
| 1856-05
| ''[[:d:Q13129615|Llannefydd]]''
|-
| style='text-align:right'| 8499
| ''[[:d:Q20821450|Thomas Roberts]]''
| [[File:Thomas Roberts, Bethesda.jpg|center|128px]]
| 1835-08-19
| 1899-11-24
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 8500
| ''[[:d:Q20821451|Thomas William]]''
|
| 1717
| 1765-12-16
| ''[[:d:Q5348100|Eglwys Ilan]]''
|-
| style='text-align:right'| 8501
| ''[[:d:Q20821456|William Saunders]]''
|
| 1806-01-17
| 1851-06-30
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 8502
| ''[[:d:Q20821458|William Thomas]]''
|
| 1749-08
| 1809-05
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 8503
| ''[[:d:Q20824262|John Thomas Jones]]''
|
| 1889-02-28
| 1952-04-04
| ''[[:d:Q6661278|Llanegwad]]''
|-
| style='text-align:right'| 8504
| ''[[:d:Q20858102|John McGrath]]''
|
| 1962-09-05
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 8505
| ''[[:d:Q20860216|Roger Jones]]''
|
| 1903
| 1982
| ''[[:d:Q28731132|Rhoshirwaun]]''
|-
| style='text-align:right'| 8506
| ''[[:d:Q20864810|Richard Rees]]''
|
| 1955-04-17
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8507
| ''[[:d:Q20865154|Derek Williams]]''
|
| 1942
| 2007
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 8508
| ''[[:d:Q20871825|Joseph Devries]]''
|
| 1994-07-12
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 8509
| ''[[:d:Q20876607|David Carpanini]]''
|
| 1946
|
| [[Wales]]
|-
| style='text-align:right'| 8510
| ''[[:d:Q20878085|Ryan Broom]]''
|
| 1996-11-24
|
| [[Newport]]
|-
| style='text-align:right'| 8511
| ''[[:d:Q20878155|Dafydd Jones]]''
|
| 1998-06-05
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 8512
| ''[[:d:Q20878173|Marcus Owen]]''
|
| 1935-04-04
| 1987-12
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 8513
| ''[[:d:Q20878221|Connor Roberts]]''
| [[File:Connor Roberts (footballer, born 1995), cropped image, Turkey vs Wales EURO 2020.jpg|center|128px]]
| 1995-09-23
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8514
| ''[[:d:Q20878227|Roy Andrewartha]]''
|
| 1938-04-23
| 2020-10-15
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 8515
| ''[[:d:Q20878239|Rick Smith]]''
| [[File:Rick Smith.jpg|center|128px]]
| 1959-05-25
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 8516
| ''[[:d:Q20878285|Josh Yorwerth]]''
| [[File:Josh Yorwerth.jpg|center|128px]]
| 1995-02-28
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8517
| ''[[:d:Q20888933|Owen Morris Roberts]]''
|
| 1906-03-28
| 1999-02-25
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 8518
| ''[[:d:Q20888934|Morgan Maddox Morgan-Owen]]''
|
| 1877-02-20
| 1950-08-14
| [[Wales]]
|-
| style='text-align:right'| 8519
| ''[[:d:Q20890211|Robert John Pryse]]''
|
| 1807-07-04
| 1889-10-03
| ''[[:d:Q3402694|Llanbadrig]]''
|-
| style='text-align:right'| 8520
| ''[[:d:Q20890214|Catherine Prichard]]''
| [[File:Catherine Prichard (Buddug).jpg|center|128px]]
| 1842-07-04
| 1909-03-29
| ''[[:d:Q4657278|Llanrhuddlad]]''
|-
| style='text-align:right'| 8521
| ''[[:d:Q20900626|Drew Sherman]]''
|
| 1987-06-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8522
| ''[[:d:Q20942797|Ken Jones]]''
|
| 1930-05-18
| 2015-08-02
| [[Wales]]
|-
| style='text-align:right'| 8523
| ''[[:d:Q20949588|J. Elwyn Hughes]]''
|
| 1940-03-09
| 2023-01-25
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 8524
| ''[[:d:Q20949696|Cynon]]''
|
|
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 8525
| ''[[:d:Q20955871|Huw Meredydd Robert]]''
|
| 20th century
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8526
| ''[[:d:Q20962418|Arnold Wienholt]]''
|
| 1826-01-22
| 1895-01-16
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 8527
| ''[[:d:Q20979145|Alex Samuel]]''
|
| 1995-09-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8528
| ''[[:d:Q20985688|Alan Rees]]''
|
| 1941-02-01
| 2005-10-02
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 8529
| ''[[:d:Q20988974|Jack Norman]]''
|
| 1909-08-02
| 1994-03-23
| [[Newport]]
|-
| style='text-align:right'| 8530
| ''[[:d:Q21000502|Geraint Stanley Jones]]''
|
| 1936-04-26
| 2015-08-25
| [[Pontypridd]]
|-
| style='text-align:right'| 8531
| ''[[:d:Q21004948|Lewis Bamford]]''
|
| 1997
|
| [[Newport]]
|-
| style='text-align:right'| 8532
| ''[[:d:Q21005409|Colin Roscoe]]''
|
| 1945-06-30
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 8533
| ''[[:d:Q21005591|Anne Denholm]]''
|
| 1991-07-29
|
| [[Wales]]
|-
| style='text-align:right'| 8534
| ''[[:d:Q21005762|Rob Evans]]''
|
| 1995-06-05<br/>1995-07-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8535
| ''[[:d:Q21030575|Charles Gough Howell]]''
|
| 1894
| 1942-09-12
| [[Cairdiff]]
|-
| style='text-align:right'| 8536
| ''[[:d:Q21030581|Alexa Davies]]''
| [[File:Alexa Davies on MTV International.jpg|center|128px]]
| 1995-08-18
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 8537
| ''[[:d:Q21030583|Dylan Wiliam]]''
| [[File:Dylan Wiliam LISE2006 podium.jpg|center|128px]]
| 20th century
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 8538
| ''[[:d:Q21030591|Gwenan Jones]]''
|
| 1889-11-03
| 1971-01-12
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 8539
| ''[[:d:Q21030612|Richard Owain Roberts]]''
| [[File:Richard Owain Roberts.png|center|128px]]
| 1982
|
| [[Anglesey]]
|-
| style='text-align:right'| 8540
| ''[[:d:Q21030613|Philip Salt]]''
|
| 1996-08-28
|
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 8541
| ''[[:d:Q21030617|The Gentle Good]]''
|
| 1981-04-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8542
| ''[[:d:Q21030620|Stephen Thomas]]''
|
| 1977-01-05
|
| ''[[:d:Q7080138|Ogmore Valley]]''
|-
| style='text-align:right'| 8543
| ''[[:d:Q21030640|Owen Harris]]''
|
| 1837
| 1905
| ''[[:d:Q6661154|Llanddeusant]]''
|-
| style='text-align:right'| 8544
| ''[[:d:Q21032001|Peter Rudeforth]]''
|
| 1963-03-20
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8545
| ''[[:d:Q21035496|William Jones]]''
|
| 1874
| 1936
| [[Wales]]
|-
| style='text-align:right'| 8546
| ''[[:d:Q21038704|Illtyd Harrington]]''
|
| 1931-07-14
| 2015-10-01
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 8547
| ''[[:d:Q21061998|Meredith Etherington-Smith]]''
|
| 1946
| 2020-01-25
| [[Wales]]
|-
| style='text-align:right'| 8548
| ''[[:d:Q21062381|Roger Matthews]]''
| [[File:Professor Roger Matthews in October 2019, a workshop in Sulaymaniyah, Iraq.jpg|center|128px]]
| 1954-08-21
|
| [[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 8549
| ''[[:d:Q21064622|Matt Protheroe]]''
| [[File:ProtheroeMatt.jpg|center|128px]]
| 1996-10-10
|
| [[Swansea]]
|-
| style='text-align:right'| 8550
| ''[[:d:Q21066421|Lara Stephen]]''
|
| 1993-09-01
|
| [[Powys]]
|-
| style='text-align:right'| 8551
| ''[[:d:Q21069708|David James]]''
| [[File:David James MHA.jpg|center|128px]]
| 1854
| 1926-07-21
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 8552
| ''[[:d:Q21078463|Eddie Dowdall]]''
|
| 1901
| 1968
| [[Newport]]
|-
| style='text-align:right'| 8553
| ''[[:d:Q21078465|Edward Enoch Jenkins]]''
|
| 1895
| 1960
| [[Cairdiff]]
|-
| style='text-align:right'| 8554
| ''[[:d:Q21079008|Doug Morgan]]''
|
| 1886-03-30
| 1958-11-21
| [[Newport]]
|-
| style='text-align:right'| 8555
| ''[[:d:Q21104246|Peter Molan]]''
|
| 1943-10-20
| 2015-09-16
| [[Cairdiff]]
|-
| style='text-align:right'| 8556
| ''[[:d:Q21155105|Charles Cullum]]''
|
| 1899-03-08
| 1979
| ''[[:d:Q17985748|Barry Docks]]''
|-
| style='text-align:right'| 8557
| ''[[:d:Q21165076|Hubert Rees]]''
|
| 1923-10-02
| 2009-09-13
| ''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 8558
| ''[[:d:Q21165253|Anthony Trafford James]]''
| [[File:Anthony Trafford James.jpg|center|128px]]
| 1922-03-06
| 2006-12-07
| [[Cairdiff]]
|-
| style='text-align:right'| 8559
| ''[[:d:Q21165576|John Aggleton]]''
|
| 1955-06-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8560
| ''[[:d:Q21165886|John Herbert Beynon]]''
|
| 1923-12-29
| 2015-08-24
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 8561
| ''[[:d:Q21165890|David Roger Jones Owen]]''
|
| 1942-05-27
| 2020-01-13
| ''[[:d:Q5004154|Bynea]]''
|-
| style='text-align:right'| 8562
| ''[[:d:Q21166454|Trevor Evans]]''
|
| 1927-04-26
| 2010-10-10
| ''[[:d:Q3404696|Tondu]]''
|-
| style='text-align:right'| 8563
| ''[[:d:Q21176250|Les Pearce]]''
|
| 1923-10-13
| 2018-04-21
| [[Swansea]]
|-
| style='text-align:right'| 8564
| ''[[:d:Q21176559|Reg Davies]]''
|
| 1909-11-24
| 1987-04-10
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 8565
| ''[[:d:Q21176942|Richard Methuen Greaves]]''
|
| 1852-11-14
| 1942-04-12
| ''[[:d:Q2035368|Tremadog]]''
|-
| style='text-align:right'| 8566
| ''[[:d:Q21181195|Nicholas Harrhy]]''
|
| 1982-09-14
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 8567
| ''[[:d:Q21246048|Sarah Savage]]''
|
| 1664-08-07
| 1752-02-27
| ''[[:d:Q684016|Flintshire]]''
|-
| style='text-align:right'| 8568
| ''[[:d:Q21284652|Tal Dunne]]''
| [[File:Tal dan.jpg|center|128px]]
| 1987-02-25
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8569
| ''[[:d:Q21284929|Paul Emanuelli]]''
| [[File:Paul Emanuelli.jpg|center|128px]]
| 1984-01-03
|
| [[Newport]]
|-
| style='text-align:right'| 8570
| ''[[:d:Q21285653|Geraint Walsh]]''
|
| 1988-05-19
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8571
| ''[[:d:Q21294997|Hayley Smith]]''
|
| 1965
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8572
| ''[[:d:Q21296968|John Evans]]''
| [[File:John Evans, astrologer 02354.jpg|center|128px]]
| 1595
| 1659
| [[Wales]]
|-
| style='text-align:right'| 8573
| ''[[:d:Q21345541|Jack Godderis]]''
|
| 1916-07-15<br/>1916-07-25
| 1971-04-07
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 8574
| ''[[:d:Q21387484|David Allen Lewis Davies]]''
|
| 1923-03-18
| 2003-03-02
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 8575
| ''[[:d:Q21389901|Stanley John Hughes]]''
|
| 1918-09-17
| 2019-11-07
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8576
| ''[[:d:Q21452756|Alfred Henry Morgan-Hall]]''
|
| 1900
| 1984
| [[Cairdiff]]
|-
| style='text-align:right'| 8577
| ''[[:d:Q21453970|Liam Hanley]]''
|
| 1933
|
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 8578
| ''[[:d:Q21454369|Howard J. Morgan]]''
|
| 1949-04-21
| 2020-09-22
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 8579
| ''[[:d:Q21454373|Howard Lloyd Roberts]]''
| [[File:Self Portrait (gcf02842).jpg|center|128px]]
| 1879
| 1935-12-22
| ''[[:d:Q894252|Borth]]''
|-
| style='text-align:right'| 8580
| ''[[:d:Q21454550|Hugh Douglas Williams]]''
|
| 1917-06-07
| 1969-11-05
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8581
| ''[[:d:Q21455047|Rose Dempster Bonnor]]''
|
| 1875
| 1967
| ''[[:d:Q12061339|Llangedwyn]]''
|-
| style='text-align:right'| 8582
| ''[[:d:Q21455263|Alfred Oliver]]''
|
| 1868
| 1943
| [[Wales]]
|-
| style='text-align:right'| 8583
| ''[[:d:Q21455479|Roy Slade]]''
|
| 1933
|
| [[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 8584
| ''[[:d:Q21455692|Manon Awst]]''
| [[File:Manon Awst portrait 2020.jpg|center|128px]]
| 1983
|
| [[Anglesey]]
|-
| style='text-align:right'| 8585
| ''[[:d:Q21455918|Sally Moore]]''
|
| 1962
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 8586
| ''[[:d:Q21456698|Andrzej Jackowski]]''
|
| 1947
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 8587
| ''[[:d:Q21456839|James Flewitt Mullock]]''
|
| 1818
| 1892
| [[Newport]]
|-
| style='text-align:right'| 8588
| ''[[:d:Q21457000|Elinor Evans]]''
|
| 1982
|
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 8589
| ''[[:d:Q21457022|Elis Gwyn Jones]]''
|
| 1918
| 1999
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 8590
| ''[[:d:Q21457350|James Malcolm Rielly]]''
|
| 1956-12-10
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8591
| ''[[:d:Q21457627|Elwyn Ioan]]''
|
| 1947
|
| ''[[:d:Q16007333|Pen-bont-rhyd-y-beddau]]''
|-
| style='text-align:right'| 8592
| ''[[:d:Q21458001|Emrys Parry]]''
|
| 1941
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8593
| ''[[:d:Q21458149|William Williams]]''
| [[File:Ap Caledfryn.jpg|center|128px]]
| 1837-03-24
| 1915
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 8594
| ''[[:d:Q21458256|Archie Rhys Griffiths]]''
|
| 1902-01-12
| 1971-04-02
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8595
| ''[[:d:Q21458479|Arthur C. Michael]]''
|
| 1881-06-21
| 1965-06-29
| [[Swansea]]
|-
| style='text-align:right'| 8596
| ''[[:d:Q21458708|Esther Grainger]]''
|
| 1912
| 1990
| [[Cairdiff]]
|-
| style='text-align:right'| 8597
| ''[[:d:Q21458912|Arthur Trevethin Nowell]]''
|
| 1862-02-05
| 1940-01-06
| ''[[:d:Q5523593|Garndiffaith]]''
|-
| style='text-align:right'| 8598
| ''[[:d:Q21459585|Joan Baker]]''
|
| 1922
| 2017-04-07
| [[Cairdiff]]
|-
| style='text-align:right'| 8599
| ''[[:d:Q21459667|Joan Oxland]]''
|
| 1920
| 2009
| [[Cairdiff]]
|-
| style='text-align:right'| 8600
| ''[[:d:Q21460388|Nerys Ann Johnson]]''
|
| 1942-10-05
| 2001-06-12
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 8601
| ''[[:d:Q21460680|John Cambrian Rowland]]''
|
| 1819-12-07
| 1890
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 8602
| ''[[:d:Q21460963|John Dafydd Evans]]''
|
| 1900
| 1984
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 8603
| ''[[:d:Q21461259|John Elwyn]]''
| [[File:JE painting RM.jpg|center|128px]]
| 1916-11-20
| 1997-11-13
| ''[[:d:Q3400150|Adpar]]''
|-
| style='text-align:right'| 8604
| ''[[:d:Q21461712|John Harvey]]''
|
| 1959
|
| ''[[:d:Q6964399|Nant-y-glo]]''
|-
| style='text-align:right'| 8605
| ''[[:d:Q21462370|Vera Bassett]]''
|
| 1912
| 1997
| ''[[:d:Q13132482|Fforest]]''
|-
| style='text-align:right'| 8606
| ''[[:d:Q21462444|Paul Brewer]]''
|
| 1946
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8607
| ''[[:d:Q21462512|Charles Byrd]]''
|
| 1916
| 2018-01-11
| ''[[:d:Q6729365|Maesycoed]]''
|-
| style='text-align:right'| 8608
| ''[[:d:Q21462817|Vincent Evans]]''
|
| 1896
| 1976
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 8609
| ''[[:d:Q21463908|Wilf Roberts]]''
|
| 1941
| 2016-09-19<br/>2016
| ''[[:d:Q6661329|Llanfaelog]]''
|-
| style='text-align:right'| 8610
| ''[[:d:Q21464054|Peter Markey]]''
|
| 1930
| 2017
| [[Swansea]]
|-
| style='text-align:right'| 8611
| ''[[:d:Q21464075|Cherry Pickles]]''
|
| 1950
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8612
| ''[[:d:Q21464720|William Edward Jones]]''
|
| 1825
| 1877
| ''[[:d:Q7837982|Trelawnyd]]''
|-
| style='text-align:right'| 8613
| ''[[:d:Q21464853|Glyn Baines]]''
|
| 1930
| 2023-01
| ''[[:d:Q3404631|Carrog]]''
|-
| style='text-align:right'| 8614
| ''[[:d:Q21464870|Glyn Jones]]''
|
| 1936
|
| ''[[:d:Q62429|Tynewydd]]''
|-
| style='text-align:right'| 8615
| ''[[:d:Q21464885|Phillida Nicholson]]''
|
| 1924
| 2021
| ''[[:d:Q11008013|Bodfari]]''
|-
| style='text-align:right'| 8616
| ''[[:d:Q21465300|Graham Bevan]]''
|
| 1935
| 2006
| [[Pontypridd]]
|-
| style='text-align:right'| 8617
| ''[[:d:Q21465817|Gwenny Griffiths]]''
|
| 1867-06-25
| 1953-12-22
| [[Swansea]]
|-
| style='text-align:right'| 8618
| ''[[:d:Q21465832|Gwyn Evans]]''
|
| 1931
|
| ''[[:d:Q5530463|Gelli]]''
|-
| style='text-align:right'| 8619
| ''[[:d:Q21466186|D. Alun Evans]]''
|
| 1945
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 8620
| ''[[:d:Q21466631|Keith Bowen]]''
|
| 1950
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 8621
| ''[[:d:Q21466820|Richard O'Connell]]''
|
| 1947
|
| ''[[:d:Q1952591|The Mumbles]]''
|-
| style='text-align:right'| 8622
| ''[[:d:Q21466996|Wynn Jones]]''
|
| 1939
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8623
| ''[[:d:Q21467261|David Mainwaring]]''
|
| 1933
| 1993
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 8624
| ''[[:d:Q21469892|Edward Boulden]]''
| [[File:Edward Boulden 1913.jpg|center|128px]]
| 1879-07-04
| 1937-08-29
| ''[[:d:Q7162285|Pencader]]''
|-
| style='text-align:right'| 8625
| ''[[:d:Q21470102|Frank Cox]]''
|
| 1920-12-04
| 2007-11-10
| [[Cairdiff]]
|-
| style='text-align:right'| 8626
| ''[[:d:Q21470103|Fred Cox]]''
|
| 1920-12-04
| 2013-09-28
| [[Cairdiff]]
|-
| style='text-align:right'| 8627
| ''[[:d:Q21474189|Dafydd Hellard]]''
|
| 1985-02-21
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8628
| ''[[:d:Q21479992|Edwin Tanner]]''
|
| 1920-12-31
| 1980
| ''[[:d:Q7162698|Pengam]]''
|-
| style='text-align:right'| 8629
| ''[[:d:Q21480955|John Pughe]]''
| [[File:John Pughe (1815-1874).jpg|center|128px]]
| 1814-09-08
| 1874-04-09
| ''[[:d:Q7837752|Tref Alaw]]''
|-
| style='text-align:right'| 8630
| ''[[:d:Q21481534|John Williams]]''
|
| 1961-05-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8631
| ''[[:d:Q21513430|Graham C. D. Griffiths]]''
|
| 1937-06-22
| 2009-05-03
| [[Cairdiff]]
|-
| style='text-align:right'| 8632
| ''[[:d:Q21516459|Richard Henry Roberts]]''
|
| 1910
| 2003
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 8633
| ''[[:d:Q21516789|William Edwyn Isaac]]''
|
| 1905
| 1995
| [[Penygraig]]
|-
| style='text-align:right'| 8634
| ''[[:d:Q21521789|John Neilson]]''
|
| 1959
|
| ''[[:d:Q6661768|Llansilin]]''
|-
| style='text-align:right'| 8635
| ''[[:d:Q21521815|Wynne Melville Jones]]''
| [[File:Parêd Gŵyl Dewi Aberystwyth 2023 - Wynne Melville Jones.jpg|center|128px]]
| 1947
|
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 8636
| ''[[:d:Q21524435|John F. C. Richards]]''
|
| 1897-03-09
| 1992-10-15
| [[Cairdiff]]
|-
| style='text-align:right'| 8637
| ''[[:d:Q21524668|Peter K. Marshall]]''
|
| 1934-07-02
| 2001-04-09
| [[Cairdiff]]
|-
| style='text-align:right'| 8638
| ''[[:d:Q21536459|Margaret Jane Gordon]]''
| [[File:Lady Margaret Jane Gordon (1880-1962), singer.jpg|center|128px]]
| 1880-03-03
| 1962-09-23
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 8639
| ''[[:d:Q21544278|Thomas Howell]]''
|
|
| 1540
| [[Wales]]
|-
| style='text-align:right'| 8640
| ''[[:d:Q21548870|Wilson Jones]]''
|
| 1795
| 1864-10-27
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 8641
| ''[[:d:Q21585387|The Anchoress]]''
| [[File:Simple Minds - 2018173231123 2018-06-22 Rock the Ring - 1D X MK II - 2684 - B70I0818.jpg|center|128px]]
| 1985
|
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 8642
| ''[[:d:Q21597973|Ray Jessel]]''
|
| 1929-10-16
| 2015-07-17
| [[Cairdiff]]
|-
| style='text-align:right'| 8643
| ''[[:d:Q21598040|Ray Weigh]]''
|
| 1928-06-23
| 2015-06-04
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 8644
| ''[[:d:Q21605189|Lloyd Robinson]]''
|
| 1912-12-21
| 1996-08-02
| [[Swansea]]
|-
| style='text-align:right'| 8645
| ''[[:d:Q21612711|Caroline Catharine Wilkinson]]''
|
| 1822-05-10
| 1881-10-02
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 8646
| ''[[:d:Q21620859|Adam Beard]]''
| [[File:Adam Beard 2023.jpg|center|128px]]
| 1996-01-07
|
| [[Swansea]]
|-
| style='text-align:right'| 8647
| ''[[:d:Q21620926|Will Boyde]]''
|
| 1994-12-15
|
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 8648
| ''[[:d:Q21621069|Jack Condy]]''
|
| 1994-12-01
|
| ''[[:d:Q2564732|Aberbargoed]]''
|-
| style='text-align:right'| 8649
| ''[[:d:Q21621139|James Davies]]''
|
| 1990-10-25
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8650
| ''[[:d:Q21621193|Dion Donohue]]''
|
| 1993-08-26
|
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 8651
| ''[[:d:Q21621239|Ryan Elias]]''
|
| 1995-01-07
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8652
| ''[[:d:Q21621263|Jarrod Evans]]''
| [[File:Jarrod Evans 2020.jpg|center|128px]]
| 1996-07-25
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8653
| ''[[:d:Q21621265|Lloyd Evans]]''
|
| 1990-09-14
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8654
| ''[[:d:Q21621266|Steffan Evans]]''
|
| 1994-09-01
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8655
| ''[[:d:Q21621405|Wyn Jones]]''
| [[File:Wyn Jones March 2023.jpg|center|128px]]
| 1992-02-26
|
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 8656
| ''[[:d:Q21621505|Rhodri Hughes]]''
|
| 1993-11-26
|
| [[Swansea]]
|-
| style='text-align:right'| 8657
| ''[[:d:Q21621506|Steffan Hughes]]''
|
| 1994-02-17
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8658
| ''[[:d:Q21621580|Aled Jenkins]]''
|
| 1990-04-22
|
| [[Swansea]]
|-
| style='text-align:right'| 8659
| ''[[:d:Q21621582|Ellis Jenkins]]''
|
| 1993-04-29
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 8660
| ''[[:d:Q21621583|Owen Jenkins]]''
|
| 1993-07-20
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 8661
| ''[[:d:Q21621611|Dan Jones]]''
|
| 1996-01-07
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8662
| ''[[:d:Q21621825|Dillon Lewis]]''
| [[File:Dillon Lewis 2023.jpg|center|128px]]
| 1996-01-04
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 8663
| ''[[:d:Q21621827|Ethan Lewis]]''
|
| 1994-03-28
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 8664
| ''[[:d:Q21621829|Josh Lewis]]''
|
| 1992-03-22
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8665
| ''[[:d:Q21622160|Torin Myhill]]''
|
| 1995-08-02
|
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 8666
| ''[[:d:Q21622199|Ioan Nicholas]]''
|
| 1998-04-03
|
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 8667
| ''[[:d:Q21622291|Scott Otten]]''
|
| 1994-07-19
|
| [[Swansea]]
|-
| style='text-align:right'| 8668
| ''[[:d:Q21622371|Tom Phillips]]''
|
| 1996-02-13
|
| [[Swansea]]
|-
| style='text-align:right'| 8669
| ''[[:d:Q21622500|Lewis Rawlins]]''
|
| 1990-04-13
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 8670
| ''[[:d:Q21622920|Garyn Smith]]''
|
| 1995-07-12
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8671
| ''[[:d:Q21622991|Aled Summerhill]]''
|
| 1994-11-22
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 8672
| ''[[:d:Q21622998|Dan Suter]]''
|
| 1993-06-29
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8673
| ''[[:d:Q21623095|Gareth Thomas]]''
| [[File:Gareth Thomas (ospreys) 2023.jpg|center|128px]]
| 1993-08-02
|
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 8674
| ''[[:d:Q21623285|Owen Watkin]]''
| [[File:Owen Watkin RWC 2019.jpg|center|128px]]
| 1996-10-12
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8675
| ''[[:d:Q21623324|Tomos Williams]]''
| [[File:Tomos Williams 2015.jpg|center|128px]]
| 1995-01-01
|
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 8676
| ''[[:d:Q21642411|Hannah Daniel]]''
|
| 1986-01-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8677
| ''[[:d:Q21642535|Gemma Hallett]]''
| [[File:Gem Hallett.jpg|center|128px]]
| 1981-08-24
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8678
| ''[[:d:Q21664555|Edwin Hughes]]''
|
| 1885-11-30
| 1949-04-17
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8679
| ''[[:d:Q21686810|Mick McLaughlin]]''
|
| 1943-01-05
| 2015-12-06
| [[Newport]]
|-
| style='text-align:right'| 8680
| ''[[:d:Q21716254|Jordan Evans]]''
| [[File:Jordan Evans.png|center|128px]]
| 1995-09-23
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8681
| ''[[:d:Q21727807|John Ingleby]]''
| [[File:Crucifiction found in the wall of the old church at Halkin, c.1795.jpg|center|128px]]
| 1749
| 1808
| ''[[:d:Q5642527|Helygain]]''
|-
| style='text-align:right'| 8682
| ''[[:d:Q21745459|Ernest Vaughan, 7th Earl of Lisburne]]''
|
| 1892-02-08<br/>1892
| 1965-06-30<br/>1965
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 8683
| ''[[:d:Q21751004|Hadyn Ellis]]''
|
| 1945-10-25
| 2006-11-06
| [[Newport]]
|-
| style='text-align:right'| 8684
| ''[[:d:Q21754193|Jacob Ifan]]''
|
| 1993
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8685
| ''[[:d:Q21856725|Edward Stanley]]''
|
| 1513
| 1564
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 8686
| ''[[:d:Q21857916|Roger Hackney]]''
|
| 1957-09-02
|
| [[Swansea]]
|-
| style='text-align:right'| 8687
| ''[[:d:Q21899385|Stephen Williams]]''
| [[File:Stephen Williams, 2023 Paris-Nice.jpg|center|128px]]
| 1996-06-09
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8688
| ''[[:d:Q21932066|Dean Reynolds]]''
|
| 1992-07-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8689
| ''[[:d:Q21933272|Alex Lynch]]''
|
| 1995-04-04
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 8690
| ''[[:d:Q21954811|Morgan Evans]]''
|
| 1992-03-23
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 8691
| ''[[:d:Q21964342|Anwen Butten]]''
| [[File:Anwen Butten.jpeg|center|128px]]
| 1972-08-29
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8692
| ''[[:d:Q21964937|Sean Holley]]''
|
| 1970-11-06
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8693
| ''[[:d:Q21997796|Ida Gaskin]]''
|
| 1919-12-09
| 2016-01-08
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 8694
| ''[[:d:Q21998348|Arthur Davies]]''
| [[File:Arthur Davies (tenor).jpg|center|128px]]
| 1941-04-11
| 2018-08<br/>2018-08-08
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8695
| ''[[:d:Q21999572|Robert Nisbet]]''
|
| 1941
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 8696
| ''[[:d:Q21999647|Ivor Davies]]''
|
| 1892-04-06
| 1959-07-02
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8697
| ''[[:d:Q21999672|Kevin Hopkins]]''
|
| 1961-09-29
|
| ''[[:d:Q268367|Cwmllynfell]]''
|-
| style='text-align:right'| 8698
| ''[[:d:Q21999673|Jack Hurrell]]''
|
| 1933-08-17
| 2003
| ''[[:d:Q5197235|Cwmcarn]]''
|-
| style='text-align:right'| 8699
| ''[[:d:Q21999689|Carl Llewellyn]]''
|
| 1965-07-29
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 8700
| ''[[:d:Q21999695|Nigel Meek]]''
|
| 1964-10-20
|
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 8701
| ''[[:d:Q21999704|Trefor Owen]]''
|
| 1933-02-20
| 2001-07
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 8702
| ''[[:d:Q21999708|Joseph Owens]]''
|
| 1878
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8703
| ''[[:d:Q21999727|Dick Roberts]]''
|
| 1891
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 8704
| ''[[:d:Q21999728|Hugh Roberts]]''
|
| 1882-10-14
| 1969-12-05
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 8705
| ''[[:d:Q21999735|Cyril Smith]]''
|
| 1893
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 8706
| ''[[:d:Q22003001|William Dyke]]''
|
| 1813
| 1880-12-09
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 8707
| ''[[:d:Q22007406|John Pettigrew]]''
|
| 1968
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8708
| ''[[:d:Q22018632|Job Harris]]''
| [[File:Job Harris 1840-1882.jpg|center|128px]]
| 1840-07-22
| 1882-01-12
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8709
| ''[[:d:Q22019199|William Owen]]''
| [[File:William Owen.png|center|128px]]
| 1825-09-10
| 1894
| ''[[:d:Q3399931|Llanelltyd]]''
|-
| style='text-align:right'| 8710
| ''[[:d:Q22038991|Sampson Lloyd]]''
|
| 1664
| 1725
| [[Welshpool]]
|-
| style='text-align:right'| 8711
| ''[[:d:Q22097933|Richard Lewis]]''
| [[File:Richard Lewis in 2018.png|center|128px]]
| 1984
|
| [[Wales]]
|-
| style='text-align:right'| 8712
| ''[[:d:Q22097945|Darril Williams]]''
|
| 1975-09-20
|
| [[Swansea]]
|-
| style='text-align:right'| 8713
| ''[[:d:Q22098316|John Thomas]]''
|
| 1852-04-12
| 1915-05-29
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8714
| ''[[:d:Q22098319|Justin Thomas]]''
|
| 1973-11-01
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8715
| ''[[:d:Q22098343|Georgia Evans]]''
|
| 1995-10-16
|
| [[Wales]]
|-
| style='text-align:right'| 8716
| ''[[:d:Q22113503|John S. Noyes]]''
|
| 1949-04-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8717
| ''[[:d:Q22117202|Margaret Tisdale]]''
|
| 1951
| 2015-04-29
| [[Welshpool]]
|-
| style='text-align:right'| 8718
| ''[[:d:Q22137015|Ellie Curson]]''
| [[File:Ellie Curson - Yeovil Ladies (cropped).jpg|center|128px]]
| 1994-02-18
|
| [[Newport]]
|-
| style='text-align:right'| 8719
| ''[[:d:Q22234320|Mary Dilys Glynne]]''
|
| 1895-02-19
| 1991-05-09
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8720
| ''[[:d:Q22271913|James Murphy]]''
|
| 1801-09-29
| 1883
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 8721
| ''[[:d:Q22277003|Remy Beasley]]''
|
|
|
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 8722
| ''[[:d:Q22277869|Daniel Gammond]]''
|
|
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 8723
| ''[[:d:Q22277934|Oncle Gilbert]]''
|
| 1969
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8724
| ''[[:d:Q22278255|Edwin Humphreys]]''
|
| 1963-11-03
|
| ''[[:d:Q3402600|Y Fron]]''
|-
| style='text-align:right'| 8725
| ''[[:d:Q22278271|Dafydd Hywel]]''
|
| 1945-12-04
| 2023-03-23
| ''[[:d:Q3405497|Garnant]]''
|-
| style='text-align:right'| 8726
| ''[[:d:Q22278601|Timothy Killeen]]''
| [[File:Tim Killeen and Tom Vilsack.jpg|center|128px]]
| 1952
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8727
| ''[[:d:Q22279195|Maisie Methuen]]''
|
| 2001-06-22
|
| [[Wales]]
|-
| style='text-align:right'| 8728
| ''[[:d:Q22280472|Kingsley Whiffen]]''
|
| 1950-12-03
| 2006-12-15
| [[Welshpool]]
|-
| style='text-align:right'| 8729
| ''[[:d:Q22312863|Alfred Daniell]]''
| [[File:Alfred Daniell (cropped).jpg|center|128px]]
| 1853
| 1937
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8730
| ''[[:d:Q22443210|Ruth Frankenberg]]''
|
| 1957-09-17
| 2007-04-22
| [[Cairdiff]]
|-
| style='text-align:right'| 8731
| ''[[:d:Q22583546|Margaret Courtenay]]''
|
| 1923-11-14
| 1996-02-15
| [[Cairdiff]]
|-
| style='text-align:right'| 8732
| ''[[:d:Q22683128|Tomos Efans]]''
| [[File:Tomos Efans (Cyndelyn).jpg|center|128px]]
| 1837
| 1908-02-10
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 8733
| ''[[:d:Q22687967|Thomas Thomas]]''
| [[File:Revd Thomas, Landore, Swansea NLW3365348.jpg|center|128px]]
| 1817
| 1888-03-16
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 8734
| ''[[:d:Q22695859|Brian Davies]]''
|
| 1938-11-15
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 8735
| ''[[:d:Q22696572|Owen John]]''
|
| 1918-05-01
| 1995-01-23
| [[Wales]]
|-
| style='text-align:right'| 8736
| ''[[:d:Q22696576|Harriet Lewis]]''
|
| 1920-08-26<br/>1911-04-24
| 1999-11-25<br/>1999-11-24
| ''[[:d:Q7837341|Trebanos]]''
|-
| style='text-align:right'| 8737
| ''[[:d:Q22696579|Gari Williams]]''
|
| 1946-03-10
| 1990-07-18
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 8738
| ''[[:d:Q22703903|Eirlys Britton]]''
|
| 1949
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8739
| ''[[:d:Q22704062|Rebecca Harries]]''
|
| 1966-09-01
|
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 8740
| ''[[:d:Q22704087|Ioan Hefin]]''
|
| 1963-06
|
| ''[[:d:Q6947838|Mynyddygarreg]]''
|-
| style='text-align:right'| 8741
| ''[[:d:Q22774613|Daniel Pearson]]''
| [[File:Daniel Pearson.jpg|center|128px]]
| 1994-02-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8742
| ''[[:d:Q22815213|Marged ferch Tomos]]''
|
| 1340
|
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 8743
| ''[[:d:Q22941875|Jess Davies]]''
|
| 1993-04-11
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8744
| ''[[:d:Q22950515|Eirian Llwyd]]''
|
| 1951
| 2014-01-29
| ''[[:d:Q13130874|Prion]]''
|-
| style='text-align:right'| 8745
| ''[[:d:Q22957455|Nicola Cousins]]''
| [[File:Nicola Cousins.jpg|center|128px]]
| 1988-10-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8746
| ''[[:d:Q22957701|Claire Skinner]]''
|
| 1997-02-17
|
| [[Wales]]
|-
| style='text-align:right'| 8747
| ''[[:d:Q22957757|Laura May Walkley]]''
|
| 1991-05-19
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8748
| ''[[:d:Q22958000|Lily Tobias]]''
|
| 1887
| 1984
| [[Swansea]]
|-
| style='text-align:right'| 8749
| ''[[:d:Q22962608|Frances Elizabeth Wynne]]''
| [[File:DV307 no.12 On board the Prince Frederick William, Ostend to Dover 25 Aug 1858 detail.png|center|128px]]
| 1836
| 1907
| ''[[:d:Q17738626|Voelas]]''
|-
| style='text-align:right'| 8750
| ''[[:d:Q22997454|Ffion Hague]]''
| [[File:Ffion Hague.jpg|center|128px]]
| 1968-02-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8751
| ''[[:d:Q23000846|Trystan Llŷr Griffiths]]''
|
| 1987
|
| ''[[:d:Q5137116|Clynderwen]]''
|-
| style='text-align:right'| 8752
| ''[[:d:Q23001673|Thereza Dillwyn Llewelyn]]''
| [[File:Thereza Dillwyn Llewelyn wearing a Bernese (Swiss) Peasant dress (4032154032).jpg|center|128px]]
| 1834
| 1926-02-21
| ''[[:d:Q7163093|Penllergaer]]''
|-
| style='text-align:right'| 8753
| ''[[:d:Q23002068|Louie Myfanwy Thomas]]''
|
| 1908-02-29
| 1968-01-25
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 8754
| ''[[:d:Q23013170|Eleri Mills]]''
|
| 1955-01
|
| ''[[:d:Q6661409|Llangadfan]]''
|-
| style='text-align:right'| 8755
| ''[[:d:Q23020660|David Thomas]]''
|
| 1942-07-22
| 2017-05-12
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8756
| ''[[:d:Q23022369|Barbara Hardy]]''
|
| 1924-06-27
| 2016-02-12
| [[Swansea]]
|-
| style='text-align:right'| 8757
| ''[[:d:Q23047441|Hugh Morgan-Owen]]''
|
| 1882
| 1953-03-06
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 8758
| ''[[:d:Q23210319|Meilyr Jones]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 8759
| ''[[:d:Q23296584|Michael Farmer]]''
|
| 1944-05-20
| 2011-04-09
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 8760
| ''[[:d:Q23304355|David Smallman]]''
|
| 1953-03-22
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 8761
| ''[[:d:Q23309977|Kathy Jones]]''
|
| 1968
|
| ''[[:d:Q3398830|Corris]]''
|-
| style='text-align:right'| 8762
| ''[[:d:Q23419103|Beth Reekles]]''
|
| 1995-06-07<br/>1995
|
| [[Newport]]
|-
| style='text-align:right'| 8763
| ''[[:d:Q23463073|James Bird]]''
|
| 1989-01-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8764
| ''[[:d:Q23511510|Catherine Glyn Davies]]''
|
| 1926-09-26
| 2007-02-22
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 8765
| ''[[:d:Q23542620|Scott Andrews]]''
|
| 1994-06-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8766
| ''[[:d:Q23582802|William Bowen]]''
| [[File:J. W. Bowen.jpg|center|128px]]
| 1876-05-08
| 1965-04-01
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 8767
| ''[[:d:Q23615727|William Field Lloyd]]''
|
| 1873
| 1965-05-29
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 8768
| ''[[:d:Q23664153|Luke Francis]]''
|
| 1989
|
| [[Wales]]
|-
| style='text-align:right'| 8769
| ''[[:d:Q23665729|Stephen Malik]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 8770
| ''[[:d:Q23681098|Llewela Davies]]''
| [[File:Llewela Davies.jpg|center|128px]]
| 1871-02
| 1952-08-22
| ''[[:d:Q631340|Talgarth]]''
|-
| style='text-align:right'| 8771
| ''[[:d:Q23681122|Mary Wynne Warner]]''
|
| 1932-06-22
| 1998-04-01
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8772
| ''[[:d:Q23691969|Louis Hunt]]''
|
| 1908-11-09
| 2002
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 8773
| ''[[:d:Q23696663|Lee Gaze]]''
|
| 1975-05-21
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8774
| ''[[:d:Q23708558|Elen Egryn]]''
|
| 1807
| 1876
| ''[[:d:Q13129617|Llanegryn]]''
|-
| style='text-align:right'| 8775
| ''[[:d:Q23721875|Shelley Miranda Barrett]]''
|
| 1970s
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 8776
| ''[[:d:Q23731514|Elen Rhys]]''
|
| 1983-11-26
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8777
| ''[[:d:Q23731532|Kate Lamb]]''
|
| 1988-01-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8778
| ''[[:d:Q23752368|John Rowlands]]''
| [[File:John Rowlands (Giraldus).png|center|128px]]
| 1824
| 1891-07-04
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 8779
| ''[[:d:Q23762604|Tyler Rees]]''
|
| 1999-02-06
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8780
| ''[[:d:Q23766046|Mary Elizabeth Phillips]]''
| [[File:THE SCOTTISH WOMEN'S HOSPITALS IN THE MACEDONIAN CAMPAIGN, 1915-1918 Q108186.jpg|center|128px]]
| 1875
| 1956-08-01
| [[Wales]]
|-
| style='text-align:right'| 8781
| ''[[:d:Q23770381|Luke Garrett]]''
|
| 1995-01-11
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 8782
| ''[[:d:Q23770470|Owain Arthur]]''
| [[File:Owain Arthur at World Premiere London, The Rings of Power 2022.jpg|center|128px]]
| 1983-03-05
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8783
| ''[[:d:Q23806567|Robert Francis Jenner]]''
|
| 1802-01-13
| 1860-04-08
| ''[[:d:Q7983059|Wenvoe]]''
|-
| style='text-align:right'| 8784
| ''[[:d:Q23806569|William Aubrey Williams]]''
| [[File:Gwilym Gwent, aka William Aubrey Williams.tiff|center|128px]]
| 1834-11-28
| 1891-07-03
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 8785
| ''[[:d:Q23812726|Rhian Edwards]]''
|
|
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8786
| ''[[:d:Q23822310|Jane Helen Rowlands]]''
|
| 1891-04-03
| 1955-02-12
| ''[[:d:Q2655856|Menai Bridge]]''
|-
| style='text-align:right'| 8787
| ''[[:d:Q23822716|William Bassett]]''
|
| 1507
| 1586
| ''[[:d:Q7083449|Old Beaupre Castle]]''
|-
| style='text-align:right'| 8788
| ''[[:d:Q23833023|Lowri Gwilym]]''
|
| 1954-10-14
| 2010-07-21
| [[Aberystwyth]]
|-
| style='text-align:right'| 8789
| ''[[:d:Q23856670|Ellis Pierce]]''
|
| 1841-01-29
| 1912-07-31
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 8790
| ''[[:d:Q23883547|Leigh De-Vulgt]]''
|
| 1981-03-17<br/>1981-03-10
|
| [[Swansea]]
|-
| style='text-align:right'| 8791
| ''[[:d:Q23883851|Josh Heard]]''
| [[File:CINvBST 2017-05-20 - Josh Heard (33997230723) (cropped).jpg|center|128px]]
| 1994-11-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8792
| ''[[:d:Q23887822|Kayleigh Green]]''
| [[File:Kayleigh Green Charlton Athletic Women (sq cropped).jpg|center|128px]]
| 1988-03-22
|
| [[Wales]]
|-
| style='text-align:right'| 8793
| ''[[:d:Q23888209|Alastair Cavenagh]]''
|
| 1964-11-17
|
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 8794
| ''[[:d:Q23892568|Aelrhiw]]''
| [[File:Eglwys S Aelrhiw a Rheithordy Rhiw St Aelrhiw's and Rectory - geograph.org.uk - 568285.jpg|center|128px]]
| 6th century
|
| ''[[:d:Q3395308|Y Rhiw]]''
|-
| style='text-align:right'| 8795
| ''[[:d:Q23900939|Ellen Hughes]]''
| [[File:Miss Ellen Hughes, Llanengan.jpg|center|128px]]
| 1862-05-18
| 1927-05-11
| ''[[:d:Q3400567|Llanengan]]''
|-
| style='text-align:right'| 8796
| ''[[:d:Q23900940|Emilia Baeyertz]]''
| [[File:Emilia Baeyertz.png|center|128px]]
| 1842-03-29
| 1926-04-26
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8797
| ''[[:d:Q23901617|Tali Esen Morgan]]''
| [[File:TaliEsenMorgan.tiff|center|128px]]
| 1858-10-28
| 1941-06-30
| ''[[:d:Q6661579|Llangynwyd]]''
|-
| style='text-align:right'| 8798
| ''[[:d:Q23913585|Joseph Arthur Hamilton Beresford]]''
|
| 1861-08-11
| 1952-12-28
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 8799
| ''[[:d:Q23924666|Thomas Roberts]]''
|
| 1902
| 1983
| [[Wales]]
|-
| style='text-align:right'| 8800
| ''[[:d:Q23927294|Callwen]]''
| [[File:All Saints, Cellan - geograph.org.uk - 49752.jpg|center|128px]]
| 530
|
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 8801
| ''[[:d:Q23927301|Gwenfyl]]''
|
| 530
|
| ''[[:d:Q5251744|Defynnog]]''
|-
| style='text-align:right'| 8802
| ''[[:d:Q23945387|Brian Andrew Hills]]''
|
| 1934-03-19
| 2006-01-13
| [[Cairdiff]]
|-
| style='text-align:right'| 8803
| ''[[:d:Q23948107|Richard James Thomas]]''
|
| 1908
| 1976
| [[Cairdiff]]
|-
| style='text-align:right'| 8804
| ''[[:d:Q23948108|George Percival Spooner]]''
|
| 1850-06-13
| 1917-01-21
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 8805
| ''[[:d:Q23988324|Alfred Weeks Szlumper]]''
| [[File:Alfred Week Szlumper.png|center|128px]]
| 1858-05-24
| 1934-11-11
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 8806
| ''[[:d:Q23988325|Sara Maria Saunders]]''
|
| 1864-03
| 1939-01
| ''[[:d:Q29496455|Cwrt Mawr]]''
|-
| style='text-align:right'| 8807
| ''[[:d:Q23988345|Margaret Townsend Jenkins]]''
|
| 1843-08-04
| 1923-06-04
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8808
| ''[[:d:Q23988353|John Edward Davies]]''
|
| 1862
| 1912
| [[Wales]]
|-
| style='text-align:right'| 8809
| ''[[:d:Q23988354|Richard Hersee]]''
|
| 1867-11-25
| 1922
| [[Wales]]
|-
| style='text-align:right'| 8810
| ''[[:d:Q23988356|Richard Owen Jones]]''
|
| 1867
| 1936
| [[Wales]]
|-
| style='text-align:right'| 8811
| ''[[:d:Q23988357|William P. Jones]]''
|
| 1870
| 1953
| [[Wales]]
|-
| style='text-align:right'| 8812
| ''[[:d:Q23988358|William Roberts Jones]]''
|
| 1870
| 1938
| [[Wales]]
|-
| style='text-align:right'| 8813
| ''[[:d:Q23988363|Anne Ceridwen Rees]]''
| [[File:Anne Ceridwen Rees.jpg|center|128px]]
| 1874-07-09
| 1905-10-19
| ''[[:d:Q13130710|Pentre Gwenlais]]''
|-
| style='text-align:right'| 8814
| ''[[:d:Q23988364|David Morral Lewis]]''
|
| 1864
| 1925
| [[Wales]]
|-
| style='text-align:right'| 8815
| ''[[:d:Q23988388|Joseph Hudson Turner]]''
|
| 1872
| 1937
| [[Wales]]
|-
| style='text-align:right'| 8816
| ''[[:d:Q23988390|John Owen Vaughan]]''
|
| 1863
| 1952
| [[Wales]]
|-
| style='text-align:right'| 8817
| ''[[:d:Q23988391|Price White]]''
|
| 1873-04-25
| 1952
| [[Wales]]
|-
| style='text-align:right'| 8818
| ''[[:d:Q23991117|Matt Whatley]]''
|
| 1992-10-02
|
| [[Wales]]
|-
| style='text-align:right'| 8819
| ''[[:d:Q23991119|Thomas Boden]]''
|
| 1860-06
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8820
| ''[[:d:Q23991125|Samuel Brookes]]''
|
| 1877
|
| [[Wales]]
|-
| style='text-align:right'| 8821
| ''[[:d:Q23991127|Les Cartwright]]''
|
| 1952-03-04
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8822
| ''[[:d:Q23991128|Dai Collier]]''
|
| 1894-04-12
| 1972-11-30
| [[Llwynypia]]
|-
| style='text-align:right'| 8823
| ''[[:d:Q23991131|Elvet Collins]]''
|
| 1902-10-16
| 1977
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 8824
| ''[[:d:Q23991132|Charles Conde]]''
|
| 1859
|
| [[Wales]]
|-
| style='text-align:right'| 8825
| ''[[:d:Q23991134|Alfred Owen Davies]]''
|
| 1863
|
| [[Wales]]
|-
| style='text-align:right'| 8826
| ''[[:d:Q23991135|Oswald Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 8827
| ''[[:d:Q23991140|Fred Dewey]]''
|
| 1898-10-11
| 1980
| [[Wales]]
|-
| style='text-align:right'| 8828
| ''[[:d:Q23991142|John Arthur Eyton-Jones]]''
| [[File:Dr John Arthur Eyton-Jones.jpg|center|128px]]
| 1860
| 1940-03-03
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8829
| ''[[:d:Q23991143|Dick Finnigan]]''
|
| 1904-05-16
|
| [[Wales]]
|-
| style='text-align:right'| 8830
| ''[[:d:Q23991144|William Tanat Foulkes]]''
|
| 1863
| 1937-02-08
| [[Wales]]
|-
| style='text-align:right'| 8831
| ''[[:d:Q23991147|George Godding]]''
|
| 1896-05-03
| 1960-11-18
| [[Wales]]
|-
| style='text-align:right'| 8832
| ''[[:d:Q23991152|Uriah Goodwin]]''
|
| 1859
| 1924
| [[Wales]]
|-
| style='text-align:right'| 8833
| ''[[:d:Q23991172|Abel Hayes]]''
|
| 1866
|
| [[Wales]]
|-
| style='text-align:right'| 8834
| ''[[:d:Q23991193|Malcolm Hersee]]''
|
| 1864
| 1922
| [[Wales]]
|-
| style='text-align:right'| 8835
| ''[[:d:Q23991231|Harry Hibbott]]''
|
| 1859
|
| [[Wales]]
|-
| style='text-align:right'| 8836
| ''[[:d:Q23991269|Billy Hole]]''
|
| 1897-11-01
| 1983-12-07
| [[Wales]]
|-
| style='text-align:right'| 8837
| ''[[:d:Q23991291|Edmund Howell]]''
|
| 1867
|
| [[Wales]]
|-
| style='text-align:right'| 8838
| ''[[:d:Q23991313|Ron Hugh]]''
|
| 1909-08-05
|
| [[Wales]]
|-
| style='text-align:right'| 8839
| ''[[:d:Q23991334|Abel Hughes]]''
|
| 1869
|
| [[Wales]]
|-
| style='text-align:right'| 8840
| ''[[:d:Q23991354|Iorwerth Hughes]]''
|
| 1925-05-26
| 1993-08-20
| [[Wales]]
|-
| style='text-align:right'| 8841
| ''[[:d:Q23991373|John Iorweth Hughes]]''
|
| 1913-01-29
| 1993
| [[Wales]]
|-
| style='text-align:right'| 8842
| ''[[:d:Q23991396|Jack Humphreys]]''
|
| 1920-01-13
| 1954-09-21
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 8843
| ''[[:d:Q23991430|Reuben Humphreys]]''
|
| 1866
| 2nd millennium
| [[Wales]]
|-
| style='text-align:right'| 8844
| ''[[:d:Q23991471|Wilf James]]''
|
| 1907-02-19
|
| [[Wales]]
|-
| style='text-align:right'| 8845
| ''[[:d:Q23991510|Eddie Jenkins]]''
|
| 1895-07-06
|
| [[Wales]]
|-
| style='text-align:right'| 8846
| ''[[:d:Q23991548|Charles Ketley]]''
|
| 1856
|
| [[Wales]]
|-
| style='text-align:right'| 8847
| ''[[:d:Q23991587|Sid Lawrence]]''
|
| 1909-03-16
|
| [[Wales]]
|-
| style='text-align:right'| 8848
| ''[[:d:Q23991610|Patrick Leary]]''
|
| 1864
|
| [[Wales]]
|-
| style='text-align:right'| 8849
| ''[[:d:Q23991651|Mal Lucas]]''
|
| 1938-10-07
| 2024-03-14
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8850
| ''[[:d:Q23991660|Bert Lumberg]]''
|
| 1901-05-20
| 1986-02-16
| [[Wales]]
|-
| style='text-align:right'| 8851
| ''[[:d:Q23991663|Tudor Martin]]''
|
| 1904-04-20
| 1979-09-06
| [[Wales]]
|-
| style='text-align:right'| 8852
| ''[[:d:Q23991664|Jack Mates]]''
|
| 1870-02-28
|
| [[Wales]]
|-
| style='text-align:right'| 8853
| ''[[:d:Q23991667|Tommy Matthias]]''
|
| 1890-11-07
|
| [[Wales]]
|-
| style='text-align:right'| 8854
| ''[[:d:Q23991668|Harry Millership]]''
|
| 1889
| 1959
| [[Wales]]
|-
| style='text-align:right'| 8855
| ''[[:d:Q23991670|Ernie Morley]]''
|
| 1901-09-11
| 1975-01-26
| [[Wales]]
|-
| style='text-align:right'| 8856
| ''[[:d:Q23991672|John Moulsdale]]''
|
| 1899-08-21
|
| [[Wales]]
|-
| style='text-align:right'| 8857
| ''[[:d:Q23991673|William Nock]]''
|
| 1876
|
| [[Wales]]
|-
| style='text-align:right'| 8858
| ''[[:d:Q23991674|Albert Pryce-Jones]]''
|
| 1870-05-26
| 1946-08-17
| [[Wales]]<br/>''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 8859
| ''[[:d:Q23991675|William Pryce-Jones]]''
| [[File:W E Pryce-Jones Newtown 1895.jpg|center|128px]]
| 1867-12-29
| 1949-03-14
| [[Wales]]
|-
| style='text-align:right'| 8860
| ''[[:d:Q23991676|Walter Hugh Roberts]]''
|
| 1858
|
| [[Wales]]
|-
| style='text-align:right'| 8861
| ''[[:d:Q23991681|Frank Scrine]]''
|
| 1925-01-09
| 2001-10-05
| [[Wales]]
|-
| style='text-align:right'| 8862
| ''[[:d:Q23991682|Herbert Sisson]]''
|
| 1862
| 1891-05-02
| [[Wales]]
|-
| style='text-align:right'| 8863
| ''[[:d:Q23991683|Sid Thomas]]''
|
| 1919-11-12
| 2012-01-19
| [[Wales]]<br/>''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 8864
| ''[[:d:Q23991685|Thomas John Thomas]]''
|
| 1877
|
| [[Wales]]
|-
| style='text-align:right'| 8865
| ''[[:d:Q23991687|Harry Trainer]]''
| [[File:Harry Trainer in 1896.jpg|center|128px]]
| 1873
| 1924
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8866
| ''[[:d:Q23991688|Jim Vaughan]]''
|
| 1868
| 2nd millennium
| [[Wales]]
|-
| style='text-align:right'| 8867
| ''[[:d:Q23991689|Alfred Ernest Watkins]]''
|
| 1878-06-26
| 1957-12-07
| ''[[:d:Q6661879|Llanwnnog]]''
|-
| style='text-align:right'| 8868
| ''[[:d:Q23991692|Dick Wilcock]]''
|
| 1868
|
| [[Wales]]
|-
| style='text-align:right'| 8869
| ''[[:d:Q23991693|Richard Parry Williams]]''
|
| 1863
|
| [[Wales]]
|-
| style='text-align:right'| 8870
| ''[[:d:Q23991695|George Woosnam]]''
|
| 1860
| 1935-12
| [[Wales]]
|-
| style='text-align:right'| 8871
| ''[[:d:Q24004546|Wendy Williams]]''
|
| 1942-04-21
| 2012-03-03
| [[Wales]]
|-
| style='text-align:right'| 8872
| ''[[:d:Q24004608|Margaret Phillips]]''
| [[File:Margaret Phillips in Tales of Tomorrow (The Evil Within).jpg|center|128px]]
| 1923-07-06
| 1984-09-09
| ''[[:d:Q4923811|Blaengwrach]]''
|-
| style='text-align:right'| 8873
| ''[[:d:Q24004660|Edward Bowen]]''
|
| 1858
| 1923
| [[Wales]]
|-
| style='text-align:right'| 8874
| ''[[:d:Q24004662|Fred Cook]]''
|
| 1902-01-20
| 1966
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 8875
| ''[[:d:Q24004663|Charles Edwards]]''
|
| 1854
| 1943
| [[Wales]]
|-
| style='text-align:right'| 8876
| ''[[:d:Q24004664|Henry Edwards]]''
|
| 1856
| 1913
| [[Wales]]
|-
| style='text-align:right'| 8877
| ''[[:d:Q24004668|Tom Hewitt]]''
| [[File:Tom Hewitt Wales International.jpg|center|128px]]
| 1889-04-26
| 1980
| [[Wales]]
|-
| style='text-align:right'| 8878
| ''[[:d:Q24004669|Arthur Hughes]]''
|
| 1884-07
| 1970
| [[Wales]]
|-
| style='text-align:right'| 8879
| ''[[:d:Q24004671|Albert Jones]]''
|
| 1883-02-06
| 1963
| [[Wales]]
|-
| style='text-align:right'| 8880
| ''[[:d:Q24004673|Jeffrey Jones]]''
|
| 1886-02-27
| 1976
| [[Wales]]
|-
| style='text-align:right'| 8881
| ''[[:d:Q24004675|John Jones]]''
|
| 1860
| 1902
| [[Wales]]
|-
| style='text-align:right'| 8882
| ''[[:d:Q24004676|Billy Jenkins]]''
|
| 1886-05-18
| 1956-12-23
| [[Cairdiff]]
|-
| style='text-align:right'| 8883
| ''[[:d:Q24004678|Tom Williams]]''
|
| 1887
| 1927-08-13
| ''[[:d:Q5315782|Dyfnant]]''
|-
| style='text-align:right'| 8884
| ''[[:d:Q24004679|Harold Thomas]]''
|
| 1883-08-17
| 1947-02-10
| [[Swansea]]
|-
| style='text-align:right'| 8885
| ''[[:d:Q24004680|William Evans]]''
|
| 1892-02-09
| 1979
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 8886
| ''[[:d:Q24004693|George Richards]]''
| [[File:George Richards (Welsh Footballer).jpg|center|128px]]
| 1874
| 1944
| [[Wales]]
|-
| style='text-align:right'| 8887
| ''[[:d:Q24004694|Oliver Taylor]]''
|
| 1869
| 1945
| [[Wales]]
|-
| style='text-align:right'| 8888
| ''[[:d:Q24004695|Charles Thomas]]''
|
| 1876
| 1935
| [[Wales]]
|-
| style='text-align:right'| 8889
| ''[[:d:Q24004697|John Vaughan]]''
|
| 1856
| 1935
| [[Wales]]
|-
| style='text-align:right'| 8890
| ''[[:d:Q24004698|Ronnie Williams]]''
|
| 1907-01-23
| 1987
| [[Wales]]
|-
| style='text-align:right'| 8891
| ''[[:d:Q24004699|William Wynn]]''
|
| 1876
| 1944
| [[Wales]]
|-
| style='text-align:right'| 8892
| ''[[:d:Q24005337|Josh Adams]]''
| [[File:Josh Adams March 2023.jpg|center|128px]]
| 1995-04-12
|
| [[Swansea]]
|-
| style='text-align:right'| 8893
| ''[[:d:Q24005345|Walter Neumann]]''
| [[File:Walter Neumann 1973 (portion B).jpg|center|128px]]
| 1946-01-01
| 2024-09-24
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 8894
| ''[[:d:Q24005525|David Harrison]]''
|
| 1972-07-08
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 8895
| ''[[:d:Q24006201|Jane Aaron]]''
|
| 1951-09-26
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8896
| ''[[:d:Q24007014|Novo Amor]]''
| [[File:Novo Amor at Prinzen Bar.jpg|center|128px]]
| 1991-08-11
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8897
| ''[[:d:Q24007087|Cerys Hale]]''
|
| 1993-04-04
|
| [[Newport]]
|-
| style='text-align:right'| 8898
| ''[[:d:Q24007150|Rebecca De Filippo]]''
|
| 1994-02-25
|
| [[Swansea]]
|-
| style='text-align:right'| 8899
| ''[[:d:Q24007174|Shona Powell Hughes]]''
|
| 1991-07-08
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8900
| ''[[:d:Q24007285|Wynne Crompton]]''
|
| 1907-05-28
| 1988
| [[Wales]]
|-
| style='text-align:right'| 8901
| ''[[:d:Q24007287|Hywel Davies]]''
|
| 1902-11-20
| 1976
| [[Wales]]
|-
| style='text-align:right'| 8902
| ''[[:d:Q24007295|Tom Edwards]]''
|
| 1906-04-09
| 1980
| [[Wales]]
|-
| style='text-align:right'| 8903
| ''[[:d:Q24007296|Emrys Ellis]]''
|
| 1904-06-29
| 1981
| [[Wales]]
|-
| style='text-align:right'| 8904
| ''[[:d:Q24007300|Tom Evans]]''
|
| 1903-04-07
| 1990
| [[Wales]]
|-
| style='text-align:right'| 8905
| ''[[:d:Q24007303|George Green]]''
|
| 1912-11-12
| 1994-05-01
| ''[[:d:Q17985748|Barry Docks]]''
|-
| style='text-align:right'| 8906
| ''[[:d:Q24007306|Megan York]]''
|
| 1987-04-16
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 8907
| ''[[:d:Q24007311|Alan Jarvis]]''
|
| 1943-08-04
| 2019-12-15
| [[Wales]]
|-
| style='text-align:right'| 8908
| ''[[:d:Q24007312|David Jones]]''
|
| 1910-10-28
| 1971-05-20
| [[Wales]]
|-
| style='text-align:right'| 8909
| ''[[:d:Q24007313|David Jones]]''
|
| 1952-02-11
|
| [[Wales]]
|-
| style='text-align:right'| 8910
| ''[[:d:Q24007314|Jimmy Jones]]''
| [[File:Screenshot 20220606-130821 Gallery.jpg|center|128px]]
| 1895
|
| [[Wales]]
|-
| style='text-align:right'| 8911
| ''[[:d:Q24007316|Richard Jones]]''
|
| 1878
| 1938
| [[Wales]]
|-
| style='text-align:right'| 8912
| ''[[:d:Q24007358|Eddie Lawrence]]''
|
| 1907-08-24
|
| [[Wales]]
|-
| style='text-align:right'| 8913
| ''[[:d:Q24007359|Dai Lewis]]''
|
| 1912-02-02
|
| [[Wales]]
|-
| style='text-align:right'| 8914
| ''[[:d:Q24007372|Tommy Mills]]''
|
| 1911-12-28
|
| [[Wales]]
|-
| style='text-align:right'| 8915
| ''[[:d:Q24007383|Elen Evans]]''
|
| 1985-09-01
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 8916
| ''[[:d:Q24007428|Aneurin Richards]]''
|
| 1902-08-24
|
| [[Wales]]
|-
| style='text-align:right'| 8917
| ''[[:d:Q24007429|Billy Richards]]''
|
| 1905
| 1956-09-30
| [[Wales]]
|-
| style='text-align:right'| 8918
| ''[[:d:Q24007432|Billy Rogers]]''
| [[File:Billy Rogers (footballer).png|center|128px]]
| 1905
| 1936-01
| [[Wales]]
|-
| style='text-align:right'| 8919
| ''[[:d:Q24007436|Sian Williams]]''
| [[File:Sian Williams Rugby.jpg|center|128px]]
| 1990-10-23
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 8920
| ''[[:d:Q24007439|Dai Thomas]]''
|
| 1926-08-01
| 2014-11-14
| [[Wales]]
|-
| style='text-align:right'| 8921
| ''[[:d:Q24007448|Ephraim Williams]]''
|
| 1877
| 1954
| [[Wales]]
|-
| style='text-align:right'| 8922
| ''[[:d:Q24007449|Jesse Williams]]''
|
| 1903-06-24
| 1972
| [[Wales]]
|-
| style='text-align:right'| 8923
| ''[[:d:Q24007470|Bethan Dainton]]''
|
| 1989-04-12
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 8924
| ''[[:d:Q24007472|Ffion Bowen]]''
|
| 1991-01-28
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 8925
| ''[[:d:Q24033907|James Davies]]''
|
| 1845
| 1910-03
| [[Wales]]
|-
| style='text-align:right'| 8926
| ''[[:d:Q24034988|Rosa Lee]]''
| [[File:Rosa Mabel Lee while working in Lowestoft.jpg|center|128px]]
| 1884
| 1976
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 8927
| ''[[:d:Q24036579|John Rogers Rees]]''
|
| 1856-05-31
| 1923-03-24
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 8928
| ''[[:d:Q24039661|Lee Waters]]''
| [[File:Lee Waters AM (28066509142).jpg|center|128px]]
| 1976-02-12
|
| [[Wales]]
|-
| style='text-align:right'| 8929
| ''[[:d:Q24040034|Hefin David]]''
| [[File:Hefin David AM (28170811245).jpg|center|128px]]
| 1977-08
|
| [[Caerphilly Coonty Burgh]]
|-
| style='text-align:right'| 8930
| ''[[:d:Q24041564|Neil McEvoy]]''
| [[File:Neil McEvoy AM (28092346611).jpg|center|128px]]
| 1970
|
| [[Wales]]
|-
| style='text-align:right'| 8931
| ''[[:d:Q24045680|Vikki Howells]]''
| [[File:Vikki Howells AM (27555188583).jpg|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 8932
| ''[[:d:Q24050178|Jayne Bryant]]''
| [[File:Jayne Bryant AM (28092339351).jpg|center|128px]]
|
|
| ''[[:d:Q7374246|Royal Gwent Hospital]]''
|-
| style='text-align:right'| 8933
| ''[[:d:Q24053857|Chris Elmore]]''
| [[File:Official portrait of Chris Elmore MP crop 2.jpg|center|128px]]
| 1983-12-23
|
| [[Newport]]
|-
| style='text-align:right'| 8934
| ''[[:d:Q24069516|Marwood Marchant]]''
|
| 1922-06-18
| 1972-06-28
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 8935
| ''[[:d:Q24073707|David Powell]]''
|
| 1969
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8936
| ''[[:d:Q24175038|Geoffrey Dhenin]]''
|
| 1918-04-02
| 2011-05-06
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 8937
| ''[[:d:Q24181959|David James]]''
|
| 1917<br/>1917-09-19
| 1981-12-12
| [[Swansea]]
|-
| style='text-align:right'| 8938
| ''[[:d:Q24182168|Aled Williams]]''
|
| 1964-01-26
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 8939
| ''[[:d:Q24182511|Greg Prosser]]''
|
| 1966-05-21
|
| [[Swansea]]
|-
| style='text-align:right'| 8940
| ''[[:d:Q24183311|Margaret Bevan]]''
| [[File:MargaretBevanGealy1916.png|center|128px]]
| 1894
|
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 8941
| ''[[:d:Q24183384|Watkin George]]''
|
| 1759
| 1822-08-10
| ''[[:d:Q7838973|Trevethin]]''
|-
| style='text-align:right'| 8942
| ''[[:d:Q24183405|Darran Harris]]''
|
| 1992-11-11
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 8943
| ''[[:d:Q24183454|Arthur Drabble]]''
|
| 1864-02-12
| 1931-07-28
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 8944
| ''[[:d:Q24183505|Steve Cooper]]''
| [[File:Steve Cooper.jpg|center|128px]]
| 1979-12-10
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8945
| ''[[:d:Q24195073|William Bridge]]''
|
| 1808
| 1886-05-26
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 8946
| ''[[:d:Q24203440|Reese J. Llewellyn]]''
|
| 1862-08-30
| 1936-12-15
| [[Wales]]
|-
| style='text-align:right'| 8947
| ''[[:d:Q24203499|Owen Daniel]]''
|
| 1875-04-11
| 1936-01-05
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 8948
| ''[[:d:Q24206353|Des Palmer]]''
|
| 1931-09-23
|
| [[Swansea]]
|-
| style='text-align:right'| 8949
| ''[[:d:Q24206440|Henry Phoenix]]''
|
| 1856
|
| [[Wales]]
|-
| style='text-align:right'| 8950
| ''[[:d:Q24218750|Charlie Oliver]]''
|
| 1901-12-23
| 1990-02-24
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8951
| ''[[:d:Q24229287|Кішан Хірані]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 8952
| ''[[:d:Q24234002|Muriel Jones]]''
| [[File:Muriel Jones.jpg|center|128px]]
| 1890
| 1974
| [[Newport]]
|-
| style='text-align:right'| 8953
| ''[[:d:Q24249604|D. LL. Lewis]]''
|
| 1816
| 1893-09-30
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8954
| ''[[:d:Q24250050|Tudor Jones]]''
|
| 1934-11-08
|
| [[Ystradgynlais]]
|-
| style='text-align:right'| 8955
| ''[[:d:Q24250356|Edward David Williams]]''
|
| 1842-09-24
| 1909
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 8956
| ''[[:d:Q24250594|May Marsden]]''
|
| 1876-05-06
| 1968-07-12
| ''[[:d:Q5116688|Churchstoke]]''
|-
| style='text-align:right'| 8957
| ''[[:d:Q24250749|William Jones]]''
|
| 1842
| 1907
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 8958
| ''[[:d:Q24266615|William Waters]]''
|
| 1843-05-29
| 1910-03-13
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8959
| ''[[:d:Q24287035|Sian Pari Huws]]''
|
| 1960-09-02
| 2015-11-29
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 8960
| ''[[:d:Q24287037|Dafydd Parri]]''
|
| 1926-07-29
| 2001-11-29
| ''[[:d:Q3399502|Rowen]]''
|-
| style='text-align:right'| 8961
| ''[[:d:Q24287039|Derec Williams]]''
|
| 1949-11-03
| 2014-05-27
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 8962
| ''[[:d:Q24287040|Alvis Richards]]''
|
| 1935
| 2006-01-22
| ''[[:d:Q7852544|Tumble]]''
|-
| style='text-align:right'| 8963
| ''[[:d:Q24287250|Richard Owens]]''
| [[File:Mr Owen NLW3364287.jpg|center|128px]]
| 1831
| 1891-12-24
| ''[[:d:Q3402636|Y Ffôr]]''
|-
| style='text-align:right'| 8964
| ''[[:d:Q24292009|Sir James Hamlyn-Williams, 3rd Baronet]]''
|
| 1790-11-25
| 1861-10-10
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 8965
| ''[[:d:Q24300868|Ellis Powell Jones]]''
|
| 1826
| 1881-12-29
| ''[[:d:Q5263315|Derwen]]''
|-
| style='text-align:right'| 8966
| ''[[:d:Q24334379|Thomas Aneurin Roberts]]''
|
| 1824
| 1892-11-18
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 8967
| ''[[:d:Q24339521|Mark Ormrod]]''
|
| 1957-01-11
| 2020-08-02
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 8968
| ''[[:d:Q24405234|David Rowlands]]''
| [[File:David Rowlands AM (28092341381).jpg|center|128px]]
| 1948-04-28
|
| ''[[:d:Q378738|Argoed]]''
|-
| style='text-align:right'| 8969
| ''[[:d:Q24405244|Gareth Bennett]]''
| [[File:Gareth Bennett AM.png|center|128px]]
| 1968-12-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 8970
| ''[[:d:Q24405255|Steffan Lewis]]''
| [[File:Steffan Lewis AM (27555190473).jpg|center|128px]]
| 1984-05-30
| 2019-01-11
| ''[[:d:Q1774850|Ystrad Mynach]]''
|-
| style='text-align:right'| 8971
| ''[[:d:Q24450426|Rheon James]]''
|
| 1992-09-21
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8972
| ''[[:d:Q24450793|Chloe Tutton]]''
|
| 1996-07-17
|
| [[Pontypridd]]
|-
| style='text-align:right'| 8973
| ''[[:d:Q24548833|Chris Knight]]''
|
| 1991-02-28
|
| [[Swansea]]
|-
| style='text-align:right'| 8974
| ''[[:d:Q24558760|Gwawr ach Brychan]]''
|
| 4th century
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 8975
| ''[[:d:Q24565981|George Poland]]''
|
| 1913-09-21
| 1988-10-06
| [[Wales]]
|-
| style='text-align:right'| 8976
| ''[[:d:Q24566004|David Jacob Davies]]''
|
| 1916-09-05
| 1974-02-11
| ''[[:d:Q16248491|Tregroes]]''
|-
| style='text-align:right'| 8977
| ''[[:d:Q24571914|Martyn Davies]]''
|
| 1956-01-14
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 8978
| ''[[:d:Q24573112|David Lewis]]''
|
| 1797
| 1872-10-16
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 8979
| ''[[:d:Q24578824|William Leonard Baker]]''
|
| 1831-05-16
| 1893-01-07
| [[Newport]]
|-
| style='text-align:right'| 8980
| ''[[:d:Q24579303|Trevor Grierson]]''
|
| 1849-04-25
| 1913-09-21
| [[Cairdiff]]
|-
| style='text-align:right'| 8981
| ''[[:d:Q24635388|Gwen ferch Cynyr]]''
|
| 6th century
| 544-10-18
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 8982
| ''[[:d:Q24702621|Tom Doran]]''
|
| 1987-08-07
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 8983
| ''[[:d:Q24706040|Jeremy Miles]]''
| [[File:Jeremy Miles official portrait (cropped).png|center|128px]]
| 1971-08
|
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 8984
| ''[[:d:Q24708157|Branwen Niclas]]''
|
| 1969
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 8985
| ''[[:d:Q24716959|Charlotte Louisa Traherne]]''
|
| 1798-04-05
| 1880
| ''[[:d:Q7164590|Penrice Castle]]''
|-
| style='text-align:right'| 8986
| ''[[:d:Q24718677|James William Webb-Jones]]''
|
| 1904
| 1965
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 8987
| ''[[:d:Q24735292|Judith Ann Tucker]]''
|
| 1960
| 2023-11-13
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 8988
| ''[[:d:Q24809662|Ted Parry]]''
|
| 1892-12-09
|
| [[Wales]]
|-
| style='text-align:right'| 8989
| ''[[:d:Q24809752|Abdullah Izzidien]]''
|
| 1993-12-02
|
| ''[[:d:Q2044159|Llanybydder]]''
|-
| style='text-align:right'| 8990
| ''[[:d:Q24827868|Trevor Owen]]''
|
| 1873
|
| [[Wales]]
|-
| style='text-align:right'| 8991
| ''[[:d:Q24845234|Thora Silverthorne]]''
|
| 1910-11-25
| 1999-01-17
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 8992
| ''[[:d:Q24845632|William Owen]]''
|
| 1860-11-20
| 1946
| [[Wales]]
|-
| style='text-align:right'| 8993
| ''[[:d:Q24845633|Bill Parry]]''
|
| 1873
| 1923
| [[Wales]]
|-
| style='text-align:right'| 8994
| ''[[:d:Q24845756|John Williams]]''
|
| 1926-10-14
| 1997-02-25
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 8995
| ''[[:d:Q24845844|Thomas Foley]]''
| [[File:Thomas Foley - Queensland politician.jpg|center|128px]]
| 1853-06-14
| 1920-09-16
| [[Swansea]]
|-
| style='text-align:right'| 8996
| ''[[:d:Q24845876|John Fowke]]''
|
| 1858-10-23
| 1938-04-25
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 8997
| ''[[:d:Q24963103|Iestyn George]]''
|
| 1966-01-29
|
| [[Swansea]]
|-
| style='text-align:right'| 8998
| ''[[:d:Q24963158|Sydney Darvell]]''
|
| 1874-05-17
|
| [[Wales]]
|-
| style='text-align:right'| 8999
| ''[[:d:Q24963161|Llewelyn Griffiths]]''
|
| 1877
|
| [[Wales]]
|-
| style='text-align:right'| 9000
| ''[[:d:Q24973140|Tutglud ach Brychan]]''
|
| 5th century
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9001
| ''[[:d:Q24996661|Nellie Evans Packard]]''
| [[File:NellieEvansPackard.tiff|center|128px]]
|
|
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 9002
| ''[[:d:Q25138514|Johnny Baynham]]''
|
| 1918-04-21
| 1995
| ''[[:d:Q8059804|Ystrad Rhondda]]''
|-
| style='text-align:right'| 9003
| ''[[:d:Q25171277|Richard Parfitt]]''
|
|
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 9004
| ''[[:d:Q25171703|Steve Hamer]]''
|
| 1951-06-14
|
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 9005
| ''[[:d:Q25171822|John Roberts]]''
|
| 1857
| 2nd millennium
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 9006
| ''[[:d:Q25171969|David Evans]]''
|
| 1924-12-20
| 2019-09-03
| [[Penygraig]]
|-
| style='text-align:right'| 9007
| ''[[:d:Q25184178|William Hughes]]''
|
| 1889
| 1955
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 9008
| ''[[:d:Q25189322|Jack Jones]]''
| [[File:Jack Jones.jpeg|center|128px]]
| 1992-02-14
|
| [[Swansea]]
|-
| style='text-align:right'| 9009
| ''[[:d:Q25206940|Arthur Davies]]''
|
| 1886
| 1949-11
| [[Wales]]
|-
| style='text-align:right'| 9010
| ''[[:d:Q25206941|Jack Butler]]''
|
| 1868
|
| [[Wales]]
|-
| style='text-align:right'| 9011
| ''[[:d:Q25206942|William Butler]]''
|
| 1872
|
| [[Wales]]
|-
| style='text-align:right'| 9012
| ''[[:d:Q25206945|John Davies]]''
|
| 1856
|
| [[Wales]]
|-
| style='text-align:right'| 9013
| ''[[:d:Q25206949|Jack Edwards]]''
|
| 1876
|
| [[Wales]]
|-
| style='text-align:right'| 9014
| ''[[:d:Q25206950|Walter Davies]]''
|
| 1863
|
| [[Wales]]
|-
| style='text-align:right'| 9015
| ''[[:d:Q25206953|Maurice Evans]]''
|
| 1859
|
| [[Wales]]
|-
| style='text-align:right'| 9016
| ''[[:d:Q25206954|Jack Garner]]''
|
| 1872
|
| [[Wales]]
|-
| style='text-align:right'| 9017
| ''[[:d:Q25206956|Edward Evelyn]]''
|
| 1862-11-18
| 1936-05-05
| [[Wales]]
|-
| style='text-align:right'| 9018
| ''[[:d:Q25206957|Roger Evans]]''
|
| 1879-11-17
|
| [[Wales]]
|-
| style='text-align:right'| 9019
| ''[[:d:Q25206960|Peter Griffiths]]''
|
| 1862-09
|
| [[Wales]]
|-
| style='text-align:right'| 9020
| ''[[:d:Q25206961|William Green]]''
|
| 1881-12-05
| 1966-09-24
| [[Aberystwyth]]
|-
| style='text-align:right'| 9021
| ''[[:d:Q25206962|George Griffiths]]''
| [[File:GeorgeGriffiths.jpg|center|128px]]
| 1865-04-11
| 1918-07-07
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 9022
| ''[[:d:Q25206970|John Hughes]]''
|
| 1877-04-16
| 1950-07-05
| [[Wales]]
|-
| style='text-align:right'| 9023
| ''[[:d:Q25206972|Edwin James]]''
|
| 1869
|
| [[Wales]]
|-
| style='text-align:right'| 9024
| ''[[:d:Q25206973|Jack Jenkins]]''
|
| 1892-03-20
| 1946-04-16
| [[Wales]]
|-
| style='text-align:right'| 9025
| ''[[:d:Q25206980|Thomas Jenkins]]''
|
| 1877
|
| [[Wales]]
|-
| style='text-align:right'| 9026
| ''[[:d:Q25206981|Evan Jones]]''
|
| 1888-10-20
|
| [[Wales]]
|-
| style='text-align:right'| 9027
| ''[[:d:Q25206982|Frederick Jones]]''
|
| 1863
|
| [[Wales]]
|-
| style='text-align:right'| 9028
| ''[[:d:Q25206986|Hugh Jones]]''
|
| 1876
|
| [[Wales]]
|-
| style='text-align:right'| 9029
| ''[[:d:Q25206987|Gordon Jones]]''
|
| 1886
|
| [[Wales]]
|-
| style='text-align:right'| 9030
| ''[[:d:Q25206988|Ralph Jones]]''
|
| 1876
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 9031
| ''[[:d:Q25206995|Richard Jones]]''
|
| 1879
|
| [[Wales]]
|-
| style='text-align:right'| 9032
| ''[[:d:Q25206996|Richard Jones]]''
|
| 1875
|
| [[Wales]]
|-
| style='text-align:right'| 9033
| ''[[:d:Q25206997|Samuel Jones]]''
|
| 1866
|
| [[Wales]]
|-
| style='text-align:right'| 9034
| ''[[:d:Q25206999|Samuel Jones]]''
|
| 1870
|
| [[Wales]]
|-
| style='text-align:right'| 9035
| ''[[:d:Q25207017|Thomas Lewis]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 9036
| ''[[:d:Q25207019|Arthur Lloyd]]''
|
| 1868
| 1942-01-10
| [[Wales]]
|-
| style='text-align:right'| 9037
| ''[[:d:Q25207020|James Lloyd]]''
|
| 1861
|
| [[Wales]]
|-
| style='text-align:right'| 9038
| ''[[:d:Q25207022|Thomas McCarthy]]''
|
| 1868
|
| [[Wales]]
|-
| style='text-align:right'| 9039
| ''[[:d:Q25207026|John Matthias]]''
|
| 1878
|
| [[Wales]]
|-
| style='text-align:right'| 9040
| ''[[:d:Q25207027|Billy Matthews]]''
|
| 1883
| 1921
| [[Wales]]
|-
| style='text-align:right'| 9041
| ''[[:d:Q25207035|Robert Morris]]''
|
| 1875
|
| [[Wales]]
|-
| style='text-align:right'| 9042
| ''[[:d:Q25207038|John Neal]]''
|
| 1899-11-29
| 1974
| [[Wales]]
|-
| style='text-align:right'| 9043
| ''[[:d:Q25207045|Thomas Owen]]''
|
| 1861
|
| [[Wales]]
|-
| style='text-align:right'| 9044
| ''[[:d:Q25207059|John Roberts]]''
|
| 1858
|
| [[Wales]]
|-
| style='text-align:right'| 9045
| ''[[:d:Q25207062|Joseph Rogers]]''
|
| 1868
|
| [[Wales]]
|-
| style='text-align:right'| 9046
| ''[[:d:Q25207068|George Thomas]]''
|
| 1857
|
| [[Wales]]
|-
| style='text-align:right'| 9047
| ''[[:d:Q25207070|John Taylor]]''
|
| 1874
|
| [[Wales]]
|-
| style='text-align:right'| 9048
| ''[[:d:Q25207076|Dick Turner]]''
|
| 1866
|
| [[Wales]]
|-
| style='text-align:right'| 9049
| ''[[:d:Q25207077|Thomas Vaughan]]''
|
| 1864
| No/unknown value
| [[Wales]]
|-
| style='text-align:right'| 9050
| ''[[:d:Q25207080|Billy Williams]]''
|
| 1896
|
| [[Wales]]
|-
| style='text-align:right'| 9051
| ''[[:d:Q25207081|Edwin Williams]]''
|
| 1868
|
| [[Wales]]
|-
| style='text-align:right'| 9052
| ''[[:d:Q25207082|George Williams]]''
|
| 1879-09
| 1916-07-27
| [[Wales]]
|-
| style='text-align:right'| 9053
| ''[[:d:Q25207083|George Williams]]''
|
| 1862
|
| [[Wales]]
|-
| style='text-align:right'| 9054
| ''[[:d:Q25209820|Thomas Lynch]]''
|
| 1907-08-31
| 1976
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 9055
| ''[[:d:Q25342380|Mitch Fenner]]''
|
| 1946-03-25
| 2016-07-03
| [[Cairdiff]]
|-
| style='text-align:right'| 9056
| ''[[:d:Q25353794|Henry Folland]]''
|
| 1878-06-15
| 1926-03-24
| ''[[:d:Q7975195|Waunarlwydd]]''
|-
| style='text-align:right'| 9057
| ''[[:d:Q25414715|Lauren Williams]]''
| [[File:Lauren Williams after the Tokyo Olympics.jpg|center|128px]]
| 1999-02-25
|
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 9058
| ''[[:d:Q25485241|Ammar Alfian]]''
|
| 1987
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9059
| ''[[:d:Q25558093|Jennifer Jones]]''
|
| 1976-12-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9060
| ''[[:d:Q25558134|Alex Harries]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 9061
| ''[[:d:Q25558142|Arwel Davies]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 9062
| ''[[:d:Q25558144|Eiry Palfrey]]''
|
| 1939-11
|
| ''[[:d:Q6661372|Llanfihangel y Creuddyn]]''
|-
| style='text-align:right'| 9063
| ''[[:d:Q25558156|Alice Hooker-Stroud]]''
|
| 1984-04
|
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 9064
| ''[[:d:Q25558240|Eiry Thomas]]''
|
| 1968-05-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9065
| ''[[:d:Q25558258|R. Alun Evans]]''
|
| 1936-09-07
| 2023-08-20
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9066
| ''[[:d:Q25558290|Cath Aran]]''
|
|
|
| [[Gwynedd]]
|-
| style='text-align:right'| 9067
| ''[[:d:Q25558317|Nesdi Jones]]''
|
| 1992-12-11
|
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9068
| ''[[:d:Q25558366|Owen Jones Ellis Nanney]]''
|
| 1790
| 1870-10-27
| ''[[:d:Q11051258|Bryncir]]''
|-
| style='text-align:right'| 9069
| ''[[:d:Q25558389|Dafydd ap Llewelyn Llwyd]]''
|
| 1522
| 1559
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 9070
| ''[[:d:Q25558390|Thomas Pryse]]''
|
|
| 1623
| ''[[:d:Q3401728|Llandre]]''
|-
| style='text-align:right'| 9071
| ''[[:d:Q25559009|Richard Richards]]''
| [[File:Portrait of Richard Richards (4674581) (cropped).jpg|center|128px]]
| 1787-09-22
| 1860-11-27
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9072
| ''[[:d:Q25559011|Ifan Gruffydd]]''
|
| 1951-08-20
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9073
| ''[[:d:Q25559026|Tony Lewis]]''
|
| 1937-04-15
| 2005-11-08
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 9074
| ''[[:d:Q25559048|Richard Vaughan]]''
|
| 1665
| 1734-03-28
| ''[[:d:Q17744231|Cors y Gedol Hall]]''
|-
| style='text-align:right'| 9075
| ''[[:d:Q25753062|Reginald Wynn Owen]]''
|
| 1876-07-23
| 1950-05-15
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 9076
| ''[[:d:Q25756678|Owen Morgan]]''
|
| 1994-04-11
|
| [[Swansea]]
|-
| style='text-align:right'| 9077
| ''[[:d:Q25824295|John S. Davies]]''
| [[File:P1040167 crop (cropped) - John S. Davies.jpg|center|128px]]
| 1940-06-07
| 2016-01-22
| ''[[:d:Q3405138|St Dogmaels]]''
|-
| style='text-align:right'| 9078
| ''[[:d:Q25858076|Scott Ellaway]]''
| [[File:Scott Ellaway filming OpusYou in 2016 (Photo by Clive Barda).jpg|center|128px]]
| 1981-08-08
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9079
| ''[[:d:Q25906323|Joel Makin]]''
|
| 1994-10-27
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9080
| ''[[:d:Q25927690|Chris Barber]]''
|
| 1941
|
| [[Newport]]
|-
| style='text-align:right'| 9081
| ''[[:d:Q25938069|Adrian Davies]]''
|
| 1966-01-06
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9082
| ''[[:d:Q26000446|Sir Edward Pryce-Jones, 1st Baronet]]''
| [[File:Edward-Pryce-Jones.jpg|center|128px]]
| 1861-02-06
| 1926-05-22
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 9083
| ''[[:d:Q26132127|Kiran Carlson]]''
| [[File:3 37 Kiran Carlson.jpg|center|128px]]
| 1998-05-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9084
| ''[[:d:Q26132784|Nigel Hurley]]''
|
| 1969
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9085
| ''[[:d:Q26156061|Tecwyn Ellis]]''
|
| 1918-04-24
| 2012-09-17
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 9086
| ''[[:d:Q26208288|Evan Richards]]''
| [[File:Evan Mathew Richards AS.jpg|center|128px]]
| 1821-11-17
| 1880-08-21
| [[Swansea]]
|-
| style='text-align:right'| 9087
| ''[[:d:Q26208520|Gruffudd Lewis]]''
|
| 1997-11-10
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9088
| ''[[:d:Q26210728|Jonathan Worsley]]''
|
| 1984-08-02
|
| [[Wales]]
|-
| style='text-align:right'| 9089
| ''[[:d:Q26213540|Sioned James]]''
|
| 1974-09-10
| 2016-07-19
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9090
| ''[[:d:Q26219700|Jasmine Joyce]]''
|
| 1995-10-09
|
| [[St Davids]]
|-
| style='text-align:right'| 9091
| ''[[:d:Q26220911|Sam Cross]]''
|
| 1992-08-26
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9092
| ''[[:d:Q26250588|David Morgan]]''
|
| 1994-01-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9093
| ''[[:d:Q26251785|Lukas Carey]]''
|
| 1997-07-17
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9094
| ''[[:d:Q26253823|Einir Jones]]''
|
| 1950
|
| [[Anglesey]]
|-
| style='text-align:right'| 9095
| ''[[:d:Q26253829|Arthur Thomas]]''
|
|
|
| [[Gwynedd]]
|-
| style='text-align:right'| 9096
| ''[[:d:Q26265397|David Morris]]''
|
| 1800
| 1864-09-30
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9097
| ''[[:d:Q26271764|William Morris]]''
|
| 1811-06-25
| 1877-02-25
| ''[[:d:Q6661525|Llangunnor]]''
|-
| style='text-align:right'| 9098
| ''[[:d:Q26289884|James Gwynne-Holford]]''
|
| 1833
| 1916
| ''[[:d:Q6661758|Llansantffraed]]''
|-
| style='text-align:right'| 9099
| ''[[:d:Q26293080|Elfed Roberts]]''
|
| 1949-07
|
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 9100
| ''[[:d:Q26405093|George Nott]]''
|
| 1996-01-21
|
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 9101
| ''[[:d:Q26689655|Stephen Morris]]''
|
| 1988-09-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9102
| ''[[:d:Q26696072|John Evans]]''
|
| 1795
| 1864
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9103
| ''[[:d:Q26702229|Cecily Mackworth]]''
|
| 1911-08-15
| 2006-07-22
| ''[[:d:Q6661799|Llantilio Pertholey]]''
|-
| style='text-align:right'| 9104
| ''[[:d:Q26704328|Michael Bonacini]]''
|
| 1960-03-01
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 9105
| ''[[:d:Q26727497|Olwen Brogan]]''
|
| 1900-12-15
| 1989-12-18
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 9106
| ''[[:d:Q26754461|Arthur Davies]]''
|
| 1872
| 1942-08-04
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9107
| ''[[:d:Q26769421|John Henry Williams]]''
|
| 1887-06-21
| 1980-12-24
| [[Wales]]
|-
| style='text-align:right'| 9108
| ''[[:d:Q26775230|Jack Roberts]]''
|
| 1991-11-20
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9109
| ''[[:d:Q26809927|Pryce Lewis]]''
| [[File:Pryce Lewis.jpg|center|128px]]
| 1831-02-13
| 1911-12-06
| ''[[:d:Q7020033|Newton]]''
|-
| style='text-align:right'| 9110
| ''[[:d:Q26818595|Gwenllian Davies]]''
|
|
| 2007-07-24
| ''[[:d:Q3910782|Bedlinog]]''
|-
| style='text-align:right'| 9111
| ''[[:d:Q26837633|Liam Angel]]''
|
| 1999-03-17
|
| [[Wales]]
|-
| style='text-align:right'| 9112
| ''[[:d:Q26837649|Kyle Copp]]''
|
| 1996-11-01
|
| [[Swansea]]
|-
| style='text-align:right'| 9113
| ''[[:d:Q26838543|Sean Griffiths]]''
|
| 1995-05-16
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9114
| ''[[:d:Q26838630|David Baynham]]''
|
| 1902-06-12
| 1974
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9115
| ''[[:d:Q26882238|Peter Edwards]]''
|
| 1947-10
| 2016-09-12
| ''[[:d:Q1428848|Fflint]]''
|-
| style='text-align:right'| 9116
| ''[[:d:Q26923804|Brad Thyer]]''
|
| 1993-02-07
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9117
| ''[[:d:Q26923806|Harrison Keddie]]''
| [[File:Harrison Keddie 2021.jpg|center|128px]]
| 1996-07-10
|
| ''[[:d:Q6732359|Magor]]''
|-
| style='text-align:right'| 9118
| ''[[:d:Q26923857|Calvin Wellington]]''
|
| 1995-12-10
|
| [[Wales]]
|-
| style='text-align:right'| 9119
| ''[[:d:Q26923859|Regan Grace]]''
| [[File:Regan Grace.jpg|center|128px]]
| 1996-12-12
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 9120
| ''[[:d:Q26924699|Kevin Courtney]]''
|
| 1959-08
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9121
| ''[[:d:Q26970843|William Trevor Anthony]]''
|
| 1912-10-28
| 1984-08-01<br/>1984-08-04
| ''[[:d:Q7859766|Tycroes]]''
|-
| style='text-align:right'| 9122
| ''[[:d:Q26973563|Haf Llewelyn]]''
|
| 1964-06-17
|
| ''[[:d:Q5197202|Cwm Nantcol]]''
|-
| style='text-align:right'| 9123
| ''[[:d:Q26985026|Aimee Moran]]''
|
| 1994-09-04
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9124
| ''[[:d:Q26985252|Frederick Kynaston Barnes]]''
|
| 1828-02-11<br/>1828
| 1908-08-29<br/>1908
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 9125
| ''[[:d:Q27036912|Cwyfan]]''
|
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 9126
| ''[[:d:Q27044313|Samuel Jones]]''
|
| 1898-11-30
| 1974-09-05
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 9127
| ''[[:d:Q27048861|Josh Helps]]''
|
| 1994-12-22
|
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 9128
| ''[[:d:Q27048869|Dafydd Hughes]]''
|
| 1996-01-08
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9129
| ''[[:d:Q27048999|Keelan Giles]]''
|
| 1998-01-29
|
| [[Swansea]]
|-
| style='text-align:right'| 9130
| ''[[:d:Q27049185|Connor Farrer]]''
|
| 1995-06-06
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9131
| ''[[:d:Q27057756|Jonny Clayton]]''
| [[File:2022-06-13 Play-offs (2022 Premier League Darts) by Sandro Halank–038.jpg|center|128px]]
| 1974-10-04
|
| [[Wales]]
|-
| style='text-align:right'| 9132
| ''[[:d:Q27058417|Stephen Goss]]''
| [[File:Stephen Goss.jpg|center|128px]]
| 1964-02-02
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 9133
| ''[[:d:Q27062496|Audrey Williams]]''
|
| 1902
| 1978
| ''[[:d:Q3403308|Dinas Powys]]''
|-
| style='text-align:right'| 9134
| ''[[:d:Q27064081|Phyllis Linton]]''
|
| 1929-06-09
| 2023-11-19
| [[Newport]]
|-
| style='text-align:right'| 9135
| ''[[:d:Q27067380|Hychan]]''
| [[File:St Hychan's Church, Eglwys Llanychan, Rhuthun, Sir Ddinbych, Cymru, Wales 09.jpg|center|128px]]
|
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 9136
| ''[[:d:Q27068512|James Ball]]''
| [[File:James Ball (2016).jpg|center|128px]]
| 1991-06-24
|
| ''[[:d:Q7228203|Ponthir]]''
|-
| style='text-align:right'| 9137
| ''[[:d:Q27070262|Greg Holmes]]''
|
| 1993-09-22
|
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 9138
| ''[[:d:Q27074279|Gwyn Llewelyn]]''
|
| 1942-03-06
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9139
| ''[[:d:Q27106535|Gerard Storm]]''
| [[File:Gerard Storm (1974).jpg|center|128px]]
| 1918-04-18
| 2002-12-04
| [[Swansea]]
|-
| style='text-align:right'| 9140
| ''[[:d:Q27140407|Siân Eirian Rees Davies]]''
|
| 1981
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9141
| ''[[:d:Q27140454|Siân Lewis]]''
|
| 1945
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9142
| ''[[:d:Q27206071|Sam Jones]]''
|
| 1993
|
| [[Swansea]]
|-
| style='text-align:right'| 9143
| ''[[:d:Q27230339|Twm Elias]]''
| [[File:Y Naturiaethwr Twm Elias yn Rhuthun Ebrill 2017 RO.jpg|center|128px]]
| 1947
|
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 9144
| ''[[:d:Q27306153|Dave Richards]]''
| [[File:Richards, Dave.jpg|center|128px]]
| 1993-12-31
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9145
| ''[[:d:Q27460689|Cyril Percival]]''
|
| 1889-10-19
| 1948-07-27
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9146
| ''[[:d:Q27494205|Manon Lloyd]]''
| [[File:Manon Lloyd - 2017 Tour Series (Motherwell, pre-race).jpg|center|128px]]
| 1996-11-05
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9147
| ''[[:d:Q27517561|Gruffydd Aled Williams]]''
|
| 1943
|
| ''[[:d:Q5278387|Dinmael]]''
|-
| style='text-align:right'| 9148
| ''[[:d:Q27553597|Elen Roger Jones]]''
| [[File:Elen Roger Jones.jpg|center|128px]]
| 1908-08-27
| 1999-04-15
| ''[[:d:Q6761826|Marian-glas]]''
|-
| style='text-align:right'| 9149
| ''[[:d:Q27579892|John Cooper]]''
|
| 1954-05-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9150
| ''[[:d:Q27588652|Lisa Forey]]''
|
| 1977-07-06
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 9151
| ''[[:d:Q27628129|Jackson Page]]''
|
| 2001-08-08
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 9152
| ''[[:d:Q27636890|Marion Purcell]]''
|
| 1960
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 9153
| ''[[:d:Q27655866|Caroline Taylor]]''
|
| 1973-08-20
|
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 9154
| ''[[:d:Q27655874|Hannah Smith]]''
|
| 1986-07-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9155
| ''[[:d:Q27661910|Harry Toft]]''
|
| 1881
| 1951-12
| [[Swansea]]
|-
| style='text-align:right'| 9156
| ''[[:d:Q27663652|Richard Lancaster]]''
|
| 1980-05-29
|
| [[Swansea]]
|-
| style='text-align:right'| 9157
| ''[[:d:Q27666574|Ruth Martin-Jones]]''
|
| 1947-01-28
|
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9158
| ''[[:d:Q27671285|Howard Davies]]''
|
| 1944-08-05
|
| [[Newport]]
|-
| style='text-align:right'| 9159
| ''[[:d:Q27733807|Jed Davies]]''
|
| 1988-01-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9160
| ''[[:d:Q27734045|Finlay Wood]]''
|
| 20th century
|
| [[Newport]]
|-
| style='text-align:right'| 9161
| ''[[:d:Q27793332|Jordan Hart]]''
|
| 1995-01-26
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9162
| ''[[:d:Q27824216|Thomas Buckland]]''
|
| 1870
| 1932
| [[Wales]]
|-
| style='text-align:right'| 9163
| ''[[:d:Q27824219|Richard Jarrett]]''
|
| 1870
|
| [[Wales]]
|-
| style='text-align:right'| 9164
| ''[[:d:Q27825230|Ben Whitehouse]]''
| [[File:Ben Whitehouse 2023.jpg|center|128px]]
| 1990-08-09
|
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 9165
| ''[[:d:Q27825483|Sir Richard Price Puleston, 1st Baronet]]''
|
| 1765-09-03
| 1840-05-19
| ''[[:d:Q26213230|Bryn y Pys Hall]]''
|-
| style='text-align:right'| 9166
| ''[[:d:Q27827594|Henry Robins]]''
|
|
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9167
| ''[[:d:Q27830996|Courtney Davies]]''
|
| 1994-07-01
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 9168
| ''[[:d:Q27838011|Andrew Davies]]''
|
| 1967-06-17
|
| ''[[:d:Q722585|Cil-y-coed]]''
|-
| style='text-align:right'| 9169
| ''[[:d:Q27861839|Gareth Powell]]''
| [[File:Gareth Powell, British-born Australian publisher, journalist, author, and editor, 1967.png|center|128px]]
| 1934-05-26
| 2016-09-16
| ''[[:d:Q3401109|Caerwys]]''
|-
| style='text-align:right'| 9170
| ''[[:d:Q27861969|Henry Morris Pryce-Jones]]''
|
| 1878-02-17
| 1952-11-05
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 9171
| ''[[:d:Q27863975|Ed Thomas]]''
|
| 1961
|
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 9172
| ''[[:d:Q27876622|Frances Môn Jones]]''
|
| 1919-10-20
| 2000-09-08
| ''[[:d:Q990946|Broughton]]''
|-
| style='text-align:right'| 9173
| ''[[:d:Q27876643|Dora Herbert Jones]]''
|
| 1890-08-26
| 1974-01-09
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 9174
| ''[[:d:Q27898910|Penelope Fillon]]''
| [[File:Penelope Fillon.jpg|center|128px]]
| 1955-07-31
|
| ''[[:d:Q6661701|Llanover]]''
|-
| style='text-align:right'| 9175
| ''[[:d:Q27922155|Ernest William Jones]]''
|
| 1870-12
| 1941-09-17
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 9176
| ''[[:d:Q27922515|Michael Forrest]]''
|
| 1932-07
| 2004-12-21
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9177
| ''[[:d:Q27924032|Marchell]]''
| [[File:Yr Eglwys Wen Dinbych St Marcella 06.JPG|center|128px]]
| 610
|
| ''[[:d:Q3404531|Bangor-on-Dee]]''
|-
| style='text-align:right'| 9178
| ''[[:d:Q27924815|Edward Laverack]]''
| [[File:Bellignies - Grand Prix des Marbriers, 25 août 2015 (A074).JPG|center|128px]]
| 1994-07-27
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9179
| ''[[:d:Q27947670|Annemarie Lewis Thomas]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 9180
| ''[[:d:Q27967959|William Roberts]]''
| [[File:Nefydd (William Roberts).jpg|center|128px]]
| 1813-03-08
| 1872-06-18
| ''[[:d:Q13129615|Llannefydd]]''
|-
| style='text-align:right'| 9181
| ''[[:d:Q27969093|Wendy Price]]''
|
| 1972-03-06
|
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 9182
| ''[[:d:Q27970129|Owen John Owen]]''
|
| 1867
| 1960-12-30
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9183
| ''[[:d:Q27971201|John Phillips]]''
|
| 1810-04-12
| 1877-05-28
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 9184
| ''[[:d:Q27971230|John Pugh]]''
|
| 1783-08
| 1839-02-16
| ''[[:d:Q6661464|Llangelynnin]]''
|-
| style='text-align:right'| 9185
| ''[[:d:Q27972098|Hugh Williams]]''
| [[File:Portrait of Cadfan (4671203).jpg|center|128px]]
| 1807
| 1870-07-11
| ''[[:d:Q3402457|Bryncrug]]''
|-
| style='text-align:right'| 9186
| ''[[:d:Q27972897|Rosemary Barrow]]''
|
| 1968-04-09
| 2016-09-21
| ''[[:d:Q3396741|Skewen]]''
|-
| style='text-align:right'| 9187
| ''[[:d:Q27972899|Roger Howells]]''
|
| 1931-09-18
| 1975
| [[Swansea]]
|-
| style='text-align:right'| 9188
| ''[[:d:Q27981378|Jonny Duddle]]''
|
| 1979
|
| [[Flintshire]]
|-
| style='text-align:right'| 9189
| ''[[:d:Q27982248|Billy James]]''
|
| 1921-10-18
| 1980-07-27
| [[Cairdiff]]
|-
| style='text-align:right'| 9190
| ''[[:d:Q27995602|Tori James]]''
| [[File:Tori James with Rhodri Morgan.jpg|center|128px]]
| 1981
|
| [[Wales]]
|-
| style='text-align:right'| 9191
| ''[[:d:Q27995652|Philip Archibald Gibbs]]''
|
| 1893-08-05
| 1960-03-04
| [[Llwynypia]]
|-
| style='text-align:right'| 9192
| ''[[:d:Q27998774|Izaak Duffy]]''
|
| 1989-02-16
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9193
| ''[[:d:Q28003067|Betty Campbell]]''
| [[File:Betty Campbell head 01.jpg|center|128px]]
| 1934-11-06
| 2017-10-13
| ''[[:d:Q5002508|Butetown]]''
|-
| style='text-align:right'| 9194
| ''[[:d:Q28011841|John Ralph Michell]]''
|
| 1861-08-12
| 1947-10-04
| [[Swansea]]
|-
| style='text-align:right'| 9195
| ''[[:d:Q28018188|Betty Morgan]]''
|
| 1942-09-05
|
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 9196
| ''[[:d:Q28024777|John Price]]''
| [[File:Jack Price BC.jpg|center|128px]]
| 1883-04-10
| 1956-04-08
| [[Swansea]]
|-
| style='text-align:right'| 9197
| ''[[:d:Q28026597|John Roberts]]''
|
| 1731
| 1806-09-19
| ''[[:d:Q3398834|Llanaelhaearn]]''
|-
| style='text-align:right'| 9198
| ''[[:d:Q28028557|Paul Panton]]''
|
| 1758
| 1822-08-24
| ''[[:d:Q3401133|Bagillt]]''
|-
| style='text-align:right'| 9199
| ''[[:d:Q28035448|Cecil Smith]]''
|
| 1936
| 2016-12-02
| [[Wales]]
|-
| style='text-align:right'| 9200
| ''[[:d:Q28037263|Amanda James]]''
|
| 1960-10-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9201
| ''[[:d:Q28037345|Anne Adams]]''
|
| 1960-01-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9202
| ''[[:d:Q28043251|Rachel Owen]]''
|
| 1968-11-30
| 2016-12-18
| [[Cairdiff]]
|-
| style='text-align:right'| 9203
| ''[[:d:Q28044426|Mary Grierson]]''
|
| 1912-09-27
| 2012-01-30
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9204
| ''[[:d:Q28045011|Terry James]]''
|
| 1933
| 2016-10-22
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 9205
| ''[[:d:Q28047804|Luke Price]]''
| [[File:Luke Price 2017.jpg|center|128px]]
| 1995-09-26
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9206
| ''[[:d:Q28047860|Harry Gould]]''
|
| 1914-07-30
| 2000-09-11
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9207
| ''[[:d:Q28059338|Jermaine Asare]]''
|
| 1983-09-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9208
| ''[[:d:Q28065152|Ron Howells]]''
|
| 1935-08-03
| 2014-08
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 9209
| ''[[:d:Q28086082|Jason Shepherd]]''
| [[File:Jason Shepherd.jpg|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 9210
| ''[[:d:Q28086085|Peter Anthony Freeman]]''
| [[File:Peter Anthony Freeman.jpg|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 9211
| ''[[:d:Q28091599|Trefor Beasley]]''
|
| 1918-11-30
| 1994-05-15
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 9212
| ''[[:d:Q28105546|John K. Davies]]''
|
| 1937-09-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9213
| ''[[:d:Q28115294|Ellis Stanbury]]''
|
| 1931
| 2007-03-26
| ''[[:d:Q1152204|South Glamorgan]]''
|-
| style='text-align:right'| 9214
| ''[[:d:Q28124208|Chris Blake]]''
|
| 1971-08-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9215
| ''[[:d:Q28151696|Rhian Griffiths]]''
|
| 1994-12-11
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 9216
| ''[[:d:Q28151842|Mark Harris]]''
| [[File:Sparky Harris.jpg|center|128px]]
| 1998-12-29
|
| [[Swansea]]
|-
| style='text-align:right'| 9217
| ''[[:d:Q28160608|Ivor Hughes]]''
|
| 1939-02-28
| 1966-08-23
| [[Welshpool]]
|-
| style='text-align:right'| 9218
| ''[[:d:Q28180374|Russell P. Hughes]]''
|
| 1946-12-23
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 9219
| ''[[:d:Q28308507|John Haydn Davies]]''
|
| 1905-02-03
| 1991-06-17<br/>1991-04-14
| ''[[:d:Q4923806|Blaencwm]]''
|-
| style='text-align:right'| 9220
| ''[[:d:Q28312659|Ilan]]''
|
|
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 9221
| ''[[:d:Q28312981|Joseph Davies]]''
|
| 1880-05-29
| 1954-07-16
| [[Pontypridd]]
|-
| style='text-align:right'| 9222
| ''[[:d:Q28354969|Stewart Williams]]''
|
| 1925-12-12
| 2011-01-13
| ''[[:d:Q7339915|Rhath]]''
|-
| style='text-align:right'| 9223
| ''[[:d:Q28354972|Richard Elwyn Hughes]]''
|
| 1928-10
| 2015-11-30
| ''[[:d:Q1681386|Rhayader]]''
|-
| style='text-align:right'| 9224
| ''[[:d:Q28356929|Ted Breeze Jones]]''
|
| 1929-03-08
| 1997-07-03
| ''[[:d:Q20597403|Manod]]''
|-
| style='text-align:right'| 9225
| ''[[:d:Q28360693|Thomas Redvers Llewellyn]]''
|
| 1901-12-04
| 1976-05-24
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 9226
| ''[[:d:Q28360696|Eric Sunderland]]''
|
| 1930-03-18
| 2010
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 9227
| ''[[:d:Q28360706|William (John) Morgan]]''
|
| 1846-12-14
| 1918-06-23
| ''[[:d:Q1936328|Nevern]]''
|-
| style='text-align:right'| 9228
| ''[[:d:Q28360712|Thomas Evan Watkins]]''
|
| 1801-05-01
| 1889-01-31
| ''[[:d:Q6661380|Llanfoist]]''
|-
| style='text-align:right'| 9229
| ''[[:d:Q28360713|John Jenkyn Morgan]]''
|
| 1875-08-10
| 1961-05-18
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 9230
| ''[[:d:Q28360720|Henry John Randall]]''
|
| 1877-12-13
| 1964-11-04
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9231
| ''[[:d:Q28360726|David Roberts]]''
|
| 1875-08-01
| 1956-03-21
| ''[[:d:Q3402405|Llanymawddwy]]''
|-
| style='text-align:right'| 9232
| ''[[:d:Q28360731|David John Roberts]]''
|
| 1883-05-14
| 1956-11-27
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9233
| ''[[:d:Q28360736|Robert Roberts]]''
| [[File:Bob Roberts, Tai'r Felin, album cover.jpg|center|128px]]
| 1870-09-01
| 1951-11-30
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 9234
| ''[[:d:Q28360740|George Isaac Thomas]]''
|
| 1895-11-29
| 1941-12-31
| ''[[:d:Q6661117|Llanboidy]]''
|-
| style='text-align:right'| 9235
| ''[[:d:Q28360744|William Phillip Thomas]]''
|
| 1861-10-27
| 1954-08-02
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 9236
| ''[[:d:Q28360754|Thomas Glyn Walters]]''
|
| 1890-01-04
| 1970-07-29
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 9237
| ''[[:d:Q28360757|John Williams]]''
|
| 1872-09-22
| 1944-05-30
| ''[[:d:Q11015816|Rhostryfan]]''
|-
| style='text-align:right'| 9238
| ''[[:d:Q28360762|Robert John Williams]]''
|
| 1891-04-13
| 1967-10-13
| ''[[:d:Q3398853|Trawsfynydd]]''
|-
| style='text-align:right'| 9239
| ''[[:d:Q28360793|Alice Matilda Langland Williams]]''
|
| 1867-10-04
| 1950
| ''[[:d:Q13656930|Oystermouth]]''
|-
| style='text-align:right'| 9240
| ''[[:d:Q28360830|Thomas Oswald Williams]]''
|
| 1888-05-10
| 1965-05-04
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 9241
| ''[[:d:Q28360838|William Owen]]''
|
| 1762
| 1853
| ''[[:d:Q11138487|Llantrisant]]''
|-
| style='text-align:right'| 9242
| ''[[:d:Q28360844|Edward Walter Rees]]''
|
| 1881-10-08
| 1940-04-24
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 9243
| ''[[:d:Q28360848|Howell Roberts]]''
|
| 1840-08-21
| 1922
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 9244
| ''[[:d:Q28360853|Peter Williams]]''
| [[File:Rev. Peter Williams (Pedr Hir), Liverpool (5293994).jpg|center|128px]]
| 1847-05-01
| 1922-03-24
| ''[[:d:Q13129677|Llanynys]]''
|-
| style='text-align:right'| 9245
| ''[[:d:Q28360856|Thomas Williams]]''
| [[File:Wynebddalen Hanes Bywyd Thomas Williams, Capelulo.jpg|center|128px]]
|
| 1855-02-14
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 9246
| ''[[:d:Q28360860|John Roberts]]''
|
| 1899-05-01
| 1979-01-30
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 9247
| ''[[:d:Q28360862|Thomas Davies]]''
|
| 1851-11-11
| 1924-12-10
| ''[[:d:Q5201424|Abercywarch]]''
|-
| style='text-align:right'| 9248
| ''[[:d:Q28360874|Lewis Meredith]]''
|
| 1826-03-22
| 1891-09-29
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 9249
| ''[[:d:Q28360879|David Michael]]''
|
| 1842-07-07
| 1913-08-11
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 9250
| ''[[:d:Q28360881|Evan Morgan]]''
|
| 1846-03-27
| 1920-11-01
| ''[[:d:Q6911498|Morfa Bychan]]''
|-
| style='text-align:right'| 9251
| ''[[:d:Q28360885|John Rhys Morgan]]''
| [[File:Portrait of John Rhys Morgan, D.D (4670414).jpg|center|128px]]
| 1822-08-03
| 1900-03-14
| ''[[:d:Q6647290|Lisvane]]''
|-
| style='text-align:right'| 9252
| ''[[:d:Q28360890|William Morgan]]''
|
| 1819-07-03
| 1878-09-07
| ''[[:d:Q5057243|Cefn Coed y Cymer]]''
|-
| style='text-align:right'| 9253
| ''[[:d:Q28360900|William Moses]]''
|
| 1742
| 1824-11-27
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9254
| ''[[:d:Q28360904|Owen Griffith Owen]]''
| [[File:Owen Griffith Owen.jpg|center|128px]]
| 1847-11-08
| 1916-02-08
| ''[[:d:Q7131619|Pant Glas]]''
|-
| style='text-align:right'| 9255
| ''[[:d:Q28360913|Richard Jones Owen]]''
| [[File:Richard Jones Owen, 'Glaslyn' (5449759) (cropped).jpg|center|128px]]
| 1831-04-13
| 1909-03-24
| ''[[:d:Q10989811|Llanfrothen]]''
|-
| style='text-align:right'| 9256
| ''[[:d:Q28360916|Robert Owen]]''
| [[File:Robert Owen (Eyron Gwyllt Walia).jpg|center|128px]]
| 1803-04-03
| 1870-08-22
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 9257
| ''[[:d:Q28360918|William Owen]]''
|
| 1788
| 1838-10-08
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 9258
| ''[[:d:Q28360923|William Owen]]''
|
| 1789
| 1841-10-15
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 9259
| ''[[:d:Q28361196|William Owen]]''
| [[File:Portrait of W. Owen Prysgol (4670429).jpg|center|128px]]
| 1813-12-12
| 1893-07-20
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9260
| ''[[:d:Q28361200|David Parry]]''
|
| 1835
| 1870-09-08
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 9261
| ''[[:d:Q28361205|Harri Parri]]''
|
| 1709
| 1800-11-15
| ''[[:d:Q10989923|Llanfihangel-yng-Ngwynfa]]''
|-
| style='text-align:right'| 9262
| ''[[:d:Q28361334|Robert Parry]]''
| [[File:Portrait of Robert Parry neu Robyn Ddu Eryri (4673403).jpg|center|128px]]
| 1804-02-07
| 1892-11-04
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9263
| ''[[:d:Q28361336|Thomas Parry]]''
|
|
| 1874-11-11
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 9264
| ''[[:d:Q28361346|Benjamin Price]]''
| [[File:Portrait of Benjamin Price Cymro Bach (4671821).jpg|center|128px]]
| 1792
| 1854-06-25
| ''[[:d:Q6661860|Llanwenarth]]''
|-
| style='text-align:right'| 9265
| ''[[:d:Q28361349|David Price]]''
|
| 1804
| 1874
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 9266
| ''[[:d:Q28361353|Thomas Walter Price]]''
|
| 1829-12-23
| 1869-05-12
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 9267
| ''[[:d:Q28361357|John Price]]''
|
| 1803
| 1887-10-14
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 9268
| ''[[:d:Q28361361|John William Prichard]]''
|
| 1749
| 1829-03-05
| ''[[:d:Q3404314|Llanddaniel Fab]]''
|-
| style='text-align:right'| 9269
| ''[[:d:Q28361371|William Thomas Rees]]''
| [[File:Portrait of William Thomas Rees, 'Alaw Ddu' (4670485).jpg|center|128px]]
| 1838-09-29
| 1904-03-19
| ''[[:d:Q20592884|Pwll-y-glaw]]''
|-
| style='text-align:right'| 9270
| ''[[:d:Q28361374|Jonathan Owain Reynolds]]''
|
| 1814-04-28
| 1891-07-17
| ''[[:d:Q6661877|Llanwinio]]''
|-
| style='text-align:right'| 9271
| ''[[:d:Q28361384|John Richards]]''
|
| 1843-07-13
| 1901-09-15
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9272
| ''[[:d:Q28361388|Griffith Roberts]]''
|
| 1846-10-07
| 1915-01-20
| ''[[:d:Q5623909|Gwytherin]]''
|-
| style='text-align:right'| 9273
| ''[[:d:Q28361398|John Roberts]]''
| [[File:Portrait of John Roberts, harpist, of Newtown (4670503) (cropped).jpg|center|128px]]
| 1816
| 1894-05-11
| ''[[:d:Q13129669|Llanrhaeadr-yng-Nghinmeirch]]''
|-
| style='text-align:right'| 9274
| ''[[:d:Q28361402|John John Roberts]]''
| [[File:Iolo Caernarfon.jpg|center|128px]]
| 1840
| 1914-11-05
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 9275
| ''[[:d:Q28361405|Lewis Roberts]]''
|
| 1756-03-09
| 1844-04-02
| ''[[:d:Q6661176|Llandecwyn]]''
|-
| style='text-align:right'| 9276
| ''[[:d:Q28361407|Richard Roberts]]''
|
| 1818
| 1876-06-19
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 9277
| ''[[:d:Q28361412|Richard Roberts]]''
| [[File:Richard Gwylfa Roberts.jpg|center|128px]]
| 1871-05-24
| 1935-07-08
| ''[[:d:Q2653611|Penmaenmawr]]''
|-
| style='text-align:right'| 9278
| ''[[:d:Q28361414|Thomas Rowland Roberts]]''
| [[File:Thomas Rowland Roberts (Asaph).jpg|center|128px]]
| 1857
| 1940-06-16
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 9279
| ''[[:d:Q28361417|Thomas Roberts]]''
| [[File:Thomas Roberts, Scorpion (4974950).png|center|128px]]
| 1816-08-25
| 1887-06-12
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 9280
| ''[[:d:Q28361425|David Rowland(S)]]''
|
| 1782-08-25
| 1820-01-07
| ''[[:d:Q5446229|Ffos-y-ffin]]''
|-
| style='text-align:right'| 9281
| ''[[:d:Q28361431|Henry Rowlands]]''
|
| 1832
| 1903-01-28
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 9282
| ''[[:d:Q28361434|David Samuel]]''
| [[File:David Samuel.jpg|center|128px]]
| 1856-03-01
| 1921-05-26
| [[Aberystwyth]]
|-
| style='text-align:right'| 9283
| ''[[:d:Q28361438|David Saunders]]''
|
| 1769-01
| 1840-02-04
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 9284
| ''[[:d:Q28361446|David Rhys Stephen]]''
| [[File:Portrait of D. Rhys Stephen (4672025).jpg|center|128px]]
| 1807-04-23
| 1852-04-24
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9285
| ''[[:d:Q28361448|Robert David Thomas]]''
| [[File:Portrait of R. D. Thomas (4672710).jpg|center|128px]]
| 1817-09-17
| 1888-11-25
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 9286
| ''[[:d:Q28361456|Edward Thomas]]''
| [[File:Cochfarf.jpg|center|128px]]
| 1853-03-09
| 1912-11-18
| ''[[:d:Q4898674|Betws]]''
|-
| style='text-align:right'| 9287
| ''[[:d:Q28361459|Thomas Emlyn Thomas]]''
|
| 1822<br/>1822-11
| 1846-04-21
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 9288
| ''[[:d:Q28361462|Evan Thomas]]''
|
| 1795
| 1867-10-02
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 9289
| ''[[:d:Q28361464|Hugh Evan Thomas]]''
|
| 1830-06-13
| 1889-12-09
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 9290
| ''[[:d:Q28361468|Francis Thomas]]''
|
| 1726
| 1796-03-04
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 9291
| ''[[:d:Q28361471|Jenkin Thomas]]''
|
| 1746-09-16
| 1807-12-26
| ''[[:d:Q6759079|Margam]]''
|-
| style='text-align:right'| 9292
| ''[[:d:Q28361476|John Thomas]]''
|
| 1742
| 1818-09-12
| ''[[:d:Q5064823|Cerrigydrudion]]''
|-
| style='text-align:right'| 9293
| ''[[:d:Q28361479|John Thomas]]''
|
| 1813
| 1866-12-26
| ''[[:d:Q13130710|Pentre Gwenlais]]''
|-
| style='text-align:right'| 9294
| ''[[:d:Q28361482|John Thomas]]''
|
| 1839-12-11
| 1921-02-25
| ''[[:d:Q13126078|Blaenannerch]]''
|-
| style='text-align:right'| 9295
| ''[[:d:Q28361486|John Thomas]]''
| [[File:Portrait of Mr. John Thomas (Eifionydd) (4671487).jpg|center|128px]]
| 1848-08-06
| 1922-11-19
| ''[[:d:Q13130691|Penmorfa]]''
|-
| style='text-align:right'| 9296
| ''[[:d:Q28361492|Arthur Simon Thomas]]''
|
| 1865-09-05
| 1935-03-03
| ''[[:d:Q5189931|Crugybar]]''
|-
| style='text-align:right'| 9297
| ''[[:d:Q28361498|Rowland Walter]]''
|
| 1819
| 1884-03
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9298
| ''[[:d:Q28361501|Abraham Williams]]''
|
| 1755-09-18
| 1828-12-27
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 9299
| ''[[:d:Q28361504|Robert Arthur Williams]]''
| [[File:Robert Arthur Williams (Berw).jpg|center|128px]]
| 1854-04-08
| 1926-04-23
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9300
| ''[[:d:Q28361508|Benjamin Williams]]''
| [[File:Portrait of 'Gwynionydd' (4672166).jpg|center|128px]]
| 1821-06-24
| 1891-12-07
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 9301
| ''[[:d:Q28361511|John Ceulanydd Williams]]''
| [[File:John Williams (Ceulanydd).jpg|center|128px]]
| 1851
| 1899-09-11
| ''[[:d:Q3398810|Tal-y-bont]]''
|-
| style='text-align:right'| 9302
| ''[[:d:Q28361514|David Williams]]''
|
| 1796-01
| 1823-01-10
| ''[[:d:Q15963900|Llanwnnen]]''
|-
| style='text-align:right'| 9303
| ''[[:d:Q28361519|Robert Herbert Williams]]''
| [[File:Portrait of R. H. Williams, Menai Bridge (Corfanydd) (4671218).jpg|center|128px]]
| 1805
| 1876-11-20
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9304
| ''[[:d:Q28361522|Hugh Williams]]''
| [[File:H Cernyw Williams.jpg|center|128px]]
| 1843-04-13
| 1937-05-03
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 9305
| ''[[:d:Q28361528|John Williams]]''
|
| 1811-08-11
| 1891-04-12
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 9306
| ''[[:d:Q28361531|John Williams]]''
|
| 1740-12-26
| 1821-03-11
| ''[[:d:Q6661464|Llangelynnin]]''
|-
| style='text-align:right'| 9307
| ''[[:d:Q28361538|John Williams]]''
|
| 1800
| 1871-12-31
| ''[[:d:Q6661167|Llanddoged]]''
|-
| style='text-align:right'| 9308
| ''[[:d:Q28361542|John Williams]]''
| [[File:John Williams (Gorfyniawc o Arfon, 1814-78) NLW3362955.jpg|center|128px]]
| 1814
| 1878-03-27
| ''[[:d:Q3398858|Talybont]]''
|-
| style='text-align:right'| 9309
| ''[[:d:Q28361547|Lewis William(S)]]''
| [[File:Lewis William.jpg|center|128px]]
| 1774
| 1862-08-14
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 9310
| ''[[:d:Q28361685|Dafydd Rhys Williams]]''
| [[File:Dafydd Rhys Williams (Index).jpg|center|128px]]
| 1851-05-08
| 1931-03-04
| ''[[:d:Q5057243|Cefn Coed y Cymer]]''
|-
| style='text-align:right'| 9311
| ''[[:d:Q28361688|Richard Williams]]''
|
| 1790
| 1839-06-20
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9312
| ''[[:d:Q28361692|Richard Williams]]''
|
| 1842-02
| 1917-03-30
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 9313
| ''[[:d:Q28361695|Foulk Robert Williams]]''
|
| 1774-10-06
| 1870-12-11
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 9314
| ''[[:d:Q28361697|Robert Williamson]]''
|
| 1807
| 1852-05-20
| ''[[:d:Q5642527|Helygain]]''
|-
| style='text-align:right'| 9315
| ''[[:d:Q28361705|Thomas Williams]]''
|
| 1774-05-25
| 1814-05
| ''[[:d:Q1024924|Llanbedrog]]''
|-
| style='text-align:right'| 9316
| ''[[:d:Q28361707|Thomas Williams]]''
|
| 1807-12-07
| 1894-12-16
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 9317
| ''[[:d:Q28361711|Daniel Thomas Williams]]''
|
| 1820-10-20
| 1876-05-02
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9318
| ''[[:d:Q28361717|Thomas Williams]]''
|
| 1821
| 1855-06-07
| ''[[:d:Q11008013|Bodfari]]''
|-
| style='text-align:right'| 9319
| ''[[:d:Q28361719|William Williams]]''
|
| 1768-11-22
| 1836-08-11
| ''[[:d:Q6729249|Maentwrog]]''
|-
| style='text-align:right'| 9320
| ''[[:d:Q28361723|William Williams]]''
|
| 1769
| 1847
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 9321
| ''[[:d:Q28361726|William Williams]]''
|
| 1800
| 1868-01-28
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 9322
| ''[[:d:Q28407622|Edla Spencer-Churchill, Duchess of Marlborough]]''
|
| 1968
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9323
| ''[[:d:Q28416510|William Warrington]]''
|
| 1735
| 1824-01-31
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9324
| ''[[:d:Q28421887|Nick Kenny]]''
| [[File:Nick Kenny 2024.png|center|128px]]
| 1993-03-13
|
| [[Newport]]
|-
| style='text-align:right'| 9325
| ''[[:d:Q28472304|Alfred Oliver]]''
|
| 1882
|
| [[Wales]]
|-
| style='text-align:right'| 9326
| ''[[:d:Q28474403|Billy McBryde]]''
|
| 1996-10-24
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9327
| ''[[:d:Q28509045|Charles Evans]]''
|
| 1897-01-31
| 1939
| [[Cairdiff]]
|-
| style='text-align:right'| 9328
| ''[[:d:Q28510956|Richard Bowen]]''
|
| 1957-01-05
|
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 9329
| ''[[:d:Q28523296|David Dilwyn John]]''
|
| 1901-11-20
| 1995-10-02
| ''[[:d:Q16249962|St Bride's Major]]''
|-
| style='text-align:right'| 9330
| ''[[:d:Q28528581|Arthur Gimblett]]''
|
| 1889
| 1957
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9331
| ''[[:d:Q28531012|William Price]]''
|
| 1869-04-16
| 1937-06-22
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 9332
| ''[[:d:Q28531231|Samuel Elliott]]''
|
| 1860-04-21
| 1933-07-14
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 9333
| ''[[:d:Q28533369|Lucie Jones]]''
| [[File:Lucie Jones Red Carpet Kyiv 2017.jpg|center|128px]]
| 1991-03-20
|
| ''[[:d:Q7165336|Pentyrch]]''
|-
| style='text-align:right'| 9334
| ''[[:d:Q28549773|Joe Hughes]]''
|
| 1898
|
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 9335
| ''[[:d:Q28560642|Morgan Morgans]]''
|
| 1814
|
| ''[[:d:Q6661154|Llanddeusant]]''
|-
| style='text-align:right'| 9336
| ''[[:d:Q28600252|Wayne Curtis]]''
|
| 1967-02-22
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9337
| ''[[:d:Q28600790|Mary Williams]]''
| [[File:Mary Williams.jpg|center|128px]]
| 1887-06-26<br/>1883
| 1977-10-17
| [[Aberystwyth]]
|-
| style='text-align:right'| 9338
| ''[[:d:Q28648730|Tegan Nox]]''
| [[File:SHIMMER Volume 88 - Nixon Newell 01 (cropped2).jpg|center|128px]]
| 1994-11-15
|
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 9339
| ''[[:d:Q28710231|Dewi Humphreys]]''
|
| 1947-03-06
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9340
| ''[[:d:Q28731295|Sion Trevor]]''
| [[File:Sion Trefor (m. 1589) Gresffordd. John Trevor (d. 1589) Gresford Church, Cymru Wales.jpg|center|128px]]
|
| 1589-07-15<br/>1589
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 9341
| ''[[:d:Q28736423|Joe Holt]]''
| [[File:2016 2017 UCI Track World Cup Apeldoorn 234.jpg|center|128px]]
| 1997-10-13
|
| [[Swansea]]
|-
| style='text-align:right'| 9342
| ''[[:d:Q28741101|Cyril Lewis]]''
|
| 1909-04-10
| 1999
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 9343
| ''[[:d:Q28748041|David Collier]]''
|
| 1957-10-02
| 2021
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 9344
| ''[[:d:Q28752872|Doreen Vermeulen-Cranch]]''
|
| 1915-12-30
| 2011-11-08
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 9345
| ''[[:d:Q28756399|Matthew Aubrey]]''
|
| 1997-06-04
|
| [[Swansea]]
|-
| style='text-align:right'| 9346
| ''[[:d:Q28777314|André Hue]]''
|
| 1923-12-07
| 2005-01-11
| [[Swansea]]
|-
| style='text-align:right'| 9347
| ''[[:d:Q28784496|Charley Edge]]''
|
| 1997-05-14
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9348
| ''[[:d:Q28823400|Huw O. Pritchard]]''
|
| 1928-07-23
| 2019-08-09
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9349
| ''[[:d:Q28853738|Ifan Phillips]]''
|
| 1996-01-29
|
| [[Wales]]
|-
| style='text-align:right'| 9350
| ''[[:d:Q28861574|Ryan Conbeer]]''
|
| 1999-02-05
|
| ''[[:d:Q3405190|Saundersfoot]]''
|-
| style='text-align:right'| 9351
| ''[[:d:Q28867970|Declan Smith]]''
|
| 1997-09-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9352
| ''[[:d:Q28867978|Frank Squires]]''
|
| 1921-03-08
| 1988
| [[Swansea]]
|-
| style='text-align:right'| 9353
| ''[[:d:Q28868083|Robert Jones]]''
|
| 1803-01
| 1850-12-19
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 9354
| ''[[:d:Q28870673|Jay Baker]]''
|
| 1991-10-06
|
| [[Wales]]
|-
| style='text-align:right'| 9355
| ''[[:d:Q28870726|Billy Reeves]]''
|
| 1996-12-18
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9356
| ''[[:d:Q28870737|Louis Ford]]''
|
| 1914-05-18
| 1980-09-20
| [[Cairdiff]]
|-
| style='text-align:right'| 9357
| ''[[:d:Q28873696|Peter Rawlinson]]''
| [[File:Peter Rawlinson (46522523975).jpg|center|128px]]
| 20th century
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 9358
| ''[[:d:Q28911822|Jason Gummer]]''
|
| 1967-10-27
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 9359
| ''[[:d:Q28922150|Wyn Thomas]]''
|
| 1929
| 2017-01
| ''[[:d:Q7164543|Penparcau]]''
|-
| style='text-align:right'| 9360
| ''[[:d:Q28935078|El Jones]]''
| [[File:El Jones Halifax poet.jpg|center|128px]]
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9361
| ''[[:d:Q28935566|Leonora Brito]]''
|
| 1954-07-07
| 2007-06-14
| [[Cairdiff]]
|-
| style='text-align:right'| 9362
| ''[[:d:Q28952252|Stefan Leyshon]]''
| [[File:Stefan Leyshon portrait.png|center|128px]]
| 1972-07-01
|
| [[Wales]]
|-
| style='text-align:right'| 9363
| ''[[:d:Q28968013|Don Punch]]''
|
| 1956-08-31
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 9364
| ''[[:d:Q28972086|John Audland]]''
|
| 1852-10-05
| 1931-10-04
| ''[[:d:Q2243491|Tintern]]''
|-
| style='text-align:right'| 9365
| ''[[:d:Q28980561|Tony Day]]''
|
| 1965-04-14
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 9366
| ''[[:d:Q29021227|Selina Rushbrook]]''
|
| 1880-06
| 1907-02-17
| [[Swansea]]
|-
| style='text-align:right'| 9367
| ''[[:d:Q29023727|Brychan Llŷr]]''
| [[File:Brychan Llyr, Jess.jpg|center|128px]]
| 1970
|
| [[Ceredigion]]
|-
| style='text-align:right'| 9368
| ''[[:d:Q29029634|John Puleston]]''
|
| 15th century
| 1551
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9369
| ''[[:d:Q29034214|Roger Jenkins]]''
| [[File:Jenkins, Roger 1981-06-20.jpg|center|128px]]
| 1940-08-08
| 2021
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 9370
| ''[[:d:Q29048134|Luke Pearce]]''
| [[File:Luke Pearce Italy 2022.jpg|center|128px]]
| 1987-11-13
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 9371
| ''[[:d:Q29052057|Connor Brown]]''
|
| 1997-04-28
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 9372
| ''[[:d:Q29052058|Oliver Pike]]''
|
| 1998-04-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9373
| ''[[:d:Q29447102|Randall Baker]]''
|
| 1944-02-25
| 2020-03-04
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9374
| ''[[:d:Q29530855|Julie Keeble]]''
|
| 1975-04-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9375
| ''[[:d:Q29545039|Michael J. Lewis]]''
|
| 1939-01-11
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9376
| ''[[:d:Q29578277|John Huw Lewis]]''
|
| 1931-01-13
| 2008-12-11
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 9377
| ''[[:d:Q29642353|Beverley Beech]]''
|
| 1944-11-12
| 2023-02-25
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 9378
| ''[[:d:Q29643012|Jack Howell]]''
|
| 1926-08-01
| 2015-01-01
| [[Swansea]]
|-
| style='text-align:right'| 9379
| ''[[:d:Q29643019|Jeff Hughes]]''
|
| 1965-11-12
| 2018-09-14
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 9380
| ''[[:d:Q29643376|Michael Oliver]]''
|
| 1925-07-03
| 2015-06-07
| ''[[:d:Q894252|Borth]]''<br/>[[Aberystwyth]]
|-
| style='text-align:right'| 9381
| ''[[:d:Q29643800|Martin Williams]]''
|
| 1947-11-22
| 2020-09-21
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 9382
| ''[[:d:Q29869245|Dafydd Dafis]]''
|
| 1958-09-01
| 2017-04-03
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 9383
| ''[[:d:Q29904560|John Potter]]''
|
| 1830
| 1868-03-31
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9384
| ''[[:d:Q29907467|Seb Davies]]''
|
| 1996-05-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9385
| ''[[:d:Q29907504|Rhun Williams]]''
|
| 1997-06-05
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9386
| ''[[:d:Q29919894|Stephen Williams]]''
| [[File:Stephen Williams.jpg|center|128px]]
| 1963-08-23
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 9387
| ''[[:d:Q29948275|Rosalind Rusbridge]]''
|
| 1915-04-19
| 2004-07-09
| [[Swansea]]
|-
| style='text-align:right'| 9388
| ''[[:d:Q29952260|Brett Johns]]''
|
| 1992-02-21
|
| [[Swansea]]
|-
| style='text-align:right'| 9389
| ''[[:d:Q29956338|D. F. Brewer]]''
|
| 1925-05-22
| 2018-07-16
| [[Cairdiff]]
|-
| style='text-align:right'| 9390
| ''[[:d:Q29959653|Tom Wrigley]]''
|
| 1992-08-13
|
| ''[[:d:Q2316216|Y Waun]]''
|-
| style='text-align:right'| 9391
| ''[[:d:Q29966512|Edith Downing]]''
|
| 1857-01
| 1931-10-03
| [[Cairdiff]]
|-
| style='text-align:right'| 9392
| ''[[:d:Q30005191|Sioned Harries]]''
|
| 1989-11-22
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9393
| ''[[:d:Q30052727|Rachel Taylor]]''
|
| 1983-06-13
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9394
| ''[[:d:Q30069829|Roger Moore]]''
|
| 1944-01-16
|
| ''[[:d:Q1141148|Gower Peninsula]]''
|-
| style='text-align:right'| 9395
| ''[[:d:Q30105096|John Thomas]]''
|
| 1806
| 1874
| [[Anglesey]]
|-
| style='text-align:right'| 9396
| ''[[:d:Q30110173|Jack Windsor Lewis]]''
|
| 1926-08-07
| 2021-07-11
| [[Cairdiff]]
|-
| style='text-align:right'| 9397
| ''[[:d:Q30118010|Rhodri Lovett]]''
|
| 1982-07-29
|
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 9398
| ''[[:d:Q30121081|Morwyn Brebner]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9399
| ''[[:d:Q30122028|Rhys Thomas]]''
|
| 1979-09-18
|
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 9400
| ''[[:d:Q30122062|Tom Davies]]''
|
| 1993-03-10
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9401
| ''[[:d:Q30122379|Leon Brown]]''
|
| 1996-10-26
|
| [[Newport]]
|-
| style='text-align:right'| 9402
| ''[[:d:Q30122806|Albert Derrick]]''
|
| 1939-08-06
| 2022
| [[Newport]]
|-
| style='text-align:right'| 9403
| ''[[:d:Q30122913|Michael Lieber]]''
| [[File:Michael Lieber.jpg|center|128px]]
| 1988-05-06
|
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 9404
| ''[[:d:Q30157831|Gwyn Harries-Jenkins]]''
|
| 1931-07-13
|
| ''[[:d:Q1814569|Risca]]''
|-
| style='text-align:right'| 9405
| ''[[:d:Q30164279|Anna McMorrin]]''
| [[File:Official portrait of Anna McMorrin MP crop 2, 2024.jpg|center|128px]]
| 1971
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9406
| ''[[:d:Q30165536|Tonia Antoniazzi]]''
| [[File:Official portrait of Tonia Antoniazzi crop 2.jpg|center|128px]]
| 1971-10-05
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9407
| ''[[:d:Q30172752|Ben Lake]]''
| [[File:Official portrait of Ben Lake crop 2.jpg|center|128px]]
| 1993-01-22
|
| [[Ceredigion]]
|-
| style='text-align:right'| 9408
| ''[[:d:Q30219424|Chris Mottershead]]''
|
| 1958-09-24
|
| ''[[:d:Q2145305|Y Bont-faen]]''
|-
| style='text-align:right'| 9409
| ''[[:d:Q30303313|Martin Conway]]''
|
| 1960
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9410
| ''[[:d:Q30321004|Robert Childs]]''
|
| 1957-04-05
|
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 9411
| ''[[:d:Q30323317|Scott Barley]]''
|
| 1992-11-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9412
| ''[[:d:Q30323462|Carl Hopgood]]''
|
| 1972
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9413
| ''[[:d:Q30344574|Geraint Dyfnallt Owen]]''
|
| 1908-01-03
| 1993-02-17
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9414
| ''[[:d:Q30500638|Joan Cowick]]''
| [[File:Shipyard Sally Pic.png|center|128px]]
| 1912-08-28
| 2004-03-08
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9415
| ''[[:d:Q30502234|Jack Marshman]]''
| [[File:Jack Marshman at UFC 230.jpg|center|128px]]
| 1989-12-19
|
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 9416
| ''[[:d:Q30605435|Brinley Rees]]''
|
| 1916-05-17
| 2001
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 9417
| ''[[:d:Q30609027|William Ellis Williams]]''
|
| 1881
| 1962
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 9418
| ''[[:d:Q30609165|Billy Hughes]]''
|
| 1920-10-02
| 1995-03-30
| [[Cairdiff]]
|-
| style='text-align:right'| 9419
| ''[[:d:Q30609386|Tom Green]]''
|
| 1900-04-12
| 1974-02-18
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 9420
| ''[[:d:Q30612083|John Davies]]''
|
|
| 1694
| [[Wales]]
|-
| style='text-align:right'| 9421
| ''[[:d:Q31358720|Manon Antoniazzi]]''
| [[File:Manon Williams Croeso Cymru.jpg|center|128px]]
| 1965-04-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9422
| ''[[:d:Q31358728|Ryan Kift]]''
|
| 1977
|
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 9423
| ''[[:d:Q31358769|Myfyr Isaac]]''
|
| 1954-03
|
| ''[[:d:Q3400083|Llanafan]]''
|-
| style='text-align:right'| 9424
| ''[[:d:Q31358792|Wil Tân]]''
|
|
|
| [[Anglesey]]
|-
| style='text-align:right'| 9425
| ''[[:d:Q31358808|Hefin Huws]]''
|
| 1964-08
|
| [[Wales]]
|-
| style='text-align:right'| 9426
| ''[[:d:Q31358836|Iestyn Jones]]''
|
| 1963-08
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9427
| ''[[:d:Q31359017|John Wayne Griffith]]''
|
| 1783
|
| ''[[:d:Q3396898|Abergwyngregyn]]''
|-
| style='text-align:right'| 9428
| ''[[:d:Q31886221|Donald Roy]]''
|
| 1930-04-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9429
| ''[[:d:Q32131488|Jane Anne Lloyd]]''
|
| 1870-05-28
| 1933-05-18
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 9430
| ''[[:d:Q32308031|Hywel Davies]]''
|
| 1957
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 9431
| ''[[:d:Q32859631|Peter Francis]]''
|
| 1958-04-22
|
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 9432
| ''[[:d:Q33083014|John Cedric Griffiths]]''
|
| 1912-06-02
| 1992-06-02
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9433
| ''[[:d:Q33125100|Kelvyn Jones]]''
|
| 1953-10-31
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 9434
| ''[[:d:Q33634794|Alfie Clarke]]''
|
| 1914
| 1953
| [[Newport]]
|-
| style='text-align:right'| 9435
| ''[[:d:Q33712219|Tommy Wolfe]]''
|
| 1900-03-07
| 1954
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 9436
| ''[[:d:Q33812797|Terry Cotton]]''
|
| 1946-01-25
|
| [[Swansea]]
|-
| style='text-align:right'| 9437
| ''[[:d:Q33818814|Estyn Griffths]]''
|
| 1927-07-22
| 2017-04
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 9438
| ''[[:d:Q33820175|Phil Holme]]''
|
| 1947-06-21
|
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 9439
| ''[[:d:Q33821432|Keith Huntley]]''
|
| 1931-02-12
| 1995-12
| [[Swansea]]
|-
| style='text-align:right'| 9440
| ''[[:d:Q33824044|Alan McIntosh]]''
|
| 1939-07-29
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 9441
| ''[[:d:Q33825302|Les Orphan]]''
|
| 1923-04-17
| 1995-09-11
| [[Newport]]
|-
| style='text-align:right'| 9442
| ''[[:d:Q34007837|Daniel Jervis]]''
|
| 1996-06-09
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9443
| ''[[:d:Q34980052|Keston Davies]]''
|
| 1996-10-02
|
| [[Swansea]]
|-
| style='text-align:right'| 9444
| ''[[:d:Q35160552|John Francon Williams]]''
| [[File:John Francon Williams 1854-1911 Commemorative Plaque.jpg|center|128px]]
| 1854
| 1911-09-04
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 9445
| ''[[:d:Q35488635|David Annwn Jones]]''
| [[File:David Annwn Jones.jpg|center|128px]]
| 1953-05-09
|
| [[Wales]]
|-
| style='text-align:right'| 9446
| ''[[:d:Q35695307|Enoch Rowland Jones]]''
|
| 1912-07-19
| 1978-08-28
| ''[[:d:Q5623368|Gwaun-Cae-Gurwen]]''
|-
| style='text-align:right'| 9447
| ''[[:d:Q35850145|Jay Foulston]]''
|
| 2000-11-27
|
| [[Wales]]
|-
| style='text-align:right'| 9448
| ''[[:d:Q36419796|P. G. Morgan]]''
| [[File:PG Morgan.tif|center|128px]]
| 1966-06
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9449
| ''[[:d:Q36697214|Tom Rhys Harries]]''
|
| 1992-10-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9450
| ''[[:d:Q37269398|Jonathan Evans-Jones]]''
|
| No/unknown value
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 9451
| ''[[:d:Q37347750|David Humphrey Jones]]''
|
| 1842
| 1904-02-11
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9452
| ''[[:d:Q37509560|David Rice Rees]]''
|
| 1787-08-06
| 1856-05-25
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 9453
| ''[[:d:Q37649676|Anita Thapar]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 9454
| ''[[:d:Q37663328|John Bird]]''
|
| 1761-09-11
| 1840
| ''[[:d:Q1035742|Cardiff Castle]]''
|-
| style='text-align:right'| 9455
| ''[[:d:Q37725178|Gary Roach]]''
|
| 1933-10-08
| 2012-03-17
| ''[[:d:Q7164547|Penpedairheol]]''
|-
| style='text-align:right'| 9456
| ''[[:d:Q37763071|Cameron Coxe]]''
| [[File:Cameron Coxe.jpg|center|128px]]
| 1998-12-18
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9457
| ''[[:d:Q37770200|William James Morgan]]''
|
| 1831
| No/unknown value
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9458
| ''[[:d:Q37804072|Evan Jones]]''
|
| 1830
| 1918
| ''[[:d:Q3404510|Llangian]]''
|-
| style='text-align:right'| 9459
| ''[[:d:Q37826665|Josiah Thomas]]''
|
| 1830-08-07
| 1905-05-21
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9460
| ''[[:d:Q37892401|Henry Hughes]]''
|
| 1808
| 1892-03-20
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9461
| ''[[:d:Q37996916|Jon Worth]]''
| [[File:Jon Worth.jpg|center|128px]]
| 1980-05-23
|
| [[Newport]]
|-
| style='text-align:right'| 9462
| ''[[:d:Q38009527|David O'Brien Owen]]''
|
| 1855-03-23
| 1920-04-10
| ''[[:d:Q3398294|Llandwrog]]''
|-
| style='text-align:right'| 9463
| ''[[:d:Q38094908|Andrew Brace]]''
| [[File:Andrew Brace 2021.jpg|center|128px]]
| 1988-06-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9464
| ''[[:d:Q38138534|Ashley Sweet]]''
|
| 1989-04-01
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 9465
| ''[[:d:Q38138540|Ellis Shipp]]''
|
| 1997-08-14
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9466
| ''[[:d:Q38170780|William Watkin Davies]]''
|
| 1895
| 1973
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9467
| ''[[:d:Q38185495|Billy Sass-Davies]]''
| [[File:BillySassDavies.jpg|center|128px]]
| 2000-02-17
|
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 9468
| ''[[:d:Q38190133|Corey Domachowski]]''
|
| 1996-09-19
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 9469
| ''[[:d:Q38190147|Keiron Assiratti]]''
|
| 1997-06-30
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9470
| ''[[:d:Q38190446|Harri Millard]]''
|
| 1996-08-17
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9471
| ''[[:d:Q38190462|Shane Lewis-Hughes]]''
|
| 1997-09-20<br/>1997-09
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 9472
| ''[[:d:Q38209921|Noel Lloyd]]''
| [[File:Yr Athro Noel Lloyd.jpg|center|128px]]
| 1946-12-26
| 2019-06-07
| [[Wales]]
|-
| style='text-align:right'| 9473
| ''[[:d:Q38216587|Marie Trevelyan]]''
|
| 1853
| 1922
| ''[[:d:Q2347528|Llantwit Major]]''
|-
| style='text-align:right'| 9474
| ''[[:d:Q38383577|Reuben Morgan-Williams]]''
|
| 1998-02-03
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9475
| ''[[:d:Q38606122|Emily Davis]]''
|
| 1900-08-03
| 1966-06-08
| [[Cairdiff]]
|-
| style='text-align:right'| 9476
| ''[[:d:Q38686224|Alison Bielski]]''
|
| 1925-11-24
| 2014-07-09
| [[Newport]]
|-
| style='text-align:right'| 9477
| ''[[:d:Q38898929|Paul Dickson]]''
|
| 1920-01-18
| 2011-10-06
| [[Cairdiff]]
|-
| style='text-align:right'| 9478
| ''[[:d:Q39039624|Billy Moore]]''
|
| 1912-10-14
| 2002
| ''[[:d:Q3398355|Llanbradach]]''
|-
| style='text-align:right'| 9479
| ''[[:d:Q39039625|Derek Williams]]''
|
| 1934-06-15
| 2014-05
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 9480
| ''[[:d:Q39040013|Peter Elias Jones]]''
|
| 1943-05
| 2010-05-19
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 9481
| ''[[:d:Q39040026|Mary Vaughan Jones]]''
|
| 1917-11
| 2002-04
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 9482
| ''[[:d:Q39074703|John Rawlins]]''
|
| 1957-06-07
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 9483
| ''[[:d:Q39074894|Robert Owen]]''
| [[File:Robert Owen.png|center|128px]]
| 1984-09-23
|
| ''[[:d:Q7080138|Ogmore Valley]]''
|-
| style='text-align:right'| 9484
| ''[[:d:Q39078711|Albert Derrick]]''
|
| 1908-09-08
| 1975-06-05
| [[Newport]]
|-
| style='text-align:right'| 9485
| ''[[:d:Q39078897|Glyn Davies]]''
|
| 1909-11-24
| 1985
| [[Swansea]]
|-
| style='text-align:right'| 9486
| ''[[:d:Q39078898|Sam Davies]]''
|
| 1894-11-05
| 1972
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9487
| ''[[:d:Q39078904|Roy McDonald]]''
|
| 1896-07-11
| 1970
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 9488
| ''[[:d:Q39078905|George Wheeler]]''
|
| 1910-02-19
| 1995
| [[Newport]]
|-
| style='text-align:right'| 9489
| ''[[:d:Q39078914|Peter Davies]]''
|
| 1936-03-08
| 2023-01-25
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9490
| ''[[:d:Q39078916|Peter Davies]]''
|
| 1942-07-01
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9491
| ''[[:d:Q39078917|Les Jones]]''
|
| 1922-12-08
| 1983
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 9492
| ''[[:d:Q39078938|Sam Jones]]''
|
|
|
| [[Newport]]
|-
| style='text-align:right'| 9493
| ''[[:d:Q39257430|Rollin Menayese]]''
|
| 1997-12-04
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 9494
| ''[[:d:Q39295246|Sir Edmund Buckley, 2nd Baronet]]''
|
| 1861
| 1919
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 9495
| ''[[:d:Q39299873|Kurt Parry]]''
|
| 1993-06-02
|
| ''[[:d:Q8040096|Wyndham]]''
|-
| style='text-align:right'| 9496
| ''[[:d:Q39388876|Дориан Дарч]]''
|
| 1984-04-25
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9497
| ''[[:d:Q39640868|Betsy]]''
|
| 2000
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 9498
| ''[[:d:Q40265813|Elizabeth Vaughan]]''
|
| 1937-03-12
|
| ''[[:d:Q2588223|Llanfyllin]]''
|-
| style='text-align:right'| 9499
| ''[[:d:Q40745599|Mags Harries]]''
|
| 1945
|
| [[Wales]]
|-
| style='text-align:right'| 9500
| ''[[:d:Q40766069|Freddie Hill]]''
|
| 1914-06-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9501
| ''[[:d:Q40889067|Basil Cottle]]''
|
| 1917-03-17
| 1994-05-13
| [[Cairdiff]]
|-
| style='text-align:right'| 9502
| ''[[:d:Q41019354|Gino Basille]]''
|
| 1928-06-02
| 1997-05-19
| [[Cairdiff]]
|-
| style='text-align:right'| 9503
| ''[[:d:Q41247240|Hannah Grace]]''
|
| 1993-06-04
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9504
| ''[[:d:Q41249260|Owen Evans]]''
|
| 1996-11-28
|
| [[Newport]]
|-
| style='text-align:right'| 9505
| ''[[:d:Q41446728|Megan Jones]]''
| [[File:Megan Jones POTM 2021 (cropped).jpg|center|128px]]
| 1996-10-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9506
| ''[[:d:Q41530142|Robson Blake]]''
|
| 1995-05-15
|
| [[Newport]]
|-
| style='text-align:right'| 9507
| ''[[:d:Q41693923|Siwan Davies]]''
| [[File:Siwan.jpg|center|128px]]
| 20th century
|
| ''[[:d:Q914291|Newport]]''
|-
| style='text-align:right'| 9508
| ''[[:d:Q41693935|Deirdre Beddoe]]''
|
| 1942
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 9509
| ''[[:d:Q41767537|Christopher Vaughan Edwards]]''
|
| 1875-01-15
| 1955-09-01
| [[Llanfairpwllgwyngyll]]
|-
| style='text-align:right'| 9510
| ''[[:d:Q41787459|Derek Jenkins]]''
|
| 1937
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9511
| ''[[:d:Q42186286|William Powell]]''
|
| 1705
| 1780
| ''[[:d:Q6964304|Nanteos]]''
|-
| style='text-align:right'| 9512
| ''[[:d:Q42211621|Cerith Flinn]]''
|
| 1986-09-29
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9513
| ''[[:d:Q42291096|Michael J. Ingleson]]''
|
|
|
| [[Newport]]
|-
| style='text-align:right'| 9514
| ''[[:d:Q42313714|Tegau Eurfron]]''
|
| 5th century
|
| [[Wales]]
|-
| style='text-align:right'| 9515
| ''[[:d:Q42314072|Laura O'Sullivan]]''
| [[File:Laura O'Sullivan (cropped).jpg|center|128px]]
| 1991-08-23
|
| [[Wales]]
|-
| style='text-align:right'| 9516
| ''[[:d:Q42375487|Paul Meek]]''
|
| 1959
|
| [[Wales]]
|-
| style='text-align:right'| 9517
| ''[[:d:Q42431221|Amy Dowden]]''
| [[File:Amy Dowden - 2023 (52720307368) (cropped).jpg|center|128px]]
| 1991-08-10
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 9518
| ''[[:d:Q42434789|Archie Ridley]]''
|
| 1869-09-22
| 1950-02-01
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 9519
| ''[[:d:Q42520174|Dylan Roberts]]''
|
| 1971-11-28
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9520
| ''[[:d:Q42583341|Hannah Miles]]''
|
| 1998-04-13
|
| [[Wales]]
|-
| style='text-align:right'| 9521
| ''[[:d:Q42774158|Colin St. Clair Oakes]]''
|
| 1908-05-23
| 1971-12-23
| ''[[:d:Q16901177|Tanyfron]]''
|-
| style='text-align:right'| 9522
| ''[[:d:Q42845798|Evan Press]]''
|
| 2000
|
| [[Swansea]]
|-
| style='text-align:right'| 9523
| ''[[:d:Q42846969|Jane Dodds]]''
| [[File:Jane-dodds (cropped).jpg|center|128px]]
| 1963-09-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9524
| ''[[:d:Q42852267|Wayne Hughes]]''
|
| 1958-03-08
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 9525
| ''[[:d:Q42886882|Owen Taylor]]''
|
| 2001-03-06
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9526
| ''[[:d:Q42889463|Lewis Collins]]''
|
| 2001-05-09
|
| [[Newport]]
|-
| style='text-align:right'| 9527
| ''[[:d:Q43127454|Irwin John David Bevan]]''
|
| 1852
| 1940
| [[Wales]]
|-
| style='text-align:right'| 9528
| ''[[:d:Q43170848|David Walsh]]''
|
| 1979-04-29
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9529
| ''[[:d:Q43178378|Taylor Davies]]''
|
| 1995-07-30
|
| [[Swansea]]
|-
| style='text-align:right'| 9530
| ''[[:d:Q43178639|Rhys Fawcett]]''
|
| 1996-10-09
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9531
| ''[[:d:Q43260423|Ben Jones]]''
|
| 1998-10-08
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9532
| ''[[:d:Q43260453|Tony O'Connor]]''
|
| 1934-04-24
| 2015-05-22
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9533
| ''[[:d:Q43289293|David J. Tozer]]''
|
| 1970
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9534
| ''[[:d:Q43304180|Philip Henry Egerton]]''
|
| 1824-08-09
| 1893-01-17
| ''[[:d:Q3406264|Gresford]]''
|-
| style='text-align:right'| 9535
| ''[[:d:Q43374061|Jethro Binns]]''
|
| 1984-10-19
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9536
| ''[[:d:Q43380801|Toni Evans]]''
|
| 1972-05-10<br/>1972-11-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9537
| ''[[:d:Q43472159|Nicki McNelly]]''
|
| 1962-05-01
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 9538
| ''[[:d:Q43538963|Wenna]]''
|
| 6th century
| 544
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 9539
| ''[[:d:Q43580958|William Dempster]]''
| [[File:Cpl William Dempster.jpg|center|128px]]
| 1876-10-21
| 1964-10-25
| [[Wales]]
|-
| style='text-align:right'| 9540
| ''[[:d:Q43847981|Owen Lane]]''
|
| 1997-12-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9541
| ''[[:d:Q44070372|Morgan Williams]]''
|
| 1995-12-28
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9542
| ''[[:d:Q44481398|Rowan Jenkins]]''
|
| 1991-06-10
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9543
| ''[[:d:Q44490509|Catherine Smaill]]''
|
| 1991-04-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9544
| ''[[:d:Q44633113|Fred Condrey]]''
|
| 1883
| 1952
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9545
| ''[[:d:Q44691153|William Powell]]''
|
| 1815
| 1878
| [[Swansea]]
|-
| style='text-align:right'| 9546
| ''[[:d:Q44711039|Dane Blacker]]''
|
| 1998-07-06
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9547
| ''[[:d:Q44742025|Joe Thomas]]''
|
| 1996-02-21
|
| [[Wales]]
|-
| style='text-align:right'| 9548
| ''[[:d:Q44742037|Will Jones]]''
|
| 1998-12-03
|
| ''[[:d:Q3381195|Penclawdd]]''
|-
| style='text-align:right'| 9549
| ''[[:d:Q44963860|Nathan Broadhead]]''
| [[File:Next Generation Trophy 2013 44.JPG|center|128px]]
| 1998-04-05
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9550
| ''[[:d:Q45048920|David Davies]]''
| [[File:Dewi Cynon (David Davies 1853-1937).jpg|center|128px]]
| 1853-08
| 1937
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 9551
| ''[[:d:Q45189110|Shaun Evans]]''
| [[File:Shaun Evans 2022.jpg|center|128px]]
| 1996-09-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9552
| ''[[:d:Q45298761|Nicholas Tee]]''
|
| 1949
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9553
| ''[[:d:Q45300946|J. Gwynn Williams]]''
|
| 1924
| 2017-10-04
| ''[[:d:Q6661359|Llanfechain]]''
|-
| style='text-align:right'| 9554
| ''[[:d:Q45319455|Ashley Griffiths]]''
|
| 1961<br/>1961-01-05
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 9555
| ''[[:d:Q45776704|Ray Giles]]''
|
| 1961-01-15
|
| ''[[:d:Q6389163|Kenfig Hill]]''
|-
| style='text-align:right'| 9556
| ''[[:d:Q45972376|Mary Thomas]]''
|
| 1932-08-02
| 1997-04-17
| [[Swansea]]
|-
| style='text-align:right'| 9557
| ''[[:d:Q45985290|Colin Lake]]''
|
| 1941-11-23
|
| [[Newport]]
|-
| style='text-align:right'| 9558
| ''[[:d:Q46194169|Charles Henry Clements]]''
|
| 1898-08-18
| 1983-04-17
| [[Aberystwyth]]
|-
| style='text-align:right'| 9559
| ''[[:d:Q46271067|David P Mills]]''
| [[File:David Paul Mills.jpg|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 9560
| ''[[:d:Q46586061|Steve Sutton]]''
|
| 1958-02-17
|
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 9561
| ''[[:d:Q47015455|Francis Huntly Griffith]]''
|
| 1885
| 1958
| ''[[:d:Q5566706|Glasbury]]''
|-
| style='text-align:right'| 9562
| ''[[:d:Q47035203|Nikara Jenkins]]''
|
| 1986
|
| [[Swansea]]
|-
| style='text-align:right'| 9563
| ''[[:d:Q47073063|Megan Chard]]''
|
| 1998-01-06
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 9564
| ''[[:d:Q47116012|J. Aelwyn Roberts]]''
|
| 1918
| 2018-01-11
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9565
| ''[[:d:Q47120646|Ena Thomas]]''
|
| 1935-06-05
| 2020-07-05
| ''[[:d:Q5441898|Felindre]]''
|-
| style='text-align:right'| 9566
| ''[[:d:Q47120904|Heulwen Hâf]]''
|
| 1944-08-01
| 2018-12-05
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 9567
| ''[[:d:Q47121085|T. Ceiri Griffith]]''
|
| 1925
| 2016-03-26
| ''[[:d:Q3395863|Llanbedr]]''
|-
| style='text-align:right'| 9568
| ''[[:d:Q47121249|Cledwyn Jones]]''
|
| 1923-06-02
| 2022-10-18
| ''[[:d:Q3396911|Talysarn]]''
|-
| style='text-align:right'| 9569
| ''[[:d:Q47121493|Ruth Morgan]]''
|
| 1966-04-26
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9570
| ''[[:d:Q47121781|Mari George]]''
|
| 1973
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9571
| ''[[:d:Q47121825|Gwen Redvers Jones]]''
|
| 1930-04-24
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9572
| ''[[:d:Q47121859|Nansi Selwood]]''
|
| 1921-11-08
| 2017-02-18
| ''[[:d:Q13130671|Penderyn]]''
|-
| style='text-align:right'| 9573
| ''[[:d:Q47122648|Gwyn Erfyl]]''
|
| 1924-06-09
| 2007-05-04
| ''[[:d:Q6661318|Llanerfyl]]''
|-
| style='text-align:right'| 9574
| ''[[:d:Q47122741|Eirwyn George]]''
| [[File:Dwy Goron Eirwyn .jpg|center|128px]]
| 1936
|
| ''[[:d:Q20007221|Tufton]]''
|-
| style='text-align:right'| 9575
| ''[[:d:Q47123094|Emyr Wyn Jones]]''
|
| 1907-05-23
| 1999-01-14
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 9576
| ''[[:d:Q47123304|Idris Charles]]''
|
| 1947-01-03
| 2021-07-07
| ''[[:d:Q3402654|Bodffordd]]''
|-
| style='text-align:right'| 9577
| ''[[:d:Q47123476|Gilmor Griffiths]]''
|
| 1917-09-07
| 1985
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9578
| ''[[:d:Q47124189|Martyn Geraint]]''
|
| 1963-06
|
| ''[[:d:Q1770495|Goodwick]]''
|-
| style='text-align:right'| 9579
| ''[[:d:Q47124236|Mair Garnon]]''
|
| 1928
| 2022-03-04
| ''[[:d:Q3405138|St Dogmaels]]''
|-
| style='text-align:right'| 9580
| ''[[:d:Q47124323|Adrian Reynolds]]''
|
| 1963
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 9581
| ''[[:d:Q47124529|Arwel Vittle]]''
|
|
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 9582
| ''[[:d:Q47124631|Arfon Haines Davies]]''
|
| 1948-06
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9583
| ''[[:d:Q47125185|Eurgain Haf]]''
|
|
|
| ''[[:d:Q7163011|Penisa'r Waun]]''
|-
| style='text-align:right'| 9584
| ''[[:d:Q47125330|Dafydd Owen]]''
| [[File:Dafydd Owen.jpg|center|128px]]
| 1919
| 2002
| ''[[:d:Q13126438|Bylchau]]''
|-
| style='text-align:right'| 9585
| ''[[:d:Q47125531|Cris Dafis]]''
|
| 1966
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9586
| ''[[:d:Q47125612|Sara Minwel Tibbott]]''
| [[File:S. Minwel Tibbott.jpg|center|128px]]
| 1936-02-08
| 1998-10-13
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9587
| ''[[:d:Q47125622|Ieuan Gwynedd Jones]]''
|
| 1920-07-07
| 2018-06-29
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9588
| ''[[:d:Q47125698|Sioned Lleinau]]''
|
|
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9589
| ''[[:d:Q47125703|Gwynedd O. Pierce]]''
|
| 1921-05-12
| 2022-05-04
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9590
| ''[[:d:Q47125847|Heather Williams]]''
| [[File:Heather M Williams.jpg|center|128px]]
| 1972-05-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9591
| ''[[:d:Q47126006|Ceridwen Lloyd-Morgan]]''
|
| 1950s
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9592
| ''[[:d:Q47126053|Islwyn Williams]]''
|
| 1917
| 1988
| ''[[:d:Q3404200|Porth]]''
|-
| style='text-align:right'| 9593
| ''[[:d:Q47126099|Mari Emlyn]]''
|
| 1964-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9594
| ''[[:d:Q47126182|Gwilym H. Jones]]''
|
| 1930
|
| ''[[:d:Q2148274|Rhos-fawr]]''
|-
| style='text-align:right'| 9595
| ''[[:d:Q47126264|Llion Jones]]''
|
| 1964
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 9596
| ''[[:d:Q47126436|William R. Lewis]]''
|
| 1948
|
| ''[[:d:Q3400997|Llangristiolus]]''
|-
| style='text-align:right'| 9597
| ''[[:d:Q47126701|Heini Gruffudd]]''
|
| 1946-03
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9598
| ''[[:d:Q47126897|Pegi Lloyd-Williams]]''
|
| 1923
|
| [[Wales]]
|-
| style='text-align:right'| 9599
| ''[[:d:Q47126908|Robert Rhys]]''
|
| 1953
|
| ''[[:d:Q13644935|Llangyndeyrn]]''
|-
| style='text-align:right'| 9600
| ''[[:d:Q47126926|Iestyn Hughes]]''
|
| 1955-11-18
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9601
| ''[[:d:Q47127197|J. Towyn Jones]]''
| [[File:J. Towyn Jones.jpg|center|128px]]
| 1942-05-29
| 2019-11-18
| ''[[:d:Q13126548|Capel Iwan]]''<br/>''[[:d:Q4941233|Boncath]]''
|-
| style='text-align:right'| 9602
| ''[[:d:Q47127360|E. Wyn James]]''
|
|
|
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 9603
| ''[[:d:Q47127962|G. Melvyn Howe]]''
|
| 1920-04-07
| 2012-08-27
| ''[[:d:Q3404663|Abercynon]]''
|-
| style='text-align:right'| 9604
| ''[[:d:Q47128294|Sêra Moore-Williams]]''
|
| 1958
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9605
| ''[[:d:Q47128461|Gareth Ffowc Roberts]]''
|
| 1945-05-23
|
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 9606
| ''[[:d:Q47128519|Daniel Davies]]''
|
| 1966
|
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 9607
| ''[[:d:Q47129647|Patti Flynn]]''
|
| 1937-04
| 2020-09-10
| ''[[:d:Q3398900|Tiger Bay]]''
|-
| style='text-align:right'| 9608
| ''[[:d:Q47129851|Teleri Bevan]]''
|
| 1931-04-11
| 2020-11
| [[Aberystwyth]]
|-
| style='text-align:right'| 9609
| ''[[:d:Q47129889|John Barnie]]''
|
| 1941
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9610
| ''[[:d:Q47130219|Janet Aethwy]]''
|
| 1950s
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9611
| ''[[:d:Q47130527|R. Arwel Jones]]''
|
| 1968-06-07
|
| ''[[:d:Q15272454|Rhosybol]]''
|-
| style='text-align:right'| 9612
| ''[[:d:Q47130540|Morfydd E. Owen]]''
|
| 1936-01-26
| 2024-03-17
| ''[[:d:Q8564160|Fochriw]]''
|-
| style='text-align:right'| 9613
| ''[[:d:Q47179942|Llwchaiarn]]''
|
| 580
| 640
| [[Wales]]
|-
| style='text-align:right'| 9614
| ''[[:d:Q47228357|Jon Norris]]''
|
| 1962-11-01
|
| [[Wales]]
|-
| style='text-align:right'| 9615
| ''[[:d:Q47263904|Connor Lemonheigh-Evans]]''
| [[File:Evans-01.jpg|center|128px]]
| 1997-01-24
|
| [[Swansea]]
|-
| style='text-align:right'| 9616
| ''[[:d:Q47309379|Hugh Thomas]]''
|
| 1964-06-12
| 2022-12
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9617
| ''[[:d:Q47436459|Zak Lee-Green]]''
|
| 1991-02-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9618
| ''[[:d:Q47453910|Kacie Oliver]]''
|
| 1989-08-23
|
| [[Newport]]
|-
| style='text-align:right'| 9619
| ''[[:d:Q47458804|Gary Pickford-Hopkins]]''
|
| 1948
| 2013-06-22
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9620
| ''[[:d:Q47459774|Paula Gellibrand]]''
| [[File:Paula Gellibrand.jpg|center|128px]]
| 1898
| 1986
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 9621
| ''[[:d:Q47460430|Nathan Foy]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9622
| ''[[:d:Q47460742|Thomas Carey-Evans]]''
| [[File:Olwen Lloyd George a Capt T J Carey Evans.jpg|center|128px]]
| 1884-06-06
| 1947-08-25
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9623
| ''[[:d:Q47467076|Horace Debenham]]''
|
| 1903-09-24
| 1993-10
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 9624
| ''[[:d:Q47467184|Katherine McNicol]]''
|
| 1961-07-19
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 9625
| ''[[:d:Q47476891|Richie Edwards]]''
|
| 1989-01-27
|
| [[Wales]]
|-
| style='text-align:right'| 9626
| ''[[:d:Q47476950|Chris Harris]]''
|
| 1977-11-11
|
| [[Wales]]
|-
| style='text-align:right'| 9627
| ''[[:d:Q47476985|Frank Williams]]''
|
| 1917-03-12
| 1978-11-24
| ''[[:d:Q7114024|Owrtyn]]''
|-
| style='text-align:right'| 9628
| ''[[:d:Q47477003|Bob Griffiths]]''
|
| 1953
|
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 9629
| ''[[:d:Q47482445|Michael Harris]]''
|
| 1969-05-06
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 9630
| ''[[:d:Q47490670|Ross Owen]]''
|
| 1994
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9631
| ''[[:d:Q47490703|Aaron Wainwright]]''
|
| 1997-09-25
|
| [[Newport]]
|-
| style='text-align:right'| 9632
| ''[[:d:Q47490719|Jared Rosser]]''
|
| 1997-12-31
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9633
| ''[[:d:Q47490721|Arwel Robson]]''
|
| 1997-02-21
|
| [[Wales]]
|-
| style='text-align:right'| 9634
| ''[[:d:Q47490745|Anna Hursey]]''
|
| 2006-06-22
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9635
| ''[[:d:Q47492896|Doug Perkins]]''
|
| 1943-04-02
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9636
| ''[[:d:Q47516819|Michael Philip Harris]]''
|
| 1939-04-28
| 2023-12-17
| [[Wales]]
|-
| style='text-align:right'| 9637
| ''[[:d:Q47517355|Rhys Britton]]''
| [[File:Saint-Amand-les-Eaux - Paris-Roubaix juniors, 9 avril 2017, départ (A38).JPG|center|128px]]
| 1999-05-13
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9638
| ''[[:d:Q47541496|Thomas Fagan Wallace]]''
|
| 1874
| 1951-02
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9639
| ''[[:d:Q47541497|Walter Morgan]]''
|
| 1821
| 1903
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 9640
| ''[[:d:Q47542010|Jason Evans]]''
|
| 1971-12-06
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9641
| ''[[:d:Q47542123|Frances Mackenzie, Countess of Seaforth]]''
|
| 1659
|
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 9642
| ''[[:d:Q47542236|Nicola Tustain]]''
|
| 1997-12-27
|
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 9643
| ''[[:d:Q47656094|Alan Phillips]]''
|
|
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 9644
| ''[[:d:Q47658470|Joe Rodon]]''
| [[File:Wales-Switzerland match at Euro 2020 in Baku 5 (cropped).jpg|center|128px]]
| 1997-10-22
|
| [[Swansea]]
|-
| style='text-align:right'| 9645
| ''[[:d:Q47671584|Ben Hingeley]]''
|
| 1997-05-30
|
| ''[[:d:Q5566710|Glascoed]]''
|-
| style='text-align:right'| 9646
| ''[[:d:Q47995095|Jack Sargeant]]''
| [[File:Jack Sargeant AM (40900021582).png|center|128px]]
| 1994-04-09
|
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 9647
| ''[[:d:Q48468627|John Phillips]]''
| [[File:John Phillips at UFC Fight Night 160 in Copenhagen.jpg|center|128px]]
| 1985-06-09
|
| [[Swansea]]
|-
| style='text-align:right'| 9648
| ''[[:d:Q48778144|John Welch]]''
|
| 1947-08
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9649
| ''[[:d:Q48794179|Honor Arundel]]''
|
| 1919-10-15
| 1973-06-08
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 9650
| ''[[:d:Q48801730|Julian Atterton]]''
|
|
|
| ''[[:d:Q5595745|Grangetown]]''
|-
| style='text-align:right'| 9651
| ''[[:d:Q48805514|Alexia Pnevmatikos]]''
|
| 1971
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9652
| ''[[:d:Q48816696|Sarah Jones]]''
|
| 1990-06-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9653
| ''[[:d:Q48816698|Rose Thomas]]''
|
| 1992-05-05
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 9654
| ''[[:d:Q48817063|Albert Gower-Rees]]''
|
| 1880
| 1956
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 9655
| ''[[:d:Q48844024|Janusz Hryniewicz]]''
|
| 1947
|
| ''[[:d:Q3402867|Penley]]''
|-
| style='text-align:right'| 9656
| ''[[:d:Q48868869|Danny Hughes]]''
|
| 1988-05-28
|
| [[Wales]]
|-
| style='text-align:right'| 9657
| ''[[:d:Q48868982|Sarah Connolly]]''
|
| 1989-03-18
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9658
| ''[[:d:Q48977772|Dewi Cross]]''
|
| 1999-12-06
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9659
| ''[[:d:Q49679357|Cyril Mossford]]''
|
| 1903
| 1968
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 9660
| ''[[:d:Q49995733|Catherine Lynch]]''
|
| 1880
| 1908-10-19
| [[Swansea]]
|-
| style='text-align:right'| 9661
| ''[[:d:Q50078331|Elise Hughes]]''
| [[File:Elise Hughes Blackburn (50452093546) (cropped).jpg|center|128px]]
| 2001-04-15
|
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 9662
| ''[[:d:Q50131942|Trefor Selway]]''
|
| 1931
| 2018-02-25
| ''[[:d:Q3406258|Pandy Tudur]]''
|-
| style='text-align:right'| 9663
| ''[[:d:Q50136388|Howard Sheppeard]]''
|
| 1933-01-31
|
| ''[[:d:Q3399762|Ynysybwl]]''
|-
| style='text-align:right'| 9664
| ''[[:d:Q50169885|Thomas Price]]''
|
| 1838
| 1928-02-22
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 9665
| ''[[:d:Q50173768|Chris Goss]]''
|
| 1961-04-15
|
| ''[[:d:Q27556140|Mountain Ash]]''
|-
| style='text-align:right'| 9666
| ''[[:d:Q50179243|Rob Sutherland]]''
|
| 1985-06-16
|
| [[Newport]]
|-
| style='text-align:right'| 9667
| ''[[:d:Q50217554|Sean Wharton]]''
|
| 1968-10-31
|
| [[Newport]]
|-
| style='text-align:right'| 9668
| ''[[:d:Q50276520|Lily Argent]]''
|
| 1886-10-08
| 1916-12-13
| [[Swansea]]
|-
| style='text-align:right'| 9669
| ''[[:d:Q50296393|Neil Salathiel]]''
|
| 1962-11-19
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9670
| ''[[:d:Q50298099|Islwyn Williams]]''
|
| 1903
| 1957
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 9671
| ''[[:d:Q50309032|Timothy Davis]]''
|
| 1779-11-20
| 1860-11-28
| ''[[:d:Q3401686|Llangybi]]''
|-
| style='text-align:right'| 9672
| ''[[:d:Q50322911|Bray Wilkins]]''
|
| 1610
| 1702-01-01
| [[Wales]]
|-
| style='text-align:right'| 9673
| ''[[:d:Q50326432|Francesca Rhydderch]]''
| [[File:Francesca Rhydderch large.jpg|center|128px]]
| 1969-02-10
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 9674
| ''[[:d:Q50332139|Lexi Lowe]]''
| [[File:Lexi Lowe - AVN Expo & AVN Awards (8394303962).jpg|center|128px]]
| 1988-07-17
|
| [[Newport]]
|-
| style='text-align:right'| 9675
| ''[[:d:Q50345115|Aled Miles]]''
|
| 1965-05-23
|
| [[Wales]]
|-
| style='text-align:right'| 9676
| ''[[:d:Q50345381|Paul Whitfield]]''
|
| 1982-05-06
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 9677
| ''[[:d:Q50365542|Sam Moore]]''
|
| 1998-09-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9678
| ''[[:d:Q50365977|Brian Jenkins]]''
|
| 1935-08-01
|
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 9679
| ''[[:d:Q50379493|Chelsea Lewis]]''
|
| 1993-11-24
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9680
| ''[[:d:Q50404210|Geraldine Norman]]''
|
| 1940-05-13
|
| [[Wales]]
|-
| style='text-align:right'| 9681
| ''[[:d:Q50413334|Banita Sandhu]]''
| [[File:Banita Sandhu graces the special screening of October (01).jpg|center|128px]]
| 1997-06-22
|
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 9682
| ''[[:d:Q50528961|Trevor Jones]]''
|
| 1923-01-27
| 1983-03
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9683
| ''[[:d:Q50528968|Tommy Edwards]]''
|
| 1923-02-11
| 2000-10
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9684
| ''[[:d:Q50580585|Audrey Bates]]''
|
| 1922-04-04
| 2001-11-21
| [[Cairdiff]]
|-
| style='text-align:right'| 9685
| ''[[:d:Q50580877|Audrey Coombs]]''
|
| 1928
| 2016-09-20
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9686
| ''[[:d:Q50581145|Betty Gray]]''
|
| 1920-08-20
| 2018-08-12
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 9687
| ''[[:d:Q50591265|Ivor Edward David]]''
|
| 1875-04-06
| 1913-11-23
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 9688
| ''[[:d:Q50676480|Hayley Parsons]]''
|
| 1973
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 9689
| ''[[:d:Q50900421|Emyr Evans]]''
|
| 1996-11-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9690
| ''[[:d:Q50947577|Ifan G Hughes]]''
|
| 1968-05-15
|
| ''[[:d:Q8054077|Ynyshir]]''
|-
| style='text-align:right'| 9691
| ''[[:d:Q51051504|Emma Hutchinson]]''
| [[File:Emma Sarah Hutchinson.jpg|center|128px]]
| 1820
| 1905-12-10
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 9692
| ''[[:d:Q51214742|Sam Pearce]]''
|
| 1994-09-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9693
| ''[[:d:Q51218990|Len Attley]]''
|
| 1910-04-21
| 1979
| [[Cairdiff]]
|-
| style='text-align:right'| 9694
| ''[[:d:Q51220615|Islwyn Jones]]''
|
| 1935-04-08
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9695
| ''[[:d:Q51221808|Enoch Mort]]''
|
| 1912-03-05
| 1999
| ''[[:d:Q7080139|Cwm Ogwr]]''
|-
| style='text-align:right'| 9696
| ''[[:d:Q51260242|Alan Couch]]''
|
| 1953-03-15
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9697
| ''[[:d:Q51287556|Dino Fetscher]]''
|
| 1988-06-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9698
| ''[[:d:Q51364729|Sam Fenwick]]''
|
| 1992-09-09
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 9699
| ''[[:d:Q51537516|Anthony Robert Alwyn Hobson]]''
|
| 1921-09-05
| 2014-07-12
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 9700
| ''[[:d:Q51537525|Ann Mercy Hunt]]''
|
| 1938-10-25
| 2014-06-25
| [[Welshpool]]
|-
| style='text-align:right'| 9701
| ''[[:d:Q51573468|Morgan Morris]]''
|
| 1998-08-28
|
| [[Wales]]
|-
| style='text-align:right'| 9702
| ''[[:d:Q51611000|Roger A. Falconer]]''
| [[File:RAF India 2.jpg|center|128px]]
| 1951-12-12
|
| [[Wales]]
|-
| style='text-align:right'| 9703
| ''[[:d:Q51645970|Bethan Davies]]''
|
| 1990-11-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9704
| ''[[:d:Q51683462|Charles John Ribton-Turner]]''
|
| 1839-11-04
| 1895-03-18
| ''[[:d:Q17740804|Bryntirion]]''
|-
| style='text-align:right'| 9705
| ''[[:d:Q51705802|Mihangel Jones]]''
|
| 1940
| 2018-03-22
| [[Ceredigion]]
|-
| style='text-align:right'| 9706
| ''[[:d:Q51754219|Liam Hutchinson]]''
|
| 1991-02-11
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9707
| ''[[:d:Q51759514|Bill Sweet]]''
|
| 1947-04-12
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9708
| ''[[:d:Q51799848|Alex Beckett]]''
|
| 1982-06-30
| 2018-04-12
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 9709
| ''[[:d:Q51844029|Gomer Lloyd]]''
|
| 1947-02-26
| 2016-01-03
| [[Swansea]]
|-
| style='text-align:right'| 9710
| ''[[:d:Q51876187|Gemma Evans]]''
|
| 1996-08-01
|
| ''[[:d:Q5530463|Gelli]]''
|-
| style='text-align:right'| 9711
| ''[[:d:Q51879759|Graham Sweet]]''
|
| 1948-10-26
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9712
| ''[[:d:Q51879898|Jackie Price]]''
|
| 1950-08-15
|
| [[Pontypridd]]
|-
| style='text-align:right'| 9713
| ''[[:d:Q51879916|Christopher Frank]]''
|
| 1949-02-06
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9714
| ''[[:d:Q51905701|Owen James]]''
|
| 1995-10-15
|
| ''[[:d:Q5445551|Glan-y-fferi]]''
|-
| style='text-align:right'| 9715
| ''[[:d:Q51908481|Saunt Belyau]]''
|
| 5th century
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 9716
| ''[[:d:Q51954536|Cenhedlon ach Briafael]]''
|
|
| 7th century
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9717
| ''[[:d:Q51954783|Keneython]]''
|
|
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 9718
| ''[[:d:Q51996869|Danielle Lewis]]''
|
|
|
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 9719
| ''[[:d:Q52002304|Dilig]]''
|
|
|
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 9720
| ''[[:d:Q52061534|Eurfyl ach Padarn]]''
|
|
|
| [[Powys]]
|-
| style='text-align:right'| 9721
| ''[[:d:Q52079677|Nathan Wigg]]''
|
| 1974-09-27
|
| [[Newport]]
|-
| style='text-align:right'| 9722
| ''[[:d:Q52083916|Eurgain ach Maelgwn Gwynedd]]''
|
| 510
|
| [[Wales]]
|-
| style='text-align:right'| 9723
| ''[[:d:Q52084553|Kieran Williams]]''
|
| 1997-04-12
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9724
| ''[[:d:Q52084831|James Ratti]]''
| [[File:James Ratti LQ 2023.jpg|center|128px]]
| 1997-10-14
|
| [[Swansea]]
|-
| style='text-align:right'| 9725
| ''[[:d:Q52084834|Dewi Lake]]''
|
| 1999-05-16
|
| [[Wales]]
|-
| style='text-align:right'| 9726
| ''[[:d:Q52084835|Tiaan Thomas-Wheeler]]''
|
| 1999-11-19
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 9727
| ''[[:d:Q52099094|David Evans, Jr.]]''
|
| 1848
| 1929
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9728
| ''[[:d:Q52107245|Judith Ablett-Kerr]]''
| [[File:Judith Ablett-Kerr (cropped).jpg|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 9729
| ''[[:d:Q52120536|Gwenhaf]]''
|
| 480
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 9730
| ''[[:d:Q52153538|J. Edwal Williams]]''
| [[File:John Edwal ac Angharad Williams; tad a mam Waldo Williams (cropped).jpg|center|128px]]
| 1863
| 1934
| ''[[:d:Q17015913|Llandissilio]]''
|-
| style='text-align:right'| 9731
| ''[[:d:Q52154446|Frances Williams Wynn]]''
| [[File:Lady Williams-Wynn and her Children.jpg|center|128px]]
| 1773
| 1857-04
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 9732
| ''[[:d:Q52156361|Ralph Joseph Horner]]''
|
| 1848-04-28
| 1926-04-07
| [[Newport]]
|-
| style='text-align:right'| 9733
| ''[[:d:Q52157138|Keith Winter]]''
|
| 1906-10-22
| 1983-02-17
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9734
| ''[[:d:Q52157525|Gwenonwy ach Meurig]]''
|
| 5th century
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9735
| ''[[:d:Q52160410|Charles Williams]]''
|
| 1915-09-08
| 1990-02-19
| ''[[:d:Q3402654|Bodffordd]]''
|-
| style='text-align:right'| 9736
| ''[[:d:Q52191516|Euryn Ogwen Williams]]''
|
| 1942-12-22
| 2021-03-16
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 9737
| ''[[:d:Q52231233|Ebenezer Morgan]]''
|
| 1820
| 1906
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 9738
| ''[[:d:Q52231975|Marged Esli]]''
|
| 1949-03
|
| [[Anglesey]]
|-
| style='text-align:right'| 9739
| ''[[:d:Q52293977|Watkin Bronfryn Joseph]]''
| [[File:Portrait of Watkin B. Joseph, 'Y Myfyr' (4670369).jpg|center|128px]]
| 1832
| 1883
| ''[[:d:Q6661962|Llechfaen]]''
|-
| style='text-align:right'| 9740
| ''[[:d:Q52455681|Annie Brewer]]''
| [[File:Annie brewer.png|center|128px]]
| 1874-11-21
| 1921-01-30
| [[Newport]]
|-
| style='text-align:right'| 9741
| ''[[:d:Q52470702|Dafydd Tomos]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9742
| ''[[:d:Q52496375|Huw Llewelyn Williams]]''
|
| 1904
| 1979
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 9743
| ''[[:d:Q52557168|Llŷr Forwen]]''
|
| 6th century
|
| [[Wales]]
|-
| style='text-align:right'| 9744
| ''[[:d:Q52604716|Reg Phillips]]''
|
| 1921-03-09
| 1972
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9745
| ''[[:d:Q52716006|Tudor Evans]]''
|
|
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 9746
| ''[[:d:Q52722880|Amy Evans]]''
|
| 1990-09-30
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9747
| ''[[:d:Q52724507|Ash Baker]]''
|
| 1996-10-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9748
| ''[[:d:Q52823870|Daniel Jefferies]]''
|
| 1999-01-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 9749
| ''[[:d:Q52911912|Jack Edwards]]''
| [[File:Jack Edwards (5292077).jpg|center|128px]]
| 1853
| 1942
| [[Aberystwyth]]
|-
| style='text-align:right'| 9750
| ''[[:d:Q53086736|Kelvin Thomas]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9751
| ''[[:d:Q53191106|Meleri]]''
|
|
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 9752
| ''[[:d:Q53428221|David Edward Williams]]''
|
| 1910-06-23
| 1994-10-08
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 9753
| ''[[:d:Q53570396|Nefyn ach Brychan]]''
|
|
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9754
| ''[[:d:Q53573757|Nwyalen ach Selyf]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 9755
| ''[[:d:Q53598867|Sue Harvard]]''
| [[File:Harvard LCCN2014711368.jpg|center|128px]]
| 1888-10-25
| 1967-05-15
| [[Wales]]
|-
| style='text-align:right'| 9756
| ''[[:d:Q53718889|Tangwystl ach Brychan]]''
|
| 5th century
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9757
| ''[[:d:Q53868716|John Bevan]]''
|
| 1846-05-10
| 1918-03-31
| [[Swansea]]
|-
| style='text-align:right'| 9758
| ''[[:d:Q53870939|Gwyn Morgans]]''
|
| 1932-04-20
| 2023
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9759
| ''[[:d:Q54005453|Wally Roberts]]''
|
| 1917-11-23
| 2006-03
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9760
| ''[[:d:Q54087307|Alfred Ross Pring]]''
|
| 1827
|
| [[Flintshire]]
|-
| style='text-align:right'| 9761
| ''[[:d:Q54556080|Kishan Hirani]]''
| [[File:Kishan Hirani PHC 2014-1.jpg|center|128px]]
| 1992-06-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9762
| ''[[:d:Q54591108|Noel James]]''
|
| 1965-12
|
| [[Swansea]]
|-
| style='text-align:right'| 9763
| ''[[:d:Q54594287|Marcus Piggott]]''
|
| 1971
|
| [[Wales]]
|-
| style='text-align:right'| 9764
| ''[[:d:Q54598807|Philip Welch]]''
|
| 1954-01-06
|
| [[Newport]]
|-
| style='text-align:right'| 9765
| ''[[:d:Q54670107|Richard Trygarn Griffith]]''
| [[File:Portrait of Mr. Trygarn Griffith ; Mrs. Trygarn Griffith (4671009).jpg|center|128px]]
| 1788-10-28
| 1866-03-26
| ''[[:d:Q29483393|Carreg Llwyd]]''
|-
| style='text-align:right'| 9766
| ''[[:d:Q54800979|Henry Evans]]''
| [[File:Portrait of Henry Evans (born 1606) (4674118).jpg|center|128px]]
| 1606
| 1710
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 9767
| ''[[:d:Q54861308|Dan Babos]]''
|
| 2000-03-01
|
| [[Newport]]
|-
| style='text-align:right'| 9768
| ''[[:d:Q54861310|Taine Basham]]''
|
| 1999-11-02
|
| [[Newport]]
|-
| style='text-align:right'| 9769
| ''[[:d:Q54869232|Rees Alfred Davis]]''
|
| 1856-12-29
| 1940-10-11
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 9770
| ''[[:d:Q54957569|Ray Davies]]''
|
| 1927-10-07
| 2017-07-20
| [[Swansea]]
|-
| style='text-align:right'| 9771
| ''[[:d:Q54982366|Neil Jones]]''
|
| 1948-03-25
| 2018-06-08
| ''[[:d:Q3398355|Llanbradach]]''
|-
| style='text-align:right'| 9772
| ''[[:d:Q55006228|Kelly Lee Owens]]''
| [[File:Roskilde Festival Kelly Lee Owens-5 (cropped).jpg|center|128px]]
| 1988-08-24
|
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 9773
| ''[[:d:Q55048184|Melville Hocken]]''
|
| 1887-01-10
| 1949-04-16
| [[Cairdiff]]
|-
| style='text-align:right'| 9774
| ''[[:d:Q55069173|Dianne Rees]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9775
| ''[[:d:Q55080950|Joel Bennett Ringer]]''
|
| 1996-11-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9776
| ''[[:d:Q55114646|Prem Sisodiya]]''
|
| 1998-09-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9777
| ''[[:d:Q55235984|Jessica Warboys]]''
|
| 1977
|
| [[Newport]]
|-
| style='text-align:right'| 9778
| ''[[:d:Q55237277|Terry Dyddgen-Jones]]''
|
| 1950-07
| 2018-06-27
| ''[[:d:Q13127572|Crwbin]]''
|-
| style='text-align:right'| 9779
| ''[[:d:Q55310397|Bridget Chetwynd]]''
|
| 1910-11-08
| 1970-11-28
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9780
| ''[[:d:Q55314922|Caryl Thomas]]''
|
| 1986-02-19
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9781
| ''[[:d:Q55350891|Les Speed]]''
|
| 1923-10-03
| 2012-06-05
| ''[[:d:Q2483466|Caergwrle]]''
|-
| style='text-align:right'| 9782
| ''[[:d:Q55363774|Stan Roberts]]''
|
| 1921-04-19
| 1995-04
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9783
| ''[[:d:Q55363791|Paul Roberts]]''
|
| 1977-07-29
|
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9784
| ''[[:d:Q55363992|Ken Morgan]]''
|
| 1932-07-28
| 2008-12-20
| [[Swansea]]
|-
| style='text-align:right'| 9785
| ''[[:d:Q55364071|Jessica Roberts]]''
| [[File:2024 UEC Track Elite European Championships 082.jpg|center|128px]]
| 1999-04-11
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9786
| ''[[:d:Q55369925|Chris Sander]]''
|
| 1962-11-11
|
| [[Swansea]]
|-
| style='text-align:right'| 9787
| ''[[:d:Q55375359|Frank Jones]]''
|
| 1960-10-03
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 9788
| ''[[:d:Q55391506|Curtis Dodge]]''
|
| 1992-12-02
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9789
| ''[[:d:Q55413128|Gwyn Vaughan Jones]]''
|
| 1958-07-08
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 9790
| ''[[:d:Q55462126|Welsh Whisperer]]''
| [[File:WelshWhisperer.jpg|center|128px]]
| 1987-09-22
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 9791
| ''[[:d:Q55584141|Jason Harries]]''
| [[File:Jason Harries 2023.jpg|center|128px]]
| 1989-02-14
|
| [[Wales]]
|-
| style='text-align:right'| 9792
| ''[[:d:Q55584143|Kieran Hardy]]''
|
| 1995-11-30
|
| [[Wales]]
|-
| style='text-align:right'| 9793
| ''[[:d:Q55584550|Rio Dyer]]''
| [[File:Rio Dyer 2023.jpg|center|128px]]
| 1999-12-21
|
| [[Newport]]
|-
| style='text-align:right'| 9794
| ''[[:d:Q55584573|Lennon Greggains]]''
|
| 1999-01-20
|
| [[Newport]]
|-
| style='text-align:right'| 9795
| ''[[:d:Q55584576|Connor Edwards]]''
|
| 1997-06-28
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 9796
| ''[[:d:Q55584580|Joe Goodchild]]''
|
| 1998-04-12
|
| [[Wales]]
|-
| style='text-align:right'| 9797
| ''[[:d:Q55587858|Thomas Merthyr Guest]]''
| [[File:Thomas Merthyr Guest Vanity Fair 1897-11-11.jpg|center|128px]]
| 1838-01-18
| 1904-11-05
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 9798
| ''[[:d:Q55605198|Ben Murphy]]''
|
| 1996-01-20
|
| [[Wales]]
|-
| style='text-align:right'| 9799
| ''[[:d:Q55607561|Christian Coleman]]''
|
| 1998-08-31
|
| [[Newport]]
|-
| style='text-align:right'| 9800
| ''[[:d:Q55607911|Colin Hudson]]''
|
| 1935-10-05
| 2005
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 9801
| ''[[:d:Q55610492|Eddie Jenkins]]''
|
| 1909-07-16
| 2005-08-05
| [[Cairdiff]]
|-
| style='text-align:right'| 9802
| ''[[:d:Q55615146|John Cockrill (House of Burgesses)]]''
|
| 1740s
|
| [[Wales]]
|-
| style='text-align:right'| 9803
| ''[[:d:Q55618848|William Williams]]''
| [[File:William Williams on a railway jigger, rabbit hunting in Otago, ca 1900 (3056669963) (cropped).jpg|center|128px]]
| 1859
| 1948
| [[Cairdiff]]
|-
| style='text-align:right'| 9804
| ''[[:d:Q55618934|William Williams]]''
|
| 1788
| 1855
| ''[[:d:Q13626046|Aberpergwm House]]''
|-
| style='text-align:right'| 9805
| ''[[:d:Q55631619|Rhodri Davies]]''
|
| 1991-10-14
|
| ''[[:d:Q3460580|Crymych]]''
|-
| style='text-align:right'| 9806
| ''[[:d:Q55632115|Russell Lewis]]''
|
| 1956-09-15
|
| ''[[:d:Q4923812|Blaengwynfi]]''
|-
| style='text-align:right'| 9807
| ''[[:d:Q55642700|William Hughes]]''
|
| 1998-05-12
| 2018-07-09
| [[Swansea]]
|-
| style='text-align:right'| 9808
| ''[[:d:Q55652337|Gwrgon]]''
|
| 5th century
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 9809
| ''[[:d:Q55652826|Ceindrych]]''
|
| 5th century
|
| ''[[:d:Q954585|Teyrnas Brycheiniog]]''
|-
| style='text-align:right'| 9810
| ''[[:d:Q55683438|Jimmy Mesene]]''
|
| 1908-03-06
| 1969-08-28
| [[Cairdiff]]
|-
| style='text-align:right'| 9811
| ''[[:d:Q55713686|Helena Jones]]''
|
| 1916-08-28
| 2018-07-18
| ''[[:d:Q7457421|Blaendulais]]''
|-
| style='text-align:right'| 9812
| ''[[:d:Q55720569|Sue Roderick]]''
|
| 1955
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9813
| ''[[:d:Q55721395|Abram Reese]]''
| [[File:Abram Reese (1829–1908).png|center|128px]]
| 1829-04-21
| 1908-04-25
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 9814
| ''[[:d:Q55739150|Arnold Hill Payne]]''
|
| 1877-04-28
| 1956-04-22
| [[Swansea]]
|-
| style='text-align:right'| 9815
| ''[[:d:Q55759986|Morgan Webster]]''
|
| 1990-04-13
|
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 9816
| ''[[:d:Q55760861|Sophie Mackintosh]]''
|
| 1988
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 9817
| ''[[:d:Q55767256|David James Llewelfryn Davies]]''
|
| 1903-06-27
| 1981-04-06
| ''[[:d:Q3405982|Llanfihangel Rhos-y-Corn]]''
|-
| style='text-align:right'| 9818
| ''[[:d:Q55824347|W. Ray Stephens]]''
|
| 1916-01-12
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 9819
| ''[[:d:Q55825490|Jack Jones]]''
|
| 1921-04-09
| 2001-05
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9820
| ''[[:d:Q55825492|Brian Jarvis]]''
|
| 1933-08-26
| 2004-01
| ''[[:d:Q3404531|Bangor-on-Dee]]''
|-
| style='text-align:right'| 9821
| ''[[:d:Q55844555|Latalia Bevan]]''
|
| 2001-01-26
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9822
| ''[[:d:Q55938193|Peter Read]]''
|
|
|
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 9823
| ''[[:d:Q55978975|Neil O'Halloran]]''
|
| 1933-06-21
| 1995-10
| [[Cairdiff]]
|-
| style='text-align:right'| 9824
| ''[[:d:Q55979165|Iorwerth Herbert]]''
|
| 1910-07-21
| 1976-08-24
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 9825
| ''[[:d:Q56000479|Peter Bailey]]''
|
| 1944-03-08
| 2005
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9826
| ''[[:d:Q56009287|Meinir Lloyd]]''
|
| 1940s
|
| ''[[:d:Q11093013|Cyffylliog]]''
|-
| style='text-align:right'| 9827
| ''[[:d:Q56051667|Rhodri ap Dyfrig]]''
| [[File:Rhodri ap Dyfrig (Nwdls, S4C) yn Eisteddfod Genedlaethol Caerdydd 2018 - at the National Eisteddfod, Cardiff 01.jpg|center|128px]]
| 1977-06-28
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9828
| ''[[:d:Q56062566|Abbie Trayler-Smith]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 9829
| ''[[:d:Q56118747|Ann Rosalie David]]''
|
| 1946-05-30
|
| [[Cairdiff]]<br/>''[[:d:Q683738|Local govrenment in Wales]]''
|-
| style='text-align:right'| 9830
| ''[[:d:Q56173874|Rose Mabel Durham]]''
|
| 1853-12
| 1928-12-24
| ''[[:d:Q3399358|Aberarth]]''
|-
| style='text-align:right'| 9831
| ''[[:d:Q56173890|Rees Arthur]]''
|
| 1821-01
| 1894-12
| ''[[:d:Q4667105|Abergwesyn]]''
|-
| style='text-align:right'| 9832
| ''[[:d:Q56173931|Ivor Astle]]''
|
| 1882
| 1966
| [[Cairdiff]]
|-
| style='text-align:right'| 9833
| ''[[:d:Q56173975|Elizabeth Mabel Bailey]]''
|
| 1862-03-16
| 1952-10-13
| ''[[:d:Q13129643|Llangattock]]''
|-
| style='text-align:right'| 9834
| ''[[:d:Q56174075|William Barrow]]''
|
| 1798
| 1886-10
| ''[[:d:Q3399931|Llanelltyd]]''
|-
| style='text-align:right'| 9835
| ''[[:d:Q56174090|Derek Baskerville]]''
|
| 1942
|
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 9836
| ''[[:d:Q56174136|Jane Belk]]''
|
| 1855
| 1935
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 9837
| ''[[:d:Q56174215|George Bettiss]]''
|
| 1775
| 1839
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9838
| ''[[:d:Q56174216|Mary Bettiss]]''
|
| 1788
|
| ''[[:d:Q13129604|Llanbeblig]]''
|-
| style='text-align:right'| 9839
| ''[[:d:Q56174242|John Thomas Beynon]]''
|
| 1807
| 1873
| ''[[:d:Q6661158|Llanddewi Velfrey]]''
|-
| style='text-align:right'| 9840
| ''[[:d:Q56174350|John George William Bonsall]]''
|
| 1817-05-29
| 1900
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9841
| ''[[:d:Q56174390|Evan Bowen]]''
|
|
|
| [[Ceredigion]]
|-
| style='text-align:right'| 9842
| ''[[:d:Q56174397|Gwynne Vaughan Bowen]]''
|
| 1829
| 1889-12-16
| ''[[:d:Q13132008|St Nicholas]]''
|-
| style='text-align:right'| 9843
| ''[[:d:Q56174569|James Brynker]]''
|
| 1668-09-19
| 1740-07-17
| ''[[:d:Q29501940|Brynkir]]''
|-
| style='text-align:right'| 9844
| ''[[:d:Q56174596|Robert Bulkeley]]''
|
| 1615
|
| ''[[:d:Q3402312|Llanfachraeth]]''
|-
| style='text-align:right'| 9845
| ''[[:d:Q56174632|John Burrell]]''
|
| 1859
| 1934
| ''[[:d:Q6661372|Llanfihangel y Creuddyn]]''
|-
| style='text-align:right'| 9846
| ''[[:d:Q56174713|David Arthur Callard]]''
|
| 1949
| 2006
| [[Cairdiff]]
|-
| style='text-align:right'| 9847
| ''[[:d:Q56174916|Gerard Casey]]''
|
| 1918-03-15
| 2000-10-21
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 9848
| ''[[:d:Q56175058|Sarah Charles]]''
|
| 1753
| 1814
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 9849
| ''[[:d:Q56175082|Charles Charman]]''
|
| 1914-04-02
| 1999
| [[Aberystwyth]]
|-
| style='text-align:right'| 9850
| ''[[:d:Q56175321|Alfred Butler Clough]]''
|
| 1797
| 1870-06-21
| ''[[:d:Q13635786|Henllan]]''
|-
| style='text-align:right'| 9851
| ''[[:d:Q56175456|Athelstan Corbet]]''
|
| 1788-06-24
| 1835-12-26
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 9852
| ''[[:d:Q56175528|Sarah Jane Rees]]''
| [[File:Sarah Jane Rees (Crangowen, 1839-1916) NLW3362516.jpg|center|128px]]
| 1839-01-09
| 1916-06-27
| ''[[:d:Q927739|Llangrannog]]''
|-
| style='text-align:right'| 9853
| ''[[:d:Q56175740|Don Dale-Jones]]''
|
| 1935
|
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 9854
| ''[[:d:Q56175743|Thomas Dalton]]''
|
| 1798
| 1878
| [[Cairdiff]]
|-
| style='text-align:right'| 9855
| ''[[:d:Q56175777|Evan David]]''
|
| 1809
| 1871
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 9856
| ''[[:d:Q56175831|Arthur Stanley Davies]]''
|
| 1889
| 1951
| [[Welshpool]]
|-
| style='text-align:right'| 9857
| ''[[:d:Q56175842|Benjamin Davies]]''
|
| 1863
| 1957
| ''[[:d:Q15921422|Llangynllo]]''
|-
| style='text-align:right'| 9858
| ''[[:d:Q56175850|David Griffith Davies]]''
|
| 1845
| 1899-04-09
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9859
| ''[[:d:Q56175852|David Oswald Davies]]''
|
| 1908-08-30
| 1992-11-17
| ''[[:d:Q7321602|Rhydcymerau]]''
|-
| style='text-align:right'| 9860
| ''[[:d:Q56175866|David Evan Davies]]''
|
| 1843
| 1914-12-24
| ''[[:d:Q1002782|Llannor]]''
|-
| style='text-align:right'| 9861
| ''[[:d:Q56175868|David Rees Davies]]''
|
| 1824
| 1916
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 9862
| ''[[:d:Q56175873|David Davies]]''
|
| 1793
| 1864-04
| ''[[:d:Q3404900|Caio]]''
|-
| style='text-align:right'| 9863
| ''[[:d:Q56175876|David Davies]]''
|
| 1799
| 1874
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 9864
| ''[[:d:Q56175882|David Davies]]''
|
| 1845
|
| ''[[:d:Q3401171|Cwmdu]]''
|-
| style='text-align:right'| 9865
| ''[[:d:Q56175916|Edward Davies]]''
|
| 1820
| 1908
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 9866
| ''[[:d:Q56175931|Frances Davies]]''
|
| 1836
| 1918
| ''[[:d:Q6661270|Llandyfaelog]]''
|-
| style='text-align:right'| 9867
| ''[[:d:Q56175946|Gladys Davies]]''
|
| 1885
|
| ''[[:d:Q6661851|Llanvihangel Crucorney]]''
|-
| style='text-align:right'| 9868
| ''[[:d:Q56175961|Humphrey Jones Davies]]''
|
| 1877-10-01
| 1966-07-09
| ''[[:d:Q6661071|Llanarmon-yn-Iâl]]''
|-
| style='text-align:right'| 9869
| ''[[:d:Q56175968|Idwal Davies]]''
|
| 1915-06-26
| 1992-07-20
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 9870
| ''[[:d:Q56176003|John Richard Davies]]''
|
| 1826
|
| ''[[:d:Q14508512|Henfynyw]]''
|-
| style='text-align:right'| 9871
| ''[[:d:Q56176004|John Davies]]''
|
| 1722
| 1799
| ''[[:d:Q6661375|Llanfihangel Ystrad]]''
|-
| style='text-align:right'| 9872
| ''[[:d:Q56176024|Jonathan Davies]]''
|
| 1857
| 1933
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 9873
| ''[[:d:Q56176026|Kate Davies]]''
|
| 1892
| 1980
| ''[[:d:Q15987474|Pren-gwyn]]''
|-
| style='text-align:right'| 9874
| ''[[:d:Q56176053|Price Davies]]''
|
| 1732
|
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 9875
| ''[[:d:Q56176082|Samuel Davies]]''
|
| 1829
| 1904
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 9876
| ''[[:d:Q56176086|Thomas George Davies]]''
|
| 1900
| 1977
| ''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 9877
| ''[[:d:Q56176089|Thomas Davies]]''
|
| 1802
| 1861-03-12
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 9878
| ''[[:d:Q56176101|Walter Cecil Davies]]''
|
| 1802
| 1863-04
| [[Llanrhaeadr-ym-Mochnant]]
|-
| style='text-align:right'| 9879
| ''[[:d:Q56176152|Rhys Lewis Davis]]''
|
| 1828-01-21
| 1916
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 9880
| ''[[:d:Q56176183|Wilfred Seymour De Winton]]''
|
| 1856
| 1929-04-25
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 9881
| ''[[:d:Q56176227|David J. Owen]]''
|
| 1877
| 1945
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 9882
| ''[[:d:Q56176497|Edward Edwards]]''
|
| 1865
| 1933
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 9883
| ''[[:d:Q56176500|Elizabeth Ann Davies]]''
|
| 1867-08-06
|
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 9884
| ''[[:d:Q56176529|Llewelyn Edwards]]''
|
|
|
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 9885
| ''[[:d:Q56176621|Siôn Eirian]]''
|
| 1954-03-26
| 2020-05-30
| ''[[:d:Q5771888|Hirwaun]]''
|-
| style='text-align:right'| 9886
| ''[[:d:Q56176675|Richard Elias]]''
|
| 1847
| 1927
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 9887
| ''[[:d:Q56176704|Annie Jane Ellis]]''
| [[File:Annie Jane Hughes-Griffiths (5227587).jpg|center|128px]]
| 1873
| 1942
| ''[[:d:Q29496455|Cwrt Mawr]]''
|-
| style='text-align:right'| 9888
| ''[[:d:Q56176713|Hugh Ellis]]''
|
| 1857
| 1931
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 9889
| ''[[:d:Q56176718|Robert Ellis]]''
|
| 1845
|
| ''[[:d:Q5256625|Denbighshire]]''
|-
| style='text-align:right'| 9890
| ''[[:d:Q56176777|Elizabeth Enoch]]''
|
| 1801
|
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 9891
| ''[[:d:Q56176894|David Arthen Evans]]''
|
| 1878
| 1936
| [[Ceredigion]]
|-
| style='text-align:right'| 9892
| ''[[:d:Q56176898|David Evans]]''
|
| 1860
| 1950
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 9893
| ''[[:d:Q56176902|David Evans]]''
|
| 1815
| 1883-08-04
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 9894
| ''[[:d:Q56176909|David Evans]]''
|
| 1875
| 1951
| [[Cairdiff]]
|-
| style='text-align:right'| 9895
| ''[[:d:Q56176912|Dic Evans]]''
|
| 1947
|
| [[Ceredigion]]
|-
| style='text-align:right'| 9896
| ''[[:d:Q56176943|Foulk Evans]]''
| [[File:Er cof am y Parch Foulk Evans, Machynlleth.. NLW3365216.jpg|center|128px]]
| 1783-02-04
| 1866-03-08
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 9897
| ''[[:d:Q56176950|Griffith Thomas Evans]]''
|
| 1853
| 1914
| ''[[:d:Q3402480|Rhydyclafdy]]''
|-
| style='text-align:right'| 9898
| ''[[:d:Q56176960|William Howell Evans]]''
|
| 1835
| 1892
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9899
| ''[[:d:Q56176970|John Owain Evans]]''
|
| 1875
| 1943-11-06
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9900
| ''[[:d:Q56176992|Jonah Bowen Evans]]''
|
| 1806
| 1876-04-17
| ''[[:d:Q6662982|Llywel]]''
|-
| style='text-align:right'| 9901
| ''[[:d:Q56176995|Josiah Daniel Evans]]''
|
| 1827-02-14
| 1905-09-12
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 9902
| ''[[:d:Q56176998|Lewis Evans]]''
|
| 1767
| 1835
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 9903
| ''[[:d:Q56177000|Mali Evans]]''
|
|
| 1991
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 9904
| ''[[:d:Q56177009|Olwen Caradoc Evans]]''
|
| 1918-08-08
| 1998-08-22
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9905
| ''[[:d:Q56177012|Olwen Elizabeth Lloyd George]]''
| [[File:Olwen Lloyd George a Capt T J Carey Evans.jpg|center|128px]]
| 1892-04-03
| 1990-03-02
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 9906
| ''[[:d:Q56177037|Simon Evans]]''
|
| 1824
| 1885
| ''[[:d:Q5348102|Eglwyswen]]''
|-
| style='text-align:right'| 9907
| ''[[:d:Q56177069|William Evans]]''
|
| 1876
| 1952
| ''[[:d:Q2278993|Pentraeth]]''
|-
| style='text-align:right'| 9908
| ''[[:d:Q56177096|Hope Wynne Eyton]]''
|
| 1754-11-19
| 1824
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 9909
| ''[[:d:Q56177160|John Jocelyn Ffoulkes]]''
|
| 1813
| 1898-06-17
| ''[[:d:Q13126438|Bylchau]]''
|-
| style='text-align:right'| 9910
| ''[[:d:Q56177351|Richard Garnons]]''
|
| 1773-12-29
| 1841-08-08
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 9911
| ''[[:d:Q56177409|William George]]''
|
| 1865
| 1920
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 9912
| ''[[:d:Q56177484|William Glasnant Jones]]''
|
| 1869
| 1951
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 9913
| ''[[:d:Q56177501|Evan Williams]]''
|
| 1866
| 1937
| ''[[:d:Q13129629|Llanfihangel Glyn Myfyr]]''
|-
| style='text-align:right'| 9914
| ''[[:d:Q56177812|George Griffith]]''
|
| 1790-03-18
| 1877-04-23
| ''[[:d:Q17741595|Garn]]''
|-
| style='text-align:right'| 9915
| ''[[:d:Q56177827|John Griffith]]''
|
| 1654
| 1698
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 9916
| ''[[:d:Q56177836|John Griffith]]''
|
| 1843
| 1864
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 9917
| ''[[:d:Q56177842|Robert John Griffith]]''
|
| 1861
|
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 9918
| ''[[:d:Q56177851|R.E. Griffith]]''
|
| 1911-10-05
| 1975-11-25
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 9919
| ''[[:d:Q56177887|William Griffith]]''
|
| 1730s
| 1766
| [[Wales]]
|-
| style='text-align:right'| 9920
| ''[[:d:Q56178037|David Thomas Guy]]''
|
| 1905-11-22
| 1976
| ''[[:d:Q14538499|Llanrhidian]]''
|-
| style='text-align:right'| 9921
| ''[[:d:Q56178145|Alban Thomas Jones Gwynne]]''
| [[File:Mather Brown (1761-1831) - The Reverend Alban Thomas Gwynne (1751–1819) - 864495 - National Trust.jpg|center|128px]]
| 1751
| 1819
| ''[[:d:Q5058788|Cenarth]]''
|-
| style='text-align:right'| 9922
| ''[[:d:Q56178156|Elliw Haf]]''
|
| 1953
|
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 9923
| ''[[:d:Q56178177|Benjamin Hall]]''
|
| 1742-07-03
| 1825-04-07
| ''[[:d:Q5618124|Gumfreston]]''
|-
| style='text-align:right'| 9924
| ''[[:d:Q56178193|Frederick Edward Hamer]]''
|
| 1865
|
| ''[[:d:Q13129664|Llanllwchaiarn]]''
|-
| style='text-align:right'| 9925
| ''[[:d:Q56178195|Florrie Hamer]]''
|
| 1903
| 1994-03-26
| ''[[:d:Q3401604|Bow Street]]''
|-
| style='text-align:right'| 9926
| ''[[:d:Q56178200|Nina Hammett]]''
|
| 1890
| 1956
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 9927
| ''[[:d:Q56178202|Victor Hampson-Jones]]''
|
| 1909-08-19
| 1977
| ''[[:d:Q3402341|Abercraf]]''
|-
| style='text-align:right'| 9928
| ''[[:d:Q56178351|Mary Elizabeth Hedley]]''
|
| 1854
| 1925
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 9929
| ''[[:d:Q56178357|Pete Hellings]]''
|
| 1921-08-01
| 1994-09-24
| [[Swansea]]
|-
| style='text-align:right'| 9930
| ''[[:d:Q56178468|Isaac Herriman]]''
|
| 1894
| 1968
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 9931
| ''[[:d:Q56178498|Elizabeth Lady Hills-Johnes]]''
|
| 1834
| 1927-04-09
| ''[[:d:Q108366926|Dolaucothi House]]''
|-
| style='text-align:right'| 9932
| ''[[:d:Q56178627|Douglas Houston]]''
|
| 1947
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9933
| ''[[:d:Q56178642|Robert Howard]]''
|
| 1692
| 1776-07-05
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 9934
| ''[[:d:Q56178666|Abraham Howell]]''
|
| 1810
| 1893
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9935
| ''[[:d:Q56178688|David Howell]]''
|
| 1817
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9936
| ''[[:d:Q56178692|Edward Howell]]''
|
| 1814-08
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9937
| ''[[:d:Q56178696|Evan Howell]]''
|
| 1806-01
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9938
| ''[[:d:Q56178698|Lewis Howell]]''
|
| 1812
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9939
| ''[[:d:Q56178703|Samuel Howell]]''
|
| 1822-10-12
|
| ''[[:d:Q4942605|Bont Dolgadfan]]''
|-
| style='text-align:right'| 9940
| ''[[:d:Q56178704|William Howell]]''
|
| 1777
| 1845
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9941
| ''[[:d:Q56178705|William Howell]]''
|
| 1804
| 1826
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 9942
| ''[[:d:Q56178756|Ann Jones]]''
|
| 1815
|
| ''[[:d:Q3404936|Llanfair Talhaiarn]]''
|-
| style='text-align:right'| 9943
| ''[[:d:Q56178760|Benjamin Hughes]]''
|
| 1821
| 1913
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 9944
| ''[[:d:Q56178790|Harold Rhys Hughes]]''
|
| 1916-05-27
| 1998
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 9945
| ''[[:d:Q56178805|John Henry Hughes]]''
|
| 1862
| 1893
| ''[[:d:Q42617191|Isle of Anglesey]]''
|-
| style='text-align:right'| 9946
| ''[[:d:Q56178842|Thomas Hughes]]''
|
| 1815
|
| ''[[:d:Q6661345|Llanfair Dyffryn Clwyd]]''
|-
| style='text-align:right'| 9947
| ''[[:d:Q56178865|Roderick Humphreys]]''
|
| 1816-01
| 1895
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 9948
| ''[[:d:Q56178885|David Hussey]]''
|
| 1852
| 1930
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 9949
| ''[[:d:Q56178925|Glyn Ifans]]''
|
| 1920
|
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 9950
| ''[[:d:Q56179080|John Jayne]]''
|
| 1805-01-29
| 1873
| ''[[:d:Q804282|Blaenafon]]''
|-
| style='text-align:right'| 9951
| ''[[:d:Q56179107|Anne Jenkins]]''
|
| 1864-12-30
| 1948
| ''[[:d:Q29495975|Trecefel]]''
|-
| style='text-align:right'| 9952
| ''[[:d:Q56179139|Richard Iwan Jenkyn]]''
|
| 1857
| 1893
| ''[[:d:Q645155|Cardiganshire]]''
|-
| style='text-align:right'| 9953
| ''[[:d:Q56179144|Herbert Noel Jerman]]''
|
| 1909-12-11
| 1994
| ''[[:d:Q17738677|Dolforgan Hall]]''
|-
| style='text-align:right'| 9954
| ''[[:d:Q56179197|Edwin William John]]''
|
| 1847
| 1938-04-07
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 9955
| ''[[:d:Q56179219|Charlotte Anna Maria Johnes]]''
|
| 1825
| 1911-03-05
| ''[[:d:Q5561752|Gileston]]''
|-
| style='text-align:right'| 9956
| ''[[:d:Q56179243|W. Jones Williams]]''
|
|
|
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 9957
| ''[[:d:Q56179374|Brynmor Pierce Jones]]''
|
| 1925
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 9958
| ''[[:d:Q56179386|Charles Jones]]''
|
| 1831
| 1917
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 9959
| ''[[:d:Q56179396|David Elwyn Jones]]''
|
| 1945
| 2003
| ''[[:d:Q2035368|Tremadog]]''
|-
| style='text-align:right'| 9960
| ''[[:d:Q56179400|David Rhys Jones]]''
|
| 1845
| 1926
| ''[[:d:Q15921422|Llangynllo]]''
|-
| style='text-align:right'| 9961
| ''[[:d:Q56179414|Daniel Jones]]''
|
| 1770
| 1821
| [[Ceredigion]]
|-
| style='text-align:right'| 9962
| ''[[:d:Q56179420|David Ivon Jones]]''
| [[File:David Ivon Jones 001.jpg|center|128px]]
| 1882
| 1924-04-13
| [[Aberystwyth]]
|-
| style='text-align:right'| 9963
| ''[[:d:Q56179423|David Samuel Jones]]''
|
| 1852-02-26
| 1898-03-16
| ''[[:d:Q3401668|Eglwysbach]]''
|-
| style='text-align:right'| 9964
| ''[[:d:Q56179431|David Jones]]''
|
| 1893
| 1916-07-12
| ''[[:d:Q101170463|Cardiganshire]]''
|-
| style='text-align:right'| 9965
| ''[[:d:Q56179448|Dedwydd Jones]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 9966
| ''[[:d:Q56179463|Edward Jones]]''
|
| 1780-06
| 1820-10-27
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 9967
| ''[[:d:Q56179473|Edwin Jones]]''
|
| 1842-01-08
| 1932
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 9968
| ''[[:d:Q56179475|Elinor Jones]]''
|
| 1946-03
|
| ''[[:d:Q6661893|Llanwrda]]''
|-
| style='text-align:right'| 9969
| ''[[:d:Q56179489|Esther Anne Davies]]''
|
| 1883-02-27
| 1940-05-13
| ''[[:d:Q2204179|Llandeilo]]''
|-
| style='text-align:right'| 9970
| ''[[:d:Q56179492|Evan W. Jones]]''
|
| 1876
|
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 9971
| ''[[:d:Q56179498|Francis Ernest Llewellyn Jones]]''
|
| 1883-08-12
| 1982
| ''[[:d:Q20599925|Tal-y-bont]]''
|-
| style='text-align:right'| 9972
| ''[[:d:Q56179504|Griffith Jones]]''
|
| 1820
| 1875
| ''[[:d:Q5714157|Heneglwys]]''
|-
| style='text-align:right'| 9973
| ''[[:d:Q56179510|Gwen Jones]]''
|
| 1777
| 1857
| ''[[:d:Q3404936|Llanfair Talhaiarn]]''
|-
| style='text-align:right'| 9974
| ''[[:d:Q56179519|Henry Francis Jones]]''
|
| 1874
| 1949-12
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 9975
| ''[[:d:Q56179526|Henry Jones]]''
|
| 1824
| 1852
| ''[[:d:Q3400119|Llanfihangel-y-Pennant]]''
|-
| style='text-align:right'| 9976
| ''[[:d:Q56179538|Hugh Jones]]''
|
|
| 1799-04-02
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 9977
| ''[[:d:Q56179544|Humphrey Jones]]''
| [[File:Humphrey Jones a Diwygiad 1859 (page 57 crop).jpg|center|128px]]
| 1832-10-11
| 1895
| ''[[:d:Q13131979|Tre'r-ddôl]]''
|-
| style='text-align:right'| 9978
| ''[[:d:Q56179545|Humphrey Jones]]''
|
|
| 1690
| ''[[:d:Q29484376|Maesygarnedd]]''
|-
| style='text-align:right'| 9979
| ''[[:d:Q56179548|Ifor Ceredig Jones]]''
|
| 1902
| 1965
| ''[[:d:Q16540181|Llangynhafal]]''
|-
| style='text-align:right'| 9980
| ''[[:d:Q56179551|Edward Iorwerth Jones]]''
|
| 1852
| 1931
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 9981
| ''[[:d:Q56179555|James Celty Jones]]''
|
| 1843
| 1912-05-26
| ''[[:d:Q5058745|Cemmaes]]''
|-
| style='text-align:right'| 9982
| ''[[:d:Q56179559|John David Jones]]''
|
| 1868
| 1929
| ''[[:d:Q6661559|Llangynfelyn]]''
|-
| style='text-align:right'| 9983
| ''[[:d:Q56179562|John Meredith Jones]]''
|
|
| 1855
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 9984
| ''[[:d:Q56179587|John David Jones]]''
|
| 1871
| 1931
| ''[[:d:Q7680110|Talyllychau]]''
|-
| style='text-align:right'| 9985
| ''[[:d:Q56179591|John Griffith Jones]]''
|
| 1843
| 1864
| ''[[:d:Q7163011|Penisa'r Waun]]''
|-
| style='text-align:right'| 9986
| ''[[:d:Q56179593|John Henry Jones]]''
|
| 1909-07-28
| 1985-10-17
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 9987
| ''[[:d:Q56179596|John Morris Jones]]''
|
| 1892-11-07
| 1984
| [[Aberystwyth]]
|-
| style='text-align:right'| 9988
| ''[[:d:Q56179597|John Reginald Jones]]''
|
| 1897-06-24
| 1964-04-21
| ''[[:d:Q13131732|Talywain]]''
|-
| style='text-align:right'| 9989
| ''[[:d:Q56179598|John Washington Jones]]''
|
| 1887
| 1974
| ''[[:d:Q7162296|Pencarreg]]''
|-
| style='text-align:right'| 9990
| ''[[:d:Q56179623|John Jones]]''
|
| 1787
| 1860-07-25
| ''[[:d:Q5256625|Denbighshire]]''
|-
| style='text-align:right'| 9991
| ''[[:d:Q56179660|Lewis Jones]]''
| [[File:Lewis Jones, Rhyl (5349002).jpg|center|128px]]
| 1850
| 1932
| ''[[:d:Q2272941|Tywyn]]''
|-
| style='text-align:right'| 9992
| ''[[:d:Q56179677|Margaret Mostyn Jones]]''
|
| 1841
| 1935-11-07
| ''[[:d:Q2424760|Mostyn]]''
|-
| style='text-align:right'| 9993
| ''[[:d:Q56179689|Mary Jones]]''
|
| 1831
| 1861
| ''[[:d:Q3400119|Llanfihangel-y-Pennant]]''
|-
| style='text-align:right'| 9994
| ''[[:d:Q56179702|Morris Jones]]''
|
| 1819
| 1875
| ''[[:d:Q7678684|Tal-y-llyn]]''
|-
| style='text-align:right'| 9995
| ''[[:d:Q56179703|Morris Jones]]''
|
| 1783
| 1862
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 9996
| ''[[:d:Q56179705|Moses Jones]]''
|
| 1792
| 1863
| ''[[:d:Q1541249|Llŷn Peninsula]]''
|-
| style='text-align:right'| 9997
| ''[[:d:Q56179714|Owen Evan Jones]]''
|
| 1834
| 1887
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 9998
| ''[[:d:Q56179728|Rhys Bevan Jones]]''
|
| 1869-09-19
| 1933-04-10
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 9999
| ''[[:d:Q56179739|Richard Jones]]''
|
| 1863
| 1942
| ''[[:d:Q3400157|Llanwnda]]''
|-
| style='text-align:right'| 10000
| ''[[:d:Q56179740|Richard Jones]]''
|
| 1799
|
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 10001
| ''[[:d:Q56179743|Richard Jones]]''
|
|
|
| ''[[:d:Q5289699|Dolwyddelan]]''
|-
| style='text-align:right'| 10002
| ''[[:d:Q56179770|Selwyn Jones]]''
|
| 1906
| 1906-11-08
| [[Pontypridd]]
|-
| style='text-align:right'| 10003
| ''[[:d:Q56179787|Thomas Zaccheus Jones]]''
|
| 1853
|
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 10004
| ''[[:d:Q56179793|Thomas Jones]]''
|
| 1823
| 1897
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 10005
| ''[[:d:Q56179800|Thomas Jones]]''
|
| 1821
|
| ''[[:d:Q3404936|Llanfair Talhaiarn]]''
|-
| style='text-align:right'| 10006
| ''[[:d:Q56179845|Walter Sylvanus Jones]]''
|
| 1883
| 1932
| ''[[:d:Q7131619|Pant Glas]]''
|-
| style='text-align:right'| 10007
| ''[[:d:Q56179862|William Jones]]''
|
| 1860
|
| ''[[:d:Q16103619|Llanfair-y-Cwmwd]]''
|-
| style='text-align:right'| 10008
| ''[[:d:Q56179865|William Jones]]''
|
| 1825
| 1893
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 10009
| ''[[:d:Q56179904|Thomas Mann Keene]]''
|
| 1868-04-28
| 1921-10-11
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 10010
| ''[[:d:Q56180075|Henry Leach]]''
|
|
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 10011
| ''[[:d:Q56180082|John Leach]]''
|
| 1826-01-08
| 1876-07-24
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 10012
| ''[[:d:Q56180094|Godfrey Lee]]''
|
| 1951
|
| [[Newport]]
|-
| style='text-align:right'| 10013
| ''[[:d:Q56180095|Henry Herbert Lee]]''
|
| 1838
| 1920-03-19
| ''[[:d:Q3403308|Dinas Powys]]''
|-
| style='text-align:right'| 10014
| ''[[:d:Q56180201|Daniel Lewis]]''
|
| 1841
| 1922
| ''[[:d:Q6661278|Llanegwad]]''
|-
| style='text-align:right'| 10015
| ''[[:d:Q56180238|Lewis Lewis]]''
|
| 1837
| 1906
| ''[[:d:Q3401549|Llangadog]]''
|-
| style='text-align:right'| 10016
| ''[[:d:Q56180262|Rees Lewis]]''
|
| 1804
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10017
| ''[[:d:Q56180457|John Meredith Lloyd Jones]]''
|
| 1907
| 1981
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 10018
| ''[[:d:Q56180589|David Francis Lloyd]]''
|
| 1866
| 1955-08
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 10019
| ''[[:d:Q56180621|George Evan Lloyd]]''
|
| 1855-10
| 1900-11-29
| ''[[:d:Q13132036|Troedyraur]]''
|-
| style='text-align:right'| 10020
| ''[[:d:Q56180667|Posthumus Lloyd]]''
|
|
|
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 10021
| ''[[:d:Q56180685|Thomas Lloyd]]''
|
| 1732
| 1788-01-21
| ''[[:d:Q1936328|Nevern]]''
|-
| style='text-align:right'| 10022
| ''[[:d:Q56180917|Roderick Lumley]]''
|
| 1838
| 1895-11-27
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 10023
| ''[[:d:Q56180942|Mary Lyttelton]]''
|
| 1813-07-22
| 1857-08-17
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10024
| ''[[:d:Q56181019|Charles Salusbury Mainwaring]]''
|
| 1845-07-07
| 1920-06-14
| ''[[:d:Q6757046|Marchwiel Hall]]''
|-
| style='text-align:right'| 10025
| ''[[:d:Q56181099|Thomas Edmund Marsh]]''
| [[File:Thomas Edmund Marsh.jpg|center|128px]]
| 1803
| 1861-01-15
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 10026
| ''[[:d:Q56181177|William Maurice]]''
|
| 1850
| 1925
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 10027
| ''[[:d:Q56181275|Mihangel ap Iwan]]''
| [[File:AP IWAN Mihagel HJ61 001.jpg|center|128px]]
| 1863-06-05
| 1944
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 10028
| ''[[:d:Q56181301|Caradoc Mills]]''
|
| 1883
| 1950
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 10029
| ''[[:d:Q56181404|William Morgan]]''
| [[File:William Morgan(?), vicar of Llandderfel NLW3363792.jpg|center|128px]]
| 1828
| 1905-08
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 10030
| ''[[:d:Q56181414|Kevin Morgan]]''
|
| 1953-01-07
|
| ''[[:d:Q258665|Rhigos]]''
|-
| style='text-align:right'| 10031
| ''[[:d:Q56181426|Rhian Morgan]]''
|
|
|
| ''[[:d:Q7653726|Cwm Tawe]]''
|-
| style='text-align:right'| 10032
| ''[[:d:Q56181427|Rhys Morgan]]''
|
| 1892
| 1961
| ''[[:d:Q20602439|Ynysmeudwy]]''
|-
| style='text-align:right'| 10033
| ''[[:d:Q56181432|Thomas Morgan]]''
|
| 1453
|
| ''[[:d:Q6661646|Llanmartin]]''
|-
| style='text-align:right'| 10034
| ''[[:d:Q56181484|Hugh Morris]]''
|
| 1830
| 1908
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 10035
| ''[[:d:Q56181485|Hugh Morris]]''
|
| 1869
| 1940-03-03
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 10036
| ''[[:d:Q56181525|Robert Owen Morris]]''
|
| 1859
| 1943
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 10037
| ''[[:d:Q56181644|Cynric Mytton-Davies]]''
|
| 1905
| 1995
| ''[[:d:Q16548107|Castle Caereinion]]''
|-
| style='text-align:right'| 10038
| ''[[:d:Q56181657|Robert Richards Nancarrow]]''
|
| 1884
| 1964
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 10039
| ''[[:d:Q56181981|Ann Corbet]]''
|
| 1684
| 1760
| ''[[:d:Q10948653|Ynysmaengwyn]]''
|-
| style='text-align:right'| 10040
| ''[[:d:Q56181991|Bryn Owen]]''
|
| 1928
| 1999
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 10041
| ''[[:d:Q56181995|Dillwyn Owen]]''
|
| 1922-09-09
| 1999-01-30
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10042
| ''[[:d:Q56182000|Elizabeth Glaslyn Owen]]''
|
| 1884
| 1963-12-28
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 10043
| ''[[:d:Q56182025|John Caleb Owen]]''
|
| 1859
|
| ''[[:d:Q927739|Llangrannog]]''
|-
| style='text-align:right'| 10044
| ''[[:d:Q56182032|John Owen]]''
|
| 1712
| 1800
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 10045
| ''[[:d:Q56182063|Morris Owen]]''
|
| 1839
| 1916
| ''[[:d:Q7165298|Pentrefoelas]]''
|-
| style='text-align:right'| 10046
| ''[[:d:Q56182074|Richard Owen]]''
|
| 1880
| 1963-08-29
| ''[[:d:Q5566589|Llansanffraid Glan Conwy]]''
|-
| style='text-align:right'| 10047
| ''[[:d:Q56182092|Thomas Owen]]''
|
| 1872
| 1956
| ''[[:d:Q29501660|Cwm Hesgyn]]''
|-
| style='text-align:right'| 10048
| ''[[:d:Q56182104|William Washington Owen]]''
|
| 1889
| 1969
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 10049
| ''[[:d:Q56182206|Thomas Parker]]''
|
| 1761
| 1818
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 10050
| ''[[:d:Q56182218|John Parry de Winton]]''
|
| 1778-07-21
| 1864-11-07
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 10051
| ''[[:d:Q56182245|John Parry]]''
|
| 1888
| 1965
| ''[[:d:Q5263315|Derwen]]''
|-
| style='text-align:right'| 10052
| ''[[:d:Q56182500|Griffith Phillips]]''
|
| 1846
| 1920
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 10053
| ''[[:d:Q56182632|Victoria Plucknett]]''
|
| 1953
|
| [[Swansea]]
|-
| style='text-align:right'| 10054
| ''[[:d:Q56182741|Gomer Powell]]''
|
| 1834
| 1871
| ''[[:d:Q1985810|Hope]]''
|-
| style='text-align:right'| 10055
| ''[[:d:Q56182952|Richard Watkin Price]]''
| [[File:R. W. Price.jpg|center|128px]]
| 1780
| 1860
| ''[[:d:Q6661284|Llanelidan]]''
|-
| style='text-align:right'| 10056
| ''[[:d:Q56182975|Thomas Lewis Prichard]]''
|
| 1880
| 1914-11-11
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 10057
| ''[[:d:Q56182977|Thomas Prichard]]''
|
| 1619
| 1690
| ''[[:d:Q1807193|Rhuddlan]]''
|-
| style='text-align:right'| 10058
| ''[[:d:Q56182984|Emrys Pride]]''
|
| 1904
|
| [[Penygraig]]
|-
| style='text-align:right'| 10059
| ''[[:d:Q56182995|Christine Pritchard]]''
|
| 1943-08-06
| 2023-02-14
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 10060
| ''[[:d:Q56183029|Gwynydd Pryce]]''
|
| 1876
| 1909-02-18
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10061
| ''[[:d:Q56183042|Absalom Prys]]''
|
| 1822
| 1895
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 10062
| ''[[:d:Q56183051|Arthur Glyn Prys-Jones]]''
|
| 1888-03-07
| 1987-02-21
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 10063
| ''[[:d:Q56183083|Arthur Pugh]]''
|
| 1910
| 1986-09-15
| ''[[:d:Q6661559|Llangynfelyn]]''
|-
| style='text-align:right'| 10064
| ''[[:d:Q56183088|Idwal Pugh]]''
|
| 1919-03-05
| 1981-06
| [[Aberystwyth]]
|-
| style='text-align:right'| 10065
| ''[[:d:Q56183099|David William Pughe]]''
|
| 1821
| 1862
| ''[[:d:Q3399377|Clynnog Fawr]]''
|-
| style='text-align:right'| 10066
| ''[[:d:Q56183116|William Pughe]]''
|
| 1765
| 1852-02-13
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 10067
| ''[[:d:Q56183197|Mary Louisa Williams]]''
|
| 1825
|
| ''[[:d:Q1992389|Beaumaris]]''
|-
| style='text-align:right'| 10068
| ''[[:d:Q56183241|Benjamin George Rees]]''
|
| 1910
| 1948-12-30
| [[Sooth Wales]]
|-
| style='text-align:right'| 10069
| ''[[:d:Q56183249|Enoch Howell Rees]]''
|
| 1888
| 1969
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 10070
| ''[[:d:Q56183252|Ivor Thomas Rees]]''
|
| 1931-08
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 10071
| ''[[:d:Q56183264|John Rees]]''
|
| 1819-10-04
| 1900-08-03
| ''[[:d:Q3405138|St Dogmaels]]''
|-
| style='text-align:right'| 10072
| ''[[:d:Q56183286|Richard Rees]]''
|
| 1851
| 1927
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 10073
| ''[[:d:Q56183300|William Rees]]''
|
| 1854
| 1934
| ''[[:d:Q6661077|Llanarthney]]''
|-
| style='text-align:right'| 10074
| ''[[:d:Q56183306|William Rees]]''
|
| 1839
| 1919
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 10075
| ''[[:d:Q56183482|David Richards]]''
|
| 1860
|
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 10076
| ''[[:d:Q56183495|John Morgan Richards]]''
|
| 1856
|
| ''[[:d:Q6661456|Llangeler]]''
|-
| style='text-align:right'| 10077
| ''[[:d:Q56183496|Jacob Richards]]''
|
| 1774
| 1834
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10078
| ''[[:d:Q56183501|John Dyer Richards]]''
|
| 1876
| 1927-11-07
| ''[[:d:Q7424466|Saron]]''
|-
| style='text-align:right'| 10079
| ''[[:d:Q56183503|John Lloyd Richards]]''
|
| 1790
| 1854-03-28
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 10080
| ''[[:d:Q56183513|Owen Richards]]''
|
| 1813
| 1886
| ''[[:d:Q13129660|Llanilar]]''
|-
| style='text-align:right'| 10081
| ''[[:d:Q56183522|Thomas Richards]]''
|
| 1785-06-03
| 1855-11-27
| ''[[:d:Q3402405|Llanymawddwy]]''
|-
| style='text-align:right'| 10082
| ''[[:d:Q56183529|Peter Rickards]]''
|
| 1716-01-21
| 1780-06-23
| ''[[:d:Q3400972|Old Radnor]]''
|-
| style='text-align:right'| 10083
| ''[[:d:Q56183569|Charles Benson Roberts]]''
|
| 1896-01-24
| 1992
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10084
| ''[[:d:Q56183595|Evan Roberts]]''
|
|
| 1991
| ''[[:d:Q3400769|Capel Curig]]''
|-
| style='text-align:right'| 10085
| ''[[:d:Q56183604|Griffith Roberts]]''
|
| 1768
| 1815
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 10086
| ''[[:d:Q56183607|Gwen Rees Roberts]]''
|
| 1916-03-02
| 2002-01-03
| ''[[:d:Q3400141|Morfa Nefyn]]''
|-
| style='text-align:right'| 10087
| ''[[:d:Q56183620|Jane Roberts]]''
|
| 1828
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10088
| ''[[:d:Q56183655|Peter Roberts]]''
|
| 1835
| 1912
| ''[[:d:Q8059699|Ysceifiog]]''
|-
| style='text-align:right'| 10089
| ''[[:d:Q56183688|Wilbert Lloyd Roberts]]''
|
| 1926
| 1996
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 10090
| ''[[:d:Q56183689|William David Roberts]]''
|
| 1861
|
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 10091
| ''[[:d:Q56183769|John Rowland]]''
|
| 1735-10-14
| 1815-11-28
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 10092
| ''[[:d:Q56183782|David Rowlands]]''
|
| 1778
|
| ''[[:d:Q18160619|Llanfihangel Penbedw]]''
|-
| style='text-align:right'| 10093
| ''[[:d:Q56183864|Mary Anne Ruck]]''
|
| 1822
| 1905-12-29
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 10094
| ''[[:d:Q56183866|Richard Ruck]]''
| [[File:RM Ruck standing.png|center|128px]]
| 1852
| 1935-03-17
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 10095
| ''[[:d:Q56183975|Dafydd Savage]]''
|
| 1809
|
| ''[[:d:Q2666382|Llanfair Caereinion]]''
|-
| style='text-align:right'| 10096
| ''[[:d:Q56183978|Roderick Urwick Sayce]]''
|
| 1890
| 1970
| [[Welshpool]]
|-
| style='text-align:right'| 10097
| ''[[:d:Q56184140|Percy Eynon Smart]]''
|
| 1912
| 1991
| [[Swansea]]
|-
| style='text-align:right'| 10098
| ''[[:d:Q56184269|Walter Spurrell]]''
|
| 1858-09-19
| 1934-04-23
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10099
| ''[[:d:Q56184489|Henry Studt]]''
|
| 1853
| 1922
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10100
| ''[[:d:Q56184657|Dora Thatcher]]''
|
| 1912-09-14
| 1985
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 10101
| ''[[:d:Q56184743|Benjamin F. Thomas]]''
|
| 1845
| 1892
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 10102
| ''[[:d:Q56184779|David Thomas]]''
|
| 1866
| 1940
| ''[[:d:Q15963900|Llanwnnen]]''
|-
| style='text-align:right'| 10103
| ''[[:d:Q56184787|Dyfed Thomas]]''
|
|
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10104
| ''[[:d:Q56184788|Eddie Thomas]]''
|
|
| 1936
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 10105
| ''[[:d:Q56184797|Gwilym Ivor Thomas]]''
|
| 1920
|
| ''[[:d:Q6661685|Llanon]]''
|-
| style='text-align:right'| 10106
| ''[[:d:Q56184810|Hugh Thomas]]''
|
| 1664
| 1688
| ''[[:d:Q6661464|Llangelynnin]]''
|-
| style='text-align:right'| 10107
| ''[[:d:Q56184827|John Thomas]]''
|
| 1733
| 1784
| ''[[:d:Q13132004|Tremain]]''
|-
| style='text-align:right'| 10108
| ''[[:d:Q56184830|John Thomas]]''
|
| 1751-10-26
| 1810-09-26
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 10109
| ''[[:d:Q56184842|Mary Thomas]]''
|
| 1857
|
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 10110
| ''[[:d:Q56184856|Nancy Thomas]]''
|
| 1906-09-02
| 1953
| [[Swansea]]
|-
| style='text-align:right'| 10111
| ''[[:d:Q56184865|Philip Thomas]]''
|
| 1857
| 1938
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10112
| ''[[:d:Q56184886|Thomas Thomas]]''
|
| 1741
| 1826-05-20
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10113
| ''[[:d:Q56184888|Thomas Thomas]]''
|
| 1808
| 1886
| [[Wales]]
|-
| style='text-align:right'| 10114
| ''[[:d:Q56184894|William Gwynne Stedman Thomas]]''
|
| 1822<br/>1821-04-27
| 1910-03-01
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10115
| ''[[:d:Q56184909|William Thorne]]''
| [[File:William Thorne.jpg|center|128px]]
|
|
| ''[[:d:Q1939963|Neyland]]''
|-
| style='text-align:right'| 10116
| ''[[:d:Q56185032|Hugh Jones]]''
|
| 1845
| 1903
| [[Anglesey]]
|-
| style='text-align:right'| 10117
| ''[[:d:Q56185117|Evan Ungoed-Thomas]]''
|
| 1860
| 1930-05-18
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10118
| ''[[:d:Q56185314|Robert Williams Vaughan]]''
| [[File:Robert Williams Vaughan (1803–1859), Bt (gcf070601).jpg|center|128px]]
| 1803-06-25
| 1859-04-29
| ''[[:d:Q17743944|Nannau]]''
|-
| style='text-align:right'| 10119
| ''[[:d:Q56185359|Henry James Vincent]]''
|
| 1799
| 1865-06-11
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 10120
| ''[[:d:Q56185440|Daniel Walters]]''
|
| 1762
| 1787
| ''[[:d:Q13644928|Llandough]]''
|-
| style='text-align:right'| 10121
| ''[[:d:Q56185447|Moses Walters]]''
|
| 1869
| 1934
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 10122
| ''[[:d:Q56185504|Dorothy Watkins]]''
|
| 1909
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 10123
| ''[[:d:Q56185516|Sarah Watkins]]''
|
| 1876
| 1975
| ''[[:d:Q17485280|Sarnau]]''
|-
| style='text-align:right'| 10124
| ''[[:d:Q56185758|David Wigley]]''
|
| 1872
|
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 10125
| ''[[:d:Q56185761|Thomas Wigley]]''
|
| 1867
| 1910-04-18
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 10126
| ''[[:d:Q56185924|David Williams]]''
|
| 1802
| 1842-09-25
| ''[[:d:Q37761359|Llangadog]]''
|-
| style='text-align:right'| 10127
| ''[[:d:Q56185945|Elizabeth Williams]]''
|
| 1836
|
| ''[[:d:Q3401549|Llangadog]]''
|-
| style='text-align:right'| 10128
| ''[[:d:Q56186093|Henry Rumsey Williams]]''
|
| 1774
| 1841
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 10129
| ''[[:d:Q56186102|Henry Williams]]''
|
| 1831
| 1910
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 10130
| ''[[:d:Q56186119|Isaac Williams]]''
|
| 1840
| 1840
| [[Aberystwyth]]
|-
| style='text-align:right'| 10131
| ''[[:d:Q56186125|John Digain Williams]]''
|
| 1864-11-06
| 1937-04-16
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 10132
| ''[[:d:Q56186139|John Rhosydd Williams]]''
|
| 1885-05-10
| 1957-08-05
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 10133
| ''[[:d:Q56186155|John Williams]]''
|
| 1761
| 1830-10-09
| ''[[:d:Q2968597|Bodelwyddan Castle]]''
|-
| style='text-align:right'| 10134
| ''[[:d:Q56186166|Lewis Ambrose Williams]]''
|
| 1814
| 1873
| [[Swansea]]
|-
| style='text-align:right'| 10135
| ''[[:d:Q56186189|Morris Thomas Williams]]''
|
| 1900
| 1946-01-06
| ''[[:d:Q3402429|Groeslon]]''
|-
| style='text-align:right'| 10136
| ''[[:d:Q56186193|Nathaniel Williams]]''
|
| 1843
|
| ''[[:d:Q13128899|Gwynfe]]''
|-
| style='text-align:right'| 10137
| ''[[:d:Q56186220|Rhys Williams]]''
|
| 1841
| 1867-01-09
| ''[[:d:Q14508467|Blaenpennal]]''
|-
| style='text-align:right'| 10138
| ''[[:d:Q56186223|Richard Williams]]''
|
| 1796
| 1856
| [[Aberystwyth]]
|-
| style='text-align:right'| 10139
| ''[[:d:Q56186231|Robert Williams]]''
|
| 1842
|
| ''[[:d:Q14508552|Llanllechid]]''
|-
| style='text-align:right'| 10140
| ''[[:d:Q56186247|Thomas Eurwedd Williams]]''
|
|
|
| ''[[:d:Q5208304|Dafen]]''
|-
| style='text-align:right'| 10141
| ''[[:d:Q56186265|Thomas Wiliems]]''
|
| 1545
| 1622
| ''[[:d:Q13125597|Arllechwedd Isaf]]''<br/>''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 10142
| ''[[:d:Q56186282|William Sylvanus Williams]]''
|
| 1829
| 1887
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 10143
| ''[[:d:Q56186351|Owen Williamson]]''
|
| 1840-11-21
| 1910-12-22
| ''[[:d:Q914316|Newborough]]''
|-
| style='text-align:right'| 10144
| ''[[:d:Q56186374|Margaret Wingfield]]''
|
| 1779
| 1835
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 10145
| ''[[:d:Q56186690|William Rhys Jones]]''
|
| 1868
| 1937
| ''[[:d:Q29499819|Bron Ceris]]''
|-
| style='text-align:right'| 10146
| ''[[:d:Q56186692|Myfanwy Williams Parry]]''
|
| 1898
| 1971
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 10147
| ''[[:d:Q56186718|Siân Williams]]''
|
| 1884-08-04
| 1965-06-03
| ''[[:d:Q17320940|Cwmbach]]''
|-
| style='text-align:right'| 10148
| ''[[:d:Q56186735|John Pugh]]''
|
| 1861-02-28
| 1942
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 10149
| ''[[:d:Q56186745|William Griffith]]''
|
| 1843
|
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 10150
| ''[[:d:Q56186754|Tydfor Jones]]''
|
| 1934-09-02
| 1983-06-20
| ''[[:d:Q27056926|Cwmtydu]]''
|-
| style='text-align:right'| 10151
| ''[[:d:Q56186763|Owen Owen]]''
|
| 1786
| 1867-08-21
| ''[[:d:Q3398878|Botwnnog]]''
|-
| style='text-align:right'| 10152
| ''[[:d:Q56186785|Huw Tudor]]''
|
| 1939
|
| ''[[:d:Q3402212|Llanfachreth]]''
|-
| style='text-align:right'| 10153
| ''[[:d:Q56186791|Dai Williams]]''
|
| 1899
| 1971
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 10154
| ''[[:d:Q56186795|John Williams]]''
|
| 1826
| 1898
| [[Aberystwyth]]
|-
| style='text-align:right'| 10155
| ''[[:d:Q56186801|Iorwerth Hughes Jones]]''
|
| 1902-07-20
| 1972
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10156
| ''[[:d:Q56186828|John Buckland Thomas]]''
|
| 1887-05-21
| 1975
| ''[[:d:Q107032535|Fforddygyfraith]]''
|-
| style='text-align:right'| 10157
| ''[[:d:Q56186834|Giraldus Jones]]''
|
| 1895
| 1978
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 10158
| ''[[:d:Q56186848|Rachel Mary Davies]]''
|
| 1911
| 1996
| [[Swansea]]
|-
| style='text-align:right'| 10159
| ''[[:d:Q56186852|Robert Roberts]]''
| [[File:Dr Robert Roberts (Isallt 1839-1914).jpg|center|128px]]
| 1839
| 1914
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 10160
| ''[[:d:Q56186886|Morris Peat]]''
|
| 1813
| 1898-12-18
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 10161
| ''[[:d:Q56186920|Griffith Williams]]''
|
| 1927
| 1977-03-28
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 10162
| ''[[:d:Q56186942|Haydn Jones]]''
|
| 1920-12-07
| 1984-11-07
| [[Pontypridd]]
|-
| style='text-align:right'| 10163
| ''[[:d:Q56186985|Thomas James Davies]]''
|
| 1919-12-12
| 2007-06-30
| ''[[:d:Q6661372|Llanfihangel y Creuddyn]]''
|-
| style='text-align:right'| 10164
| ''[[:d:Q56186987|William Cosslett]]''
|
| 1831
| 1904-09-22
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 10165
| ''[[:d:Q56187014|Islwyn Jones]]''
|
| 1931-02-05
| 2015-04-19
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 10166
| ''[[:d:Q56187067|Elizabeth Elen Roberts]]''
|
|
| 1979-01-31
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 10167
| ''[[:d:Q56187082|Brinley Jenkins]]''
|
| 1926-06-17
| 2001-06-24
| ''[[:d:Q5197219|Cwmavon]]''
|-
| style='text-align:right'| 10168
| ''[[:d:Q56187086|Eric Roberts]]''
|
| 1944
|
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 10169
| ''[[:d:Q56187112|Richard Ellis Williams]]''
|
| 1862
| 1926
| ''[[:d:Q107032857|Pen-y-ffridd]]''
|-
| style='text-align:right'| 10170
| ''[[:d:Q56187113|Thomas Llewellyn Stephens]]''
|
| 1897
| 1959
| ''[[:d:Q7679437|Talgarreg]]''
|-
| style='text-align:right'| 10171
| ''[[:d:Q56187126|Evan John Williams]]''
|
|
| 1993
| ''[[:d:Q15963881|Swyddffynnon]]''
|-
| style='text-align:right'| 10172
| ''[[:d:Q56187127|Ffowc Williams]]''
|
| 1897
| 1995
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 10173
| ''[[:d:Q56187139|Harri Samuel]]''
|
|
| 1985
| ''[[:d:Q8059797|Ystalyfera]]''
|-
| style='text-align:right'| 10174
| ''[[:d:Q56187142|Hugh Roberts]]''
|
| 1832-01-01
| 1907
| ''[[:d:Q3402457|Bryncrug]]''
|-
| style='text-align:right'| 10175
| ''[[:d:Q56187149|Sion Phylip]]''
|
|
| 1961
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 10176
| ''[[:d:Q56187160|Cassie Simon]]''
|
| 1898
| 1989
| ''[[:d:Q6661893|Llanwrda]]''
|-
| style='text-align:right'| 10177
| ''[[:d:Q56187161|Tom Williams]]''
|
| 1899
| 1986-12-21
| ''[[:d:Q13131789|Temple Bar]]''
|-
| style='text-align:right'| 10178
| ''[[:d:Q56187176|David Cynddelw Williams]]''
|
| 1870
| 1942
| [[Aberystwyth]]
|-
| style='text-align:right'| 10179
| ''[[:d:Q56187190|Annie Julian Parry]]''
|
| 1889
| 1972
| ''[[:d:Q3401562|Llanrug]]''
|-
| style='text-align:right'| 10180
| ''[[:d:Q56187197|Dafydd Glyn Hughes]]''
|
| 1921-01-08
|
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 10181
| ''[[:d:Q56187231|David Peate]]''
|
| 1831
| 1896
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 10182
| ''[[:d:Q56187241|Mattie Adele Gwynne Evans]]''
|
| 1908-04-06
| 1994-09-16
| ''[[:d:Q3401786|Gilfach Goch]]''
|-
| style='text-align:right'| 10183
| ''[[:d:Q56187280|Mati Rees]]''
|
| 1902
| 1989
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 10184
| ''[[:d:Q56187291|David Thomas]]''
|
| 1861
| 1933
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 10185
| ''[[:d:Q56187302|William Jones]]''
|
| 1852
| 1914
| ''[[:d:Q3008014|Cwm-twrch]]''
|-
| style='text-align:right'| 10186
| ''[[:d:Q56187325|Robert D. Edwards]]''
|
| 1813
| 1889-01
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 10187
| ''[[:d:Q56187369|Caleb Chivers]]''
|
| 1819
| 1872
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10188
| ''[[:d:Q56187381|John Davies]]''
|
| 1740
| 1821
| ''[[:d:Q6661746|Llansamlet]]''
|-
| style='text-align:right'| 10189
| ''[[:d:Q56187415|Daniel Evans]]''
|
| 1803
| 1858
| ''[[:d:Q4667107|Abergwili]]''
|-
| style='text-align:right'| 10190
| ''[[:d:Q56187420|John Thomas Evans]]''
|
| 1869-08-01
| 1940-05-10
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 10191
| ''[[:d:Q56187424|Joseph Evans]]''
|
| 1801
| 1867
| ''[[:d:Q7837984|Trelech]]''
|-
| style='text-align:right'| 10192
| ''[[:d:Q56187471|Ethel Dora Heins]]''
|
| 1886
| 1933-01-03
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 10193
| ''[[:d:Q56187527|Evan Jones]]''
|
| 1809
| 1855
| ''[[:d:Q7162281|Penbryn]]''
|-
| style='text-align:right'| 10194
| ''[[:d:Q56187543|John Jones]]''
|
| 1782
| 1859-12-20
| ''[[:d:Q29504273|Ty Poeth Cottage]]''
|-
| style='text-align:right'| 10195
| ''[[:d:Q56187572|William Lewes]]''
|
| 1746
| 1828-03-08
| ''[[:d:Q108464343|Llysnewydd]]''
|-
| style='text-align:right'| 10196
| ''[[:d:Q56187576|Henry Isgaer Lewis]]''
|
| 1852
| 1922-05-19
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 10197
| ''[[:d:Q56187626|Job Miles]]''
|
| 1841
| 1914
| ''[[:d:Q25172113|St Brides-super-Ely]]''
|-
| style='text-align:right'| 10198
| ''[[:d:Q56187643|Benjamin Joseph Morse]]''
|
| 1899
| 1977
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 10199
| ''[[:d:Q56187671|Hugh T. Owen]]''
|
| 1837
| 1912
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 10200
| ''[[:d:Q56187675|Robert Owen]]''
|
| 1796
| 1883
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 10201
| ''[[:d:Q56187742|David Roberts]]''
| [[File:Portrait of Dr. David Roberts, 'Dewi Ogwen', of Wrexham (4670497).jpg|center|128px]]
| 1818-04-19
| 1897-09-05
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10202
| ''[[:d:Q56187751|Thomas Gwynedd Roberts]]''
|
| 1840
| 1920
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10203
| ''[[:d:Q56187761|Lewis Christmas, Rev. Simons]]''
|
| 1885-12
| 1974
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10204
| ''[[:d:Q56187789|Richard Tibbott]]''
|
| 1719-01-18
| 1798-03-18
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 10205
| ''[[:d:Q56187818|Elizabeth Phillipps Williams]]''
|
| 1825
| 1872
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10206
| ''[[:d:Q56187928|William Wynn]]''
|
| 1704-07-14
| 1761
| ''[[:d:Q1024935|Harlech]]''
|-
| style='text-align:right'| 10207
| ''[[:d:Q56224169|Earl Godding]]''
|
| 1934-01-06
|
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10208
| ''[[:d:Q56226224|Steve Kenworthy]]''
|
| 1959-11-06
| 2001-06-26
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10209
| ''[[:d:Q56240178|Carlos Uzal]]''
|
| 1971-03-27
|
| [[Newport]]
|-
| style='text-align:right'| 10210
| ''[[:d:Q56243394|Eifion Lloyd Jones]]''
|
| 1948-10-13
|
| ''[[:d:Q13128401|Felinfach]]''
|-
| style='text-align:right'| 10211
| ''[[:d:Q56248345|Billy Waters]]''
|
| 1931-09-19
|
| [[Swansea]]
|-
| style='text-align:right'| 10212
| ''[[:d:Q56248408|Glyn Hughes]]''
|
| 1931-11-29
| 1995-08-19
| ''[[:d:Q5140559|Coedpoeth]]''
|-
| style='text-align:right'| 10213
| ''[[:d:Q56248414|Alan Jones]]''
|
| 1939-09-12
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10214
| ''[[:d:Q56248428|David Jones]]''
|
| 1936-03-05
|
| ''[[:d:Q2304575|Saltney]]''
|-
| style='text-align:right'| 10215
| ''[[:d:Q56248472|Ken Jones]]''
|
| 1937-05-11
|
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 10216
| ''[[:d:Q56248566|George Jones]]''
|
| 1930-07-09
| 2017-06
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10217
| ''[[:d:Q56254074|Geoff Lloyd]]''
|
| 1942-08-18
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10218
| ''[[:d:Q56254201|Steve Morgan]]''
|
| 1970-12-28
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10219
| ''[[:d:Q56254266|Ian Hughes]]''
|
| 1946-03-17
|
| ''[[:d:Q3399883|Cefn Mawr]]''
|-
| style='text-align:right'| 10220
| ''[[:d:Q56254267|Ken Hughes]]''
| [[File:Hughes, Ken.jpg|center|128px]]
| 1966-01-09
|
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 10221
| ''[[:d:Q56254513|Dennis Griffiths]]''
|
| 1935-08-12
| 2005-08-13
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 10222
| ''[[:d:Q56254679|Steve Jones]]''
|
| 1962-11-28
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10223
| ''[[:d:Q56254683|Joe Lloyd]]''
|
| 1910-09-30
| 1996-04-01
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 10224
| ''[[:d:Q56290679|Brandon Cooper]]''
|
| 2000-01-14
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10225
| ''[[:d:Q56291963|Thomas Lloyd]]''
|
| 1709
|
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 10226
| ''[[:d:Q56291966|Peter Maurice]]''
|
|
| 1759-08
| ''[[:d:Q5064823|Cerrigydrudion]]''
|-
| style='text-align:right'| 10227
| ''[[:d:Q56292794|Liam Cullen]]''
|
| 1999-04-23
|
| [[Swansea]]
|-
| style='text-align:right'| 10228
| ''[[:d:Q56299224|Tudur Hallam]]''
|
| 1975
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 10229
| ''[[:d:Q56374089|James Alfred Vanes]]''
|
| 1853
| 1937-01-02
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10230
| ''[[:d:Q56412441|Rico Zulkarnain]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10231
| ''[[:d:Q56416973|Jamie Mathias]]''
| [[File:Bullet for my Valentine - Wacken Open Air 2016-AL2279.jpg|center|128px]]
| 1990-04-10
|
| ''[[:d:Q4667213|Abertysswg]]''
|-
| style='text-align:right'| 10232
| ''[[:d:Q56423618|Clifford Jack Spurgeon]]''
|
| 1934
| 2008
| [[Cairdiff]]
|-
| style='text-align:right'| 10233
| ''[[:d:Q56434529|Richard Winpenny]]''
|
|
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10234
| ''[[:d:Q56448683|Kenneth Bowen]]''
| [[File:Kenneth Bowen (tenor).png|center|128px]]
| 1932-08-03
| 2018-09-01
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10235
| ''[[:d:Q56452474|Kathryn Gray]]''
|
| 1973
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 10236
| ''[[:d:Q56486681|Ryan Sears]]''
|
| 1998-12-30
|
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 10237
| ''[[:d:Q56514940|Ed Holden]]''
| [[File:Mr Phormula yn ystod yr Eisteddfod 2024.jpg|center|128px]]
| 1980s
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10238
| ''[[:d:Q56517052|Alice Bunting]]''
| [[File:Alice Bunting (cropped).jpg|center|128px]]
| 1881
| 1964-10-11
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 10239
| ''[[:d:Q56557885|Elizabeth Jane De La Hoyde]]''
|
| 1854
|
| [[Wales]]
|-
| style='text-align:right'| 10240
| ''[[:d:Q56569685|Benjamin Roose]]''
| [[File:Benjamin Roos, Parys.jpg|center|128px]]
| 1820
| 1879-03-21
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 10241
| ''[[:d:Q56596108|Brownlow Wynne Cumming]]''
| [[File:Wynne Brownlow.jpg|center|128px]]
| 1815-03-23
| 1882
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 10242
| ''[[:d:Q56599693|Eddie Beynon]]''
|
| 1924-11-17
| 2002-02
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10243
| ''[[:d:Q56611801|John Henry Davies]]''
|
| 1850-03-02
| 1893-04-16
| [[St Davids]]
|-
| style='text-align:right'| 10244
| ''[[:d:Q56612499|J. Bryan Jones]]''
|
| 1934
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 10245
| ''[[:d:Q56630953|Connor Davies]]''
| [[File:Connor Davies.jpg|center|128px]]
| 1997-01-17
|
| [[Wales]]
|-
| style='text-align:right'| 10246
| ''[[:d:Q56641621|Rhys Carré]]''
|
| 1998-02-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10247
| ''[[:d:Q56650872|Catherine Lewis]]''
| [[File:Catherine Morgan.jpg|center|128px]]
| 1570
| 1615-09-29
| ''[[:d:Q6723489|Machen]]''
|-
| style='text-align:right'| 10248
| ''[[:d:Q56651111|Catherine Anwyl]]''
| [[File:Catherine Owen, daughter Lewis Anwyl.jpg|center|128px]]
| 1628
| 1685
| [[Wales]]
|-
| style='text-align:right'| 10249
| ''[[:d:Q56651238|Charles Martin Strick Humphreys]]''
| [[File:Charles Martin Strick Humphreys.jpg|center|128px]]
| 1862
| 1934
| ''[[:d:Q5136817|Clydach]]''
|-
| style='text-align:right'| 10250
| ''[[:d:Q56651639|Ebenezer Cooper]]''
| [[File:Ebenezer Cooper, Llangollen.jpg|center|128px]]
| 1800
| 1863-10-24
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 10251
| ''[[:d:Q56663821|Howell Gwynne]]''
|
| 1668
| 1708
| ''[[:d:Q6661068|Llanafan Fawr]]''
|-
| style='text-align:right'| 10252
| ''[[:d:Q56670370|Christopher J. Spiers]]''
|
| 1953-11-27
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10253
| ''[[:d:Q56676566|Mary Eleanor Hamlyn-Williams]]''
| [[File:Lady M.E. Hamlyn Williams & Sir H. Drummond.jpg|center|128px]]
| 1825-07-19
| 1872-08-18
| ''[[:d:Q13131061|Edwinsford]]''
|-
| style='text-align:right'| 10254
| ''[[:d:Q56678161|Liza Burgess]]''
|
| 1964-03-24
|
| [[Newport]]
|-
| style='text-align:right'| 10255
| ''[[:d:Q56685080|Margaret Wynne]]''
| [[File:Margaret Wynne (1722 -).jpg|center|128px]]
| 1722-08-23
| 1761
| ''[[:d:Q17744479|Garthewin]]''
|-
| style='text-align:right'| 10256
| ''[[:d:Q56709363|Nickie Aiken]]''
| [[File:Official portrait of Nickie Aiken MP crop 2.jpg|center|128px]]
| 1969-02-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10257
| ''[[:d:Q56709415|Huw Thomas]]''
|
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10258
| ''[[:d:Q56739671|John Wilson]]''
| [[File:Revd John Wilson.jpg|center|128px]]
| 1682
| 1728
| ''[[:d:Q7837767|Trefeglwys]]''
|-
| style='text-align:right'| 10259
| ''[[:d:Q56752753|Alex Koukouravas]]''
|
| 1998-04-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10260
| ''[[:d:Q56753204|Thomas Williams]]''
| [[File:Thos Williams, JP, Gwaelodygarth 1823-03.jpg|center|128px]]
| 1823-11-11
| 1903
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10261
| ''[[:d:Q56753470|Peter Tate]]''
|
| 1940-04-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10262
| ''[[:d:Q56798470|Gareth Crwys-Williams]]''
|
| 1907-12-27
| 1970-03-08
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 10263
| ''[[:d:Q56809237|Charlie Kelsall]]''
|
| 1921-04-15
| 2019-04-20
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10264
| ''[[:d:Q56811910|Dai James]]''
|
| 1899-11-16
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10265
| ''[[:d:Q56811976|Gib Bellis]]''
|
| 1919-04-21
| 2000-09-01
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 10266
| ''[[:d:Q56849322|James Lawton]]''
|
| 1943-07-28
| 2018-09-27
| [[Flintshire]]
|-
| style='text-align:right'| 10267
| ''[[:d:Q56868055|Greg Fitzgerald]]''
|
| 1960s
|
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10268
| ''[[:d:Q56868240|Isaac Jones]]''
|
| 1835-08
| 1899
| ''[[:d:Q5200191|Cynwyl Gaeo]]''
|-
| style='text-align:right'| 10269
| ''[[:d:Q57053098|Aaron Lewis]]''
|
| 1998-06-26
|
| [[Swansea]]
|-
| style='text-align:right'| 10270
| ''[[:d:Q57059048|Aimee Watson]]''
|
| 2000-08-04
|
| [[Wales]]
|-
| style='text-align:right'| 10271
| ''[[:d:Q57156069|William Bernard Ready]]''
|
| 1914-09-16
| 1981-09-12
| [[Cairdiff]]
|-
| style='text-align:right'| 10272
| ''[[:d:Q57239164|Trevor Peck]]''
|
| 1938-05-25
| 2014-05-14
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10273
| ''[[:d:Q57242836|Jon Morgan]]''
|
| 1970-07-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10274
| ''[[:d:Q57293437|Charles Henry Pugh]]''
|
| 1840-06-06
| 1901-04-09
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 10275
| ''[[:d:Q57313836|Stephen Pugh]]''
|
| 1973-11-27
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10276
| ''[[:d:Q57313938|Nathan Cadette]]''
|
| 1980-01-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10277
| ''[[:d:Q57342401|Dennis Callan]]''
|
| 1932-07-27
| 2006-10
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10278
| ''[[:d:Q57342446|Thomas Eyton-Jones]]''
| [[File:Dr Thomas Eyton-Jones.jpg|center|128px]]
| 1832-03-20
| 1893-02-12
| ''[[:d:Q3399915|Llangar]]''
|-
| style='text-align:right'| 10279
| ''[[:d:Q57395537|Isaak Davies]]''
|
| 2001-09-25
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10280
| ''[[:d:Q57418933|John William Duncan]]''
| [[File:Duncan, John William (1903 cricket first X1 team photo.jpg|center|128px]]
| 1885-10-31
| 1963-04-04
| [[Cairdiff]]
|-
| style='text-align:right'| 10281
| ''[[:d:Q57449691|Benjamin Parry]]''
|
| 1835
| 1910-08-06
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 10282
| ''[[:d:Q57498379|Joseph Williams]]''
|
|
| 1903-07
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 10283
| ''[[:d:Q57515716|Anne Boden]]''
| [[File:Anne-Boden-2.jpg|center|128px]]
| 1960-01
|
| [[Swansea]]
|-
| style='text-align:right'| 10284
| ''[[:d:Q57541918|Robin Williams]]''
|
| 1950
| 2018-10-19
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 10285
| ''[[:d:Q57549384|Ash Dykes]]''
| [[File:Ash Dykes.jpg|center|128px]]
| 1990-11-01
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10286
| ''[[:d:Q57579739|Brian S. Osborne]]''
|
| 1938-10-13
|
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 10287
| ''[[:d:Q57586301|Cai Evans]]''
|
| 1999-06-23
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 10288
| ''[[:d:Q57587669|Tommy Reffell]]''
| [[File:Tommy Reffell 2023.jpg|center|128px]]
| 1999-04-27
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10289
| ''[[:d:Q57603694|Peter Francombe]]''
|
| 1963-08-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10290
| ''[[:d:Q57710838|Hugh Llewelyn]]''
|
|
|
| ''[[:d:Q7457421|Blaendulais]]''
|-
| style='text-align:right'| 10291
| ''[[:d:Q57725826|Ted Gorin]]''
|
| 1924-03-02
| 2013-05-30
| [[Cairdiff]]
|-
| style='text-align:right'| 10292
| ''[[:d:Q57725863|Stan Griffiths]]''
|
| 1911-02-08
| 2003-01-12
| ''[[:d:Q7165282|Pentre]]''
|-
| style='text-align:right'| 10293
| ''[[:d:Q57725868|Wyn Griffiths]]''
|
| 1919-10-17
| 2006-05-29
| ''[[:d:Q4923812|Blaengwynfi]]''
|-
| style='text-align:right'| 10294
| ''[[:d:Q57729457|Noel Phillips]]''
|
| 1883-07-30
| 1961-08-15
| [[Newport]]
|-
| style='text-align:right'| 10295
| ''[[:d:Q57731118|Evan Pughe]]''
|
| 1872
|
| ''[[:d:Q3402312|Llanfachraeth]]''
|-
| style='text-align:right'| 10296
| ''[[:d:Q57741929|Joseph Barclay Jenkins]]''
| [[File:J. Barclay Jenkins (5292158).jpg|center|128px]]
|
|
| ''[[:d:Q5197262|Cwmystwyth]]''
|-
| style='text-align:right'| 10297
| ''[[:d:Q57833991|Matthew Hedges]]''
|
| 1973-04-23
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10298
| ''[[:d:Q57908543|Gillian Turner]]''
|
|
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 10299
| ''[[:d:Q57983939|Leah Dixon]]''
| [[File:2020 Fleche Wallonne Tibco LeahDixon.jpg|center|128px]]
| 1991-08-26
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10300
| ''[[:d:Q58007986|Eddie Dennis]]''
|
| 1986-03-22
|
| [[Swansea]]
|-
| style='text-align:right'| 10301
| ''[[:d:Q58008163|Andy Gorman]]''
|
| 1974-09-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10302
| ''[[:d:Q58010516|Nick Hencher]]''
|
| 1961-08-24
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10303
| ''[[:d:Q58174217|Joe Hillier]]''
|
| 1907-04-10
| 1979
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10304
| ''[[:d:Q58174859|Emlyn John]]''
|
| 1907-03-04
| 1962
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 10305
| ''[[:d:Q58176051|Alec Lucas]]''
|
| 1945-12-01
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10306
| ''[[:d:Q58241482|Wyndraeth Morris-Jones]]''
|
| 1918-08-01
| 1999-09-22
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10307
| ''[[:d:Q58303142|Ian Love]]''
|
| 1958-03-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10308
| ''[[:d:Q58331721|Margaret Roberts]]''
|
| 1833
| 1919
| ''[[:d:Q13129677|Llanynys]]''
|-
| style='text-align:right'| 10309
| ''[[:d:Q58365710|Frank Arthur Morgan]]''
|
| 1844-02-24
| 1907-02-11
| ''[[:d:Q14538499|Llanrhidian]]''
|-
| style='text-align:right'| 10310
| ''[[:d:Q58435926|Sarah Lianne Lewis]]''
|
| 1988
|
| ''[[:d:Q5771888|Hirwaun]]''
|-
| style='text-align:right'| 10311
| ''[[:d:Q58456635|Dave Ridley]]''
|
| 1916-12-16
| 1998-09-13
| [[Pontypridd]]
|-
| style='text-align:right'| 10312
| ''[[:d:Q58483511|George G. Bywater]]''
|
| 1828-11-15<br/>1828-11-22
| 1898-05-16
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 10313
| ''[[:d:Q58494672|Wayne Matthews]]''
|
| 1964-09-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10314
| ''[[:d:Q58494918|Kelly Packwood]]''
|
| 1986-08-10
|
| [[Newport]]
|-
| style='text-align:right'| 10315
| ''[[:d:Q58494927|Kerry Packwood]]''
|
| 1986-08-10
|
| [[Newport]]
|-
| style='text-align:right'| 10316
| ''[[:d:Q58689968|Thomas Salusbury]]''
|
| 1620s<br/>1625
| 1665
| [[Wales]]
|-
| style='text-align:right'| 10317
| ''[[:d:Q58755703|Mark Layton]]''
|
| 1957-10-16
|
| [[Wales]]
|-
| style='text-align:right'| 10318
| ''[[:d:Q58756929|Thelma Rodgers]]''
|
| 1947-12-01
| 2021-10-12
| [[Swansea]]
|-
| style='text-align:right'| 10319
| ''[[:d:Q58815528|Idris Miles]]''
|
| 1908-08-02
| 1983
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10320
| ''[[:d:Q58815533|Ivor Llewellyn Brace]]''
|
| 1898
| 1952-10
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 10321
| ''[[:d:Q58830228|Gwyneth Alva Challis]]''
|
| 1930-01-25
| 2010-11-21
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10322
| ''[[:d:Q58882693|Steffan Alun]]''
|
| 1985
|
| [[Swansea]]
|-
| style='text-align:right'| 10323
| ''[[:d:Q58892217|Thomas Frederick Worrall]]''
| [[File:Worrall 1899.jpg|center|128px]]
| 1872
| 1957
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10324
| ''[[:d:Q58894968|Jim Atherton]]''
|
| 1923-04-02
| 2010-02-01
| ''[[:d:Q2183255|Queensferry]]''
|-
| style='text-align:right'| 10325
| ''[[:d:Q58895039|Griff Norman]]''
|
| 1926-02-20
| 2010-08-06
| [[Cairdiff]]
|-
| style='text-align:right'| 10326
| ''[[:d:Q58895046|Ken Oakley]]''
|
| 1929-05-09
| 2017-03
| ''[[:d:Q3401116|Rhymney]]''
|-
| style='text-align:right'| 10327
| ''[[:d:Q58898759|Esyllt Sears]]''
|
| 1981-03
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10328
| ''[[:d:Q58928487|Tommy Paget]]''
|
| 1909-03-04
| 1960
| [[Cairdiff]]
|-
| style='text-align:right'| 10329
| ''[[:d:Q58973187|Terry Gooding]]''
|
| 1931-04-15
| 2018-10-01
| [[Cairdiff]]
|-
| style='text-align:right'| 10330
| ''[[:d:Q58987694|Christopher Jones]]''
|
| 1909
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10331
| ''[[:d:Q59132436|Harry Parfitt]]''
|
| 1929-09-26
| 2012-10-17
| [[Cairdiff]]
|-
| style='text-align:right'| 10332
| ''[[:d:Q59140084|Dan Thomas]]''
| [[File:Dan Thomas, comediwr.jpg|center|128px]]
| 1980
|
| [[Swansea]]
|-
| style='text-align:right'| 10333
| ''[[:d:Q59179585|Luke Jephcott]]''
|
| 2000-01-26
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10334
| ''[[:d:Q59180819|Tony Pickrell]]''
|
| 1942-11-03
| 2015
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10335
| ''[[:d:Q59202196|Iwan Arwel Griffith]]''
|
| 1988-08-26
|
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 10336
| ''[[:d:Q59205109|Cecil Pritchard]]''
|
| 1902-05-01
| 1966-08-27
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 10337
| ''[[:d:Q59262901|Eleri Morgan]]''
| [[File:Eleri Morgan comedi crop.jpg|center|128px]]
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10338
| ''[[:d:Q59263349|Hywel Pitts]]''
|
|
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10339
| ''[[:d:Q59263556|Sarah Breese]]''
|
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10340
| ''[[:d:Q59268327|Mandy Payne]]''
| [[File:Mandy Payne Artist.jpg|center|128px]]
| 1964
|
| [[Wales]]
|-
| style='text-align:right'| 10341
| ''[[:d:Q59305320|Flora Forster]]''
|
| 1896
| 1981
| [[Swansea]]
|-
| style='text-align:right'| 10342
| ''[[:d:Q59347218|Mary Bevan]]''
| [[File:Mary Bevan.jpg|center|128px]]
|
| 1819-02-03
| ''[[:d:Q13128012|Dyffryn Aeron]]''
|-
| style='text-align:right'| 10343
| ''[[:d:Q59463318|Owen Francis]]''
|
| 1879-06-15
| 1936-04-06
| ''[[:d:Q20598098|Cwm Pennant]]''
|-
| style='text-align:right'| 10344
| ''[[:d:Q59548506|Ken Waters]]''
|
| 1961-10-09
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 10345
| ''[[:d:Q59588469|William Mars-Jones]]''
|
| 1915-09-04
| 1999-01-10
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 10346
| ''[[:d:Q59588707|Len Richards]]''
|
| 1911-04-13
| 1985-12-27
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10347
| ''[[:d:Q59588770|Bernard Ross]]''
|
| 1924-11-08
| 1999-02-20
| [[Swansea]]
|-
| style='text-align:right'| 10348
| ''[[:d:Q59622229|Benjamin Saunders]]''
|
| 1968-11-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10349
| ''[[:d:Q59628016|George Pickard]]''
|
| 1913-07-05
| 2007-05-01
| [[Cairdiff]]
|-
| style='text-align:right'| 10350
| ''[[:d:Q59629779|Arthur Cecil Bining]]''
|
| 1893
| 1957
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 10351
| ''[[:d:Q59655839|Harold Friend]]''
|
| 1909
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10352
| ''[[:d:Q59655851|Jack McJennett]]''
|
| 1906
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10353
| ''[[:d:Q59655868|Harry Perks]]''
|
| 1912
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10354
| ''[[:d:Q59655874|Doug Redwood]]''
|
| 1918
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 10355
| ''[[:d:Q59656121|Medwyn Evans]]''
|
| 1964-11-08
|
| ''[[:d:Q4981044|Brynteg]]''
|-
| style='text-align:right'| 10356
| ''[[:d:Q59656154|Allen Price]]''
|
| 1968-03-24
|
| ''[[:d:Q3401140|Gelligaer]]''
|-
| style='text-align:right'| 10357
| ''[[:d:Q59656412|Len Edwards]]''
|
| 1930-05-30
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10358
| ''[[:d:Q59656415|Steve Mackreth]]''
|
| 1950-07-01
|
| ''[[:d:Q7369807|Rossett]]''
|-
| style='text-align:right'| 10359
| ''[[:d:Q60050765|Terry Parsons]]''
|
| 1935-06-19
| 1999-05-08
| ''[[:d:Q7836589|Trealaw]]''
|-
| style='text-align:right'| 10360
| ''[[:d:Q60194679|Callum Sheedy]]''
| [[File:Callum Sheedy LQ 2023.jpg|center|128px]]
| 1995-10-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10361
| ''[[:d:Q60198015|David Gwynne-James]]''
|
| 1937-06-12
| 2012-11-11
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 10362
| ''[[:d:Q60429542|Olivia Frances Tonge]]''
|
| 1858-11-11
| 1949
| ''[[:d:Q62029921|Gwenfain]]''
|-
| style='text-align:right'| 10363
| ''[[:d:Q60429570|Eric Richards]]''
|
| 1940-08-03
| 2018-09-21
| ''[[:d:Q5884520|Holt]]''
|-
| style='text-align:right'| 10364
| ''[[:d:Q60544850|Albert L. Harris]]''
|
| 1869
|
| ''[[:d:Q3398874|Abergynolwyn]]''
|-
| style='text-align:right'| 10365
| ''[[:d:Q60581700|Megan Barker]]''
| [[File:2024 UEC Track Elite European Championships 083 (cropped).jpg|center|128px]]
| 1997-08-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10366
| ''[[:d:Q60589082|Mab Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10367
| ''[[:d:Q60632790|Thyrza Anne Leyshon]]''
|
| 1892-03-07
| 1996
| [[Swansea]]
|-
| style='text-align:right'| 10368
| ''[[:d:Q60658323|Delyth Jewell]]''
| [[File:Delyth Jewell (cropped).jpg|center|128px]]
| 1987
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 10369
| ''[[:d:Q60663044|Len Hewitt]]''
|
| 1920-03-20
| 1979-05-24
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10370
| ''[[:d:Q60684771|Dave Griffiths]]''
|
| 1963-11-26
| 2007-03-02
| [[Cairdiff]]
|-
| style='text-align:right'| 10371
| ''[[:d:Q60684870|Bryn Davies]]''
|
| 1917<br/>1917-12-17
| 1990
| [[Cairdiff]]
|-
| style='text-align:right'| 10372
| ''[[:d:Q60685583|Vince Jones]]''
|
| 1900<br/>1900-03-04
| 1950
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10373
| ''[[:d:Q60685958|Maurice O'Sullivan]]''
|
| 1952-12-04
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10374
| ''[[:d:Q60685999|Billy Morris]]''
|
| 1920<br/>1920-09-28
| 1994
| [[Swansea]]
|-
| style='text-align:right'| 10375
| ''[[:d:Q60686009|Jerry Murphy]]''
|
| 1907<br/>1907-03-16
| 1992
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 10376
| ''[[:d:Q60686073|Cecil Price]]''
|
| 1919<br/>1919-12-02
| 2008
| [[Cairdiff]]
|-
| style='text-align:right'| 10377
| ''[[:d:Q60686093|Percy Richards]]''
|
| 1906
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10378
| ''[[:d:Q60693753|Rees Thomas]]''
|
| 1934-03-01
| 2017-11-06
| ''[[:d:Q7165426|Penywaun]]''
|-
| style='text-align:right'| 10379
| ''[[:d:Q60693826|Dave Campbell]]''
|
| 1947-02-18
| 2013-12-07
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10380
| ''[[:d:Q60694076|Billy Lewis]]''
|
| 1923-07-04
| 2013-07-27
| [[Cairdiff]]
|-
| style='text-align:right'| 10381
| ''[[:d:Q60694079|Ray Williams]]''
|
| 1931-05-01
| 2015
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10382
| ''[[:d:Q60694141|Ted Morris]]''
|
| 1921-05-06
| 2000-03
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 10383
| ''[[:d:Q60733888|Peter Bishop]]''
| [[File:MOMA exhibition.jpg|center|128px]]
| 1953-05-21
| 2022
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 10384
| ''[[:d:Q60733920|Andy Edwards]]''
|
| 1965-03-28
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10385
| ''[[:d:Q60733948|Dan Davis]]''
|
| 1998-09-17
|
| [[Wales]]
|-
| style='text-align:right'| 10386
| ''[[:d:Q60733994|Ben Williams]]''
|
| 1999-03-31
|
| [[Wales]]
|-
| style='text-align:right'| 10387
| ''[[:d:Q60734014|Sion Jones]]''
| [[File:Sion Jones.jpg|center|128px]]
| 1997-12-16
|
| [[Wales]]
|-
| style='text-align:right'| 10388
| ''[[:d:Q60734062|Luke Morgan]]''
|
| 1992-05-16
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10389
| ''[[:d:Q60734191|Curtis Davies]]''
| [[File:Curtis Davies.jpg|center|128px]]
| 1997-01-17
|
| [[Wales]]
|-
| style='text-align:right'| 10390
| ''[[:d:Q60734266|Scott Williams]]''
|
| 1974-08-07
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10391
| ''[[:d:Q60734311|Allan Lewis]]''
|
| 1971-05-31
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10392
| ''[[:d:Q60734320|John Smith]]''
|
| 1944-09-13
|
| ''[[:d:Q6268758|Johnstown]]''
|-
| style='text-align:right'| 10393
| ''[[:d:Q60734360|Harri Morgan]]''
|
| 2000-03-16
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10394
| ''[[:d:Q60734441|John Davies]]''
|
| 1959-11-18
|
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 10395
| ''[[:d:Q60734448|Kevin Jones]]''
|
| 1974-02-16
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10396
| ''[[:d:Q60734511|Joe Adams]]''
|
| 2001-02-13
|
| [[Wales]]
|-
| style='text-align:right'| 10397
| ''[[:d:Q60734513|Martin Goldsmith]]''
|
| 1962-05-25
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10398
| ''[[:d:Q60734569|Alan Jones]]''
|
| 1944-01-13
|
| ''[[:d:Q2483466|Caergwrle]]''
|-
| style='text-align:right'| 10399
| ''[[:d:Q60734690|Mike Keen]]''
|
| 1953-02-12
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10400
| ''[[:d:Q60734744|Chris Ingram]]''
|
| 1976-12-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10401
| ''[[:d:Q60734943|Danny McCarthy]]''
|
| 1942-09-26
| 2019-07
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 10402
| ''[[:d:Q60735001|Brad Evans]]''
|
| 1974
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 10403
| ''[[:d:Q60735037|Peter Morgan]]''
|
| 1951-10-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10404
| ''[[:d:Q60735114|Steve Scott]]''
|
| 1966-11-05
|
| ''[[:d:Q6268758|Johnstown]]''
|-
| style='text-align:right'| 10405
| ''[[:d:Q60735120|Neil Robinson]]''
|
|
|
| ''[[:d:Q3216519|Laleston]]''
|-
| style='text-align:right'| 10406
| ''[[:d:Q60735575|Steve Bray]]''
| [[File:Steve Bray, Stop Brexit Man (48794896706).jpg|center|128px]]
| 1969
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10407
| ''[[:d:Q60735660|Jon Roberts]]''
|
| 1968-12-30
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10408
| ''[[:d:Q60735930|Will Griffiths]]''
|
| 1998-12-25
|
| [[Wales]]
|-
| style='text-align:right'| 10409
| ''[[:d:Q60736661|Dai Evans]]''
|
| 1934-06-19
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 10410
| ''[[:d:Q60744121|Roger Ashton]]''
|
| 1921<br/>1921-08-16
| 1985-07
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 10411
| ''[[:d:Q60746170|William Morgan]]''
|
| 1862
| 1914-10-22
| ''[[:d:Q13130355|Nantgarw]]''
|-
| style='text-align:right'| 10412
| ''[[:d:Q60750706|Charlie Hill]]''
|
| 1918-09-06
| 1998-12-22
| [[Cairdiff]]
|-
| style='text-align:right'| 10413
| ''[[:d:Q60752582|Lyn Thomas]]''
|
| 1920-09-19
| 1993-04-21
| [[Swansea]]
|-
| style='text-align:right'| 10414
| ''[[:d:Q60761614|William John Philpin Jones]]''
|
| 1913-08-17
| 1992-06-28
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 10415
| ''[[:d:Q60763309|Lew Bowen]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 10416
| ''[[:d:Q60764058|Harold Jenkins]]''
|
| 1902
| 1981
| [[Newport]]
|-
| style='text-align:right'| 10417
| ''[[:d:Q60764297|Edward Phillips]]''
|
| 1883-01-18
| 1915-05-08
| [[Newport]]
|-
| style='text-align:right'| 10418
| ''[[:d:Q60791067|Fred Castle]]''
|
| 1902<br/>1902-04-10
|
| [[Penygraig]]
|-
| style='text-align:right'| 10419
| ''[[:d:Q60791136|Albert Evans]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10420
| ''[[:d:Q60791390|Ernest Lewis]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10421
| ''[[:d:Q60791526|Albert Miles]]''
|
| 1903
|
| ''[[:d:Q302872|Treorchy]]''
|-
| style='text-align:right'| 10422
| ''[[:d:Q60791589|Eric Morris]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10423
| ''[[:d:Q60842075|Grace Roberts]]''
|
| 1843
| 1899-11-01
| [[Wales]]
|-
| style='text-align:right'| 10424
| ''[[:d:Q60959205|Paul Lamford]]''
|
| 1953-08-30
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10425
| ''[[:d:Q61014919|James Wharton]]''
|
| 1987-01-01
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10426
| ''[[:d:Q61107392|Gary Lloyd]]''
|
| 1972-03-26
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10427
| ''[[:d:Q61107438|Owen Evans]]''
|
| 1968-11
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10428
| ''[[:d:Q61107823|Santes Marchell o Dalgarth]]''
| [[File:Tal Garth, Garth Madrun.jpg|center|128px]]
| 375
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 10429
| ''[[:d:Q61107833|Lleucu]]''
|
| 5th century
|
| ''[[:d:Q6661551|Llangwyryfon]]''
|-
| style='text-align:right'| 10430
| ''[[:d:Q61107844|Anhun de Gwrthyfer]]''
|
|
|
| [[Ceredigion]]
|-
| style='text-align:right'| 10431
| ''[[:d:Q61107860|Andrew Thomas]]''
|
| 1967-02-01
| 2020-07-28
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 10432
| ''[[:d:Q61107892|O. M. Lloyd]]''
|
| 1910-02-14
| 1980-02-01
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 10433
| ''[[:d:Q61107961|Betsan Moses]]''
|
| 1971-11
|
| ''[[:d:Q7228397|Pontyberem]]''
|-
| style='text-align:right'| 10434
| ''[[:d:Q61107977|Guto Roberts]]''
|
| 1925-03-13
| 1999-03-06
| ''[[:d:Q29483949|Isallt-fawr]]''
|-
| style='text-align:right'| 10435
| ''[[:d:Q61119025|Alison Griffiths]]''
|
| 1963-08-04
|
| [[Wales]]
|-
| style='text-align:right'| 10436
| ''[[:d:Q61122449|Henry Baird]]''
|
| 1878-04-13
| 1950-02-22
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 10437
| ''[[:d:Q61341106|Joseph Herbert Morcom]]''
|
| 1871-05-31
| 1942-02-28
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10438
| ''[[:d:Q61450736|James Botham]]''
|
| 1998-02-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10439
| ''[[:d:Q61473813|John David Spillane]]''
|
| 1909
| 1985
| [[Cairdiff]]
|-
| style='text-align:right'| 10440
| ''[[:d:Q61595023|Haydn Jones]]''
|
| 1946-05-08
| 2010-08-31
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 10441
| ''[[:d:Q61607699|Morgan Nicholas]]''
|
| 1895-06-04
| 1963-08-12
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10442
| ''[[:d:Q61675797|Liv Hill]]''
|
| 2000
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 10443
| ''[[:d:Q61697219|Helena Jones]]''
|
| 1870-07-14
| 1946-09-04
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 10444
| ''[[:d:Q61698489|Denys Jones]]''
|
| 1930
| 2003
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10445
| ''[[:d:Q61707036|Alys Williams]]''
| [[File:Alys Williams (cantores; Welsh singer) 01.jpg|center|128px]]
| 1987
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10446
| ''[[:d:Q61731675|Kylie Nolan]]''
|
| 1998-06-27
|
| [[Wales]]
|-
| style='text-align:right'| 10447
| ''[[:d:Q61739647|Ian Sutherland]]''
|
| 1935
| 1999
| ''[[:d:Q4879473|Bedwellty]]''
|-
| style='text-align:right'| 10448
| ''[[:d:Q61742592|Joe Price]]''
|
| 1928-09-20
| 1992-10-30
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 10449
| ''[[:d:Q61780191|Cassia Pike]]''
|
| 2000-12-27
|
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 10450
| ''[[:d:Q61781833|David B. Barrett]]''
|
| 1927-08-30
| 2011-08-04
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 10451
| ''[[:d:Q61828492|Josh Reynolds]]''
|
| 1998-12-01
|
| [[Newport]]
|-
| style='text-align:right'| 10452
| ''[[:d:Q61828617|Will Kelly]]''
|
| 1997-08-05
|
| [[Wales]]
|-
| style='text-align:right'| 10453
| ''[[:d:Q61828912|Benjamin Fry]]''
| [[File:Benjamin Fry 2021.jpg|center|128px]]
| 1998-09-26
|
| [[Wales]]
|-
| style='text-align:right'| 10454
| ''[[:d:Q61842520|Llewellyn Morgan]]''
|
| 1909<br/>1905-03-07
| 1979
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10455
| ''[[:d:Q61855944|William Dickinson]]''
|
| 1889-11-02
| 1948-11-24
| [[Swansea]]
|-
| style='text-align:right'| 10456
| ''[[:d:Q61857237|Jimmy Jones]]''
|
| 1919
| 1976
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 10457
| ''[[:d:Q61868466|Ruth Price]]''
|
| 1924
| 2019-02-23
| ''[[:d:Q6787320|Mathry]]''
|-
| style='text-align:right'| 10458
| ''[[:d:Q61882790|Herbert Jones]]''
|
| 1929-01-20
| 2020-04-16
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 10459
| ''[[:d:Q61964521|Denis John Williams]]''
|
| 1908
| 1990
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10460
| ''[[:d:Q61983407|Owain Wyn Evans]]''
| [[File:Owain Wyn Evans.jpg|center|128px]]
| 1984-03-09
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 10461
| ''[[:d:Q62006906|Selwyn Pemberton]]''
|
| 1928-10-13
| 2005-05
| [[Cairdiff]]
|-
| style='text-align:right'| 10462
| ''[[:d:Q62024163|Dennis Lambourne]]''
|
| 1945-10-07
|
| [[Swansea]]
|-
| style='text-align:right'| 10463
| ''[[:d:Q62084118|Irving Davies]]''
|
| 1926
| 2002
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10464
| ''[[:d:Q62102936|Pryce Hughes]]''
|
| 1687
| 1715
| ''[[:d:Q13129655|Llanllugan]]''
|-
| style='text-align:right'| 10465
| ''[[:d:Q62198596|Daniel Sumner]]''
|
|
|
| ''[[:d:Q3402312|Llanfachraeth]]''
|-
| style='text-align:right'| 10466
| ''[[:d:Q62359670|David Edwards]]''
|
| 1925-12-14
| 2001-03-04
| ''[[:d:Q1002793|Llangollen]]''
|-
| style='text-align:right'| 10467
| ''[[:d:Q62388891|Roger Mostyn]]''
|
| 1953-08-31
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10468
| ''[[:d:Q62468253|Samuel Bevan]]''
|
| 1816
| No/unknown value
| [[Swansea]]
|-
| style='text-align:right'| 10469
| ''[[:d:Q62513133|Andy Evans]]''
|
|
|
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 10470
| ''[[:d:Q62513940|Alana Spencer]]''
|
| 1992-02-11
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10471
| ''[[:d:Q62514794|Dorothea Eliza Smith]]''
| [[File:Fruits of the Lima Market Folding Watercolor.jpg|center|128px]]
| 1804-01-29
| 1864-11-06
| [[Llanfwrog, Denbighshire|Llanfwrog]]
|-
| style='text-align:right'| 10472
| ''[[:d:Q62567115|Reg Turnell]]''
|
|
| 1917-11-23
| [[Aberystwyth]]
|-
| style='text-align:right'| 10473
| ''[[:d:Q62588463|Stan Weaver]]''
|
| 1890
| 1973
| [[Swansea]]
|-
| style='text-align:right'| 10474
| ''[[:d:Q62648180|David Roberts]]''
|
| 1820-06-16
| 1872-05-26
| ''[[:d:Q3398858|Talybont]]''
|-
| style='text-align:right'| 10475
| ''[[:d:Q62655912|Harry Hollis]]''
|
| 1913-12-12
| 1982-08-18
| ''[[:d:Q3405926|Deeside]]''
|-
| style='text-align:right'| 10476
| ''[[:d:Q62689812|Donald Webley]]''
|
| 1916
| 1990
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10477
| ''[[:d:Q62764975|Ruth Jones]]''
| [[File:Official portrait of Ruth Jones MP crop 2, 2024.jpg|center|128px]]
| 1962-04
|
| [[Newport]]
|-
| style='text-align:right'| 10478
| ''[[:d:Q62768570|Arthur Smith]]''
|
|
|
| ''[[:d:Q6757051|Marchwiel]]''
|-
| style='text-align:right'| 10479
| ''[[:d:Q62769837|Chris Summers]]''
|
| 1972-01-06
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10480
| ''[[:d:Q62847549|Mal Rees]]''
|
| 1924<br/>1924-04-21
| 2003
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10481
| ''[[:d:Q62857954|David Lambert]]''
|
| 1939-07-07
| 2016
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 10482
| ''[[:d:Q62858588|Dick Williams]]''
|
| 1898
|
| [[Wales]]
|-
| style='text-align:right'| 10483
| ''[[:d:Q62923789|Margarette "Peggy" Golding]]''
|
| 1881-11
| 1939
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 10484
| ''[[:d:Q63036264|David Arthur Davies]]''
|
| 1913-11-11
| 1990-11-13
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10485
| ''[[:d:Q63041675|Howell Moore-Gwyn]]''
|
| 1886-07-07
| 1956-07-31
| ''[[:d:Q5318606|Dyffryn Clydach]]''
|-
| style='text-align:right'| 10486
| ''[[:d:Q63160970|Alfred Ernest Owen]]''
|
| 1869
| 1929
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10487
| ''[[:d:Q63165862|Paul Karabardak]]''
|
| 1985-10-03
|
| [[Swansea]]
|-
| style='text-align:right'| 10488
| ''[[:d:Q63184794|Shellyann Evans]]''
| [[File:Shellyann Evans - 53369865382.jpg|center|128px]]
|
|
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 10489
| ''[[:d:Q63228559|Lilian Nicholas]]''
|
| 1909
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 10490
| ''[[:d:Q63242185|Hugh Eyton-Jones]]''
| [[File:Hugh Mortimer Eyton-Jones.jpg|center|128px]]
| 1863
| 1943
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10491
| ''[[:d:Q63248308|Geraint Evans]]''
|
|
|
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 10492
| ''[[:d:Q63313185|Edwin Rees]]''
|
| 1899
|
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 10493
| ''[[:d:Q63341276|Graham Jones]]''
|
| 1949-09-16
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10494
| ''[[:d:Q63341983|Nancie Colling]]''
|
| 1919
| 2020-07-01
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 10495
| ''[[:d:Q63376732|Graham J. Durant]]''
|
| 1934-03-14
| 2009-03-11
| [[Newport]]
|-
| style='text-align:right'| 10496
| ''[[:d:Q63384576|Agnes Charlotte Gude]]''
| [[File:Konfirmasjonsbilde av Agnes Gude - Theodor Schuhmann & Sohn - Gudesamlingen - Norsk Folkemuseum - NF.27080-051.jpg|center|128px]]
| 1863-02-01
| 1929-07-11
| ''[[:d:Q203387|Betws-y-Coed]]''
|-
| style='text-align:right'| 10497
| ''[[:d:Q63391841|Eric Styles]]''
|
| 1967
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10498
| ''[[:d:Q63432097|Prano Bailey-Bond]]''
| [[File:Prano Bailey-Bond 2022.jpg|center|128px]]
| 1982
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10499
| ''[[:d:Q63614875|Jaime Gareth Flórez Barreales]]''
|
| 1969
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 10500
| ''[[:d:Q63699006|Macauley Southam-Hales]]''
| [[File:Southam, Macauley.jpg|center|128px]]
| 1996-02-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10501
| ''[[:d:Q63699954|Stuart Webber]]''
|
| 1984-04-15
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10502
| ''[[:d:Q63827261|Mari Griffith]]''
|
| 1940
| 2019-05-13
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 10503
| ''[[:d:Q63869654|Allan Watson]]''
|
| 1944-11-05
|
| ''[[:d:Q880986|Coed-duon]]''
|-
| style='text-align:right'| 10504
| ''[[:d:Q63871177|Mably Owen]]''
|
| 1912-03-17
| 1969-06-26
| ''[[:d:Q13635744|Heath]]''
|-
| style='text-align:right'| 10505
| ''[[:d:Q63874313|Ray Lawrence]]''
|
| 1944
|
| ''[[:d:Q5197235|Cwmcarn]]''
|-
| style='text-align:right'| 10506
| ''[[:d:Q63929463|Fay Jones]]''
| [[File:Official portrait of Fay Jones MP crop 2.jpg|center|128px]]
| 1985-01-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10507
| ''[[:d:Q63953173|Seirian Sumner]]''
|
| 1974-05-03
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10508
| ''[[:d:Q63993767|Dewi Griffiths]]''
|
| 1991-08-09
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10509
| ''[[:d:Q64005542|Kate Williams Evans]]''
| [[File:Kate Williams Evans c1890.jpg|center|128px]]
| 1866-10-01
| 1961-02-02
| [[Llansantffraid-ym-Mechain]]
|-
| style='text-align:right'| 10510
| ''[[:d:Q64006439|Ronald Niebour]]''
|
| 1903-04-04
| 1972-07-19
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10511
| ''[[:d:Q64009025|Felicity Dahl]]''
|
| 1938-12-12
|
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 10512
| ''[[:d:Q64009303|Roman Walker]]''
|
| 2000-08-06
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10513
| ''[[:d:Q64010406|Tom Booth-Amos]]''
| [[File:Tom Booth Amos 2019.jpg|center|128px]]
| 1996-03-12
|
| [[Newport]]
|-
| style='text-align:right'| 10514
| ''[[:d:Q64214523|Ella Powell]]''
| [[File:Ella Powell Lewes FC Women v Charlton Ath Women 16 08 20 pre-season-75 (50234968972) (cropped).jpg|center|128px]]
| 2000-02-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10515
| ''[[:d:Q64358828|Alan Reynolds]]''
|
| 1960-10-26
|
| ''[[:d:Q7008960|New Inn]]''
|-
| style='text-align:right'| 10516
| ''[[:d:Q64374426|Jimmy Ithell]]''
|
| 1959-12-10
| 1986-01-03
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10517
| ''[[:d:Q64414789|Ruth King]]''
|
|
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10518
| ''[[:d:Q64485247|William Davies]]''
|
| 1820s
| 1900
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10519
| ''[[:d:Q64624167|Ray Williams]]''
|
| 1951
| 2016-08
| ''[[:d:Q3401157|Bedwas]]''
|-
| style='text-align:right'| 10520
| ''[[:d:Q64685172|Sîan Reynolds]]''
|
| 1940
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10521
| ''[[:d:Q64685572|Josephine Campbell]]''
|
| 1860
| 1921
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10522
| ''[[:d:Q64685648|Naunton Wingfield Davies]]''
|
| 1851
| 1925
| [[Newport]]
|-
| style='text-align:right'| 10523
| ''[[:d:Q64685707|Clotworthy Gillmor]]''
|
| 1818
| 1886
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10524
| ''[[:d:Q64685864|Caroline Phillipson]]''
| [[File:Caroline-Gifford-Phillipson-ne-Lethbridge-Mrs-CG-Phillipson (cropped).jpg|center|128px]]
| 1823
| 1893
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 10525
| ''[[:d:Q64685882|Daisy Hugh Pryce]]''
|
| 1862
| 1921
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 10526
| ''[[:d:Q64685883|Gwendolen Pryce]]''
|
| 1868
| 1934
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 10527
| ''[[:d:Q64685888|Catherine Randolph]]''
|
| 1839
| 1884
| ''[[:d:Q3395336|Gwrych Castle]]''
|-
| style='text-align:right'| 10528
| ''[[:d:Q64685923|Henry Sturkey]]''
|
| 1824
| 1875
| ''[[:d:Q7837893|Tregynon]]''
|-
| style='text-align:right'| 10529
| ''[[:d:Q64685943|John Montmorency Tucker]]''
|
| 1780
| 1852
| [[Swansea]]
|-
| style='text-align:right'| 10530
| ''[[:d:Q64705104|Ifan Prys Edwards]]''
|
| 1942-01-11
| 2020-03-16
| [[Aberystwyth]]
|-
| style='text-align:right'| 10531
| ''[[:d:Q64736714|Ben Cambriani]]''
|
| 1999-12-24
|
| [[Wales]]
|-
| style='text-align:right'| 10532
| ''[[:d:Q64738481|Cairn Newton-Evans]]''
| [[File:Citizenship cairn newton evans-cropped 3.jpg|center|128px]]
| 1991-04-06
|
| [[Swansea]]
|-
| style='text-align:right'| 10533
| ''[[:d:Q64747491|Tomi Lewis]]''
|
| 1999
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 10534
| ''[[:d:Q64748740|Annabel Jones]]''
|
|
|
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 10535
| ''[[:d:Q64795912|George W. Harris]]''
| [[File:George William Harris (1872-1964) in 1918.png|center|128px]]
| 1872-06-12<br/>1871-07-01
| 1964-07-18<br/>1964-07-28
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 10536
| ''[[:d:Q64814802|Barbara M. Middlehurst]]''
|
| 1915-09-15
| 1995-03-06
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 10537
| ''[[:d:Q64853341|Shaun Chapple]]''
|
| 1973-02-14
|
| [[Swansea]]
|-
| style='text-align:right'| 10538
| ''[[:d:Q64876104|Percy James]]''
|
| 1917
| 1993-06
| ''[[:d:Q1859627|Rhondda]]''
|-
| style='text-align:right'| 10539
| ''[[:d:Q64919712|George Brooke]]''
|
| 1913
| 1993
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 10540
| ''[[:d:Q64986130|Chris Reynolds]]''
|
| 1960-07-16
| 2023-05-04
| [[Wales]]
|-
| style='text-align:right'| 10541
| ''[[:d:Q64995849|Alice Griffiths]]''
| [[File:Alice Griffiths Lewes FC Women v Charlton Ath Women 16 08 20 pre-season-137 (50234760281).jpg|center|128px]]
| 2001-01-22
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10542
| ''[[:d:Q65029330|Tom Rogers]]''
|
| 1998-12-17
|
| [[Wales]]
|-
| style='text-align:right'| 10543
| ''[[:d:Q65030266|Joseph Lewis]]''
|
| 1992-07-26
|
| [[Newport]]
|-
| style='text-align:right'| 10544
| ''[[:d:Q65030475|David Rees]]''
|
| 1940-12-29
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 10545
| ''[[:d:Q65030489|Peter Williams]]''
|
| 1960-05-17
|
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10546
| ''[[:d:Q65030620|Jack Fairweather]]''
|
| 1978
|
| [[Wales]]
|-
| style='text-align:right'| 10547
| ''[[:d:Q65031279|Keith Matthews]]''
|
| 1934-03-07
| 2008
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10548
| ''[[:d:Q65041352|Robert Stanley]]''
| [[File:Final 1mb Robert for book mayor.jpg|center|128px]]
| 1828
| 1828
| [[Cairdiff]]
|-
| style='text-align:right'| 10549
| ''[[:d:Q65044903|Charles Jones]]''
|
| 1893
| 1960-01-19
| [[Cairdiff]]
|-
| style='text-align:right'| 10550
| ''[[:d:Q65058631|Richard Davies]]''
|
| 1862
| 1938-02
| [[Sooth Wales]]
|-
| style='text-align:right'| 10551
| ''[[:d:Q65062011|Harry Davies]]''
|
| 1888
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10552
| ''[[:d:Q65073530|Joe Jones]]''
|
| 1995
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10553
| ''[[:d:Q65122752|William Ingram]]''
|
| 1930
| 2013-01-29
| ''[[:d:Q7315716|Resolfen]]''
|-
| style='text-align:right'| 10554
| ''[[:d:Q65178482|Joris Collier]]''
|
| 1951
|
| [[Wales]]
|-
| style='text-align:right'| 10555
| ''[[:d:Q65295002|Tim Morgan]]''
|
| 1949
| 2019
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10556
| ''[[:d:Q65297132|John Peter (Ioan Pedr)]]''
| [[File:Portrait of Ioan Pedr (4670577).jpg|center|128px]]
| 1833-04-10
| 1877-01-17
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 10557
| ''[[:d:Q65367867|Alice Evans]]''
| [[File:20150922 1656 W AUT WAL 3083.jpg|center|128px]]
| 1994
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10558
| ''[[:d:Q65517696|Gwilym Owen]]''
|
| 1931
| 2019-07
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 10559
| ''[[:d:Q65550443|James Crisp]]''
|
| 1927-11-15
| 2005-12-04
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 10560
| ''[[:d:Q65551884|Peter Turnbull]]''
|
| 1989-05-20
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10561
| ''[[:d:Q65555292|Emma Jenkins]]''
|
| 1993
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10562
| ''[[:d:Q65557110|Edgar Watkins]]''
|
| 1887-05-12
| 1960
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 10563
| ''[[:d:Q65593860|Stanley Leigh]]''
|
| 1901-12-27
| 1986
| [[Swansea]]
|-
| style='text-align:right'| 10564
| ''[[:d:Q65624959|Ian Roberts]]''
|
| 1961<br/>1961-02-28
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 10565
| ''[[:d:Q65642051|Ernest Leigh]]''
|
| 1895
| 1960
| [[Swansea]]
|-
| style='text-align:right'| 10566
| ''[[:d:Q65665802|Rhian Nokes]]''
|
| 1989-02-13
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10567
| ''[[:d:Q65705995|Jackie Pottinger]]''
|
| 1913
| 1979
| [[Cairdiff]]
|-
| style='text-align:right'| 10568
| ''[[:d:Q65735824|Ivor Vice]]''
|
| 1929-07-23
| 2005-09-22
| [[Swansea]]
|-
| style='text-align:right'| 10569
| ''[[:d:Q65735847|Glyn Hopkins]]''
|
| 1928-10-01
| 2023-11-23
| [[Pontypridd]]
|-
| style='text-align:right'| 10570
| ''[[:d:Q65745228|Percy May]]''
|
| 1927-10-06
| 1977-10-16
| [[Swansea]]
|-
| style='text-align:right'| 10571
| ''[[:d:Q65786419|Cissy Davies]]''
|
| 1932-12-01
| 2005-10-04
| [[Swansea]]
|-
| style='text-align:right'| 10572
| ''[[:d:Q65786800|Pat Evans]]''
|
| 1926
| 2020-01-19
| [[Swansea]]
|-
| style='text-align:right'| 10573
| ''[[:d:Q65923146|Charles H. Williams]]''
|
| 1822
| No/unknown value
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 10574
| ''[[:d:Q65929278|Lew Evans]]''
|
| 1919
| 2017-09-27
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 10575
| ''[[:d:Q65929299|Joseph Barnett]]''
|
| 1920-11-03
| 1999-05
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10576
| ''[[:d:Q65946181|Valerie Mullins]]''
|
| 1935-01-17
|
| [[Swansea]]
|-
| style='text-align:right'| 10577
| ''[[:d:Q65946185|Margaret Thomas-Neale]]''
|
| 1931-08-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10578
| ''[[:d:Q65946188|Gwynedd Lewis-Lingard]]''
|
| 1934-12-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10579
| ''[[:d:Q65948591|Agnes Davies]]''
|
| 1920-09-30
| 2011-02-13
| ''[[:d:Q13131207|Saron]]''
|-
| style='text-align:right'| 10580
| ''[[:d:Q65969957|John Mulhall]]''
|
| 1938-08-18
| 2022-08-06
| [[Cairdiff]]
|-
| style='text-align:right'| 10581
| ''[[:d:Q66023017|Dorothy Summers]]''
|
| 1941-09-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10582
| ''[[:d:Q66023521|Pat Perks]]''
|
| 1940-05-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10583
| ''[[:d:Q66049720|Jo Price]]''
| [[File:20150922 1656 W AUT WAL 3084.jpg|center|128px]]
| 1985-06-07
|
| [[St Davids]]
|-
| style='text-align:right'| 10584
| ''[[:d:Q66105403|Elizabeth Baines]]''
|
| 1947-06-18
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10585
| ''[[:d:Q66124299|Edith Parnell]]''
|
| 1913
| 1938-11-13
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 10586
| ''[[:d:Q66125144|Ossie Evans]]''
|
| 1916-09-02
| 1986
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10587
| ''[[:d:Q66133297|Agnes Twiston Hughes]]''
|
| 1895-09-28
| 1981-10-20
| [[Wales]]
|-
| style='text-align:right'| 10588
| ''[[:d:Q66147583|Guto Dafydd]]''
|
| 1990-03-14
|
| [[Gwynedd]]
|-
| style='text-align:right'| 10589
| ''[[:d:Q66198004|Graham Bent]]''
|
| 1945-10-06
| 2002-05-15
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 10590
| ''[[:d:Q66241174|Stavros Ambizas]]''
|
| 1936
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10591
| ''[[:d:Q66289592|Edward Battiscombe]]''
|
| 1874-07-23
| 1970-02-16
| ''[[:d:Q5566706|Glasbury]]''
|-
| style='text-align:right'| 10592
| ''[[:d:Q66295328|Pamela Hopkins]]''
|
| 1953-09-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10593
| ''[[:d:Q66305732|Ron Wynn]]''
|
| 1923-11-02
| 1983-10-08
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10594
| ''[[:d:Q66309772|Patrick Killian]]''
| [[File:Patrick Killian.jpg|center|128px]]
| 1974-10-26
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 10595
| ''[[:d:Q66310007|Ifor Morris Thomas]]''
|
| 1909-07-08
| 1985-08-14
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10596
| ''[[:d:Q66311283|Ethel Mary Hartland]]''
|
| 1875-09-01
| 1964
| [[Swansea]]
|-
| style='text-align:right'| 10597
| ''[[:d:Q66317458|Pender Chalmers]]''
| [[File:Maysie Burlingham 1915.jpg|center|128px]]
| 1894-12-08
| 1982-07-29
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10598
| ''[[:d:Q66335445|Callum Taylor]]''
|
| 1998-06-19
|
| [[Newport]]
|-
| style='text-align:right'| 10599
| ''[[:d:Q66360557|Mike Williams]]''
|
| 1956<br/>1956-12-01
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10600
| ''[[:d:Q66360802|Michael Lea Thomas]]''
|
| 1927-02-06
| 1992-05-09
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 10601
| ''[[:d:Q66360907|William James "Bill" Rees]]''
|
| 1914
| 1995
| [[St Davids]]
|-
| style='text-align:right'| 10602
| ''[[:d:Q66364666|Drew Parker]]''
| [[File:Drew Parker 20.02.27.jpg|center|128px]]
| 1997
|
| ''[[:d:Q3395452|Cei Connah]]''
|-
| style='text-align:right'| 10603
| ''[[:d:Q66384840|William Smale]]''
|
| 2001-02-28
|
| [[Newport]]
|-
| style='text-align:right'| 10604
| ''[[:d:Q66398333|Andrew Morris]]''
|
| 1961
|
| [[Swansea]]
|-
| style='text-align:right'| 10605
| ''[[:d:Q66428065|Ben Cabango]]''
|
| 2000-05-30<br/>2001-05-23
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10606
| ''[[:d:Q66441769|Esmé Dodderidge]]''
|
| 1916-01-03
| 1997-04-28
| [[Swansea]]
|-
| style='text-align:right'| 10607
| ''[[:d:Q66604836|Sonia Lawrence]]''
|
| 1980-01-19
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 10608
| ''[[:d:Q66606917|Willie Llewelyn]]''
|
| 1868-04-01
| 1893-08-24<br/>1893-08-25
| ''[[:d:Q4667051|Aberdulais]]''
|-
| style='text-align:right'| 10609
| ''[[:d:Q66660980|Veronica Milligan]]''
|
| 1926-03-11
| 1989-09-23
| [[Pontypridd]]
|-
| style='text-align:right'| 10610
| ''[[:d:Q66689127|Jason Evans]]''
| [[File:Jason Evans Wikimedian 2023.jpg|center|128px]]
| 1984
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10611
| ''[[:d:Q66692898|William Collins]]''
|
| 1848-06-16<br/>1848
| 1932-01-07<br/>1932
| ''[[:d:Q13127047|Cheriton]]''
|-
| style='text-align:right'| 10612
| ''[[:d:Q66694580|Nora M. Finn]]''
| [[File:Nora M. Finn (1866-1898) circa 1895.png|center|128px]]
| 1865-07-03
| 1898-06-24
| [[Cairdiff]]
|-
| style='text-align:right'| 10613
| ''[[:d:Q66712828|Jamie Slater]]''
|
| 1968-10-27
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10614
| ''[[:d:Q66732355|Lewis Thomas]]''
|
| 1997
|
| [[Swansea]]
|-
| style='text-align:right'| 10615
| ''[[:d:Q66732400|Lee Harris]]''
|
| 1968-04-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10616
| ''[[:d:Q66734203|Richard Benyon]]''
|
| 1964
|
| [[Newport]]
|-
| style='text-align:right'| 10617
| ''[[:d:Q66737792|Ben Gwalchmai]]''
|
| 1985
|
| ''[[:d:Q4787855|Arddleen]]''
|-
| style='text-align:right'| 10618
| ''[[:d:Q66738023|Cyril Jones]]''
|
| 1920-07-17
| 1995-11-27
| ''[[:d:Q6268758|Johnstown]]''
|-
| style='text-align:right'| 10619
| ''[[:d:Q66762454|Elin Harlow]]''
|
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10620
| ''[[:d:Q66779535|Emyr Currie-Jones]]''
|
| 1917-01-17
| 2008-10-13
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 10621
| ''[[:d:Q66819461|Owen Elias Roberts]]''
|
| 1908-06-19
| 2000-10-14
| ''[[:d:Q1866857|Llanystumdwy]]''
|-
| style='text-align:right'| 10622
| ''[[:d:Q66823499|Carrie Jones]]''
|
| 2003-09-04
|
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 10623
| ''[[:d:Q66841012|Chloe Chivers]]''
|
| 1999
|
| [[Wales]]
|-
| style='text-align:right'| 10624
| ''[[:d:Q66841084|Ffion Morgan]]''
| [[File:Ffion Morgan Lewes FC Women 1 Crystal Palace Women 2 Conti Cup 07 10 20-159 (50442352421).jpg|center|128px]]
| 2000-05-11
|
| [[Wales]]
|-
| style='text-align:right'| 10625
| ''[[:d:Q66844101|Jack Evans]]''
|
| 1998-04-25
|
| [[Swansea]]
|-
| style='text-align:right'| 10626
| ''[[:d:Q67019082|Jarry Lee]]''
| [[File:Jarry Lee Oscar Blandi 2020.png|center|128px]]
| 1993
|
| [[Swansea]]
|-
| style='text-align:right'| 10627
| ''[[:d:Q67117129|Luca Hoole]]''
| [[File:LHooleBRovers.jpg|center|128px]]
| 2002
|
| [[Wales]]
|-
| style='text-align:right'| 10628
| ''[[:d:Q67146942|Dom Jefferies]]''
| [[File:Dom Jefferies, Brentford F.C. footballer.jpg|center|128px]]
| 2002
|
| [[Wales]]
|-
| style='text-align:right'| 10629
| ''[[:d:Q67146943|Elis Watts]]''
|
| 2002
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10630
| ''[[:d:Q67185184|The Vivienne]]''
| [[File:RuPaul with All Stars 7 Contestants at LA DragCon 2022 by dvsross (crop - The Vivienne).jpg|center|128px]]
| 1992-04-12
|
| [[Wales]]
|-
| style='text-align:right'| 10631
| ''[[:d:Q67198301|Enid Layard]]''
|
| 1843-07-01
| 1912-11-01
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10632
| ''[[:d:Q67201474|Clive Davis]]''
|
| 1949
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 10633
| ''[[:d:Q67222729|Debbie Wilcox]]''
| [[File:Official portrait of Baroness Wilcox of Newport crop 2, 2022.jpg|center|128px]]
| 1957-06-15
|
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 10634
| ''[[:d:Q67222739|Hilary Greaves]]''
| [[File:Hilary Greaves (20613169345).jpg|center|128px]]
| 1978-09-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10635
| ''[[:d:Q67454699|Beaumont Wilson Bowen Dixie]]''
|
| 1819-03-27
| 1898-03-27
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 10636
| ''[[:d:Q67599358|Ray Booth]]''
|
| 1949-12-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10637
| ''[[:d:Q67641500|John Trevelyan]]''
|
| 1948-03-13
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10638
| ''[[:d:Q67641543|David John Sully]]''
|
| 1947-06-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10639
| ''[[:d:Q67651447|William Jones]]''
|
| 1757
| 1830-02-02
| ''[[:d:Q3402560|Bontddu]]''
|-
| style='text-align:right'| 10640
| ''[[:d:Q67656962|Tom Jenkins]]''
|
| 1920
| 2012
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10641
| ''[[:d:Q67782102|John Richard Williams]]''
|
| 1892
| 1961
| ''[[:d:Q3401123|Llandudno Junction]]''
|-
| style='text-align:right'| 10642
| ''[[:d:Q67790654|Adrian Masters]]''
|
| 1984
|
| [[Newport]]
|-
| style='text-align:right'| 10643
| ''[[:d:Q67802439|Saint Cyndeyrn ap Cyngar]]''
|
|
|
| ''[[:d:Q2578706|Kingdom of Ceredigion]]''
|-
| style='text-align:right'| 10644
| ''[[:d:Q67886292|Geoffrey Cutter]]''
|
| 1934-10-01
|
| [[Newport]]
|-
| style='text-align:right'| 10645
| ''[[:d:Q67907384|Betty Davies]]''
|
| 1917
| 2018-01-27
| [[Aberystwyth]]
|-
| style='text-align:right'| 10646
| ''[[:d:Q67921919|Tôpher Mills]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10647
| ''[[:d:Q68065250|Ryan Hillier]]''
|
| 2003
|
| [[Newport]]
|-
| style='text-align:right'| 10648
| ''[[:d:Q68217203|Bob Evans]]''
|
| 1947
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10649
| ''[[:d:Q68585432|John Bassett Trumper]]''
| [[File:John B. Trumper 2018.jpg|center|128px]]
| 1944-03-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10650
| ''[[:d:Q69060453|Tomi Evans]]''
|
|
|
| [[Pembrokeshire|Sir Benfro]]<br/>''[[:d:Q13131775|Tegryn]]''
|-
| style='text-align:right'| 10651
| ''[[:d:Q69998002|Austin Savage]]''
|
| 1940-02-15
| 2024-05-01
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10652
| ''[[:d:Q70022333|Wyn George]]''
|
| 1910<br/>1917
| 1985
| [[Wales]]
|-
| style='text-align:right'| 10653
| ''[[:d:Q70111934|Keith Morris]]''
|
| 1958-03-09
| 2019-10-05
| [[Aberystwyth]]
|-
| style='text-align:right'| 10654
| ''[[:d:Q70170755|Jacob Draper]]''
|
| 1998-07-24
|
| ''[[:d:Q7898590|Upper Cwmbran]]''
|-
| style='text-align:right'| 10655
| ''[[:d:Q70430408|David Morgan]]''
|
| 1937-05-22
| 2019-10-03
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 10656
| ''[[:d:Q70473832|Niki Pilkington]]''
|
|
|
| ''[[:d:Q1974260|Nefyn]]''
|-
| style='text-align:right'| 10657
| ''[[:d:Q70602412|Malvin Mortimer]]''
|
| 1952-05-03
|
| [[Llwynypia]]
|-
| style='text-align:right'| 10658
| ''[[:d:Q71128886|Eloise Laity]]''
|
| 1994-05-09
|
| [[Wales]]
|-
| style='text-align:right'| 10659
| ''[[:d:Q71334330|John Cule]]''
|
| 1920
| 2015-04-10
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 10660
| ''[[:d:Q71496189|Phoebe Richards]]''
|
| 1993-03-26
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 10661
| ''[[:d:Q72097669|Geraint Vaughan Jones]]''
|
| 1938
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 10662
| ''[[:d:Q72342996|Baroness Matilda von Lachmann]]''
|
| 1821-08-17
| 1895-09
| [[Swansea]]
|-
| style='text-align:right'| 10663
| ''[[:d:Q72591827|Ria Jones]]''
|
| 1967-03-08
|
| [[Swansea]]
|-
| style='text-align:right'| 10664
| ''[[:d:Q72835607|Mari Berllan Biter]]''
|
|
|
| ''[[:d:Q3399358|Aberarth]]''
|-
| style='text-align:right'| 10665
| ''[[:d:Q72921909|Neco Williams]]''
| [[File:2022 FIFA World Cup United States 1–1 Wales - (24) (cropped).jpg|center|128px]]
| 2001-04-13
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10666
| ''[[:d:Q72973962|John Hartley]]''
|
| 1943
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10667
| ''[[:d:Q73211440|Louis Gray]]''
|
| 1995-08-11
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10668
| ''[[:d:Q73276230|David Thomas]]''
|
| 1927-06-27
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10669
| ''[[:d:Q73276307|Terry Monaghan]]''
|
| 1933
|
| ''[[:d:Q2469852|Mountain Ash]]''
|-
| style='text-align:right'| 10670
| ''[[:d:Q73516034|Margaret Auld]]''
|
| 1932-07-11
| 2010-09-10
| [[Cairdiff]]
|-
| style='text-align:right'| 10671
| ''[[:d:Q73632769|Jacquie Barnbrook]]''
|
| 1964-12-15
|
| [[Newport]]
|-
| style='text-align:right'| 10672
| ''[[:d:Q73700067|Thomas Gronow]]''
|
| 1797
| 1870-08-17
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10673
| ''[[:d:Q73855341|Dawn Williams]]''
|
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10674
| ''[[:d:Q73855347|Dilys Thomas]]''
|
|
|
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 10675
| ''[[:d:Q73855378|Lowri Cynan]]''
|
|
|
| ''[[:d:Q850566|Betws]]''
|-
| style='text-align:right'| 10676
| ''[[:d:Q73855381|Hazel Walford Davies]]''
|
| 1940-01
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10677
| ''[[:d:Q73855404|Laura Sheldon]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 10678
| ''[[:d:Q73855463|Sheelagh Thomas]]''
|
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10679
| ''[[:d:Q74050176|Tom Cutler]]''
|
| 1959
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10680
| ''[[:d:Q74185530|Ioan Lloyd]]''
| [[File:Ioan Lloyd EPCR 2023.jpg|center|128px]]
| 2001-04-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10681
| ''[[:d:Q74817155|Callum Jones]]''
|
| 2002-08-30
|
| [[Swansea]]
|-
| style='text-align:right'| 10682
| ''[[:d:Q74817195|Joe Woodiwiss]]''
|
| 2003
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10683
| ''[[:d:Q75253752|Vera Edyth Griffith-Boscawen]]''
| [[File:Sir D. Broughton LCCN2014718668.jpg|center|128px]]
| 1894-01-02
| 1968-08-21
| ''[[:d:Q5648626|Hanmer]]''
|-
| style='text-align:right'| 10684
| ''[[:d:Q75257649|Lady Anne Somerset]]''
|
| 1631-10
| 1662
| ''[[:d:Q2630723|Raglan Castle]]''
|-
| style='text-align:right'| 10685
| ''[[:d:Q75262431|Morgan Lindsay]]''
| [[File:Morgan Lindsay (IWM).jpg|center|128px]]
| 1857-02-13
| 1935-11-01
| ''[[:d:Q7837474|Tredegar Park]]''
|-
| style='text-align:right'| 10686
| ''[[:d:Q75296912|Morys Lloyd-Mostyn]]''
|
| 1887-02-20
| 1968-12-03
| ''[[:d:Q4937022|Bodysgallen Hall]]''
|-
| style='text-align:right'| 10687
| ''[[:d:Q75303015|Robert Charles Herbert]]''
|
| 1827-06-24
| 1902-10-31
| [[Welshpool]]
|-
| style='text-align:right'| 10688
| ''[[:d:Q75315040|Edward Wynne-Finch]]''
|
| 1842-12-09
| 1914-01-07
| ''[[:d:Q7165298|Pentrefoelas]]''
|-
| style='text-align:right'| 10689
| ''[[:d:Q75316050|Eryl Smith]]''
|
| 1893
| 1930-01-25
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10690
| ''[[:d:Q75386990|Lady Emily Cadogan]]''
|
| 1773-05-26
| 1839-12-22
| ''[[:d:Q7201721|Plas Newydd]]''
|-
| style='text-align:right'| 10691
| ''[[:d:Q75420061|George Brooke Meares]]''
|
| 1838-01-09
| 1894-08-04
| ''[[:d:Q5566621|Glandyfi]]''
|-
| style='text-align:right'| 10692
| ''[[:d:Q75442343|Elaine Bathurst, Lady Bledisloe]]''
| [[File:Elaine Bathurst, Lady Bledisloe (cropped).jpg|center|128px]]
| 1879-12-11
| 1956-02-06
| ''[[:d:Q13656930|Oystermouth]]''
|-
| style='text-align:right'| 10693
| ''[[:d:Q75445238|Wilberforce Ernest Hazell]]''
|
| 1871
| 1953-03-04
| ''[[:d:Q5256625|Denbighshire]]''
|-
| style='text-align:right'| 10694
| ''[[:d:Q75514713|John Sibbering]]''
|
| 1829
| 1906-01-06
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 10695
| ''[[:d:Q75544284|Edward Robert Wood]]''
|
| 1819
| 1876-09-27
| [[Cairdiff]]
|-
| style='text-align:right'| 10696
| ''[[:d:Q75569765|Richard Owen]]''
|
| 1824
| 1902
| ''[[:d:Q990100|Dolbenmaen]]''
|-
| style='text-align:right'| 10697
| ''[[:d:Q75597041|George Prothero]]''
|
| 1818-03-18
| 1894-11-16
| [[Newport]]
|-
| style='text-align:right'| 10698
| ''[[:d:Q75616092|John Hubert Emlyn Jones]]''
|
| 1915-08-06
| 2014-02-04
| [[Wales]]
|-
| style='text-align:right'| 10699
| ''[[:d:Q75616428|Francis Henry Wolryche-Whitmore]]''
|
| 1820
| 1908-07-13
| ''[[:d:Q13644937|Llanmaes]]''
|-
| style='text-align:right'| 10700
| ''[[:d:Q75651054|Jeffrey O'Riordan]]''
|
| 1931-03-27
| 2017-10-09
| [[Newport]]
|-
| style='text-align:right'| 10701
| ''[[:d:Q75682717|Sion Wiggin]]''
|
| 1995-09-01
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10702
| ''[[:d:Q75758932|Harriet Anne Jones]]''
|
| 1817
| 1928
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 10703
| ''[[:d:Q75817575|Alexander Murray-Threipland]]''
|
| 1972-08-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10704
| ''[[:d:Q75817581|Alice Murray-Threipland]]''
|
| 1972-08-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10705
| ''[[:d:Q75844853|Seán Sáirséal Ó hÉigeartaigh]]''
|
| 1917-02-11
| 1967-06-14
| [[Welshpool]]
|-
| style='text-align:right'| 10706
| ''[[:d:Q75846128|William Quick]]''
|
| 1902-04-19
| 1994
| [[Cairdiff]]
|-
| style='text-align:right'| 10707
| ''[[:d:Q75866941|William Parry Crawley]]''
|
|
|
| ''[[:d:Q11129506|Bryngwyn]]''
|-
| style='text-align:right'| 10708
| ''[[:d:Q75903180|John Lloyd]]''
|
| 1844-05-07
| 1910
| ''[[:d:Q15242566|Llanmerewig]]''
|-
| style='text-align:right'| 10709
| ''[[:d:Q75933413|Richard Quintin Hoare]]''
|
| 1943-01-30
| 2020-03-24
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 10710
| ''[[:d:Q75946239|Sir Richard Puleston, 2nd Bt.]]''
|
| 1789-06-20
| 1860-12-19
| ''[[:d:Q684016|Flintshire]]''
|-
| style='text-align:right'| 10711
| ''[[:d:Q75947093|Dorothy Glynne]]''
|
| 1680
| 1731-09
| [[Wales]]
|-
| style='text-align:right'| 10712
| ''[[:d:Q75976071|George Leader Owen]]''
|
| 1838
| 1905-02-09
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 10713
| ''[[:d:Q76025826|Henry Awbrey]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10714
| ''[[:d:Q76025828|John Awbrey]]''
|
| 1623
| 1692
| [[Wales]]
|-
| style='text-align:right'| 10715
| ''[[:d:Q76082157|Essex Lloyd-Mostyn]]''
|
| 1834
| 1916-10-21
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 10716
| ''[[:d:Q76086417|George Grant Francis]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 10717
| ''[[:d:Q76104067|Rees Lloyd-Jones]]''
|
| 1925
| 2011-09-27
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 10718
| ''[[:d:Q76188083|Owen Putland Meyrick]]''
|
| 1752-09-26
| 1825-03-24
| ''[[:d:Q3400978|Bodorgan]]''
|-
| style='text-align:right'| 10719
| ''[[:d:Q76198610|Nadolig Ximenes Gwynne]]''
|
| 1832-12-25
| 1920-05-09
| ''[[:d:Q26219505|Glanbran]]''
|-
| style='text-align:right'| 10720
| ''[[:d:Q76201785|Thomas Fanning-Evans]]''
|
|
| 1870
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 10721
| ''[[:d:Q76214693|Iris Lambert Williams]]''
|
| 1919-04-27
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 10722
| ''[[:d:Q76214792|William Wynne]]''
|
| 1774
| 1834-02-08
| ''[[:d:Q11047227|Peniarth]]''
|-
| style='text-align:right'| 10723
| ''[[:d:Q76363017|Jamie Wallis]]''
| [[File:Official portrait of Dr Jamie Wallis MP crop 2.jpg|center|128px]]
| 1984-06-02
|
| ''[[:d:Q4898674|Betws]]''
|-
| style='text-align:right'| 10724
| ''[[:d:Q76363105|Scott Benton]]''
| [[File:Official portrait of Scott Benton MP crop 2.jpg|center|128px]]
| 1987-07-01
|
| [[Newport]]
|-
| style='text-align:right'| 10725
| ''[[:d:Q76363918|Beth Winter]]''
| [[File:Official portrait of Beth Winter MP crop 2.jpg|center|128px]]
| 1974-10-04
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10726
| ''[[:d:Q76364874|Alex Davies-Jones]]''
| [[File:Official portrait of Alex Davies-Jones MP crop 2, 2024.jpg|center|128px]]
| 1989-04-05
|
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 10727
| ''[[:d:Q76365516|Thomas Morgan Llewellin]]''
|
| 1816
| 1891-11-30
| ''[[:d:Q6661562|Llangynidr]]''
|-
| style='text-align:right'| 10728
| ''[[:d:Q76439584|James James]]''
|
| 1800
| 1879-01-05
| ''[[:d:Q3402056|Betws Ifan]]''
|-
| style='text-align:right'| 10729
| ''[[:d:Q76449783|Michael T. Ridout]]''
|
| 1955
| 2019
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10730
| ''[[:d:Q76450637|Robin Millar]]''
| [[File:Official portrait of Robin Millar MP crop 2.jpg|center|128px]]
| 1968-10-15
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10731
| ''[[:d:Q76537664|John C. Waymouth]]''
|
| 1821-06-24
| 1892-12-09
| [[Wales]]
|-
| style='text-align:right'| 10732
| ''[[:d:Q76613834|Prydwen Elfed-Owens]]''
|
|
|
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10733
| ''[[:d:Q76615306|N. A. Pett]]''
|
|
|
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10734
| ''[[:d:Q76615429|Owen Glyn Roberts]]''
|
|
|
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10735
| ''[[:d:Q76615797|Neil Trevor Jones]]''
|
|
|
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10736
| ''[[:d:Q76616291|Michael Tibbott]]''
|
|
|
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10737
| ''[[:d:Q76616645|Meurig Thomas]]''
|
|
|
| ''[[:d:Q7837859|Tregeiriog]]''
|-
| style='text-align:right'| 10738
| ''[[:d:Q76700917|Dylan Levitt]]''
| [[File:Dylan Levitt.jpg|center|128px]]
| 2000-11-17
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 10739
| ''[[:d:Q76836405|David Edwardes]]''
| [[File:Parchedig David Edwardes (1836–1916), MA (gcf03776).jpg|center|128px]]
| 1836
| 1916
| ''[[:d:Q16542738|Nantcwnlle]]''
|-
| style='text-align:right'| 10740
| ''[[:d:Q76837507|Arthur Erskine Owen Humphreys-Owen]]''
| [[File:Arthur Erskine Owen Humphreys-Owen (1876–1928) (gcf06357).jpg|center|128px]]
| 1876
| 1928
| ''[[:d:Q3309484|Aberriw]]''
|-
| style='text-align:right'| 10741
| ''[[:d:Q77215517|James Jones]]''
|
| 1695
|
| [[Wales]]
|-
| style='text-align:right'| 10742
| ''[[:d:Q77359183|Jessica Hemmings]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10743
| ''[[:d:Q77364621|Graham Oliver Osborne]]''
| [[File:LU MRD G O Osborne chromatograph.jpg|center|128px]]
| 1925
|
| [[Monmouthshire]]
|-
| style='text-align:right'| 10744
| ''[[:d:Q78155720|Chem Campbell]]''
| [[File:Chem Campbell 2021.jpg|center|128px]]
| 2002-12-30
|
| [[Wales]]
|-
| style='text-align:right'| 10745
| ''[[:d:Q78674851|Henry Landor]]''
|
| 1816
| 1877-01-06
| [[Anglesey]]
|-
| style='text-align:right'| 10746
| ''[[:d:Q78828774|Morgan Boyes]]''
|
| 2001-04-22
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10747
| ''[[:d:Q78902170|Robert Stanley Gorrell Dent]]''
|
| 1909<br/>1908
| 1991<br/>1984
| [[Newport]]
|-
| style='text-align:right'| 10748
| ''[[:d:Q79322942|Terry Vaughan]]''
|
| 1938<br/>1938-04-22
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 10749
| ''[[:d:Q79329132|Louis Rees-Zammit]]''
| [[File:Louis Rees-Zammit March 2023.jpg|center|128px]]
| 2001-02-02
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 10750
| ''[[:d:Q79359895|Anne Burns]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10751
| ''[[:d:Q79459553|Colin Treharne]]''
|
| 1937<br/>1937-07-30
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10752
| ''[[:d:Q79478098|Eveline Annie Jenkins]]''
|
| 1893
| 1976
| [[Monmouthshire]]
|-
| style='text-align:right'| 10753
| ''[[:d:Q79765222|Edward Keynes Purchase]]''
|
| 1862
| 1923
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 10754
| ''[[:d:Q79843548|Doug Curtin]]''
|
| 1947<br/>1947-09-15
| 2022
| [[Cairdiff]]
|-
| style='text-align:right'| 10755
| ''[[:d:Q79856442|Annes Elwy]]''
|
| 1992-09-26
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 10756
| ''[[:d:Q80314802|Ioan Roberts]]''
|
| 1941-11-22
| 2019-12-29
| ''[[:d:Q28731132|Rhoshirwaun]]''
|-
| style='text-align:right'| 10757
| ''[[:d:Q80478275|Ruth van Heyningen]]''
|
| 1917-10-26
| 2019-10-24
| [[Newport]]
|-
| style='text-align:right'| 10758
| ''[[:d:Q80549688|Lillian Griffith]]''
|
| 1877-07-14
| 1972
| ''[[:d:Q3304459|Abersychan]]''
|-
| style='text-align:right'| 10759
| ''[[:d:Q80832360|Terry Perdue]]''
|
| 1940-11-10
| 1998-08-19
| [[Swansea]]
|-
| style='text-align:right'| 10760
| ''[[:d:Q80863365|Ian Davies]]''
|
| 1978-01-15
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 10761
| ''[[:d:Q81052834|Jac Morgan]]''
| [[File:Jac Morgan 2023.jpg|center|128px]]
| 2000-01-21
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10762
| ''[[:d:Q81052941|Alun Lawrence]]''
|
| 1998-08-12
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10763
| ''[[:d:Q81087079|Ieuan Owen]]''
|
| 1941-02-12
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 10764
| ''[[:d:Q81145749|Charles Evan-Thomas]]''
|
| 1897-11-05
| 1953-03-28
| ''[[:d:Q1003123|Builth Wells]]''
|-
| style='text-align:right'| 10765
| ''[[:d:Q81147173|David Llewellyn]]''
|
| 1949-08-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10766
| ''[[:d:Q81191668|Geraint Frowen]]''
|
| 1984-05-07
|
| ''[[:d:Q3404556|Pontyclun]]''
|-
| style='text-align:right'| 10767
| ''[[:d:Q81713322|Tweli Griffiths]]''
|
| 1954
|
| ''[[:d:Q7162285|Pencader]]''
|-
| style='text-align:right'| 10768
| ''[[:d:Q81749728|Wendy White]]''
|
| 1963
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10769
| ''[[:d:Q81750352|Griff Rowland]]''
|
| 1969-07-12
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10770
| ''[[:d:Q82026018|Rupert Shipperley]]''
|
| 1992-11-21
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 10771
| ''[[:d:Q82201529|Edith Lovell Andrews]]''
|
| 1886-11-07
| 1980
| [[Newport]]
|-
| style='text-align:right'| 10772
| ''[[:d:Q82211696|Elizabeth Everett]]''
|
| 1797-05-08
| 1878-03-12
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 10773
| ''[[:d:Q82736987|Connagh Howard]]''
|
| 1992
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10774
| ''[[:d:Q83222996|Ben Thomas]]''
|
| 1998-11-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10775
| ''[[:d:Q83289553|Llŷr Titus]]''
|
| 1990s
|
| ''[[:d:Q1541249|Llŷn Peninsula]]''
|-
| style='text-align:right'| 10776
| ''[[:d:Q83559707|Patrick Harrington]]''
|
| 1949-06-23
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 10777
| ''[[:d:Q83739297|Sam Costelow]]''
|
| 2001-01-10
|
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 10778
| ''[[:d:Q83744439|Ieuan Rees]]''
|
| 1941
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 10779
| ''[[:d:Q83864687|Carwyn Penny]]''
|
| 1998-11-17
|
| [[Wales]]
|-
| style='text-align:right'| 10780
| ''[[:d:Q83875033|Ella Barnwell]]''
| [[File:2021 UEC Track Jun & U23 European Championships 533.jpg|center|128px]]
| 2001-01-14
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10781
| ''[[:d:Q83986618|Ralph Granger Watkin]]''
|
| 1873-03-30
| 1953-11-06
| [[Pontypridd]]
|-
| style='text-align:right'| 10782
| ''[[:d:Q84048212|Stephen Varney]]''
| [[File:Stephen Varney 2022.jpg|center|128px]]
| 2001-05-16
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10783
| ''[[:d:Q84078989|Lily Woodham]]''
| [[File:Lily Woodham.jpg|center|128px]]
| 2000<br/>2000-09-03
|
| [[Wales]]
|-
| style='text-align:right'| 10784
| ''[[:d:Q84320766|Tom Whittington]]''
|
| 1848
| 1919
| ''[[:d:Q16248422|Tonna]]''
|-
| style='text-align:right'| 10785
| ''[[:d:Q84436572|Ted Robbins]]''
|
| 1877
| 1946-01-16
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10786
| ''[[:d:Q84592655|Charles Lloyd]]''
|
| 1613
| 1657
| ''[[:d:Q17741174|Dolobran Hall]]''
|-
| style='text-align:right'| 10787
| ''[[:d:Q84893687|James McCarthy]]''
|
| 1999
|
| [[Newport]]
|-
| style='text-align:right'| 10788
| ''[[:d:Q85220401|Emyr Huws Jones]]''
|
| 1950-02
|
| ''[[:d:Q1002817|Llangefni]]''
|-
| style='text-align:right'| 10789
| ''[[:d:Q85411541|Colwyn Edward Vulliamy]]''
|
| 1886-06-20
| 1971-09-01
| [[Wales]]
|-
| style='text-align:right'| 10790
| ''[[:d:Q85431450|Ron Ainge]]''
|
| 1920-08-05
| 2008-03
| ''[[:d:Q2030641|Pontardawe]]''
|-
| style='text-align:right'| 10791
| ''[[:d:Q85764603|Griffith Griffith]]''
|
| 1823-12-08
| 1889
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 10792
| ''[[:d:Q85771463|John Davidson]]''
|
| 1964-10-23
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10793
| ''[[:d:Q85771711|John Rea]]''
|
| 1868<br/>1868-12-21
| 1944
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 10794
| ''[[:d:Q85792913|Peter Arthur]]''
|
| 1939-04-04
|
| [[Swansea]]
|-
| style='text-align:right'| 10795
| ''[[:d:Q85796162|Ray Powell]]''
|
| 1924-08-05
| 2014-05
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 10796
| ''[[:d:Q85810650|Trevor Lewis]]''
|
| 1919-08-16
| 1995-05-19
| [[Swansea]]
|-
| style='text-align:right'| 10797
| ''[[:d:Q85815681|William Hudson]]''
|
| 1928<br/>1928-03-10
| 2014-02
| [[Swansea]]
|-
| style='text-align:right'| 10798
| ''[[:d:Q85815731|William Randall]]''
|
| 1888
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10799
| ''[[:d:Q85828658|Chris Klefenz]]''
|
|
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 10800
| ''[[:d:Q85841208|William Glynn Williams]]''
|
| 1851
| 1938-02-23
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 10801
| ''[[:d:Q85851754|Richard Barnes]]''
|
| 1975-09-06
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10802
| ''[[:d:Q85851980|Steve Jones]]''
|
| 1964-10-23
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10803
| ''[[:d:Q85859937|Arthur William Oswald Davies]]''
|
| 1875-05-25
| 1928-01-16
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10804
| ''[[:d:Q85874731|Michael Beckett]]''
|
| 1995-03-27
|
| ''[[:d:Q1022259|Solfach]]''
|-
| style='text-align:right'| 10805
| ''[[:d:Q85951426|Simon Warr]]''
|
| 1953-09-09
| 2020-02-22
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 10806
| ''[[:d:Q85984763|Giancarlo Gemin]]''
|
| 1962
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10807
| ''[[:d:Q86445222|Jane Stanness]]''
|
|
|
| ''[[:d:Q7164543|Penparcau]]''
|-
| style='text-align:right'| 10808
| ''[[:d:Q86970456|Rakel Harbitz]]''
|
| 1887-12-22
| 1944-01-27
| [[Cairdiff]]
|-
| style='text-align:right'| 10809
| ''[[:d:Q87296575|Eleanor Coster]]''
|
| 1996-01-31
|
| [[Newport]]
|-
| style='text-align:right'| 10810
| ''[[:d:Q87344165|Henry Price]]''
|
| 1872
| 1922
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10811
| ''[[:d:Q87355238|Tracy Rees]]''
|
| 1972
|
| [[Swansea]]
|-
| style='text-align:right'| 10812
| ''[[:d:Q87455769|Andy Pollitt]]''
|
| 1963-10-26
| 2019-11-13
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 10813
| ''[[:d:Q87474480|Donal Anthony Foley]]''
|
| 1956
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10814
| ''[[:d:Q87474632|Evan Roberts]]''
|
| 1923-11-18
| 2007-03-26
| ''[[:d:Q3399272|Penygroes]]''
|-
| style='text-align:right'| 10815
| ''[[:d:Q87499051|Frances Anne Jane Collier]]''
|
| 1832-11-12
| 1900-07-19
| ''[[:d:Q7983059|Wenvoe]]''
|-
| style='text-align:right'| 10816
| ''[[:d:Q87617078|Thomas Henry Blythe]]''
|
| 1822
| 1883-04-04
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 10817
| ''[[:d:Q87740471|Caine Woolerton]]''
|
| 1999-11-06
|
| [[Wales]]
|-
| style='text-align:right'| 10818
| ''[[:d:Q87740637|Ioan Davies]]''
|
| 1999-11-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10819
| ''[[:d:Q87748575|Lady James]]''
|
| 1869
| 1938
| [[Wales]]
|-
| style='text-align:right'| 10820
| ''[[:d:Q87758340|David Archard Williams]]''
|
| 1796
| 1879-09
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10821
| ''[[:d:Q87758558|Francis Evelyn]]''
|
| 1859-05-24
| 1910-12-08
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 10822
| ''[[:d:Q87855425|Henry Bowen]]''
|
| 1633-03
| 1723
| [[Wales]]
|-
| style='text-align:right'| 10823
| ''[[:d:Q87894273|John Stevenson]]''
|
| 1951
| 2020-03-12
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10824
| ''[[:d:Q87905789|Albert Clifton Kelway]]''
|
| 1865-12-20
|
| ''[[:d:Q15222581|Hakin]]''
|-
| style='text-align:right'| 10825
| ''[[:d:Q88074967|Ruth May]]''
| [[File:Ruth May CNO.jpg|center|128px]]
| 1967
|
| [[Wales]]
|-
| style='text-align:right'| 10826
| ''[[:d:Q88289718|Phil Parry]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10827
| ''[[:d:Q88360982|Steffan Cennydd]]''
|
| 1995
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10828
| ''[[:d:Q88468482|Abby Meehan]]''
|
| 1853
| 1931
| [[Swansea]]
|-
| style='text-align:right'| 10829
| ''[[:d:Q88509572|Rhys Thomas]]''
|
|
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 10830
| ''[[:d:Q88527143|Paul Barrow]]''
|
| 1953-06-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10831
| ''[[:d:Q88590650|Rhodri Thomas]]''
|
| 1942-03-13
|
| ''[[:d:Q3405138|St Dogmaels]]''
|-
| style='text-align:right'| 10832
| ''[[:d:Q88886811|Denise Hampson]]''
|
| 1978
|
| ''[[:d:Q1067984|Clwyd]]''
|-
| style='text-align:right'| 10833
| ''[[:d:Q89579900|Dewi Rhys Williams]]''
|
| 20th century
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10834
| ''[[:d:Q89688629|Daniel Jarrett]]''
| [[File:Daniel Jarett Sullivan.jpg|center|128px]]
| 1854
| 1917-09-23
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10835
| ''[[:d:Q89839749|Robert Knight]]''
|
| 1858-04-21
| 1938-05-22
| ''[[:d:Q7592715|St Brides Major]]''
|-
| style='text-align:right'| 10836
| ''[[:d:Q89842872|Morgan Jones]]''
|
| 1829-12-20
| 1905-06-02
| ''[[:d:Q11932059|Llandygwydd]]''
|-
| style='text-align:right'| 10837
| ''[[:d:Q89891143|Andrew Teilo]]''
|
| 20th century
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10838
| ''[[:d:Q89891226|John Downing]]''
|
| 1940-04-17
| 2020-04-08
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10839
| ''[[:d:Q89916448|Dannii Harwood]]''
|
| 1982-06-19
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 10840
| ''[[:d:Q90023497|Amy Boulden]]''
|
| 1993-08-06
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10841
| ''[[:d:Q90688233|Keith Harrhy Ruddock]]''
|
| 1939
| 1996-12-20
| ''[[:d:Q5187462|Croesyceiliog]]''
|-
| style='text-align:right'| 10842
| ''[[:d:Q90908939|Marjorie Mallik]]''
|
| 1925-10-21
| 1998-08-31
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 10843
| ''[[:d:Q91350809|Gwyn Rowley]]''
|
| 1938-05-24
| 2023-05-02
| [[Cairdiff]]
|-
| style='text-align:right'| 10844
| ''[[:d:Q91615685|Lloyd Warburton]]''
| [[File:LloydWarburton.jpg|center|128px]]
| 2003-12-17
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10845
| ''[[:d:Q92026186|John Hughes (Idanfryn)]]''
|
| 1832
| 1876
| ''[[:d:Q3402736|Llanidan]]''
|-
| style='text-align:right'| 10846
| ''[[:d:Q92311589|Debbie Johnsey]]''
|
| 1957-07-03
|
| [[Newport]]
|-
| style='text-align:right'| 10847
| ''[[:d:Q92438583|Norman van de Vater]]''
|
| 1946-08-27
|
| ''[[:d:Q5197228|Cwmbach]]''
|-
| style='text-align:right'| 10848
| ''[[:d:Q93130781|Percy Farrant]]''
|
| 1868-04-25
| 1921-09-04
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 10849
| ''[[:d:Q93148214|Barrie Rees]]''
|
| 1944-02-04
| 1965-03-27
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 10850
| ''[[:d:Q93232204|James Stanley McQuade]]''
|
| 1929-10-07
| 2019-01-10
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10851
| ''[[:d:Q93372127|Martin J. Haigh]]''
|
| 1950-07-29
| 2022-02-04
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 10852
| ''[[:d:Q93413854|Glyn O. Phillips]]''
|
| 1927-11-11
| 2020-07-05
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 10853
| ''[[:d:Q93450444|George A. Jeffrey]]''
|
| 1915-07-29
| 2000-02-13
| [[Cairdiff]]
|-
| style='text-align:right'| 10854
| ''[[:d:Q93462296|Benjamin Watkins]]''
|
| 1853
| 1913
| ''[[:d:Q6661129|Llancayo]]''
|-
| style='text-align:right'| 10855
| ''[[:d:Q93605036|Leon Stanfield]]''
|
| 1934
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10856
| ''[[:d:Q94005165|Hywel Griffith]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10857
| ''[[:d:Q94102329|Valerie Miles]]''
|
| 1914
| 1999
| ''[[:d:Q4667120|Aberkenfig]]''
|-
| style='text-align:right'| 10858
| ''[[:d:Q94134193|Beryl Baigent]]''
|
| 1937
|
| ''[[:d:Q6661943|Llai]]''
|-
| style='text-align:right'| 10859
| ''[[:d:Q94139976|Colin Palfrey]]''
|
| 1939
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10860
| ''[[:d:Q94349890|Keith Lyons]]''
| [[File:Keith Lyons.jpg|center|128px]]
| 1952-05-07
| 2020-05-13
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 10861
| ''[[:d:Q94379750|Edith Massey]]''
|
| 1863
| 1946
| ''[[:d:Q3404757|Llangoed]]''
|-
| style='text-align:right'| 10862
| ''[[:d:Q94379751|Gwenddolen Massey]]''
|
| 1864
| 1960
| ''[[:d:Q3404757|Llangoed]]''
|-
| style='text-align:right'| 10863
| ''[[:d:Q94496232|Barrie J. Davies]]''
|
| 1977
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 10864
| ''[[:d:Q94502283|Caradoc Jones]]''
|
| 1875
| 1969
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 10865
| ''[[:d:Q94518563|W. Evans Darby]]''
|
| 1844-07-10
| 1922-11-07
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 10866
| ''[[:d:Q94534761|Fred Jones]]''
|
| 1877-05-03
| 1948-12-02
| ''[[:d:Q15987467|Blaen Celyn]]''
|-
| style='text-align:right'| 10867
| ''[[:d:Q94579608|Edwina McGrail]]''
|
| 1950
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10868
| ''[[:d:Q94641829|David Edwards]]''
|
| 1934-12-10
|
| ''[[:d:Q3404051|Treharris]]''
|-
| style='text-align:right'| 10869
| ''[[:d:Q94665402|William Cooper Howells]]''
|
| 1807-05-15
| 1894-08-28
| [[Wales]]
|-
| style='text-align:right'| 10870
| ''[[:d:Q94696644|Mandi Haswell]]''
|
| 1949-10-01
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 10871
| ''[[:d:Q94813036|Thomas Job]]''
|
| 1901-08-10
| 1947-07-31
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10872
| ''[[:d:Q94823364|Christine Jones]]''
|
| 1955
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 10873
| ''[[:d:Q94831390|Wilhelm Körner]]''
|
| 1898
| 1971
| [[Cairdiff]]
|-
| style='text-align:right'| 10874
| ''[[:d:Q94997935|Graham Morris]]''
|
| 1964-03-28
|
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 10875
| ''[[:d:Q95000156|Eliza Harris]]''
|
| 1831
| 1891-06-12
| ''[[:d:Q3400328|St Athan]]''
|-
| style='text-align:right'| 10876
| ''[[:d:Q95188939|Nia Dryhurst]]''
|
| 1970-06-30
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10877
| ''[[:d:Q95208143|Eirian James]]''
|
| 1952-09-07
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 10878
| ''[[:d:Q95236346|Richard Idwal Hopwood]]''
|
| 1884-01-09
|
| [[Wales]]
|-
| style='text-align:right'| 10879
| ''[[:d:Q95287152|Thomas Arthur Rowett Hyndman]]''
|
| 1911
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10880
| ''[[:d:Q95304925|David Kingdon]]''
|
| 1969-04
|
| [[Wales]]
|-
| style='text-align:right'| 10881
| ''[[:d:Q95466885|Sadie Allen]]''
|
| 1930
| 2017
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 10882
| ''[[:d:Q95563204|John Cording]]''
|
| 1944
|
| [[Newport]]
|-
| style='text-align:right'| 10883
| ''[[:d:Q95636791|Cen Williams]]''
| [[File:Cen Williams (Dylunydd).jpg|center|128px]]
| 1946-04-07
| 2020-05-24
| ''[[:d:Q9001581|Gwalchmai]]''
|-
| style='text-align:right'| 10884
| ''[[:d:Q95676245|Myriel Irfona Davies]]''
|
| 1920-03-05
| 2000-12-20
| [[Swansea]]
|-
| style='text-align:right'| 10885
| ''[[:d:Q95698426|Joe Talbot]]''
| [[File:Idles - Haldern Pop Festival 2017 - Alexander Kellner - 2.jpg|center|128px]]
| 1984-08-23
|
| [[Newport]]
|-
| style='text-align:right'| 10886
| ''[[:d:Q95785749|Ioan Meredith]]''
|
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10887
| ''[[:d:Q95826771|Aaron Fuller]]''
|
| 1994
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10888
| ''[[:d:Q95838349|J. M. W. Bean]]''
|
| 1928-08-25
| 2012-05-14
| [[Wales]]
|-
| style='text-align:right'| 10889
| ''[[:d:Q96004521|Elizabeth Stack]]''
| [[File:Elizabeth Stack nee Jones.jpg|center|128px]]
| 1829-02-19
| 1919-12-02
| [[Anglesey]]
|-
| style='text-align:right'| 10890
| ''[[:d:Q96016290|Humphrey Stanley Herbert Jones]]''
|
| 1817
| 1902
| [[Anglesey]]
|-
| style='text-align:right'| 10891
| ''[[:d:Q96021277|John Scarrott]]''
| [[File:'Jack Scarrott' Boxing promoter.jpg|center|128px]]
| 1870-03-28
| 1947-10-06
| [[Newport]]
|-
| style='text-align:right'| 10892
| ''[[:d:Q96050319|Stephen Carkeek]]''
| [[File:Stephen James Carkeek c 1865.jpg|center|128px]]
| 1815-04-12
| 1878-11-27
| [[Swansea]]
|-
| style='text-align:right'| 10893
| ''[[:d:Q96064938|Eric Sixsmith]]''
|
| 1904-10-15
| 1986-04-06
| [[Cairdiff]]
|-
| style='text-align:right'| 10894
| ''[[:d:Q96066729|Leslie Shepherd]]''
|
| 1918-11-23
| 2012-02-18
| ''[[:d:Q7228399|Pontycymer]]''
|-
| style='text-align:right'| 10895
| ''[[:d:Q96154651|Gareth Brenton]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10896
| ''[[:d:Q96186370|James Waite]]''
|
| 1999-05-11
|
| ''[[:d:Q990153|Cwmbran]]''
|-
| style='text-align:right'| 10897
| ''[[:d:Q96196503|Thomas Craven]]''
|
| 1844-03-28
| 1919
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 10898
| ''[[:d:Q96199382|Griffith Bowen]]''
|
| 1600
| 1675
| [[Wales]]
|-
| style='text-align:right'| 10899
| ''[[:d:Q96202788|Thomas Bowen Rees]]''
|
| 1826-07-10
| 1899-12-30
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 10900
| ''[[:d:Q96244279|Captain Thomas Yale]]''
|
| 1616
| 1683
| [[Wales]]
|-
| style='text-align:right'| 10901
| ''[[:d:Q96313660|Layla Saad]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10902
| ''[[:d:Q96349090|Ethel Saxon]]''
|
| 1891
| 1917-09-03
| ''[[:d:Q1245075|Monmouthshire]]''
|-
| style='text-align:right'| 10903
| ''[[:d:Q96384682|John Tudor]]''
|
| 1953-04-18
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10904
| ''[[:d:Q96385713|Kevin James]]''
|
| 1984
|
| [[Wales]]
|-
| style='text-align:right'| 10905
| ''[[:d:Q96398942|Peter Isaac]]''
|
| 1931-05-16
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10906
| ''[[:d:Q96401737|Rhys Davies]]''
|
| 1998-02-08
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10907
| ''[[:d:Q96401739|Rhys Davies]]''
| [[File:Rhys Davies 2023.jpg|center|128px]]
| 1998-11-09
|
| [[Swansea]]
|-
| style='text-align:right'| 10908
| ''[[:d:Q96402446|Roger Jones]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 10909
| ''[[:d:Q96406533|Steve Hill]]''
|
| 1957
|
| [[Wales]]
|-
| style='text-align:right'| 10910
| ''[[:d:Q96483757|Roger Yeoman]]''
|
| 1957-01-15
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10911
| ''[[:d:Q96484421|Sally Morgan]]''
| [[File:Sally Morgan.jpg|center|128px]]
|
|
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 10912
| ''[[:d:Q96603547|John Cadwalader]]''
|
| 1677
| 1734
| [[Wales]]
|-
| style='text-align:right'| 10913
| ''[[:d:Q96655359|Myrddin John]]''
| [[File:Llun MJ.png|center|128px]]
| 1933-12-20
| 2021-12-22
| ''[[:d:Q850566|Betws]]''
|-
| style='text-align:right'| 10914
| ''[[:d:Q96686922|Cyril Edward Hughes Davies]]''
|
| 1890
| 1922
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 10915
| ''[[:d:Q96886219|Ian Willmore]]''
| [[File:Ian Willmore portrait.jpg|center|128px]]
| 1958-11-05
| 2020-04-07
| [[Cairdiff]]
|-
| style='text-align:right'| 10916
| ''[[:d:Q97002354|Jeannette Lowrie]]''
| [[File:Jeannette Lowrie, stage and vaudeville actress (SAYRE 5507) (cropped).jpg|center|128px]]
| 1880s
| 1937
| [[Wales]]
|-
| style='text-align:right'| 10917
| ''[[:d:Q97010729|Amanda Blanc]]''
| [[File:Amanda Blanc.jpg|center|128px]]
| 1967
|
| ''[[:d:Q7837902|Treherbert]]''
|-
| style='text-align:right'| 10918
| ''[[:d:Q97047137|David A. Evans]]''
|
| 1893-08-07
| 1966-05-20
| [[Wales]]
|-
| style='text-align:right'| 10919
| ''[[:d:Q97066423|Watkin Lewis Griffies-Williams, 3rd Baronet]]''
|
| 1800
| 1877
| ''[[:d:Q2281176|Llwynywermod]]''
|-
| style='text-align:right'| 10920
| ''[[:d:Q97302253|John Edward Walker]]''
|
| 1880
| 1940
| [[Wales]]
|-
| style='text-align:right'| 10921
| ''[[:d:Q97307833|Paul Grist]]''
|
| 1939-01-18
|
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 10922
| ''[[:d:Q97361474|Reginald Ford]]''
|
| 1889-11-18
| 1937-05-07
| [[Cairdiff]]
|-
| style='text-align:right'| 10923
| ''[[:d:Q97365110|Freddie John]]''
|
| 1991-09-06
|
| [[Newport]]
|-
| style='text-align:right'| 10924
| ''[[:d:Q97452589|Harry Fry]]''
|
| 2001-04-05
|
| [[Wales]]
|-
| style='text-align:right'| 10925
| ''[[:d:Q97452647|Matthew Taylor]]''
|
| 1999-08-05
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10926
| ''[[:d:Q97453097|Derek Boote]]''
|
| 1942-12-13
| 1974-11-29
| ''[[:d:Q3402685|Gaerwen]]''
|-
| style='text-align:right'| 10927
| ''[[:d:Q97453295|William Thomas David]]''
|
| 1886-04-19
| 1948-05-29
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 10928
| ''[[:d:Q97467288|Andy Roberton]]''
|
| 1948-03
|
| ''[[:d:Q2254730|Tref-y-clawdd]]''
|-
| style='text-align:right'| 10929
| ''[[:d:Q97486769|Jack Vale]]''
|
| 2001-03-03
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10930
| ''[[:d:Q97500250|Ralph Turner]]''
|
| 1936-07-29
| 2017-09-29
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 10931
| ''[[:d:Q97515198|William Henry Smith]]''
| [[File:William Henry Sedley-Smith.jpg|center|128px]]
| 1806-12-04
| 1872-01-17
| [[Wales]]
|-
| style='text-align:right'| 10932
| ''[[:d:Q97516507|Paul du Feu]]''
|
| 1935
| 2013-01-01
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 10933
| ''[[:d:Q97531979|Mary Bowen]]''
|
| 1635
| 1707
| [[Wales]]
|-
| style='text-align:right'| 10934
| ''[[:d:Q97564245|Dafydd Gruffydd]]''
|
| 1911
| 1982
| [[Cairdiff]]
|-
| style='text-align:right'| 10935
| ''[[:d:Q97579239|Ahmed Yasine Ali]]''
|
|
|
| [[Newport]]
|-
| style='text-align:right'| 10936
| ''[[:d:Q97579262|Peter Hope Jones]]''
|
| 1935-05-21
| 2020-07-13
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 10937
| ''[[:d:Q97628029|Jacob Rees]]''
|
| 1844-10-15
| 1933-10-16
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10938
| ''[[:d:Q97657068|Albert Powell]]''
|
| 1908-06-22
| 1940-10-18
| ''[[:d:Q2664179|Bargoed]]''
|-
| style='text-align:right'| 10939
| ''[[:d:Q97657108|Fred Jones]]''
|
| 1909-08-26
| 1994-08
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 10940
| ''[[:d:Q97696565|John Rhys Williams]]''
|
| 1925
| 2017-09-30
| [[Wales]]
|-
| style='text-align:right'| 10941
| ''[[:d:Q97732453|Eluned Gramich]]''
|
| 1989
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 10942
| ''[[:d:Q97741582|Rhian Cleverly]]''
| [[File:Lewes FC Women 2 Liverpool Women 2 01 11 2020-242 (50557034961).jpg|center|128px]]
| 1995-01-11
|
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 10943
| ''[[:d:Q97741605|Ellie Leek]]''
| [[File:Ellie Leek Blackburn Rovers Women 2021 (sq cropped).jpg|center|128px]]
| 1995-01-21
|
| [[Torfaen]]
|-
| style='text-align:right'| 10944
| ''[[:d:Q97817249|H. Harford Williams]]''
|
| 1931
| 2018-07-04
| ''[[:d:Q6809972|Meidrim]]''
|-
| style='text-align:right'| 10945
| ''[[:d:Q97837328|Rhys Williams]]''
|
| 1921
| 2020-06-25
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 10946
| ''[[:d:Q97860783|Charlie Smith]]''
|
| 1915-08-26
| 1984-03-31
| [[Cairdiff]]
|-
| style='text-align:right'| 10947
| ''[[:d:Q97949525|Rod Williams]]''
|
| 1909-12-02
| 1987
| [[Newport]]
|-
| style='text-align:right'| 10948
| ''[[:d:Q98019030|Rhydian Richards]]''
|
| 1975-12-08
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10949
| ''[[:d:Q98076937|Jonathan Denning]]''
|
| 1991-01-03
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 10950
| ''[[:d:Q98078703|Hilda Wilson]]''
| [[File:Hilda Wilson.png|center|128px]]
| 1860-04-07
| 1918-12-01
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 10951
| ''[[:d:Q98088454|Harry Powell]]''
|
| 1995-06-01
|
| [[Newport]]
|-
| style='text-align:right'| 10952
| ''[[:d:Q98098855|Scott Phillips]]''
|
| 1994-03-31
|
| [[Swansea]]
|-
| style='text-align:right'| 10953
| ''[[:d:Q98104064|Ieuan Owen]]''
|
|
|
| ''[[:d:Q787395|Llanfairfechan]]''
|-
| style='text-align:right'| 10954
| ''[[:d:Q98185610|Richard Charles]]''
|
| 1823
| 1883
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 10955
| ''[[:d:Q98188056|Reuben de Maid]]''
|
| 2005-03-24
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10956
| ''[[:d:Q98208516|Gwyn Jones Francis]]''
|
| 1930-09-17
| 2015-11-27
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 10957
| ''[[:d:Q98380225|Claire Robertson]]''
|
| 1975-08-25
| 2017-10-26
| ''[[:d:Q4923812|Blaengwynfi]]''
|-
| style='text-align:right'| 10958
| ''[[:d:Q98399836|Rebecca Owen]]''
|
|
| 1697-08-23
| [[Wales]]
|-
| style='text-align:right'| 10959
| ''[[:d:Q98479345|John Crandon Gridley]]''
|
| 1904-05-28
| 1968-11-25
| [[Cairdiff]]
|-
| style='text-align:right'| 10960
| ''[[:d:Q98707343|R. Mansell Prothero]]''
|
| 1924-08-20
| 2013-12-24
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 10961
| ''[[:d:Q98761657|Ronald Clifford Bateman]]''
|
| 1947<br/>1947-07
|
| [[Wales]]
|-
| style='text-align:right'| 10962
| ''[[:d:Q98803946|Emrys Jones]]''
| [[File:Emrys Jones aboard 'Canadusa' at Waterways -- Jones INS-331 (cropped).jpg|center|128px]]
| 1905-09-15
| 1973
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 10963
| ''[[:d:Q98886407|Dafydd Edwards]]''
|
|
|
| ''[[:d:Q4897692|Bethania]]''
|-
| style='text-align:right'| 10964
| ''[[:d:Q98899882|Richie Thomas]]''
|
| 1906
| 1988
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 10965
| ''[[:d:Q98917019|Samuel Jones]]''
|
| 1735
| 1814
| [[Wales]]
|-
| style='text-align:right'| 10966
| ''[[:d:Q98926499|Vashon Baker]]''
|
| 1811
| 1878-01-12
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 10967
| ''[[:d:Q98926785|Joseph Baker]]''
|
| 1817
| 1893-10-20
| ''[[:d:Q2532363|Llanandras]]''
|-
| style='text-align:right'| 10968
| ''[[:d:Q98930729|Brian Bluck]]''
| [[File:Brian Bluck.jpg|center|128px]]
| 1935-08-29
| 2015
| ''[[:d:Q3400823|Pîl]]''
|-
| style='text-align:right'| 10969
| ''[[:d:Q98970349|Sonny Lewis]]''
|
| 2005
|
| [[Newport]]
|-
| style='text-align:right'| 10970
| ''[[:d:Q98971974|Lewys Twamley]]''
|
| 2003-08-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10971
| ''[[:d:Q99308880|Stewart Buckle Carne Ross]]''
|
| 1876-01-18
| 1923-10-15
| [[Cairdiff]]
|-
| style='text-align:right'| 10972
| ''[[:d:Q99335237|Stephen Banister]]''
|
| 1918-10-07
| 2006-06-28
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 10973
| ''[[:d:Q99479049|CDawgVA]]''
| [[File:CDawgVA at SMASH 2022.jpg|center|128px]]
| 1996-07-26
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 10974
| ''[[:d:Q99540803|John Woolley]]''
|
| 1951
|
| [[Wales]]
|-
| style='text-align:right'| 10975
| ''[[:d:Q100144360|Casi Wyn]]''
| [[File:Casi Wyn in Capel Moriah 03.JPG|center|128px]]
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 10976
| ''[[:d:Q100235419|Robert Albert Jones]]''
|
| 1864
|
| [[Wales]]
|-
| style='text-align:right'| 10977
| ''[[:d:Q100243553|Charlie Hulson]]''
|
| 1993-03-07
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 10978
| ''[[:d:Q100285075|W. H. Sherwood Roberts]]''
|
| 1834-10-16
| 1917-01-22
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 10979
| ''[[:d:Q100396308|Ken Messer]]''
|
| 1931-07-03
| 2018-04-28
| [[Newport]]
|-
| style='text-align:right'| 10980
| ''[[:d:Q100596005|Sarah J. Lloyd]]''
|
| 1896
|
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 10981
| ''[[:d:Q100605823|Harry Ridley]]''
|
| 1868
| 1949-01-11
| ''[[:d:Q771986|Cas-gwent]]''
|-
| style='text-align:right'| 10982
| ''[[:d:Q100634638|Jalisa Andrews]]''
|
| 1994
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 10983
| ''[[:d:Q100741889|Llinos Medi]]''
| [[File:Official portrait of Llinos Medi MP crop 2.jpg|center|128px]]
|
|
| ''[[:d:Q42617191|Isle of Anglesey]]''
|-
| style='text-align:right'| 10984
| ''[[:d:Q100805872|Allen Phillips Griffiths]]''
|
| 1927-06-11
| 2014-12-01
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 10985
| ''[[:d:Q100929975|Jamie Hill]]''
|
| 1999-06-14
|
| [[Pontypridd]]
|-
| style='text-align:right'| 10986
| ''[[:d:Q100942348|Dai Powell]]''
|
| 1935-01-19
|
| [[Swansea]]
|-
| style='text-align:right'| 10987
| ''[[:d:Q100951828|Emily Maltman]]''
| [[File:Emily Maltman.jpg|center|128px]]
| 1982-02-22
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 10988
| ''[[:d:Q100998829|Robert William Evans]]''
| [[File:Robert William Evans mayor of Rockhampton.png|center|128px]]
| 1862<br/>1872-07-24
| 1955-06-11
| [[Swansea]]
|-
| style='text-align:right'| 10989
| ''[[:d:Q101054639|Paul Merchant]]''
|
| 1945-05-29
|
| [[Wales]]
|-
| style='text-align:right'| 10990
| ''[[:d:Q101079978|Thomas North]]''
|
| 1858
| 1942
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 10991
| ''[[:d:Q101090855|Callum Carson]]''
|
| 1999-03-13
|
| [[Wales]]
|-
| style='text-align:right'| 10992
| ''[[:d:Q101103863|Reilly Featherstone]]''
|
| 1998-12-22
|
| [[Newport]]
|-
| style='text-align:right'| 10993
| ''[[:d:Q101130033|Joe Hawkins]]''
| [[File:Joe Hawkins 2023.jpg|center|128px]]
| 2002-06-11
|
| [[Wales]]
|-
| style='text-align:right'| 10994
| ''[[:d:Q101221023|Arianwen]]''
|
| 5th century
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 10995
| ''[[:d:Q101223178|Leighton Alfred]]''
|
| 1962-08-27
|
| [[Wales]]
|-
| style='text-align:right'| 10996
| ''[[:d:Q101417476|Eric Roberts]]''
|
| 1945
| 1979
| [[Wales]]
|-
| style='text-align:right'| 10997
| ''[[:d:Q101417848|Jac Price]]''
|
| 2000-08-04
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 10998
| ''[[:d:Q101513237|Rhys Jenkins]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 10999
| ''[[:d:Q101553967|Russell L. Jones]]''
|
|
|
| ''[[:d:Q5319397|Dyserth]]''
|-
| style='text-align:right'| 11000
| ''[[:d:Q101915918|Eluned King]]''
| [[File:2019 UCI Juniors Track World Championships 092.jpg|center|128px]]
| 2002-08-01
|
| [[Swansea]]
|-
| style='text-align:right'| 11001
| ''[[:d:Q102036559|Harrison Bright]]''
|
| 2004
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 11002
| ''[[:d:Q102036561|Callum Brain]]''
|
| 2003-06-10
|
| [[Newport]]
|-
| style='text-align:right'| 11003
| ''[[:d:Q102036566|Aneurin Livermore]]''
|
| 2003-01-18
|
| [[Wales]]
|-
| style='text-align:right'| 11004
| ''[[:d:Q102036570|Callum Ryan-Phillip]]''
|
| 2004-05-14
|
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 11005
| ''[[:d:Q102046790|Teddy Williams]]''
| [[File:Teddy Williams March 2023.jpg|center|128px]]
| 2000-10-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11006
| ''[[:d:Q102079613|Rosa M. Morris]]''
|
| 1914
| 2011
| ''[[:d:Q7359368|Rogerstone]]''
|-
| style='text-align:right'| 11007
| ''[[:d:Q102114729|Peter W. M. John]]''
|
| 1923-08-20
| 2015-01-22
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 11008
| ''[[:d:Q102161876|Henry Chapman]]''
|
| 1868-01-07
| 1942-05-05
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 11009
| ''[[:d:Q102182387|Arthur John Capel]]''
|
| 1894-12-11
| 1979-04-18
| [[Cairdiff]]
|-
| style='text-align:right'| 11010
| ''[[:d:Q102184605|Harold Horton]]''
|
| 1881
| 1969
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11011
| ''[[:d:Q102188216|Paul H. Roberts]]''
|
| 1929-09-13
| 2022-11-17
| [[Aberystwyth]]
|-
| style='text-align:right'| 11012
| ''[[:d:Q102229381|A. Thomas Fuller]]''
|
| 1924-07-06
|
| [[Newport]]
|-
| style='text-align:right'| 11013
| ''[[:d:Q102245338|Gwilym Bradley]]''
|
| 2000-09-10
|
| [[Wales]]
|-
| style='text-align:right'| 11014
| ''[[:d:Q102245350|Iestyn Harris]]''
|
| 1998-11-24
|
| [[Wales]]
|-
| style='text-align:right'| 11015
| ''[[:d:Q102247988|Cadwaladr Roberts]]''
| [[File:Mr. Cadwaladr Roberts arweinydd adnabyddus Cor Meibion y Moelwyn a Chor Mawr Ffestiniog (5449681).jpg|center|128px]]
| 1854-06-05
| 1915-06-14
| ''[[:d:Q3398814|Tanygrisiau]]''
|-
| style='text-align:right'| 11016
| ''[[:d:Q102289268|Ash Randall]]''
|
| 1989-06-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11017
| ''[[:d:Q102331169|John James]]''
|
| 1872-03-03
| 1932
| ''[[:d:Q5200192|Cynwyl Elfed]]''
|-
| style='text-align:right'| 11018
| ''[[:d:Q102359203|Stuart Cornes]]''
|
| 1960-03-04
|
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 11019
| ''[[:d:Q102428219|James Beaumont]]''
|
| 1988-03-30
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11020
| ''[[:d:Q102432298|Robert Owen Jones]]''
|
| 1837-11-24
| 1926
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 11021
| ''[[:d:Q102735094|Mason Grady]]''
| [[File:Mason Grady u20 2022.jpg|center|128px]]
| 2002-03-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11022
| ''[[:d:Q102819062|Ivor John Thomas]]''
|
| 1873
| 1913-04-03
| [[Newport]]
|-
| style='text-align:right'| 11023
| ''[[:d:Q103716744|Taine Plumtree]]''
|
| 2000-03-09
|
| [[Swansea]]
|-
| style='text-align:right'| 11024
| ''[[:d:Q103811325|Owen Vaughan Jones]]''
|
| 1907-12-27
| 1986-09-04
| ''[[:d:Q3400157|Llanwnda]]''
|-
| style='text-align:right'| 11025
| ''[[:d:Q103976474|Anne Briar Riddall]]''
|
| 1940-08-13
| 2016-05-22
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 11026
| ''[[:d:Q103996099|Tom Broster]]''
|
| 1878-10-06
| 1942-05-19
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11027
| ''[[:d:Q104057253|Scott McGlynn]]''
| [[File:Scott McGlynn.jpg|center|128px]]
| 1987-05-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11028
| ''[[:d:Q104094371|Winston Jenkins]]''
|
| 1912
| 1982
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 11029
| ''[[:d:Q104175572|Luke Yendle]]''
|
| 2000-06-27
|
| [[Wales]]
|-
| style='text-align:right'| 11030
| ''[[:d:Q104224598|Charlotte Carey]]''
|
| 1996-06-11
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 11031
| ''[[:d:Q104234346|David McKinley Williams]]''
|
| 1887-02-20
| 1978-03-13
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 11032
| ''[[:d:Q104286266|Albert Edward Ashcroft]]''
|
| 1862-07-31
| 1942-04-20
| ''[[:d:Q24663457|Cwmbach]]''
|-
| style='text-align:right'| 11033
| ''[[:d:Q104286274|James Daniel Baird]]''
|
| 1840
| 1908-01-01
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 11034
| ''[[:d:Q104286445|Charles Davy]]''
|
| 1825
| 1914-04-16
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 11035
| ''[[:d:Q104286719|William Charles Kensington]]''
|
| 1845
| 1922-08-20
| ''[[:d:Q1139893|Cricieth]]''
|-
| style='text-align:right'| 11036
| ''[[:d:Q104286775|Thomas Snow Miller]]''
|
| 1859-11-16
| 1917-08-13
| [[Wales]]
|-
| style='text-align:right'| 11037
| ''[[:d:Q104369841|Edwin Davy]]''
|
| 1826
| 1869-02-13
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 11038
| ''[[:d:Q104415876|Pedr Ap Llwyd]]''
|
| 1957-02-20
|
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 11039
| ''[[:d:Q104531559|Zoe Bäckstedt]]''
| [[File:2021 UEC Track Jun & U23 European Championships 043.jpg|center|128px]]
| 2004-09-24
|
| ''[[:d:Q3404556|Pontyclun]]''
|-
| style='text-align:right'| 11040
| ''[[:d:Q104544505|Eric Williams]]''
|
| 1927-11-17
| 2009-07-24
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11041
| ''[[:d:Q104545709|Ian Williams]]''
|
| 1931-08-04
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11042
| ''[[:d:Q104586821|John Bale]]''
|
| 1940-01-14
| 2023
| [[Cairdiff]]
|-
| style='text-align:right'| 11043
| ''[[:d:Q104590335|Ruben Chorlton-Owen]]''
|
| 2001-06-21
|
| [[Wales]]
|-
| style='text-align:right'| 11044
| ''[[:d:Q104655980|Denise Sommers]]''
|
| 1969-04-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11045
| ''[[:d:Q104719149|Alun Jones]]''
|
| 1966-12-15
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 11046
| ''[[:d:Q104758912|Kelvin Thomas]]''
|
| 1919-09-14
| 2019-06-14
| [[Cairdiff]]
|-
| style='text-align:right'| 11047
| ''[[:d:Q104761592|Nansi Williams]]''
|
| 1922
| 1966-10-21
| ''[[:d:Q3244565|Aberfan]]''
|-
| style='text-align:right'| 11048
| ''[[:d:Q104761963|Cameron Evans]]''
|
| 2001-02-23
|
| [[Swansea]]
|-
| style='text-align:right'| 11049
| ''[[:d:Q104765398|Matilda Devries]]''
|
| 2003-12-31
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11050
| ''[[:d:Q104768094|Kemsley Mathias]]''
| [[File:Kemsley Mathias 2022.jpg|center|128px]]
| 1999-07-29
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 11051
| ''[[:d:Q104821881|Charles Lewis]]''
|
| 1828-04-14
| 1913-03-26
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 11052
| ''[[:d:Q104839512|Mirain Llwyd Owen]]''
|
| 1973
| 2021-01-13
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11053
| ''[[:d:Q104839524|James Jones]]''
|
| 1997-03-03
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11054
| ''[[:d:Q104883931|Gwynn Davies]]''
| [[File:R Gwynn Davies.jpg|center|128px]]
| 1920-01-19
| 2007-10-12
| ''[[:d:Q2983932|Waunfawr]]''
|-
| style='text-align:right'| 11055
| ''[[:d:Q104906897|Lyndon Simmonds]]''
|
| 1966-11-11
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 11056
| ''[[:d:Q104907464|Charlie Caton]]''
|
| 2002-11-25
|
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 11057
| ''[[:d:Q104945292|Adelaide Eyre]]''
|
| 1826-10-30
| 1905-05-17
| ''[[:d:Q1965490|Laugharne]]''
|-
| style='text-align:right'| 11058
| ''[[:d:Q105047935|John Howell]]''
|
| 1871-09-19
| 1945-03-04
| ''[[:d:Q8059809|Ystradyfodwg]]''
|-
| style='text-align:right'| 11059
| ''[[:d:Q105070508|Callum Scott Howells]]''
|
| 1999
|
| [[Pontypridd]]
|-
| style='text-align:right'| 11060
| ''[[:d:Q105077276|Evan Prosser]]''
|
| 1836
| 1896-08-02
| [[Wales]]
|-
| style='text-align:right'| 11061
| ''[[:d:Q105080581|Ffion Davies]]''
| [[File:Ffion Davies OF 02.jpg|center|128px]]
| 1995-01-18
|
| [[Swansea]]
|-
| style='text-align:right'| 11062
| ''[[:d:Q105134303|Alan Wynne-Thomas]]''
|
| 1941
| 2008-09-28
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11063
| ''[[:d:Q105140904|Rufus Wells]]''
|
| 1947-07-03
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11064
| ''[[:d:Q105155076|David Graham Jenkins]]''
|
| 1933
| 1995
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 11065
| ''[[:d:Q105188058|Richard Hermer]]''
| [[File:Richard Hermer Official Cabinet Portrait, July 2024 (cropped).jpg|center|128px]]
| 1968-09
|
| ''[[:d:Q1152204|South Glamorgan]]''
|-
| style='text-align:right'| 11066
| ''[[:d:Q105199556|Dan Hawkins]]''
|
| 2001-04-22
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11067
| ''[[:d:Q105295044|Henry Troadec]]''
|
| 1915-05-30
| 2017-06-01
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11068
| ''[[:d:Q105298835|Jill Nalder]]''
| [[File:Jill nalder 2022 1.jpg|center|128px]]
| 1961
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11069
| ''[[:d:Q105305836|Steffan Thomas]]''
|
| 1997-04-27
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11070
| ''[[:d:Q105319846|Alex George]]''
| [[File:Alex George at the British Library.jpg|center|128px]]
| 1990-02-15
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11071
| ''[[:d:Q105344677|Rowland James Williams]]''
|
| 1919
| 2005-10-12
| ''[[:d:Q13130114|Merthyr]]''
|-
| style='text-align:right'| 11072
| ''[[:d:Q105388992|Rhian Nest James]]''
|
| 1962
|
| [[Wales]]
|-
| style='text-align:right'| 11073
| ''[[:d:Q105437716|Joshua Milton]]''
| [[File:Joshua Milton 2, 2015 Wimbledon Qualifying - Diliff.jpg|center|128px]]
| 1989-10-14
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11074
| ''[[:d:Q105480896|Rubin Colwill]]''
|
| 2002-04-27
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11075
| ''[[:d:Q105514757|C. R. Jones]]''
| [[File:C. R. Jones, Ysw., Y.H., Llanfyllin (5236452).jpg|center|128px]]
| 1828
| 1902
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11076
| ''[[:d:Q105549362|Michael Roberts]]''
|
| 1943-12-01
| 2014-11-14
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 11077
| ''[[:d:Q105560094|Lewy Williams]]''
|
| 2002-01-18
|
| [[Swansea]]
|-
| style='text-align:right'| 11078
| ''[[:d:Q105753094|Huw Williams]]''
|
| 1960-11-20
|
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 11079
| ''[[:d:Q105803185|Donald Hoskins]]''
|
| 1933
| 2021-02-12
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 11080
| ''[[:d:Q105810383|John P. Mahoney]]''
| [[File:1918 John Mahoney Massachusetts House of Representatives.png|center|128px]]
| 1888-05-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11081
| ''[[:d:Q105812487|Sam Pearson]]''
|
| 2001-10-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11082
| ''[[:d:Q105821038|Cai Tomos]]''
|
| 1979
|
| [[Wales]]
|-
| style='text-align:right'| 11083
| ''[[:d:Q105824928|Ivan Dale Owen]]''
|
| 1924-08-02
| 1997-11-12
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11084
| ''[[:d:Q105883342|Cyril Glyndwr Williams]]''
|
| 1921-06-01
| 2004-03-31
| ''[[:d:Q7228391|Pontyates]]''
|-
| style='text-align:right'| 11085
| ''[[:d:Q105887434|Cliff Tamplin]]''
|
| 1920-05-14
| 2006-02-01
| [[Cairdiff]]
|-
| style='text-align:right'| 11086
| ''[[:d:Q105893541|Howard A Barnes]]''
|
| 1944-04-08
|
| ''[[:d:Q2564732|Aberbargoed]]''
|-
| style='text-align:right'| 11087
| ''[[:d:Q105946397|Gwenan Davies]]''
| [[File:Gwen CS.jpg|center|128px]]
| 1994-05-12
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11088
| ''[[:d:Q105946804|William Henry Davies]]''
|
| 1849
| 1907-01-20
| [[Monmouthshire]]
|-
| style='text-align:right'| 11089
| ''[[:d:Q105959279|Ali Kent]]''
|
| 1960-11-13
|
| [[Swansea]]
|-
| style='text-align:right'| 11090
| ''[[:d:Q105972198|Hugh Jones]]''
|
| 1966-11-12
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11091
| ''[[:d:Q105973425|Peter Elliott]]''
| [[File:Peter Elliott.jpg|center|128px]]
| 1958-08-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11092
| ''[[:d:Q105981798|Ursula Martin]]''
| [[File:One Woman Walks - Ursula Martin.jpg|center|128px]]
| 1980-02-24
|
| [[Swansea]]
|-
| style='text-align:right'| 11093
| ''[[:d:Q105993903|William George Conley]]''
|
| 1842-07-12
| 1924-05-08
| [[Newport]]
|-
| style='text-align:right'| 11094
| ''[[:d:Q106096160|Alex Griffiths]]''
|
| 2002-06-12
|
| [[Swansea]]
|-
| style='text-align:right'| 11095
| ''[[:d:Q106097840|Claire Nicholas]]''
|
| 1986-09-08
|
| [[Swansea]]
|-
| style='text-align:right'| 11096
| ''[[:d:Q106097845|Lauren Parfitt]]''
|
| 1994-04-01
|
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 11097
| ''[[:d:Q106104065|Phil Obbard]]''
|
| 1949-03-24
|
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 11098
| ''[[:d:Q106141816|Owen Smith]]''
| [[File:Owen Smith 2019 (cropped).jpg|center|128px]]
| 1994-11-07
|
| ''[[:d:Q7659625|Sychdyn]]''
|-
| style='text-align:right'| 11099
| ''[[:d:Q106166812|Vernon Stanley Jones]]''
|
| 1875-08-06
| 1955-12-04
| ''[[:d:Q3402138|Ystrad Meurig]]''
|-
| style='text-align:right'| 11100
| ''[[:d:Q106193079|Byron Wozencraft]]''
|
| 1951-09-26
| 1998-12-26
| [[Swansea]]
|-
| style='text-align:right'| 11101
| ''[[:d:Q106193204|John Corfe]]''
|
| 1935-08-29
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11102
| ''[[:d:Q106193220|Dyfri Jones]]''
|
| 1943-05-05
| 2011-04-29
| [[Cairdiff]]
|-
| style='text-align:right'| 11103
| ''[[:d:Q106193430|John Assiratti]]''
|
| 1946-02-26
|
| ''[[:d:Q24638205|Rhondda Valley]]''
|-
| style='text-align:right'| 11104
| ''[[:d:Q106193530|Paul Linwood]]''
|
| 1971-01-31
|
| [[Newport]]
|-
| style='text-align:right'| 11105
| ''[[:d:Q106193983|Terry James]]''
|
| 1946-06-08
|
| [[Pontypridd]]
|-
| style='text-align:right'| 11106
| ''[[:d:Q106194128|Liam Meek]]''
|
| 1998-03-03
|
| [[Newport]]
|-
| style='text-align:right'| 11107
| ''[[:d:Q106201505|Cavan Phillips]]''
|
| 1998-11-04
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11108
| ''[[:d:Q106201762|Justin Smith]]''
|
| 1997-07-05
|
| ''[[:d:Q3405138|St Dogmaels]]''
|-
| style='text-align:right'| 11109
| ''[[:d:Q106204495|Brian Lashbrook]]''
|
| 1947-06-23
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11110
| ''[[:d:Q106204551|Kenneth Crook]]''
|
| 1949-02-10
| 2014-07-14
| [[Swansea]]
|-
| style='text-align:right'| 11111
| ''[[:d:Q106243608|Arthur Walter Powell]]''
|
| 1893
| 1970
| [[Cairdiff]]
|-
| style='text-align:right'| 11112
| ''[[:d:Q106254832|Gwenllian Howells]]''
| [[File:Gwenllian Evans (5236480).jpg|center|128px]]
|
|
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 11113
| ''[[:d:Q106270402|Angela Hui]]''
| [[File:Angela hui 2022 1.jpg|center|128px]]
| 1991
|
| ''[[:d:Q3404708|Beddau]]''
|-
| style='text-align:right'| 11114
| ''[[:d:Q106314366|Rosie Andrews]]''
|
| 1949-04-16
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11115
| ''[[:d:Q106351904|Adi Taviner]]''
|
| 1990-02-20
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11116
| ''[[:d:Q106364026|Kerin Lake]]''
|
| 1990-05-24
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11117
| ''[[:d:Q106369503|Eleanor Daniels]]''
| [[File:EleanorDaniels1914.tif|center|128px]]
| 1886-12-28
| 1994-03-18
| ''[[:d:Q6661077|Llanarthney]]''
|-
| style='text-align:right'| 11118
| ''[[:d:Q106393535|Amy Noel Morfydd Ballinger]]''
| [[File:Amy Noel Morfydd Ballinger (5449693).jpg|center|128px]]
| 1907
| 1950-09-26
| ''[[:d:Q1244613|Llandaf]]''
|-
| style='text-align:right'| 11119
| ''[[:d:Q106418087|James Hughes]]''
| [[File:James Hughes (Glanrheidol) first Mayor reformed corporation of Aberystwyth, A.D. 1836 (5349083).jpg|center|128px]]
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 11120
| ''[[:d:Q106418333|William Jones]]''
| [[File:William Jones, 'Monfa' (of Bootle) (5349085).jpg|center|128px]]
| 1840
| 1918
| ''[[:d:Q13126121|Bodwrog]]''
|-
| style='text-align:right'| 11121
| ''[[:d:Q106418847|John Lloyd Griffith]]''
| [[File:The late J. Lloyd Griffith Esq., M.A (5348993).jpg|center|128px]]
| 1839-01-06
| 1902-01-01
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 11122
| ''[[:d:Q106421024|Dai Games]]''
|
| 1938
| 2018-05
| ''[[:d:Q8054074|Ynysddu]]''
|-
| style='text-align:right'| 11123
| ''[[:d:Q106452516|Ren]]''
|
| 1990-03-29
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11124
| ''[[:d:Q106459264|Jack Shore]]''
| [[File:Jack Shore at CAGE Warrior 100.jpg|center|128px]]
| 1995-02-06
|
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 11125
| ''[[:d:Q106465167|Alisha Butchers]]''
|
| 1997-06-14
|
| [[Swansea]]
|-
| style='text-align:right'| 11126
| ''[[:d:Q106465233|Cornelius Griffiths]]''
| [[File:Rev. Cornelius Griffiths born Feb 25th 1829 ; died Nov 6th 1905 (5293977).jpg|center|128px]]
| 1829-02-25
| 1905-11-06
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 11127
| ''[[:d:Q106465379|Sam Jenkins]]''
| [[File:The Great Welsh Revival Mr. Sam Jenkins-- the Sankey of Wales. (5294015).jpg|center|128px]]
| 1882
|
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 11128
| ''[[:d:Q106465424|May John]]''
| [[File:Miss May John (5294079) (cropped).jpg|center|128px]]
| 1874-01-26
| 1962-10-18
| ''[[:d:Q3399891|Ton Pentre]]''
|-
| style='text-align:right'| 11129
| ''[[:d:Q106467715|David Charles Davies]]''
| [[File:David Charles Davies at Palm Beach, Florida, 1908 (5449735).jpg|center|128px]]
| 1866
| 1928-07-14
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 11130
| ''[[:d:Q106468578|Rosamund Victoria Salusbury]]''
| [[File:Miss Salusbury (daughter of the late Major Salusbury, owner of the Bachygraig Estate) (5449764) (cropped).jpg|center|128px]]
| 1885
| 1950
| [[Wales]]
|-
| style='text-align:right'| 11131
| ''[[:d:Q106472293|Catherine Miriam Anwyl]]''
| [[File:Catherine Miriam Anwyl (5449774) (cropped).jpg|center|128px]]
| 1871
| 1953
| [[Wales]]
|-
| style='text-align:right'| 11132
| ''[[:d:Q106492696|Gwenllian Pyrs]]''
|
| 1997-11-28
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11133
| ''[[:d:Q106496101|Robyn Wilkins]]''
|
| 1995-04-01
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11134
| ''[[:d:Q106501654|Chris Riley]]''
|
| 1939-01-19
| 1983
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 11135
| ''[[:d:Q106518337|Rachel Howell-Evans]]''
|
| 1914-01-15
| 2003-06-01
| ''[[:d:Q14477598|Trefnant]]''
|-
| style='text-align:right'| 11136
| ''[[:d:Q106540639|Amber Davies]]''
| [[File:Amber-davies-51.webp|center|128px]]
| 1996-10-04
|
| ''[[:d:Q1186888|Dinbych]]''<br/>[[Denbighshire|Sir Ddinbych]]<br/>[[Wales]]
|-
| style='text-align:right'| 11137
| ''[[:d:Q106574374|Hugh Harrison]]''
|
| 1875-04-16
| 1912-05-15
| ''[[:d:Q5468045|Forden]]''
|-
| style='text-align:right'| 11138
| ''[[:d:Q106588660|Kenneth Davies]]''
|
| 1925-12-20<br/>1928
| 2015-06-15
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11139
| ''[[:d:Q106602538|Joan M. Eyles]]''
|
| 1907-06-15
| 1986-06-14
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11140
| ''[[:d:Q106604082|Jamie Miller]]''
| [[File:Jamie Miller 2022.png|center|128px]]
| 1997-09-09
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11141
| ''[[:d:Q106614747|Immanuel Feyi-Waboso]]''
| [[File:Immanuel Feyi-Waboso LQ Feb 2024.jpg|center|128px]]
| 2002-12-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11142
| ''[[:d:Q106629768|Ann Parry Owen]]''
| [[File:Annparryowen02.jpg|center|128px]]
|
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11143
| ''[[:d:Q106629794|Johanna Waters]]''
|
| 1976
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11144
| ''[[:d:Q106635128|Benjamin Thomas]]''
|
| 1838-04-09
| 1920
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 11145
| ''[[:d:Q106636382|Owen E. Evans]]''
|
| 1920-12-23
| 2018-10-31
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 11146
| ''[[:d:Q106637558|Frank Robinson Brown]]''
|
| 1910-12-13
| 1981-09-11
| [[Cairdiff]]
|-
| style='text-align:right'| 11147
| ''[[:d:Q106638464|Alwyn Owens]]''
|
| 1931
| 2023
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 11148
| ''[[:d:Q106645035|Shaquille Wynter-Coles]]''
|
| 2000-10-10
|
| [[Wales]]<br/>[[Ingland]]
|-
| style='text-align:right'| 11149
| ''[[:d:Q106669233|Herbert Forsdike]]''
|
| 1875-11-06
| 1942-03-29
| [[Cairdiff]]
|-
| style='text-align:right'| 11150
| ''[[:d:Q106687698|Timothy Jones]]''
|
| 1967-01-18
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11151
| ''[[:d:Q106697312|Patricia Bellotti]]''
|
| 1931-07-03
| 2017-12-04
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 11152
| ''[[:d:Q106705757|Emma Packe]]''
| [[File:Mrs Packe c1875.jpg|center|128px]]
| 1840-04-20
| 1914-07-11
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 11153
| ''[[:d:Q106716134|Caroline Orr]]''
|
| 1862-06-05
| 1945-04-05
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 11154
| ''[[:d:Q106754536|Gareth Davies]]''
| [[File:GarethDaviesMS-Castle.jpg|center|128px]]
|
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 11155
| ''[[:d:Q106761230|Buffy Williams]]''
| [[File:Buffy-williams.jpg|center|128px]]
| 1976-11-01
|
| [[Williamstown, Rhondda Cynon Taf|Williamstown]]
|-
| style='text-align:right'| 11156
| ''[[:d:Q106762245|James Evans]]''
| [[File:James-evans.jpg|center|128px]]
|
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 11157
| ''[[:d:Q106763028|Mervyn Davies]]''
|
| 1918-01-17
| 2015-05-12
| [[Swansea]]
|-
| style='text-align:right'| 11158
| ''[[:d:Q106766510|Cefin Campbell]]''
| [[File:Cefin Campbell yng Nghaerfyrddin (cropped).jpg|center|128px]]
| 1950
|
| ''[[:d:Q2079042|Glanamman]]''
|-
| style='text-align:right'| 11159
| ''[[:d:Q106808905|Lawrie Hooper]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11160
| ''[[:d:Q106812083|Lisa Neumann]]''
|
| 1993-12-23
|
| [[Swansea]]
|-
| style='text-align:right'| 11161
| ''[[:d:Q106814756|Luke Fletcher]]''
| [[File:Luke-fletcher.jpg|center|128px]]
|
|
| ''[[:d:Q2567716|Pencoed]]''
|-
| style='text-align:right'| 11162
| ''[[:d:Q106823039|Gwynfryn Morgan Daniel]]''
|
| 1904-08-01
| 1960-10-31
| ''[[:d:Q4980820|Bryn]]''
|-
| style='text-align:right'| 11163
| ''[[:d:Q106827606|John Geoffrey Jones]]''
|
| 1928-09-14
| 2014-06-14
| ''[[:d:Q2253279|Burry Port]]''
|-
| style='text-align:right'| 11164
| ''[[:d:Q106908968|Barbara Cooper]]''
|
| 1929-10-10
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 11165
| ''[[:d:Q106935335|Joe Roberts]]''
|
| 2000-05-10
|
| [[Swansea]]
|-
| style='text-align:right'| 11166
| ''[[:d:Q106940566|Mike Prosser]]''
|
| 1966
|
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 11167
| ''[[:d:Q106959770|Samuel Islwyn Evans]]''
|
| 1914-12-29
| 1999-05-05
| ''[[:d:Q3395358|Kidwelly]]''
|-
| style='text-align:right'| 11168
| ''[[:d:Q107012530|Harriet Jones]]''
|
| 1997-05-27
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11169
| ''[[:d:Q107021806|Mark Harding]]''
|
| 1971-06-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11170
| ''[[:d:Q107031300|Mared Jarman]]''
|
| 1994
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11171
| ''[[:d:Q107033474|Hanna Jarman]]''
|
| 1989
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11172
| ''[[:d:Q107062398|Noel Kennedy]]''
|
| 1965
|
| [[Wales]]
|-
| style='text-align:right'| 11173
| ''[[:d:Q107094503|Christopher Williams]]''
|
| 1972
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11174
| ''[[:d:Q107126154|Ntazana Mayembe]]''
|
| 2003-04-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11175
| ''[[:d:Q107127836|Nick Laughland]]''
|
| 1951-05-25
| 2020-06-01
| ''[[:d:Q1009261|Caerllion]]''
|-
| style='text-align:right'| 11176
| ''[[:d:Q107182198|Frederick George Albert Stuckey]]''
|
| 1870
| 1937-10-07
| [[Wales]]
|-
| style='text-align:right'| 11177
| ''[[:d:Q107182592|Elizabeth Jones-Sifford]]''
|
| 1861-02
| 1925-02-04
| [[Wales]]
|-
| style='text-align:right'| 11178
| ''[[:d:Q107207795|Gerald Williams]]''
| [[File:Gerald Williams, nai Hedd Wyn, y tu allan i'r Ysgwrn (cropped).jpg|center|128px]]
| 1928-02-06
| 2021-06-11
| ''[[:d:Q10959753|Yr Ysgwrn]]''
|-
| style='text-align:right'| 11179
| ''[[:d:Q107212477|Megan Davies]]''
|
| 2002-01-19
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11180
| ''[[:d:Q107220523|Philip Harrhy Jones]]''
|
| 1931-01-30
| 1994-09-22
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 11181
| ''[[:d:Q107242293|John T. Davies]]''
|
| 1881-05-09
| 1938-03-31
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11182
| ''[[:d:Q107244824|Gavin Bilton]]''
|
| 1988-10-23
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 11183
| ''[[:d:Q107284337|Sarah Green]]''
| [[File:Official portrait of Sarah Green MP.jpg|center|128px]]
| 1982-04-25
|
| ''[[:d:Q2311675|Corwen]]''
|-
| style='text-align:right'| 11184
| ''[[:d:Q107341053|Morris Baron Cohen]]''
|
| 1900-02-16
| 1972-12-21
| [[Pontypridd]]
|-
| style='text-align:right'| 11185
| ''[[:d:Q107355375|Jake Heyward]]''
| [[File:Crop 1500 metres men final Tampere 2018.jpg|center|128px]]
| 1999-04-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11186
| ''[[:d:Q107363545|Wyndham Edwards]]''
|
| 1892-06-23
| 1961-05-08
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 11187
| ''[[:d:Q107366865|Evan Pierce]]''
| [[File:Evan Pierce. Mezzotint by S. W. Reynolds, junior, 1849, afte Wellcome V0006595.jpg|center|128px]]
|
| 1895-03-15
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 11188
| ''[[:d:Q107368806|Percy Baker]]''
|
| 1880-07-27
| 1957
| [[Cairdiff]]
|-
| style='text-align:right'| 11189
| ''[[:d:Q107370884|Wyn Jones]]''
|
| 1959-09-25
| 2021-06-24
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11190
| ''[[:d:Q107394161|Daniel Tudor]]''
|
| 1866-07-21
| 1928-11-23
| ''[[:d:Q728477|Lampeter]]''
|-
| style='text-align:right'| 11191
| ''[[:d:Q107395029|Wil Jones]]''
|
| 1960
| 2020-08-30
| [[Wales]]
|-
| style='text-align:right'| 11192
| ''[[:d:Q107407076|William Lloyd Phillips]]''
|
| 1881-09-08
| 1966-04-22
| [[Newport]]
|-
| style='text-align:right'| 11193
| ''[[:d:Q107411765|Albert Hawkins]]''
|
| 1886-05-21
| 1969
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 11194
| ''[[:d:Q107464879|Billy Poyntz]]''
|
| 1894-03-18
| 1966
| ''[[:d:Q7860286|Tylorstown]]''
|-
| style='text-align:right'| 11195
| ''[[:d:Q107479464|Jeremiah Azu]]''
| [[File:2022-08-21 European Championships 2022 – Men's 4 x 100 Metres by Sandro Halank–014.jpg|center|128px]]
| 2001-05-15
|
| ''[[:d:Q7379326|Rumney]]''
|-
| style='text-align:right'| 11196
| ''[[:d:Q107485959|Edward Robarts]]''
|
| 1770
| 1832
| ''[[:d:Q672545|Barmouth]]''
|-
| style='text-align:right'| 11197
| ''[[:d:Q107500567|Douglas C. Fox]]''
|
| 1906
| 1979
| ''[[:d:Q203387|Betws-y-Coed]]''
|-
| style='text-align:right'| 11198
| ''[[:d:Q107521039|Hannah Brier]]''
|
| 1998-02-03
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11199
| ''[[:d:Q107580139|Andrew York]]''
|
| 1968-05-28
|
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 11200
| ''[[:d:Q107582050|George Brinley Evans]]''
|
| 1925
|
| ''[[:d:Q5318603|Dyffryn Cellwen]]''
|-
| style='text-align:right'| 11201
| ''[[:d:Q107583041|Miggs Wynne Morris]]''
|
| 1938-01-31
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 11202
| ''[[:d:Q107599146|Ian Williams]]''
|
| 1931-08-04
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11203
| ''[[:d:Q107613302|Connor Marshall]]''
|
| 1998-01-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11204
| ''[[:d:Q107631283|Paula Craig]]''
| [[File:Paula Craig MBE British former detective (cropped).jpg|center|128px]]
| 1963
|
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 11205
| ''[[:d:Q107661809|Sir David Nicholas]]''
|
| 1930-01-25
| 2022-06-06
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 11206
| ''[[:d:Q107691517|Taffy Owen]]''
|
| 1936
| 2021
| [[Anglesey]]
|-
| style='text-align:right'| 11207
| ''[[:d:Q107697068|Richard Jones]]''
|
| 1955-08-04
| 2021-07
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11208
| ''[[:d:Q107820965|Hector Pardoe]]''
| [[File:Team GB Hector Pardoe.jpg|center|128px]]
| 2001-03-29
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11209
| ''[[:d:Q108114994|Benjamin Baynton]]''
|
| 1789-09-17
| 1854
| [[Wales]]
|-
| style='text-align:right'| 11210
| ''[[:d:Q108115703|Hefin Elis]]''
|
| 1950-06-04
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11211
| ''[[:d:Q108136770|Robert Roberts]]''
|
| 1674-01-07
| 1728-11-11
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 11212
| ''[[:d:Q108155320|Thomas Davies]]''
|
| 2003-11-11
|
| [[Wales]]
|-
| style='text-align:right'| 11213
| ''[[:d:Q108187231|M. A. Oliver-Semenov]]''
|
|
|
| ''[[:d:Q5368392|Trelái]]''
|-
| style='text-align:right'| 11214
| ''[[:d:Q108192429|Trefor Prest]]''
|
| 1945
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11215
| ''[[:d:Q108217230|David Vaughan Davies]]''
|
| 1911-10-28
| 1969-07-16
| ''[[:d:Q5058745|Cemmaes]]''
|-
| style='text-align:right'| 11216
| ''[[:d:Q108219735|Daniel Williams]]''
|
| 2001-04-20
|
| [[Wales]]
|-
| style='text-align:right'| 11217
| ''[[:d:Q108224262|Henry Foxall]]''
| [[File:Profile Portrait of Henry Foxall.png|center|128px]]
| 1758
| 1823
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 11218
| ''[[:d:Q108243277|Ezzelina Jones]]''
|
| 1921-06-28
| 2012-11-07
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 11219
| ''[[:d:Q108284983|Georgia Wilson]]''
|
| 1995
|
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 11220
| ''[[:d:Q108300147|Derrick Pritchard Webley]]''
|
| 1922-01-02
| 1994-11
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11221
| ''[[:d:Q108313299|Gaynor Madoc Leonard]]''
|
|
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 11222
| ''[[:d:Q108323729|Harri Jenkins]]''
|
| 1996-03-28
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11223
| ''[[:d:Q108354160|Zack Maher]]''
|
| 2002-02-05
|
| [[Newport]]
|-
| style='text-align:right'| 11224
| ''[[:d:Q108373707|Omid Scobie]]''
| [[File:2022 - Fourth Estate SAM 9975 (52472936660) (cropped).jpg|center|128px]]
| 1981-07-04
|
| [[Wales]]<br/>[[Lunnon]]
|-
| style='text-align:right'| 11225
| ''[[:d:Q108386688|Doris Lindner]]''
|
| 1896
| 1979
| ''[[:d:Q2742075|Llanyre]]''
|-
| style='text-align:right'| 11226
| ''[[:d:Q108416183|John Fletcher Owen]]''
| [[File:John Fletcher Owen (4050606421).jpg|center|128px]]
| 1839-04-09
| 1924-06-10
| ''[[:d:Q6661098|Llanbedr-y-Cennin]]''
|-
| style='text-align:right'| 11227
| ''[[:d:Q108485535|Jack Jones]]''
|
|
|
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 11228
| ''[[:d:Q108485546|Noel Edwards]]''
|
| 1898-11-26
|
| ''[[:d:Q6268758|Johnstown]]''
|-
| style='text-align:right'| 11229
| ''[[:d:Q108485747|Sam Bowen]]''
|
| 2001-01-14
|
| [[Wales]]
|-
| style='text-align:right'| 11230
| ''[[:d:Q108524848|Josh Tarling]]''
| [[File:2021 UEC Track Jun & U23 European Championships 278.jpg|center|128px]]
| 2004-02-15
|
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 11231
| ''[[:d:Q108525988|John Charles McLean]]''
|
| 1875-07
| 1952-04-29
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 11232
| ''[[:d:Q108532305|Thomas Matthews]]''
|
| 1992-08-19
|
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11233
| ''[[:d:Q108536009|Kieron Evans]]''
|
| 2001-12-19
|
| ''[[:d:Q10970286|Brithdir]]''
|-
| style='text-align:right'| 11234
| ''[[:d:Q108545267|Patrick Corcoran]]''
|
| 1951-04-11
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11235
| ''[[:d:Q108550800|Iestyn Evans]]''
|
| 2003-12-20
|
| [[Wales]]
|-
| style='text-align:right'| 11236
| ''[[:d:Q108560477|A.M.C. Nicholl]]''
|
| 1879
|
| ''[[:d:Q13644928|Llandough]]''
|-
| style='text-align:right'| 11237
| ''[[:d:Q108566666|J.A. Speed]]''
|
| 1888
|
| [[Swansea]]
|-
| style='text-align:right'| 11238
| ''[[:d:Q108601753|David Rogers Jones]]''
|
| 1942-10-17
| 2022-12-11
| ''[[:d:Q1813948|Prestatyn]]''
|-
| style='text-align:right'| 11239
| ''[[:d:Q108610241|Annie Florence Evans]]''
| [[File:Florrie Evans missionary.png|center|128px]]
| 1884-12-15
| 1967-12-11
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 11240
| ''[[:d:Q108678888|Thomas William Jones]]''
| [[File:Thomas William Jones.webp|center|128px]]
| 1877-11-15
| 1967-06
| ''[[:d:Q3405038|Cemaes]]''
|-
| style='text-align:right'| 11241
| ''[[:d:Q108686833|Thomas Gruffydd Davies]]''
|
| 1931-01-08
| 2019-01-26
| ''[[:d:Q7457421|Blaendulais]]''
|-
| style='text-align:right'| 11242
| ''[[:d:Q108753145|Robert Morris Evans]]''
|
| 1915-10-14
| 2008-02-24
| ''[[:d:Q5446245|Ffynnongroew]]''
|-
| style='text-align:right'| 11243
| ''[[:d:Q108753677|Judith Hockaday]]''
|
| 1929-09-19
| 2019-05-24
| [[Cairdiff]]
|-
| style='text-align:right'| 11244
| ''[[:d:Q108753852|John Glyn Penrhyn Jones]]''
|
| 1921-02-19
| 1973-10-12
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 11245
| ''[[:d:Q108754201|Arthur Griffith Maitland-Jones]]''
|
| 1890-03-06<br/>1890-03-08
| 1957-05-17
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11246
| ''[[:d:Q108754941|Eirwyn Norman Rowlands]]''
|
| 1915-06-11
| 2003-03-08
| ''[[:d:Q4675083|Acrefair]]''
|-
| style='text-align:right'| 11247
| ''[[:d:Q108755272|Reginald Norman Tattersall]]''
|
| 1914-02-13
| 1974-08-24
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11248
| ''[[:d:Q108837354|Dylan Emery]]''
|
| 2001-03-31
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11249
| ''[[:d:Q108874754|Matt Sargent]]''
|
| 2001-07-24
|
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 11250
| ''[[:d:Q108885058|Evan Cambria Thomas]]''
|
| 1867-03-28
| 1930-03-14
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 11251
| ''[[:d:Q109015181|James Rowberry]]''
|
| 1985-04-26
|
| [[Newport]]
|-
| style='text-align:right'| 11252
| ''[[:d:Q109037476|George Bowen]]''
|
| 1745
| 1814
| [[Swansea]]
|-
| style='text-align:right'| 11253
| ''[[:d:Q109062193|Ann Griffiths]]''
|
| 1934-10-26
| 2020-07-24
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 11254
| ''[[:d:Q109276106|Helen Mackay]]''
|
| 1897
| 1973
| [[Cairdiff]]
|-
| style='text-align:right'| 11255
| ''[[:d:Q109278982|Dewi Arwel Hughes]]''
|
| 1947-01-01
| 2017-10-04
| ''[[:d:Q6661536|Llangwm]]''
|-
| style='text-align:right'| 11256
| ''[[:d:Q109296921|Owen Beck]]''
| [[File:Owen Beck.png|center|128px]]
| 2002-08-09
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11257
| ''[[:d:Q109339963|Gerard Dynevor]]''
|
| 1931
| 1966-05-21
| [[Cairdiff]]
|-
| style='text-align:right'| 11258
| ''[[:d:Q109381288|Shirley Dynevor]]''
|
| 1933
| 2023
| [[Cairdiff]]
|-
| style='text-align:right'| 11259
| ''[[:d:Q109442672|Grahame Fox]]''
|
| 1963
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11260
| ''[[:d:Q109479497|Thomas Fisher]]''
| [[File:Portrait of NX17395 Warrant-Officer Thomas Fisher, Official Photographer with the Military History and Information Section.jpg|center|128px]]
| 1908
| 1942-11-16
| [[Cairdiff]]
|-
| style='text-align:right'| 11261
| ''[[:d:Q109479931|David Morgan]]''
|
| 1833
| 1919
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 11262
| ''[[:d:Q109567506|Scott Jenkins]]''
|
| 1980-10-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11263
| ''[[:d:Q109604218|Zac Williams]]''
|
| 2004
|
| [[Denbighshire|Sir Ddinbych]]
|-
| style='text-align:right'| 11264
| ''[[:d:Q109606512|David Roberts Sr.]]''
|
| 1810
| 1881-12-05
| [[Wales]]
|-
| style='text-align:right'| 11265
| ''[[:d:Q109615124|William H. Griffiths]]''
|
| 1851
| 1931-11
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 11266
| ''[[:d:Q109630143|Edward Williams]]''
|
| 1850
| 1934
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 11267
| ''[[:d:Q109630370|J Gwyndud Jones]]''
|
| 1831
| 1926
| ''[[:d:Q1071035|Penrhyndeudraeth]]''
|-
| style='text-align:right'| 11268
| ''[[:d:Q109669301|Rowland Thomas]]''
|
| 1789
| 1856
| [[Wales]]
|-
| style='text-align:right'| 11269
| ''[[:d:Q109669500|Edward Foulkes]]''
|
| 1850
| 1917
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 11270
| ''[[:d:Q109676105|David Hooson]]''
|
| 1926-04-25
| 2008-05-16
| ''[[:d:Q2745164|Vale of Clwyd]]''
|-
| style='text-align:right'| 11271
| ''[[:d:Q109681025|Arthur Beacham]]''
|
| 1913-07-27
| 2012-06-04
| [[Crosskeys]]
|-
| style='text-align:right'| 11272
| ''[[:d:Q109700497|Tim Wilkinson]]''
|
| 1947-02-09
| 2020-09-16
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 11273
| ''[[:d:Q109732636|Peter A. Griffiths]]''
|
| 1832
| 1911-11-28
| ''[[:d:Q6661345|Llanfair Dyffryn Clwyd]]''
|-
| style='text-align:right'| 11274
| ''[[:d:Q109733043|Margaret Ellen James]]''
|
| 1843
|
| ''[[:d:Q20007216|Monington]]''
|-
| style='text-align:right'| 11275
| ''[[:d:Q109735696|Frances Althea Trevor]]''
|
| 1848-01-29
| 1906
| ''[[:d:Q13644930|Llandrinio]]''
|-
| style='text-align:right'| 11276
| ''[[:d:Q109768829|Shirley Jones]]''
|
| 1934-11-14
|
| ''[[:d:Q24638205|Rhondda Valley]]''
|-
| style='text-align:right'| 11277
| ''[[:d:Q109769748|Robert Gwyneddon Davies]]''
|
| 1870
| 1928-04-17
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 11278
| ''[[:d:Q109780504|Andreas Christodoulidis]]''
|
| 1951
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11279
| ''[[:d:Q109811832|Edgar Williams Parry]]''
|
| 1919-05-01
| 2011<br/>2011-02-09
| ''[[:d:Q3396764|Betws Garmon]]''
|-
| style='text-align:right'| 11280
| ''[[:d:Q109824414|Garibaldi Tyler]]''
| [[File:Portrait of Garibaldi Tyler ca. 1907.jpg|center|128px]]
| 1866-10-29
| 1953-08-21
| ''[[:d:Q672693|Carmarthen]]''
|-
| style='text-align:right'| 11281
| ''[[:d:Q109849817|Pete Williams]]''
|
| 1954-03-12
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 11282
| ''[[:d:Q109859950|John Richards]]''
|
| 1745
| 1836
| ''[[:d:Q3404603|Ardudwy]]''
|-
| style='text-align:right'| 11283
| ''[[:d:Q109894727|Edward Williams]]''
|
| 1715
| 1795-04-23
| ''[[:d:Q6661223|Llandochau Fach]]''
|-
| style='text-align:right'| 11284
| ''[[:d:Q109993471|Maureen Rees]]''
|
| 1942-02-25
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11285
| ''[[:d:Q110086719|Dafydd Gwilym Davies]]''
|
| 1922-07-01
| 2017-12-13
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 11286
| ''[[:d:Q110103399|David Edmondes Owen]]''
| [[File:"Elwedd" (Rev. D Edmondes-Owen as Elwedd) (4541053364).jpg|center|128px]]
| 1866
| 1922
| [[Wales]]
|-
| style='text-align:right'| 11287
| ''[[:d:Q110107533|Ignatius Williams]]''
|
| 1835
| 1905-07-05
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 11288
| ''[[:d:Q110114874|MADDOX]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11289
| ''[[:d:Q110160973|Islwyn Morgan Lake]]''
|
| 1925-03-14
| 2018-11-25
| ''[[:d:Q6661884|Llanwnda]]''
|-
| style='text-align:right'| 11290
| ''[[:d:Q110183271|Winifred Marian Chambers]]''
|
| 1888-09-21
| 1979-01-21
| [[Swansea]]
|-
| style='text-align:right'| 11291
| ''[[:d:Q110185703|Cameron Winnett]]''
| [[File:Cameron Winnett 2022.jpg|center|128px]]
| 2003-01-07
|
| ''[[:d:Q2330789|Llantrisant]]''
|-
| style='text-align:right'| 11292
| ''[[:d:Q110214233|Cyril Hodges]]''
|
| 1915-02-28
| 1974
| [[Cairdiff]]
|-
| style='text-align:right'| 11293
| ''[[:d:Q110214251|Llew Morgan]]''
|
| 1885
| 1960
| [[Ystradgynlais]]
|-
| style='text-align:right'| 11294
| ''[[:d:Q110214277|David Silyn Evans]]''
| [[File:Y Parch. D. Silyn Evans (5292108).jpg|center|128px]]
| 1850
| 1930-09-11
| ''[[:d:Q13128837|Gwernogle]]''
|-
| style='text-align:right'| 11295
| ''[[:d:Q110214284|John Owen Williams]]''
|
| 1892-06-18
| 1973
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 11296
| ''[[:d:Q110214288|Leslie Wynne Evans]]''
|
| 1911
| 1985
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 11297
| ''[[:d:Q110220872|Paul Bowen]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11298
| ''[[:d:Q110221104|Lex Lamprey]]''
|
| 1975-06-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11299
| ''[[:d:Q110292435|Frank Davies]]''
|
| 1903-08-01
| 1970
| [[Swansea]]
|-
| style='text-align:right'| 11300
| ''[[:d:Q110298824|Alex Mann]]''
|
| 2002-01-06
|
| [[Wales]]
|-
| style='text-align:right'| 11301
| ''[[:d:Q110323565|John Timothy Lewis]]''
|
| 1845
| 1923-02-22
| ''[[:d:Q2487253|Tregaron]]''
|-
| style='text-align:right'| 11302
| ''[[:d:Q110400063|Carolina Collet]]''
|
| 1959
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11303
| ''[[:d:Q110424746|Owen Jones]]''
|
| 1811
| 1862
| ''[[:d:Q5200185|Cynwyd]]''
|-
| style='text-align:right'| 11304
| ''[[:d:Q110437612|Donald Alister Griffiths]]''
| [[File:Donald Alister Griffiths.png|center|128px]]
| 1927-07-02
| 2018-07-06
| [[Pontypridd]]
|-
| style='text-align:right'| 11305
| ''[[:d:Q110439012|Helene Elizabeth Leach]]''
|
| 1831-10-27
| 1910-02-28
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 11306
| ''[[:d:Q110439382|John Maddocks]]''
|
| 1601
| 1662
| ''[[:d:Q11008013|Bodfari]]''
|-
| style='text-align:right'| 11307
| ''[[:d:Q110440473|David Jones]]''
|
|
|
| [[Ceredigion]]
|-
| style='text-align:right'| 11308
| ''[[:d:Q110442060|William Jones]]''
|
| 1867
| 1915
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 11309
| ''[[:d:Q110442214|Baldwyn Lloyd Roberts]]''
|
| 1892-01-06
| 1945-05-06
| ''[[:d:Q20589424|Pen-y-bont-fawr]]''
|-
| style='text-align:right'| 11310
| ''[[:d:Q110458257|Samuel Williams]]''
|
|
| 1876-11
| ''[[:d:Q3399408|Pontllyfni]]''
|-
| style='text-align:right'| 11311
| ''[[:d:Q110458597|Ivan Thomas Davies]]''
|
| 1852
| 1931-02-06
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 11312
| ''[[:d:Q110476831|Ian Price]]''
|
| 1946-05-08
| 2014-05-29
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 11313
| ''[[:d:Q110621082|Taliesin Rees]]''
|
| 1883
| 1963-11-07
| ''[[:d:Q13644933|Llangennech]]''
|-
| style='text-align:right'| 11314
| ''[[:d:Q110621616|Thomas Lewis Old]]''
|
| 1885
| 1958
| ''[[:d:Q1537181|Tonypandy]]''
|-
| style='text-align:right'| 11315
| ''[[:d:Q110621944|John Mortimer Green]]''
|
| 1844
| 1864
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 11316
| ''[[:d:Q110622080|Emrys Hughes]]''
|
|
|
| ''[[:d:Q25558292|Borth-y-Gest]]''
|-
| style='text-align:right'| 11317
| ''[[:d:Q110626749|Ben Morus]]''
| [[File:Ben Morus, of Lampeter (5349014).jpg|center|128px]]
| 1881
| 1913-01
| ''[[:d:Q6661336|Llanfair Clydogau]]''
|-
| style='text-align:right'| 11318
| ''[[:d:Q110627723|David Owen Thomas]]''
| [[File:David Owen Thomas (1852–1925).png|center|128px]]
| 1852-11-21
| 1925-02-11
| ''[[:d:Q1936328|Nevern]]''
|-
| style='text-align:right'| 11319
| ''[[:d:Q110627807|Evan Penllyn Jones]]''
|
| 1839
| 1902-02
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 11320
| ''[[:d:Q110628094|William Saunders Davies]]''
|
| 1815
| 1883
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 11321
| ''[[:d:Q110636999|William Pierce Elwy Jones]]''
|
| 1875
| 1926-11-07
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 11322
| ''[[:d:Q110646313|Carys Eleri]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11323
| ''[[:d:Q110654328|Jabez Evans]]''
|
| 1895<br/>1895-04-29
| 1966
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 11324
| ''[[:d:Q110663533|William Lewes]]''
|
| 1878-09-01
| 1952-08-18
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 11325
| ''[[:d:Q110663635|John Lias Davies]]''
|
| 1863
| 1934-04-08
| ''[[:d:Q5572835|Glyn Ceiriog]]''
|-
| style='text-align:right'| 11326
| ''[[:d:Q110664358|Grace Ellis]]''
|
| 1860
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11327
| ''[[:d:Q110689275|Richard Thomas]]''
|
| 1987-01-10
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11328
| ''[[:d:Q110722956|John Lewis]]''
|
| 1815
| 1873-10-31
| ''[[:d:Q14508512|Henfynyw]]''
|-
| style='text-align:right'| 11329
| ''[[:d:Q110724360|Gwilym Howell Jones]]''
|
| 1890
|
| ''[[:d:Q13129677|Llanynys]]''
|-
| style='text-align:right'| 11330
| ''[[:d:Q110724403|Thomas Gwernogle Evans]]''
|
| 1853
| 1940-03-28
| ''[[:d:Q15963885|Llanwenog]]''
|-
| style='text-align:right'| 11331
| ''[[:d:Q110726191|Evan Thomas]]''
|
| 1829
|
| [[Llanfair-yng-Nghornwy]]
|-
| style='text-align:right'| 11332
| ''[[:d:Q110726419|Elizabeth Giffard]]''
|
| 1766
| 1842-03-19
| ''[[:d:Q17737897|Nerquis Hall]]''
|-
| style='text-align:right'| 11333
| ''[[:d:Q110760139|Calum Kavanagh]]''
|
| 2003
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11334
| ''[[:d:Q110767143|Arthur Foulkes-Roberts]]''
|
| 1864
| 1941
| ''[[:d:Q13129615|Llannefydd]]''
|-
| style='text-align:right'| 11335
| ''[[:d:Q110767602|James Ronald Williams]]''
|
| 1899-01-13
| 1969
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 11336
| ''[[:d:Q110768012|David Thomas Salathiel]]''
|
| 1872
| 1947-10-12
| ''[[:d:Q8059809|Ystradyfodwg]]''
|-
| style='text-align:right'| 11337
| ''[[:d:Q110768355|William Evans Jones]]''
|
| 1854
| 1938
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 11338
| ''[[:d:Q110802391|John Ellis Jones]]''
|
| 1840
|
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 11339
| ''[[:d:Q110802439|Benjamin Menai Francis]]''
|
| 1864
| 1929-12-29
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 11340
| ''[[:d:Q110805638|John Williams]]''
|
| 1795
| 1856
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 11341
| ''[[:d:Q110812845|Thomas Bowen]]''
|
| 1792
| 1869
| ''[[:d:Q5047586|Carway]]''
|-
| style='text-align:right'| 11342
| ''[[:d:Q110827530|John Tudor]]''
|
| 1877-05-23
| 1952-01-11
| ''[[:d:Q17487513|Llanglydwen]]''
|-
| style='text-align:right'| 11343
| ''[[:d:Q110844810|Beneticta Jane Keene]]''
|
| 1866
|
| ''[[:d:Q1191195|Wyddgrug]]''
|-
| style='text-align:right'| 11344
| ''[[:d:Q110859735|Dafydd Jenkins]]''
| [[File:Dafydd Jenkins 2023.jpg|center|128px]]
| 2002-12-05
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11345
| ''[[:d:Q110863526|Jennifer Toye]]''
| [[File:Jennifer Toye.jpg|center|128px]]
| 1933-12-16
| 2022-01-17
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 11346
| ''[[:d:Q110918111|Malcolm Williams]]''
|
|
|
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 11347
| ''[[:d:Q110918134|Pamela Field]]''
|
|
|
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11348
| ''[[:d:Q110935652|Robert Williams]]''
|
| 1848-01-27
| 1918-10-16
| ''[[:d:Q8059810|Ystradowen]]''
|-
| style='text-align:right'| 11349
| ''[[:d:Q110939874|David R. Abram]]''
|
| 1957
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 11350
| ''[[:d:Q110951897|Robert Rowlands]]''
|
| 1840
|
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 11351
| ''[[:d:Q110952047|John Daniel Evans]]''
|
| 1869
| 1948
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11352
| ''[[:d:Q110952071|Peter Felix]]''
|
| 1792
| 1861-02-01
| [[Aberystwyth]]
|-
| style='text-align:right'| 11353
| ''[[:d:Q110952124|John Lewis Butler]]''
|
| 1791
| 1861
| ''[[:d:Q6661117|Llanboidy]]''
|-
| style='text-align:right'| 11354
| ''[[:d:Q110952825|Elizabeth Herbert]]''
|
| 1869
|
| ''[[:d:Q13644947|Lledrod]]''
|-
| style='text-align:right'| 11355
| ''[[:d:Q110961740|Ted Regan]]''
|
| 1900-12-27
| No/unknown value
| ''[[:d:Q2304575|Saltney]]''
|-
| style='text-align:right'| 11356
| ''[[:d:Q110962956|Robert J. Jones]]''
|
| 1899-05-06
| 1962-03-26
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 11357
| ''[[:d:Q110979469|John Evans]]''
|
| 1835
| 1888
| ''[[:d:Q15963900|Llanwnnen]]''
|-
| style='text-align:right'| 11358
| ''[[:d:Q110979531|Hugh Charles Howells]]''
|
| 1825
| 1880-01-27
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 11359
| ''[[:d:Q110979757|David Thomas]]''
|
| 1823
| 1914
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 11360
| ''[[:d:Q110979932|Richard Rhys Hughes]]''
|
| 1873
| 1952
| ''[[:d:Q5572835|Glyn Ceiriog]]''
|-
| style='text-align:right'| 11361
| ''[[:d:Q110987557|Robert Evans]]''
|
| 1952<br/>1960
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11362
| ''[[:d:Q111016369|Griffith Griffiths]]''
| [[File:Gutyn Ebrill (Griffith Griffiths) (1828-1909).jpg|center|128px]]
| 1828
| 1909-09-09
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11363
| ''[[:d:Q111016496|Isaac Cheshire]]''
|
| 1830
| 1882-05-21
| ''[[:d:Q3363693|Meifod]]''
|-
| style='text-align:right'| 11364
| ''[[:d:Q111016512|John Cheshire]]''
|
| 1828
|
| ''[[:d:Q3363693|Meifod]]''
|-
| style='text-align:right'| 11365
| ''[[:d:Q111022163|Mary Ann Finn]]''
|
| 1858-07-18
| 1885-08-31
| [[Cairdiff]]
|-
| style='text-align:right'| 11366
| ''[[:d:Q111040774|Elizabeth Myrtle Evans]]''
|
|
| 2004-12
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11367
| ''[[:d:Q111088055|John Hughes Williams]]''
|
| 1796
| 1868
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 11368
| ''[[:d:Q111088099|Anna Eliza Pridham]]''
|
| 1789
|
| ''[[:d:Q2273077|Newcastle Emlyn]]''
|-
| style='text-align:right'| 11369
| ''[[:d:Q111103618|Helen Muscat]]''
|
|
| 2013-10-19
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 11370
| ''[[:d:Q111134348|Rhian Edmunds]]''
| [[File:2021 UEC Track Jun & U23 European Championships 331.jpg|center|128px]]
| 2003-04-04
|
| [[Newport]]
|-
| style='text-align:right'| 11371
| ''[[:d:Q111137021|William Thomas Parry]]''
|
| 1837-05-17
| 1896-09-10
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11372
| ''[[:d:Q111170402|Edward Roberts]]''
|
| 1891-02-20
|
| ''[[:d:Q616452|Rhosllannerchrugog]]''
|-
| style='text-align:right'| 11373
| ''[[:d:Q111177108|Charles Evans]]''
|
| 1858-08-14
| 1934-01-14
| ''[[:d:Q5468045|Forden]]''
|-
| style='text-align:right'| 11374
| ''[[:d:Q111206274|Cameron Congreve]]''
|
| 2004-01-24
|
| [[Blaenau Gwent]]
|-
| style='text-align:right'| 11375
| ''[[:d:Q111226701|Thomas M. Pugh]]''
|
|
| 1917-05-09
| [[Wales]]
|-
| style='text-align:right'| 11376
| ''[[:d:Q111227982|Daniel T. Davies]]''
|
| 1851
| 1899
| [[Wales]]
|-
| style='text-align:right'| 11377
| ''[[:d:Q111228164|Richard Hamer]]''
|
| 1858
| 1931-10-29
| [[Wales]]
|-
| style='text-align:right'| 11378
| ''[[:d:Q111228239|John N. Jones]]''
|
| 1850
|
| [[Wales]]
|-
| style='text-align:right'| 11379
| ''[[:d:Q111228248|William P. Jones]]''
|
| 1828-08
|
| [[Wales]]
|-
| style='text-align:right'| 11380
| ''[[:d:Q111228249|William R. Jones]]''
|
| 1827
|
| [[Wales]]
|-
| style='text-align:right'| 11381
| ''[[:d:Q111228303|David C. Evans]]''
|
| 1820
| 1910
| [[Wales]]
|-
| style='text-align:right'| 11382
| ''[[:d:Q111228454|Robert H. Hughes]]''
|
| 1832
|
| [[Wales]]
|-
| style='text-align:right'| 11383
| ''[[:d:Q111229039|Richard Lewis]]''
|
| 1833
|
| [[Wales]]
|-
| style='text-align:right'| 11384
| ''[[:d:Q111229993|Evan Morgan]]''
|
| 1805
|
| [[Wales]]
|-
| style='text-align:right'| 11385
| ''[[:d:Q111230003|Evan R. Morris]]''
|
| 1842
|
| [[Wales]]
|-
| style='text-align:right'| 11386
| ''[[:d:Q111230005|Owen Morris]]''
|
| 1858
| 1930
| [[Wales]]
|-
| style='text-align:right'| 11387
| ''[[:d:Q111230239|Richard Wigley]]''
|
| 1833
| 1902
| [[Wales]]
|-
| style='text-align:right'| 11388
| ''[[:d:Q111230638|John T. Williams]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11389
| ''[[:d:Q111272370|Gomer Llewellyn Jones]]''
|
| 1911-12-11
| 1977-09-01
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 11390
| ''[[:d:Q111272947|David John Jones]]''
|
| 1906-06-29
| 1978-12-10
| [[Swansea]]
|-
| style='text-align:right'| 11391
| ''[[:d:Q111273858|Mary Tharesa Talbot]]''
|
| 1795
| 1861
| ''[[:d:Q16855574|Penrice]]''
|-
| style='text-align:right'| 11392
| ''[[:d:Q111274052|Evan Festin Jones]]''
|
| 1859
| 1918-06-04
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 11393
| ''[[:d:Q111297806|Nima Tamizi]]''
|
| 2001-12-21
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11394
| ''[[:d:Q111311358|David Hancock]]''
|
| 1946-05-18
| 1978
| [[Wales]]
|-
| style='text-align:right'| 11395
| ''[[:d:Q111425052|Florence Hannah Williams]]''
|
| 1882-04-28
| 1958-08-16
| [[Swansea]]
|-
| style='text-align:right'| 11396
| ''[[:d:Q111433491|Emma Finucane]]''
| [[File:2024 UEC Track Elite European Championships 091.jpg|center|128px]]
| 2002-12-22
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11397
| ''[[:d:Q111441867|Lowri Thomas]]''
| [[File:2024 UEC Track Elite European Championships 074.jpg|center|128px]]
| 1999-03-03
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 11398
| ''[[:d:Q111540079|William Henry Allen]]''
|
| 1844
| 1926-10-01
| [[Cairdiff]]
|-
| style='text-align:right'| 11399
| ''[[:d:Q111577701|George Stephen Evans]]''
| [[File:George Stephen Evans (5292083).jpg|center|128px]]
| 1880
| 1936-02-07
| ''[[:d:Q2536016|Crickhowell]]''
|-
| style='text-align:right'| 11400
| ''[[:d:Q111586572|Rees Powell]]''
|
| 1782
| 1865
| ''[[:d:Q6661441|Llangathen]]''
|-
| style='text-align:right'| 11401
| ''[[:d:Q111589348|Gwilym Thomas Jones]]''
|
| 1908-06-27
| 1956-07-09
| ''[[:d:Q1025821|Pwllheli]]''
|-
| style='text-align:right'| 11402
| ''[[:d:Q111593054|Owen Morris Williams]]''
|
| 1870
| 1958
| ''[[:d:Q5057359|Ceidio]]''
|-
| style='text-align:right'| 11403
| ''[[:d:Q111594316|Griffith Robert Pierce]]''
|
| 1841-11-03
| 1915-12-16
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 11404
| ''[[:d:Q111604675|Daniel Steinhauer]]''
|
| 1785
| 1852
| [[Wales]]
|-
| style='text-align:right'| 11405
| ''[[:d:Q111635551|Mark McGreal]]''
|
| 1986
|
| [[Pontypridd]]
|-
| style='text-align:right'| 11406
| ''[[:d:Q111692498|Amy Williams]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11407
| ''[[:d:Q111699970|Salvia]]''
|
| 2000-08-18
|
| ''[[:d:Q11093013|Cyffylliog]]''
|-
| style='text-align:right'| 11408
| ''[[:d:Q111718598|Rhys Davies]]''
|
| 1795-01
| 1838-09-09
| ''[[:d:Q6661562|Llangynidr]]''
|-
| style='text-align:right'| 11409
| ''[[:d:Q111721885|Francis Llewelyn Lowther]]''
|
| 1870-06-15
| 1948-09-09
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11410
| ''[[:d:Q111722158|Rees Jones]]''
|
| 1899-06
| 1977
| ''[[:d:Q16542738|Nantcwnlle]]''
|-
| style='text-align:right'| 11411
| ''[[:d:Q111722537|Roland Thorne]]''
|
| 1939
| 2019
| ''[[:d:Q991055|Milford Haven]]''
|-
| style='text-align:right'| 11412
| ''[[:d:Q111729269|Margaret Williams]]''
|
| 1782
|
| [[Wales]]
|-
| style='text-align:right'| 11413
| ''[[:d:Q111737125|Thomas William Llynfi Davies]]''
|
| 1876
| 1937-05-14
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 11414
| ''[[:d:Q111746342|Thomas Davies]]''
|
| 1833
| 1899
| [[Sooth Wales]]
|-
| style='text-align:right'| 11415
| ''[[:d:Q111746468|Timothy Thomas]]''
|
| 1811
| 1887
| ''[[:d:Q2233618|Llanrwst]]''
|-
| style='text-align:right'| 11416
| ''[[:d:Q111746490|William Harris]]''
|
| 1830
| 1911
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 11417
| ''[[:d:Q111746832|David Bateman]]''
|
| 1807
| 1886
| ''[[:d:Q15260126|Moylgrove]]''
|-
| style='text-align:right'| 11418
| ''[[:d:Q111746897|Thomas Edwardes]]''
|
| 1792
| 1852-08-27
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 11419
| ''[[:d:Q111747123|Lewis Thomas Rowland]]''
|
| 1836-09-05
| 1891-02-04
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 11420
| ''[[:d:Q111747294|David Williams]]''
|
| 1824
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11421
| ''[[:d:Q111747463|Richard Abbott Jones]]''
|
| 1824
| 1875
| ''[[:d:Q38825|Sir Drefaldwyn]]''
|-
| style='text-align:right'| 11422
| ''[[:d:Q111751380|Peter Gordon Watson]]''
|
| 1930-04-30
| 2017-01-31
| [[Newport]]
|-
| style='text-align:right'| 11423
| ''[[:d:Q111802911|Lowri Roberts]]''
|
| 1997-10-18
|
| ''[[:d:Q4936476|Bodelwyddan]]''
|-
| style='text-align:right'| 11424
| ''[[:d:Q111805253|Jeanne Le Bars]]''
|
| 1942-02-11
|
| [[Swansea]]
|-
| style='text-align:right'| 11425
| ''[[:d:Q111819745|John Gwyddno Williams]]''
| [[File:J Gwyddno Williams.jpg|center|128px]]
| 1861
| 1950
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 11426
| ''[[:d:Q111832054|Morgan Rice James]]''
|
| 1792
| 1855
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 11427
| ''[[:d:Q111832613|Eliphaz Watkin Morgan]]''
|
| 1870
| 1944-05-30
| [[Ystradgynlais]]
|-
| style='text-align:right'| 11428
| ''[[:d:Q111832695|Effie Spurrell]]''
|
| 1849
| 1929
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11429
| ''[[:d:Q111843049|Robert Reed]]''
|
| 1968
|
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 11430
| ''[[:d:Q111859674|Andrew Bond Phipson]]''
|
| 1821
| 1903-05-01
| [[Cairdiff]]
|-
| style='text-align:right'| 11431
| ''[[:d:Q111869544|Robert Jones]]''
|
| 1845
| 1906
| ''[[:d:Q577711|Sir Feirionnydd]]''
|-
| style='text-align:right'| 11432
| ''[[:d:Q111901957|Tom Sparrow]]''
|
| 2003<br/>2002-12-06
|
| ''[[:d:Q2019227|Buckley]]''
|-
| style='text-align:right'| 11433
| ''[[:d:Q111902619|Luke Mariette]]''
|
| 2003
|
| ''[[:d:Q1186888|Dinbych]]''
|-
| style='text-align:right'| 11434
| ''[[:d:Q111907087|Philip Gwynne Jones]]''
|
| 1966
|
| [[Swansea]]
|-
| style='text-align:right'| 11435
| ''[[:d:Q111912514|Edward David James]]''
|
| 1904
| 1934
| ''[[:d:Q177165|Narberth]]''
|-
| style='text-align:right'| 11436
| ''[[:d:Q111913876|John Albert Alexander Williams]]''
|
| 1863
| 1944-09-24
| ''[[:d:Q13129604|Llanbeblig]]''
|-
| style='text-align:right'| 11437
| ''[[:d:Q111914446|Laura Parry]]''
|
| 1835
| 1936
| ''[[:d:Q13644946|Llanwrin]]''
|-
| style='text-align:right'| 11438
| ''[[:d:Q111916128|John Evans]]''
|
| 1806
| 1872
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 11439
| ''[[:d:Q111916310|Morgan Lewis]]''
|
| 1797
| 1887
| ''[[:d:Q20593513|Llandeilo'r-fân]]''
|-
| style='text-align:right'| 11440
| ''[[:d:Q111936538|Thomas Woodward]]''
|
| 1900-11-13
| 1981
| ''[[:d:Q7844935|Troed-y-rhiw]]''
|-
| style='text-align:right'| 11441
| ''[[:d:Q111941150|David Hart]]''
|
|
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 11442
| ''[[:d:Q111956292|Jude Howell]]''
|
| 1956-11-18
| 2022-04-29
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11443
| ''[[:d:Q111974082|Edward Rumsey Williams]]''
|
| 1802
| 1886
| ''[[:d:Q13129604|Llanbeblig]]''
|-
| style='text-align:right'| 11444
| ''[[:d:Q111975178|Susannah Owen]]''
|
| 1863
|
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 11445
| ''[[:d:Q111975531|John Hathren Davies]]''
|
| 1855-10-29
| 1910-03
| ''[[:d:Q15987581|Talsarn]]''
|-
| style='text-align:right'| 11446
| ''[[:d:Q111975864|John Bevan Jones]]''
|
| 1861
| 1937-05-31
| ''[[:d:Q3403140|Llanfair-ar-y-bryn]]''
|-
| style='text-align:right'| 11447
| ''[[:d:Q111976039|William Pugh]]''
|
| 1750-06-25
| 1845
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11448
| ''[[:d:Q111976622|Charles Lloyd]]''
|
| 1698-01-17
| 1767
| ''[[:d:Q17741174|Dolobran Hall]]''
|-
| style='text-align:right'| 11449
| ''[[:d:Q111983112|Robert Jones Edwards]]''
|
| 1849
|
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 11450
| ''[[:d:Q111983251|John Jenkins]]''
|
| 1864
| 1934
| ''[[:d:Q6661375|Llanfihangel Ystrad]]''
|-
| style='text-align:right'| 11451
| ''[[:d:Q111983824|F. W. Dunning]]''
|
| 1928
| 2018
| [[Cairdiff]]
|-
| style='text-align:right'| 11452
| ''[[:d:Q111985983|Thomas Hevin Williams]]''
|
| 1905-06-27
| 1984
| ''[[:d:Q171923|Bala]]''
|-
| style='text-align:right'| 11453
| ''[[:d:Q111986142|Henry Wynne Jones]]''
|
| 1815
| 1892-06
| ''[[:d:Q3399236|Bodedern]]''
|-
| style='text-align:right'| 11454
| ''[[:d:Q111986753|William Rees]]''
|
| 1887-12-14
| 1978-09
| ''[[:d:Q4667218|Aberyscir]]''
|-
| style='text-align:right'| 11455
| ''[[:d:Q111995663|Francis Gordon Baker]]''
|
| 1920-12-14
| 2007
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 11456
| ''[[:d:Q112035006|Gina Wilson]]''
|
| 1943
|
| ''[[:d:Q2771917|Abergele]]''
|-
| style='text-align:right'| 11457
| ''[[:d:Q112041592|David Goronwy Griffiths]]''
|
| 1882
| 1958
| ''[[:d:Q13127595|Cwmdu]]''
|-
| style='text-align:right'| 11458
| ''[[:d:Q112041644|David Thomas]]''
|
|
| 1866
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 11459
| ''[[:d:Q112042004|David Marks Jones]]''
|
| 1843
|
| ''[[:d:Q5120035|Cilrhedyn]]''
|-
| style='text-align:right'| 11460
| ''[[:d:Q112063701|Benjamin Williams]]''
|
| 1822
|
| ''[[:d:Q3405138|St Dogmaels]]''
|-
| style='text-align:right'| 11461
| ''[[:d:Q112063783|David Henry Williams]]''
|
| 1886
| 1935-11-26
| ''[[:d:Q894252|Borth]]''
|-
| style='text-align:right'| 11462
| ''[[:d:Q112064153|Morgan Evans Davies]]''
|
| 1882
| 1944-01-17
| ''[[:d:Q1765460|Aberaeron]]''
|-
| style='text-align:right'| 11463
| ''[[:d:Q112064238|Thomas Hubert John Rees]]''
|
| 1904
| 1932-09-07
| ''[[:d:Q7593398|St Ishmael]]''
|-
| style='text-align:right'| 11464
| ''[[:d:Q112064480|William Dyfed Parry]]''
|
| 1893
|
| ''[[:d:Q1770481|Rhiwabon]]''
|-
| style='text-align:right'| 11465
| ''[[:d:Q112065060|William Hibbs Bevan]]''
|
| 1788
| 1846
| [[Sooth Wales]]
|-
| style='text-align:right'| 11466
| ''[[:d:Q112065107|Griffith Williams Jones]]''
|
| 1871
| 1924-04-01
| ''[[:d:Q13129606|Llanddeiniolen]]''
|-
| style='text-align:right'| 11467
| ''[[:d:Q112074369|Gwilym Pugh]]''
|
| 1618
| 1689
| ''[[:d:Q731669|Sir Gaernarfon]]''
|-
| style='text-align:right'| 11468
| ''[[:d:Q112078599|John Owen]]''
|
| 1817
| 1886
| ''[[:d:Q5136827|Clydau]]''
|-
| style='text-align:right'| 11469
| ''[[:d:Q112079324|Lewis Griffith Roberts]]''
|
| 1916-01-14
| 1986
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11470
| ''[[:d:Q112080083|John Lloyd Nuttall]]''
|
| 1858
| 1929-02-25
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 11471
| ''[[:d:Q112080160|Oswald Rees Owen]]''
|
| 1907-05-13
| 1980
| ''[[:d:Q7678684|Tal-y-llyn]]''
|-
| style='text-align:right'| 11472
| ''[[:d:Q112080183|Owen Davies Thomas]]''
|
| 1834
| 1922-08-02
| ''[[:d:Q13129647|Llangyfelach]]''
|-
| style='text-align:right'| 11473
| ''[[:d:Q112080194|John Davies]]''
|
| 1846
| 1924
| ''[[:d:Q11932059|Llandygwydd]]''
|-
| style='text-align:right'| 11474
| ''[[:d:Q112080260|David Hughes]]''
|
| 1839
| 1923
| ''[[:d:Q14508553|Llanycil]]''
|-
| style='text-align:right'| 11475
| ''[[:d:Q112080351|Mingge Xu]]''
| [[File:Xu WMQ22 (14) (52191114756).jpg|center|128px]]
| 2007-10-02
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11476
| ''[[:d:Q112108323|William Bracewell]]''
|
| 1991
|
| [[Swansea]]
|-
| style='text-align:right'| 11477
| ''[[:d:Q112108953|Franco Smith]]''
| [[File:Petrus François Smith 2022.jpg|center|128px]]
| 2000-05-03
|
| [[Newport]]
|-
| style='text-align:right'| 11478
| ''[[:d:Q112115299|Arthur Rhys Roberts]]''
|
| 1872-04-27
| 1920-11-26
| ''[[:d:Q1883524|Bethesda]]''
|-
| style='text-align:right'| 11479
| ''[[:d:Q112116356|George Baker]]''
|
| 1902-09-05
| 1982
| [[Pontypridd]]
|-
| style='text-align:right'| 11480
| ''[[:d:Q112117297|Arwen Banning]]''
|
| 1970
|
| [[Swansea]]
|-
| style='text-align:right'| 11481
| ''[[:d:Q112119470|John Williams]]''
|
| 1870
| 1929-12-18
| ''[[:d:Q3401012|Llannerch-y-medd]]''
|-
| style='text-align:right'| 11482
| ''[[:d:Q112119851|Abel Edmunds]]''
|
| 1800-12-15
| 1865-06-22<br/>1865-06-29
| ''[[:d:Q6661562|Llangynidr]]''
|-
| style='text-align:right'| 11483
| ''[[:d:Q112126488|Caradog Tegid Rowlands]]''
|
| 1891
| 1968
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 11484
| ''[[:d:Q112127551|William Jones]]''
|
| 1821
| 1903
| ''[[:d:Q3399289|Llanllyfni]]''
|-
| style='text-align:right'| 11485
| ''[[:d:Q112127710|Robert Cadwaladr Evans]]''
|
| 1857
| 1922-04-13
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11486
| ''[[:d:Q112127814|Hugh Edwards]]''
|
| 1871
| 1941
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 11487
| ''[[:d:Q112127857|Abednego Jenkin]]''
|
| 1819
| 1888-09-19
| ''[[:d:Q2085995|St Clears]]''
|-
| style='text-align:right'| 11488
| ''[[:d:Q112128015|William Caradog Evans]]''
|
| 1848
| 1878
| ''[[:d:Q7680110|Talyllychau]]''
|-
| style='text-align:right'| 11489
| ''[[:d:Q112128209|John Saunders]]''
|
| 1798
| 1871
| ''[[:d:Q6661644|Llanllwni]]''
|-
| style='text-align:right'| 11490
| ''[[:d:Q112128245|Thomas Lloyd Jones]]''
|
| 1867
|
| ''[[:d:Q13130702|Penrhiw-llan]]''
|-
| style='text-align:right'| 11491
| ''[[:d:Q112132303|Walter Hugh James]]''
|
| 1845-09-17
| 1937-08-21
| ''[[:d:Q6661403|Llanfyrnach]]''
|-
| style='text-align:right'| 11492
| ''[[:d:Q112132334|David William Bateman]]''
|
| 1898
| 1967
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11493
| ''[[:d:Q112132378|Job Richards]]''
|
| 1830
| 1890-12-22
| ''[[:d:Q6661267|Llandybie]]''
|-
| style='text-align:right'| 11494
| ''[[:d:Q112132441|Henry Howard Evans]]''
|
| 1865-04-28
| 1935-04-25<br/>1936-05-02
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11495
| ''[[:d:Q112132478|Evan Isaac Thomas]]''
|
| 1824
| 1903-01-16
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 11496
| ''[[:d:Q112132605|David Davies]]''
|
|
| 1901
| ''[[:d:Q3402429|Groeslon]]''
|-
| style='text-align:right'| 11497
| ''[[:d:Q112135582|Dyfrig Evans]]''
|
| 1978-08-23
| 2022-05-26
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11498
| ''[[:d:Q112147144|Thomas John Williams]]''
|
| 1869-04-25
| 1944-04-24
| ''[[:d:Q20602439|Ynysmeudwy]]''
|-
| style='text-align:right'| 11499
| ''[[:d:Q112169408|Ioan Croft]]''
|
| 2001-11-30
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11500
| ''[[:d:Q112180788|Garan Croft]]''
|
| 2001-11-30
|
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11501
| ''[[:d:Q112222252|Tony Luigi Leopoldo Lenza]]''
|
| 1962-08-24
|
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 11502
| ''[[:d:Q112224804|Jordan Davies]]''
|
| 1998-08-18
|
| ''[[:d:Q5140559|Coedpoeth]]''
|-
| style='text-align:right'| 11503
| ''[[:d:Q112224866|Abram Owen Thomas]]''
|
| 1876-03-21
| 1931-01-13
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 11504
| ''[[:d:Q112355680|Huw Roland Jones]]''
|
| 1937-07-22
| 2023-06-22
| ''[[:d:Q2741834|Llanidloes]]''
|-
| style='text-align:right'| 11505
| ''[[:d:Q112376926|Keith Bayliss]]''
|
| 1954
|
| [[Swansea]]
|-
| style='text-align:right'| 11506
| ''[[:d:Q112384154|Peter Lowe]]''
|
| 1941-04-08
| 2012-01-19
| [[Cairdiff]]
|-
| style='text-align:right'| 11507
| ''[[:d:Q112440218|Gareth Calway]]''
|
| 1956
|
| ''[[:d:Q573757|Brynbuga]]''
|-
| style='text-align:right'| 11508
| ''[[:d:Q112471825|Clifford Naunton Morgan]]''
|
| 1901-12-20
| 1986-02-24
| ''[[:d:Q870815|Glamorgan]]''
|-
| style='text-align:right'| 11509
| ''[[:d:Q112474545|Robin Okey]]''
|
| 1942
| 2023-12
| [[Cairdiff]]
|-
| style='text-align:right'| 11510
| ''[[:d:Q112532075|Roger Branfill-Cook]]''
|
| 1949
|
| [[Swansea]]
|-
| style='text-align:right'| 11511
| ''[[:d:Q112552665|David Burns Moffat]]''
|
| 1921
| 2017
| [[Swansea]]
|-
| style='text-align:right'| 11512
| ''[[:d:Q112583717|Ben Barlow]]''
|
| 1994-07-22
|
| [[Wales]]
|-
| style='text-align:right'| 11513
| ''[[:d:Q112615363|Gwilym Roberts]]''
|
| 1935-02-12
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11514
| ''[[:d:Q112630388|Peter Lodwick]]''
| [[File:Peter Lodwick.jpg|center|128px]]
| 1944-02-09
|
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11515
| ''[[:d:Q112672989|Evan Jenkins]]''
|
| 1794-11-10
| 1849-09-23
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 11516
| ''[[:d:Q112686378|Hugh Beaver Roberts]]''
|
| 1820
| 1903
| ''[[:d:Q5119934|Cilcain]]''
|-
| style='text-align:right'| 11517
| ''[[:d:Q112829353|Megan Carter Davies]]''
|
| 1996-05-10
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 11518
| ''[[:d:Q112893294|Vivienne Soan]]''
|
| 1955
|
| ''[[:d:Q1024885|Llandrindod Wells]]''
|-
| style='text-align:right'| 11519
| ''[[:d:Q112947395|William M. Protheroe]]''
|
| 1925-10-16
| 2012-09-04
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 11520
| ''[[:d:Q112961957|T. W. Allen]]''
|
| 1864-02-06
| 1943-11-24
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 11521
| ''[[:d:Q112968170|Ben Thompson]]''
|
| 2002
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11522
| ''[[:d:Q113006051|Eric Jones]]''
|
|
|
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 11523
| ''[[:d:Q113026138|John Davies Thomas]]''
|
| 1844-10-11
| 1893-01-30
| [[Swansea]]
|-
| style='text-align:right'| 11524
| ''[[:d:Q113112197|M. Rosalind Morris]]''
| [[File:Rosalindmorris.jpg|center|128px]]
| 1920-05-08
| 2022-03-26
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 11525
| ''[[:d:Q113230729|Alison Cross]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11526
| ''[[:d:Q113290489|Carly-Sophia Davies]]''
|
| 1995
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11527
| ''[[:d:Q113384254|Medi Harris]]''
|
| 2002-09-15
|
| ''[[:d:Q950671|Porthmadog]]''
|-
| style='text-align:right'| 11528
| ''[[:d:Q113451866|Jasmine Hacker-Jones]]''
|
| 2000-07-11
|
| [[Wales]]
|-
| style='text-align:right'| 11529
| ''[[:d:Q113459737|Howard Johns]]''
|
| 1892-02-15
| 1964-03-29
| ''[[:d:Q1762242|Pembroke]]''
|-
| style='text-align:right'| 11530
| ''[[:d:Q113510481|Kathleen Mary Williams]]''
|
| 1919-06-11
| 1974-12-04
| [[Wales]]
|-
| style='text-align:right'| 11531
| ''[[:d:Q113551285|Esyllt Maelor]]''
|
|
|
| ''[[:d:Q1024935|Harlech]]''
|-
| style='text-align:right'| 11532
| ''[[:d:Q113551771|John Prytherch]]''
| [[File:Portrait of John Prytherch (4672676).jpg|center|128px]]
| 1774
| 1864
| ''[[:d:Q42617191|Isle of Anglesey]]''
|-
| style='text-align:right'| 11533
| ''[[:d:Q113566900|Tino Belli]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11534
| ''[[:d:Q113587569|Arnold Stanley Meara]]''
|
| 1914-12
| 1993-12
| [[Wales]]
|-
| style='text-align:right'| 11535
| ''[[:d:Q113660811|John Malcom Cherrett]]''
|
| 1935
| 2014-08-29
| ''[[:d:Q3402761|Llandegfan]]''
|-
| style='text-align:right'| 11536
| ''[[:d:Q113680486|John Morgan Edwards]]''
|
| 1868-05-31
| 1924-03-16
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 11537
| ''[[:d:Q113724684|Thomas Morton]]''
| [[File:Thomas Morton (1829-1887).jpg|center|128px]]
| 1829-03-17
| 1887-08-11
| [[Wales]]
|-
| style='text-align:right'| 11538
| ''[[:d:Q113782878|Subhamati]]''
|
| 1953
|
| [[Newport]]
|-
| style='text-align:right'| 11539
| ''[[:d:Q113805746|Dervis Ward]]''
|
| 1923-12-05
| 1996-03-27
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 11540
| ''[[:d:Q113845815|Frank Cranmer]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11541
| ''[[:d:Q113845816|Celia Kenny]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11542
| ''[[:d:Q113861465|John Davies Bryan]]''
| [[File:John Davies Bryan from O'r Aifft.png|center|128px]]
| 1857
| 1888-11-13
| ''[[:d:Q6661071|Llanarmon-yn-Iâl]]''
|-
| style='text-align:right'| 11543
| ''[[:d:Q113882702|Emily Phillips]]''
| [[File:2022-08-12 European Championships 2022 – Emily Philipps Sport Climbing Women's Boulder by Sandro Halank–097.jpg|center|128px]]
| 2002-08-10
|
| ''[[:d:Q5199901|Cyncoed]]''
|-
| style='text-align:right'| 11544
| ''[[:d:Q114212000|Sisilia Tuipulotu]]''
|
| 2003-08-14
|
| [[Newport]]
|-
| style='text-align:right'| 11545
| ''[[:d:Q114212177|Megan Webb]]''
|
| 2001-01-09
|
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11546
| ''[[:d:Q114261259|Ceridwen Lloyd Davies]]''
|
| 1900-09-24
| 1983-10-30
| ''[[:d:Q5608946|Griffithstown]]''
|-
| style='text-align:right'| 11547
| ''[[:d:Q114341648|Nathan Stoneman]]''
|
| 1996-09-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11548
| ''[[:d:Q114458166|Rowland Rowland]]''
|
| 1812-03-12
| 1882-03-08
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 11549
| ''[[:d:Q114529460|Percival Edward Thacker]]''
| [[File:William Newzam Prior Nicholson - Canadian Headquarters Staff.jpg|center|128px]]
| 1873-10-28
| 1945-07-03
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11550
| ''[[:d:Q114560082|Lucy Packer]]''
| [[File:Lucy Packer 2022.jpg|center|128px]]
| 2000-02-02
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 11551
| ''[[:d:Q114571030|Amy Laugharne]]''
|
| 1879-06-24
| 1950-07-14
| [[Cairdiff]]
|-
| style='text-align:right'| 11552
| ''[[:d:Q114589891|Peter Collins]]''
|
| 1958-05-13
|
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 11553
| ''[[:d:Q114608980|Griffith Vaughan Williams]]''
| [[File:Griff Vaughan Williams.jpg|center|128px]]
| 1940-11-09
| 2010-11-15
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11554
| ''[[:d:Q114663477|Anna Morris]]''
| [[File:2024 UEC Track Elite European Championships 081.jpg|center|128px]]
| 1995-06-13
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11555
| ''[[:d:Q114724934|Siôn Daniel Young]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11556
| ''[[:d:Q114866371|Beatrice Green]]''
| [[File:Beatrice Green (Bruley).png|center|128px]]
| 1894-10-01
| 1927-10-19
| ''[[:d:Q2272537|Abertyleri]]''
|-
| style='text-align:right'| 11557
| ''[[:d:Q114872525|Max Deeds]]''
|
| 1987-09-26
|
| [[Newport]]
|-
| style='text-align:right'| 11558
| ''[[:d:Q115049023|Stephen Nigel Thomas]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11559
| ''[[:d:Q115097654|Joe Low]]''
|
| 2002-02-20
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11560
| ''[[:d:Q115124980|Abbie Hern]]''
|
| 1997-02-09
|
| [[Pontypridd]]
|-
| style='text-align:right'| 11561
| ''[[:d:Q115254921|Alun G. Jones]]''
|
| 1941-03-21
| 2012-10-20
| ''[[:d:Q2020203|Rhyl]]''
|-
| style='text-align:right'| 11562
| ''[[:d:Q115256986|Edgar Hitchman]]''
|
| 1915-05-27
| 1983
| [[Cairdiff]]
|-
| style='text-align:right'| 11563
| ''[[:d:Q115257191|Sydney Jenkins]]''
|
| 1873-07-14
| 1947-05-21
| [[Cairdiff]]
|-
| style='text-align:right'| 11564
| ''[[:d:Q115381177|Eric Hywel Roberts]]''
|
| 1930-01-27
| 2016-08-13
| [[Welshpool]]
|-
| style='text-align:right'| 11565
| ''[[:d:Q115482387|James Fender]]''
|
| 2001-08-03
|
| [[Swansea]]
|-
| style='text-align:right'| 11566
| ''[[:d:Q115492510|Tako Taal]]''
|
| 1989
|
| [[Wales]]
|-
| style='text-align:right'| 11567
| ''[[:d:Q115526483|Rachel Dawson]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 11568
| ''[[:d:Q115616673|Elizabeth May Watkin Jones]]''
|
| 1907-05-10
| 1965-06-21
| ''[[:d:Q3402628|Capel Celyn]]''
|-
| style='text-align:right'| 11569
| ''[[:d:Q115652166|David Bevan]]''
|
| 1829-04-20
| 1913-01-12
| ''[[:d:Q547052|Brecknockshire]]''
|-
| style='text-align:right'| 11570
| ''[[:d:Q115662147|Steven Jones]]''
| [[File:The Chief Constable (5236540).jpg|center|128px]]
| 1875-07-09
| 1938-12-25
| ''[[:d:Q3397661|Llangeitho]]''
|-
| style='text-align:right'| 11571
| ''[[:d:Q115676843|Richard Gwyn]]''
|
| 1918
|
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 11572
| ''[[:d:Q115687459|William Evan Williams]]''
|
| 1896
| 1917-10-27
| ''[[:d:Q2173658|Deiniolen]]''
|-
| style='text-align:right'| 11573
| ''[[:d:Q115687922|Frances Williams]]''
|
| 1760
| 1801
| ''[[:d:Q3404644|Whitford]]''
|-
| style='text-align:right'| 11574
| ''[[:d:Q115688322|Geoffrey Bilson]]''
|
| 1938-01-27
| 1987-07-25
| [[Cairdiff]]
|-
| style='text-align:right'| 11575
| ''[[:d:Q115747841|Alec Allen]]''
|
| 1895-02-01
| 1972-03-07
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 11576
| ''[[:d:Q115780417|Bryn Thomas]]''
|
| 1912-04-29
| 2005-07-19
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11577
| ''[[:d:Q115794521|Iain Martin]]''
| [[File:Professor Iain Martin (Deakin University Vice-Chancellor).jpg|center|128px]]
|
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 11578
| ''[[:d:Q115796734|Tim Davies]]''
|
| 1960
|
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 11579
| ''[[:d:Q115803662|Brian Woodward]]''
| [[File:Brian Woodward.jpg|center|128px]]
| 1952-05-09
| 2022-11-13
| ''[[:d:Q156990|Monmouth]]''
|-
| style='text-align:right'| 11580
| ''[[:d:Q115830694|James Horgan]]''
|
| 1867-04-06
| 1946-11-26
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11581
| ''[[:d:Q115839842|Mary Goff Lloyd]]''
|
| 1815-02-09
| 1907-02-11
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11582
| ''[[:d:Q115926343|Geraint Vaughan-Jones]]''
|
| 1929-10-03
| 2002-12-23
| ''[[:d:Q6661318|Llanerfyl]]''
|-
| style='text-align:right'| 11583
| ''[[:d:Q115929783|Connor Morgans]]''
|
| 1999-11-26
|
| [[Swansea]]
|-
| style='text-align:right'| 11584
| ''[[:d:Q115930521|William Henry Hughes]]''
|
| 1856
| 1926
| ''[[:d:Q13129672|Llanrhychwyn]]''
|-
| style='text-align:right'| 11585
| ''[[:d:Q116178708|Carl Morris]]''
|
|
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11586
| ''[[:d:Q116199583|Helena Braithwaite]]''
|
| 1938
| 2018-11-28
| ''[[:d:Q3397684|Pontarddulais]]''
|-
| style='text-align:right'| 11587
| ''[[:d:Q116451856|W. Gwyn Thomas]]''
|
| 1928
| 1994
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 11588
| ''[[:d:Q116717924|Jude Brigley]]''
|
|
|
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 11589
| ''[[:d:Q116717968|Gwyn Briwnant-Jones]]''
|
| 1956
|
| ''[[:d:Q675460|Machynlleth]]''
|-
| style='text-align:right'| 11590
| ''[[:d:Q116739631|James Jones]]''
|
| 1860
| 1943
| ''[[:d:Q3050619|Treffynnon]]''
|-
| style='text-align:right'| 11591
| ''[[:d:Q116768200|J. Kerry Thomas]]''
|
| 1934-05-16
| 2015-01-18
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 11592
| ''[[:d:Q116770788|Thomas Prichard]]''
|
| 1846
| 1920
| [[Anglesey]]
|-
| style='text-align:right'| 11593
| ''[[:d:Q116783944|Edward Hamilton Acton]]''
|
| 1862-11-26
| 1895-02-15
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11594
| ''[[:d:Q116785463|Paul Gyngell]]''
|
| 1959-01-26
| 2010-10-03
| [[Pontypridd]]
|-
| style='text-align:right'| 11595
| ''[[:d:Q116792293|Gareth Haulfryn Williams]]''
| [[File:Llen Natur Wicipedia conference15.jpg|center|128px]]
| 1944-02-09
|
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 11596
| ''[[:d:Q116880496|David R. Davies]]''
|
| 1927-02-22
| 2016-09-01
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11597
| ''[[:d:Q116883186|David Elias]]''
|
| 1790-06-16
| 1856-05-29
| ''[[:d:Q319538|Abererch]]''
|-
| style='text-align:right'| 11598
| ''[[:d:Q116922937|Mary Knibb]]''
|
| 1798
| 1866-04-01
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 11599
| ''[[:d:Q116933504|M. Peter Middleton]]''
|
| 1946-04-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11600
| ''[[:d:Q116994784|Eileen Mary Rees]]''
|
| 1912-09-21
| 2008-02-12
| [[Cairdiff]]
|-
| style='text-align:right'| 11601
| ''[[:d:Q117251092|George Brown Naysmith]]''
|
| 1866
| 1894-01-30
| [[Wales]]
|-
| style='text-align:right'| 11602
| ''[[:d:Q117286666|Arnold Alonzo Sheppard]]''
|
| 1908-05-14
| 1979-02-05
| ''[[:d:Q5002508|Butetown]]''
|-
| style='text-align:right'| 11603
| ''[[:d:Q117286914|Morgan Rice Morgan]]''
|
| 1806
| 1874
| ''[[:d:Q6661375|Llanfihangel Ystrad]]''
|-
| style='text-align:right'| 11604
| ''[[:d:Q117286952|David Rhagfyr Jones]]''
|
| 1858
| 1915-04-03
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11605
| ''[[:d:Q117286967|Abraham Williams]]''
|
| 1816
| 1882
| ''[[:d:Q6809972|Meidrim]]''
|-
| style='text-align:right'| 11606
| ''[[:d:Q117287364|Charles Henry Glascodine]]''
|
| 1843
| 1928
| ''[[:d:Q990125|Llanelli]]''
|-
| style='text-align:right'| 11607
| ''[[:d:Q117290164|Fflyn Edwards]]''
|
| 2009-03-07
|
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 11608
| ''[[:d:Q117306933|Gawen Goodman]]''
|
| 1526
| 1604
| ''[[:d:Q1013633|Rhuthun]]''
|-
| style='text-align:right'| 11609
| ''[[:d:Q117313621|Ellis Owen Roberts]]''
|
| 1871
| 1959
| ''[[:d:Q5200185|Cynwyd]]''
|-
| style='text-align:right'| 11610
| ''[[:d:Q117313781|John Watkin Jones]]''
|
| 1835
| 1874
| ''[[:d:Q6661318|Llanerfyl]]''
|-
| style='text-align:right'| 11611
| ''[[:d:Q117314501|David Davies]]''
|
| 1815
| 1815<br/>1887-09-02
| ''[[:d:Q7163099|Penmachno]]''
|-
| style='text-align:right'| 11612
| ''[[:d:Q117314527|William Leigh Morgan]]''
|
| 1809
| 1899
| ''[[:d:Q6661277|Llanedi]]''
|-
| style='text-align:right'| 11613
| ''[[:d:Q117383847|John Thomas]]''
|
| 1720
| 1811
| [[Wales]]
|-
| style='text-align:right'| 11614
| ''[[:d:Q117465300|Nicola Heywood-Thomas]]''
|
| 1955-05-17
| 2023-04-06
| ''[[:d:Q779813|Aberteifi]]''
|-
| style='text-align:right'| 11615
| ''[[:d:Q117600065|Gustavus Charles Edward Jones]]''
|
| 1912
| 1988
| [[Welshpool]]
|-
| style='text-align:right'| 11616
| ''[[:d:Q117600963|Henry Inglis Wynne Williams]]''
|
| 1870-07-24
| 1942
| ''[[:d:Q4936754|Boduan]]''
|-
| style='text-align:right'| 11617
| ''[[:d:Q117611477|Scott Oates]]''
|
| 1998-04-10
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11618
| ''[[:d:Q117611484|Andrew Oates]]''
|
| 1999-07-29
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11619
| ''[[:d:Q117760287|William Headley]]''
|
| 1856
| 1915
| ''[[:d:Q3405897|Llanbadarn Fawr]]''
|-
| style='text-align:right'| 11620
| ''[[:d:Q117760674|Alice Jane Headley]]''
|
| 1909
| 1971
| ''[[:d:Q5318814|Dylife]]''
|-
| style='text-align:right'| 11621
| ''[[:d:Q117804037|Sarah Williams]]''
|
| 1859
| 1920
| ''[[:d:Q3403507|Llanbrynmair]]''
|-
| style='text-align:right'| 11622
| ''[[:d:Q117804079|Mary Williams]]''
|
| 1868
| 1893
| ''[[:d:Q17015913|Llandissilio]]''
|-
| style='text-align:right'| 11623
| ''[[:d:Q117804180|Morvydd Monica Williams]]''
|
| 1902
| 1915
| ''[[:d:Q990103|Hwlffordd]]''
|-
| style='text-align:right'| 11624
| ''[[:d:Q117804269|David Dalis Davies]]''
|
| 1864
| 1936
| ''[[:d:Q5276401|Dihewyd]]''
|-
| style='text-align:right'| 11625
| ''[[:d:Q117815356|Bramwell James Leonard Pearce]]''
|
| 1961-04-19
| 2021-08-29
| [[Wales]]
|-
| style='text-align:right'| 11626
| ''[[:d:Q117832601|Thomas Fanning-Evans]]''
|
| 1838
| 1890
| ''[[:d:Q472667|Amlwch]]''
|-
| style='text-align:right'| 11627
| ''[[:d:Q117834659|William Williams]]''
|
| 1867
| 1920
| ''[[:d:Q17015913|Llandissilio]]''
|-
| style='text-align:right'| 11628
| ''[[:d:Q117834694|John Jones]]''
|
| 1850
| 1912
| ''[[:d:Q781725|Llangernyw]]''
|-
| style='text-align:right'| 11629
| ''[[:d:Q117834799|Geoffrey Woolley]]''
|
| 1915-06-29
| 2010-02-17
| ''[[:d:Q1529978|Tredegar]]''
|-
| style='text-align:right'| 11630
| ''[[:d:Q117846310|Jean Ross]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 11631
| ''[[:d:Q117945973|Morris Jones]]''
|
| 1866
| 1944
| ''[[:d:Q3402958|Carno]]''
|-
| style='text-align:right'| 11632
| ''[[:d:Q118067079|Fannie Margaret Thomas]]''
|
| 1868
| 1953
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11633
| ''[[:d:Q118109189|John Owen]]''
|
| 1857-05-06
| 1934-04-16
| ''[[:d:Q791811|Beddgelert]]''
|-
| style='text-align:right'| 11634
| ''[[:d:Q118164946|David William Jones]]''
|
| 1832
| 1900
| [[Merthyr Tydfil|Merthyr Tudful]]
|-
| style='text-align:right'| 11635
| ''[[:d:Q118169494|John Mayor]]''
|
| 1755-04-05
| 1826-05-22
| ''[[:d:Q1235510|Dolgellau]]''
|-
| style='text-align:right'| 11636
| ''[[:d:Q118203177|Ryan Woodman]]''
| [[File:Ryan Woodman 2022.jpg|center|128px]]
| 2004-02-02
|
| [[Newport]]
|-
| style='text-align:right'| 11637
| ''[[:d:Q118256271|John Jones]]''
|
| 1871
|
| ''[[:d:Q2733944|Brynamman]]''
|-
| style='text-align:right'| 11638
| ''[[:d:Q118258969|Jen Wilson]]''
|
| 1944
| 2023-05-08
| [[Swansea]]
|-
| style='text-align:right'| 11639
| ''[[:d:Q118267620|Mai Jones]]''
|
| 1897
|
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 11640
| ''[[:d:Q118268597|Lewis Williams]]''
|
| 1865
|
| ''[[:d:Q17015913|Llandissilio]]''
|-
| style='text-align:right'| 11641
| ''[[:d:Q118383328|Arthur Jones]]''
|
| 1916
| 1988
| ''[[:d:Q3401144|Ferndale]]''
|-
| style='text-align:right'| 11642
| ''[[:d:Q118397835|Robert Gwilym Jones]]''
|
| 1888-05-30
|
| ''[[:d:Q881062|Blaenau Ffestiniog]]''
|-
| style='text-align:right'| 11643
| ''[[:d:Q118399149|John Raymond Williams]]''
|
| 1928
| 2018
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11644
| ''[[:d:Q118399238|John Naish]]''
|
| 1923-04-24
| 1963-07-19
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11645
| ''[[:d:Q118430298|Louisa Traherne]]''
|
| 1794
| 1870
| ''[[:d:Q7593371|St Hilary]]''
|-
| style='text-align:right'| 11646
| ''[[:d:Q118641147|Tomos Pattinson]]''
|
| 2005-10-17
|
| [[Wales]]
|-
| style='text-align:right'| 11647
| ''[[:d:Q118869337|Benjamin Evans]]''
|
| 1745
| 1834-03-09
| ''[[:d:Q2193617|Llandysul]]''
|-
| style='text-align:right'| 11648
| ''[[:d:Q118900764|Evan Evans]]''
|
| 1850
| 1933
| [[Aberystwyth]]
|-
| style='text-align:right'| 11649
| ''[[:d:Q118903180|William Griffith]]''
|
| 1597-10-28
| 1648-10-17
| ''[[:d:Q3405864|Llandygai]]''
|-
| style='text-align:right'| 11650
| ''[[:d:Q119175309|Hana Lili]]''
|
| 2000
|
| [[Vale o Glamorgan]]
|-
| style='text-align:right'| 11651
| ''[[:d:Q119521816|David Evans]]''
| [[File:W.T. Pike Contemporary Biographies N & E Ridings of Yorkshire 1903 (43aa).jpg|center|128px]]
| 1841-10-17
| 1905-08-08
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11652
| ''[[:d:Q119997064|Desmond Healy]]''
|
| 1930
| 2021
| ''[[:d:Q107032187|Bancffosfelen]]''
|-
| style='text-align:right'| 11653
| ''[[:d:Q120069320|Huldah Charles Bassett]]''
|
| 1901-06-08
| 1982-07-15
| ''[[:d:Q11029741|Penparc]]''
|-
| style='text-align:right'| 11654
| ''[[:d:Q120135075|David Aitken]]''
|
| 1926-05-16
| 2021-08-10
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 11655
| ''[[:d:Q120164850|Arthur Robinson]]''
|
| 1814-09-30
| 1893-07-30
| [[Newport]]
|-
| style='text-align:right'| 11656
| ''[[:d:Q120394226|Alan Williams]]''
|
| 1934
| 2011-06-15
| [[Swansea]]
|-
| style='text-align:right'| 11657
| ''[[:d:Q120538514|Stella Musulin]]''
| [[File:Stella Musulin.jpg|center|128px]]
| 1915-07-16
| 1996-01-21
| ''[[:d:Q3012283|Dale]]''
|-
| style='text-align:right'| 11658
| ''[[:d:Q120608062|Jo Thomas]]''
|
| 1972
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 11659
| ''[[:d:Q120684883|Robert Williams]]''
|
| 1990-01-16
|
| [[Sooth Wales]]
|-
| style='text-align:right'| 11660
| ''[[:d:Q120754310|John Brown]]''
|
| 1932
| 2008-06-01
| [[Wales]]
|-
| style='text-align:right'| 11661
| ''[[:d:Q120835093|Erica M. Frank]]''
|
| 1921
| 2013-10-30
| [[Cairdiff]]
|-
| style='text-align:right'| 11662
| ''[[:d:Q120854861|Gainor Hughes]]''
|
| 1745
| 1780
| ''[[:d:Q6661145|Llandderfel]]''
|-
| style='text-align:right'| 11663
| ''[[:d:Q121918481|Thomas Hutchinson]]''
|
| 1815
| 1903-07-18
| ''[[:d:Q3400972|Old Radnor]]''
|-
| style='text-align:right'| 11664
| ''[[:d:Q122051699|Wild Boar]]''
|
| 1989-10-12
|
| ''[[:d:Q3404671|Blaina]]''
|-
| style='text-align:right'| 11665
| ''[[:d:Q122131298|Art School Girlfriend]]''
| [[File:Art School Girlfriend 2023 Cropped.jpg|center|128px]]
|
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11666
| ''[[:d:Q122228095|Timothy Francis Lee]]''
|
| 1998-09-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11667
| ''[[:d:Q122577954|Alun ap Brinley]]''
|
| 1961-01-16
|
| ''[[:d:Q904472|Aberhonddu]]''
|-
| style='text-align:right'| 11668
| ''[[:d:Q122583506|Catrin Arwel]]''
|
| 1981-01-04
|
| ''[[:d:Q2472406|Rhydaman]]''
|-
| style='text-align:right'| 11669
| ''[[:d:Q122583808|Rhys Ap William]]''
|
|
|
| ''[[:d:Q3401092|Morriston]]''
|-
| style='text-align:right'| 11670
| ''[[:d:Q122750045|Clara Thomas]]''
|
| 1841-08-22
| 1914-06-12
| ''[[:d:Q26212261|Pencerrig]]''
|-
| style='text-align:right'| 11671
| ''[[:d:Q122831816|Glanmor Griffiths]]''
|
| 1939-12-21
| 2023-09-26
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11672
| ''[[:d:Q122900265|Jenny James]]''
|
| 1927
| 2014-10-24
| [[Pontypridd]]
|-
| style='text-align:right'| 11673
| ''[[:d:Q122927360|Rosie Hughes]]''
|
| 1995-10-12
|
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 11674
| ''[[:d:Q122932453|David John Lewis]]''
|
| 1893-04-29
| 1982-05-06
| ''[[:d:Q7164543|Penparcau]]''
|-
| style='text-align:right'| 11675
| ''[[:d:Q122973319|Andrew Lamerton]]''
|
| 1970-05-28
|
| ''[[:d:Q5116731|Church Village]]''
|-
| style='text-align:right'| 11676
| ''[[:d:Q123004882|John McLaggan]]''
|
| 1893-06-18
| 1967-01-01
| ''[[:d:Q3405926|Deeside]]''
|-
| style='text-align:right'| 11677
| ''[[:d:Q123018814|Charles Dawe]]''
|
| 1886-03-16
| 1958-08-27
| ''[[:d:Q7675879|Taibach]]''
|-
| style='text-align:right'| 11678
| ''[[:d:Q123055219|Noha Kaiss]]''
|
| 1976-06-11
|
| [[Wales]]
|-
| style='text-align:right'| 11679
| ''[[:d:Q123110921|Edie Bens]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 11680
| ''[[:d:Q123118389|Marion Welchman]]''
|
| 1915
| 1997
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 11681
| ''[[:d:Q123197640|Alun Carter]]''
|
| 1964-12-13
| 2024-08-02
| ''[[:d:Q6744584|Malpas]]''
|-
| style='text-align:right'| 11682
| ''[[:d:Q123219567|Darcie Davies]]''
|
| 2005-06-14
|
| [[Wales]]
|-
| style='text-align:right'| 11683
| ''[[:d:Q123236090|Chris Boss]]''
|
| 1928-06-12
| 2011-05-30
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 11684
| ''[[:d:Q123238082|Mark Douglas]]''
|
| 1960-12-10
|
| [[Aberystwyth]]
|-
| style='text-align:right'| 11685
| ''[[:d:Q123347939|Jetset Andy]]''
| [[File:Jetset Andy onboard Qatar Airways' A380.jpg|center|128px]]
|
|
| ''[[:d:Q39480|Porthcawl]]''
|-
| style='text-align:right'| 11686
| ''[[:d:Q123415348|Graham Drury]]''
|
| 1952-02-13
| 2024-01-26
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11687
| ''[[:d:Q123643783|Richard Flower]]''
|
| 1567
| 1588-08-30
| [[Anglesey]]
|-
| style='text-align:right'| 11688
| ''[[:d:Q123689931|Syd Griffiths]]''
|
| 1905
| 1940-09-11
| ''[[:d:Q2398901|Hawarden]]''
|-
| style='text-align:right'| 11689
| ''[[:d:Q123735311|Charles Sargeant]]''
|
| 1925-01-16
| 2023-11-13
| ''[[:d:Q6661603|Llanhilleth]]''
|-
| style='text-align:right'| 11690
| ''[[:d:Q123743053|Louisa M. Spooner]]''
|
| 1820
| 1886-12-05
| ''[[:d:Q6729249|Maentwrog]]''
|-
| style='text-align:right'| 11691
| ''[[:d:Q123744657|Don Evans]]''
|
| 1939-05-03
| 2023-09-24
| [[Swansea]]
|-
| style='text-align:right'| 11692
| ''[[:d:Q123762847|Carol Byrne Jones]]''
|
| 1943-07-31
| 2023-11-29
| [[Carmarthenshire|Sir Gaerfyrddin]]
|-
| style='text-align:right'| 11693
| ''[[:d:Q123908302|Evie Rees]]''
|
| 1996-02-02
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11694
| ''[[:d:Q123943417|Lauren Drew]]''
|
| 1993-02-17
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11695
| ''[[:d:Q123943566|Mackenzie Martin]]''
| [[File:Mackenzie Martin 2022.jpg|center|128px]]
| 2003-10-26
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11696
| ''[[:d:Q123974804|Marie Hutcheson]]''
|
| 1854
| 1914-01-25
| ''[[:d:Q319369|Aberdare]]''
|-
| style='text-align:right'| 11697
| ''[[:d:Q124023518|Hannah Grae]]''
|
| 2002-09-17
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11698
| ''[[:d:Q124063038|Frederick Tymms]]''
|
| 1889-08-04
| 1987-12-09
| ''[[:d:Q558878|Dinbych-y-pysgod]]''
|-
| style='text-align:right'| 11699
| ''[[:d:Q124093276|Morgan Morse]]''
| [[File:Morgan Morse 2022.jpg|center|128px]]
| 2005-01-15
|
| [[Swansea]]
|-
| style='text-align:right'| 11700
| ''[[:d:Q124219459|Leonard Bailey]]''
|
| 1910-08-08
| 1997-09-11
| [[Pontypridd]]
|-
| style='text-align:right'| 11701
| ''[[:d:Q124258738|Gwern Gwynfil]]''
| [[File:GGwynfil2.jpg|center|128px]]
| 1974
|
| ''[[:d:Q22338221|Bronglais Hospital]]''
|-
| style='text-align:right'| 11702
| ''[[:d:Q124311563|Thomas John Rhys Jones]]''
|
| 1916-06-19
| 1997-05-24
| [[Ystradgynlais]]
|-
| style='text-align:right'| 11703
| ''[[:d:Q124344804|Dan Edwards]]''
| [[File:Dan Edwards LQ 2022.jpg|center|128px]]
| 2003-05-07
|
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11704
| ''[[:d:Q124351152|Terry Adams]]''
|
| 1938-02-22
| 2019-04-20
| ''[[:d:Q2003342|Neath]]''
|-
| style='text-align:right'| 11705
| ''[[:d:Q124355125|Therese Squires]]''
|
| 1949
|
| [[Swansea]]
|-
| style='text-align:right'| 11706
| ''[[:d:Q124357694|Evan Lloyd]]''
|
| 2001-12-28
|
| ''[[:d:Q427792|Penarth]]''
|-
| style='text-align:right'| 11707
| ''[[:d:Q124369042|Elin Maher]]''
| [[File:Elin Maher.jpg|center|128px]]
| 1972-02-29
|
| ''[[:d:Q2741540|Gorseinon]]''
|-
| style='text-align:right'| 11708
| ''[[:d:Q124372795|George Francis Evans]]''
|
| 1809
| 1895-07-15
| [[Cairdiff]]
|-
| style='text-align:right'| 11709
| ''[[:d:Q124424654|Joshua Philip Turner]]''
|
| 1897-03-26
| 1949-03-30
| ''[[:d:Q609161|Abergavenny]]''
|-
| style='text-align:right'| 11710
| ''[[:d:Q124515975|Louisa Beatrice Simmonds]]''
|
| 1918-12
| 2011-11
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11711
| ''[[:d:Q124535331|Nel Metcalfe]]''
|
| 2004-12-17
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11712
| ''[[:d:Q124684373|Kate Williams]]''
|
| 2000-04-05
|
| [[Swansea]]
|-
| style='text-align:right'| 11713
| ''[[:d:Q124697774|Thomas Johnson]]''
|
| 1992-11-28
|
| [[Wales]]
|-
| style='text-align:right'| 11714
| ''[[:d:Q124729090|Dewi Myrddin Hughes]]''
| [[File:Dewi Myrddin Hughes.jpg|center|128px]]
| 1941-04-09
|
| ''[[:d:Q3406313|Llansannan]]''
|-
| style='text-align:right'| 11715
| ''[[:d:Q124784741|Sir Cecil Day]]''
| [[File:Cecil Day 1925.jpg|center|128px]]
| 1884-11-09
| 1963-01-01
| ''[[:d:Q669171|Drenewydd]]''
|-
| style='text-align:right'| 11716
| ''[[:d:Q124850599|Jonathan Sergison]]''
|
| 1964
|
| ''[[:d:Q548248|St Asaph]]''
|-
| style='text-align:right'| 11717
| ''[[:d:Q124851999|Lyn Léwis Dafis]]''
|
| 1960-08-11
| 2022-03-15
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 11718
| ''[[:d:Q124855174|Charles William Jones]]''
| [[File:C. W. Jones portrait.png|center|128px]]
| 1836
| 1908-07-15
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 11719
| ''[[:d:Q124864171|John Belle]]''
|
| 1932
| 2016
| [[Wales]]
|-
| style='text-align:right'| 11720
| ''[[:d:Q124986479|John David Francis Jones]]''
|
| 1939-07-10
| 2009-03-04
| [[Newport]]
|-
| style='text-align:right'| 11721
| ''[[:d:Q125015402|aimsey]]''
| [[File:Aimsey in 2022.png|center|128px]]
| 2001-12-11
|
| [[Wales]]
|-
| style='text-align:right'| 11722
| ''[[:d:Q125025293|Thomas D. Evans]]''
|
| 1844-07-21
| 1903-06-20
| [[Wales]]
|-
| style='text-align:right'| 11723
| ''[[:d:Q125121773|Sydney Kingston Gore]]''
| [[File:Lieut Sydney Kingston GORE, 1st Bn Royal West Kent Regiment - geograph.org.uk - 5252748.jpg|center|128px]]
| 1889-07-12
| 1914-10-28
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 11724
| ''[[:d:Q125145904|Thomas George John]]''
|
| 1880-11-18
| 1946-08-09
| ''[[:d:Q784824|Pembroke Dock]]''
|-
| style='text-align:right'| 11725
| ''[[:d:Q125191138|Anya Paintsil]]''
|
| 1993
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11726
| ''[[:d:Q125216731|Drew Pritchard]]''
|
| 1970-06-24
|
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 11727
| ''[[:d:Q125307823|Ronald Barraud]]''
|
| 1906
|
| ''[[:d:Q2297559|Glyn Ebwy]]''
|-
| style='text-align:right'| 11728
| ''[[:d:Q125324061|George Rudd Thompson]]''
|
| 1868
| 1948-11-03
| [[Newport]]
|-
| style='text-align:right'| 11729
| ''[[:d:Q125324831|Henry Edwards]]''
|
|
|
| [[Newport]]
|-
| style='text-align:right'| 11730
| ''[[:d:Q125398598|Austin Anthony]]''
|
| 1908-12-17
| 1965-01-10
| ''[[:d:Q1930405|Glynneath]]''
|-
| style='text-align:right'| 11731
| ''[[:d:Q125510592|Diana Edwards-Jones]]''
|
| 1932-12-13
| 2024-04-14
| [[Swansea]]
|-
| style='text-align:right'| 11732
| ''[[:d:Q125525882|Edward Morus Jones]]''
| [[File:30 Medi 2012 - Dirprwy Lywydd yn Nant Gwrtheyrn 30 September 2012 - Deputy Presiding Officer at Nant Gwrtheyrn (8070076064) (cropped).jpg|center|128px]]
| 1944-05-22
|
| ''[[:d:Q3402425|Llanuwchllyn]]''
|-
| style='text-align:right'| 11733
| ''[[:d:Q125536673|Elizabeth Rhŷs]]''
|
| 1841-05-26
| 1911-04-29
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 11734
| ''[[:d:Q125543942|Charlie Crew]]''
|
| 2006
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11735
| ''[[:d:Q125581918|Myra Evans]]''
|
| 1883-11-01
| 1972-08-25
| ''[[:d:Q2039004|New Quay]]''
|-
| style='text-align:right'| 11736
| ''[[:d:Q125593574|Eirian Short]]''
|
| 1924
| 2021
| ''[[:d:Q1018730|Fishguard]]''
|-
| style='text-align:right'| 11737
| ''[[:d:Q125620979|Muriel Lavender]]''
|
| 1933-04-26
| 2018-06-11
| ''[[:d:Q7534773|Sketty]]''
|-
| style='text-align:right'| 11738
| ''[[:d:Q125621885|Iris Thomas]]''
|
| 1919
| 2012-06-24
| ''[[:d:Q2051921|Maerdy]]''
|-
| style='text-align:right'| 11739
| ''[[:d:Q125622230|J. H. Matthews]]''
|
| 1930-09-11
| 1978-02-08
| [[Swansea]]
|-
| style='text-align:right'| 11740
| ''[[:d:Q125635746|Peter Rees]]''
|
| 1937-10-14
|
| ''[[:d:Q3910782|Bedlinog]]''
|-
| style='text-align:right'| 11741
| ''[[:d:Q125662553|Dave Thomas]]''
|
| 1941-04-29
| 2017-01-03
| ''[[:d:Q3072939|Pontrhydyfen]]''
|-
| style='text-align:right'| 11742
| ''[[:d:Q125792254|Elvira Gwenllian Payne]]''
|
| 1917-03-28
| 2007-04-05
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 11743
| ''[[:d:Q125792255|Cyril George Cupid]]''
|
| 1908
| 1965
| [[Swansea]]
|-
| style='text-align:right'| 11744
| ''[[:d:Q125792258|John Darwin Hinds]]''
|
| 1922-12-22
| 1981
| ''[[:d:Q809009|Barry]]''
|-
| style='text-align:right'| 11745
| ''[[:d:Q125792263|Ernest Burton]]''
|
| 1893
| 1960
| [[Monmouthshire]]
|-
| style='text-align:right'| 11746
| ''[[:d:Q125792264|Neil Sinclair]]''
|
| 1944
| 2019
| [[Cairdiff]]
|-
| style='text-align:right'| 11747
| ''[[:d:Q125792267|Myer Cohen]]''
|
| 1904
| 1997
| [[Swansea]]
|-
| style='text-align:right'| 11748
| ''[[:d:Q125792270|Montague Black]]''
|
| 1917-11-10
| 1986-02-19
| [[Swansea]]
|-
| style='text-align:right'| 11749
| ''[[:d:Q125792273|Gene Latter]]''
|
| 1942
| 2004
| ''[[:d:Q5002508|Butetown]]''
|-
| style='text-align:right'| 11750
| ''[[:d:Q125792284|Robert Owen Pugh]]''
|
| 1846-02-02
| 1922-08-20
| ''[[:d:Q3402212|Llanfachreth]]''
|-
| style='text-align:right'| 11751
| ''[[:d:Q125792285|David Rosser-Owen]]''
|
| 1943-03
| 2021-12-05
| [[Swansea]]
|-
| style='text-align:right'| 11752
| ''[[:d:Q125792287|James Sapoe John Mannay]]''
|
| 1927-12-02
| 2012-05-30
| ''[[:d:Q5002508|Butetown]]''
|-
| style='text-align:right'| 11753
| ''[[:d:Q125792292|Harold Smart]]''
|
| 1899
| 1919-06-11
| [[Cairdiff]]
|-
| style='text-align:right'| 11754
| ''[[:d:Q125792294|Olwen Watkins]]''
|
| 1935
| 2018-12-31
| ''[[:d:Q3398900|Tiger Bay]]''
|-
| style='text-align:right'| 11755
| ''[[:d:Q125792297|Henry Joseph Ernest]]''
|
| 1929
| 2023-06-04
| [[Cairdiff]]
|-
| style='text-align:right'| 11756
| ''[[:d:Q125792302|Jane Leonard]]''
|
| 1834
| 1917-04-03
| ''[[:d:Q3401566|Llanarth]]''
|-
| style='text-align:right'| 11757
| ''[[:d:Q125792310|Eliza Pughe]]''
|
| 1826
| 1847
| ''[[:d:Q7837752|Tref Alaw]]''
|-
| style='text-align:right'| 11758
| ''[[:d:Q125792314|Manikam Susheela Lourie]]''
|
| 1941
| 2023-05-01
| ''[[:d:Q527467|Colwyn Bay]]''
|-
| style='text-align:right'| 11759
| ''[[:d:Q125792318|Thomas Charles Jacobsen]]''
|
| 1921-04-28
| 1973-10-03
| ''[[:d:Q7194170|Pillgwenlli]]''
|-
| style='text-align:right'| 11760
| ''[[:d:Q125792320|Mavis Llewellyn]]''
|
| 1908-02-17
| 1978
| ''[[:d:Q4923812|Blaengwynfi]]''
|-
| style='text-align:right'| 11761
| ''[[:d:Q125792321|Ceridwen Brown]]''
|
| 1896-10-10
| 1976
| ''[[:d:Q2821566|Aberaman]]''
|-
| style='text-align:right'| 11762
| ''[[:d:Q125792325|Caroline Elizabeth Williams]]''
|
| 1823
| 1908-01-13
| [[Bridgend|Pen-y-bont ar Ogwr]]
|-
| style='text-align:right'| 11763
| ''[[:d:Q125792432|Mahala Davis]]''
|
| 1937
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11764
| ''[[:d:Q125948678|David Davies]]''
|
| 1837
| 1867-11-17
| ''[[:d:Q6661564|Llangunllo]]''
|-
| style='text-align:right'| 11765
| ''[[:d:Q126010568|Richard Jenkin Ellis]]''
|
| 1888-11-09
| 1976
| [[Aberystwyth]]
|-
| style='text-align:right'| 11766
| ''[[:d:Q126011056|June Gruffydd]]''
|
| 1929
| 1989
| ''[[:d:Q3402958|Carno]]''
|-
| style='text-align:right'| 11767
| ''[[:d:Q126083187|Hugh Royston Jenkins]]''
|
| 1933-11-09
| 2024-03-07
| ''[[:d:Q1072019|Port Talbot]]''
|-
| style='text-align:right'| 11768
| ''[[:d:Q126484833|Sabrina Lee]]''
|
| 1992-11-28
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11769
| ''[[:d:Q126501230|Ken Caswell]]''
|
| 1946
|
| ''[[:d:Q1980175|Brynmawr]]''
|-
| style='text-align:right'| 11770
| ''[[:d:Q126947966|Elined Prys]]''
|
| 1895-02-16
| 1983-06-30
| ''[[:d:Q7837765|Trefeca]]''
|-
| style='text-align:right'| 11771
| ''[[:d:Q126993139|John Powell]]''
|
|
| 1743
| ''[[:d:Q4667105|Abergwesyn]]''
|-
| style='text-align:right'| 11772
| ''[[:d:Q126993374|John Powell]]''
|
| 1720
| 1766
| ''[[:d:Q6661307|Llanelly]]''
|-
| style='text-align:right'| 11773
| ''[[:d:Q127377863|Lili Jones]]''
|
| 2005-09-26
|
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11774
| ''[[:d:Q127416552|Rhys Thomas]]''
|
| 2006-11-05
|
| ''[[:d:Q634054|Conwy]]''
|-
| style='text-align:right'| 11775
| ''[[:d:Q127548319|Catherine George]]''
|
| 20th century
|
| [[Wales]]
|-
| style='text-align:right'| 11776
| ''[[:d:Q127592033|Huw Rowlands]]''
|
| 1962-04-18
|
| [[Swansea]]
|-
| style='text-align:right'| 11777
| ''[[:d:Q127684880|David Read]]''
|
| 1933-09-28
| 2024-06-27
| ''[[:d:Q3404686|Senghenydd]]''
|-
| style='text-align:right'| 11778
| ''[[:d:Q128506365|Oliver Thomas]]''
|
| 1987-09-05
| 2014-04-26
| [[Powys]]
|-
| style='text-align:right'| 11779
| ''[[:d:Q128847459|Anita Bronson]]''
|
| 1940-07-01
| 2024-07-10
| ''[[:d:Q996492|Llandudno]]''
|-
| style='text-align:right'| 11780
| ''[[:d:Q128934347|Hugh Trollope]]''
|
| 1925-03-09
| 2011-03-08
| [[Swansea]]
|-
| style='text-align:right'| 11781
| ''[[:d:Q128995758|Lilian Jane Mason]]''
|
| 1874-11-20
| 1953-01-28
| ''[[:d:Q1021164|Pontypool]]''
|-
| style='text-align:right'| 11782
| ''[[:d:Q129075710|Helen Prosser]]''
|
| 1962-08
|
| ''[[:d:Q7823763|Tonyrefail]]''
|-
| style='text-align:right'| 11783
| ''[[:d:Q129257059|Axel Rudakubana]]''
|
| 2006-08-07
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11784
| ''[[:d:Q129312859|Huw Roberts]]''
|
| 1921
| 2010-06-25
| ''[[:d:Q1638504|Llanberis]]''
|-
| style='text-align:right'| 11785
| ''[[:d:Q129400724|Ian Hamilton Burton]]''
|
| 1915-09-03
| 1996-03-14
| ''[[:d:Q3404443|Pennal]]''
|-
| style='text-align:right'| 11786
| ''[[:d:Q129485359|Martin Ace]]''
|
| 1945-12-31
|
| [[Swansea]]
|-
| style='text-align:right'| 11787
| ''[[:d:Q129920146|Macs Page]]''
|
| 2004-12-17
|
| ''[[:d:Q5277964|Dinas Cross]]''
|-
| style='text-align:right'| 11788
| ''[[:d:Q130218515|Jane Maurice]]''
|
| 1812-10-19
|
| ''[[:d:Q129979095|Tyddyn-Tudur]]''
|-
| style='text-align:right'| 11789
| ''[[:d:Q130238722|Llion Jones]]''
| [[File:Llion Jones, author of Attention is All You Need, at CIC Tokyo speaking about sakana.ai (cropped).jpg|center|128px]]
| 1984
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11790
| ''[[:d:Q130238909|Charles Herbert George Martin]]''
|
| 1881-10-05
| 1915-05-01
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 11791
| ''[[:d:Q130259502|Elias Phillips Jones]]''
|
| 1865-02-27
| 1937-03
| ''[[:d:Q5136827|Clydau]]''
|-
| style='text-align:right'| 11792
| ''[[:d:Q130259511|Edith Frances Hopkins]]''
|
| 1880-04
| 1937-12
| [[Cairdiff]]
|-
| style='text-align:right'| 11793
| ''[[:d:Q130259565|Lewis Hopkins]]''
|
| 1836
|
| [[Cairdiff]]
|-
| style='text-align:right'| 11794
| ''[[:d:Q130319607|Julian Webber]]''
|
| 1951
|
| [[Wales]]
|-
| style='text-align:right'| 11795
| ''[[:d:Q130321930|Alfred Seymour Bankart]]''
| [[File:Sir Alfred Bankart.jpg|center|128px]]
| 1870-04-16
| 1933-10-21
| ''[[:d:Q1858117|Llansawel]]''
|-
| style='text-align:right'| 11796
| ''[[:d:Q130327532|Mary Jordan]]''
|
| 1879-11-27
| 1961-05-15
| [[Cairdiff]]
|-
| style='text-align:right'| 11797
| ''[[:d:Q130340125|Christopher Edwards]]''
|
| 1966
|
| [[Swansea]]
|-
| style='text-align:right'| 11798
| ''[[:d:Q130355895|John Sutherland (architect)]]''
| [[File:John Sutherland ONZM Investiture.jpg|center|128px]]
| 1933
| 2022-06-26
| [[Wales]]
|-
| style='text-align:right'| 11799
| ''[[:d:Q130367283|Edward Davies]]''
|
| 1618-02-20
| 1680-03-14
| ''[[:d:Q111328993|Rhiwlas]]''
|-
| style='text-align:right'| 11800
| ''[[:d:Q130367508|Mary Brittill]]''
| [[File:Portrait of Dame Brettell (4672793).jpg|center|128px]]
| 1717-12-24
| 1821-11-09
| [[Aberystwyth]]
|-
| style='text-align:right'| 11801
| ''[[:d:Q130377526|Morfudd Hughes]]''
|
| 1961-05-28
|
| ''[[:d:Q257446|Caergybi]]''
|-
| style='text-align:right'| 11802
| ''[[:d:Q130402747|Adam Sylvester]]''
|
| 2000-05-18
|
| ''[[:d:Q24192181|University Hospital Llandough]]''
|-
| style='text-align:right'| 11803
| ''[[:d:Q130409503|Thomas Foulkes]]''
|
| 1826<br/>1825-09-05
| 1901<br/>1900-12-22
| [[Wales]]
|-
| style='text-align:right'| 11804
| ''[[:d:Q130453759|Claude Isaac Lewis]]''
|
| 1880-04-12
| 1924-01-12
| [[Cairdiff]]
|-
| style='text-align:right'| 11805
| ''[[:d:Q130469355|Tonya Smith]]''
|
|
|
| [[Swansea]]
|-
| style='text-align:right'| 11806
| ''[[:d:Q130547278|Deborah Humble]]''
|
| 1969-08-04
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11807
| ''[[:d:Q130707271|Dewi Wyn Williams]]''
|
| 1958
|
| ''[[:d:Q7165424|Penysarn]]''
|-
| style='text-align:right'| 11808
| ''[[:d:Q130736389|Josey Pillon]]''
|
| 1876-12-27
| 1956
| [[Cairdiff]]
|-
| style='text-align:right'| 11809
| ''[[:d:Q130743648|Moss Williams]]''
|
| 1859
| 1944
| ''[[:d:Q428829|Caernarfon]]''
|-
| style='text-align:right'| 11810
| ''[[:d:Q130744479|John Salisbury]]''
|
| 1707-09-01
| 1762-12-18
| ''[[:d:Q1892770|North Wales]]''
|-
| style='text-align:right'| 11811
| ''[[:d:Q130750866|Maredudd ap Huw]]''
|
| 1972-09
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11812
| ''[[:d:Q130921889|Thomas Dempster Jones]]''
|
| 1914
| 1989
| ''[[:d:Q1024935|Harlech]]''
|-
| style='text-align:right'| 11813
| ''[[:d:Q130994182|Verlie Blanch George]]''
|
| 1907
| 1981
| ''[[:d:Q496368|Wrexham]]''
|-
| style='text-align:right'| 11814
| ''[[:d:Q130994444|John Charles]]''
|
| 1870
| 1941
| ''[[:d:Q4980803|Brymbo]]''
|-
| style='text-align:right'| 11815
| ''[[:d:Q131154389|Ifor Bowen Griffith]]''
|
| 1907-01-22
| 1990-05-05
| ''[[:d:Q3398942|Tregarth]]''
|-
| style='text-align:right'| 11816
| ''[[:d:Q131171335|Jenni Hall]]''
|
| 1939
|
| [[Bangor, Gwynedd|Bangor]]
|-
| style='text-align:right'| 11817
| ''[[:d:Q131278513|James Arthur Davies]]''
|
| 1923
| 2007
| ''[[:d:Q4941233|Boncath]]''
|-
| style='text-align:right'| 11818
| ''[[:d:Q131288412|Eleanor Dwyryd]]''
|
| 1915-01-17
| 1978-02-10
| ''[[:d:Q3757704|Ffestiniog]]''
|-
| style='text-align:right'| 11819
| ''[[:d:Q131304634|Hywel Jenkins]]''
|
| 1976-03-07
|
| ''[[:d:Q909119|Caerphilly]]''
|-
| style='text-align:right'| 11820
| ''[[:d:Q131310255|Arthur John]]''
|
| 1900-05-11
| 1929-08-16
| ''[[:d:Q3401198|Gowerton]]''
|-
| style='text-align:right'| 11821
| ''[[:d:Q131323969|Trevor Nicholas]]''
|
| 1894-01-07
| 1979-03-14
| ''[[:d:Q10967145|Sudbrook]]''
|-
| style='text-align:right'| 11822
| ''[[:d:Q131323970|Aaron Rees]]''
|
| 1886-08-02
| 1950-01-22
| ''[[:d:Q2243637|Maesteg]]''
|-
| style='text-align:right'| 11823
| ''[[:d:Q131323971|Bill Morris]]''
|
| 1894-01-20
| 1967-07-14
| ''[[:d:Q3405637|Cwmtillery]]''
|-
| style='text-align:right'| 11824
| ''[[:d:Q131327721|Jim Jones]]''
|
| 1893-10-04
| 1934-03-03
| ''[[:d:Q4667111|Abergwynfi]]''
|-
| style='text-align:right'| 11825
| ''[[:d:Q131336737|Joe Thomas]]''
|
| 2002-03-12
|
| [[Wales]]
|-
| style='text-align:right'| 11826
| ''[[:d:Q131342512|Thomas Stanley Thomas]]''
|
| 1917-07-04
| 2015-09-14
| ''[[:d:Q5302695|Dowlais]]''
|-
| style='text-align:right'| 11827
| ''[[:d:Q131358247|Diane Tammes]]''
|
| 1942-04-10
| 2020-05-30
| [[Welshpool]]
|-
| style='text-align:right'| 11828
| ''[[:d:Q131444573|Robert John Davies]]''
| [[File:Caniadau Barlwydon Llyfr 1 (page 4 crop).jpg|center|128px]]
| 1853-08-03
|
| ''[[:d:Q24182555|Llidiardau]]''
|-
| style='text-align:right'| 11829
| ''[[:d:Q131538921|Laurie Webb]]''
|
| 1924-05-06
|
| [[Newport]]
|}
== feectional human ==
{| class='wikitable sortable'
! #
! enw
! eemage
! date o birth
! date o daith
! place o birth
|-
| style='text-align:right'| 1
| ''[[:d:Q1283396|Myrddin Wyllt]]''
|
| 540
|
| ''[[:d:Q835835|Caerfyrddin]]''
|-
| style='text-align:right'| 2
| ''[[:d:Q4006190|Larry Talbot]]''
| [[File:TheWolfManLobbyCardCropped.png|center|128px]]
|
|
| [[Wales]]
|-
| style='text-align:right'| 3
| ''[[:d:Q6742717|Malcolm Wynn-Jones]]''
|
| 1958-12-29
|
| ''[[:d:Q5315782|Dyfnant]]''
|}
== folklore character ==
{| class='wikitable sortable'
! #
! enw
! eemage
! date o birth
! date o daith
! place o birth
|-
| style='text-align:right'| 1
| ''[[:d:Q72699024|Canthrig Bwt]]''
|
|
|
| ''[[:d:Q13130349|Nant Peris]]''
|-
| style='text-align:right'| 2
| ''[[:d:Q72823385|Beti'r Bont]]''
|
|
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 3
| ''[[:d:Q72824249|Gwen Davies]]''
|
|
|
| [[Pembrokeshire|Sir Benfro]]
|-
| style='text-align:right'| 4
| ''[[:d:Q72826181|Peggy Abercamles]]''
|
|
|
| ''[[:d:Q651733|Llanymddyfri]]''
|-
| style='text-align:right'| 5
| ''[[:d:Q72828361|Sali Minffordd]]''
|
|
|
| [[Powys]]
|}
== human whose existence is disputed ==
{| class='wikitable sortable'
! #
! enw
! eemage
! date o birth
! date o daith
! place o birth
|-
| style='text-align:right'| 1
| ''[[:d:Q1883439|Madog ab Owain Gwynedd]]''
| [[File:01madog07.jpg|center|128px]]
| 1150
| No/unknown value
| ''[[:d:Q2369922|Dolwyddelan Castle]]''
|-
| style='text-align:right'| 2
| ''[[:d:Q13127568|Y Crythor Du]]''
|
|
|
| [[Gwynedd]]
|}
== Misc ==
{| class='wikitable sortable'
! #
! enw
! eemage
! date o birth
! date o daith
! place o birth
|-
| style='text-align:right'| 1
| ''[[:d:Q2483726|Cadfael]]''
|
| 1080
|
| ''[[:d:Q2684439|Trefriw]]''
|-
| style='text-align:right'| 2
| ''[[:d:Q2560424|Pixie]]''
|
|
|
| [[Wales]]
|-
| style='text-align:right'| 3
| ''[[:d:Q6389447|Kenmare Sorceress]]''
|
| 1909-09-22
|
| [[Wales]]
|-
| style='text-align:right'| 4
| ''[[:d:Q6426771|Edward Kenway]]''
| [[File:WW St Louis 2014 - Assassin's Creed (14019411076).jpg|center|128px]]
| 1693-03-10
|
| [[Swansea]]
|-
| style='text-align:right'| 5
| ''[[:d:Q111462365|Glassalt]]''
|
| 1891
|
| [[Wales]]
|-
| style='text-align:right'| 6
| ''[[:d:Q129914267|Siân Lewis (Caerdydd)]]''
| [[File:Siân Lewis 2018, Llanelwedd.jpg|center|128px]]
| 1970-08-05
|
| [[Cairdiff]]
|-
| style='text-align:right'| 7
| ''[[:d:Q130282161|Cennard Davies]]''
| [[File:Cennard Davies pen ac ysgwydd.jpg|center|128px]]
| 1937-04-17
|
| ''[[:d:Q302872|Treorchy]]''
|}
{{Wikidata list end}}
99axo83wy36bq66xwqc2t2m15d7n7cd
Willard Van Orman Quine
0
140563
901712
883960
2025-01-04T11:17:19Z
RabbieBurnsGhost
114955
Chynged the spellin of philosophy
901712
wikitext
text/x-wiki
{{Infobox philosopher
| region = [[Wastren Philosophy]]
| era = [[20t-century philosophy]]
| image =
| caption = Willard Van Orman Quine
| name = Willard Van Orman Quine
| birth_date = {{birth date|mf=yes|1908|6|25}}
| birth_place = [[Akron, Ohio|Akron]], [[Ohio]]
| death_date = {{death date and age|mf=yes|2000|12|25|1908|6|25}}
| death_place = [[Boston]], [[Massachusetts]]
| spouse = Naomi Clayton<ref name=mactutor/><br>Marjorie Boynton<ref name=mactutor/>
| alma_mater = [[Oberlin College]] (B.A., 1930)<br>[[Harvard University]] (Ph.D., 1932)
| institutions = [[Harvard Varsity]]
| school_tradition = [[Analytic philosophy|Analytic]]
| main_interests = [[Logic]], [[ontology]], [[epistemology]], [[filosofie o leid]], [[philosophy o mathematics]], [[philosophy o science]], [[set theory]]
| notable_ideas = [[New Foondations]], [[indeterminacy o translation]], [[naituralised epistemology]], [[ontological relativity]], [[Quine's paradox]], [[Duhem–Quine thesis]], [[Quine–Putnam indispensability thesis]], [[radical translation]], [[inscrutability o reference]], [[confirmation holism]], [[Quine–McCluskey algorithm]], [[Plato's beard]]
| influences = [[Rudolf Carnap]], [[Alfred Tarski]], [[Vienna Circle]], [[Clarence Irving Lewis|C. I. Lewis]], [[Alfred North Whitehead|A. N. Whitehead]], [[B. F. Skinner]], [[Pierre Duhem]]
| influenced = [[Roger F. Gibson, Jr.]], [[Donald Davidson (philosopher)|Donald Davidson]], [[Daniel Dennett]], [[David Lewis (philosopher)|David Lewis]], [[Hilary Putnam]], [[Dagfinn Føllesdal]], [[Gilbert Harman]], [[Hao Wang (academic)|Hao Wang]], [[Stephen Stich]], [[Hilary Kornblith]]
| awards = [[Rolf Schock Prizes]] in Logic an Philosophy {{small|(1993)}}<br>[[Leet o Kyoto Prize winners|Kyoto Prize]] <small>(1996)</small>
}}
{{Infobox scientist
| name = Willard Van Orman Quine
| thesis_title = The Logic of Sequences: A Generalization of Principia Mathematica ({{lang-sco|The Logic o Sequences: A Generalisation o Principia Mathematica}})
| thesis_url = https://www.researchgate.net/publication/271047938_Quine_W_V_The_logic_of_sequences_A_generalization_of_Principia_mathematica_Harvard_dissertations_in_philosophy_Garland_Publishing_New_York_and_London_1990_xi_290_pp
| thesis_year = 1932
| doctoral_advisor = [[Alfred North Whitehead]]
| doctoral_students = [[Donald Davidson (filosofer)|Donald Davidson]], [[Hubert Dreyfus]], [[David Lewis (filosofer)|David Lewis]], [[Daniel Dennett]], [[Gilbert Harman]], [[Dagfinn Føllesdal]], [[Hao Wang (academic)|Hao Wang]]
}}
[[File:Willard Van Orman Quine on Bluenose II in Halifax NS harbor 1980.jpg|thumb|200px|Willard Van Orman Quine (1980)]]
'''Willard Van Orman Quine''' (Juin 25, 1908 – December 25, 2000) (kent tae intimates as "Van")<ref name=mactutor>{{MacTutor|id=Quine|date=October 2003}}</ref> wis an [[American filosofer|American philosopher]] an [[logician]] in the [[analytic filosofie|analytic tradeetion]], recognised as "ane o the maist influential philosophers o the twentiet century."<ref>[http://www.nytimes.com/2000/12/29/arts/29QUIN.html "W. V. Quine, Philosopher Who Analyzed Language and Reality, Dies at 92"]</ref>
==References==
{{reflist}}
{{Authority control}}
{{DEFAULTSORT:Quine, Willard Van Orman}}
[[Category:Willard Van Orman Quine| ]]
[[Category:1908 births]]
[[Category:2000 daiths]]
[[Category:20t-century philosophers]]
[[Category:American atheists]]
[[Category:American logicians]]
[[Category:American militar personnel o Warld War II]]
[[Category:American philosophers]]
[[Category:American filosofie academics]]
[[Category:Analytic philosophers]]
[[Category:Atheist philosophers]]
[[Category:Empiricists]]
[[Category:Epistemologists]]
[[Category:Fellaes o the Committee for Skeptical Inquiry]]
[[Category:Harvard Varsity alumni]]
[[Category:Harvard Varsity faculty]]
[[Category:Holism]]
[[Category:Kyoto laureates in Airts an Filosofie]]
[[Category:Materialists]]
[[Category:Model theorists]]
[[Category:Oberlin College alumni]]
[[Category:Ontologists]]
[[Category:Fowk frae Akron, Ohio]]
[[Category:Philosophers o leid]]
[[Category:Philosophers o mathematics]]
[[Category:Philosophers o science]]
[[Category:Philosophy o logic]]
[[Category:Pragmatists]]
[[Category:Rolf Schock Prize laureates]]
[[Category:Set theorists]]
[[Category:Wesleyan Varsity faculty]]
[[Category:Tarski lecturers]]
[[Category:Behaviourism]]
665wxp7xayog50lfqmbkjk5sy7kebpi
Outlander (TV series)
0
173134
901705
901509
2025-01-04T03:35:42Z
Stephan1000000
59533
90
901705
wikitext
text/x-wiki
{{Infobox television
|show_name = Outlander
|image = Outlander title card.jpg
|caption =
|genre = {{Plainlist|
* [[Historical feection]]
* [[Drama]]
* [[Science feection]]
* [[Adventur]]
* [[Fantasie]]
* [[Romance film|Romance]]
}}
|based_on = {{Based on|[[Outlander series|''Outlander'' series]]|[[Diana Gabaldon]]}}
|developer = [[Ronald D. Moore]]
|starring = {{Plainlist|
* [[Caitriona Balfe]]
* [[Sam Heughan]]
* [[Tobias Menzies]]
* [[Gary Lewis (actor)|Gary Lewis]]
* [[Graham McTavish]]
* [[Lotte Verbeek]]
* [[Bill Paterson (actor)|Bill Paterson]]
* [[Laura Donnelly (actress)|Laura Donnelly]]
* [[Douglas Henshall]]
* Steven Cree
* Duncan Lacroix
* Grant O'Rourke
* [[Stephen Walters]]
* [[Simon Callow]]
* [[Dominique Pinon]]
* [[Stanley Weber]]
* [[Richard Rankin]]
* Sophie Skelton
* [[Andrew Gower (actor)|Andrew Gower]]
* [[Rosie Day]]
* [[Nell Hudson]]
* [[Clive Russell]]
* [[Frances de la Tour]]
}}
|theme_music_composer =
|opentheme = "[[The Skye Boat Song]]" bi Raya Yarbrough
|endtheme =
|composer = [[Bear McCreary]]
|country = Unitit Kinrick<br />Unitit States
|language = Inglis<br />Scots Gaelic<br />Scots<br />French
|num_seasons = 7
|num_episodes = 90
|list_episodes = Leet o Outlander episodes
|executive_producer = {{Plainlist|
* [[Andy Harries]]
* Jim Kohlberg
* Ronald D. Moore
* Maril Davis
* [[Anne Kenney]]
* [[Toni Graphia]]
* [[Ira Steven Behr]]
}}
|producer = David Brown<br />Matthew B. Roberts
|editor = Michael O'Halloran<br>Liza Cardinale<br>Melissa Lawson Cheung
|location = {{Plainlist|
* [[Scotland]]
* [[Prague]], [[Czech Republic]]
* [[Ingland]]
* [[Cape Toun]], [[Sooth Africae]]
}}
|cinematography = Neville Kidd<br>David Higgs<br>Martin Fuher<br>Denis Crossan<br>Stephen McNutt
|camera = [[Single-camera setup|Single-camera]]
|runtime = 51–88 minutes
|company = {{Plainlist|
* [[Sony Pictures Television]]
* [[Left Bank Pictures]] <!-- Andy Harries' company -->
* Story Mining and Supply Company <!-- Jim Kohlberg's company -->
* Tall Ship Productions <!-- Ron Moore's company -->
}}
|distributor = Sony Pictures Television
|channel = [[Starz]]
|picture_format =
|audio_format =
|first_run = Unitit States
|first_aired = {{Start date|2014|8|9}}
|last_aired = present
|followed_by =
|related =
|website = http://www.starz.com/originals/outlander
|website_title = Offeecial wabsteis
|production_website =
}}
'''''Outlander''''' is a Breetish-American telly drama series based on the historical [[time traivel]] [[Outlander series|''Outlander'' series]] o novelles bi [[Diana Gabaldon]].
[[Category:1743 in feection]]
[[Category:1945 in feection]]
[[Category:2010s American televeesion series]]
[[Category:2010s American drama televeesion series]]
[[Category:2014 American televeesion series debuts]]
[[Category:Inglis-leid televeesion programmes]]
[[Category:Outlander series]]
[[Category:Scots Gaelic-leid films]]
[[Category:Serial drama televeesion series]]
[[Category:Starz network shows]]
[[Category:Televeesion programmes based on novelles]]
[[Category:Televeesion series bi Left Bank Pictures]]
[[Category:Televeesion series bi Sony Pictures Television]]
[[Category:Televeesion series set in the 18t century]]
[[Category:Televeesion series set in the 1940s]]
[[Category:Televeesion shaws set in Fraunce]]
[[Category:Televeesion shaws set in Scotland]]
[[Category:Time traivel televeesion series]]
k4fltniyk8uv249jzfzaoeocoastkay
Ghil'ad Zuckermann
0
201463
901701
900012
2025-01-03T22:49:11Z
InternetArchiveBot
79721
Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5
901701
wikitext
text/x-wiki
{{Infobox scientist
| name = Ghil'ad Zuckermann
| image = Zuckermann.jpg
| caption =Ghil'ad Zuckermann
| birth_date = {{Birth date and age|1971|6|1|df=y}}
| birth_place = [[Tel Aviv]], [[Israel]]
| fields = [[Lingueestics]], [[:en:Language revitalization|Language revitalization]]
| alma_mater = [[Varsity o Cambridge]]<br /> [[Varsity o Oxford]]<br />[[Varsity o Tel Aviv]]<br />[[United World College of the Adriatic]]
|doctoral_advisor =
|doctoral_students =
|notable_students =
| known_for = [[:en:Phono-semantic matching|Phono-semantic matching]], "Revivalistics", Hybridic theory of "Israeli" ([[Ebreu]]), Classification of camouflaged borrowing, Language reclamation and mental health
|author_abbrev_bot =
|author_abbrev_zoo =
|influences =
|influenced =
|awards =
| image_size = 250px
| work_institutions = [[Varsity o Cambridge]], [[Varsity o Adelaide]], [[Churchill College, Cambridge]], [[Shanghai Jiao Tong Varsity]], [[Weizmann Institute of Science]], [[Varsity o Queensland]], [[National University of Singapore]], [[Varsity o Texas at Austin]]}}
'''Ghil'ad Zuckermann''' (born [[1 Juin]] 1971, [[Tel Aviv]], [[Israel]]) (D.Phil., [[Varsity o Oxford]]; Ph.D., [[Varsity o Cambridge]])<ref>[https://www.vividsydney.com/speaker/prof-ghilad-zuckermann Vivid Sydney (Light, Music and Ideas)] {{Webarchive|url=https://web.archive.org/web/20180618125759/https://www.vividsydney.com/speaker/prof-ghilad-zuckermann |date=2018-06-18 }}, Speaker: Prof. Ghil'ad Zuckermann.</ref> is a [[Australie|Australien]]-[[Great Breetain|Breetish]]-[[Israel|Israeli]]-[[Italy|Italian]] [[Lingueestics|lingueest]].
He is profesor at the Varsity o [[Adelaide]], [[Australie]].<ref>[https://www.pedestrian.tv/news/meet-the-aussie-lumbersexual-on-a-mission-to-make-your-beard-lustrous Meet Ghil'ad Zuckermann, master of 11 languages], Pedestrian TV.</ref><ref>[https://www.jewishnews.net.au/ghilads-indigenous-language-game-changer/79545 Ghil’ad’s Indigenous language game changer] {{Webarchive|url=https://web.archive.org/web/20180713185342/https://www.jewishnews.net.au/ghilads-indigenous-language-game-changer/79545 |date=2018-07-13 }}, Shane Desiatnik, AJN, July 12, 2018.</ref>
== [[Alma mater|Almae matres]] ==
* [[United World College]] of the Adriatic
* [[Varsity o Tel Aviv]]
* [[St Hugh's College]], [[Varsity o Oxford]]
* [[Churchill College]], [[Varsity o Cambridge]]<ref>[https://www.aljazeera.com/indepth/features/starting-scratch-aboriginal-group-reclaims-lost-language-180626082306196.html Starting from scratch: Aboriginal group reclaims lost language], With the help of a linguistics professor, Barngarla, which has not been spoken for 60 years, is being pieced together, Al Jazeera, John Power, 29.6.2018.</ref><ref>[http://www.themonthly.com.au/issue/2014/september/1409493600/anna-goldsworthy/voices-land Voices of the land], In Port Augusta, an Israeli linguist is helping the Barngarla people reclaim their language / Anna Goldsworthy, The Monthly, September 2014.</ref><ref>[https://www.edx.org/bio/ghilad-zuckermann edX], Professor Ghil'ad Zuckermann.</ref><ref>[https://adelaidefestivalofideas.com.au/speakers/professor-ghilad-zuckermann/ Adelaide Festival of Ideas], Professor Ghil'ad Zuckermann.</ref>
== Bibliografie ==
=== Books ===
*[[w:en:Revivalistics: From the Genesis of Israeli to Language Reclamation in Australia and Beyond|''Revivalistics: From the Genesis of Israeli to Language Reclamation in Australia and Beyond'']], 2020, [https://global.oup.com/academic/product/revivalistics-9780199812790 Oxford University Press] {{ISBN|9780199812790}} / {{ISBN|9780199812776}}
*[[w:en:Language Contact and Lexical Enrichment in Israeli Hebrew|''Language Contact and Lexical Enrichment in Israeli Hebrew'']], 2003, [https://www.palgrave.com/gp/book/9781403917232 Palgrave Macmillan] (ISBN 9781403917232 / ISBN 978140338695)
*[http://www.zuckermann.org/israelit.html ''Israelit Safa Yafa''], 2008, Am Oved (ISBN 978-965-13-1963-1)
*[http://www.zuckermann.org/guide.html ''Engaging – A Guide to Interacting Respectfully and Reciprocally with Aboriginal and Torres Strait Islander People, and their Arts Practices and Intellectual Property''], 2015
*[http://www.dictionary.barngarla.org/ ''Dictionary of the Barngarla Aboriginal Language of Eyre Peninsula, South Australia''], 2018
*[https://www.degruyter.com/downloadpdf/j/ijsl.2014.2014.issue-226/ijsl-2014-frontmatter226/ijsl-2014-frontmatter226.pdf ''Jewish Language Contact''] (''International Journal of the Sociology of Language'' 226), 2014
*[http://www.cambridgescholars.com/download/sample/58082 ''Burning Issues in Afro-Asiatic Linguistics''] {{Webarchive|url=https://web.archive.org/web/20200816120017/http://www.cambridgescholars.com/download/sample/58082 |date=2020-08-16 }}, 2012
*[https://www.adelaide.edu.au/directory/ghilad.zuckermann?dsn=directory.file;field=data;id=41076;m=view''Barngarlidhi Manoo (Speaking Barngarla Together)''], Barngarla Language Advisory Committee, 2019. ([https://www.adelaide.edu.au/directory/ghilad.zuckermann?dsn=directory.file;field=data;id=41096;m=view ''Barngarlidhi Manoo'' – Part II])
=== Articles ===
* Zuckermann, Ghil'ad; Quer, Giovanni; Shakuto, Shiori (2014). [http://www.professorzuckermann.com/#!native-tongue-title/cufd Native Tongue Title: Proposed Compensation for the Loss of Aboriginal Languages], ''Australian Aboriginal Studies'' 2014/1: 55-71.
* Zuckermann, Ghil'ad; Walsh, Michael (2014). [http://www.professorzuckermann.com/our-ancestors-are-happy- “Our Ancestors Are Happy!”: Revivalistics in the Service of Indigenous Wellbeing], ''Foundation for Endangered Languages'' XVIII: 113-119.
* Zuckermann, Ghil'ad; Walsh, Michael (2011). [http://www.zuckermann.org/pdf/Revival_Linguistics.pdf Stop, Revive, Survive: Lessons from the Hebrew Revival Applicable to the Reclamation, Maintenance and Empowerment of Aboriginal Languages and Cultures], ''Australian Journal of Linguistics'' 31: 111–127.
* Zuckermann, Ghil'ad (2009). [http://www.zuckermann.org/pdf/Hybridity_versus_Revivability.pdf Hybridity versus Revivability: Multiple Causation, Forms and Patterns], ''Journal of Language Contact'' 2: 40–67.
* Zuckermann, Ghil'ad (2006). [http://www.zuckermann.org/pdf/new-vision.pdf A New Vision for "Israeli Hebrew": Theoretical and Practical Implications of Analysing Israel's Main Language as a Semi-Engineered Semito-European Hybrid Language], ''Journal of Modern Jewish Studies'' 5: 57–71.
* Zuckermann, Ghil'ad (2004). [http://www.zuckermann.org/pdf/cultural_hybridity.pdf Cultural Hybridity: Multisourced Neologization in "Reinvented" Languages and in Languages with "Phono-Logographic" Script], ''Languages in Contrast'' 4: 281–318.
* Zuckermann, Ghil'ad (2003). [http://www.zuckermann.org/english.pdf Language Contact and Globalisation: The Camouflaged Influence of English on the World's Languages – with special attention to Israeli (sic) and Mandarin], ''Cambridge Review of International Affairs'' 16: 287–307.
* Zuckermann, Ghil'ad (2008). [http://www.zuckermann.org/pdf/Realistic_Prescriptivism_Academy.pdf 'Realistic Prescriptivism': The Academy of the Hebrew Language, its Campaign of 'Good Grammar' and Lexpionage, and the Native Israeli Speakers], ''Israel Studies in Language and Society'' 1: 135–154.
* Zuckermann, Ghil'ad (2006). [http://www.zuckermann.org/pdf/complement_clause.pdf "Complement Clause Types in Israeli"], ''Complementation: A Cross-Linguistic Typology'', Oxford University Press, pp. 72–92.
* Zuckermann, Ghil'ad (2006). [http://www.zuckermann.org/pdf/engineering.pdf " 'Etymythological Othering' and the Power of 'Lexical Engineering' in Judaism, Islam and Christianity. A Socio-Philo(sopho)logical Perspective"], ''Explorations in the Sociology of Language and Religion'', John Benjamins, pp. 237–258.
* Yadin, Azzan; Zuckermann, Ghil'ad (2010). [http://www.zuckermann.org/pdf/Secularization-f.pdf "Blorít: Pagans' Mohawk or Sabras' Forelock?: Ideological Secularization of Hebrew Terms in Socialist Zionist Israeli"], ''The Sociology of Language and Religion: Change, Conflict and Accommodation'', Palgrave Macmillan, pp. 84–125.
* Sapir, Yair; Zuckermann, Ghil'ad (2008). [http://www.zuckermann.org/pdf/icelandicPSM.pdf "Icelandic: Phonosemantic Matching"], ''Globally Speaking: Motives for Adopting English Vocabulary in Other Languages'', Multilingual Matters, pp. 19–43.
== Filmografie ==
* [https://vimeo.com/channels/357807/44019045 Fry's Planet Word], [[Stephen Fry]]
* [https://www.youtube.com/watch?v=DZPjdNaLCho SBS: Living Black: S18 Ep9 - Linguicide]
* [https://www.youtube.com/watch?v=izVGZRqciTY Babbel: Why Revive A Dead Language? - Interview with Prof. Ghil'ad Zuckermann]
* [https://www.edx.org/course/language-revival-securing-future-adelaidex-lang101x ''Language Revival: Securing the Future of Endangered Languages''], edX MOOC
== Freemit airtins ==
* [http://researchers.adelaide.edu.au/profile/ghilad.zuckermann Ghil'ad Zuckermann, D.Phil. (Oxon.)]
* [http://www.adelaide.edu.au/directory/ghilad.zuckermann University Staff Directory: Professor Ghil'ad Zuckermann]
* [https://adelaide.academia.edu/zuckermann Ghil'ad Zuckermann, Academia] {{Webarchive|url=https://web.archive.org/web/20180506001754/http://adelaide.academia.edu/Zuckermann |date=2018-05-06 }}
* [http://www.jewish-languages.org/ghilad.zuckermann.html Jewish Language Research Website: Ghil'ad Zuckermann] {{Webarchive|url=https://web.archive.org/web/20180618125946/http://www.jewish-languages.org/ghilad.zuckermann.html |date=2018-06-18 }}
* [http://www.zuckermann.org/ Professor Ghil'ad Zuckermann's website]
* [https://www.pedestrian.tv/news/meet-the-aussie-lumbersexual-on-a-mission-to-make-your-beard-lustrous/ Australian of the Day: Ghil'ad Zuckermann]
* [http://www.themonthly.com.au/issue/2014/september/1409493600/anna-goldsworthy/voices-land Voices of the land], Anna Goldsworthy, The Monthly, September 2014.
* [https://www.bbc.co.uk/programmes/p03fslbj BBC World Service: Reawakening Language]
* [http://www.zuckermann.org/poetry.html Selutis Alpinis (Se tu vens cà sù ta' cretis), Ghil'ad Zuckermann], "A site dedicated to the memory of Maestro Piero Poclen, a mentsh"
== See also ==
* [[:en:Phono-semantic matching|Phono-semantic matching]]
* [[:en:Barngarla language|Barngarla leid]]
== Notes ==
<references/>
{{Authority control}}
{{DEFAULTSORT:Zuckermann, Ghilad}}
[[Category:1971 births]]
[[Category:Livin fowk]]
[[Category:Fowk frae Tel Aviv]]
[[Category:Linguists frae Australie]]
[[Category:Australian lexicografers]]
[[Category:Linguists frae Israel]]
[[Category:Israeli philologists]]
[[Category:Israeli Jews]]
[[Category:Historical linguists]]
[[Category:Etymologists]]
[[Category:Linguists o Yiddish]]
[[Category:Linguists o Australie aboriginal leids]]
[[Category:Sociolinguists]]
[[Category:Israeli Hebraists]]
[[Category:Israeli emigrants tae Australie]]
[[Category:Naturalised ceetizens o Australie]]
[[Category:Semiticists]]
[[Category:Lingueestics eddicators]]
[[Category:Lingueestics writers]]
[[Category:Academics o the Varsity o Cambridge]]
[[Category:Varsity o Adelaide faculty]]
[[Category:Varsity o Queensland faculty]]
[[Category:Naitional Varsity o Singapore faculty]]
[[Category:Varsity o Texas at Austin faculty]]
[[Category:Shanghai Jiao Tong University faculty]]
[[Category:East Cheenae Normal Varsity faculty]]
[[Category:Shanghai Internaitional Studies Varsity faculty]]
[[Category:La Trobe Varsity faculty]]
[[Category:Fowk frae Adelaide]]
[[Category:Tel Aviv Varsity alumni]]
[[Category:Alumni o St Hugh's College, Oxford]]
[[Category:Fellaes o Churchill College, Cambridge]]
[[Category:Contreibutors tae the Oxford English Dictionary]]
[[Category:Chevening Scholars]]
[[Category:Translation scholars]]
[[Category:Fowk eddicatit at a United World College]]
[[Category:Recipients o grants/fellaeships frae the Australie Resairch Cooncil (ARC)]]
[[Category:Recipients o grants/fellaeships frae the Naitional Heal an Medical Resairch Cooncil (NHMRC)]]
[[Category:20t-century linguists]]
[[Category:21st-century linguists]]
[[Category:Alumni o the Adi Lautman Interdisciplinary Programme for Ootstaundin Students]]
baztsv75s4hnkkva1z89nddbwe7l1n7
Syrien civil war
0
227861
901681
842277
2025-01-03T18:21:28Z
Italiano1922
115108
/* growthexperiments-addlink-summary-summary:3|0|0 */
901681
wikitext
text/x-wiki
The '''Syrien civil war''' ({{Lang-ar|الحرب الأهلية السورية}}, ''al-ḥarb al-ʾahlīyah as-sūrīyah'') is a current mony-sided civil war in [[Syrie]] focht atween the [[Ba'ath Pairty (Syrie-dominatit faction)|Ba'athist]] [[Syrie|Arab Republic o Syrie]] led bi Syrien president Bashar al-Assad, alang wi domestic an ootlaund allies, an various airmies frae hame an abroad agin baith the Syrien goverment an ilka ane tae the ither in mony combinations.<ref>{{Cite news|title=Syria's civil war explained from the beginning|publisher=Al Jazeera|url=http://www.aljazeera.com/news/2016/05/syria-civil-war-explained-160505084119966.html|url-status=live|access-date=29 April 2017|archive-url=https://web.archive.org/web/20170430014912/http://www.aljazeera.com/news/2016/05/syria-civil-war-explained-160505084119966.html|archive-date=30 April 2017}}</ref>
== Backgrun ==
=== Assad goverment ===
The secular Ba'ath Syrien Regional Branch goverment cam tae pouer throu a [[coup d'état]] in 1963. Fer mony years, Syrie gang throu a series o coups and chynges o rulerskip,<ref>{{Cite news|last=Wilson|first=Scott|date=25 April 2011|title=Syria escalates attacks against demonstrators|work=The Seattle Times|url=http://seattletimes.nwsource.com/html/nationworld/2014875394_syria26.html|url-status=dead|archive-url=https://web.archive.org/web/20110429193035/http://seattletimes.nwsource.com/html/nationworld/2014875394_syria26.html|archive-date=29 April 2011}}</ref> intil Mairch o 1971, [[Hafez al-Assad]], an [[Alawites|Alawite]], decalret hessel President. The secular Syrien Regional Branch steyed the foremaist political authoritie in whit was, afore, an [[ane-pairtie state]] intil the first multi-pairtie election o the [[Fowk's Cooncil o Syrie]] was held in 2012.<ref>{{Cite web|date=25 May 2012|title=Assad says Syria 'able' to get out of crisis|url=http://www.aljazeera.com/news/middleeast/2012/05/2012524113941282101.html|url-status=live|archive-url=https://web.archive.org/web/20120607214248/http://www.aljazeera.com/news/middleeast/2012/05/2012524113941282101.html|archive-date=7 June 2012|access-date=11 June 2012|publisher=[[Al Jazeera]]}}</ref> On 31 o Januarie 1973, Hafez al-Assad pit a new constitution intae effec, thit led tae a national crysis. Unalike foregane constitutions, this ane didnae requeest thit the president o Syrie be a [[Muslim]], leadin tae fairce protest in [[Hama]], [[Homs]] an [[Aleppo]] organysit bi the [[Muslim Britherheid]] an the ''ulama''. The goverment lestit throu a series o [[Islamist uprisin in Syrie|airmed revolts]] frae [[Poleetical Islam|Islamists]], fer the maist pairt memmers o the Muslim Britherheid, frae 1976 intil 1982.
Efter the deith o Hafez al-Assad in 2000, his son Bashar al-Assad wis electit tae be President o Syrie. Bashar an hes wyfe Asma, a [[Sunni Islam|Sunni Muslim]] born an eddicatit in the UK,<ref name="rose">{{Cite news|last=Golovnina|first=Maria|date=19 March 2012|title=Asma al Assad, a "desert rose" crushed by Syria's strife|work=Reuters|url=https://www.reuters.com/article/2012/03/19/us-syria-asma-idUSBRE82I0MB20120319|url-status=live|access-date=8 August 2013|archive-url=https://web.archive.org/web/20130923084401/http://www.reuters.com/article/2012/03/19/us-syria-asma-idUSBRE82I0MB20120319|archive-date=23 September 2013}}</ref> tae begin wi, inspyred howpes fer democratic reforms; houanivver, accordin tae hes creetics, Bashar failt tae brin in hes promised reforms.<ref name="nyt1Apr11">{{Cite news|last=Liam Stack|last2=J. David Goodman|date=1 April 2011|title=Syrian Protesters Clash With Security Forces|work=The New York Times|url=https://www.nytimes.com/2011/04/02/world/middleeast/02syria.html|url-status=live|access-date=19 December 2013|archive-url=https://web.archive.org/web/20130513035056/http://www.nytimes.com/2011/04/02/world/middleeast/02syria.html|archive-date=13 May 2013}}</ref> President Al-Assad statit in 2017 thit nae 'moderate opposition' tae hes rule exists, an thit aa opposition forces is jihadists thit intend tae destroy the secular leadership o Syrie; hes pynt o view wis thit terrorist groups operatin athin Syrie is 'linkit wi the agendas o foreign kintras'.<ref>{{Cite web|title=President Bashar al-Assad interview with Croatian newspaper Vecernji List|url=https://leakofnations.com/president-bashar-al-assad-interview-with-croatian-newspaper-vecernji-list-syrian-civil-war/|url-status=dead|archive-url=https://web.archive.org/web/20170413073030/https://leakofnations.com/president-bashar-al-assad-interview-with-croatian-newspaper-vecernji-list-syrian-civil-war/|archive-date=13 April 2017|access-date=12 April 2017|website=leakofnations.com}}</ref>
=== Demographics ===
The tot o the population in July o 2018 wis estimatit tae be 19,454,263 fowk; cultur groups – rochlie [[Syrien fowk|Arab]] 50%, [[Alawites|Alawite]] 15%, Kurd 10%, Levantine 10%, ither 15% (incluidin o [[Druze fowk in Syrie|Druze]], Ismaili, Imami, [[Assyrian fowk|Assyrian]], Turkmen, [[Armenians in Syrie|Armenian]]); releegions – [[Muslim]] 87% (offeecial; incluidin o [[Sunni Islam|Sunni]] 74% an Alawi, Ismaili, an [[Shia Islam|Shia]] 13%), [[Christianity|Christian]] 10% (maistlie o [[Eistern Christianitie|Eistern Christian kirks]]<ref name="IRFR2006">{{Cite web|title=Syria|url=https://2001-2009.state.gov/g/drl/rls/irf/2006/71432.htm|url-status=live|archive-url=https://web.archive.org/web/20190722104603/https://2001-2009.state.gov/g/drl/rls/irf/2006/71432.htm|archive-date=22 July 2019|access-date=11 July 2016|website=U.S. Department of State}}</ref> – mich be smawer acause o Christian flicht frae the kintra), [[Druze]] 3% an [[Jews|Jewish]] (few bidin in Damascus an Aleppo).<ref>{{Cite web|title=The World Factbook: Syria|url=https://www.cia.gov/the-world-factbook/countries/syria/|access-date=21 December 2018|website=CIA Library}}</ref>
=== Socioeconomic backgrun ===
Socioeconomic inequalities growed geylie efter [[Free mercat|free mairket]] policies ware brocht in bi Hafez al-Assad taewart the end o hes rule, an it acceleratit efter Bashar al-Assad cam tae pouer. Wi a focus on the [[tertiary sector o the economy|service sector]], they policies brocht benefit fer a minoritie o the kintra's fowk, maistlie fowk wha ware connectit tae the goverment, an memmers o the Sunni mairchant cless o Damascus an Aleppo.<ref name="Poor rural rebels">{{Cite news|date=16 October 2012|title=Rebels in Syria's largest city of Aleppo mostly poor, pious and from rural backgrounds|publisher=Fox News Channel|agency=Associated Press|url=http://www.foxnews.com/world/2012/10/16/rebels-in-syria-largest-city-aleppo-mostly-poor-pious-and-from-rural/|url-status=live|access-date=28 January 2013|archive-url=https://web.archive.org/web/20121207232408/http://www.foxnews.com/world/2012/10/16/rebels-in-syria-largest-city-aleppo-mostly-poor-pious-and-from-rural/|archive-date=7 December 2012}}</ref> In 2010, Syrie's nominal GDP per capita wis anely $2,834, seemilar tae Sub-Saharan African kintras sic as [[Nigerie]] an a muckle sicht laicher than its neebors sic as [[Lebanon]], wi a yearlie grawth rate o 3.39%, ablow maist ither developing kintras.<ref>{{Cite web|title=Syria GDP per Capita [2002 - 2020] [Data & Charts]|url=https://www.ceicdata.com/en/indicator/syria/gdp-per-capita|url-status=dead|archive-url=https://web.archive.org/web/20171214130246/https://www.ceicdata.com/en/indicator/syria/gdp-per-capita|archive-date=14 December 2017|access-date=18 August 2020|website=www.ceicdata.com}}</ref>
Mair ower, the country wis facin particular heich rates o youth unempleyment.<ref>{{Cite web|date=11 August 2011|title=Youth Exclusion in Syria: Social, Economic, and Institutional Dimensions|url=http://journalistsresource.org/studies/government/international/youth-exclusion-in-syria-economic/|url-status=live|archive-url=https://web.archive.org/web/20120614153453/http://journalistsresource.org/studies/government/international/youth-exclusion-in-syria-economic/|archive-date=14 June 2012|access-date=11 August 2012|publisher=Journalist's Resource}}</ref> Whin the war startit, discontent agin the goverment wis maist felt in Syrie's pair airts, predominant amang conservative Sunnis.<ref name="Poor rural rebels">{{Cite news|date=16 October 2012|title=Rebels in Syria's largest city of Aleppo mostly poor, pious and from rural backgrounds|publisher=Fox News Channel|agency=Associated Press|url=http://www.foxnews.com/world/2012/10/16/rebels-in-syria-largest-city-aleppo-mostly-poor-pious-and-from-rural/|url-status=live|access-date=28 January 2013|archive-url=https://web.archive.org/web/20121207232408/http://www.foxnews.com/world/2012/10/16/rebels-in-syria-largest-city-aleppo-mostly-poor-pious-and-from-rural/|archive-date=7 December 2012}}<cite class="citation news cs1" data-ve-ignore="true">[http://www.foxnews.com/world/2012/10/16/rebels-in-syria-largest-city-aleppo-mostly-poor-pious-and-from-rural/ "Rebels in Syria's largest city of Aleppo mostly poor, pious and from rural backgrounds"]. </cite></ref> These incluided o ceeties wi heich rates o povertie, sic as [[Daraa]] an [[Homs]], an the mair pair airts o muckle ceeties.
=== Drocht ===
This cam alang wi the maist fearsom drocht ivver recordit in Syrie, thit bidit frae 2006 intil 2011 an caused crap failyie athort the kintra, a ryse in [[fuid prices]] an a migration en-masse o fairmin faimilies tae the urban centres.<ref name="Kelley drought 2015">Kelley, C. P., Mohtadi, S., Cane, M. A., Seager, R., & Kushnir, Y. (17 March 2015). "Climate change in the Fertile Crescent and implications of the recent Syrian drought". ''Proceedings of the National Academy of Sciences''. '''112''' (11): 3241–3246. Bibcode:2015PNAS..112.3241K. doi:10.1073/pnas.1421533112. PMC 4371967. <nowiki>PMID 25733898</nowiki>. Archived from the original on 30 August 2018. Retrieved 31 August 2018. </ref> This migration pit muckle strain on intimmers thit was aareadie burdened bi the inflowe o aroon 1.5 million refugees frae the [[Iraq War]].<ref>{{Cite news|last=Fountain|first=Henry|date=2 March 2015|title=Researchers Link Syrian Conflict to a Drought Made Worse by Climate Change|work=The New York Times|url=https://www.nytimes.com/2015/03/03/science/earth/study-links-syria-conflict-to-drought-caused-by-climate-change.html|url-status=live|access-date=1 May 2017|archive-url=https://web.archive.org/web/20170425175902/https://www.nytimes.com/2015/03/03/science/earth/study-links-syria-conflict-to-drought-caused-by-climate-change.html|archive-date=25 April 2017|issn=0362-4331}}</ref> The drocht haes been linkit tae [[Climate chynge|anthropogenic warldwide warmin]].<ref>{{Cite journal|last=Kelley|first=Colin P.|last2=Mohtadi|first2=Shahrzad|last3=Cane|first3=Mark A.|last4=Seager|first4=Richard|last5=Kushnir|first5=Yochanan|date=17 March 2015|title=Climate change in the Fertile Crescent and implications of the recent Syrian drought|url=http://www.pnas.org/content/112/11/3241|url-status=dead|journal=Proceedings of the National Academy of Sciences|volume=112|issue=11|pages=3241–3246|bibcode=2015PNAS..112.3241K|doi=10.1073/pnas.1421533112|pmc=4371967|pmid=25733898|archive-url=https://web.archive.org/web/20180830231854/http://www.pnas.org/content/112/11/3241|archive-date=30 August 2018|access-date=31 August 2018}}</ref><ref>{{Cite web|date=29 February 2012|title=Syria: Climate Change, Drought and Social Unrest|url=https://climateandsecurity.org/2012/02/29/syria-climate-change-drought-and-social-unrest/|url-status=live|archive-url=https://web.archive.org/web/20170414205011/https://climateandsecurity.org/2012/02/29/syria-climate-change-drought-and-social-unrest/|archive-date=14 April 2017|access-date=1 May 2017|website=The Center for Climate & Security}}</ref><ref>{{Cite journal|last=Gleick|first=Peter H.|date=2014-07-01|title=Water, Drought, Climate Change, and Conflict in Syria|journal=Weather, Climate, and Society|volume=6|issue=3|pages=331–340|doi=10.1175/wcas-d-13-00059.1}}</ref> Ample supplee o watter continyes tae be an issue in the current civil war an it is fer frequent the tairget o militarie action.<ref>{{Cite news|date=8 September 2012|title=Aleppo water supply cut as Syria fighting rages|work=BBC News|url=https://www.bbc.com/news/world-middle-east-19533112|url-status=live|access-date=1 May 2017|archive-url=https://web.archive.org/web/20170730114347/http://www.bbc.com/news/world-middle-east-19533112|archive-date=30 July 2017}}</ref>
=== Human richts ===
The situation o [[human richts]] in Syrie haes been lang syne the tairget o muckle critique frae global organisations.<ref>https://www.hrw.org/world-report-2010 p. 555.</ref> The richts o [[Freedom o speech|free expression]], [[Freedom o associe|associe]] an [[Freedom o assemblie|assemblie]] ware strictly controlled in Syrie afore the uprisin. The kintra wis unner [[State o emergencie|a state o emergencie]] atween 1963 an 2011 an public gaitherins o mair nor five fowk ware prohibitit.<ref name="Reuters16Apr11">{{Cite news|date=16 April 2011|title=Syria's Assad vows to lift emergency law by next week|work=Reuters|url=https://www.reuters.com/article/2011/04/16/us-syria-idUSTRE72N2MC20110416|url-status=live|access-date=1 January 2014|archive-url=https://web.archive.org/web/20140102192245/http://www.reuters.com/article/2011/04/16/us-syria-idUSTRE72N2MC20110416|archive-date=2 January 2014}}</ref> Securitie forces haed braid pouers o arrest an detention.<ref name="AmInt2009">{{Cite web|year=2009|title=Syria|url=http://report2009.amnesty.org/en/regions/middle-east-north-africa/syria|url-status=dead|archive-url=https://web.archive.org/web/20120228221417/http://report2009.amnesty.org/en/regions/middle-east-north-africa/syria|archive-date=28 February 2012|access-date=1 February 2012|publisher=Amnesty International}}</ref> In spyte o howps fer democratic chynge wi the 2000 Damascus Spring, Bashar al-Assad wis briadlie reportit tae hae failt in brinin aboot ony impruivement. A [[Human Richts Watch]] report pit oot richt afore the start o the 2011 uprisin seyd thit he haad failt tae mak substantial impruivement tae the state o human richts syne comin tae pouer.<ref>{{Cite news|last=Black|first=Ian|date=16 July 2010|title=Syrian human rights record unchanged under Assad, report says|work=The Guardian|location=London|url=https://www.theguardian.com/world/2010/jul/16/syrian-human-rights-unchanged-assad|url-status=live|access-date=13 December 2016|archive-url=https://web.archive.org/web/20160813034407/https://www.theguardian.com/world/2010/jul/16/syrian-human-rights-unchanged-assad|archive-date=13 August 2016}}</ref>
== References ==
[[Category:Wars involvin Turkey]]
[[Category:Wars involvin the Unitit States]]
[[Category:Wars involvin the Unitit Kinrick]]
[[Category:Wars involvin Syrie]]
[[Category:Wars involvin Saudi Arabie]]
[[Category:Wars involvin Roushie]]
[[Category:Wars involvin Qatar]]
[[Category:Wars involvin Jordan]]
[[Category:Wars involvin Iraq]]
[[Category:Wars involvin Iran]]
[[Category:Wars involvin Fraunce]]
[[Category:Politics o Syrie]]
[[Category:2010s in Syrie]]
[[Category:2010s ceevil wars]]
[[Category:Sirian Ceevil War]]
71322q10wtuy9yzgslu6sbofktng47s
Cyrillic script
0
230928
901685
884343
2025-01-03T19:07:47Z
Italiano1922
115108
901685
wikitext
text/x-wiki
{{Fixscots}}
{{Unsoorced}}
The Cyrillic script 9 (Кириллица), or Cyrillic alphabet - kent bi ither naimes sic as the Slavonic script, or the Slaivic script - is a [[writin seestem]] uised fer mony leids acros [[Eurasie]]. It is the naitional script in sevrel [[Slavic leids|Slavic]], [[Turkic leids|Turkic]], [[Mongolic leids|Mongolic]], [[Uralic leids|Uiralic]], [[Caucus leids|Caucus]], an [[Iranian leids|Iranian]] talkin kintra an leids i [[Sootheestren Europe]], [[Eastren Europe|Eestren Europe]], the [[Caucasus]], [[Central Asie|Centra Asie]], [[Northren Asie]], an [[Eestren Asie]], an uised bi mony ither minoritie leids.
As bi 2019, aboot 250 million fowk in Eurasie uis Cyrillic as th'official screipt fer ther naitional leids, wi [[Roushie]] makin aboot hauf o them. When [[Bulgarie]] joinit the [[European Union|European Uinion]] o the 1 Januar 2007, Cyrillic acome the third offeecial script o th'[[European Union]], efter the [[Laitin alphabet|Laitin]] an [[Greek alphabet|Greik]] alphabets.
Th'[[Early Cyrillic Alphabet]] wis developt i the 9t yeirhunner AD i th [[Preslav Litrary Schuil]] i the [[First Bulgarie Empire|First Bulgarie Empir]] at the time o [[Tsar Simeon I the graet]], maist liklie bi the disciple o the twa Byzantin Brither [[Cyril an Methodius]], whi hed aforehaund makkit the [[Glagolitic script]]. Alang wi thaem were [[Clement of Ohrid]], [[Naum o Preslav]], [[Angelar]], [[Sava]] an ither scolars. The Cyrillic script wis cried fer tae honour [[Sint Cyril]].
qhgv75zc12c5bl25o29vhwspaep6cry
Wikipedia:Votes for deletion/Leet o neo-Nazi organisations
4
232300
901694
2025-01-03T21:49:40Z
CiphriusKane
74958
Made page wi "{{subst:afd2|pg={{subst:SUBPAGENAME}}|cat=U|text=Anither badly wrate airticle aat wis shoved on here acause it exists on enwiki. The three entries aat haed airticles a haed ti delete fur bein fu ae controversial unsoorced statements}} ~~~~"
901694
wikitext
text/x-wiki
===[[Leet o neo-Nazi organisations]]===
{{REMOVE THIS TEMPLATE WHEN CLOSING THIS AfD|U}}
:{{la|Leet o neo-Nazi organisations}} – (<includeonly>[[Wikipedia:Votes for deletion/Leet o neo-Nazi organisations|View AfD]]</includeonly><noinclude>[[Wikipedia:Votes for deletion/Log/2025 Januar 3#{{anchorencode:Leet o neo-Nazi organisations}}|View log]]</noinclude>{{int:dot-separator}} <span class="plainlinks">[http://toolserver.org/~snottywong/cgi-bin/votecounter.cgi?page=Wikipedia:Votes_for_deletion/Leet_o_neo-Nazi_organisations Stats]</span>)
:({{Find sources|Leet o neo-Nazi organisations}})
Anither badly wrate airticle aat wis shoved on here acause it exists on enwiki. The three entries aat haed airticles a haed ti delete fur bein fu ae controversial unsoorced statements [[Uiser:CiphriusKane|CiphriusKane]] ([[Uiser collogue:CiphriusKane|tauk]]) 21:49, 3 Januar 2025 (UTC)
4ad278bziy15jajdoxtvg6a7m9snqi2